From fa503cf42629235044306372a2a48cff2f51c34f Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Tue, 25 Jan 2022 17:03:38 -0500 Subject: [PATCH 1/8] Initial commit for materialsmine kgapp --- whyis/Dockerfile.dev | 8 +- whyis/materialsmine/.circleci/config.yml | 29 + .../ChemDatabase/chemprops_example.json | 112 + whyis/materialsmine/ChemDatabase/notes.md | 31 + whyis/materialsmine/LICENSE | 21 + whyis/materialsmine/README.md | 56 + whyis/materialsmine/config.py | 277 + whyis/materialsmine/data/dummy_xml_file.ttl | 19 + .../data/parameterized_queries/PQ01.ttl | 281 + .../data/parameterized_queries/PQ02.ttl | 69 + .../data/parameterized_queries/PQ03.ttl | 221 + .../data/parameterized_queries/PQ04.ttl | 73 + .../data/parameterized_queries/PQ05.ttl | 59 + .../data/parameterized_queries/PQ06.ttl | 102 + .../data/parameterized_queries/PQ07.ttl | 239 + .../data/parameterized_queries/PQ08.ttl | 254 + .../data/parameterized_queries/PQ09.ttl | 327 + .../data/parameterized_queries/PQ10.ttl | 90 + .../data/parameterized_queries/PQ11.ttl | 130 + .../data/parameterized_queries/PQ12.ttl | 46 + .../data/parameterized_queries/PQ13.ttl | 74 + .../data/parameterized_queries/PQ14.ttl | 94 + .../data/parameterized_queries/PQ15.ttl | 329 + .../data/parameterized_queries/README.txt | 15 + .../2d_pixelated_designs_static_sdd.xlsx | Bin 0 -> 19700 bytes .../caltech_2d_pixelated_designs_static.csv | 32769 ++++++++++++++++ .../data/symmetric_10x10/fig_1.png | Bin 0 -> 55073 bytes whyis/materialsmine/data/viz.ttl | 1 + .../install_files/celery.service | 22 + .../install_files/celerybeat.service | 17 + .../apache2/sites-available/000-default.conf | 23 + .../install_files/etc/conf.d/celery | 26 + .../install_files/etc/default/celeryd | 41 + .../install_files/fuseki.service | 58 + whyis/materialsmine/install_files/system.conf | 51 + whyis/materialsmine/materialsmine/__init__.py | 1 + whyis/materialsmine/materialsmine/agent.py | 11 + whyis/materialsmine/nanomine.ttl | 3240 ++ whyis/materialsmine/requirements.txt | 117 + whyis/materialsmine/run/log4j2.properties | 68 + whyis/materialsmine/script/bootstrap | 14 + whyis/materialsmine/script/load-dev | 21 + whyis/materialsmine/script/load-metamine.sh | 6 + whyis/materialsmine/script/server | 2 + whyis/materialsmine/script/setup | 97 + whyis/materialsmine/setl/chem_props.setl.ttl | 79 + .../setl/dev_nanomine_files.setl.ttl | 88 + .../setl/materialsmine.ontology.setl | 435 + whyis/materialsmine/setl/materialsmine.ttl | 2889 ++ whyis/materialsmine/setl/mdcs_files.setl.ttl | 91 + whyis/materialsmine/setl/nanomine.ttl | 2430 ++ whyis/materialsmine/setl/ontology.setl.ttl | 389 + whyis/materialsmine/setl/xml_ingest.setl.ttl | 1363 + whyis/materialsmine/static/css/nanomine.css | 0 whyis/materialsmine/static/html/README.md | 1 + whyis/materialsmine/static/images/README.md | 1 + whyis/materialsmine/static/js/nanomine.js | 0 .../facet_values_20201008_HARDCODED.json | 2733 ++ .../facet_values_20210625_HARDCODED.json | 2733 ++ whyis/materialsmine/templates/home_view.html | 25 + whyis/materialsmine/templates/pnc_facets.json | 78 + whyis/materialsmine/templates/readme.md | 0 .../templates/visualization.html | 707 + whyis/materialsmine/tests/README.md | 53 + whyis/materialsmine/tests/__init__.py | 0 .../materialsmine/tests/auto_test_template.py | 16 + whyis/materialsmine/tests/auto_tester.py | 69 + whyis/materialsmine/tests/ingest_tester.py | 756 + .../materialsmine/tests/interesting_files.txt | 1 + whyis/materialsmine/tests/template.py | 134 + .../tests/test_L101_S11_Dang_2007.py | 14 + .../tests/test_L101_S3_Dang_2007.py | 35 + .../tests/test_L102_S3_Hu_2007.py | 84 + .../tests/test_L104_S4_He_2009.py | 14 + .../tests/test_L141_S19_Gao_2013.py | 14 + .../tests/test_L150_S7_Akcora_2009.py | 15 + .../tests/test_L155_S2_Roy_2005.py | 182 + .../tests/test_L157_S5_Zhao_2008.py | 20 + .../tests/test_L168_S4_Luo_2013.py | 63 + .../tests/test_L172_S18_Huo_2015.py | 8 + .../tests/test_L199_S1_Duncan_2010.py | 129 + .../tests/test_L203_S9_Ma_2009.py | 365 + .../tests/test_L217_S2_Ash_2002.py | 14 + .../tests/test_L254_S35_Castillo_2011.py | 24 + .../tests/test_L256_S3_Potschke_2004.py | 18 + .../tests/test_L260_S5_Haggenmueller_2006.py | 14 + .../tests/test_L300_S5_Nakane_1999.py | 66 + .../tests/test_article_metadata.py | 62 + .../tests/test_chem_props_ingest.py | 149 + .../tests/test_chemical_names.py | 105 + .../tests/test_component_properties.py | 112 + .../tests/test_pnc_properties.py | 188 + .../tests/xml/L101_S11_Dang_2007.xml | 489 + .../tests/xml/L101_S3_Dang_2007.xml | 228 + .../tests/xml/L102_S3_Hu_2007.xml | 135 + .../tests/xml/L104_S4_He_2009.xml | 1579 + .../tests/xml/L141_S19_Gao_2013.xml | 253 + .../tests/xml/L150_S7_Akcora_2009.xml | 538 + .../tests/xml/L155_S2_Roy_2005.xml | 2418 ++ .../tests/xml/L157_S5_Zhao_2008.xml | 209 + .../tests/xml/L168_S4_Luo_2013.xml | 904 + .../tests/xml/L172_S18_Huo_2015.xml | 1042 + .../tests/xml/L199_S1_Duncan_2010.xml | 342 + .../tests/xml/L203_S9_Ma_2009.xml | 951 + .../tests/xml/L217_S2_Ash_2002.xml | 289 + .../tests/xml/L256_S3_Potschke_2004.xml | 1 + .../tests/xml/L260_S5_Haggenmueller_2006.xml | 264 + .../tests/xml/L300_S5_Nakane_1999.xml | 571 + whyis/materialsmine/vocab.ttl | 48 + whyis/materialsmine/whyis.conf | 142 + whyis/materialsmine/wsgi.py | 1 + whyis/materialsmine/xml_files/download_xml.py | 41 + 112 files changed, 66749 insertions(+), 3 deletions(-) create mode 100644 whyis/materialsmine/.circleci/config.yml create mode 100644 whyis/materialsmine/ChemDatabase/chemprops_example.json create mode 100644 whyis/materialsmine/ChemDatabase/notes.md create mode 100644 whyis/materialsmine/LICENSE create mode 100644 whyis/materialsmine/README.md create mode 100644 whyis/materialsmine/config.py create mode 100644 whyis/materialsmine/data/dummy_xml_file.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ01.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ02.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ03.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ04.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ05.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ06.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ07.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ08.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ09.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ10.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ11.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ12.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ13.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ14.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/PQ15.ttl create mode 100644 whyis/materialsmine/data/parameterized_queries/README.txt create mode 100644 whyis/materialsmine/data/symmetric_10x10/2d_pixelated_designs_static_sdd.xlsx create mode 100644 whyis/materialsmine/data/symmetric_10x10/caltech_2d_pixelated_designs_static.csv create mode 100644 whyis/materialsmine/data/symmetric_10x10/fig_1.png create mode 100644 whyis/materialsmine/data/viz.ttl create mode 100644 whyis/materialsmine/install_files/celery.service create mode 100644 whyis/materialsmine/install_files/celerybeat.service create mode 100644 whyis/materialsmine/install_files/etc/apache2/sites-available/000-default.conf create mode 100644 whyis/materialsmine/install_files/etc/conf.d/celery create mode 100644 whyis/materialsmine/install_files/etc/default/celeryd create mode 100644 whyis/materialsmine/install_files/fuseki.service create mode 100644 whyis/materialsmine/install_files/system.conf create mode 100644 whyis/materialsmine/materialsmine/__init__.py create mode 100644 whyis/materialsmine/materialsmine/agent.py create mode 100644 whyis/materialsmine/nanomine.ttl create mode 100644 whyis/materialsmine/requirements.txt create mode 100644 whyis/materialsmine/run/log4j2.properties create mode 100755 whyis/materialsmine/script/bootstrap create mode 100755 whyis/materialsmine/script/load-dev create mode 100755 whyis/materialsmine/script/load-metamine.sh create mode 100755 whyis/materialsmine/script/server create mode 100755 whyis/materialsmine/script/setup create mode 100644 whyis/materialsmine/setl/chem_props.setl.ttl create mode 100644 whyis/materialsmine/setl/dev_nanomine_files.setl.ttl create mode 100644 whyis/materialsmine/setl/materialsmine.ontology.setl create mode 100644 whyis/materialsmine/setl/materialsmine.ttl create mode 100644 whyis/materialsmine/setl/mdcs_files.setl.ttl create mode 100644 whyis/materialsmine/setl/nanomine.ttl create mode 100644 whyis/materialsmine/setl/ontology.setl.ttl create mode 100644 whyis/materialsmine/setl/xml_ingest.setl.ttl create mode 100644 whyis/materialsmine/static/css/nanomine.css create mode 100644 whyis/materialsmine/static/html/README.md create mode 100644 whyis/materialsmine/static/images/README.md create mode 100644 whyis/materialsmine/static/js/nanomine.js create mode 100644 whyis/materialsmine/templates/facet_values_20201008_HARDCODED.json create mode 100644 whyis/materialsmine/templates/facet_values_20210625_HARDCODED.json create mode 100644 whyis/materialsmine/templates/home_view.html create mode 100644 whyis/materialsmine/templates/pnc_facets.json create mode 100644 whyis/materialsmine/templates/readme.md create mode 100644 whyis/materialsmine/templates/visualization.html create mode 100644 whyis/materialsmine/tests/README.md create mode 100644 whyis/materialsmine/tests/__init__.py create mode 100644 whyis/materialsmine/tests/auto_test_template.py create mode 100644 whyis/materialsmine/tests/auto_tester.py create mode 100644 whyis/materialsmine/tests/ingest_tester.py create mode 100644 whyis/materialsmine/tests/interesting_files.txt create mode 100644 whyis/materialsmine/tests/template.py create mode 100644 whyis/materialsmine/tests/test_L101_S11_Dang_2007.py create mode 100644 whyis/materialsmine/tests/test_L101_S3_Dang_2007.py create mode 100644 whyis/materialsmine/tests/test_L102_S3_Hu_2007.py create mode 100644 whyis/materialsmine/tests/test_L104_S4_He_2009.py create mode 100644 whyis/materialsmine/tests/test_L141_S19_Gao_2013.py create mode 100644 whyis/materialsmine/tests/test_L150_S7_Akcora_2009.py create mode 100644 whyis/materialsmine/tests/test_L155_S2_Roy_2005.py create mode 100644 whyis/materialsmine/tests/test_L157_S5_Zhao_2008.py create mode 100644 whyis/materialsmine/tests/test_L168_S4_Luo_2013.py create mode 100644 whyis/materialsmine/tests/test_L172_S18_Huo_2015.py create mode 100644 whyis/materialsmine/tests/test_L199_S1_Duncan_2010.py create mode 100644 whyis/materialsmine/tests/test_L203_S9_Ma_2009.py create mode 100644 whyis/materialsmine/tests/test_L217_S2_Ash_2002.py create mode 100644 whyis/materialsmine/tests/test_L254_S35_Castillo_2011.py create mode 100644 whyis/materialsmine/tests/test_L256_S3_Potschke_2004.py create mode 100644 whyis/materialsmine/tests/test_L260_S5_Haggenmueller_2006.py create mode 100644 whyis/materialsmine/tests/test_L300_S5_Nakane_1999.py create mode 100644 whyis/materialsmine/tests/test_article_metadata.py create mode 100644 whyis/materialsmine/tests/test_chem_props_ingest.py create mode 100644 whyis/materialsmine/tests/test_chemical_names.py create mode 100644 whyis/materialsmine/tests/test_component_properties.py create mode 100644 whyis/materialsmine/tests/test_pnc_properties.py create mode 100644 whyis/materialsmine/tests/xml/L101_S11_Dang_2007.xml create mode 100644 whyis/materialsmine/tests/xml/L101_S3_Dang_2007.xml create mode 100644 whyis/materialsmine/tests/xml/L102_S3_Hu_2007.xml create mode 100644 whyis/materialsmine/tests/xml/L104_S4_He_2009.xml create mode 100644 whyis/materialsmine/tests/xml/L141_S19_Gao_2013.xml create mode 100644 whyis/materialsmine/tests/xml/L150_S7_Akcora_2009.xml create mode 100644 whyis/materialsmine/tests/xml/L155_S2_Roy_2005.xml create mode 100644 whyis/materialsmine/tests/xml/L157_S5_Zhao_2008.xml create mode 100644 whyis/materialsmine/tests/xml/L168_S4_Luo_2013.xml create mode 100644 whyis/materialsmine/tests/xml/L172_S18_Huo_2015.xml create mode 100644 whyis/materialsmine/tests/xml/L199_S1_Duncan_2010.xml create mode 100644 whyis/materialsmine/tests/xml/L203_S9_Ma_2009.xml create mode 100644 whyis/materialsmine/tests/xml/L217_S2_Ash_2002.xml create mode 100644 whyis/materialsmine/tests/xml/L256_S3_Potschke_2004.xml create mode 100644 whyis/materialsmine/tests/xml/L260_S5_Haggenmueller_2006.xml create mode 100644 whyis/materialsmine/tests/xml/L300_S5_Nakane_1999.xml create mode 100644 whyis/materialsmine/vocab.ttl create mode 100644 whyis/materialsmine/whyis.conf create mode 100644 whyis/materialsmine/wsgi.py create mode 100644 whyis/materialsmine/xml_files/download_xml.py diff --git a/whyis/Dockerfile.dev b/whyis/Dockerfile.dev index f58ca333..6d179908 100644 --- a/whyis/Dockerfile.dev +++ b/whyis/Dockerfile.dev @@ -1,7 +1,9 @@ -FROM ubuntu:18.04 +FROM ubuntu:20.04 RUN apt-get update && apt-get install -y software-properties-common gcc && \ add-apt-repository -y ppa:deadsnakes/ppa -RUN apt-get update && apt-get install -y python3 python3-distutils python3-pip python3-apt curl +RUN apt-get update && apt-get install -y python3.9 python3.9-distutils python3.9-dev python3-pip curl libdb5.3-dev default-jdk-headless +RUN python3.9 -m pip install requests wheel +RUN python3.9 -m pip install whyis==2.0a4 WORKDIR '/apps' -CMD [ "/bin/bash" ] \ No newline at end of file +CMD [ "/bin/bash" ] diff --git a/whyis/materialsmine/.circleci/config.yml b/whyis/materialsmine/.circleci/config.yml new file mode 100644 index 00000000..9172708a --- /dev/null +++ b/whyis/materialsmine/.circleci/config.yml @@ -0,0 +1,29 @@ +version: 2 +jobs: + build: + working_directory: /apps/nanomine-graph + docker: + - image: tetherlessworld/whyis:latest + steps: + - checkout + - run: + name: Set permissions + command: chown -R whyis.whyis /apps/nanomine-graph + - run: + name: Install application + command: pip3 install -e . + - run: + name: Install newer version of SETLr + command: | + pip3 uninstall --yes setlr + pip3 install -q git+https://github.com/tetherless-world/setlr.git#egg=setlr + - run: + name: Start the whyis entrypoint (assumes cwd /apps/whyis) + command: cd /apps/whyis && /docker-entrypoint.sh + - run: + name: Run tests + command: cd /apps/whyis && python3 manage.py test --ci + - store_artifacts: + path: /apps/whyis/test-results/py/htmlcov + - store_test_results: + path: /apps/whyis/test-results diff --git a/whyis/materialsmine/ChemDatabase/chemprops_example.json b/whyis/materialsmine/ChemDatabase/chemprops_example.json new file mode 100644 index 00000000..e09b6f12 --- /dev/null +++ b/whyis/materialsmine/ChemDatabase/chemprops_example.json @@ -0,0 +1,112 @@ +[ + { + "_id": "O(C1=CC=C(C=C1)C(=O)C2=CC=C(OC3=CC=C(C=C3)[*])C=C2)[*]", + "_stdname": "Poly(ether ether ketone)", + "_abbreviations": [ + "PEEK" + ], + "_density": 1.29, + "_boc": [ + "000060020011012102030000100000000000", + "000020000010000100000000000000000000" + ], + "_tradenames": [ + "Zeniva", + "KetaSpire" + ], + "_synonyms": [] + }, + { + "_id": " C(C(C1=CC=CC=C1)[*])[*] ", + "_stdname": "Polystyrene", + "_abbreviations": [ + "PS" + ], + "_density": 1.04, + "_boc": [ + "000020000001011101110000200000000000", + "000000000000000100100000000000000000", + "000040020002021200010000200000000000", + "000040020003021200010000300100000000", + "010030001002031100000100210000000000" + ], + "_tradenames": [ + "Pelaspan", + "Afcolene", + "Aim", + "Amoco", + "Bextrene", + "Carinex", + "Distrene", + "Dylene", + "Edistir", + "Erinoid", + "Fina", + "Fostarene", + "Gedex", + "Hostyren", + "Huntsman PS", + "Lacqrene", + "Ladene", + "Lorkalene", + "Luron", + "Lustran", + "Lustrex", + "Neste PS", + "Polystyrol", + "Restirolo", + "Sicostyrol", + "Sternite", + "Stiroplasto", + "Stymer", + "Styrodur", + "Styron", + "Styvarene", + "Vestyron", + "Polystyrol", + "Polyzote", + "Pyrochek 68" + ], + "_synonyms": [ + "polyphenylethene", + "poly-1-phenylethylene", + "polyvinylbenzene" + ] + }, + { + "_id": "N(CCCCCC(=O)[*])[*]", + "_stdname": "Nylon 6", + "_abbreviations": [ + "PA 6", + "Nylon 6" + ], + "_density": 1.08, + "_boc": [ + "000000000001021000000000100000001000", + "100000000000000100000000000000001000", + "000000000001021000000000100000001000", + "302000000002102201010000100000000000", + "100110001001101100000000100000001000", + "301110002001213201000000100000000000", + "303100003001113201000000100000001000", + "303100003001113201000000100000000000", + "201110001001102201000000100000000000", + "302000000002102201010000100000000000", + "100040022002224100010002200100000000" + ], + "_tradenames": [ + "Perlon", + "Plaskon" + ], + "_synonyms": [ + "Poly(caprolactam)", + "polyamide 6", + "poly(ω-aminocaproamide)", + "poly(6-aminocaproic acid)", + "poly(ε-aminocaproic acid)", + "poly(ω-caproamide)", + "polycaprolactam", + "poly-[imino-(1-oxohexamethylene)]" + ] + } +] \ No newline at end of file diff --git a/whyis/materialsmine/ChemDatabase/notes.md b/whyis/materialsmine/ChemDatabase/notes.md new file mode 100644 index 00000000..6f863c28 --- /dev/null +++ b/whyis/materialsmine/ChemDatabase/notes.md @@ -0,0 +1,31 @@ +# Chemical Property Database Ingestion + +## RDF Structure +Pure pseudocode: +``` +chemical + id $ID; + stdname $STD_NAME; + abbreviations $ABBREV_1, $ABBREV_2, ..., $ABBREV_N; + density $DENSITY; + tradenames $TRADENAME_1, $TRADENAME_2, ..., $TRADENAME_N; + synonyms $SYNONYM_1, $SYNONYM_2, ..., $SYNONYM_N; +``` + +Applying our ontology: +``` +PREFIX sio: +PREFIX nanomine: +PREFIX rdfs: + +sio:ChemicalSubstance + nanomine:CU_Formula $ID; + rdfs:label $STD_NAME; + nanomine:Abbreviation $ABBREV_1, $ABBREV_2, ..., $ABBREV_N; + sio:Density $DENSITY + nanomine:TradeName $TRADENAME_1, $TRADENAME_2, ..., $TRADENAME_N; + sio:Synonym $SYNONYM_1, $SYNONYM_2, ..., $SYNONYM_N; + +``` + +So using this pattern, we have to write an SETLr ingest script to import the data from the JSON files into the knowledge graph. diff --git a/whyis/materialsmine/LICENSE b/whyis/materialsmine/LICENSE new file mode 100644 index 00000000..00a0976d --- /dev/null +++ b/whyis/materialsmine/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Rui Yan + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/whyis/materialsmine/README.md b/whyis/materialsmine/README.md new file mode 100644 index 00000000..4ac15cf9 --- /dev/null +++ b/whyis/materialsmine/README.md @@ -0,0 +1,56 @@ +# Nanomine-graph +visualization for nanomine project + +# Installation +- install [whyis](http://tetherless-world.github.io/whyis/install) using this command + ``` + WHYIS_BRANCH=master bash < <(curl -skL https://raw.githubusercontent.com/tetherless-world/whyis/master/install.sh) + ``` +- whyis will be installed in /apps/whyis +- install nanomine-graph app following: + ``` + sudo su - whyis + cd /apps + git clone https://github.com/tetherless-world/nanomine-graph.git + cd /apps/nanomine-graph + pip install -e . + exit + sudo service apache2 restart + sudo service celeryd restart + sudo su - whyis + cd /apps/whyis + python manage.py createuser -e (email) -p (password) -f (frstname) -l (lastname) -u (username) --roles=admin + ``` +- In your terminal, load the ontology and XML Ingest Semantic ETL file: + ``` + cd /apps/whyis + python manage.py load -i /apps/nanomine-graph/setl/ontology.setl.ttl -f turtle + python manage.py load -i /apps/nanomine-graph/setl/xml_ingest.setl.ttl -f turtle + python manage.py load -i 'http://semanticscience.org/ontology/sio-subset-labels.owl' -f xml + ``` + +- Load any Nanomine XML files you may already have. There is a collection floating around among developers. For production, the curation service will post XML files to the Whyis instance when they're ready to be used. + + ``` + cd /apps/whyis + python manage.py load -i -f turtle + ``` + + +- go to http://localhost/ to login with your credentials during "createuser" command + +# Developing mode +Each time a change is made on the visualization, apache2 and celeryd service have to be restarted manually. +This is very troublesome. whyis has a developing mode that help you allevate this pain. +``` +sudo su - whyis +cd /app/whyis +python manage.py runserver -h 0.0.0.0 +``` +Then, you only need to refresh your webpage to see your changes immediately after you make changes to the visualization. +After you finished the visualization changes, you can shutdown the developing mode with CTRL+c. +Then you have to restart apache2 and celeryd service by +``` +sudo service apache2 restart +sudo service celeryd restart +``` diff --git a/whyis/materialsmine/config.py b/whyis/materialsmine/config.py new file mode 100644 index 00000000..da336f27 --- /dev/null +++ b/whyis/materialsmine/config.py @@ -0,0 +1,277 @@ +# -*- config:utf-8 -*- + +import os +import logging +from datetime import timedelta + +project_name = "nanomine" +import importer + +import autonomic +import agents.nlp as nlp +import rdflib +from datetime import datetime + + +# Set to be custom for your project +LOD_PREFIX = os.environ.get('NM_GRAPH_LOD_PREFIX','http://materialsmine.org') + +#os.getenv('lod_prefix') if os.getenv('lod_prefix') else 'http://hbgd.tw.rpi.edu' + +skos = rdflib.Namespace("http://www.w3.org/2004/02/skos/core#") + +from nanomine.agent import * + +import whyis_unit_converter.unit_converter_agent as converter + +from authenticator import JWTAuthenticator + +authenticator_config = [] # set into config dict later +authenticator_secret = os.environ.get('NM_GRAPH_AUTH_SECRET', None) +if authenticator_secret: + authenticator_config.append(JWTAuthenticator(key=authenticator_secret)) + +# base config class; extend it to your needs. +Config = dict( + # use DEBUG mode? + DEBUG = False, + + site_name = "Nanomine", + + site_description = "Material Informatics for Polymer Nanocomposites", + + root_path = '/apps/whyis', + + app_path = '/apps/nanomine-graph', + + site_header_image = 'static/images/random_network.png', + + # use TESTING mode? + TESTING = False, + + # use server x-sendfile? + USE_X_SENDFILE = False, + + WTF_CSRF_ENABLED = True, + SECRET_KEY = "VOJ12a53NB9HOURFLNDOIWQZZ8YuFpMc", + + base_rate_probability = 0.8, + + file_archive = { + #'depot.backend': 'depot.io.gridfs.GridFSStorage', + #'depot.mongouri': 'mongodb://localhost/whyis_files', + 'depot.storage_path' : '/data/files', + 'cache_max_age' : 3600*24*7, + }, + vocab_file = "/apps/nanomine-graph/vocab.ttl", + WHYIS_TEMPLATE_DIR = [ + "templates", + ], + WHYIS_CDN_DIR = "/apps/nanomine-graph/static", + + # LOGGING + LOGGER_NAME = "%s_log" % project_name, + LOG_FILENAME = "/var/log/%s/output-%s.log" % (project_name,str(datetime.now()).replace(' ','_')), + LOG_LEVEL = logging.INFO, + LOG_FORMAT = "%(asctime)s %(levelname)s\t: %(message)s", # used by logging.Formatter + + PERMANENT_SESSION_LIFETIME = timedelta(days=7), + + # EMAIL CONFIGURATION + ## MAIL_SERVER = "", + ## MAIL_PORT = 587, + ## MAIL_USE_TLS = True, + ## MAIL_USE_SSL = False, + ## MAIL_DEBUG = False, + ## MAIL_USERNAME = '', + ## MAIL_PASSWORD = '', + ## DEFAULT_MAIL_SENDER = "rui ", + + # see example/ for reference + # ex: BLUEPRINTS = ['blog'] # where app is a Blueprint instance + # ex: BLUEPRINTS = [('blog', {'url_prefix': '/myblog'})] # where app is a Blueprint instance + BLUEPRINTS = [], + + lod_prefix = LOD_PREFIX, + SECURITY_EMAIL_SENDER = "rui ", + SECURITY_FLASH_MESSAGES = True, + SECURITY_CONFIRMABLE = False, + SECURITY_CHANGEABLE = True, + SECURITY_TRACKABLE = True, + SECURITY_RECOVERABLE = True, + SECURITY_REGISTERABLE = True, + SECURITY_PASSWORD_HASH = 'sha512_crypt', + SECURITY_PASSWORD_SALT = 'B3kPg16LgaoxOm4Jp4kg31iGwz7fx4Kv', + SECURITY_SEND_REGISTER_EMAIL = False, + SECURITY_POST_LOGIN_VIEW = "/", + SECURITY_SEND_PASSWORD_CHANGE_EMAIL = False, + SECURITY_DEFAULT_REMEMBER_ME = True, + ADMIN_EMAIL_RECIPIENTS = [], + db_defaultGraph = LOD_PREFIX + '/', + + DEFAULT_ANONYMOUS_READ = True, + + + admin_queryEndpoint = 'http://localhost:8080/blazegraph/namespace/admin/sparql', + admin_updateEndpoint = 'http://localhost:8080/blazegraph/namespace/admin/sparql', + + knowledge_queryEndpoint = 'http://localhost:8080/blazegraph/namespace/knowledge/sparql', + knowledge_updateEndpoint = 'http://localhost:8080/blazegraph/namespace/knowledge/sparql', + + authenticators = authenticator_config, + + #knowledge_useBlazeGraphBulkLoad = True, + #knowledge_bulkLoadEndpoint = 'http://localhost:8080/blazegraph/dataloader', + #knowledge_BlazeGraphProperties = '/apps/whyis/knowledge.properties', + #load_dir = '/data/loaded', + #knowledge_bulkLoadNamespace = 'knowledge', + + LOGIN_USER_TEMPLATE = "auth/login.html", + CELERY_BROKER_URL = 'redis://localhost:6379/0', + CELERY_RESULT_BACKEND = 'redis://localhost:6379/0', + CACHE_TYPE = "redis", # Flask-Caching related configs + CACHE_KEY_PREFIX = 'whyis_cache_', + CACHE_REDIS_URL = 'redis://localhost:6379/0', + CACHE_DEFAULT_TIMEOUT = 0, + + default_language = 'en', + namespaces = [ + importer.LinkedData( + prefix = LOD_PREFIX+'/dcat/', + url = 'http://www.w3.org/ns/dcat#%s', + headers={'Accept':'text/turtle'}, + format='turtle' + ), + importer.LinkedData( + prefix = LOD_PREFIX+'/doi/', + url = 'http://dx.doi.org/%s', + headers={'Accept':'text/turtle'}, + format='turtle', + postprocess_update= ['''insert { + graph ?g { + ?pub a . + } + } where { + graph ?g { + ?pub ?doi. + } + }''', + '''delete { + ?author ?orcid. + } insert { + graph ?g { + ?author ?orcid. + } + } where { + graph ?g { + ?author a ; + ?orcid. + } + } + '''] + ), + importer.LinkedData( + prefix = LOD_PREFIX+'/orcid/', + url = 'http://orcid.org/%s', + headers={'Accept':'application/ld+json'}, + format='json-ld', + replace=[ + ('\\"http:\\/\\/schema\\.org\\",', '{"@vocab" : "http://schema.org/"},'), + ('https://doi.org/', 'http://dx.doi.org/'), + ('https://', 'http://'), + ], + postprocess_update= ['''delete { + ?org ?p ?o. + ?s ?p ?org. + } insert { + graph ?g { + ?s ?p ?o. + } + } where { + graph ?g { + { + ?org a ; + [ + a ; + ?propertyID; + ?idValue; + ]. + ?org ?p ?o. + bind(IRI(concat("%s/organization/", str(?propertyID),"/",str(?idValue))) as ?s) + } union { + ?org a ; + [ + a ; + ?propertyID; + ?idValue; + ]. + ?s ?p ?org. + bind(IRI(concat("%s/organization/", str(?propertyID),"/",str(?idValue))) as ?o) + } + } + }''' % (LOD_PREFIX, LOD_PREFIX) , + ''' + insert { + graph ?g { + ?s ?name. + } + } where { + graph ?g { + ?s ?name. + } + } + '''] + ), + importer.LinkedData( + prefix = LOD_PREFIX+'/dbpedia/', + url = 'http://dbpedia.org/resource/%s', + headers={'Accept':'text/turtle'}, + format='turtle', + postprocess_update= '''insert { + graph ?g { + ?article ?abstract. + } + } where { + graph ?g { + ?article ?abstract. + } + } + ''' + ) + ], + inferencers = { + "SDDAgent": autonomic.SDDAgent(), + "SETLr": autonomic.SETLr(), + "SETLMaker": autonomic.SETLMaker(), + "CacheUpdater" : autonomic.CacheUpdater(), + "UnitConverter": converter.UnitConverter(), +# "HTML2Text" : nlp.HTML2Text(), + "EntityExtractor" : nlp.EntityExtractor(), + "EntityResolver" : nlp.EntityResolver(), +# "TF-IDF Calculator" : nlp.TFIDFCalculator(), +# "SKOS Crawler" : autonomic.Crawler(predicates=[skos.broader, skos.narrower, skos.related]) + }, + inference_tasks = [ +# dict ( name="SKOS Crawler", +# service=autonomic.Crawler(predicates=[skos.broader, skos.narrower, skos.related]), +# schedule=dict(hour="1") +# ) + ] +) + + +# config class for development environment +Dev = dict(Config) +Dev.update(dict( + DEBUG = True, # we want debug level output + MAIL_DEBUG = True, + EXPLAIN_TEMPLATE_LOADING = True, + DEBUG_TB_INTERCEPT_REDIRECTS = False +)) + +# config class used during tests +Test = dict(Config) +Test.update(dict( + TESTING = True, + WTF_CSRF_ENABLED = False +)) diff --git a/whyis/materialsmine/data/dummy_xml_file.ttl b/whyis/materialsmine/data/dummy_xml_file.ttl new file mode 100644 index 00000000..babb05ba --- /dev/null +++ b/whyis/materialsmine/data/dummy_xml_file.ttl @@ -0,0 +1,19 @@ +@prefix dc: . +@prefix mt: . +@prefix np: . +@prefix prov: . +@prefix rdf: . +@prefix rdfs: . +@prefix schema: . +@prefix sio: . +@prefix whyis: . +@prefix xml: . +@prefix xsd: . + + a schema:Dataset ; + schema:distribution . + + a , + schema:DataDownload, + ; + whyis:hasContent "data:text/xml;charset=UTF-8;base64,PD94bWwgdmVyc2lvbj0nMS4wJyBlbmNvZGluZz0nVVRGLTgnPz4KPFBvbHltZXJOYW5vY29tcG9zaXRlPjxJRD5MMDAwX0R1bW15XzIwMjFfUzE8L0lEPjxDb250cm9sX0lEPkwwMDBfUzFfMjAyMV9TMTwvQ29udHJvbF9JRD48U2NoZW1hVmVyc2lvbj5sb2NhbHRlc3Q8L1NjaGVtYVZlcnNpb24+PFNjaGVtYUlEPmxvY2FsdGVzdDwvU2NoZW1hSUQ+PERhdGFzZXRJRD5sb2NhbHRlc3Q8L0RhdGFzZXRJRD48REFUQV9TT1VSQ0U+PENpdGF0aW9uPjxDb21tb25GaWVsZHM+PENpdGF0aW9uVHlwZT5yZXNlYXJjaCBhcnRpY2xlPC9DaXRhdGlvblR5cGU+PFB1YmxpY2F0aW9uPkpvdXJuYWwgb2YgQXBwbGllZCBQb2x5bWVyIFNjaWVuY2U8L1B1YmxpY2F0aW9uPjxUaXRsZT5UaGVybWFsIGFuZCBtZWNoYW5pY2FsIHByb3BlcnRpZXMgb2YgcG9seWFtaWRlIDEyL2dyYXBoZW5lIG5hbm9wbGF0ZWxldHMgbmFub2NvbXBvc2l0ZXMgYW5kIHBhcnRzIGZhYnJpY2F0ZWQgYnkgZnVzZWQgZGVwb3NpdGlvbiBtb2RlbGluZzwvVGl0bGU+PEF1dGhvcj5aaHUsIERpbmdjaHVuPC9BdXRob3I+PEF1dGhvcj5SZW4sIFl1YW55dWFuPC9BdXRob3I+PEF1dGhvcj5MaWFvLCBHdWFuZ3hpbjwvQXV0aG9yPjxBdXRob3I+SmlhbmcsIFNoZW5nbG9uZzwvQXV0aG9yPjxBdXRob3I+TGl1LCBGZW5naHVhPC9BdXRob3I+PEF1dGhvcj5HdW8sIEppYW5qdW48L0F1dGhvcj48QXV0aG9yPlh1LCBHYW9qaWU8L0F1dGhvcj48S2V5d29yZD5leHRydXNpb248L0tleXdvcmQ+PEtleXdvcmQ+bWVjaGFuaWNhbCBwcm9wZXJ0aWVzPC9LZXl3b3JkPjxLZXl3b3JkPm5hbm9zdHJ1Y3R1cmVkIHBvbHltZXJzPC9LZXl3b3JkPjxLZXl3b3JkPnN0cnVjdHVyZeKAkHByb3BlcnR5IHJlbGF0aW9uc2hpcHM8L0tleXdvcmQ+PEtleXdvcmQ+dGhlcm1hbCBwcm9wZXJ0aWVzPC9LZXl3b3JkPjxQdWJsaXNoZXI+V2lsZXkgQmxhY2t3ZWxsIChKb2huIFdpbGV5ICZhbXA7IFNvbnMpPC9QdWJsaXNoZXI+PFB1YmxpY2F0aW9uWWVhcj4yMDE3PC9QdWJsaWNhdGlvblllYXI+PERPST4xMC4xMDAyL2FwcC40NTMzMjwvRE9JPjxWb2x1bWU+MTM0PC9Wb2x1bWU+PFVSTD5odHRwOi8vZG9pLndpbGV5LmNvbS8xMC4xMDAyL2FwcC40NTMzMjwvVVJMPjxMYW5ndWFnZT5FbmdsaXNoPC9MYW5ndWFnZT48TG9jYXRpb24+U2Nob29sIG9mIE1hdGVyaWFscyBTY2llbmNlIGFuZCBFbmdpbmVlcmluZzsgU2hhbmdoYWkgVW5pdmVyc2l0eTsgQmFvc2hhbiBEaXN0cmljdCBTaGFuZ2hhaSAyMDA0NDQgQ2hpbmEsIFpoZWppYW5nIEtleSBMYWJvcmF0b3J5IG9mIEFkZGl0aXZlIE1hbnVmYWN0dXJpbmcgTWF0ZXJpYWxzLCBOaW5nYm8gSW5zdGl0dXRlIG9mIE1hdGVyaWFscyBUZWNobm9sb2d5IGFuZCBFbmdpbmVlcmluZzsgQ2hpbmVzZSBBY2FkZW15IG9mIFNjaWVuY2U7IE5pbmdibyAzMTUyMDEgQ2hpbmE8L0xvY2F0aW9uPjxEYXRlT2ZDaXRhdGlvbj4yMDE5LTA1LTA4PC9EYXRlT2ZDaXRhdGlvbj48L0NvbW1vbkZpZWxkcz48Q2l0YXRpb25UeXBlPjxKb3VybmFsPjxJU1NOPjAwMjE4OTk1PC9JU1NOPjxJc3N1ZT4zOTwvSXNzdWU+PC9Kb3VybmFsPjwvQ2l0YXRpb25UeXBlPjwvQ2l0YXRpb24+PC9EQVRBX1NPVVJDRT48TUFURVJJQUxTPjxNYXRyaXg+PE1hdHJpeENvbXBvbmVudD48Q2hlbWljYWxOYW1lPlBvbHkobWV0aHlsIG1ldGhhY3J5bGF0ZSk8L0NoZW1pY2FsTmFtZT48UHViQ2hlbVJlZj42NjU4LjA8L1B1YkNoZW1SZWY+PEFiYnJldmlhdGlvbj5QTU1BPC9BYmJyZXZpYXRpb24+PFBsYXN0aWNUeXBlPnRoZXJtb3BsYXN0aWM8L1BsYXN0aWNUeXBlPjxQb2x5bWVyQ2xhc3M+UG9seWFjcnlsaWNzPC9Qb2x5bWVyQ2xhc3M+PFBvbHltZXJUeXBlPmhvbW9wb2x5bWVyPC9Qb2x5bWVyVHlwZT48TWFudWZhY3R1cmVyT3JTb3VyY2VOYW1lPkFDTUUgUG9seW1lcnM8L01hbnVmYWN0dXJlck9yU291cmNlTmFtZT48VHJhZGVOYW1lPnBsZXhpZ2xhc3M8L1RyYWRlTmFtZT48TW9sZWN1bGFyV2VpZ2h0PjxkZXNjcmlwdGlvbj53ZWlnaHQgYXZlcmFnZSAoTXcpPC9kZXNjcmlwdGlvbj48dmFsdWU+MTAwLjA8L3ZhbHVlPjx1bml0PmtEYTwvdW5pdD48L01vbGVjdWxhcldlaWdodD48UG9seWRpc3BlcnNpdHk+MS41PC9Qb2x5ZGlzcGVyc2l0eT48VGFjdGljaXR5PmF0YWN0aWM8L1RhY3RpY2l0eT48RGVuc2l0eT48dmFsdWU+MS4xODwvdmFsdWU+PHVuaXQ+Zy9jbV4zPC91bml0PjwvRGVuc2l0eT48VmlzY29zaXR5Pjx2YWx1ZT4xLjA8L3ZhbHVlPjx1bml0PlBhLXM8L3VuaXQ+PC9WaXNjb3NpdHk+PEhhcmRlbmVyPkFDTUUgSGFyZGVuZXI8L0hhcmRlbmVyPjxBZGRpdGl2ZT48ZGVzY3JpcHRpb24+QUNNRSBBZGRpdGl2ZTwvZGVzY3JpcHRpb24+PHZhbHVlPjEuMDwvdmFsdWU+PHVuaXQ+JTwvdW5pdD48L0FkZGl0aXZlPjwvTWF0cml4Q29tcG9uZW50PjwvTWF0cml4PjxGaWxsZXI+PEZpbGxlckNvbXBvbmVudD48Q2hlbWljYWxOYW1lPlNpbGljb24gZGlveGlkZTwvQ2hlbWljYWxOYW1lPjxQdWJDaGVtUmVmPjI0MjYxLjA8L1B1YkNoZW1SZWY+PEFiYnJldmlhdGlvbj5TaU8yPC9BYmJyZXZpYXRpb24+PE1hbnVmYWN0dXJlck9yU291cmNlTmFtZT5BQ01FIElub3JnYW5pY3M8L01hbnVmYWN0dXJlck9yU291cmNlTmFtZT48VHJhZGVOYW1lPkFDTUVTaWwyMzwvVHJhZGVOYW1lPjxEZW5zaXR5Pjx2YWx1ZT4yLjY1PC92YWx1ZT48dW5pdD5nL2NtXjM8L3VuaXQ+PC9EZW5zaXR5PjxDcnlzdGFsUGhhc2U+QW1vcnBob3VzPC9DcnlzdGFsUGhhc2U+PFN1cmZhY2VBcmVhPjxzcGVjaWZpYz48dmFsdWU+NS4wPC92YWx1ZT48dW5pdD5tXjIvZzwvdW5pdD48L3NwZWNpZmljPjwvU3VyZmFjZUFyZWE+PFBhcnRpY2xlQXNwZWN0UmF0aW8+PHZhbHVlPjEuNTwvdmFsdWU+PC9QYXJ0aWNsZUFzcGVjdFJhdGlvPjxOb25TcGhlcmljYWxTaGFwZT48V2lkdGg+PHZhbHVlPjEwLjA8L3ZhbHVlPjx1bml0Pm5tPC91bml0PjwvV2lkdGg+PExlbmd0aD48dmFsdWU+MTUuMDwvdmFsdWU+PHVuaXQ+bm08L3VuaXQ+PC9MZW5ndGg+PERlcHRoPjx2YWx1ZT4xMC4wPC92YWx1ZT48dW5pdD5ubTwvdW5pdD48L0RlcHRoPjwvTm9uU3BoZXJpY2FsU2hhcGU+PFBhcnRpY2xlU3VyZmFjZVRyZWF0bWVudD48Q2hlbWljYWxOYW1lPmFtaW5vcHJvcHlsIHRyaWV0aG94eXNpbGFuZTwvQ2hlbWljYWxOYW1lPjxBYmJyZXZpYXRpb24+QVBURVM8L0FiYnJldmlhdGlvbj48TWFudWZhY3R1cmVyT3JTb3VyY2VOYW1lPkFDTUUgU2lsYW5lczwvTWFudWZhY3R1cmVyT3JTb3VyY2VOYW1lPjxUcmFkZU5hbWU+QVAxMDE8L1RyYWRlTmFtZT48RGVuc2l0eT48dmFsdWU+MS4wPC92YWx1ZT48dW5pdD5nL2NtXjM8L3VuaXQ+PC9EZW5zaXR5PjxHcmFmdERlbnNpdHk+PHZhbHVlPjEuMDwvdmFsdWU+PHVuaXQ+Y2gvbm1eMjwvdW5pdD48L0dyYWZ0RGVuc2l0eT48TW9sZWN1bGFyV2VpZ2h0Pjx2YWx1ZT4yMjEuMzc8L3ZhbHVlPjx1bml0PmcvbW9sPC91bml0PjwvTW9sZWN1bGFyV2VpZ2h0PjwvUGFydGljbGVTdXJmYWNlVHJlYXRtZW50PjwvRmlsbGVyQ29tcG9uZW50PjxGaWxsZXJDb21wb3NpdGlvbj48RnJhY3Rpb24+PG1hc3M+PHZhbHVlPjAuMTExMTwvdmFsdWU+PHNvdXJjZT5yZXBvcnRlZDwvc291cmNlPjwvbWFzcz48dm9sdW1lPjx2YWx1ZT4wLjA4MDgyMzQ1NjwvdmFsdWU+PHNvdXJjZT5oeXBvdGhldGljYWxseSBjb21wdXRlZCBieSBDaGVtUHJvcHM8L3NvdXJjZT48L3ZvbHVtZT48L0ZyYWN0aW9uPjwvRmlsbGVyQ29tcG9zaXRpb24+PERlc2NyaXB0aW9uPlNpbGljb24gZGlveGlkZSBuYW5vcGFydGljbGVzPC9EZXNjcmlwdGlvbj48L0ZpbGxlcj48L01BVEVSSUFMUz48UFJPUEVSVElFUz48RWxlY3RyaWNhbD48RGllbGVjdHJpY0JyZWFrZG93blN0cmVuZ3RoPjxXZWlidWxsUGFyYW1ldGVyPjxkZXNjcmlwdGlvbj5zY2FsZSBwYXJhbWV0ZXI8L2Rlc2NyaXB0aW9uPjwvV2VpYnVsbFBhcmFtZXRlcj48V2VpYnVsbFBhcmFtZXRlcj48ZGVzY3JpcHRpb24+c2hhcGUgcGFyYW1ldGVyPC9kZXNjcmlwdGlvbj48L1dlaWJ1bGxQYXJhbWV0ZXI+PC9EaWVsZWN0cmljQnJlYWtkb3duU3RyZW5ndGg+PC9FbGVjdHJpY2FsPjwvUFJPUEVSVElFUz48L1BvbHltZXJOYW5vY29tcG9zaXRlPg==". diff --git a/whyis/materialsmine/data/parameterized_queries/PQ01.ttl b/whyis/materialsmine/data/parameterized_queries/PQ01.ttl new file mode 100644 index 00000000..c14de92c --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ01.ttl @@ -0,0 +1,281 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ01 a whyis:SparqlTemplate; + spin:labelTemplate "Show me polymer nanocomposite samples containing {?Filler} filler surrounded by {?Matrix} matrix, along with the {?AmountType} fraction of filler and reported values of {?AttributeType}."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +SELECT DISTINCT * WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a mm:Filler ] ; + a [ rdfs:label ?Filler ] ; + sio:hasAttribute [ a ?AmountType ; + sio:hasValue ?FillerAmount] ] , + [ sio:hasRole [ a mm:Matrix ] ; + a [ rdfs:label ?Matrix ] ] ; + sio:hasAttribute [ a ?AttributeType ; + sio:hasValue ?AttributeValue ; + sio:hasUnit ?UnitOfMeasure ] . +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Filler"; + schema:option [ + rdfs:label "any"; + schema:position 1 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 2 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 3 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 4 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 5 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 6 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 7 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 8 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 9 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 10 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 11 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 12 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 13 + ], + [ + rdfs:label "reduced graphene oxide"; + schema:value "Reduced graphene oxide"; + schema:position 14 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 15 + ] + ], + [ + a spl:Argument ; + sp:varName "Matrix"; + schema:option [ + rdfs:label "any"; + schema:position 1 + ], + [ + rdfs:label "epoxy"; + schema:value "DGEBA Epoxy Resin"; + schema:position 2 + ], + [ + rdfs:label "PMMA"; + schema:value "Poly(methyl methacrylate)"; + schema:position 3 + ], + [ + rdfs:label "polystyrene"; + schema:value "Polystyrene"; + schema:position 4 + ], + [ + rdfs:label "polyethylene"; + schema:value "Poly(ethylene)"; + schema:position 5 + ], + [ + rdfs:label "PEG"; + schema:value "Poly(ethylene glycol)"; + schema:position 6 + ], + [ + rdfs:label "PVDF"; + schema:value "Poly(vinylidene fluoride)"; + schema:position 7 + ], + [ + rdfs:label "poly(bisphenol A carbonate)"; + schema:value "Poly(bisphenol A carbonate)"; + schema:position 8 + ], + [ + rdfs:label "silicone"; + schema:value "Silicone rubber"; + schema:position 9 + ], + [ + rdfs:label "polypropylene"; + schema:value "Poly(propylene)"; + schema:position 10 + ], + [ + rdfs:label "cycloaliphatic epoxy"; + schema:value "Cycloaliphatic Epoxy Resin"; + schema:position 11 + ], + [ + rdfs:label "P2VP"; + schema:value "Poly(2-vinyl pyridine)"; + schema:position 12 + ], + [ + rdfs:label "PVA"; + schema:value "Poly(vinyl alcohol)"; + schema:position 13 + ], + [ + rdfs:label "polyimide"; + schema:value "Polyimide"; + schema:position 14 + ], + [ + rdfs:label "polyurethane"; + schema:value "Polyurethane"; + schema:position 15 + ], + [ + rdfs:label "PLA"; + schema:value "Polylactic acid"; + schema:position 16 + ] + ], + [ + a spl:Argument ; + sp:varName "AmountType"; + schema:option [ + rdfs:label "volume"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "mass"; + schema:identifier ; + schema:position 2 + ] + ], + [ + a spl:Argument ; + sp:varName "AttributeType"; + schema:option [ + rdfs:label "glass transition temperature"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "elastic modulus"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "crystallization temperature"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "elongation at break"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "tensile stress at break"; + schema:identifier ; + schema:position 5 + ], + [ + rdfs:label "electrical conductivity"; + schema:identifier ; + schema:position 6 + ], + [ + rdfs:label "thermal decomposition temperature"; + schema:identifier ; + schema:position 7 + ], + [ + rdfs:label "melting temperature"; + schema:identifier ; + schema:position 8 + ], + [ + rdfs:label "tensile stress at yield"; + schema:identifier ; + schema:position 9 + ], + [ + rdfs:label "volume resistivity"; + schema:identifier ; + schema:position 10 + ], + [ + rdfs:label "flexural modulus"; + schema:identifier ; + schema:position 11 + ], + [ + rdfs:label "thermal conductivity"; + schema:identifier ; + schema:position 12 + ], + [ + rdfs:label "elongation at yield"; + schema:identifier ; + schema:position 13 + ], + [ + rdfs:label "flexural stress at break"; + schema:identifier ; + schema:position 14 + ], + [ + rdfs:label "surface resistivity"; + schema:identifier ; + schema:position 15 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ02.ttl b/whyis/materialsmine/data/parameterized_queries/PQ02.ttl new file mode 100644 index 00000000..52f29ef5 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ02.ttl @@ -0,0 +1,69 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ02 a whyis:SparqlTemplate; + spin:labelTemplate "Show me polymer nanocomposite samples containing at least {?MinFiller} constituent material(s) classified as a filler and at least {?MinMatrix} constituent material(s) classified as a matrix."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +SELECT DISTINCT * WHERE { + { + SELECT DISTINCT ?Sample + (COUNT(DISTINCT ?Filler) AS ?FillerCount) (GROUP_CONCAT(DISTINCT ?Filler ; SEPARATOR=", ") AS ?FillerMaterials) + (COUNT(DISTINCT ?Matrix) AS ?MatrixCount) (GROUP_CONCAT(DISTINCT ?Matrix ; SEPARATOR=", ") AS ?MatrixMaterials) + WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a mm:Filler ] ; + a [ rdfs:label ?Filler ] ] , + [ sio:hasRole [ a mm:Matrix ] ; + a [ rdfs:label ?Matrix] ] + } + GROUP BY ?Sample + } + FILTER( (?FillerCount >= ?MinFiller) && (?MatrixCount >= ?MinMatrix) ) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "MinFiller"; + schema:option [ + rdfs:label "1"; + schema:value 1; + schema:position 1 + ], + [ + rdfs:label "2"; + schema:value 2; + schema:position 2 + ], + [ + rdfs:label "3"; + schema:value 3; + schema:position 3 + ] + ], + [ + a spl:Argument ; + sp:varName "MinMatrix"; + schema:option [ + rdfs:label "1"; + schema:value 1; + schema:position 1 + ], + [ + rdfs:label "2"; + schema:value 2; + schema:position 2 + ], + [ + rdfs:label "3"; + schema:value 3; + schema:position 3 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ03.ttl b/whyis/materialsmine/data/parameterized_queries/PQ03.ttl new file mode 100644 index 00000000..d654f51a --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ03.ttl @@ -0,0 +1,221 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ03 a whyis:SparqlTemplate; + spin:labelTemplate "Show me research articles published in or after {?MinYear} that studied {?Filler} as a nanocomposite filler material and {?Matrix} as a matrix material, and list all matrix and filler materials studied in that article."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +PREFIX dct: +SELECT DISTINCT ?doi ?Year +(GROUP_CONCAT(DISTINCT ?Filler ; SEPARATOR=", ") AS ?FillerMaterials) +(GROUP_CONCAT(DISTINCT ?Matrix ; SEPARATOR=", ") AS ?MatrixMaterials) +WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a mm:Filler ] ; + a [ rdfs:label ?Filler ] ] , + [ sio:hasRole [ a mm:Matrix ] ; + a [ rdfs:label ?Matrix ] ] . + ?doi a dct:BibliographicResource ; + dct:created ?Year ; + sio:hasPart ?Sample . + FILTER (?Year >= ?MinYear) +} +GROUP BY ?doi ?Year +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "MinYear"; + schema:option [ + rdfs:label "2000"; + schema:value 2000; + schema:position 1 + ], + [ + rdfs:label "2005"; + schema:value 2005; + schema:position 2 + ], + [ + rdfs:label "2010"; + schema:value 2010; + schema:position 3 + ], + [ + rdfs:label "2015"; + schema:value 2015; + schema:position 4 + ], + [ + rdfs:label "2020"; + schema:value 2020; + schema:position 5 + ] + ], + [ + a spl:Argument ; + sp:varName "Filler"; + schema:option [ + rdfs:label "any material"; + schema:position 1 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 2 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 3 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 4 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 5 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 6 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 7 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 8 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 9 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 10 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 11 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 12 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 13 + ], + [ + rdfs:label "reduced graphene oxide"; + schema:value "Reduced graphene oxide"; + schema:position 14 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 15 + ] + ], + [ + a spl:Argument ; + sp:varName "Matrix"; + schema:option [ + rdfs:label "any material"; + schema:position 1 + ], + [ + rdfs:label "epoxy"; + schema:value "DGEBA Epoxy Resin"; + schema:position 2 + ], + [ + rdfs:label "PMMA"; + schema:value "Poly(methyl methacrylate)"; + schema:position 3 + ], + [ + rdfs:label "polystyrene"; + schema:value "Polystyrene"; + schema:position 4 + ], + [ + rdfs:label "polyethylene"; + schema:value "Poly(ethylene)"; + schema:position 5 + ], + [ + rdfs:label "PEG"; + schema:value "Poly(ethylene glycol)"; + schema:position 6 + ], + [ + rdfs:label "PVDF"; + schema:value "Poly(vinylidene fluoride)"; + schema:position 7 + ], + [ + rdfs:label "poly(bisphenol A carbonate)"; + schema:value "Poly(bisphenol A carbonate)"; + schema:position 8 + ], + [ + rdfs:label "silicone"; + schema:value "Silicone rubber"; + schema:position 9 + ], + [ + rdfs:label "polypropylene"; + schema:value "Poly(propylene)"; + schema:position 10 + ], + [ + rdfs:label "cycloaliphatic epoxy"; + schema:value "Cycloaliphatic Epoxy Resin"; + schema:position 11 + ], + [ + rdfs:label "P2VP"; + schema:value "Poly(2-vinyl pyridine)"; + schema:position 12 + ], + [ + rdfs:label "PVA"; + schema:value "Poly(vinyl alcohol)"; + schema:position 13 + ], + [ + rdfs:label "polyimide"; + schema:value "Polyimide"; + schema:position 14 + ], + [ + rdfs:label "polyurethane"; + schema:value "Polyurethane"; + schema:position 15 + ], + [ + rdfs:label "PLA"; + schema:value "Polylactic acid"; + schema:position 16 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ04.ttl b/whyis/materialsmine/data/parameterized_queries/PQ04.ttl new file mode 100644 index 00000000..f446db94 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ04.ttl @@ -0,0 +1,73 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ04 a whyis:SparqlTemplate; + spin:labelTemplate "Show me research articles containing the word {?Text} in the article title."; + sp:text """ +PREFIX dct: +SELECT DISTINCT * WHERE { + ?doi a dct:BibliographicResource ; + dct:created ?Year ; + dct:title ?Title + FILTER (REGEX(LCASE(STR(?Title)), ?Text)) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Text"; + schema:option [ + rdfs:label "dielectric"; + schema:value "dielectric"; + schema:position 1 + ], + [ + rdfs:label "mechanical"; + schema:value "mechanical"; + schema:position 2 + ], + [ + rdfs:label "electrical"; + schema:value "electrical"; + schema:position 3 + ], + [ + rdfs:label "thermal"; + schema:value "thermal"; + schema:position 4 + ], + [ + rdfs:label "high"; + schema:value "high"; + schema:position 5 + ], + [ + rdfs:label "low"; + schema:value "low"; + schema:position 6 + ], + [ + rdfs:label "functionalized"; + schema:value "functionalized"; + schema:position 7 + ], + [ + rdfs:label "morphology"; + schema:value "morphology"; + schema:position 8 + ], + [ + rdfs:label "interfacial"; + schema:value "interfacial"; + schema:position 9 + ], + [ + rdfs:label "characterization"; + schema:value "characterization"; + schema:position 10 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ05.ttl b/whyis/materialsmine/data/parameterized_queries/PQ05.ttl new file mode 100644 index 00000000..d5a20a89 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ05.ttl @@ -0,0 +1,59 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ05 a whyis:SparqlTemplate; + spin:labelTemplate "Show me interactive charts from the gallery with {?Text} in the chart description."; + sp:text """ +PREFIX dct: +PREFIX sio: +SELECT DISTINCT * WHERE { + ?doi a sio:Chart ; + dct:description ?Description ; + dct:title ?Title + FILTER (REGEX(LCASE(STR(?Description)), ?Text)) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Text"; + schema:option [ + rdfs:label "hover"; + schema:value "hover"; + schema:position 1 + ], + [ + rdfs:label "click"; + schema:value "click"; + schema:position 2 + ], + [ + rdfs:label "tooltip"; + schema:value "tooltip"; + schema:position 3 + ], + [ + rdfs:label "zoom"; + schema:value "zoom"; + schema:position 4 + ], + [ + rdfs:label "select"; + schema:value "select"; + schema:position 5 + ], + [ + rdfs:label "interaction"; + schema:value "interaction"; + schema:position 6 + ], + [ + rdfs:label "mouse"; + schema:value "mouse"; + schema:position 7 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ06.ttl b/whyis/materialsmine/data/parameterized_queries/PQ06.ttl new file mode 100644 index 00000000..d85438c7 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ06.ttl @@ -0,0 +1,102 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ06 a whyis:SparqlTemplate; + spin:labelTemplate "Show me distinct matrix materials containing {?Filler} as a filler material, ranked by the count of research articles linked to that material combination, as well as a list of the DOIs of the respective research articles."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +PREFIX dct: +SELECT DISTINCT ?Matrix (COUNT(DISTINCT ?doi) AS ?DOI_Count) (GROUP_CONCAT(DISTINCT ?doi ; SEPARATOR=", ") AS ?ListOfDOIs) WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a mm:Filler ] ; + a [ rdfs:label ?Filler ] ] , + [ sio:hasRole [ a mm:Matrix ] ; + a [ rdfs:label ?Matrix ] ] . + ?doi a dct:BibliographicResource ; + sio:hasPart ?Sample . + FILTER(!REGEX(STR(?doi), "unpublished")) +} +GROUP BY ?Matrix +ORDER BY DESC (?DOI_Count) +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Filler"; + schema:option [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 1 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 2 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 3 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 4 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 5 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 6 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 7 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 8 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 9 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 10 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 11 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 12 + ], + [ + rdfs:label "reduced graphene oxide"; + schema:value "Reduced graphene oxide"; + schema:position 13 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 14 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ07.ttl b/whyis/materialsmine/data/parameterized_queries/PQ07.ttl new file mode 100644 index 00000000..650a7bdf --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ07.ttl @@ -0,0 +1,239 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ07 a whyis:SparqlTemplate; + spin:labelTemplate "Show me research articles that prepared samples using {?ProcessType}, reported {?PropertyClass} property measurements, and studied {?Material} as a constituent material."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +PREFIX dct: +PREFIX prov: +SELECT DISTINCT ?doi ?Material ?MaterialRole ?Property WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a [ rdfs:label ?MaterialRole ] ] ; + a [ rdfs:label ?Material ] ] ; + prov:wasGeneratedBy [ a ?ProcessType ] ; + sio:hasAttribute [ a ?Property ] . + ?Property rdfs:subClassOf ?PropertyClass . + ?doi a dct:BibliographicResource ; + sio:hasPart ?Sample . + FILTER(!REGEX(STR(?doi), "unpublished")) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "ProcessType"; + schema:option [ + rdfs:label "solution processing"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "melt mixing"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "in-situ polymerization"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "other process"; + schema:identifier ; + schema:position 4 + ] + ], + [ + a spl:Argument ; + sp:varName "PropertyClass"; + schema:option [ + rdfs:label "electrical"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "thermal"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "viscoelastic"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "mechanical"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "rheological"; + schema:identifier ; + schema:position 5 + ] + ], + [ + a spl:Argument ; + sp:varName "Material"; + schema:option [ + rdfs:label "any material"; + schema:position 1 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 2 + ], + [ + rdfs:label "epoxy"; + schema:value "DGEBA Epoxy Resin"; + schema:position 3 + ], + [ + rdfs:label "PMMA"; + schema:value "Poly(methyl methacrylate)"; + schema:position 4 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 5 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 6 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 7 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 8 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 9 + ], + [ + rdfs:label "polyethylene"; + schema:value "Poly(ethylene)"; + schema:position 10 + ], + [ + rdfs:label "polystyrene"; + schema:value "Polystyrene"; + schema:position 11 + ], + [ + rdfs:label "PVDF"; + schema:value "Poly(vinylidene fluoride)"; + schema:position 12 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 13 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 14 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 15 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 16 + ], + [ + rdfs:label "silicone"; + schema:value "Silicone rubber"; + schema:position 17 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 18 + ], + [ + rdfs:label "PLA"; + schema:value "Polylactic acid"; + schema:position 19 + ], + [ + rdfs:label "polypropylene"; + schema:value "Poly(propylene)"; + schema:position 20 + ], + [ + rdfs:label "poly(bisphenol A carbonate)"; + schema:value "Poly(bisphenol A carbonate)"; + schema:position 21 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 22 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 23 + ], + [ + rdfs:label "cycloaliphatic epoxy"; + schema:value "Cycloaliphatic Epoxy Resin"; + schema:position 24 + ], + [ + rdfs:label "polyurethane"; + schema:value "Polyurethane"; + schema:position 25 + ], + [ + rdfs:label "PVA"; + schema:value "Poly(vinyl alcohol)"; + schema:position 26 + ], + [ + rdfs:label "P2VP"; + schema:value "Poly(2-vinyl pyridine)"; + schema:position 27 + ], + [ + rdfs:label "PEG"; + schema:value "Poly(ethylene glycol)"; + schema:position 28 + ], + [ + rdfs:label "cellulose"; + schema:value "Cellulose"; + schema:position 29 + ], + [ + rdfs:label "polyimide"; + schema:value "Polyimide"; + schema:position 30 + ], + [ + rdfs:label "PVC"; + schema:value "Poly(vinyl chloride)"; + schema:position 31 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ08.ttl b/whyis/materialsmine/data/parameterized_queries/PQ08.ttl new file mode 100644 index 00000000..93c2ebb2 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ08.ttl @@ -0,0 +1,254 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ08 a whyis:SparqlTemplate; + spin:labelTemplate "Show me research articles published in or after {?MinYear} that studied {?Material} as a constituent and include an author with the name {?AuthorMatch}."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +PREFIX dct: +PREFIX foaf: +SELECT DISTINCT ?doi ?Material ?MaterialRole ?Year ?Author WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a [ rdfs:label ?MaterialRole ] ] ; + a [ rdfs:label ?Material ] ] . + ?doi a dct:BibliographicResource ; + dct:creator [ foaf:name ?Author ] ; + dct:created ?Year ; + sio:hasPart ?Sample . + FILTER(!REGEX(STR(?doi), "unpublished")) + FILTER((?Year >= ?MinYear) && (REGEX(STR(?Author), ?AuthorMatch))) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "MinYear"; + schema:option [ + rdfs:label "2000"; + schema:value 2000; + schema:position 1 + ], + [ + rdfs:label "2005"; + schema:value 2005; + schema:position 2 + ], + [ + rdfs:label "2010"; + schema:value 2010; + schema:position 3 + ], + [ + rdfs:label "2015"; + schema:value 2015; + schema:position 4 + ], + [ + rdfs:label "2020"; + schema:value 2020; + schema:position 5 + ] + ], + [ + a spl:Argument ; + sp:varName "Material"; + schema:option [ + rdfs:label "any material"; + schema:position 1 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 2 + ], + [ + rdfs:label "epoxy"; + schema:value "DGEBA Epoxy Resin"; + schema:position 3 + ], + [ + rdfs:label "PMMA"; + schema:value "Poly(methyl methacrylate)"; + schema:position 4 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 5 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 6 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 7 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 8 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 9 + ], + [ + rdfs:label "polyethylene"; + schema:value "Poly(ethylene)"; + schema:position 10 + ], + [ + rdfs:label "polystyrene"; + schema:value "Polystyrene"; + schema:position 11 + ], + [ + rdfs:label "PVDF"; + schema:value "Poly(vinylidene fluoride)"; + schema:position 12 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 13 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 14 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 15 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 16 + ], + [ + rdfs:label "silicone"; + schema:value "Silicone rubber"; + schema:position 17 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 18 + ], + [ + rdfs:label "PLA"; + schema:value "Polylactic acid"; + schema:position 19 + ], + [ + rdfs:label "polypropylene"; + schema:value "Poly(propylene)"; + schema:position 20 + ], + [ + rdfs:label "poly(bisphenol A carbonate)"; + schema:value "Poly(bisphenol A carbonate)"; + schema:position 21 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 22 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 23 + ], + [ + rdfs:label "cycloaliphatic epoxy"; + schema:value "Cycloaliphatic Epoxy Resin"; + schema:position 24 + ], + [ + rdfs:label "polyurethane"; + schema:value "Polyurethane"; + schema:position 25 + ], + [ + rdfs:label "PVA"; + schema:value "Poly(vinyl alcohol)"; + schema:position 26 + ], + [ + rdfs:label "P2VP"; + schema:value "Poly(2-vinyl pyridine)"; + schema:position 27 + ], + [ + rdfs:label "PEG"; + schema:value "Poly(ethylene glycol)"; + schema:position 28 + ], + [ + rdfs:label "cellulose"; + schema:value "Cellulose"; + schema:position 29 + ], + [ + rdfs:label "polyimide"; + schema:value "Polyimide"; + schema:position 30 + ], + [ + rdfs:label "PVC"; + schema:value "Poly(vinyl chloride)"; + schema:position 31 + ] + ], + [ + a spl:Argument ; + sp:varName "AuthorMatch"; + schema:option [ + rdfs:label "Schadler"; + schema:value "Schadler"; + schema:position 1 + ], + [ + rdfs:label "Benicewicz"; + schema:value "Benicewicz"; + schema:position 2 + ], + [ + rdfs:label "Kumar"; + schema:value "Kumar"; + schema:position 3 + ], + [ + rdfs:label "Nelson"; + schema:value "Nelson"; + schema:position 4 + ], + [ + rdfs:label "Hillborg"; + schema:value "Hillborg"; + schema:position 5 + ], + [ + rdfs:label "Zhao"; + schema:value "Zhao"; + schema:position 6 + ], + [ + rdfs:label "Bell"; + schema:value "Bell"; + schema:position 7 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ09.ttl b/whyis/materialsmine/data/parameterized_queries/PQ09.ttl new file mode 100644 index 00000000..ebf65e17 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ09.ttl @@ -0,0 +1,327 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ09 a whyis:SparqlTemplate; + spin:labelTemplate "Show me polymer nanocomposite samples containing {?Filler1}, {?Filler2}, or {?Filler3} as a filler material, along with the associated matrix materials and the reported value of {?AttributeType}."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +SELECT DISTINCT * WHERE { + ?Sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a mm:Filler ] ; + a [ rdfs:label ?Filler ] ] , + [ sio:hasRole [ a mm:Matrix ] ; + a [ rdfs:label ?Matrix] ] ; + sio:hasAttribute [ a ?AttributeType ; + sio:hasValue ?AttributeValue ; + sio:hasUnit [ rdfs:label ?UnitOfMeasure ] ] + FILTER((?Filler = ?Filler1) || (?Filler = ?Filler2) || (?Filler = ?Filler3)) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Filler1"; + schema:option [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 1 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 2 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 3 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 4 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 5 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 6 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 7 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 8 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 9 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 10 + ], + [ + rdfs:label "reduced graphene oxide"; + schema:value "Reduced graphene oxide"; + schema:position 11 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 12 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 13 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 14 + ] + ], + [ + a spl:Argument ; + sp:varName "Filler2"; + schema:option [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 1 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 2 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 3 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 4 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 5 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 6 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 7 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 8 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 9 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 10 + ], + [ + rdfs:label "reduced graphene oxide"; + schema:value "Reduced graphene oxide"; + schema:position 11 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 12 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 13 + ], + [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 14 + ] + ], + [ + a spl:Argument ; + sp:varName "Filler3"; + schema:option [ + rdfs:label "barium titanate"; + schema:value "Barium titanate"; + schema:position 1 + ], + [ + rdfs:label "titania"; + schema:value "Titanium dioxide"; + schema:position 2 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 3 + ], + [ + rdfs:label "carbon black"; + schema:value "Carbon black"; + schema:position 4 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 5 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 6 + ], + [ + rdfs:label "silver"; + schema:value "Silver"; + schema:position 7 + ], + [ + rdfs:label "graphene oxide"; + schema:value "Graphene oxide"; + schema:position 8 + ], + [ + rdfs:label "zinc oxide"; + schema:value "Zinc oxide"; + schema:position 9 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 10 + ], + [ + rdfs:label "reduced graphene oxide"; + schema:value "Reduced graphene oxide"; + schema:position 11 + ], + [ + rdfs:label "single-wall CNTs"; + schema:value "Single-wall carbon nanotubes"; + schema:position 12 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 13 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 14 + ] + ], + [ + a spl:Argument ; + sp:varName "AttributeType"; + schema:option [ + rdfs:label "glass transition temperature"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "elastic modulus"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "crystallization temperature"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "elongation at break"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "tensile stress at break"; + schema:identifier ; + schema:position 5 + ], + [ + rdfs:label "electrical conductivity"; + schema:identifier ; + schema:position 6 + ], + [ + rdfs:label "thermal decomposition temperature"; + schema:identifier ; + schema:position 7 + ], + [ + rdfs:label "melting temperature"; + schema:identifier ; + schema:position 8 + ], + [ + rdfs:label "tensile stress at yield"; + schema:identifier ; + schema:position 9 + ], + [ + rdfs:label "volume resistivity"; + schema:identifier ; + schema:position 10 + ], + [ + rdfs:label "flexural modulus"; + schema:identifier ; + schema:position 11 + ], + [ + rdfs:label "thermal conductivity"; + schema:identifier ; + schema:position 12 + ], + [ + rdfs:label "elongation at yield"; + schema:identifier ; + schema:position 13 + ], + [ + rdfs:label "flexural stress at break"; + schema:identifier ; + schema:position 14 + ], + [ + rdfs:label "surface resistivity"; + schema:identifier ; + schema:position 15 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ10.ttl b/whyis/materialsmine/data/parameterized_queries/PQ10.ttl new file mode 100644 index 00000000..31ede88a --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ10.ttl @@ -0,0 +1,90 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ10 a whyis:SparqlTemplate; + spin:labelTemplate "Show me charts from the gallery whose query includes {?Text}, along with the title of the chart."; + sp:text """ +PREFIX sio: +PREFIX schema: +PREFIX dct: +SELECT ?Chart ?Title WHERE { + ?Chart a sio:Chart ; + schema:query ?Query ; + dct:title ?Title . + FILTER(REGEX(LCASE(STR(?Query)), ?Text)) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Text"; + schema:option [ + rdfs:label "glass transition temperature"; + schema:value "glasstransitiontemperature"; + schema:position 1 + ], + [ + rdfs:label "elastic modulus"; + schema:value "tensilemodulus"; + schema:position 2 + ], + [ + rdfs:label "journal articles"; + schema:value "bibliographicresource"; + schema:position 3 + ], + [ + rdfs:label "elongation at break"; + schema:value "elongationatbreak"; + schema:position 4 + ], + [ + rdfs:label "permittivity"; + schema:value "permittivity"; + schema:position 5 + ], + [ + rdfs:label "tan delta"; + schema:value "tandelta"; + schema:position 6 + ], + [ + rdfs:label "storage modulus"; + schema:value "storagemodulus"; + schema:position 7 + ], + [ + rdfs:label "loss modulus"; + schema:value "lossmodulus"; + schema:position 8 + ], + [ + rdfs:label "electrical conductivity"; + schema:value "electricalconductivity"; + schema:position 9 + ], + [ + rdfs:label "regular expression filter"; + schema:value "regex"; + schema:position 10 + ], + [ + rdfs:label "binding of variables"; + schema:value "bind"; + schema:position 11 + ], + [ + rdfs:label "group_concat aggregate operator"; + schema:value "group_concat"; + schema:position 12 + ], + [ + rdfs:label "provenance ontology terms"; + schema:value "http://www.w3.org/ns/prov#"; + schema:position 13 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ11.ttl b/whyis/materialsmine/data/parameterized_queries/PQ11.ttl new file mode 100644 index 00000000..f8f13938 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ11.ttl @@ -0,0 +1,130 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ11 a whyis:SparqlTemplate; + spin:labelTemplate "Show me attributes in the knowledge graph that report values with {?UnitOfMeasure} as their unit of measure, as well as the count of distinct polymer nanocomposite samples and count of distinct research articles linked to that attribute and unit combination, in descending order by article count."; + sp:text """ +PREFIX rdfs: +PREFIX sio: +SELECT DISTINCT ?UnitOfMeasure ?AttributeType + (COUNT(DISTINCT ?doi) AS ?ArticleCount) + (COUNT(DISTINCT ?sample) AS ?SampleCount) +WHERE { + ?attr a ?AttributeType ; + sio:hasValue ?AttributeValue ; + sio:hasUnit [ rdfs:label ?UnitOfMeasure ] . + ?doi sio:hasPart ?sample . + ?sample sio:hasAttribute ?attr . +} +GROUP BY ?UnitOfMeasure ?AttributeType +ORDER BY DESC (?ArticleCount) +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "UnitOfMeasure"; + schema:option [ + rdfs:label "Celsius"; + schema:value "Celsius"; + schema:position 1 + ], + [ + rdfs:label "Megapascal"; + schema:value "Megapascal"; + schema:position 2 + ], + [ + rdfs:label "Hertz"; + schema:value "Hertz"; + schema:position 3 + ], + [ + rdfs:label "Percent"; + schema:value "Percent"; + schema:position 4 + ], + [ + rdfs:label "Pascal"; + schema:value "Pascal"; + schema:position 5 + ], + [ + rdfs:label "Gigapascal"; + schema:value "Gigapascal"; + schema:position 6 + ], + [ + rdfs:label "Siemens per Centimeter"; + schema:value "Siemens per Centimeter"; + schema:position 7 + ], + [ + rdfs:label "Siemens per Meter"; + schema:value "Siemens per Meter"; + schema:position 8 + ], + [ + rdfs:label "Kilovolt per Millimeter"; + schema:value "Kilovolt per Millimeter"; + schema:position 9 + ], + [ + rdfs:label "Ohm Centimeter"; + schema:value "Ohm Centimeter"; + schema:position 10 + ], + [ + rdfs:label "Second"; + schema:value "Second"; + schema:position 11 + ], + [ + rdfs:label "Kelvin"; + schema:value "Kelvin"; + schema:position 12 + ], + [ + rdfs:label "Micrometer"; + schema:value "Micrometer"; + schema:position 13 + ], + [ + rdfs:label "Watt per Meter-Kelvin"; + schema:value "Watt per Meter-Kelvin"; + schema:position 14 + ], + [ + rdfs:label "Kilopascal"; + schema:value "Kilopascal"; + schema:position 15 + ], + [ + rdfs:label "Kilojoule per Square Meter"; + schema:value "Kilojoule per Square Meter"; + schema:position 16 + ], + [ + rdfs:label "Joule per Gram"; + schema:value "Joule per Gram"; + schema:position 17 + ], + [ + rdfs:label "Gram per Cubic Centimeter"; + schema:value "Gram per Cubic Centimeter"; + schema:position 18 + ], + [ + rdfs:label "Radian per Second"; + schema:value "Radian per Second"; + schema:position 19 + ], + [ + rdfs:label "Joule per Gram-Kelvin"; + schema:value "Joule per Gram-Kelvin"; + schema:position 20 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ12.ttl b/whyis/materialsmine/data/parameterized_queries/PQ12.ttl new file mode 100644 index 00000000..4781b87f --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ12.ttl @@ -0,0 +1,46 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ12 a whyis:SparqlTemplate; + spin:labelTemplate "Show me attributes in the knowledge graph that are a subclass of {?PropertyClass} property."; + sp:text """ +PREFIX rdfs: +PREFIX mm: +SELECT * WHERE { + ?AttributeType rdfs:subClassOf+ ?PropertyClass +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "PropertyClass"; + schema:option [ + rdfs:label "electrical"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "thermal"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "viscoelastic"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "mechanical"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "rheological"; + schema:identifier ; + schema:position 5 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ13.ttl b/whyis/materialsmine/data/parameterized_queries/PQ13.ttl new file mode 100644 index 00000000..2ea0a2f0 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ13.ttl @@ -0,0 +1,74 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ13 a whyis:SparqlTemplate; + spin:labelTemplate "Show me the count of distinct {?Type} in the knowledge graph."; + sp:text """ +PREFIX sio: +PREFIX mm: +PREFIX dct: +PREFIX owl: +PREFIX npub: +SELECT (COUNT(DISTINCT ?instance) as ?count) WHERE { + ?instance a ?Type +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Type"; + schema:option [ + rdfs:label "polymer nanocomposite samples"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "research articles"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "procedures"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "control samples"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "units of measure"; + schema:identifier ; + schema:position 5 + ], + [ + rdfs:label "glass transition temperature values"; + schema:identifier ; + schema:position 6 + ], + [ + rdfs:label "classes"; + schema:identifier ; + schema:position 7 + ], + [ + rdfs:label "nanopublications"; + schema:identifier ; + schema:position 8 + ], + [ + rdfs:label "images"; + schema:identifier ; + schema:position 9 + ], + [ + rdfs:label "XML files"; + schema:identifier ; + schema:position 10 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ14.ttl b/whyis/materialsmine/data/parameterized_queries/PQ14.ttl new file mode 100644 index 00000000..9fbb54be --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ14.ttl @@ -0,0 +1,94 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ14 a whyis:SparqlTemplate; + spin:labelTemplate "Show me characterization devices linked to the method {?CharacterizationMethod}, as well as a list of research article DOIs linked to that characterization device and method."; + sp:text """ +PREFIX mm: +PREFIX prov: +PREFIX sio: +PREFIX dct: +SELECT DISTINCT ?DeviceURI (COUNT(DISTINCT ?doi) AS ?ArticleCount) (GROUP_CONCAT(DISTINCT ?doi; SEPARATOR=", ") AS ?ArticleList) WHERE { + ?x prov:wasQuotedFrom ?doi, [ a dct:BibliographicResource ] ; + prov:wasGeneratedBy [ a ?CharacterizationMethod ; + prov:used [ a sio:Device ; a ?DeviceURI ] ] . + FILTER(!REGEX(STR(?doi), "unpublished")) + FILTER(REGEX(STR(?DeviceURI), "materialsmine")) +} +GROUP BY ?DeviceURI +ORDER BY DESC (?ArticleCount) +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "CharacterizationMethod"; + schema:option [ + rdfs:label "scanning electron microscopy"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "dynamic mechanical analysis"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "transmission electron microscopy"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "thermogravimetric analysis"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "dielectric and impedance spectroscopy analysis"; + schema:identifier ; + schema:position 5 + ], + [ + rdfs:label "differential scanning calorimetry"; + schema:identifier ; + schema:position 6 + ], + [ + rdfs:label "X-ray diffraction and scattering"; + schema:identifier ; + schema:position 7 + ], + [ + rdfs:label "Fourier transform infrared spectroscopy"; + schema:identifier ; + schema:position 8 + ], + [ + rdfs:label "Raman spectroscopy"; + schema:identifier ; + schema:position 9 + ], + [ + rdfs:label "X-ray photoelectron spectroscopy"; + schema:identifier ; + schema:position 10 + ], + [ + rdfs:label "atomic force microscopy"; + schema:identifier ; + schema:position 11 + ], + [ + rdfs:label "optical microscopy"; + schema:identifier ; + schema:position 12 + ], + [ + rdfs:label "nuclear magnetic resonance"; + schema:identifier ; + schema:position 13 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/PQ15.ttl b/whyis/materialsmine/data/parameterized_queries/PQ15.ttl new file mode 100644 index 00000000..362952d0 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/PQ15.ttl @@ -0,0 +1,329 @@ +@prefix rdfs: . +@prefix schema: . +@prefix sp: . +@prefix spin: . +@prefix spl: . +@prefix whyis: . +@prefix materialsmine_templates: . + +materialsmine_templates:PQ15 a whyis:SparqlTemplate; + spin:labelTemplate "Show me research articles published in the journal {?Journal} that studied {?Material} as a constituent material and reported values of {?AttributeType}. "; + sp:text """ +PREFIX dct: +PREFIX sio: +PREFIX mm: +PREFIX rdfs: +SELECT ?Journal ?Material (GROUP_CONCAT(DISTINCT ?doi; SEPARATOR=", ") AS ?ListOfDOIs) (COUNT(DISTINCT ?doi) AS ?CountOfDOIs) WHERE { + ?doi a dct:BibliographicResource ; + dct:isPartOf [ dct:title ?Journal ] ; + sio:hasPart ?sample . + ?sample a mm:PolymerNanocomposite ; + sio:hasComponentPart [ sio:hasRole [ a [ rdfs:label ?MaterialRole ] ] ; + a [ rdfs:label ?Material ] ] ; + sio:hasAttribute [ a ?AttributeType ; sio:hasValue ?value ] +} +GROUP BY ?Journal ?Material +ORDER BY DESC (?CountOfDOIs) +} +"""; + spin:constraint [ + a spl:Argument ; + sp:varName "Journal"; + schema:option [ + rdfs:label "Macromolecules"; + schema:value "Macromolecules"; + schema:position 1 + ], + [ + rdfs:label "Polymer"; + schema:value "Polymer"; + schema:position 2 + ], + [ + rdfs:label "Composites Science and Technology"; + schema:value "Composites Science and Technology"; + schema:position 3 + ], + [ + rdfs:label "IEEE Trans. on Dielectrics and Electrical Insulation"; + schema:value "IEEE Transactions on Dielectrics and Electrical Insulation"; + schema:position 4 + ], + [ + rdfs:label "J. Applied Polymer Science"; + schema:value "Journal of Applied Polymer Science"; + schema:position 5 + ], + [ + rdfs:label "Carbon"; + schema:value "Carbon"; + schema:position 6 + ], + [ + rdfs:label "J. Polymer Science B Polymer Physics"; + schema:value "Journal of Polymer Science Part B: Polymer Physics"; + schema:position 7 + ], + [ + rdfs:label "J. Materials Chemistry"; + schema:value "Journal of Materials Chemistry"; + schema:position 8 + ], + [ + rdfs:label "ACS Applied Materials & Interfaces"; + schema:value "ACS Applied Materials & Interfaces"; + schema:position 9 + ], + [ + rdfs:label "Polymer Composites"; + schema:value "Polymer Composites"; + schema:position 10 + ], + [ + rdfs:label "Advanced Materials"; + schema:value "Advanced Materials"; + schema:position 11 + ], + [ + rdfs:label "J. Physical Chemistry C"; + schema:value "The Journal of Physical Chemistry C"; + schema:position 12 + ], + [ + rdfs:label "Polymer Degradation and Stability"; + schema:value "Polymer Degradation and Stability"; + schema:position 13 + ], + [ + rdfs:label "Synthetic Metals"; + schema:value "Synthetic Metals"; + schema:position 14 + ], + [ + rdfs:label "European Polymer Journal"; + schema:value "European Polymer Journal"; + schema:position 15 + ], + [ + rdfs:label "Materials Science and Engineering A"; + schema:value "Materials Science and Engineering: A"; + schema:position 16 + ], + [ + rdfs:label "Polymer International"; + schema:value "Polymer International"; + schema:position 17 + ], + [ + rdfs:label "Polymer Bulletin"; + schema:value "Polymer Bulletin"; + schema:position 18 + ], + [ + rdfs:label "ACS Macro Letters"; + schema:value "ACS Macro Letters"; + schema:position 19 + ], + [ + rdfs:label "J. Materials Science"; + schema:value "Journal of Materials Science"; + schema:position 20 + ], + [ + rdfs:label "Composites Part A Applied Science and Manufacturing"; + schema:value "Composites Part A: Applied Science and Manufacturing"; + schema:position 21 + ], + [ + rdfs:label "Nature Materials"; + schema:value "Nature Materials"; + schema:position 22 + ], + [ + rdfs:label "Applied Physics Letters"; + schema:value "Applied Physics Letters"; + schema:position 23 + ], + [ + rdfs:label "Nano Letters"; + schema:value "Nano Letters"; + schema:position 24 + ], + [ + rdfs:label "ACS Nano"; + schema:value "ACS Nano"; + schema:position 25 + ], + [ + rdfs:label "Materials Letters"; + schema:value "Materials Letters"; + schema:position 26 + ], + [ + rdfs:label "Materials & Design"; + schema:value "Materials & Design"; + schema:position 27 + ], + [ + rdfs:label "Nanotechnology"; + schema:value "Nanotechnology"; + schema:position 28 + ], + [ + rdfs:label "Progress in Organic Coatings"; + schema:value "Progress in Organic Coatings"; + schema:position 29 + ], + [ + rdfs:label "Advanced Functional Materials"; + schema:value "Advanced Functional Materials"; + schema:position 30 + ], + [ + rdfs:label "Chemical Physics Letters"; + schema:value "Chemical Physics Letters"; + schema:position 31 + ], + [ + rdfs:label "Polymers"; + schema:value "Polymers"; + schema:position 32 + ], + [ + rdfs:label "Nature Nanotechnology"; + schema:value "Nature Nanotechnology"; + schema:position 33 + ], + [ + rdfs:label "RSC Advances"; + schema:value "RSC Advances"; + schema:position 34 + ], + [ + rdfs:label "Physical Review Letters"; + schema:value "Physical Review Letters"; + schema:position 35 + ] + ], + [ + a spl:Argument ; + sp:varName "Material"; + schema:option [ + rdfs:label "any material"; + schema:position 1 + ], + [ + rdfs:label "PMMA"; + schema:value "Poly(methyl methacrylate)"; + schema:position 2 + ], + [ + rdfs:label "silica"; + schema:value "Silicon dioxide"; + schema:position 3 + ], + [ + rdfs:label "multi-wall CNTs"; + schema:value "Multi-wall carbon nanotubes"; + schema:position 4 + ], + [ + rdfs:label "epoxy"; + schema:value "DGEBA Epoxy Resin"; + schema:position 5 + ], + [ + rdfs:label "montmorillonite"; + schema:value "Montmorillonite"; + schema:position 6 + ], + [ + rdfs:label "polyethylene"; + schema:value "Poly(ethylene)"; + schema:position 7 + ], + [ + rdfs:label "polystyrene"; + schema:value "Polystyrene"; + schema:position 8 + ], + [ + rdfs:label "graphene"; + schema:value "Graphene"; + schema:position 9 + ], + [ + rdfs:label "P2VP"; + schema:value "Poly(2-vinyl pyridine)"; + schema:position 10 + ], + [ + rdfs:label "PVDF"; + schema:value "Poly(vinylidene fluoride)"; + schema:position 11 + ], + [ + rdfs:label "alumina"; + schema:value "Aluminium oxide"; + schema:position 12 + ], + [ + rdfs:label "graphite"; + schema:value "Graphite"; + schema:position 13 + ], + [ + rdfs:label "nylon"; + schema:value "Nylon 6-6"; + schema:position 14 + ] + ], + [ + a spl:Argument ; + sp:varName "AttributeType"; + schema:option [ + rdfs:label "glass transition temperature"; + schema:identifier ; + schema:position 1 + ], + [ + rdfs:label "tensile stress at yield"; + schema:identifier ; + schema:position 2 + ], + [ + rdfs:label "tensile stress at break"; + schema:identifier ; + schema:position 3 + ], + [ + rdfs:label "tan delta"; + schema:identifier ; + schema:position 4 + ], + [ + rdfs:label "storage modulus"; + schema:identifier ; + schema:position 5 + ], + [ + rdfs:label "loss modulus"; + schema:identifier ; + schema:position 6 + ], + [ + rdfs:label "electrical conductivity"; + schema:identifier ; + schema:position 7 + ], + [ + rdfs:label "elastic modulus"; + schema:identifier ; + schema:position 8 + ], + [ + rdfs:label "melting temperature"; + schema:identifier ; + schema:position 9 + ] + ]. diff --git a/whyis/materialsmine/data/parameterized_queries/README.txt b/whyis/materialsmine/data/parameterized_queries/README.txt new file mode 100644 index 00000000..ebf7e9e3 --- /dev/null +++ b/whyis/materialsmine/data/parameterized_queries/README.txt @@ -0,0 +1,15 @@ +PQ01.ttl - PASS +PQ02.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ03.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ04.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ05.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ06.ttl - PASS +PQ07.ttl - PASS +PQ08.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ09.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ10.ttl - FAIL (PASS if VALUES clause placed after FILTER, inside main SELECT clause) +PQ11.ttl - PASS +PQ12.ttl - PASS +PQ13.ttl - PASS +PQ14.ttl - PASS +PQ15.ttl - PASS \ No newline at end of file diff --git a/whyis/materialsmine/data/symmetric_10x10/2d_pixelated_designs_static_sdd.xlsx b/whyis/materialsmine/data/symmetric_10x10/2d_pixelated_designs_static_sdd.xlsx new file mode 100644 index 0000000000000000000000000000000000000000..5b7efcc8e838c57599f5d74369df9fd123862961 GIT binary patch literal 19700 zcmeIa1yo(jvM!8!a0u=!++BjZ1b26L_uwAfHMqNLaEAavg1fsrk7VC-_c=NH{Qn)# z#(VGHImTLZb#?bQyXUIvs;;hXSxHbZR3Hc-C?FspLLiZ|Pf-tap21XM`th?zEg>Mrc5MmmY^s^C^ z(0qmQN6?F}K$lzvsBsoAFkpOEL*0r>Gc0Deyy=ems?8+@^*@nCvwod^>uwsygw=opdE7#DvDz7M8~F{BoakJuPEV_`^B| zT|y(V1jsC0O&VqJn;RlB)hF3Q>IyZQ_#d{XXHk8Fn^PYc#4dg0?)W~hq}Xa^K@W_j z*e+#44=nTAfen+cox45Bg)(};Lj>hRa654eO?r(doDr=07lQF}e3d!Y!il#bw!xL3 z@?iIbNh7yuQ4kea^Y^n#ZVcR*jj;~R9e^MEK*HbPdg*%luH#K6Utd9iWdA{0>y_w< zuijWt>P;A7-=tN?-pJB{j`rvGe@W?oV$uA&u9wA1%kNV@Qg zwGt|Ne-d9psE^Dg!Cvkp!$DNU@&^_5Y4?5_UR>smJQyUr*etm42o@Cy|?uq24Wk_%*c0)6QTp8+1Ebmb4X$oMYE>So#gzy)=%oTO%+IbQ;&5Syj;n27ethHF zeXW;PW97h+@;>34eh2HzTz3LYtk}=Q4-M+3;kLh9 zI!e$IeiyhQb)TyUPmt?+U@uRysUF6uacrO-@~SZ_Y>%ZU{b8WqEKhQw8fd;UdKg;` zEnQ(Vqt$D7Na>(d=U;LaWc$PM#@nz9^JXX^ys^t0SN%Od6pECU2uU5 z2tZR7Pvy;sEL7xJE$}GAvv*O>ms#1%&G@V`KnIXKezTI>fMw$0VdBB7s9 z<|Lm^ewi$bI-U<0E!jmqb(!iGINzvR|5XD>A9+;IP%NzY4rV~Rorfv$`fksvQ}+IM zF5i92()2!g^6GEzfvir&vieRr8xHaEbsaMOqX?a>#8pPq^?D>8vJAJ`R9}EcojM|R z{OTyn1ESkxa;~wgak-n+t0H)g^TNgCo`{+`is5o2$i33&rQ@J|iOydq73v3->NNJM3K!Y3WF!>scEN+RcCwRu?*LrS7^r;Ze zqF%aQh(0sIN1z{n5at4*F#V`T_05I%n?4gi84R$(w8 zpes}$AdEl7!NJtX$kBoB*Nyq-I9sN=8nwWV=w0dfDj0uDYKN?f4y<%vZH51_#C>k1 z78)W)T7R6is_5X=dlLwF5%j2@zmYke_ z3G{VwbpkOz>Kq*6;7 z8B5^@^cKIcq_GFW?LI7WW3|j;FX00Z;f2RG>gMcP9LLVsfP$6MPn}RNo72oQO-u?g z`F@fevNXEz@T{#DS$>6|3RvPwU!|EzpurZ6IX{_{?9E9L9j8)p#`SfI%@z;UwF=q9 zjX}Odo!z;8vdKYM7sNR1>Dw*jJyJQ`3dgv)7ui-D>VT55hJl**?zQj0zN=D<0@bPA zme}{zokuu$+`*(qI!2eN>ihc2=Z-I~B1qYL8*#kV*Ic-FM3-2r$WRq~m#MwRG_J#Z z#sn9*PymxnVOCN@gI&vwe-|f~c45O3&Qn?btud3jCH=Hn0tS&eH#XAkMTS*{DjC&u z$C96|xdlT?{n-7EYSl|0vN~_sJpg|yQn9TFvTMTq%gxRsbR2~t)ci7$m6iOk!#7yb z%0b7H9+<+)v*plM=%Np)vSWZ5?MgR!3XUa}drJW{+#B#!w<={{zKY^;&nb_q54fLR zO;9j$-FQrM!r(DT*xk6KIG=T4KTAeM$H0c_>+APp02moi;84<%DfGv4q1{9Xv`{XP ze7R?$fizVgk&w$VdCiHYqi{z`-pX(EUJwVFY4CK@?+-3JN=gOcgPY3I6)UKAAGxXCt zKUrU5Ja9_yPYcan)FrMA1`2(=qyJSrh?{(LEa0tp%&q_tnL9@R=M^hF!A$Fq*lrMJ zL<)FsT;7~aUX3q+(eDl=ZSw|`nL72>oP7rdxy6c1C_weKUUF>~oL9@HSyAXWsasU# z=^w&_?k`bt(bv)GD|(E=taB92T7j)n&{JD=|*}X`i^rR*(DMZ*71|f@@1Vl0L zB-IC77XQKqZj8a9p+zZU5^M|WkVSif7@-H`#xnu}HZq29_33Sv zc3(L<&+!ge@j}G%xa?pNAnb`keJeuSEFHaNNT&9iM$jzej^4kUm$c(@FV#uTA$XKN zuQGC&*HoP*eT)k;QkI}I2{(TQ!6E(3#ZAMm;#uy(a&0IB& z!?XWljrTsBvs0%6-#Ck^Z9Y@pz`>!mL%n@Lv%OX4!x8WM9~CEwkHxR8i`Sbc7WI#% z3d75EjW(+vcv=^hct4VASDwy3$_(Vx);^ZL=WTbJw@j)$Ex3NcxVSht+H`*SJl%P9 zZS;A>=ThSKu=LotvH1sY7Ucx*?R{e@?~Xx7n|sOC;x%uv)Zpdu!Se&+T4nwQ{-Hd% zO#Mb>-xNNza#k2F>)cIW>-BZt(P}uI&P2hXZIddu##T=so6c*BRwn+y(8S`%<&EX-i8svAG(u_XSaA3cX2nkGJEP|vXCGDiPVOw;52x-Q-o^A7b1YU^(;BY^ zzo!!&31%GtysB369Cb8%Ib%##vZXZ!LwcvWx3D|vJ2kd&MwHiXJ6?NV+dH|qFg!BM z?AO0KQF}B!U)2N`dLMT;Ui)yLfKOw!X`d+5vAMiz>YUmXE?cPw9?pziEHA&L1>U>4 zsXvYE^ynyO&C$m1TDh+sEL(Rr`>3;9&G!s?+CA^jn7gnXBP(=f1>5gU&FomKckW*t zd3((_7815Uv1`qJzdSnXNutHkv1)vE#MoMI0%T>mEQwSmK5lQ{J72C_Vx=qiE^l5` zl?K08$PT8l_Dbb+D7t+9@~wJFQIE}P>o$qu_VWJGY(&e;?6T*y9`ki^XZy5{BD|3G zvUpL(YeGSH03Kgt<8@J2XO@Z0l&k$irlw2!N`n;f=Jyt(1$eT?4ClkRMeld_0anTd zNKW?4W~f<9==N068oo;~TgrruFwIJXeF5~NX=VeF2}$i-WNo|>eqhYq)}13Zub8bX|2 z%#R;A-TToOEgsCD1cRiD09r(xUcyffIU-g!9xRsxgS3nM50W^tRIF|+SR6?*Nf!w; z9`p8=OCAX{K%8FOPYroARyPr>mL!?9iy9iH66`!7`q!^&For}~k}e`>nA!j$X!IYD z!s>pql86@2el+}bq)?4gnJ_jwAhi6wq)^RZ3`qog$U<6vRg#D<&>(dDTcl9!VAV+k zcgR9IerJ-1KF}ca{9pj6E-;2<0w@$AJwJLW#9(L;27VF%R3BJ%G64pPkb$4A6k-%K z2qV7`0BQ(~A!VO;O6CAYjb~8n6+4>o~8oY z3NS0phAmPr7Xa;vYL#XS7XN+C-`8i|V|lRLy+|#ui}7%8MxcsRUM;1`t~?B&@W_;bvC7(J&ZuYtUr@ zf3AF17MDA7^w9mH0i|w@thcqirS-Hzfn8z&9VOia2uD8!k#>3XI-eGV0)F4bR$`H-SV^}%u zg9sUGj2F&z8YV@A1MgqG*!YDOjDD4W0O1jgTot7VgDg8|n%~OMH33bQNfPH&GrW>% z@(^Jc^@bAFI|}ySr5l^pCPM(oIPJz;u5}?U&Zt(6y(4cQCYNwBag7fjb^{$zU`?kY zk?1W9#2{yK$0f}oKAq%xim$4HwAi@jo_iRwSt6eJrT_%qO%-mNo@fgzVRUs!3h}aR zuwf6ik8sk1pR;<6`{`(Rsk>ac({P>Ak|j@vZ-{FfK4O{xZ#2sN8oYrmd}9rVO~@pp z0+JXoQ_4ue%2Wli2&@JvcSHeQe&);`tNzd-!g0wmZW0$xL0XC%$dl@XO?Sq_V(C#a z@hyTYvrwcG3I+w(a>Of5bclnLXYq9addM~10^xfPp=-K8B)zGY|%3RhN|Le~C$ z^~kXW{iZ?I4-1|+gDjcKd#Na|laF57j3Qd?ZAwq0$$Id&-SdF@ZP>g1F#*;@a`ML( zJ>{{F{lFC&)?O@LGrJ3VGq*Nq-U7f(m=N=d`Louq8-eVe@s~b-$+E^c>BL!}KtQ4J zKVuGlxzZg?jjW95etk3i1UXfB+qR~NQ2c}ZpzK{LaNu>%CV&8 zQ*mKeDb=Cnxx`2!9GVTu2M14 zYJ%IfM%~<=b5~YMv2m}cIFKc4CW(YA8LY-6I8O)CdP05u(u^q{)(&W9fv_v{u>cp* z`C@6-@@Gct6_ zOyKeOF-PvD5pcounzZNk&|~9|4yVuH!Dno^L~UZ?HIEN-{WO#GL4n>G3T-bbM4?HG zfwj8gvmWiYG+$a(A1BT{}5MdnHB>Ri@pY5T&7hxRVo1;j51b)B}<+IE^hD=YiMYLY2V0Ix1on08zgs2c`%U6XdJ(f`_(XO6oQI)GKG; z=?5lq1E59+rQTWaQYa}1v!eW@u7Sq>5pPle|6`=7J0npM{+ZG%^-N>roT?9{4N3Mu4J*=z7=)$c}B!_Dd4h8?iVo<>1lGdC|e|JsxZ?RvT8 z+Emvf2o3)eys(h>)0%^qxY@8pFh>TYp)g;e?cL^jL>kKvE(#> zGj_>R5*3eFP*#?Yg$RE>kz@?D%J6`)cn8mEb@1XTq^%VjJXc5Sec!Bhn;BlBov=94 z!HIq2(dVqTQqgdm^z8G*@yfh^djMEn**Ub=(7e$JZ+RV=(RsB$msjRJ2+lEe7tzzu zxxr7}IrpS5Nq}rQHBy@0)^ae8hqSRuT+V_o@b_$1 zhr;;uY;w2rOcoaDtk0@Bb3c7>Q}dd&{^*l6nl=2w`ozrK zyypFI*Z6u2>B%Nr7(@*1F?Rt*vvTV0E!laCcktq&Hbv zurIh+qOV15Rda2BIpA;}WHR)fd1v*6^JZ6z>qvul!O^v^85_Moa`m$1PP5{*zQqb} z^p44^h34d<(8=LU-!t(@`z6MekmbZQJ-ZC$vs_=5le4PPm=fpttT( zinKv|#NNu?()-j(*|{nWXTm3yS9FquwcX3cuT_1yZJ|u1g3RXBLGCe@?S4jBspCqj z0n7J+q0vAmqg1ZbZ(-9-d*GitDJX7nCN?d6O`s{E=J)MyiCI2!@Q;6$9Xe!L7a6fNSXW=y#*1Qj#r^T8ol_VpRH`bhostl z{R|W6#iGS(;YaHYMUtbyx(JZK{Dq>QrLEqweST&y@MCq+ryzj^iAx}2031Ri^pMpN z4YMN4U($?7WM9kWTVD;D94PqL#>Yq*LAHX5zV_Zm5=5KA`nk&Ymf83U7$y)1MH5l* z6A15s`JxVyFm|C5hL8#OcRko7EIeoFhKU(QJd;sI6Jfp;K?nO$C}t5d?-Ymkur zS~Z)8jPx^C_$@aK*6*mcXvW9Fw&!Yr%BC(rTy$ z{A5f_ET@8|ld1>z$Y&T6`wUbeejy1gNrp>$++-ET?vVQ6eOCZJ+ISylu`}v-L_ktJ zA0yn9cFC9dEpbyn3q-3Jn=t5I#e}+GbMhUG4MIE80)cNs5qyk@Wx|=;^NP%VV+2!R zC4?1&C+=0|p?vg&n(?9Ez*LO7i`MbX={VOTip$r(=Hv$Da8GrmF%p6sP!mVPftkfz zU?`%Ef8nG^CPsBv1R3HGc#zbDW6UAmByfsfh?;R02yiHoSm>eHI*6c`=-QK^04v={ z=i5_aqy#g#W`pTs*OVP(>+ep{AwAAhWif`6*C#+GrIAP&u(B7a1n3V}1SzLbm`z9& z^rRS(1xj+}twr!-C2_&{PNnk^$)rSgCr_1rQOS!Qpgyo|SP<8fs*dd=h)j$XXmUgr z>sREoAT^L6h$Jy0!%(Kf`sO$ z!nl>R$g#ga%p*YDu!Zq86hY+T?(cyV5`*xAz8|*>bf`wMt2U^+1dH`05NIMY{FzZd zsIV2*-K^Fc-D$180s*Z?dlnjywo+41~H=1}xsAozXMdm7&mc)+Y1QvuH7q_e;<#T^ylq z*h2ge=U0}pE#xDd2Ootd8Ac93;<$BK}4#)Zx)}vC|@8qJX-<$t!rVZLvNW>25ST`Hz*TXG|nxqdE=G--8zf!=p31g z&YrnXrN8@++!*l?(!TG~6anbrd>3gr7v}mRB%D|X8nonF6wRdH>+z!C?EI5g-yV|4 z1Qr_;qY@Vr6VY#w4r|Zw;Yx}S`nqs{n3yI5PhYOf3_nExD)*e-_^kt~vV;?;v9fV) zZPQb2`~Lo^Hby3eUS-o#P~}8O$l>66S6!HKH%ELK8|NP-dkPWYjXGRfdb-vFpw~@& zz+y9u1u`dIkj-(TT-4FU>e+Yp>Y|p-0AQOW!~*((BoRFGruC;+W)So-*W%@8p6`7F zfb#^ZlnsB@q`5!^#7@IyduTiY%&DdG-)M;dxzSNfq}U9Az{0Kc_%xg@(Yx$qN0Ybz zlTSiX05br4B!W_pG`@bwW$XKgJbur^y}NHo7jFzHK|o5G4u@Q=7hS|x&5Em8ftxnnwh_Y4g!7YK-*QV* z;9{%y<;M)IrZPE4_m~^^R)XC86Po_0n)EZ%7TvjPA@4($V&q4rgcB?F1l^f(*mz{I zP)bsNL(3LL3bi!&&;E@A-_2I0xxb2X>i`QlNMl6iZU^z{TL=f*a*Y$%B|aU05wby; za2q`hw{dgoT$pXIcUz10;)zmQE4?+r_>nc18?sc|Pw7pEed(AL)%hWL*92|Hm!pTt zf%jy%=Ke0+Ywg=fsHVzWxb0s!SQtyMIhY}UfZB0@fZl>#eg=LynCjUZ87es1n^~JU z{IqQ2)s}4*SrL8kt6sZowK=n^sq4>Y3Ghwh^RTO!`8S+x-kFAm)=T7x%2!9~y*_@9 z$8l`qGV)?D#5=uoY0Ld6T9{UV_d(o%s{Hf7z9A=`xYAyYeAK|E%;m_lPCxNs0Httw z0ymybK5ka#(_K$Yy){_dFkV#BcsYDrFS_IpD6UDW;!hXZ(!@AVEK#9am=qGN@lz~L zvC@ULc}NLZQ83GtF5KRa@Zal79!eA38e?(Wu(NP}9Bd6{w7HBchR+V=_GaLadRG&B zqC177Pn351GId*us_55)i0U`ACpB)h#KV?%5-ERPn^W^zMYf{0*Ji1yK)o=CB3{C{ zm$f26t{XrixciEDXeEtH$B*1A$z=(wwq4SVj+Pe;myKoSWC4@X%N-5bP4AbOgZdGb z|C2H;w8w2Up$?0EWusxcw#=*z2=CV9qG2j2x-(fIEAo&U=5sH`MI??9N+*(C5_nIm z-#j?%Fp=F9GkPFjrJSw!W3AzX14vqowF1vmCzMp2S?br5=aV}^e#A9lmc0RixtZ>- zZu@*{dnB*d8%K>EU|}eqN1|wnRHv4oo}aM9r@~JYP!?;<-*+s~d-JmcN>mk5l-N*| zXvm@-DE8F|g-x>_30Hg9d~~S(Od8NG1~RA=8_B2_xEh&P2WwXM z@bMdOhSrj{kB};hX7raPNrlh_R@pXzgRdN6PCG5u*oH%=`h=7BgHF?8+xpPEvaO2S zRPItptqr!%h;cl?qHWHY4{~h>;g)UAzzO44n==|(xfzW$=<#L=3vxT;xwGAwf@_(E zZf49dw6eTnr0>8QxdmBAjcP$62R|2ZjMh`;*VITMj8m>Y*IXjVvrS==fDb?EQCI;> zqq)RPE36@L*=`a%X+6hr-{_x)UlA1e6VjQzMuh}70Fe0;NY>cuW$hhzv(M+Z?h%%V zp{P9B#Rv-v?+=llG^I};gRgiBm#85~5Mj7#cYu6F+9x1!KC&9#!O+SLFGKlHp-4&i z>#5yk$N>nsK1@H4U2C=dplV~a4Mn+*Y|zA+N~U?fFfthFk>I!|k9m*BF5B2$jyXC= z&h+G7M(m*`+P{~~z$sg1On2xixc}+sSoet|fsb4UIGa2FoF8e7sgo<$C3k*{ z$$c}8Jp|7M*;N&Q0_i;6luu&2MnV(h56JB^tizZeQxy~#74hgNC4Qs%qA(Hn1sDL4 zbo;9~*ZxRK8Z|Z1PL+g+RUWanlJqobFO&E*_?g8 zI`!CDhtZt=AcM^oozrH%F1!5){YrMv6r@$dWe`W6>3zcW3cb1Q?A6NA_bM}C*PhZY z(M|=X#bP~k(4qGhLDr`0AEyOQeUrYQtgwRIE3VE@?rX>ndXLVtDKd(C6_Uav>i{fN z>B4CZao=lw;Ep^L^zBa_m?56%bIRZ|AdP+AzL$NRe^fY56TB5FG(SW4#bg&S*w1v; z-f3eh-l~@?FQ5}vyj^zd?f13f_5y+kn5ria2pE9P8NSNlG53UrgOT1(ydZMbwAqi@ zTsA3@7~JIl0;)xoM?JKJZ^0e|I`A1XfMO50)c0shTv4efiK?Z90WaG~$0Ve+(LX-N>aZRv&vTF9&1pMX-&U0rEoF@r^z+ck_D6p0zTWeaXa06^~bWBrxR>r zlI(6bN+oCywreZru3Iw-e_zh@$PC9R(o9TC8oCz%(prxv{El-DT$hg=fkbnhg9P$G zGh~L(84hOqU`cYVnzUH(vx^VZ4F4BFr*X1Nz6@B`>VaUl+jDXUr*YUVCXcVe>0e~M zD3Q>luZHpksy8*2kL17GYQpcaVB^Htdne zCu8R-26HmKaWGhWjO*HLouEg?eXcGWTu&j3t!tKza(7e?2l0Xd830WnahITZkGlE@ zBdyGbS`DMKj%ZoVf4QBCRp5>4TE?+j5#7cm8j(Y*h-pxdP0HhggVTPI+d4;_JNFoQ zr+|IcEndYvK`y!vyl~2(s&E%TF8W1k?Q(PIuYD*|pJoNB-rV?~-!#p;f73FKZk9&B z)JvX{l}#Ew;tP-2EATxR%eQD!Bv}^e7)qzqQ%!h0;#CSWmd`+bi_id@sS=TSK!sipNF06{_!~BAGvw2s*=>9@A~n)BL$j89}^dFPz&CO&wF| z2kh6rk`h&ZohhviQb1n_*kGj~i~)|>^T%RgAIfG^oSH7wY2px_+wf+UkfXAuZ@- znRyQYhsG_x=L%|u)ppQzL}h5z zg%LQMU^QTM)ruoHIH!iZc-XSS-5A&O%N?CZ6)YSjbaBM!$4|*(mi=fd5IY!63L5sqSRnxt-UmleX-otphXJm-v3I<95NHTJOTPzN%};QO?}qb@$q>vQk9 zs- zRTEs0W&z{z7Kp#TAnr@v3IVTL+^OMKzD;(LIWacqbV&=?tI0bCt`aqBN17*r%a;+Y z39i>p*77;!6q&rBaa~V6SkvZM7j!mF#fSdhRinqQ)>!4OqhZO;#o7yG9`BS@+KyNE zXDTy53a{{{949axvCQ}-eWUyc`HXJ@Lfg9-ODuE1lpW5V@X3;FYPK`bQZ`?RN+}{cfK}A#JZcG5_9ST-*HA94&I|I)aN=GIvXusFU7)w> zGaToMzLpH=fl$iomK5t}?eb4!OQer%RJ*ItPp({@osWrFUEBld_LgD}=fXF#o3yhY z3k7-|T;&A_BM2j{iui`HH}~ZI>*0VGV()cR@66}7fBK(SE63UF6-eL0#(%u6`}~X5 z%3oYimaJv7!Hybqs#@Vyr=oictA_Bvbu8vHc3tK@K-aEqi+HKHP=(hV~A0A?&JL*lq39 zHqY`zJ0#^Tp{AKvSsyZhM>wj{!{n{>tU9><+UV#b>q?+X2kM{|>nB{L!QJId^%_IX zx`ij`*t<%>HL}nU9JFHp5=5rWZyJK7+OJ=iD7wDeo2i;u?%C^lp(EW+RNA_c&j#-F z68;gy^lPHTO>eEwln^e#Vm3JR;-o==Ib`nScbu30iO$**J44QvV3cz?%FHzXZ)j6o4V%fyU*%KhB_H(iZMg~^AGgRMMn}F>I;A%8Y=q6 z>M0Tq%A={3;1DV_Ql351mmnGzr~XXdS}UE+2g?N#NY41@4pQ;u^7AQ1 zt;lF3${DpKK>L%M<5anyPZw^|HVJNRX@J*We$KHup(i3`S_{1ZH;sCVRgo<1kD zULq);U#DMR=0;%c*vvi+vih)0mm3EKOAdjJj;-qEm^GCCxPhoqrnc>-(?$_<-o4^A z&v@y1nt>2#z$BpksCgI)fryTNcmJ750~<I`d;u;Ijq_Q zcG=l;G#!hfY-IxJaxHJsd|}`fW5aZ~b6ejvOFvWt8l4?Ql;jJIO4U~9G42`~mcNlB zyB}oLrslHq*>bQOMdQm~su?9Ct+c5(3(EOzWBb1tT7E4pmnHrRga|r?Ji>)ro(oQ2 zz_JS~=xfk^3xvR}_!$T>m`FxJ2Ip}brW&-m=jGkt`!mn{Fl3R7#@0PGbl?{Gb zo1H_8Z;CZjunmqf#+x4ok~x$PgmKqnhk>D$oF(twp~2!D$@?TqlL#JPfy9vAB$ zrdKzUaw*4Qn%sJ_3egDszFdCpm2F7K|La$YDOk^hgLVW8tOoUVmFgF+K9O>az>!|b z6u^;7)1&74haAZ}_aBwddU19cWD~}Wvyz2|&=dW&BOp5S&M*>{C_%+7X|6GsOOrzM zn2^UEiuz%)s@$Mz-6y%OoJ8RZYrz5aA22-PCz#6L*PR8V6B2#`;ZNDNYb##^j+dC< zg<7ueG?&9_41QDOU%$K*wm?Mt^wV&gUMm#P4(JO)$`9VjH~SCy@>&+^Ts^=tcL)o< zV!iL3;?$~(!%!X`VPEF)LsLZ@JQfucKvw_a<9ZDvo)8H=#^#EDZ38i?af)~_UA8D6 zCR$H6*1;(fwRAo-zgHhz917B~p|~d((aeAT!V3r>%Is{A+4FZypW(&W0)ng>ad#Ub4Eqcq^w}7S@1iv*Z9p- zF5Q@5o*m?$hI!uKZDx zr7}HhBs%c5TOcWl_L=viQ7D^M5MiFlUV=!IgFK2lG40#*!=CdDmu0Xi;4SoaUw^n|ws#d;CWaJ0>j8fjXSs7U zEUG|XWJ|o;EtzP)9;3;E)nnmcF}?zbn$F|s5X!lXvq*j2cRW^&5p1BcoeDy0Vtxu~ zL9O`gE?9^krJ_xK@2Mv@#oyf&SbEV<_m}30zafcP>)U%Pee(n&zHJ>gv@wvix3P7g z)3dexX`H@ovj49Q!*6dcJ+A9#Fj>$k=nZ_(N#wFMR1lxC90@k3ZXZbR@py^UfPkeq z;tzr!(@_mbb7r-YHmLXE54}3Ejlm7#H;9w&N#TcT0A$<#q**J6bJeG&2LLk3vBa_~ zWHUQRn8x*eoTex~K`gjbQ(%wgcOku)0#kESmhq;eCi(k$^9`e=f{v0h-vl-~8g>br z8q3UX->(U>+JV(yFgR&%t|kle*>LfB&<5VdyOqFis=1*y#du|*cwWLo{;abx1DyBX z^xp;@DdR?)fiID1aFqbl`|{Qi*1AKYMG|aKj9$`%9^aPlW*0;h?PbD0U|cZpKPExC z633cEe)HYdugsnKj8PT$E}X|2L|)Oyb4l+VAGrcL+z?N?d13W)$xizxe+RueU7+=D z4t>31;3uter##r+OA5OQ`ZIWTUaf65+)Y%w04>p?BjEA7fsNtRaYWpxBOxg6+VBsF z9RVh%F0VA1&N@8#RW!`A)uJ{c^R3-It`5&Sv&Ux)sNVU|A8#_rwhLyFB)pMwpA7_7 zYHMQJc^Zy%(; zXLth}d!zs2__ufVZkHNb&qKREqL0v!a zAV^(vG9peQ@T};Y_gd+!CTEgj7ocv+Zgjd++$BdJ zY)T;~O$qkWnK8At>d?t)ZGnqlhR17G!V1tiNbFRSzPu|MVBzg7etDbJ{W0AG2BCRd zC;991h5q(7|91b2(}rXv{}JFHk39KX#h>?zw?X>v4nX<6;y)e(@%I&{-+XNU`cR19 zaem+U|0fa!^gkT~@O$Oow@Lq5nf+}Cy5A9g_qhIv5W?~Y!oT}pf3NzxN9)h32JF9g;V=DLzXSg67Wos@Dqyxih4s_>kCpQgGT5og)rnUWI?o1r2 z!&5i6s<2UsB6-Nc%v=H^eHHaV+g48T4Kb9w7Mm5uAz%!m$iz<%@mUOAyBu#_yZSLU za=9}ix;DZH(iP^qbBBQv0!L*J9s4&qLgQluy<{=yh(WywsMDL-J8A)oiwvL-jHkt> zbeIz^UC%l{Z!WD}SH_4xzT*ahd&ZE7-`Rr3w37r_vG41Fksn}O4$p5_*U|I}%Lu}I zHw|;!`zwzpnP+kiS7{U~Eo%A|Al*V4mO34&xRWT*HF7TG2$I#Nnc_c0yy8y7Wd^g~ z6%_Js1Pci`Y!V-g~emvvfUzm{cXwFe&>#7qnohJ)=;%z~XF{Gi)t(piYg zGFAst76#4-(JDqm?RM~M3AV6W;f!>kcsc5FD7&1r7{ORnfER-q)+aO%KTH{|z)$!B zjmJ+!*&_&*6MG2JVZu=*)QuBn!WhJ_i=$&A8l=KS^)m6kjh-xVpJ3o%HB=H{;#m*dgB`^|&P(8ye64b#)Ibh&_y>D1N*@dzp5hYQOKq`9e_cVTnd9JcvXr zh9^c|o}e_zE1zG<_%<$?L4u)Tqz$*X=$njLjgEU^ieU=OkI7Ykurli6J5yC;_{I4Z z3d@CPQ8Kxv<$mY)p$V34O_{&nr4^x2s;$q_l%ai((_Xd=sZF1+BZov z*){o~OzYmUI^W>nkk~Nmd%Db4W+8U5*3w%-f_IMdB^ZBm`$8btIYl0{d+_i zI71FYABI#i&NH(0^$nu*k6txYj+7@>w!Lzw5UG&SeO5kK&Q@tqxnMBxD!*c&f>Dog z3VHX@-KTel?s~ZP=H1Q{$QuxjZ{RomVJcPaQZ3+K*HjqL7VzXKhR}RKf&IZt^R=>? zbdT~KxdoYp@sR$I{gAsMM8B1OE&Qtg-Tupx*6CI)!4Sa?jV^v6ejrW2tuDby;Y48x z55Msomo4XxPb~u{PZBC{mY&bq&FH@uo^R;&8+qjL!`;v-V1dro!?Ww-MaO9<9$Aup zQaxq2smp_Y6A{y~Dm`@*1=JTxSJ;HlK=9L%Y?DgCarwl)2**K1jKeiQs5EqmDE{-pjD264LB`)Kw>-A0IuK1`Vt)!>_ zPC!pfOFNw(wQr`keY;4@SbJ`pd*G%&d;587cB|~~iM{1ezu?{?kD_=f#%d#r@dryg zm>p)Fgu&8BhQBqBu6nRHSGM(b4o8fZ0`onK8K*t#EuSqt?e2^$z3u}wA{&rJh#qt; zIu2b1k1u&zvTwDpyxr3*&#GV}FCp(;iYjd^#iOMYrCa2uaG=Yg6=~D)xBbyio6jox z&aW=NIS^(L?w%=GOv;ND~%3`z_>$QYOST0oA|qeIn~O+r-K_DmE}*% zscR^Xi33GG-)>_K;fBn4;Yuu3!Ah&%D$*$Hu*no63l0Sf;-v?c`hArP{(#>2#2`R@!8v>}|3Cr7xdo zi9>+1LP}mLJ;1JG>RH1|`Q!%-71=DM?Bt9u+0FW@Mq8D}68+*LVe>~pzGWKr5v%cJ z0_-~m;zo@ImHOEQZ;Lc!PpfX%zSwz7zsk_9_XGafZArOn@q!H$z-QrEl}?H}rQ97D%)3tg`)PR|n!U0f|_r<%&# zyQJH~J6N9EmVd0Se>q%N`5U{C@#olZF<&=4q;!vY-)8Jxrn*TsW!sasHC|snts}Rc z;2^e>p#_WLMO5XE(Q8ZJwt%wnn%znN%FQ)Tb-uoU?le%W)- zXP(NRdcc4u%^S>o`TUIicd=>z{eC_TF^ylczeCTw(xp$otz{I;YOYE>lj6$F%J;|- z$Pt&_6qY;*>pQHVQsc{7^NA$6D*IOUd3ZOn@v<>eCMe=3#r5>iW|SzY=g&o&&TW%D zi=euk+Ln%tW6f{om!b8?;fzr-8hnmnZ^OASpI=pM)}ODbaN%%qsd39}CQ%@mz$!}M zy*5J7J=iyTEE3B`>(Tnl9q*Fv*1~JFYu8Sa2B^Fq6K+KXVtA+`o)RP2YsdQ9R5|hi zh?eGxx|@q_Xu_(RDmT^mNgx-OryU6G58g}YuB!`kvtK3q#;9`)Ue~lZOswo>COnJT z;Uv)PyvWu%Cm=ZNMZ332(*am9%idVc;r@LPCvXh|VS-6P7{C=6_yd7yK$!nrgFyGd zwEwx*1#|q{20)zg&LHT&ZA^jRn@<|>1$zJci;*4&0>CJU6!^xJK>oJIfRteTy#|H> zK5}{rYHGl*o~@6)y@#)pr(gPb(IjvK$4k}37X+eYyZM6EbXoTRpzG_bZ|rA$Uqiyy z)1BAa&eO)8H^|-VW*m@IkOXk)ZtrIe4{~?&@RbOXX8xyz1aN(Gn~xd(PZK{^X=da5 z+HeI=AA9&+USVE-W*J;K94_T!=OCf0sQhnt;9t_rPJVt~5`27tfq}e%LcE?nj(h^* z;^KV#f_#F4JU|N`-(U|v>mVKvUzR_E{2fQp-q+U0*~`z_(*u4puC8Qd@st2GFO0I4a;=?8(gIvtd>y6@ z*=2kDRQ29dH(LLtPom$H<|PlUBi6zSb8{ZHhFex9(^V_(c2?R16J^)Ws1-2dDpDlb z888XGA43DfWg2_6Na$oU+$UWaQ*k2H!T$4 zTy+1v9VIM-vg%;33G?HVti`4;y5afU({s*QV-2wOp8pdacaWX86${;fGoaAx9quwLMQt&M`X9)1zB;2o~;II zhaqv3or~2C$z8|MQZtpVU@FFbOl<~JQ0;7WB_;eel39OWwh|$1GYfaBf{ZmZ#t@zn+o;|JOP`Er-0x^Ka{F`R@Y&fJ zU2xJzW1eHh6M=83f{~Akr9&MQ6cju(D(p_jvn6Fc&QC>~?T0D9bOhJCe{Oj1FPo5P zH{Wl6_j0vRVbJdjztI2Bp&@Qb^<%N66*45$kGQ~UFi(3cnabzlV z-RxRLEyo2KHY)<&9tPh>*91?tQrts)h6AL+oG|!Q3ROK0iVp;uBMJuT<6{a3cA-h} z2I3V7OUgSwg5n#$n4vLfADG?lV&`TTy0h*bpB!ga1f^Xo*-Bj`%?~-wv}``hrqJUw ztsF~YL{A9mOL!eb-VJx+9lNSf8+Rb=#g?eoNrw>0gvjBNwmurN#6~ zYGAiF7H>!TnC1pL6mIC>?aw z=`Gc2m_!8;5)um7oZ*oS+$s3*`KM$03fsGb&edafp8hXQ?!Ip`4Z*uIZ5Jl{XE9_% zwzjqbmuLRR;R;ED$M5zMBlrm2>OUE}p(j70*;pN40RV zEb40sdad*murq=+-e!kvC*{?7;cFF1IqNI7jP9%7TS?`2Gea$D?~p}uorJFxPqQYovoml|t*#jRsF^-MCTR;~V}h*$;M^nCYNQjNY&Xo$dBT_b z_(QcTG1p?U)a`LQBYoyy1-^d3|7$*qRIi8`Ukul-Z2H#5mHe_a$)N7sn!G%k%{jT= zK%ez8UHG&^%0lMq;prULwaNUa-?pl3Z-;3DTWQX<=32CKH9p@G8Oob-PstzG&zf4x zh)liOO{?>fRI84_?<`PDPp!)st_A7;gmi2WX2junX}vBx-fkXov_#$VYp`%5MR7)a z>?aPoK4B13A2qLYAn**wp2lDzj)YPcrj-S~jpP>(EtsOV<9ndHy7EzFZr$dw9ren! z(UAkrMg7?imX+X`Y^`x;se#naAFQFDuPr8w9-0v#79 z3v&F-!vBR~WYn0V;y#z-wMS-BxA7{WZX^qAX{Z)U?2?hs>!BjTck`CQV)3x_R^Z^~YM&i!uHws= znB&FKP&7RZyupNH#hBd+!YDGI5E3HLL9Y^;{RrEpgt#XnA0qMzJKj=4ZeR%NND1lU z<7?1*y7*g>GpAT7WJ2IMcBge_B~{hI7x7Aq?nimx!CU%ZoI&||m9Op)&*Ys9MMK(lG27NMs(Mqb|Q1|F=}`m3OiADo@-#O^UlSyiAc?5IMldiH8_Ss*82;_AKWcrFUC z20jQgWLxqm-RzGld?p6}Jm*z%>D>A{w(7XFnHs)ytp6=ZmFVn%8WMF4R!56hnzjCz zjBVQp=iDuLzb0R{BzpAtiy!t=HjsMA8l^g;jNRPF?&hgw2d?nz$Orr~DbX%#2SG(I zZ$o1cdcex^dY=~l2NotFKPEpYfn&o#aU+On$JDBj{48W~wa;ZDrdAFEdGYGR9aBhN z>#vg_5NSeae)YzpXtvFSxXWa!_DC6L;!SE!BS<&|JiOZQyMok zYx+9-(rWuV(F^vfvx`!Lh^zc0obttZuJKupjKCHQ0frKje#Rp_RwN~8jWp)Y)vuJo zESZSOy5ex#IWkM*SDs|tV7|VT-fa#kkL|N+E*#Wz0P&|yJgOu>g(j+p;b0h{gF}hhTO9apD*5y8M&Tlk`rlp&wz|{dh83{y%s+JsDx>T{-A7 z;jgdkwNU)HMA_(6uCl#wp}BPNjP!f34pBe}b_q&(|AE{phwV&-d46qz^Dq>nM`hAdrsCV(uw}?kLPHqtnvLNu_>S)M0cc-JM z4HyBEIsYtpE?fKSs8fupORa)xP?2w`A#iYI=24UR2nZqL zo2^fgO}}(nAlu?j6^p3G&CM@EFIHj^QGl(gPFUR||7)wB@<=H9G4h>gj>ejr$6Eea zMBf@KC{vIdtVj8%qjsp#67VnVmGd1A)A7d&MLo!6d<#{mJmta9r&7gAsMhX!+Spz! z?#mC4CrG^xxZYyW)#(Syj*WLnsO$n;6yyjf_#(ALA;;ehD}o6Zo~(^Y`0Qz>8+<(w zl1=KhIIa#m3T?r-beVP)<<6mLCf~#m;{w%;gib#JEjAl6qNia3_fwbKUGm=Pzo>bnvXL0LDsxv>K9mKkCV^Lu}_ zO^Uc&Z=@p4H+X;&U;51u&vR_)a~2y2uj!u8pc?}#JUU529W6-pLQ+Qn`3|I5+TJ(G z7-p5rcZF<0l4Xg9k)NMsiR-lAjLmg3Hm;hv%HOdyh=b09uO)hN=Hl;N2m>on?j1pN zU)fN!U>GpY<2arMi@8Fp>~Ii-AM{nmbffdRJ0tnbP+hfKj!VWaYclHYi#mY{ofN=6 z1Nkh8F`u2k`QLpeQAD?IcF#20%Q}grvx4r(S8DB;oHjF7pK*Ny*O*}m+zN#DB1^Xme$oaZdc)6KVmMs@|GMy$akh{k>s(a=K!r1)*_;rh&xNA$$+> zfB&+XiNu?XVwPTi|M4N-N$=#BfYJcaWVA><^PccO3PlGf)ZKV}s=pqZI2=m3wz)vt zz540?*|@wl48LZ+-D6cKQXw44#X$~CwbfbubgE=zM@^|HvD>qQwHj2#F+yJ2+EI42 z?Y$vaZ+S(s4;nz=Hsw=DC_$tgOz}_z@(4w%XylCh-*jFP4F0+Ly5ih}-6C(a|5IWN z<_cf+**XI^co5g`D^*A2BlNNW^!!^CE2M+d=y!4q+8(Qy)=cuQm{SvGY_E)*Ly2B3 zl*N|gZNqHPjw#u$BkLfS9Ai(ri z`zb1AB5>8wRb>Za0}sG?@9{{NU7&Ve#B~^DvL_Rmn2s{y?i&g!IxJRXu&8!KeLdj( zf!sCkoF=cSfsS=8kcg3#4#(!?01+sl)|P#oDhs~U0| zB4d^klfx{~B3J4NB43-_?L38_VY&V_0Kr+*J?G}OG`4SC2nN8>%pz+2x&Erw2e}fR zLzVHLfhbtZ2;vhjoa2POa>QG{J?c>H7Pa#0EXa`yj208JFZVnk39a~oV4%KnyZ8xy4HAf%2lqy`B!yP!t( zWcQ6A9zh(G;gn$4nH=he;GP!ESM48lzck66E~N$``FMPBvyk_{$Oo1Tp}Z zC<5#Ew~H6atR=lUAbq?Y2+nM0UmZT~)!FzUsUK9Xr~T_~eW#FD0l>%;G{7F4Mz`;9 z{_D?6>|xs3mQ!mBv>f|YB>WO?)9pr&snR6H$o@(#1WoF7(NKmZ62Bowr8P+lO#Uenz^UZQa^Ziu$yzy>cIsN) ztTv3hJTA7Evzdha;@e{bk7ug0$?XrZbBJ7_Vi0Y~$|9&&b|r~63&sMbI-~d_h;{LU zqa<15kX>tHj5Lrb?G#`E59xr|{+O23U-e%tMV~R(szOiVgf3T^At)8@oFeF*@?Kp2 zL^0GpzcdF%boL49^qI0epr6aW&#~_lFbhp+lH=NzEkCg|{?SKP3w1NGl=JfkCccOV z*z<9e7CYX*d+?A7GIi-pYHaodmVtm;;P>=l?^eubr!h1jgFyXIQ5J9qmMb(Pjhch# z2?P>t4j7iDNuE;g5uJQ(tsn-;?Ym6G_JG8nN=f|8{|kQaDkI5G7po&5lK_P0$XMKv zH2DSj`<}X7lovQ1(*f%zA{n{;rSxRCaZBwjhLtxfatA>>H|Ww*4x|!$hBuTVg_(r$ zUnA`xG5)pgOdc(Coind>id^m=Z`~HeuvSt>XkpKz&bSZfvL9lfJS#h95tQ<;4|-nOSiSNkh4E(IjtwB} zrL+lsywq-W^!<_{IUly&7?87Sg^386_*EpGB@;GSR~(VNyv#>JF7@z|#|!(wc2zf@ z_tWX8=N||G;Q~s5WWe~N+r$tCFe%Dy2J*Z|!}Qs=B^=UP0-4KDT=C7gZx=&K>jaY_ zbs)jCpWBU7i{VUQKp?-G%xm%8a5jlMz6x$02@E9NB{n9$5Adoe1D4tt*mF{mb2;)3 zjfhScJHL{DBQFsovksFZFOwnIy3kgksZ-2dMRHQa9CD|;borAvW*Jp(I93{X-PmaH z$j`3O9$9ncIW4xiXi_`%0$h)ZXaV~_;FopnsgL*c&ux?yLwx?o&b#@TX|c!TE@}D4 zDrt{4n|7A8-?(*_>?CQd!&z_l(>4A{%#xMi#yK~%XjW(VXw!U`&CA;i53J#?zVwBL zN{)uozFi;aBa_bE$L!rgWn5L%paML%dmtQUpkys1A}@%Jl?R)iq7- z%K6#W*04}Hi>W;xUmlKGE%%hg)0tNJWI4N(fnKEmoT3`$^$ zmHcI&n0?E>6BFrk!lo%${`!wT)q2CAtdP`Qu#4Ns`-6|4oH5I}ePK%O5|4KTmhV%R zxQ$1_PH08Czx40g4_I%&2DS2V-|U-D(#ImENCq`EG-eAW1Ks@mrs@VWmLHfUfX=l@ z(QL^jw@C{gG<%4jcDR}TbtT48ph(dZ+MHoiim}5f@5-R}R@)i2T_N^C?-M@EdP#^| ztdsXeyq?NB&-qq{!m!0Q%*Y%WWHaauH|(0ew_uz-UU1Rk^R} cD8@xQIdH?<# z!18XN{oXXJ&@X_{2O8ytF!Kuve&dEb$@!`S#Kb?9A#yMWI!8JxDhcx%gR{>`$V(`9 zpbj)z2mM{wBzeIPd9D9*1J>s()pq4)quhbv)1v0R^`Kf_qqT+n>!xgizC2zFe|C%T z5&fK28tGm8*t`qxjrOxUP}2k?3#0*SzB`i9TjbZNx+V(~2Xnb|M1+iY9h+kY>p#T; zcnD1Uah#^RRuV;=znbYYBA6WcsOy5=duS`&#?Pd~zWMQAO(9F=HMh$E( z+m1_17T>Y6H+wVF{aHuuEX}I=NB;WTAB%9Sn5|ock8di0wStf&%y&VzaO4W2V~i*b zivRO^dWb%A>xcq1L$tv%Caj0d82WT_{cI91GKW3~Q+6u1F&YkT#}nVO4MPm2efKrk z2WLEf)2)A2Ofl>g%{ljbj?{+b!Yovu)uNTr4}%ktX7Vfl;$7;}kmH6P;L9z_a7Zct zs2Ln!EJ&g2p<{4;&O9BLOVw>({EhpOOH0;~4C{5B<-zDzJzFm;DLXVAE8y+@qW*0% z=83mSFnX5P4NOQ~vJ-j}pT?|^r{{6}QUj2Kw;aHq@v@Xf{8L>7GBr!*J@X+f7}OalrA3?cbB} zNH!!$2eY$;x80x!V+sI8R7R;`|7GU@w59JZ{zVq1j{XD(b#L-nZ8UVoR{18BGVgMO z?>6V06~zsC2g%%fZbE`9JM^-Y98u06+L-(4rF``b5p)g*>ZUTbJZgVjFgy-ci#B2x z_Up%>i)C9rhJ!7S{FlQQ+xQ7Ii-Raho;`?s#xU;Ad2IG^H?q!5`2sPEm1h1j-k;1u zvN8Z^2#A#Rrm*^!=neEwa)A6b-NB$*f< zLLIU1JOE{Idzx=^z031F5aK9(d!xPn6TwIH)S6S%}Xh4RFE94=6^0*l(+fwe+O zlGpEZKn!0~nDK6M_>yfPw{vP|%0~ZD2x4q#4z&{>H~3m+);dzr0nWKQg8!D$BONrh zs2AzU3Z8d(!6M=X3Kg@gW4!%iONAWw+`G39CNN)}VmZZ%kH#xiwx8rUwUo7Cj9 zZ2?=^pV0mm3O>6$mi$!ss4$9cIdBl)udUf?VYWE>$C!TcBRr=WCmgF40lihU0Zc}; z(JE40dchDo8@^7Q8i6sm2-nG{Zg^j*?O6^h1)_gkT$wM;l z?vB-d*JZ{~U!I5~R+R!ooxo^=^Dlj(qk`<|DA-?mw7l>{x&cC-cDn&2uZ{f1@M$kF^GF6%&o!{bGq*VdWrt+2$l`GEO2Cwbp;1!H6@Dib zF#jE3{%^yf(~*Cm)x*0G{h=PP8~bFm;N5jmRz~s1g zBqqNg%gXn{&Qq%8=fO#?-ZxEREqVVYc@3zW!hkad01Pd7lfnA0=CDA;60}IYN?2^K zZEMMD5cC0bc2-_?S@atp#wImKEv;-&|pn$=;QIn*5*e#GkbjSnLhTK;| zC>EluBiCl98YE>ycPghsd`m;LB=V^;dafdUAtqG2{;=bM73?SO!iq7xFkbxfhU9sF zQ*IBo6v14u}i((nP@PZvl@m;ZzKZIB3n zTfs_eKO`5#DBKy9B=sWAMM-FjBJW-K+=a|@N4Vn_Q=kS)_GC>tT8)w2eWYH#HQyl7 zMi}6Qgx;o;{#`HE$0#;0Cj}TQ4d7!GiC)M2!3roqG9}C7A$3PDQJT+T+YRmyvDZQ3 zB?L&h&WZhekyl$I`1-xx0Nv6iJUW7?KjNCvAd+Y`<41g~>|_WU=?mJl_vjumXt>$a z78c;R#W9Kg^}imm4yKJ-(}?7AxM+T=eXAN2xi$VJyOTbkfou0{6lvv%gEm~DlWrD| z*1`;@xeKv~f|{v>Ocb+IZeepDuMN+}Pd(kaR~fp0yyqI3#lmC*VIZuIMLf9iyOe$0 zOn=@|LIF#I0>>oe?67QHv>mX{AOO25L~TTc#0{gM5&OLx@~+^Eb;v|UrGWNZ60MS7 z*NG*|*Ye3o^@rF&4cc#wMJM1S)BJ9BK&CexpfJFI9f;6@ zIroD*_!+E3abv^hvYU6YB(_#|q$Xp36yOne2CG6;v3{z7BsbMS$Ekq+C+W_O)yaT3 zF|VV3E0E(pKqq+G;w<~m1&#Kfdv~jXbO7(U9Si7aXmay&fF!%A?GPY99@oI}la}jR zWdxO36m9@MYYF4qk}bVx`NJ0n=C3n+^VbApIj%ptuOFF_3|)6zhKKb;M6)fkL1L2{ zeU}W#7oVtyuXMKFWQ`LtfEhQ88>{R7F=Jy#Xt`Ov>a4?CjIfwrC6;K?z0l{_m$h7u z`G?xOrOu(u6IEP(Y&N#IA3oT;v#?^qIbjD*oX9~KfRqqT~11pQT< z?)=LLqzdF409NX)feR6v$IMh>Hj2frhBjLS&iDg6>cj^4&uT?Wpq}=RRNlhTK_FmP zJ478V`zRiwdKl59X<8pwB7@bD`K1GRI1n5(@i#C-iNs#&Anscl@bOyZQB_M5Yl(^d z*NNN9ZLg>R0epr6S}#KFl<;pAVlxR1w!=EZ-H_{6NJjD@pd!zd5rje)nV;Q4h15Z6 zARaJvM-ZtOWep;dzOcTso~=Dr-dbpPm!Lt>%K_iVBs%D@ZKf*HpK1UQO-KR`uu zKK|nmtS(7lLgzUIy`;66_pY;3pnhm(Z2)ivuX$^E!rKL2!s@xXb}GwogvcOkorOVk6p`1XFp$)=CZSuUl#w@W7eWz{OwxU!l$<8CfPI@ zxhPHR4V7e&DY$&OyFwY1fR@6IT~Kl;5z@Z8PNV^g5)i_whCpg% zn$3s={O$wtnE?UvxeL1QNe7Uf z922_GU>c=f1n4Rjy}VfqeS`#0&^{cfF|sW-dxYpCFzcp0at0_&lpWxJ(zf<9{r&`% zJqDPz_|a*I6VCd(;Q)Qyt6Ou(E;*Npr5>7EqRgmsYkFk-xQ&(93QtAYM^f~rcT;4! zv9kYi9Siso&WZaApqP54ne6!b`iP6P#1yib+Oz{uUD1Hq`t{3814!b=Y#%ZqrsrEv zt?sL%ujKn>6twp&wRujUoS3^&T-xk|C@xYg_dHzx`YfQj_~9L1%dAEjjUjGPj&Ej^ zCzHYYTM0}|(M`N#@k&Hr{OdtPANFS;X2IXwK$HL{wwyl(*1-p{uwI1n$fVv0H^jZ7 z{0+`w@B?s`-(l%%*(Bs$*PSp1j6{A6(!E=T$WZMIa|gIFgn@}8=Y~h>(0IL|CkJ^g z_mo~9zHu{fcnsSO0SU~%<1R##JuYI5yp$Eh=;u&HbVvSLaKgSg3hFlIFz+~494Sr; zO3q)aS4Oi|fyRND&c|^*g6~Ibw+zOO70|SLMq5p0MnfA~x8Lc!6?;>tm{kRwg9xen zg8IMF3k9OE8T)n&1f}OfYc7~>@w5}~i#oRZ@^}@dzUESwziFio?C>)07etL9j!RFj z#oE(g6Vq z8`nbLz{bLEAaz+lG8oJxPQBoQAbea0pzPG9mGvsX{e_bT!P%1S;TVq-xkJpP54$G_ z!Gu$;gUUM^r)Zz*^>9aiZ;J&alMF~nnE9#uAK&Su2bEtH^YT3%EW&sfM4T9DblY88 zm0;+bbpvUTD=5>k=xe@YJ`^OGqnvRU;xV4NrD6<@P<&I1S5Cr@!-c>j0C!cYpKS-E zLzfAt?%wz#Y{1@*s9n|mC1tsohz~%4F-8Y?+E<6#`5T+#E~vi88j3 zF*Ghh9i93_$r!@PYutj#1RlO;wsdVzG>Hw!DjrBFGd_i2W)rfD&n$hSz$(bQ zOJE*Gi-VvM6r@DAVw@8FoKZybr*UvE>tkUq74ftNA&aeXS`y{0S7-|u8fro-L(~(v zj5%!S^6Mu{R$eRfrs$TB%UiA7Fz!Jk{wg<;LAa5W^sbUCw+um@uVPqZV2D`!A^Ya3 z$|ss~0pCj^b|=3c3V_Kn6A7|8kGcULvLW{x1(Gs_@qpFGA1)elINk!$cP>`Xvm6y> zQTkM`4t^dons_M>8J%i@?8&#ZbF`ZKsnb%c$Rhv*RVTyKf3%ke&xT(t=z`|J*@a&n)6 zmrtw!jlj>gHcqJN&4CQ{ua;l(*$s3wZGQ+nc`rN~+SvqaI&z7)`1z@N`|-|I6KpD# zeu=#__)dpl{y+-vNINCv3m#EvmyL=DV=Q_9)BE>)?e@InzhbhYDSuS?Y^EF3Sk(T! zYzNMTKFiNBdf~8<@}TR}MUIC;eaqM_NOZ+Tr0f_Cm@U7D{O+3}o%R&t&7l$z$XTJL zzz-(6yD6Sj7H74;o{iI*t!#CY43%C-PdG``9?{(v8D9xie~kx21**Vlr!6fe&M zyPuD_VM6HIT^bXY8WS@G^s+OQ?Gq2Qd55yUJ5HrCtv(+q)4g-2Z&t*|YyQGFFT;^S zf+fm+v}sMKsh!0Y)9%9@J_dT{jpK~}T4I@lO7-NzVSnzSsx;I>l$|7}xN#_XsmkX( z53^4p=QCeip4}*OZC-?sSP(c-b_G^$wJSIDVU$BA>sj69ZIL&5v{m~8@j6tcL>1cg z>%~MCJ5cbf(cqk)meoQ|P(qMuAE_c7t4iNNa_^BxpS&)DbXjdIJ-U(UAM$~YWSPiN zH=-d+^^-C!oh)Yx9v+^Etn9AC#GQzOf$8y@v9U3lZ03j(X(rWg6FyZOjH}N(B9z6) zY;)dvyWD=l$aS^7zniv_lc6m7SdOE9>1o=`_55dd6OKXi*arHLkdJ4Px8CRnW>eG) z2=Vfff=4cFJ6^Foqtwt8+eDN%pJNy@C~@ZNU*+@2%ua7WSu> zTB_)!uZAj7bF8hemv;v3_r}G?F9ZYz9=o!?(@~ayO_6QF;AI^+J3Jad5x(@Y zFY)r%>}t3e$tmN1GO{K2*sz6?qSutKGfv%|%2}ow=E~Bgpr;Qvnp||f=X)7Fz?F{W z4}KDUTD2XUKI-0vuhjT~6mby6%V!FeASSP6FRm{>OdxV* z1L+5k@inxxzD!MJ=+%~U9|mv#{AtQ6K`xRaIK%arPPQ#m+b|uJ&e*SXLaA~Zw)CXK zgH9pk%jNlTp@G%rOm)iqs!yv@V5zY+s=FIEqYwNY_L%~RjahE$ynd2q`W<`oFRU*1 zzUXA64#9sPYu|BuO5;P7aZTRkx>wfL!N0@Yh__!LQCe{lcxbj`@s)H3`LHucaW-`5 zaph+5b(Mz^>(UH?QUi`N>j%A;pXpKDJYfAQLI$Z@OSzRI^h%tGewZ{gG(OPf_fOdS zV-r<$X()KwhP;@Z7rMgR!!Py+nrsIMUtSED%e@H8KpjYj9*xwPxBuu*o1t$EVnPTG zbgP(R9Bs|n0%v^9SgU0`;F_c#I?HfZTV6_eKKQ}zcD-)P^+?K(SzGSAqQrvD(=*XQ znYOYQqq-(lMz;##9@rKI6w8fT3ry;~yD_dLs=|fs+rsTRHwxK7;>yy;$T0s5yIN{#mhIeRr81&&4Qbm%1 zW393a?SbR{0|SNgIMn@3#C@{ybe}M=31=g()*>b3Yn?yd7VQs9v7I*N$6pf2tq>R{ zl5Ii>Ej`#MK4yY+S;AQ|Yd9AtmG@lw>1j!vA5HFMA|LyXNGuCN_+H#jJ`kQ8HJ{&I zh+h}^PIWe=y>5EAd+~WUb)-#4Mr<5AqtXKF(Vg&E$j}d;c-~7X!8+l9=N2M_pj)rb zA3WN!62>iYXPPjD7Pw9{xqm6JQ38&%zdcd;9yw+DMS3Az9NIyu_O6(ht=V%az*d>@ zkTr##!oic|Wc^v{)<-Q_b7n_6`yaP_N~6StgjVKJ>j!V$+d|)IdYkQ7yFa^pG;ZyN zoq26LkTQqDz<$Il&l>uMR*N%QJ1qK5Hl@@?-OvKp#2YL2@;eqI&Ua%SfA5D;_moZ7 zGP^@F_yT(Lcz?WIdc>^~-H0|m>+d$8s^ISH&HFj@z~!R@R0HlNfsIW=8pTmpym~eB zGt-`qtRu|2XHfmEvK6^{Be!oMeH`{D-Oli|X7&zUdL84PNuDLkC!?2Gd&iz9xz=&` z_!RnS(F^d<;qywu8yt+>eWy+Rb*nBcokc`~%P)SV|Hr`V2zr&WAWR*q)#vH&Zh>W9 zvSR(_NfA63uv@xZDqb?;%U>M82B$EZAD$HWY1*xj?&AR`dUGhv0AHJQ_;HbrGH|}6c)Wi*uzR?_cw>NfOwdir zdffR?=Mmw2C{#5qf@%794)5^mJ=k9GzR4=KRpS*gk$I8leE-5&e zNhBC|9Gn(ariaZnyd_h%+yMJUV0t!zoh5TrVV_bQrvy@jj}~ikaPe}QdHaI&6Z ze?(XJ>&Lb>r?kS1v5^$5pLfxD~3`>;Q(!yr~NZ7ZP6E($Is68u?tNk7e1jNmcjb@qfd1` zJ`cfphJQbHd1gd^C-=bxUd9jdL8M-qq-)n;Gj*(G)u|(KjlZ8M9^=$vqj&9S2H;3Xn0hV z?9R~VHEHp4dTyXDL0N_IS-NsWLLE`q^ zUqQJx<+5Uk=#HyT$oGIZORNyHZ?o5f;8%o=WIz(OE&Ms%;AU}Y{7{i-Xu;0t9Ag^& zy4Gc3Q+?VS-Zaq9I5w=_gZodEm5Nbs-E39wilfkLbRrwd!VmEk8d$}Kk&-sKNiE|x zXOkM%x9ONz1t{(<0L0I-JCFbbJ$UQa@h3}dzz6@VC}@1iX2tarBW&_MX!oYhvz(A%a z3VNRUhpmLuz~Gd(a#6ZXRCggc3>iC!VkU-VE5|X3lEJ4}*(~6K_pjN(Thf`4D$uW$85lV4>BdHTIhtO&sTXv8zX?c`xo6m zd}R!Rn|M8X_u8Ts)$R6E@!hiKc{!Kk7b_gA-a$c!7V-D@r<*Ji)Z-BUl|Z( z6Slj%EU-(nba#UwAt1Fhh=dY?q|%Lq2og&PN`rtXv8V`0HzKhh4bn(RERA$`oQL;2 zKfZH*?w^@wX6~4|uKT{0pk(gGA;-p^dv%M2g7El2h1`eiJ5c2M0o;KnWnTA4Jq}mN zeMpnk=!#Fr1ESZgzXPm9LliiEO=k1%|L9f?5QOM@tKE|b0HIj9u_qE*pi10wJ>v)o zNa~|$O-TOuuzA!TNV)x8W~SLKkF?e5-R<_9ZJG0_f?4P*M)OESDZUJ15GsNI^8_rA zdsvs;f_66KgJQrd^OnvfSGN)vJ_{I3FK;G#*~*kZa*TGM4Llnev`s%w_IIsR^GQtw z)f4;C+PQO1DeX!ODMLPJ_PVxkc$5-k}5`+Ruh` zZr`!MPYFmB#HF?9hHn)Av_f(R5~h1hDH!P(bbc|yl%LLpDX4sv^IRbwrz4U1@EV|q zL%6UkWzgwxDlA(MTW#?|vjcg)GA2x|5cLuGT-RHS=r2(<^gn2~4IjMzr3k(&0Rx$b zT%%&-KRv^>D!Bo@bAf*ruY|q|yoXbP!OkZlL~*pm#0CY6K&n595h8J<>jv0UR7I-X z5th8H2H#pJWUM+I3AhA#)cC7{TEMtqA#Lo)%=azza$Q?LsQxMHhCwf1pnu7$+o4Gl z>7vg0g+Lj-s~m<-YjE`IXlhxQXTyQ_JL zx~o@B4$V5k6PBH1l(L2u_Ao>i9uD@*b*6y}#2S8-wm}5(By`$PS8lE4xeX!G+euGv zLkJliG=J0=8MYHCjRiqM6m~+m0BVWFy0J9D>p>GKfkl%V^21i-9_UvYG(*`H#qx*) z+h;Rm0x@)qBdYe)gZ!&$7}0$m9sc!_wAee-yCtHpBa#wksJ|O)?{KUBDYKRT zrM*SPnFHS5x!s}(2k7NjF@ZC;j-s1?vl)RiX}+9TW8Yca%L?6PTS4%4K!aXvX8YY= zWsqsbSQHDl9tY?yn3TqW?v)|0%a`To!z)=ycDRR@vO5#0hcGdV!!0EH|MVJ!z}S%z z$w60rM2AAp!A+_!(ZXf3;eANQ(_E24(vdL#%&}-de}G_!34oi8c{k6L=;%VIH*Xj| zRThe={v>?D`U+Z591aRO)LMMeFQ=h`CZ~2K4B@f*3C{`pFvl^g=1k}`> z#Sp@--O6y>6mexn6A9rUN&~#hJK1!+qtAc?o>Xej#lM25f;wh`cZINQ=}}i`;8ul70HEP(G&w&{txJnF$4xA8d8dX zL!36;34C`O3vd>v@j0CTQzT0buHP@yn4ku#^VMQO)bI zQ%edjR*34)`=&4Xl>JJkoXA;?B{1tDU#xIrKeU zK6#C#`|Dw#2;tHs3wl~TS9(jjz6CBgtV6#9=Knj2Vnx&)MZk`v7eKTWyNuh^^;vf{VzJ%{TA_l$ZzZxqBL2zKx_JYL5z5pdHQTdM-b>V~%FeYxaZdFgTBxG=h7 zsGBuFgx2Rps0m<%pm;Zgsh~T;R=Bi$lKN|#EqS2-s|8>s`MBr9T=cF`QV5<&7v{DS z#o@Nve#)titLVRtx*|g(bhEDk8s~xuhLOBtdWlE{A;Lfx1viyy$VxRTabi_UJe*HL zPqyX*x`RUZZ!E13UJ~N|V*aHbRgE(`ivwtL=t8FJNpyh?JC}3&q7R%#6e$q?_UHtT z4E~F*e9(Ng`iz^w1(`Azpa$^?o2z9QG$67M$pRGp&MN&O2l*e=Z6c*2A2hoM=*}d! zw>iLR!vqGy&MGo}(?h7qXdA4)u;O{~Q*W}p9`IqJb7)B70UzOvzKXfU{52?n+1}FY zz&ZYlBvMcfXg=1yY+Kc8w;(Iy3RksN2SasRc3E%5&TGArPH`5*UT@L4boP+6=M`u> zJ3?k~EFBk$D?Bl01+S9>zRLrbe;-*bfkeBpzN#MgSmqs#AEcjtd`nQV4g*0^#sAf) z^nXE7oE(Opl!1V>gM`;{7?rF<7Qxpj40fgr;-VM>Iy@gF*!|c__x;l?x!H%&8im!7 z(y#)IB3K2>P7o2BYJ&$Of7<(G={dVVAqz#`&0+*~$kd0TWhNgXVEoU~w{%aZn%sYO zp@IOfCm0OTk(QB`Ab%42T~NRVq4PEpLLf-3p>_GvG78EZAkG)^BeRN~}&W zsb%KO&sqbl1QF#(TK&)?T0wcQaJk1DHkar#joS-E@H5E0kXS&FgMKl`! zxbYhJ{#f_oUVw2XlLO}XEXlo|_}};6hk1PaAT8(Izc}lh{UDg6m)eHlb2Mq?wMS~R z$;aUJRJRr_xZpE_rkj%l=EDvbawC-A1^f>xjq4AIah#G0ew@moO(M~#<|2Ony?&qU zwf~6L+ZfOiCNT704A_YUsu5v?FKs|i3jeKp6F>Lhvp@Y&7&C5n&b6akOMypyfLLrN zFbjEiOiG4oW)~wX1}R(N^HQK|$YFw#8tfp3kfv=mD0?LEQo{y7ImT80r^cL&6q--= zBu5XI&!NFFzscaU^=v4=_@U^x4S}wGU9dCz-TAz<{_fvt+`pM{mc2-Nr3AsX!0t>N ze4ty~G#Fa3!i{?DulKH8g;G6SBnwWf#iRV~*z6DCgUPb5r|CQa+8v@5KPLi@W!Qqf z65CCfv^XKrDo9S^J|U}+ObXuj!?#J7wd4ay-cX zN>1jlqT405pMF!6@FL(Qd`ry1jNKf~xRNyq7tkAGZb66;BFMPhS!r&tHbwBIwg}2} zGg+#oju#=HGoF9v;lFG;19Ed_M89QyYu_+`BK{F7&Pl{&96|672N!|FjXQE zKM8Zjl?b^9JK{ew|Bsv$QbIZ5&seYVCwC5qFhx8V8Wu}V{kZ<7wa@>@U6+1@UKREq zPT}lNx3NSv7#O@UMZjpar;!B0!&N{&#N___EI_M<5Q#)DxUE_m__k0tZ7Ew4oXY>U zGI0qoPc9AGc_RYOzzZq@r)f2c{9$r{Xle36sWW|7vU zz?h?GE#S(yLzDW*5az-P;a#KUPhxnbJL5!5jy<&%`I+3|LNdqmBN2Ma)$RG9=9CrF zETs#o-~ERFs8VhcgSW~pcym~i3*j{yxzaM%USMTz)02B9@M-6#394HE6`AwA zePDLiT-mIy?01;n^e5pdTLYpdQc)zNj46f>^RP;RTed=?G^=k@@M{8?Z%dS=+|o@! zBa;IxoNZG5Q?iOcFFnq=kTvN`jBUWzm32c72$>WJo=>7sZJ=9fxN5g(4-Rn|qtR6o zMM~bgBceZ!ZydKyMQ}r3LQI&^Dahn0SsH=-h zpPijuQH<~@r{s;l>&cO7K)E}M&apLy+tVVSvf$b*^PPoBZ~4WX3G{roF(+dsPwOA`A*F$$zy|^h z7ps3+htb=L5le0{JU6&}0q;&o!hY7~ScQ(ty{2bo))yu7_`_0SF_ss9*QToaBw8@rIS-n zB5HEdB=6L#LxNC2CJEKlB)_q~j-ZRe{!+62kP3>M1LOv_{*B}r3AVBbHg#_BZj4n# z5xC-078IXVG41sK&6A55%>5c}GL|>8eeu4>!<*r~oKxd(`or&_2VX{VyIx&}UX@C0 z7wXerv6@^1p$j`QhPm)UCcC>e8JL)SdX^ye!GjHicvM>b zn8)zNCeDF-?!4>H9%2e=-dhW_p05G-Q&p>+wSuf7r0yblsT#Oc~dKEV-BaOPVq-7Q*#27UeBA6=-y!B#cs6o3AMk zv|%c^;B_Xme38fVKI>)XjMSTy-dU*6q&8ri7( z%tOhkQp#-mM}*i1j*6Uzr5;gDF+m2cdoKoj4`qs(2|_ejL4~ecy``GI{II5+p9$Cb zA5j!J=8PQtoslF=o+{Xl(&m?L$}e~zM`Qwp{rx&L&5v)=X9+`$*va^#^bmV* zv{L2@46?cj2yjnRIjA^}DDMc37Z1X(BO`t>li9>ho>#Cy+8b_14*xznYY!)L@c}_ zH~l+b`%`9b^@R6gmiS5Wodn5!Nw)*B9!V|fc@pYBFQZ8Ry{N(q6=9CxbENA|T*2O! z$M32^jbfggzU6G#>$z{GOpYcT$70d0b4@d6Lt+!Aw*YdiGOCBtKIY#O7S^@V1U8<= z*YUY0%tR7Bs_o(GZr+7_s+%}8HgWJ3dm-AO`C+xEJ(G6@22 ztjq3XC1q3O^wCUYae^0BVDMIgo>gS$my53Z2M9WEtZ;n5MG>D!9NO^@l9um@D`IS+ zYsUy@$hp>Wo!sjgC!sh8?#K>n0q)-(0+rxUAVvs2x8 zbjIw(_`$v`?61e;0;o;CE8W@7-W;>g?SzNCR0hq#Kd|KsZE-g&{RcP|@j*tj^HuJa zd@mdk?Nq4U%)XX%8BvYm=luBO^RMDqzjoh%wQu2i<_$D=zNk;7bJ~^HVAn5biuy zG$kZPm%8Wp>NH~}L*TD6rP3nbc2#ZT6KI^U)n@wk@y*0ktU(D~uQH-PW8~-`ZjsWB z+&z0qJ4Jsa-l;}g?%tl7VEq=KO{Pl`{?J?g9!~k|7qQWT>v^}RM5-}V1D3R;Q!!+< z9t1qqs-z(XS^0i?VlA7moG#pY11|mY!^JGnhCNjEi%}Zs|EN049%6{`y4m#BdPOKU ztK^w0Kd#ucg>?PQUT5*(Wc6Bi)^h)gD*$_oEUtcF6nryQv|&S%C0DhcBBqfI7r?*C zxyca94*%IV^CQVTop18@WCE;cW%!ZoH;RvU%|o01?RdE9Fn*?&tLE$SW8lO}8UzPf z6#bbF`^?+E5x9`eAoe(R(d2p&8JXfVV6g_Hip1aZNv~3exlls1qA+SR1}7%3p(@xv z%=+e!U=1>m!3U=bICE#RvZ;>5n3v8BqV24~0n1ZEh7E_HU5D!+i^w7+3y+IaIoQN(!c@z;AA z3(Fi}bVhj+Rp3fg`ObUgTi+Z55S=prBJZ#Ny^wuiQm#sD1E|7WH7TgbJq1>+aOD>PC!TiM4--HtT)* z=olpb_&q%!`fwKp^qWbIvx1g6CR>tnVt(KGp`eNc&4WyJ*tjF@prub z;|_jBWsXPeKwB`f4PRsCzZYi%A*5wA+%S^a^lY`+WcgCpDDZG1bcmdHdpSiD26EccjK!!wtLmspTVg(!QF~W`e=QHV9hZpMji{-jtRqolg&1aHYJJMDKvq1v7 z57{VDZb(^=M-eU@Hpy&GA08k0n5cj(I#phWBV}$Yz)8Lc(%m8t_aM6?q$_rUv@9)s zSGEE-=h243mSyW(8`V~p`6op$`!t5sV&nhz3q!M)Kj7w%i(Wj#Jzdi8%{V7W39D@} zgl(&2%CW)8NTaqYRnBYbcD0Mo)LTohf{JfPmj@i8o5fla=;lBsk)sgzv+YTEICWm(=XrW=V?f0+}-CzaMhuAJI?5Z^~R8<3gq zLfllV{c$uqDq?L9;@?=--lasC!>Vrkl3XRG5k`RBx3MB|nS1<1B)15{4Bad|OOPoH z<7Bj#n8$`+kGy}d-#zM`eiuv6JP?@|&p~KDle)cKd#KK0vXZQyDt(rldlC#2K&BO{ znA!Rdf}))p^k%$0T}zGjkSGrIoiaO)iPNYyW%i@Tz*Hwdw-q*UaOB5-ps5j?9&q~d zfmSI%>BQNvU*T+nYfBp~rJTd5H*RZi-qD!zt5J|6AG#S3#cj}bpCdtd^i^1158dV$ z@#zq=oA*4Pw)1^!U$ngf0fw5@H!!qY>zi_cF> zh7fv9r(zlyVklm`a(5&b3Sf&q9dp6aTqv*Bz{b?=zc%Udx=&X|MvQ~;v@rNmDc33n z3}b){<5m8?9316-v~wl@-yz+*JtSsJO#tafLdanqmQRo7nF=rW8x8MdDi4+Al|dgq zcVeM$D%~|L-SZaq2i159Oy_fg<8MtCIbj##p;P`o^n z2!;nPYm%?S*#d!2`+y``-4_xs_#0zY-Nv!|4wOLrX2BnUWhQSk0S>{ zZbKa_Hw^kqx7c%Wyi5&~OW3t?FznK__8k0}2o{vPER+JHw*bOU0a28ad!B6^WBGr| zD!(XF`;2toZX-YEMu?2=P{o+ig!A=x80L!fmq+Vm|a(y=? zHk1-Y5>a+tJTEQt&m(0q&3R?ldwUyg5Z0Dky9x!=6A)5WKph}}c7h;rAk4D8Q|otO z0Bt+UFzmkyf6(Gvbbk240gR?XeKh;Rh5DFL$%!SNJ2^ISBICrKcIK0Uv@krD|LK)1 z%Xr)|ix{241IynDa^$W8x{7BuX>U~~SWRwofU_)DEU=ZDNDyuVBnfpPnLxMZ&I(B@ z_FOHYGYfx=o9}st8RYEbbM%y<))Ch#7PPHSKX^FX2xu|&R9Iflin0Vi9+y!mw&MnL zgpEy6g`5wqetFznCBU6z3ajD(jBHD4J;?;{Ob2#U`lXc{UI9`ac$!ngFsh?4DeIQ7 z3m6d|+$yI`)}YSrfvkjd5~$?vNcK7dP)?g2;FLbl9^)F7{jlcF9|rH9G9V z9kR<)zXB5h4IzKs{H>`ji?QwitZGiPDX;G*f7U-gA=jW?>_P-=dgziPpn`lh}$y zqS9|JSV5}*d`MGh0dSssk8Car!b4gt!kqCC8c02W0fIcl3zLh&mvWmdy>>|l)JddI z%S`NjD=Vu?waGoyazAcnk-cJPB^mri8qwzF42(bJf68@Rb|9n-N)IV|cZf~~8V*Qh z1d!?JA#P^n>x=3+R4B!kbX#MT7HQ8c2Q&I7#XrT`R@^m|txgLQOw0d(rG?zymgTmv-~F|rpuQKNN5R0Xsv#dF*G#Lh&63y zq`>pgSHet@9)qw z>pI_Nb{ycOk7?~SZ&SVjnHAFG1=t8hPMD=o(c^9(lZwI)Swjg(BTA4}5Gm2YuOpmb zvjqCl^9!Ns%smi~74B)PC`+*0KkaORq3|T`u}Nx z1zb?E0ER%Jv7ed&;@@q$Y`qcRu3Z{>;SWLieEHVlYLAQ3A~#hhDM3amLT(j~n!Qp{ zqZqqN!RNTCy@Hfk1>^VB(DG_%W;_H+6;XEj?Hcx9zvJ6m2Yg|`l?)t9u{wrN-(anv z#X5(}>gCjTVN2v*q|9J$Wj?tFwNVHSE1p;x6kC>|(3Er0KwS(nvnQiKJ!mP|`q}!R zC9kPUoFF1s(%oH36Obh4gH-bjy?A&NvMDXfS&Bmu_jv$jq?lBmS`zomkU)zCp7sl-`n0sW)DX^N13lVyNqnNhLY9Xt?m z0oZY;&B~FU-PR9SZ|Z8$ec)|LvjB=SP6hf<0+!7}9-BAD+5-)uK=IUP36Oi2;pAyu zd4vsi>}B1PTZIWuCcv)0#+NMt5y#4!JpTudNkRDJjeyb950!xCQT#o-D|s6u)?Q0pt-4 z?%S&b;}cCT;D7|k(5da0H@wt#UWEB%mzd4vvdM#Igle6MQxxT(CS%(8Vs}oE+f!=c z$)a3*JUw0)mIbiRv$J7Q^;=+<#Vk$*vi@x3VvGYBx6UF{!erk*CHJ!7;THLl=`G0n zzkL*QpB<^n@51+FRlsTtn=V~BiR)lWVVBQ@g@kHCCK~QhyF~y(On}B(Ri%M04L>eR z?IFAk8gO2n>i|a!kcp8Mz=10rXux7|aaDLVYw-zbt=G+*q;;dN{e zg|CrT3CI|A!nbrSSr3(PzGm+udOu+7bYKL<`Nb5K5~^^k=F~|>Au{-%*phoJ##xsw zOF=$VTw`n!Z}zn;svVj-+rNCu53I@m*^%^@J1^u#+b|n-RWW$<=q;3cc zf%}L?4N*72!lF1W#IOQIF%}Fv<`A7Z)05ZMe=k1}=&T zdO$2jh?nu*5BLt?Ic03H-BO|G<{v?)SML3`MT46I@xjTzk1v=XZ}jBIBkh?(Fo2X3 z7Hz9=L67^(3O-RI69eDvtZ~W=&4m=`We$uu2ciRFURyDRr$7U@+8nk$=5pRIrU-Jr z!aBXxOW3gW<9g;myc>S6q@v=cX-CmvHflu-0HuM#R$z(cV88M0C_w7LvsfYCdNu9O ziJF|T5F}%52X*~AU(C6)-t$i{(n@^&*v!bq;!%iQDm|c%2q-aL?aTBA?5S(H&o~xn zo9e07d9`b~Ohg*&SNa)CIw{al_6zi#3Pxa75_m@oQyKpJtZpPEOI8*bt(ON&YJPcxlVQch;W_A44~8*xOmIraDgv zsCb>U;=<@chyVI2{_AJ^y%uBo^jvTh00Ovyx0NFG*U2)OYI|`QtLuxFK%>Aj#%w>E zr&AlgO@1Qp`gAH2$Z@f2oD@jLI9u?*4)UJ0saMGFjtt^MTm2gNfEi6UQ)J=sNmngX zf|r>5-$$A<5$Bm9E<5svlA`K`(Nb&aKs`# z;6z}p&xkEyrO!#b#mSK6&tg*}EMW#8_z$eybg>n~{-To3*n4Xq4Fo^b;(x)_LiWdb zFKtmCf>&W2e}bi0r=U z(Qf5R+hz~&o_Ia8<4g$enQ^8@@8rBD8+dE)B^uXIX2m?2CG{>L<(Ej*>antMfal;H z$#R7F)9Gu2tHn`#6W)QE0EZ*2eg~Hp0`&OxXC6X2WkT3VXTe?SV0C$CQ#J-3=7|Mv z<&0e;%j7T&A{zO{*rNR5=g?tZ=Zsp-CH~V#Ssy=E`IM!ix@4b& z_i+BqgidUAanb0-r7a}(+ zmls?R^RlNyp4Ef|Vv%J8hUo+1M7XT@bQcw+R*_mJ#!w?g2e?Z3Q@pTNcw}aRkfqno zg0FT!vnxBaq&~?3O143L&Lf$e)B~eYFy$N1vE!`{vaEjUL$Cz21Qh@L`FCY?b>_p1 z=BHKU*tu+$W`=xuEuhmu4DqAx-u3P|%bfX)$%P%OJBzoit1nno)u!Siu*~QD?wvv6 zi0_0W2^oRj?~-ZGwP}25FoZYqd$ms^_F0Hpjym{+2j%ZxyZMdy{JHQF=GD;DQ{*?` z?@AbROt_4p4!KMAVJ;}b=L?GII{avR;=Xw^!E-T5T;DvuX|$7Jg7~#i66o-d+9l^> zeC|zv+|vvRdz4JJ`8{2;Goob1!z17Jd(5Hn+_oF-bwj_qyH_oaZl%*7z-)m28rP9; z+AmLc=i4VWbV)pUtp{?0UOu+5;*yfw2H24d?W_n(fzBuuD>t|PELpz=yJTr2`qEg2 zWZxeYor%^4{3)Buy=mL-9tSJGYl3frB;Q zD7EDKdDJrEK!k~M{bOC&A(vaFG^V_H|D5pq{VWG)MOau^jn9UWOdNlz#XmG~56sc?h>k)Y zW`X0VIwLA?3@!mRdFPBrO};x>%Lf|j8WApZ%bfnh`RY{!9;eQ0@{+!jbZP7}vPrP1@R zGe!A{>iv(1Y{OcylHsu<1|0RrtJA~Oz5s&Go;0R*DQ&jtSt)rrQ^@1>J8noG$mpr8 z30qrR)k3B<6FJI}MPG12oE;3<<;e4EVQp%3ChX5eC1uIc0^P-?wJ!etQvhLP&%wcQ z%DgI^`gEF%7J2*u=yba8jM)jkxoB@z?;+2=OPpfSM$)h zSkHvQLHwVytjHIMB7 zbFy^1d*GnvKSPQrYw{mI!eRes4byD$^P6T&?>XpmB_IjXqLOz{5$=}vtF~E z+R;G~vz~Ivh=_B_%H>0E>lqpZB#kdGV%R?-^2dI`Zpz9pgQPFk^B*B+)<#3xc^V70 z-^{9q9=F>e@mAPwOwFEC`I_7)^WGDpKm1`gD0sDO9>z-c+fGFPI&}XT6HCPuW38;s z^vAGlS%?mw@LR={ZCyF0)b*{q8=FdZ9?90~q;rejb)r=UXyGLC47WuMc(mqMRUI5c zMSw&&cF`D?_SqiH6SWb6jY#n^)aeYYccncRG z-!>>%R%nf=ehPgo%An6a2p0o6b2F-cA9ZDg3??#h3RXyj(ndz>6CM{CD|R6ntJH}4 zL}Q^?O6GQ)0zoHy%#*AI5e+nr4>JjK+31R^-BlPF^Th(Uz*`W@!_iO=I<(tNnH53> zwZA9!Q0eQvdH4MZxYm)PT0KcQd04(=Pdi@4Z||Bh=QKfH`4$#d7-?sBGJ2QyRzzbE zg<6M+gAlda{8zSh!XggFLbEUrK?WK`qp@Uv$xphDkIz*LQMQVpW0RFO$6m$@#>xb} zvd^Di^tA*!J|FF|zqU)^Va3@LPT_KDE_9H6SHh*r%av>;Z_iD$dBd1hE^THX^0~8& z7-MONKa5#n8((c?idL}#FKxje3|)^;G?-^85*Tz*>yyvqZz`QXq$XuhDMl$$e*4V- zP{7E)R|i0Wr-m;SR2n0%%2SgDUiwg0BfgO@1)jK_x`eIeViE7Bs>dsuFS1i-t4T@k z3R=H#_Q3z%^y+zTfu>e0T8dGljxYf0yS9EEu*h8w(8PbBV0GwaN`82o#olgfRd>C` z3m1w+3L(3Nj%0;aPMrQRkn*ayYQC|Y2hCK?-{A}SGVwpfZeV@2=QUO5hv4^|Up+E2 zI_N9&V#r_VA500S5WkC#xO_%!gB?d z8F%f!sG{>osY*!0b_1;V(waVydIvlOX=N?X&yEsK(vB+*H3aODE6V|99fu@xym@2& z^;WHP*8(O!gqk7sPQKdl$@W#4{6Q)E+9Ad3rfomWF!8Mb65Dt;Kk4JugZo3DEB4l< zz9$iVT~Yl7;;-!*e*&S9cQ z-=0pH^Hru@RFhiQeEGr1*jN{D<;r^6*ZP(--M;_SJSp(Tq=Xk5;7{`>_}{ex zts|UKUnVMRQS5@zI@+8Qn-$#E@CtaSsAsy~AEnO}{n>%h|=Vc2eS$Yc>A4)-zeI84J8!Fa&%zK9i zzvzB#;mLjwR=Cq$NR;_|Ue!G=o)W9^fm81ZWct_ioaFT4S(XrmVuSC-l*=D2$P7E0 zV^FAKMF0#RjYLu_Skv^|@n8?c_s>iBzhWha*LW^QjDrXqEhfZdzz+%f-N}^=L&EQ{ z6GgG!T=wL&Tyh?_bk=;!S#3^!Q!AgWCcKiXcCyt!zCtABn^5@>kS*DQCLCOY&CrfJmVMwcxp!MGo?3>8piA3GX(}9iD_yg#{t=- zE;I9OdhvHAo8FTJV2RZ{Xb!y#?ut-E0%nVhR>ns(Ht70A{qcEeCB<%}EWZb5uGqu% z-=tlwa9&8hGJK6I3z8a7D%hv1+@zpDe3njA$+7$J1q3g(l%D4Lp~y;$b(CP$dre3+ zHzqbPu+T@YI0MQ#NC?&}hj7(a z-U~K>@i5xbZ$F?|5KCo3`5iodnwni#zuhE$xFqH%B?Afj#QZzhow1fjSN6_4Qm}iX z{8RO+ohcgnjYm(dc>ikVt~CE3d9)1I;B#P7AvZJaWaJ#8>$&~rQlhu(ID_NT)@6bS z_kLFQ0r-^$EeB{s8VuuNhG$q`;~TAbpd*=ee$Aa*&`(zg5zFuD(Hqz7s};pTrn`PM zJ3YkK<6yL0a%;w!P;dpzr}~aqhcQkMb@&==`cZ}*H{c0$V5sZ>%!(5``c{@;SBKv3 z;Ka`seKN9^mmQ-H%5gV7$WBCUe02ESw0yo1EYvdqGj0+kmcP_vhEHU@scB454rA`q zL6YFp*UPh5EwsM+@`?b_^yfX2{3hA`((H-bOobomc-3-IDzsh=uoP#9-^PGv@P%A5 zqRIu*hS%nCCc#|?;MrhF860WKwao%?)G2AsuPCG;VR^P5D>vS%t03{RCg$X8i+au1 zd77rQRh*?n)ayUFAzZx`I4#3U-0-R>(22s^0o)xwiCc?Q2Ig`9_*9u|@G&GDY~Gl` zvf{%X%iP@?7If-XpPEfBQt$45ec|xuo^((%;0MRP2x%#>tqwBCRvxntSneXQ1zUcP zcavp$dXPB3{7O(dNG*4?yjXN%DTC~@&4Ghw1bCUK(3Ts{L3OA%^gO>@!Vpr-iO~Qh zhbsL2RML1{C|+XD{WRm@=JLa2z$!g&4aD8*cQW!5JjPr$ zt)oAqhZO&B<|<@K51r}fH>i7T+lhTnEgb`0(#z6eXQm3LK=$0d!Ra+x%EO(@R0n10 zgvsn9a^eBIIr`KYf6)w`QbL(tpS#XYa%Q6X&87uHjuC_84(@-Q(xFdvtv1`{86k&? zL24NHg8-B)!ei6;0gdpgGf@}N>eO1AnaLgxYn zWWYPidgu|q_Uy~A*!6W}vX>%g*#j+#5D|{VnW+}lC7AvArs+uCkvASfttGIAX2{3mBNu^+#`i+pxXgUcsgD8kvrrM8MeD|yd<~WD{o{it@B_Q zJqdob=M$%9o5lI1T?JY6ZjV<~?p z{3(vMGN(v7#)k)8&w&3U97h_V*S_!?en<%9l^{pQt@p@ec+3)hg!%pKU%|&;OJ`qk z#RioL=#tDP4=)p1MuO*wurSJJUNgp3#L1zhz()QyO;8T`lh@Lj&96(y?7v&SNm-4k63;!SH3vV zzYF39SCL zxrGF8F!2KN1LvSWWIPk~y_T^ysG%k+1n&V7Vh9|SA$?OC3c9X}oqFOJqlXUkgJP?1 zgySIr3E4CrBJt3rWks4LHWV%H2Qz0CVqJLu0F0K^z~PltDbb+^y}y(CONfO=7-0YQ z&@%6Q9gNMZ>lrr)5$*?0Rxmt&*VPT_%a%XX9RH2l@MDUi}Y9AIwvAqQCAbbM>YCx8_* zj|ys_sxpC)0mIAxH@uZMXDsuXc5Qj7`B-ih8nI_~)1H^+aqNOZBQnh-sd|&sw-Igg8Ah2l{ z7YHF7L_;)E zvM#OgxMeOSb->LzcCO{!&oo?jG{eP5I#9okB0F?x|P_^>|-of44 zrnJluSptu_4%s}bXZjk(x^VAA0%luVG=+K(FQ)5Lv+kD*(yv2b)DM(fMcJ7tJHF0!7sRkHWfl>Me^7^{ z3TuX)6!!{1Ts4*dT6PIQ%!Jx zhnmXH-=I!f*un-;y)0VU^PzrO7S>Xts?{%-=rUd4F4!PSrWLjTLK|}P9N*>pU=PK@ zmh8bq@`qN;@K@Z#3OAlX78qqmD?<|8kCMUrDc3?F*IasPIJ8QIKoBJ$ntOn5zMTjV zHYtX#D_VKT_6G|J&&r5*|a7%gbIl78_T1=9GuxgesFtSiTzr&^ISia{uB@w ztc8RWa{zb0dhRh+_-F=_nh{5~EjltH^M1OTE~EB%&_%Q?L4rDjg!%U~B_LS;%OXel z?Zu${CUcA%c!}KtMdP71_}Fe>11?w|;%EV53g!R*7ktd%_jqnfjq1g zCCed>fe;Po;+)KW!W&;r1R3GAl2072ooXP3$q)2!)R_5|_`gz@stC2uH5UEJ6m%9B z6DH?Md01W`bZpqie{W{cLX~r*DFv^@V({xpd+Ix;XAYC?!70|U6#`FE2duJqM&G@3 zLcHFXdIdz0Sa&7j1Y{UYJet!V{vW$FW-V^*GNWK>v2b7ub_J3;&Msd&_vS zmz69F#m@zN;mu(D=1>-RuqLTfdPTxqZTM$0{^N7XI19(Q%c(B9mBM%fB9>nPXPP(ADBjP4F*F?2xCGj_6IbmuYa7}xV!}2G1K_B zpCWr#s+6%!dZhi3!|dG}bKd~0PKMZRDg%$@HE<29mmt1lnw~A*z$(n*FTqt~!Kq?s zvBhitaL`lQzPjGz>1o7ZV}tM+D`@i%kP-)G*6ey)l3x}vd_S$XEJ6J?7y zzWb_@ccYVwxSCvsd$aGQmGuu*X=LltkaKQer>9K3dC!S}FoJ6i)-5I()$Y^ z&c7=B+8^PR_%gav1D&0BGFcR;tvYVL@7yfbF4qyK9oUoq{Tx{G*L<$WR1DrH2bjzc zcN}NdkW`AgYpvge3+V>6>s{4h?tS+{a6EXkcd@;IPp8F446g$8tmVt{WQmX8uvd+z(x>Te zes3}1gv#O`r<*KUnnmYw1vkP_zh~Dw+b#~}ceDG>w6z|sN=(LaP5$wld z$Aeqg_4T<8y=jtq#{QKl_jk!|J$iwY)A-CD5~-Ki2D{EY+IP7ovcP8OfI2Ib%^#x* zerAdr=~z#`84})S{NjSI^FtGY_&^7&H2uXskUFtCSS|2>vJ30Y-+R%c)m}qVZ{n^LC1ijgQIg z6_f>DJGQ^K9eOxX;o=|?ebpj(92qUeY+2-3Bz50+`3K`)uMdCTUHS|Cee%(}hjGIf z{oQBhqr&@pg0wnXoG6Kwn&qCcOQQHo@g36HZm*Z}?n$^&TNpDTTUBbN9Nxi(vGXRvPfSmvcN^>fTgl{UM!z>sQ)N#~vnH zYN2CIBfRt|POQD4g^8}GGu0k^by*SNIMOQnE>XX<@CiZV@0*05;WvW^&Hl4`+b|YV zqUSfEE{j)w;VT2%^bcv&)uKlRyVycDVpi-KcKZ84TOCZ&N*609)+U$n4S~|RGe0Ya z&i;+k&Q*1^QOET3d$C`x_Wj%A@uB(a^~s{E_jG$MO&z)~H$A%Q_I}{`HY0|vE=h*o zW65r+MNjH98+x9MA&vtznsCE4kdRt!*3N$vx^gd9dKvF|ai4s%1GmO|2DJAb|Ku*Q z?z(a6zp%M3A298Kc=xx8f7YQgw)SJWPp(hiv*AT5*4U@5J@Hsu6~}V!QAXw_mk9k} zszG&a!vL}L%e%Tx1AmDN{1=GvozB%GUmxKm_9z*w1rf}Tf#bTDfWfnb^ab6p#4q>NN7O*v$;~b3fCRNq z({*NIXARwF;`2L3GYQ%tH>OWIRv+dMho*av4Y$ebKE9sPn5QHvH}bvKYoF7W{BsT@ zAam}7CqvI9&_iL9@QEuo`kBhY@LjTg{pU$LDyw%D*T3G2N`0YqX$e69HzZCG9_SnO z{qHnVU>aeIKCRt2(r2WiCj2rWLTW+Yi-jHOf}9B8N*K$A(ZF>VE38z|dhY}b0n0MhP-;@9QIW(bs(8Wssn;!9!Y&dXy5c`^^HLo9bx)GUA$Q`<++k2c z2}v63o%Xhu`q9q*(=Rf(h)kp1=&zq^%0CLlZWWoO7TDT==7?^lV<~}X%%* z)BV*mZ(gCxfRQ1UO^;M}Yc-r^{;87j@^gpNpH(U^^=j9W9=#^MM-uHtxMQ@>OXF1h zP^>x~>`!@LH}YrB^Y}#1gOLZGW&RO#BY2Nvxs zuiu9(1g^kc*Y*onN9#~Izoy|BJf6rT0^Z0e;wU;-1~Slmim5QzaY81_5D!$3#^oh5 zs`n?6J!*#F$iH`8Nx zQ=`_@vv!f8PuTb!^yLD=;r^j;+-)VFB^F|m?shuUV?iFfj71nnIfFT) z#F~i_qQuy%Wtd9D5oxYlgpjz;O(45fq5$$#P8LPt z2V`ov5a72UgbVyKEUG6L8fN&KwLjMN*D*O0tKOTjyT@i&{`yXWu#<3tgg0+)LzHyp z359HN`PaZ(aFY4nt#_7<9~&)K3eqht4Hz{aQUC4*AnymaFT&1x|6o(EdP_Cf`h%90 zjl=GE8#NdAvNrW0YSZ&Le59;D6#?=*diQkgXQ4wSi#n~Z)uuN$QOOm}`wHG6Tdg=A z!PSYyr*ENySTj&6Rhx`pCmC~x}vhR#W?CmqK95duT_jN@zSyoGW?|$=fo*=miVvpBC62~& zV9nbfg9R2J2(Wu8th_T_hei^S=^Tx)i{n;iL zKz^4W7!?9M@+3%-@XiW%gr0S_sX?}_E=hzBIOmERYh9UUfGA&Cl@F2(fD*J^FE{k! zKga+1*D}O~?C*d7_npaPfS9;voMv6{@0mV;S6e~w&j$hT>l5m8_~#+` z1b9i3L7-=hXTBpE&}_QxTkuQ>2hPe4cxpjG{Q z4Pd(H|2X`g>H0mf|IgD!MN35$!}HgPmr16bm5Pr54K1y5@$>9>%cf6hbf)p!vWYr0 zpyKDYakItu$ZcD*zLtS)suznB_%}&>jjPw)@XGbld%UEjrOkGUa`htJBkcAIsW#m; z3(|qUV2DNGCFhUJ6`%i_PH}r*HFRKeXE-K#< zlEFw=R9a*7?gSnPd7iu$c3OQ>j+&9WO-)_)$)+NM4J?O5YI@LzF-Rod;x^E?5)cs3 ziny&Cq6$8$V(C={auYbGGPQFJ?t426PkDASqJEA3*r^0)QxbA?sM~~ZluJCKzP{e_ z;_R40kI%~PK5LI2s2(DZ^%*j7&-T#a5U2IIMs$lsKx}nVpiNn6PKlI#BP~o^F@TIg zRXaz2JHRSq%gV(7LN>Znc{r&=M9IbZeb9*wVF{@(K>gUN6fqQ->v?%3;3?^N$11pyEkHhk=M-Hj2bM>haN zNcAzzF4@u7ezJ)hLgeepC%rGvAKdnl_K7K)h;s_-2`##lRQWVZD}5=^ovRmKX3}__ z&KLh7t8KF#U6PpG!jbaEcv)cwg@xpP_ACpih&4$;+>iItzVFV(9bCc}pn6QmS1@wj z8ByeQs5l5qPFUU^F10sxn+;^|3#AiL99BQKvJDZ2L6ANgzS;(^=@{5Ser%j94!aLZ zv7s4AqiKWCg-Uuv3$({wWZj?23dZNTebLIEbOYz&f`3*pD4K0V2Y;e@u|QNC0up6n&t z141sJxxf}8GV^`uO8sJoFrMUZnBuVwAf#_LM3;t>_Re`rgR2=)1;z4<0C=gkcG ziD9P5lqvbLIYM`0H$9|vvk=1eGQnmSOBD=apNoh#Lm?#ObX35N%-FY)C_>e z=lC`Ue?rg~IDmx0#qXUy{&Q^rwxa<+eodV>@+a^m1N(%4SBLNZ1iXuXLF<2R^nYgb z|7(pp1UUgM)Jq%hRVx3xu9Bw!@w@1AqZ3HC??W6D5M#cBTcud|JNfuC*+`C zo08-EYFsqe(jsq<|I#63Nj{l@aGZykhq`8Zdb$DnHHAH5Wnjt9O%!Ne9@T{viU7=A zl=%5x|3gvH@p6L?vO%}f8-pm>4VF6NwUhAk*vOaRAON~m0GL%+>Q3U$h2#{ocrAqj zSWn6zu3x2=Z);(}v8`ueMUU&nzSx~)IGX4Bqoj#^nZ$Qy#f0e?B%@xiEjygSeKtA$ z>(!kiI@`AtHDtTyNuE)+xb$_rlG7^VCSPiJuRp8y@*K@GmUev(z>D)t++Toa99~oA zxYP&WUmtst$72~ju^bQ8_{nECs^4X*CMdceZrq>Bd|klEG9th2IRFb5v6l6j3N~wx zO22teE3zw1_i0y~e6k$a9~PRWm90o4_=?ly!D>?g#uQLeVz$1VlM@T?yQGJpKu5-l z$n~BS=@r1(rV9q$mUC~k7PAsN)m8V#_BGSHb3U)~5V~(zCAtFXNKDfP)Jy2mY!G)J zlEE`_((CkBk@w}r06vltOJ%^VU-}`GUMx;ENjzbrd@X0kv(Rnd%CvK{p|jsl^r$kK z?zq!stCpaDu`@oXY2{JxEhb+%a;hdhxhLDkgtb%*%oQuFN>Mige8_HA!ZX~U$str< zA02sL951C4SRZaoq*LB=%U#vzAIp_RfPnrq_hYvgya4!|@@iTHT=R}N9AiGa%6%=j z{Xy-10Fm{*1f@JWg$scaR#WK!yxGfMB!h}xvCSQt1TI>>!6eBu@kz&SF`(y*iseMP z(|&Fde`F0Uj7n~ukJ%^hI&NzKW^xe_W1?bg4%Q$Y8bm4@HVEs6mDvv7yES2al}>l$a`0=czpz_e zPtMQ@>;}FR2nw7+J|w0~Sf;%?FSdq9?4rTo%9D{ja=gvJ{MgA0=X8{VCn$yFJWRm& zEl(FtrM7L7WKbpIi@mo%(a85=@NE^JZbO?8fqAx1OC{S?ryKW-3wcd8?50(c2bXyc zEi9p%MXUxSwbBK^{=nwV_xWDG9CxxEHPgD8a;~GmF5{r*{awoA$V@zItUiJj z)l9foZw`e8^3`Bjl-B9QIdj?z4|2{nHSX_C2!`$W7k9n1so?pQBz=$AZKVtK+^yxXj|5Nj6ZAQdp0;u zF_{62GupKIGh;GE@aNc66OHRpG?e*Nt=mNbR59 zPX6;cqY41{Cj9#L^q;o@XT(JLgw_kIt6(H$|# zvfvxbJ|?jd5vV4~y0s_mep0DvYd>}6%2}}a)*d|w8+sYnJN09Op!X3`$zWIBJ%iKJ zSFZy0ix#G*jjR)1uUosn?>3bf9$hRBeq&P@GRo#V#>68kAP_YyCnwkU!+NNVjM6)P zRShSFS6EoL*rNGl=;Xi(lQ7(Iu4r{q*%o%AI8Rn@lAb9y2hX<@IrmBU$BY4qNZhM- z;pqwSKex|vx`e9!tRP^ zyDku9b=p#Ttg43cxNoOg_7X zX-!Q@!5keF&UBc*aT!#^9BfR)bLp3=k2;MMn1whyEP_{QDc>JW?>e9CtrS@gk(9a27*cg3TX<)la!*l5}^7ek**}%vwxwxS*8Smo>z*0Id7`& zE_HKH2_dd!oKRr8XHsQ@$PbrS2ebMCxL7r`x90E_V&vH(yWAo>cDECK_~mZKx6P$w zgIlf?ASUKqgUYxn0E-K@=Q=Ll5m82E#ZUSV*WD6xfN)j~Z&qJk6j=>^qk-`E{>%$2 zhYPD>5#azuHC%7(va(9`96TvG_bg)lh0$~#dhVPaLL-;~fNx|s{8vD!jY*xr<6#UU zV;7^rX%i=CXJC(?m*0A5IUJ}GyvV7O$2jw0>IyjlJtO4JVw}s=gldANl5pG4Y`tiD z&%NHg0Zp~^Ut=Xxs!;~_e1DQtWgw3SzG|*a*ZO4>mRQ(YKP3)gF!L%pdi0XThg;06 zXc#d$&tRrZLX#hs=-|do26$L*&&GIGeLcf1kfT9~oV0Xa6-P{P{z|&~rsC?pHy+U& zV{tx9K4)ASISKrD?k+9Ur*$To ztzY)QcA}hLY`25Y66hdDA@*9OSh%VKri})l?`2A;065PfmSanm8Yb{L!~*HYu;MzN zZ;CwG4)fNRlSn;3Q^pT;tLlrgLEu&&HFEa>bvR17LWh<`j{Rdi>(i(H?)!o4iSkp& zUCw>LR_jVf*ADncnk=NTK4B6Uh{}`ItaP#C=fR-?Y-8HpYO2mwHxKW^9nhVr_JFz| zX%4Da_F=9-(`)+|sdTc`kPQN2P&~cseE8m8zgqO35XD0Uj@DXzFt9zyS zV+kyFc+@M&grT@No5Z}Y%N7yP&8Qc@*}rcm(g_RCyJ+yKQp+i^1hyo{uCgkv8)#OVXQZ1UGTifaEwC0!A{l7HfX|_ z<^Zsa#px5@-t@f6e>zs^7P`sG=xYyp<65+=YH`wY_FAR)nvfzz`s6-oY;2mqm| z1MpKiu%FETH;;z@N>S*KynQ7v{B~7*V*zPCM(AF5gy~9id<}#z z_Xf2M)5F8V6MqUP5?2}3zAduoWll<+&^+0{tBg!G_+@PSTUuDg16`TX=1@8%z{^$v zVzHcLA7zrAMYf?eDJdyv3e@3*b0#3CMOXjzJm+{Q0?;eO#u{~h`%ys7@={lVlKa8B z0s$GlG9ZI0r=_Kdt;9CNVkEr1bjx2`x&h4=`>$3hJ^_LI<2OO^h4~pPkcY)9->=x< z-{Vwa^*QqX^<${-ug$9XE2bv%MLkyz3<#}Qt!&+=QXj7(j91EHV&ud?v6W+`6L@sI zeDuHJ&kvIK38A-N1NDwYfC&2Ffe*YVtHA=t_z@6n-8?=+8;n>8@xiCRJ>r|2fA-H4 zoDPL0A13K|);YK(aJU1tuVuKE_=fd6Zr+E3(6>+jRa7cje1Ky7=!M6(7Mdz>CgV?{ zfjPJ=u8jJvukZwb7j@CyPREXz$<*Bc$1qB%)rUXg70ZqwQ9~bs`26RkD5mF?Za<)b z>2j_()D*!Ytcf2y0OV;Te+0-~cGsIW^9TmFPqjP}y4%4q<#5?UFTzbXd)9fKH69Z7oJt@qI zKnVB=tq+~Zo6n_-TIjn@Qd`VT_5vs_7pmL22$~6H(IsPGeJreW4<7q z1Nd5WvCW7>J%8b&*20_13e7@Hc3|$==u9Tf%vWp;mjnzRAH{sDwL5v&tuCWYcf9m3(Bt7$Xts(-N zdOijm**@!%$8lobOgfuqzk;81%5%M`6RjaSU&p1coA?Mk(c@#l|KL*dZZaWVc&_n-p9*$l|sw6pe5AxCGLhLuO~V_fTUT~c2+93#bMD^~B>P>W#>T;@Uq+bl@nM8O<9qvXL^ zL!FD2p*1!Zt~tM#0J+5-Ux?<{_s_v=SCk)oCzUdsrg`OShI2eg3QeHL^2(x<12Y*| ze5uf$l=t!~M6$hOFAj?BNk)WOqn-@AsEKQYxh&|eq7g3{T=@)r5ocD+o8K^DJ+y6b zyB#B$IRc5JM<#o|r5<%}TkdtSN~}trBa%XPIEcpBqX`AqgO5p`h7OiLoubItZ#TRs zKvVEOmR`OEXDK3_ksL^;n6si6bkBvO_@wB8FzbI;?tMT}e@W!q=8k5Qil+CTonJ{X zEO^l>gCI)9<}rrClgpwStZmLhmf09&I4j3(FxGOU9C*FKTQA|ngiM|JegtGu>bDJ6 z7TCKIdFbk#bUHDC9RmcgE?)El*Zy7A^VSmKlv_+{m8ct3#}JLqRWYnmx5&QKv?ez; zB8IZoJ*V;3>Mb)3`WcNpNC4ZqS3@yH;@h6|OqxfknCoIcA!cq>reI&~ z28lpzw8&7^!Kk%a-Mz{&eM7OZieYFK3mD<8$t5;7K$uT=3SDRFgY7|fwGBOgMBc1i zMDXoR@_{7JTl|1N70n!YLo+rXDAPa~w@_oj%CiBQna;9qu|s{>JjPy&=enMepL%m` zjaJ*V?rI?4BTk8mSFDX57{DIgH1~6>39nFyY;OY}m?uI6+bzDRG>w{;?BNU3$xKAw(V#!25<0GDxcDIO zYFwu-fy%h_lS~!tMCSPWV#60afr%VE=zcE@LSFTU8*~G-cLv{pB}3E0UyU# z>zSmSu?nsT5PDgiVTY{(!^236ixxFWIui;Q_GG*4^HV!V5u;2{Wk+7Ur|4FBOYWHDKC`MM_S@JPG!DL?%JF1Ye&y zgHA=Z%U>fDX`w-)d+x~Lx-?qOdbGVHqF+cII|>tRy|?N>^Grqm8=S|tPVgUZP7(x_ zWbD5ewzY_BuxCSY@YbT4kWq`iHbkCn-d~{<KHuf?Y0$|4=fy>UB$_8 z%B8|^?qifH#zTf@bM9tJcatl6=4_U-nqwFGMQ{jSXaA6@k})ZU#-|3^;7FR=Fx%g* zMt1o+(5+EsC2wJ<`ohUxh9jta`o=U=X0qa^&=E;4 z*m%R(+zseus7n)}(Yd#b^PWxsj@;*dn(lnh(}PbW`N1eQdr`E6x8rktnzu=g@_T5c z9iq9#FXYf>AgmWx#+#+iX}Q+?h41mT@BTNIA}B*~;AG!#3|Kz4`yoEyNAFFWlJ^dV zf8b~k{NjW8=hglET-98l{>h4D?O!j?N)jhLxQ6wBE>y4nsc9(T9B~vB|Ya#{QwyAGo${*Vmqv%To9%Ed)GINyGz1Ffz+AJWB>^f!; zJtMSVtp#o<LrYe6C*B`4+jMc}5q&CFmB|T359%MEqIVd9UjvD#P zIZys~U)add2(0wgZ@Cnc7$eIJEB6eVq}NN~XHQ z6wZDyASA@BzVtKy)jzkDOaPWD@<%OfLJ}VB6+D1~;uD?N>Y2}|nT#6gz(Os+=5J@L9$u@1O5IAmR zW1AetdsWt8zV>kBwo5qPkvxYxTV?3vCFnyKXdL zy?#(XwEIDgYpg!~(3AH0&6URk@KtheHRsOGP{8a2e`x-PEK4##AxvR4!3L-UCedg2 z19+&=_utawhu|Pxnx%7>KOwjJ977R{x(0*Yr$00EJk=k>%;kJ^RO;tq#zBu zk7F6vs9$xx#@C z%W-_EH7NEj zJevXgKa6fwD)~;izgw5tx2Q0n%@O>~iYprv0yd3#Dy8QlyUuI_%cq??12|v$I^6K! z-PWR*RE&X(+a)0#Gn3Isx4)_H^b#%kY~qekfCmSIy=sT}@wVW82>QcRfteEQe4fFH z*={E#G5m-I*2$0F*b;J+Bk$cG-^a$3;0Ny*Xo ztA9%uiS&Z)H1N+0M#zXq5*g}*yL1cmiwb|@Q^tQ0tS$X+?4wVezsfk&#nHAP_x`WX zbbqfqAiR1ezH=IekODJ(`<9w_$X{N_YQj*?X7XjzX2Y3H(50}qer!#qY)~OHl8kR7 z;G0p-&!9PsMg!;Ae1rW4Yq2U}GcMBCwm8sw1UjslzOpKQe0#&W81;mWVQCXO5)o$1 z-ptHmwPSyg`2JC*qj@=Z8_9%t|JtiJlRT<8^u+aogWSHWr}1Wwo9A2%Ty%*?cx3AF z=rOGi{wsi;BuMT(?kiO4X4Pc`TlRZj!jvs=+!6y*GL}k0?=-leHqGeL)^+$Zqs{cR zDj~#k&$qAD5L~kh8rb8;wV77(vAw)Fw*)r!U_DSq;ym~}5t@A285nmTUptGUNmVb- z*@58sVbaOmyb*&j%WH>8MY7l28)Q-%Ul{Ud2g;&Tu>~{IxdPvn&y@fvRXNpV<{f1Q z9kbOEe6w(v)TL6#0j(Tv zsuE^JBb2Pj!@58B8Ej|LmO^jUJ0zo920~O4M!)`YqF(f?dqITtRpm8QA*lIoyFQz7 z)dJ%0r^Q20rb^3Kxq$BB!7Z{StQDa&7UWxye<;U!*)n=q>7d0C&|~=;mSS8OnpQ;V3&{4o|ejn>@Ar2=RD4`VFjl`o6U>pAV zNsVsodx+DCTf%1nUFQk51fN@iIT`=Gi3~=dz14Gm97oWsLOJIn1u^#-h|l$H21h)U zyxY@_8=dnTLM%Kpkb!+a2lnBjkz$eBX3>8xd>@xS83>T&?0n!%{GvpqnF|&&p7~DI zN*fLcTnM$~5*5R&J~moht3f5ZBJCS>gqR_NPu4>Jv5~&Q6w}VVQ%z;oOtija5@$SD zo6MMfb!7YX#$6oVg-=#gH&a8M++jOb{As8RZrtjqFpZBi;<{%t^4rMDCmTYrBFswqWSfe=K1F zI3`cYg0vf^10<;g4tk%gWCrC=IDn}L8E>p)mrUO6<}zAQ*Yu{?B3<4*7;^h9P%rx6 zRPKErum2{tEgEoD%aX-!41U||qb6}))PYPsqq@IrRr}IF545kZUs7E9J?0dM*it{H!7p?No(7TbGsW*)+mjlVWGUbhAx zXs~0+cRq`Yo-!7{QhWVU{MtQEV;VIduW4U`zH+BE@`YJwhXAj}DG-sQIIi_StE-LS zk^qP+kot4?o>+e04V&qT*DHNjdT)`5idp(sD~*EH0L7Bbi&KCOc%|brpRBZIEV;FQWHtNR|1Ejxwp$hu zD#RLipYPAgOhXulhk(i>9nzb~6t_;BJl?Od;W$yEo>%EWO(8UY=N&;ei{Yr5x_7fw z+dYD`pQ8=jR*Ko2_(tm@K2HJK^T#P5y;@fb71u>*WFnX)3dAyzX06(^xT|=Mw77B< zM&3K~tq%x28sFdS4;_DPk_+z%e1H1eSbUI70&chOG&lyS|8Y6+a@vpVJzpN6)X-oU zpAc%#U|kd+)ZN4llV`;)ydgiH!!RaZ9w%K2UBwj%eN{_gGl~<+=n1HUpQayQfy?&n zSR5ROQYQhBVuK-2ha0Cqpad5~t7X2aM`khyyF$Y>Ypny%xjwxUQws zW*AV(Wv9-6+W>i>z+FaE{4H=@2rH8SA<`Ad_I+Q2WJHolq&}>B1My55if_;dVc+Xy zJnYIO&SCO45K=vYsp1U*k>2DAb~3k$uXt%U_FCqGp#)(qfS<9f5>^JnswJYy^TS)B z)#-P#RreP31=`HhY`W6Bh8aMffS%o`g~e@f?jWlPZ7u%5V1`nS44g0)aed5f(;Sk!qLiSv)d0~XD2zHwe3CxLB7|c&itaa_;bd!5&<{^rUFaQ?`8gp4#=^9|d#-i|1 zUJ%*TM8IsLzTP|br+`wtca;$D~^Oc85wl8@JaCk$e**C9< z?!1~So8r75)DgZrOQWnboeMpU9Xe|qvkNK9dTDNE@PU;N; z->nD~csKxJF2PLI8^*IB+!eSBow(d)xYR(4%~H>FltE0exH5uF+}_)i-Wm-eCW(VV z7rPRdh2O`e#RqVg@bbGbI8yP}gfyv3XO|b7m+$>*g^cl1WIAk*X2`sC>f%u^N)u7> zQ)i2U>68h9e<28!+Zwglm>uciq`Y^x54|rB&EC=PG%W&ucykx?Jg)l!Dz3p9qkhMz z)^-)FpLu%sVf!U22clgkR~M1@jwHYjY&SV)R1+UgniH$i2a6%O-wl-5{`boc2>8o# zMt#6{BE31jwZ0)0E>GzB2wIp#@8q@$>)MOz526djiGhBxzkiR2X%yDEhk{p?`A@!a zn`;e2IJYg9FF#5OrdjfxgP^bcrDw;fb ztIi;IFE2VA|6qoS2js&iLzh;W7q5XGVWIOK>Dkf$7tIL3kRhh;__fqC+@hvFp1@Y3 zZLmg+1)3w3l1bTxw0UGWjB3e^t*|d5w3Pj40>WA9IRwV69Ke4tCn|G%RTgmf5oFB} zkcJizN*^CsZJq6QXJ#h4eM8V`DQbjDw zSa^UU6JUgk;GT%Ekl@?XEQ}W;^4K8F8u@FkvpCRiesu8;98gh|1&SQSh}_bB zgZ9kPsp6$3(tBZjtfU^o2ZW-By<`L{C$MTJ5@I_TOBuuxpSe#sL4)9IG(8ZpsyxA% zNWFtjqW4f@Op-R}xet{4(nXG9OV9#o&#w|N zQSi{ep@>@)k~(l1Sk0alya(2gdF^(*Vv96_djvksJiKkJI(wTObXz0XW$6^yqSXuFB0BP87-hoPJvktoBX~ZnD9=5_K>beSf&N z$*JUHYN&pe_@=Z ze4sOsCk^axsZ!de0Jofwi7vtpcF|A-e+kQjxX6K90-!A9Z{ycsBM5jTgZ(DNbdpck zN8Vf&_bpw%idTnPjSv%ej`>48jV>paE>nhPsp;MKes%I7<|GXw@&yM@@;CN$#nZ3V z@r$9%GF5v6&39$;n2nJLXn41c!JVX#UaEB;3P(tbRoA#|l!|984rp1vkD00295du2>>OC(FArU*-`>egz%AbFm zZ0L#R5Ak4O#+H0PD$mtmI%A@x*#RC!-`)Bt1hhhHO}Ep#{4g&~nU)mG!$!bI=6mw0 ztt0lKiadoQ8_I;kx>x~eRNNr?-`am5>7xjXQ+HD%sOCk8_v{Jm1U=b9q{=BOcA^}| z`Wc@$csk_9Cagj9#=7^#l6M(UflZJ6pXJ!-E$Yu{0Pt^fr6euPV?5}7@4tI0?4FjuRZ6@<+N3#%i+LieD?6350w zS^GTSppNuZFrZn}&izlVmz_VUjrM%Y`TDl)E)VR|J?ioD%pu?eb#QP1rjNVeQ&|`>$ z+oe5EOIU+YuoOy^7WV*2UBUkJ*EAJpOHeOKVx}a}kbFspN2-tA6`b z_&3+)D%D&R8#t(!K<>qK_ZNH`#|KmsK7_>i45aJzO|gKw7yEHX^j}nX3}SkcmCMvr zPi+*a-oRBkfH9TBMS){JzlV_6(@8~ZA29ik$m=7kAZ{{z?e64uVTCni7+bI?D7xAd z>|?!RkHi!*x!9{h8}=~$?cFT8U4XLX#>RSiwj{xAroMQko=I6|P@G3n+*xJFg`A+C zFq2)p{EP#HOoKhtC00ZGZ!{mp->^vyUNLA5=p|r#sp(D6*+l+rD}@fC`TlI$cLKrA zJL6hjF$eIU4_iFL#@QZEkdG%+7;mCdIq`lzF=~&Cx@so%P}yib|Z`x(2G6yy6S(F`Zr*%IW43Z zL9A8-3#F*_gKP(H6l)zmodU)t52DSxW{wFdBOCZMSAk46WjC8%&U<)wNrRy)aHmxS z8)zj|5mt^8BeM^Jkzh%Vw&qQC8VP-cX!h&mu-E8(TV>9Fb6Y^WGg1U$`c`kT`|HSB zT&1C~a^l;EEz4l$z&-FVD%l$5H^9UzwLrzXjY-RZ09&KK1Y${HEkE^f$G3l|}xz~0tH!{)H zZF5C7Q#-NT>+*Dp8`$UEOzIW$Q(IEKw2h~FDA2Nf04^#1+7X}qA-lwJt4y%hFbTut zoDYg5cRr*N0jJH1y6F_C?b7gtFzq&4)tGGEsHVP)10Lh}yof-}AW_9Z#z>$@RQsPt zH2w$#sf#D97kN7V+RUCaalAclZy-LhcgvcJOo z8cm(UaxD960$i2S>tYu+m?dcO@VgddLqS+C2z#w9RaszmLU1XthP(RA0X6_J-C;AN zy+(_+^IX%r23weAe<>B>{dghr45E*fcsCQF#JxsPKc)l zmO?D`W;q>MEZEwveAezoRX z>f>4EPBu^5ZJV4wd@DxZF*YBZu*B`LE*pGmb*;=D=tTU^XG1j0jKDyU5H9Am43`we zOxr062jPFTpnuR$b6(~WRcGhvx4;GjPU^~jU8d{JzWktn+v&NNzr3PEEqfXOuiEpa#~;jlCC| z^b1<;vj~&hj}$fq0}mnF%dyDP-NTG^9>zF8!d{?t8-Z2Kw~M3iFatc`xVJuJddUSr zfH{eg@bOu6!xHC6bL=LT_l|Xcd4zz?Bk6__(QfdnkroD|kF`+Pp+3^23wLQ2%JaTv zY9Re?Tbcg{Hn5BGKx1Gs{cxlGs-_dTg-malfyV4XffSv6MoW-rtDmq&cWa=hen8

{N=0q5ww8Z2~r0 z!7P^rikO2uM~kF>Lg&eR&}y_o5MY~c&Bi&R$e}Ia-|FHHF}gc)oDrqsv?R2UHe_VP zaQDSRn05VWA*OywS{`>Bg^>8*qOO^5>(yh8fTuA9 z7OVd1W;c9p8bQDBslrcQGM{C1xV*=UY{uZ2@vcO|aNBYpNPRD05*K0ZS{Q!PJa?iB zsPs~?*_!V?>>!BHZ66&$GhMszukZ@x`m{^K{Lfg- zqHsZ>s&gn%OOs$~sS2dPsz7?i8d0zJZuj=rhNWDUrq(2|`3$qJ`)|fBziZ#Ur zi?AnZ@wIgVs-YgU%&=J~8VEhYpg*$jEx6he}EmRR|~oE!!{w5)Sk7)3$v>0Lh`xiaR+Z%bI#l=_ zC=w~Za*x>T0 z^V5VaXG!*yknNAGele=zH^M*tJ->fa<6xc=aZ*0Z8MKW|4aI)fbS6~p=(En+s>$(! zh7VIGdX9~LJRlk?Kedk;8@DWJ9UK4oMI=2S#P$rAcx?8E2zV|0UQ%nZ7gv6kp_kyO zjroKe&gypSk6YxW;Wa#KE#&cXo3wgkkM~zx&k!a2+wZh(+h661j46eFe<&@|=S~aC z%C@Ec)nX3g?aPok-F{y0*=9vwbjNlqV>6*tP1>huTRfzj@z-#ZK=7yRJZ>A?{v{rp zT7eBs@gUn%TK|yoB%7l2zbj9SV#o;j)?)J~n;PI*u-h0Y`f0pZa#rycy-0p^vu;T% ztR~UrI&-CV{tty0y!&QTQ#QXFSZS*;EF-cr)>0W*89wTe+jOYHnHyMHWI6`4qi|Lkt5O>KsXEG60`_+u z=L>As-AxJPJ}t}snQ)Kpk*vu|UT3^uNtd|ITyvmV%TaAA$+J)CCv%NLDynDlviisV zBsA|o*vwIiB*_8;^8*?^B4NW#wL6OPxxpuqgdk4Lt2zwwY z+hzj7QXMoN{ax`^yJ>M__+Jynhi-&V2#L@70r{885S;&`6E;nh!0iVFl~XHBD za0^B;NqcNHcJ&3@p40{LkVpBN4pLvd(j@kdfw+k7kR$Zo=GcJ$>jyodXD?|byejtCO17Q-1WXk=hhu7{ zGHz7+df+Fy%mx;jHizyc+&&$9kyR`|{RTpOHspOiL?zJ`4B@#kn!&&&zUARt$V4AV z5nMgCXXbPN4AHOIY(4BLA}IGfC%c%!mP!@pmyVcL^vR@^SYAN!T(eMdOOUCpeE$z^ z8k^v5y5fe)QU5ntqtHW3kEthgKE*{$2PQ<-ls0E<1uD*$TGadtVh255XRo$^Du9du z?{YVPvDe@8WVWO3>-9ybiI0>EU_*VIS$H%-mlD_g a . diff --git a/whyis/materialsmine/install_files/celery.service b/whyis/materialsmine/install_files/celery.service new file mode 100644 index 00000000..10b20766 --- /dev/null +++ b/whyis/materialsmine/install_files/celery.service @@ -0,0 +1,22 @@ +[Unit] +Description=Celery Service +After=network.target + +[Service] +Type=forking +User=$WHYIS_USER +Group=$WHYIS_GROUP +EnvironmentFile=/etc/conf.d/celery +WorkingDirectory=$WHYIS_APP_HOME +ExecStart=/bin/sh -c '${CELERY_BIN} -A ${CELERY_APP} multi start ${CELERYD_NODES} \ + --pidfile=${CELERYD_PID_FILE} --logfile=${CELERYD_LOG_FILE} \ + --loglevel="${CELERYD_LOG_LEVEL}" ${CELERYD_OPTS}' +ExecStop=/bin/sh -c '${CELERY_BIN} multi stopwait ${CELERYD_NODES} \ + --pidfile=${CELERYD_PID_FILE} --loglevel="${CELERYD_LOG_LEVEL}"' +ExecReload=/bin/sh -c '${CELERY_BIN} -A ${CELERY_APP} multi restart ${CELERYD_NODES} \ + --pidfile=${CELERYD_PID_FILE} --logfile=${CELERYD_LOG_FILE} \ + --loglevel="${CELERYD_LOG_LEVEL}" ${CELERYD_OPTS}' +Restart=always + +[Install] +WantedBy=multi-user.target \ No newline at end of file diff --git a/whyis/materialsmine/install_files/celerybeat.service b/whyis/materialsmine/install_files/celerybeat.service new file mode 100644 index 00000000..820d3705 --- /dev/null +++ b/whyis/materialsmine/install_files/celerybeat.service @@ -0,0 +1,17 @@ +[Unit] +Description=Celery Beat Service +After=network.target + +[Service] +Type=simple +User=$WHYIS_USER +Group=$WHYIS_USER +EnvironmentFile=/etc/conf.d/celery +WorkingDirectory=$WHYIS_APP_HOME/celery +ExecStart=/bin/sh -c '${CELERY_BIN} -A ${CELERY_APP} beat \ + --pidfile=${CELERYBEAT_PID_FILE} \ + --logfile=${CELERYBEAT_LOG_FILE} --loglevel=${CELERYD_LOG_LEVEL}' +Restart=always + +[Install] +WantedBy=multi-user.target \ No newline at end of file diff --git a/whyis/materialsmine/install_files/etc/apache2/sites-available/000-default.conf b/whyis/materialsmine/install_files/etc/apache2/sites-available/000-default.conf new file mode 100644 index 00000000..a6d7fe33 --- /dev/null +++ b/whyis/materialsmine/install_files/etc/apache2/sites-available/000-default.conf @@ -0,0 +1,23 @@ +WSGIPythonHome $PYTHON_HOME + + + WSGIDaemonProcess whyis user=$WHYIS_USER group=$WHYIS_GROUP threads=5 home=$WHYIS_APP_HOME + WSGIScriptAlias / $WHYIS_APP_HOME/wsgi.py + + + WSGIProcessGroup whyis + WSGIApplicationGroup %{GLOBAL} + + Order allow,deny + Allow from all + + = 2.3> + Require all granted + + + Header set Access-Control-Allow-Origin "*" + + + + +# vim: syntax=apache ts=4 sw=4 sts=4 sr noet diff --git a/whyis/materialsmine/install_files/etc/conf.d/celery b/whyis/materialsmine/install_files/etc/conf.d/celery new file mode 100644 index 00000000..19bb6c58 --- /dev/null +++ b/whyis/materialsmine/install_files/etc/conf.d/celery @@ -0,0 +1,26 @@ +# Name of nodes to start +# here we have a single node +CELERYD_NODES="w1" + +# Absolute or relative path to the 'celery' command: +CELERY_BIN="$PYTHON_HOME/bin/celery" + +# App instance to use +CELERY_APP="wsgi.celery" + +# How to call manage.py +CELERYD_MULTI="multi" + +# Extra command-line arguments to the worker +CELERYD_OPTS="--time-limit=300 --concurrency=8" + +# - %n will be replaced with the first part of the nodename. +# - %I will be replaced with the current child process index +# and is important when using the prefork pool to avoid race conditions. +CELERYD_PID_FILE="/var/run/celery/%n.pid" +CELERYD_LOG_FILE="/var/log/celery/%n%I.log" +CELERYD_LOG_LEVEL="INFO" + +# you may wish to add these options for Celery Beat +CELERYBEAT_PID_FILE="/var/run/celery/beat.pid" +CELERYBEAT_LOG_FILE="/var/log/celery/beat.log" \ No newline at end of file diff --git a/whyis/materialsmine/install_files/etc/default/celeryd b/whyis/materialsmine/install_files/etc/default/celeryd new file mode 100644 index 00000000..efc5d9c5 --- /dev/null +++ b/whyis/materialsmine/install_files/etc/default/celeryd @@ -0,0 +1,41 @@ +# Edit the options in this file to match your projects environment. +# See http://ask.github.com/celery/cookbook/daemonizing.html for the complete +# documentation on the options. + +# WARNING: This script is only designed to run the worker(s) for a single +# project. If you need to start workers for multiple projects you should +# consider using supervisor. +# Examples can be found in /usr/share/doc/python-celery/supervisord/ + +# Change this to true when done to enable the init.d script. +# Default: false +ENABLED="true" + +# Name of nodes to start +# here we have a single node +CELERYD_NODES="w1" +# or we could have three nodes: +#CELERYD_NODES="w1 w2 w3" + +# Where to chdir at start. +CELERYD_CHDIR="/apps/whyis" +CELERYBEAT_CHDIR=$CELERYD_CHDIR + +ENV_PYTHON="$CELERYD_CHDIR/venv/bin/python" + +# Extra arguments to celeryd +CELERYD_OPTS="-A wsgi.celery --concurrency=4" +CELERYBEAT_OPTS="-A wsgi.celery" + +# Name of the celery config module. +#CELERY_CONFIG_MODULE="wsgi.celery" +CELERY_BIN=$CELERYD_CHDIR"/venv/bin/celery" + +# %n will be replaced with the nodename. +CELERYD_LOG_FILE="/var/log/celery/%n.log" + +# Workers should run as an unprivileged user. +CELERYD_USER="whyis" +CELERYD_GROUP="whyis" +CELERYBEAT_USER=$CELERYD_USER +CELERYBEAT_GROUP=$CELERYD_GROUP diff --git a/whyis/materialsmine/install_files/fuseki.service b/whyis/materialsmine/install_files/fuseki.service new file mode 100644 index 00000000..37e767e9 --- /dev/null +++ b/whyis/materialsmine/install_files/fuseki.service @@ -0,0 +1,58 @@ +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. +# +# ========= +# +# Fuseki service configuration / unit file for systemd +# +# Usage: +# ------ +# +# 1. Place this file under /etc/systemd/system/ +# 2. Create a system user called "$WHYIS_USER" and make sure it has permission +# to access the Fuseki configuration and databases +# 3. Adjust the paths and other settings below if necessary +# 4. Activate using: sudo systemctl enable fuseki.service + +[Unit] +Description=Fuseki + +[Service] +# Edit environment variables to match your installation +Environment=FUSEKI_BASE=$WHYIS_APP_HOME/fuseki +# Edit the line below to adjust the amount of memory allocated to Fuseki +Environment=JVM_ARGS=-Xmx4G +# Edit to match your installation +ExecStart=$FUSEKI_SERVER +# Run as user "$WHYIS_USER" +User=$WHYIS_USER +Restart=on-abort +# Java processes exit with status 143 when terminated by SIGTERM, this +# should be considered a successful shutdown +SuccessExitStatus=143 +### By default, the service logs to journalctl only. +### If additional logging to a file is required, uncomment the following three lines +# StandardOutput=syslog +# StandardError=syslog +# SyslogIdentifier=fuseki +### This logs to syslog. If, e.g., rsyslogd is used, you can provide a file +### /etc/rsyslog.d/fuseki.conf, consisting of the following two lines (uncommented) +### if $programname == 'fuseki' then /var/log/fuseki/stderrout.log +### if $programname == 'fuseki' then stop + + +[Install] +WantedBy=multi-user.target diff --git a/whyis/materialsmine/install_files/system.conf b/whyis/materialsmine/install_files/system.conf new file mode 100644 index 00000000..30415fab --- /dev/null +++ b/whyis/materialsmine/install_files/system.conf @@ -0,0 +1,51 @@ +import logging +from datetime import datetime, timedelta + +from authenticator import JWTAuthenticator + +authenticator_config = [] # set into config dict later +authenticator_secret = os.environ.get('NM_GRAPH_AUTH_SECRET', None) +if authenticator_secret: + authenticator_config.append(JWTAuthenticator(key=authenticator_secret)) + +AUTHENTICATORS = authenticator_config + +DEBUG=False + +# LOGGING +LOGGER_NAME = "whyis_log" +LOG_FILENAME = "/var/log/whyis/output-whyis-%s.log" % (str(datetime.now()).replace(' ','_')) +LOG_LEVEL = logging.INFO +LOG_FORMAT = "%(asctime)s %(levelname)s\t: %(message)s" # used by logging.Formatter + +PERMANENT_SESSION_LIFETIME = timedelta(days=7) +# EMAIL CONFIGURATION +## MAIL_SERVER = "smtp.mailgun.org" +## MAIL_PORT = 587 +## MAIL_USE_TLS = True +## MAIL_USE_SSL = False +## MAIL_DEBUG = False +## MAIL_USERNAME = '' +## MAIL_PASSWORD = '' +## DEFAULT_MAIL_SENDER = "Whyis Admin " +EMBEDDED_FUSEKI = False +ADMIN_ENDPOINT = 'http://localhost:3030/admin/sparql' + +KNOWLEDGE_ENDPOINT = 'http://localhost:3030/knowledge/sparql' + +EMBEDDED_CELERY = False +CELERY_BROKER_URL = 'redis://localhost:6379/0' +CELERY_RESULT_BACKEND = 'redis://localhost:6379/0' + +NANOPUB_ARCHIVE = { + 'depot.storage_path' : "$WHYIS_APP_HOME/nanopublications", +} +FILE_ARCHIVE = { + 'cache_max_age' : 3600*24*7, + 'depot.storage_path' : '$WHYIS_APP_HOME/files' +} +CACHE_TYPE = "redis" # Flask-Caching related configs +CACHE_KEY_PREFIX = 'whyis_cache_' +CACHE_REDIS_URL = 'redis://localhost:6379/0' +CACHE_DEFAULT_TIMEOUT = 0 +MULTIUSER = True diff --git a/whyis/materialsmine/materialsmine/__init__.py b/whyis/materialsmine/materialsmine/__init__.py new file mode 100644 index 00000000..02c597e1 --- /dev/null +++ b/whyis/materialsmine/materialsmine/__init__.py @@ -0,0 +1 @@ +from . import agent diff --git a/whyis/materialsmine/materialsmine/agent.py b/whyis/materialsmine/materialsmine/agent.py new file mode 100644 index 00000000..70683701 --- /dev/null +++ b/whyis/materialsmine/materialsmine/agent.py @@ -0,0 +1,11 @@ +import whyis.autonomic +from rdflib import * +from slugify import slugify +import whyis.nanopub + +sioc_types = Namespace("http://rdfs.org/sioc/types#") +sioc = Namespace("http://rdfs.org/sioc/ns#") +sio = Namespace("http://semanticscience.org/resource/") +dc = Namespace("http://purl.org/dc/terms/") +prov = whyis.autonomic.prov +whyis = whyis.autonomic.whyis diff --git a/whyis/materialsmine/nanomine.ttl b/whyis/materialsmine/nanomine.ttl new file mode 100644 index 00000000..9dce8b18 --- /dev/null +++ b/whyis/materialsmine/nanomine.ttl @@ -0,0 +1,3240 @@ +@prefix : . +@prefix bibo: . +@prefix dc: . +@prefix nanomine: . +@prefix owl: . +@prefix prov: . +@prefix rdfs: . +@prefix sio: . +@prefix skos: . + +<<<<<<< HEAD + a owl:Class ; +======= + a owl:Class ; +>>>>>>> nanomine/master + rdfs:label "Author", + "DOI", + "Date of Citation", + "Date of Measurement", + "Date of Sample Made", + "Edition", + "Editor", + "ISBN", + "ISSN", + "Institution or Lab", + "Issue", + "Keyword", + "Language", + "Publication Year", + "Publisher", + "Title", + "URL", + "Volume", + "nan", + "related DOI" ; +<<<<<<< HEAD + nanomine:hasSelector "//DegreeOfCrystallization", + "//Rheological", + "//Volumetric", + "//WeibullParameter" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf prov:Agent . + +:ns a owl:Ontology ; + rdfs:label "Nanomaterials Ontology" ; + dc:creator , + , + , + ; + rdfs:comment "A nanomaterials ontology to support data publication using Nanomine." ; + owl:imports bibo:, + , + . + +nanomine:AC_DielectricConstant a owl:Class ; + rdfs:label "AC Dielectric Constant" ; + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:AC_DielectricDispersion a owl:Class ; + rdfs:label "AC Dielectric Dispersion" ; +<<<<<<< HEAD + nanomine:hasSelector "//AC_DielectricDispersion" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "Frequency dependent dielectric constant" . + +nanomine:Abbreviation a owl:Class ; + rdfs:label "Abbreviation" ; + rdfs:subClassOf sio:Name ; + skos:definition "a shortened form of a word or phrase. It consists of a group of letters taken from the word or phrase." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Abbreviation" . + +nanomine:Air a owl:Class ; + rdfs:label "Air" ; + rdfs:subClassOf nanomine:AmbientCondition . + +nanomine:ArcResistance a owl:Class ; + rdfs:label "Arc Resistance" ; +<<<<<<< HEAD + nanomine:hasSelector "//ArcResistance" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "A measure of the durability of an insulating or dielectric material against the formation of conductive paths along thesurface by arc discharges." . + +nanomine:AspectRatio a owl:Class ; + rdfs:label "Aspect Ratio" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "is the ratio of its sizes in different dimensions. For example, the aspect ratio of a rectangle is the ratio of its longer side to its shorter side – the ratio of width to height, when the rectangle is oriented as a \"landscape\"." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Aspect_ratio" . + +nanomine:Atactic a owl:Class ; + rdfs:label "Atactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition "In atactic macromolecules the substituents are placed randomly along the chain. The percentage of meso diads is between 1 and 99%. With the aid of spectroscopic techniques such as NMR it is possible to pinpoint the composition of a polymer in terms of the percentages for each triad." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Atactic_polymers" . + +nanomine:AtomicForceMicroscopy a owl:Class ; + rdfs:label "Atomic Force Microscopy" ; + nanomine:hasSelector "//Atomic_Force_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:ViscoelasticProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:MechanicalProperty ], +======= + owl:someValuesFrom nanomine:MechanicalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], +>>>>>>> nanomine/master + sio:Measuring ; + skos:definition "Nanoscale probing of material surface characteristics" . + +nanomine:BallMilling a owl:Class ; + rdfs:label "Ball Milling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Grinding process with rotating cylindrical shells and ball " . + +nanomine:BarrelTemperature a owl:Class ; + rdfs:label "Barrel Temperature" ; + rdfs:subClassOf . + +nanomine:Book a owl:Class ; + rdfs:label "Book" . + +nanomine:BreakdownStrength a owl:Class ; + rdfs:label "Breakdown Strength" ; + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:BrittleTemperature a owl:Class ; + rdfs:label "Brittle Temperature" ; +<<<<<<< HEAD + nanomine:hasSelector "//BrittleTemperature" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "Brittleness temperature is the temperature at which 50% of the tested specimens exhibit brittle failure at specified impact conditions" . + +nanomine:CU_Formula a owl:Class ; + rdfs:label "Constitutional Unit Formula" ; + rdfs:subClassOf sio:Name ; + skos:definition "a way of expressing information about the proportions of atoms that constitute a particular chemical compound, using a single line of chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas and plus (+) and minus (−) signs. " ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Chemical_formula" . + +nanomine:Casting a owl:Class ; + rdfs:label "Casting" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:Centrifugation a owl:Class ; + rdfs:label "Centrifugation" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "process which involves the application of the centripetal force for the sedimentation of heterogeneous mixtures with a centrifuge" . + +nanomine:CharpyImpactEnergy a owl:Class ; + rdfs:label "Charpy Impact Energy" ; +<<<<<<< HEAD + nanomine:hasSelector "//CharpyImpactEnergy" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:MechanicalProperty ; + skos:definition "Energy absorbed by the sample during Charpy impact testing" . + +nanomine:ChemicalUsed a owl:Class ; + rdfs:label "Chemical Used" ; + rdfs:subClassOf sio:ChemicalEntity . + +nanomine:CoRotation a owl:Class ; + rdfs:label "Co-Rotation" ; + rdfs:subClassOf nanomine:RotationMode . + +nanomine:Communication a owl:Class ; + rdfs:label "Communication" ; + rdfs:subClassOf bibo:AcademicArticle . + +nanomine:Compression a owl:Class ; + rdfs:label "Compression" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing countervailing forces applied inward along the central axis of a material." . + +nanomine:CompressionModulus a owl:Class ; + rdfs:label "Compression Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressionModulus" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressionProperty ; + skos:definition "The ratio of compressive stress to compressive strain" . + +nanomine:CompressionStressAtBreak a owl:Class ; + rdfs:label "Compression Stress At Break" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressionStressAtBreak" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressionProperty ; + skos:definition "Compression stress when specimen breaks" . + +nanomine:CompressionStressAtYield a owl:Class ; + rdfs:label "Compression Stress At Yield" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressionStressAtYield" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressionProperty ; + skos:definition "Compression stress at yield point" . + +nanomine:CompressiveCreepRuptureStrength a owl:Class ; + rdfs:label "Compressive Creep Rupture Strength" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressiveCreepRuptureStrength" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressiveCreep ; + skos:definition "Material strength at rupture during a compressive creep test" . + +nanomine:CompressiveCreepRuptureTime a owl:Class ; + rdfs:label "Compressive Creep Rupture Time" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressiveCreepRuptureTime" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressiveCreep ; + skos:definition "Time taken to rupture from applying load during a compressive creep test" . + +nanomine:CompressiveCreepStrain a owl:Class ; + rdfs:label "Compressive Creep Strain" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressiveCreepStrain" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:CompressiveCreep ; + skos:definition "Profile of strain as a function of time during a compressive creep test" . + +nanomine:CompressiveLoadingProfile a owl:Class ; + rdfs:label "Compressive Loading Profile" ; +<<<<<<< HEAD + nanomine:hasSelector "//Compression/LoadingProfile" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:CompressionProperty ; + skos:definition "Stress vs. strain curve of during compressive loading and/or unloading test" . + +nanomine:CompressiveToughness a owl:Class ; + rdfs:label "Compressive Toughness" ; +<<<<<<< HEAD + nanomine:hasSelector "//CompressiveToughness" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:CompressionProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied compressive load." . + +nanomine:ConePlateRheometery a owl:Class ; + rdfs:label "Cone-Plate Rheometry" ; + nanomine:hasSelector "//Rheometery[RheometerType='cone-plate']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + nanomine:Rheometery ; + skos:definition "The liquid is placed on horizontal plate and a shallow cone placed into it. The angle between the surface of the cone and the plate is around 1–2 degrees but can vary depending on the types of tests being run. Typically the plate is rotated and the torque on the cone measured." . + +nanomine:Constituent a owl:Class ; + rdfs:label "Constituent" . + +nanomine:ConstitutionalUnit a owl:Class ; + rdfs:label "Constitutional Unit" ; + rdfs:subClassOf sio:UnitOfMeasurement . + +nanomine:Cooling a owl:Class ; + rdfs:label "Cooling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], +======= + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + sio:Procedure . + +nanomine:Copolymer a owl:Class ; + rdfs:label "Copolymer" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "polymers containing a mixture of repeat units" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . + +nanomine:CounterRotation a owl:Class ; + rdfs:label "Counter-Rotation" ; + rdfs:subClassOf nanomine:RotationMode . + +nanomine:CrystalPhase a owl:Class ; + rdfs:label "Crystal Phase" ; + rdfs:subClassOf sio:CrystalStructure ; + skos:definition "A single material may have several distinct solid states capable of forming separate phases. Water is a well-known example of such a material. For example, water ice is ordinarily found in the hexagonal form ice Ih, but can also exist as the cubic ice Ic, the rhombohedral ice II, and many other forms. Polymorphism is the ability of a solid to exist in more than one crystal form. For pure chemical elements, polymorphism is known as allotropy. For example, diamond, graphite, and fullerenes are different allotropes of carbon." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Phase_(matter)#Crystal_phases" . + +nanomine:CrystallizationTemperature a owl:Class ; + rdfs:label "Crystallization Temperature" ; +<<<<<<< HEAD + nanomine:hasSelector "//CrystalizationTemperature" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ThermalProperty, + ; + skos:definition "It is the temperature at which a solid phase begins to form, resulting in a mixture of solid particles and solution" . + +nanomine:Curing a owl:Class ; + rdfs:label "Curing" ; + rdfs:subClassOf sio:Procedure . + +nanomine:CurrentDensity a owl:Class ; + rdfs:label "Current Density" ; +<<<<<<< HEAD + nanomine:hasSelector "//CurrentDensity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "the amount of electric current flowing per unit cross-sectional area of a material." . + +nanomine:CycleInformation a owl:Class ; + rdfs:label "Cycle Information" ; + nanomine:hasSelector "//CycleInformation" ; + rdfs:subClassOf sio:InformationContentEntity . + +nanomine:DC_DielectricConstant a owl:Class ; + rdfs:label "DC Dielectric Constant" ; +<<<<<<< HEAD + nanomine:hasSelector "//DC_DielectricConstant" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:DSC_Profile a owl:Class ; + rdfs:label "DSC Profile" ; +<<<<<<< HEAD + nanomine:hasSelector "//DSC_Profile" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ThermalProperty ; + skos:definition "Heat flow vs temperature out of a differential scanning calorimetry experiment" . + +nanomine:DegreeOfCrystallization a owl:Class ; + rdfs:label "Degree of Crystallinity" ; +<<<<<<< HEAD + nanomine:hasSelector "//DegreeOfCrystallinity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "The percentage of the crystallized region in a polymer/material. It describes the extent of the crystallization process" . + +nanomine:Density a owl:Class ; + rdfs:label "Density" ; +<<<<<<< HEAD + nanomine:hasSelector "//Density" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty, + ; + skos:definition "The density, or more precisely, the volumetric mass density, of a substance is its mass per unit volume.", + "degree of consistency measured by the quantity of mass per unit volume" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Density" . + +nanomine:DieDiameter a owl:Class ; + rdfs:label "Die Diameter" ; + rdfs:subClassOf . + +nanomine:DielectricLossPermittivity a owl:Class ; + rdfs:label "Dielectric Loss Permittivity" ; +<<<<<<< HEAD + nanomine:hasSelector "//Dielectric_Loss_Permittivity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:DielectricLossTangent a owl:Class ; + rdfs:label "Dielectric Loss Tangent" ; +<<<<<<< HEAD + nanomine:hasSelector "//Dielectric_Loss_Tangent" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:DielectricRealPermittivity a owl:Class ; + rdfs:label "Dielectric Real Permittivity" ; +<<<<<<< HEAD + nanomine:hasSelector "//Dielectric_Real_Permittivity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:DielectricandImpedanceSpectroscopyAnalysis a owl:Class ; + rdfs:label "Dielectric and Impedance Spectroscopy Analysis" ; + nanomine:hasSelector "//Dielectric_and_Impedance_Spectroscopy_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of dielectric spectroscopy (variation of dielectric constant with frequency) " . + +nanomine:DifferentialScanningCalorimetry a owl:Class ; + rdfs:label "Differential Scanning Calorimetry" ; + nanomine:hasSelector "//Differential_Scanning_Calorimetry" ; + rdfs:subClassOf [ a owl:Restriction ; +<<<<<<< HEAD + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ThermalProperty ], +======= + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:CoolingRate ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:HeatingRate ], + [ a owl:Restriction ; +<<<<<<< HEAD + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:CoolingRate ], +======= + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ThermalProperty ], +>>>>>>> nanomine/master + sio:Measuring ; + skos:definition "Measurement of heat required to increase unit temperature in a material" . + +nanomine:Dissolving a owl:Class ; + rdfs:label "Dissolving" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Solvent ], + sio:Procedure ; + skos:definition "Dissolving into solution without external force" . + +nanomine:Drying-Evaporation a owl:Class ; + rdfs:label "Drying Evaporation" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], +======= + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], +>>>>>>> nanomine/master + sio:Procedure ; + skos:definition "Process for drying and evaporation of liquid solutions" . + +nanomine:DynamicMechanicalAnalysis a owl:Class ; + rdfs:label "Dynamic Mechanical Analysis" ; + nanomine:hasSelector "//Dynamic_Mechanical_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + sio:Measuring ; + skos:definition "Method to get viscoelastic behavior of materials with controlled temperature and frequency" . + +nanomine:DynamicProperty a owl:Class ; + rdfs:label "Dynamic Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//DynamicProperties" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "A materials property representing the behavior of the material under some dynamic environmental force." . + +nanomine:DynamicPropertyProfile a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//DynamicPropertyProfile" . + +nanomine:DynamicViscosity a owl:Class ; + rdfs:label "Dynamic Viscosity" ; + nanomine:hasSelector "//DynamicViscosity" ; +======= + rdfs:label "nan" . + +nanomine:DynamicViscosity a owl:Class ; + rdfs:label "Dynamic Viscosity" ; +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalViscosity . + +nanomine:Elastomer a owl:Class ; + rdfs:label "Elastomer" ; + rdfs:subClassOf nanomine:Plastic ; + skos:definition "a polymer with viscoelasticity (having both viscosity and elasticity) and very weak inter-molecular forces, generally having low Young's modulus and high failure strain compared with other materials." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Elastomer" . + +<<<<<<< HEAD +nanomine:ElectricConductivity a owl:Class ; + rdfs:label "Electric Conductivity" ; + nanomine:hasSelector "//ElectricConductivity" ; +======= +nanomine:ElectricPercolationThreshold a owl:Class ; + rdfs:label "Electric Percolation Threshold" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "minimum filler content in the polymer matrix after which there is no significant change in the electrical properties of the composites." . + +nanomine:ElectricalConductivity a owl:Class ; + rdfs:label "Electric Conductivity" ; + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "ability of electric current to flow through a material" . + +<<<<<<< HEAD +nanomine:ElectricPercolationThreshold a owl:Class ; + rdfs:label "Electric Percolation Threshold" ; + nanomine:hasSelector "//ElectricPercolationThreshold" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "minimum filler content in the polymer matrix after which there is no significant change in the electrical properties of the composites." . + +======= +>>>>>>> nanomine/master +nanomine:Electrometry a owl:Class ; + rdfs:label "Electrometry" ; + nanomine:hasSelector "//Electrometry" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of electric charge or electrical potential difference" . + +nanomine:ElongationAtBreak a owl:Class ; + rdfs:label "Elongation At Break" ; +<<<<<<< HEAD + nanomine:hasSelector "//ElongationAtBreak" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Elongation of specimen when breaks" . + +nanomine:ElongationAtYield a owl:Class ; + rdfs:label "Elongation At Yield" ; +<<<<<<< HEAD + nanomine:hasSelector "//ElongationAtYield" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile elongation corresponding to the yield (an increase in strain does not result in an increase in stress)." . + +nanomine:EnergyDensity a owl:Class ; + rdfs:label "Energy Density" ; +<<<<<<< HEAD + nanomine:hasSelector "//EnergyDensity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "amount of energy stored in a given system or region of space per unit volume or mass" . + +nanomine:Equipment a owl:Class ; + rdfs:label "Equipment", + "Equipment Used" ; + nanomine:hasSelector "//Equipment", + "//EquipmentUsed" ; + rdfs:subClassOf sio:Device . + +nanomine:EssentialWorkOfFracture a owl:Class ; + rdfs:label "Essential Work Of Fracture" ; +<<<<<<< HEAD + nanomine:hasSelector "//EssentialWorkOfFracture" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FractureToughnessProperty ; + skos:definition "Energy associated with cracking at the process zone" . + +nanomine:Eutactic a owl:Class ; + rdfs:label "Eutactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition "In eutactic macromolecules, substituents may occupy any specific (but potentially complex) sequence of positions along the chain. Isotactic and syndiotactic polymers are instances of the more general class of eutactic polymers, which also includes heterogeneous macromolecules in which the sequence consists of substituents of different kinds (for example, the side-chains in proteins and the bases in nucleic acids)." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Eutactic_polymers" . + +nanomine:ExperimentalProcedure a owl:Class ; + rdfs:label "Experimental Procedure" ; + rdfs:subClassOf sio:Procedure . + +nanomine:Experimenter a owl:Class ; + rdfs:label "Experimenter" ; + rdfs:subClassOf prov:Agent . + +nanomine:Extrusion a owl:Class ; + rdfs:label "Extrusion" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Extruder ], + sio:Procedure ; + skos:definition "Process used to create objects of a fixed cross-sectional profile. A material is pushed through a die of the desired cross-section." . + +nanomine:FiberTensileElongation a owl:Class ; + rdfs:label "Fiber Tensile Elongation" ; +<<<<<<< HEAD + nanomine:hasSelector "//FiberTensileElongation" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Elongation along grain direction in fibers" . + +nanomine:FiberTensileModulus a owl:Class ; + rdfs:label "Fiber Tensile Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//FiberTensileModulus" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile modulus along grain direction in fibers" . + +nanomine:FiberTensileStrength a owl:Class ; + rdfs:label "Fiber Tensile Strength" ; +<<<<<<< HEAD + nanomine:hasSelector "//FiberTensileStrength" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile Stress along grain direction in fibers" . + +nanomine:Filler a owl:Class ; + rdfs:label "Filler" ; + rdfs:subClassOf sio:Role . + +<<<<<<< HEAD +nanomine:FillerComponent a owl:Class ; + rdfs:label "Filler Component" ; + rdfs:subClassOf nanomine:Component . + +======= +>>>>>>> nanomine/master +nanomine:FillerComponentComposition a owl:Class ; + rdfs:label "Filler Component Composition" ; + rdfs:subClassOf nanomine:Composition . + +<<<<<<< HEAD +======= +nanomine:FillerComponentInComposite a owl:Class ; + rdfs:label "Filler Component in Composite" ; + rdfs:subClassOf nanomine:FillerComponent . + +>>>>>>> nanomine/master +nanomine:FillerComposition a owl:Class ; + rdfs:label "Filler Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:FillerProcessing a owl:Class ; + rdfs:label "Filler Processing" ; + rdfs:subClassOf nanomine:Processing . + +nanomine:FlexuralCreepRuptureStrength a owl:Class ; + rdfs:label "Flexural Creep Rupture Strength" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralCreepRuptureStrength" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralCreep ; + skos:definition "Material strength at rupture during a flexural creep test" . + +nanomine:FlexuralCreepRuptureTime a owl:Class ; + rdfs:label "Flexural Creep Rupture Time" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralCreepRuptureTime" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralCreep ; + skos:definition "Time taken to rupture from applying load during a flexural creep test" . + +nanomine:FlexuralCreepStrain a owl:Class ; + rdfs:label "Flexural Creep Strain" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralCreepStrain" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:FlexuralCreep ; + skos:definition "Profile of strain as a function of time during a flexural creep test" . + +nanomine:FlexuralLoadingProfile a owl:Class ; + rdfs:label "Flexural Loading Profile" ; +<<<<<<< HEAD + nanomine:hasSelector "//Flexural/LoadingProfile" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:FlexuralProperty ; + skos:definition "Stress vs. strain curve of during flexural loading and/or unloading test" . + +nanomine:FlexuralModulus a owl:Class ; + rdfs:label "Flexural Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralModulus" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralProperty ; + skos:definition "Ratio of stress to strain in flexural deformation, or the tendency for a material to bend" . + +nanomine:FlexuralStressAtBreak a owl:Class ; + rdfs:label "Flexural Stress At Break" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralStressAtBreak" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralProperty ; + skos:definition "Flexural stress at the moment at which a test specimen tears" . + +nanomine:FlexuralStressAtYield a owl:Class ; + rdfs:label "Flexural Stress At Yield" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralStressAtYield" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralProperty ; + skos:definition "Flexural stress corresponding to the yield point" . + +nanomine:FlexuralToughness a owl:Class ; + rdfs:label "Flexural Toughness" ; +<<<<<<< HEAD + nanomine:hasSelector "//FlexuralToughness" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:FlexuralProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied flexural load." . + +nanomine:FourierTransformInfraredSpectroscopy a owl:Class ; + rdfs:label "Fourier Transform Infrared Spectroscopy" ; + nanomine:hasSelector "//Fourier_Transform_Infrared_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Measurement of infrared spectrum of absorption or emission of a solid, liquid or gas" . + +nanomine:FractureEnergy a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//FractureEnergy" . + +nanomine:FrequencySweep a owl:Class ; + rdfs:label "nan" ; + nanomine:hasSelector "//FrequencySweep" . + +nanomine:GlassTransitionTemperature a owl:Class ; + rdfs:label "Glass Transition Temperature" ; + nanomine:hasSelector "//GlassTransitionTemperature" ; +======= + rdfs:label "nan" . + +nanomine:FrequencySweep a owl:Class ; + rdfs:label "nan" . + +nanomine:GlassTransitionTemperature a owl:Class ; + rdfs:label "Glass Transition Temperature" ; + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "is the temperature region where the polymer transitions from a hard, glassy material to a soft, rubbery material." . + +nanomine:GraftDensity a owl:Class ; + rdfs:label "Graft Density" ; + rdfs:subClassOf sio:Density ; + skos:definition "A result of surface treatment process, the graft density quantifies the area density of surface-treatment molecules on the surface of the filler, typically in units of chains/nm^2." . + +nanomine:GrowthRateOfCrystal a owl:Class ; + rdfs:label "Growth Rate Of Crystal" ; +<<<<<<< HEAD + nanomine:hasSelector "//GrowthRateOfCrystal" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "Rate of the crystallization process" . + +nanomine:GrowthRateParameterOfAvramiEquation a owl:Class ; + rdfs:label "Growth Rate Parameter Of Avrami Equation" ; +<<<<<<< HEAD + nanomine:hasSelector "//GrowthRateParameterOfAvramiEquation" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "Growth Rate Parameter in Avrami Equation" . + +nanomine:HalflifeOfCrystallization a owl:Class ; + rdfs:label "Halflife Of Crystallization" ; +<<<<<<< HEAD + nanomine:hasSelector "//HalflifeOfCrystallization" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "The time required for half of a material to form a crystalline structure under some condition." . + +nanomine:Hardener a owl:Class ; + rdfs:label "Hardener" ; + rdfs:subClassOf nanomine:Additive ; + skos:definition "A chemical additive that increases the viscosity of a polymer." . + +nanomine:HardnessScale a owl:Class ; + rdfs:label "Hardness Scale" ; +<<<<<<< HEAD + nanomine:hasSelector "//HardnessScale" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:HardnessProperty ; + skos:definition "A standard numerical scale associated with a particular hardness test tip geometry." . + +nanomine:HardnessTestStandard a owl:Class ; + rdfs:label "Hardness Test Standard" ; +<<<<<<< HEAD + nanomine:hasSelector "//HardnessTestStandard" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:HardnessProperty ; + skos:definition "A materials testing standard, created by a standards body such as ASTM, defining test parameters such as pre-load, load, and tip geometry of the testing apparatus." . + +nanomine:HardnessValue a owl:Class ; + rdfs:label "Hardness Value" ; +<<<<<<< HEAD + nanomine:hasSelector "//HardnessValue" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:HardnessProperty ; + skos:definition "The numerical value of hardness output by the testing apparatus, given a particular hardness scale as input." . + +nanomine:HeatOfCrystallization a owl:Class ; + rdfs:label "Heat Of Crystallization" ; +<<<<<<< HEAD + nanomine:hasSelector "//HeatOfCrystallization" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "The amount of heat that must be removed from one gram of a liquid at its freezing point to freeze it with no change in temperature." . + +nanomine:HeatOfFusion a owl:Class ; + rdfs:label "Heat Of Fusion" ; +<<<<<<< HEAD + nanomine:hasSelector "//HeatOfFusion" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "change in enthalpy with energy dissipation" . + +nanomine:Heating a owl:Class ; + rdfs:label "Heating" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], +======= + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + sio:Procedure ; + skos:definition "Process for applying heat" . + +nanomine:HeatingZone a owl:Class ; + rdfs:label "Heating Zone" ; + rdfs:subClassOf sio:SpatialRegion . + +nanomine:HeatingZoneNumber a owl:Class ; + rdfs:label "Heating Zone Number" ; + rdfs:subClassOf sio:Number . + +nanomine:HighPressureCapillaryRheometery a owl:Class ; + rdfs:label "High Pressure Capillary Rheometry" ; + nanomine:hasSelector "//Rheometery[RheometerType='high pressure capillary']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + nanomine:Rheometery . + +nanomine:HighShearMixing a owl:Class ; + rdfs:label "High Shear Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "A stator-rotator setup that disperses substance into continuous phase through high shear" . + +nanomine:Homopolymer a owl:Class ; + rdfs:label "Homopolymer" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "polymers that contain only a single type of repeat unit" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . + +nanomine:HotPressing a owl:Class ; + rdfs:label "Hot-Processing (Compression Molding)" ; + rdfs:subClassOf nanomine:Molding ; + skos:definition "Applying heat and pressure" . + +nanomine:IZOD_Area a owl:Class ; + rdfs:label "IZOD Area" ; +<<<<<<< HEAD + nanomine:hasSelector "//IZOD_Area" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:MechanicalProperty ; + skos:definition "Area associated in Izod impact testing" . + +nanomine:IZOD_ImpactEnergy a owl:Class ; + rdfs:label "IZOD Impact Energy" ; +<<<<<<< HEAD + nanomine:hasSelector "//IZOD_ImpactEnergy" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:MechanicalProperty ; + skos:definition "Energy absorbed by the sample during Izod impact testing, as calculated by the height of swing arm" . + +nanomine:ImpactToughness a owl:Class ; + rdfs:label "Impact Toughness" ; +<<<<<<< HEAD + nanomine:hasSelector "//ImpactToughness" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Impact ; + skos:definition "The amount of impact energy a material can absorb prior to fracture." . + +nanomine:Impedance a owl:Class ; + rdfs:label "Impedance" ; +<<<<<<< HEAD + nanomine:hasSelector "//Impedance" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:In-SituPolymerization a owl:Class ; + rdfs:label "In-Situ Polymerization" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of nanoparticles within liquid monomer so that polymer formation results in embedding of particles" . + +nanomine:Inert a owl:Class ; + rdfs:label "Inert" ; + rdfs:subClassOf nanomine:AmbientCondition . + +nanomine:InjectionMolding a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:InterfacialTension a owl:Class ; + rdfs:label "Interfacial Tension" ; +<<<<<<< HEAD + nanomine:hasSelector "//InterfacialTension" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "Interfacial tension is the force that holds the surfaceof a particular phase together" . + +nanomine:InterphaseThickness a owl:Class ; + rdfs:label "Interphase Thickness" ; +<<<<<<< HEAD + nanomine:hasSelector "//InterphaseThickness" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "Thickness of matrix-particle interaction area with a gradient property as a function of distance from particle surface" . + +nanomine:Isotactic a owl:Class ; + rdfs:label "Isotactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition """Isotactic polymers are composed of isotactic macromolecules (IUPAC definition). In isotactic macromolecules all the substituents are located on the same side of the macromolecular backbone. An isotactic macromolecule consists of 100% meso diads. Polypropylene formed by Ziegler-Natta catalysis is an isotactic polymer. Isotactic polymers are usually semicrystalline and often form a helix configuration. + +""" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Isotactic_polymers" . + +nanomine:JIntegral a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//J-integral" . +======= + rdfs:label "nan" . +>>>>>>> nanomine/master + +nanomine:Journal a owl:Class ; + rdfs:label "Journal" . + +nanomine:KFactor a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//K-factor" . + +nanomine:LC_PhaseTransitionTemperature a owl:Class ; + rdfs:label "LC Phase Transition Temperature" ; + nanomine:hasSelector "//LC_PhaseTransitionTemperature" ; +======= + rdfs:label "nan" . + +nanomine:LC_PhaseTransitionTemperature a owl:Class ; + rdfs:label "LC Phase Transition Temperature" ; + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "temperature of transition to liquid crystal phase" . + +nanomine:LengthOfHeatingZone a owl:Class ; + rdfs:label "Length Of Heating Zone" ; + rdfs:subClassOf sio:Length . + +nanomine:LinearElastic a owl:Class ; + rdfs:label "Linear Elastic" ; +<<<<<<< HEAD + nanomine:hasSelector "//LinearElastic" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:FractureToughnessProperty ; + skos:definition "Infinitesimal material deformation or deformation within the linear regime" . + +nanomine:LinearExpansionCoefficient a owl:Class ; + rdfs:label "Linear Expansion Coefficient" ; +<<<<<<< HEAD + nanomine:hasSelector "//LinearExpansionCoefficient" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "It is the fractional change in length per degree of temperature change" . + +nanomine:ManufacturerOrSourceName a owl:Class ; + rdfs:label "Manufacturer Or Source Name" ; + rdfs:subClassOf sio:Organization ; + skos:definition "An organization that enages in the value added production of merchandise for use or sale using labour and machines, tools, chemical and biological processing, or formulation." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Manufacturing" . + +nanomine:MassFraction a owl:Class ; + rdfs:label "Mass Fraction" ; + rdfs:subClassOf sio:Concentration . + +nanomine:MasterCurve a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//MasterCurve" . +======= + rdfs:label "nan" . +>>>>>>> nanomine/master + +nanomine:Matrix a owl:Class ; + rdfs:label "Matrix" ; + rdfs:subClassOf sio:Role . + +nanomine:MatrixComponent a owl:Class ; + rdfs:label "Matrix Component" ; + rdfs:subClassOf nanomine:Component . + +nanomine:MatrixComponentComposition a owl:Class ; + rdfs:label "Matrix Component Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:MatrixProcessing a owl:Class ; + rdfs:label "Matrix Processing" ; + rdfs:subClassOf nanomine:Processing . + +nanomine:MeasurementMethod a owl:Class ; + rdfs:label "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//MeasurementMethod" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Measuring . + +nanomine:MechanicalMixing a owl:Class ; + rdfs:label "Mechanical Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Manual mixing" . + +nanomine:MeltMixing a owl:Class ; + rdfs:label "Melt Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Mixing of polymer and nanoparticles in molten state" . + +nanomine:MeltProcessing a owl:Class ; + rdfs:label "Melt Processing" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of polymer and nanoparticles in molten state" . + +nanomine:MeltViscosity a owl:Class ; + rdfs:label "Melt Viscosity" ; +<<<<<<< HEAD + nanomine:hasSelector "//MeltViscosity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalViscosity . + +nanomine:MeltingTemperature a owl:Class ; + rdfs:label "Melting Temperature" ; +<<<<<<< HEAD + nanomine:hasSelector "//MeltingTemperature" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "the temperature at which a solid turns into a liquid" . + +nanomine:Mixer a owl:Class ; + rdfs:label "Mixer" ; + rdfs:subClassOf sio:Device . + +nanomine:MixingMethod a owl:Class ; + rdfs:label "Mixing Method" ; + rdfs:subClassOf sio:Procedure . + +nanomine:MolecularWeight_Mn a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf sio:Mass ; + skos:altLabel "Number Average Molar Mass" ; + skos:definition "Mn, the number averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the arithmetic mean of the matrix polymer chains." . + +nanomine:MolecularWeight_Mw a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf sio:Mass ; + skos:altLabel "Mass Average Molar Mass" ; + skos:definition "Mw, the weight averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the average size of the matrix polymer chains." . + +nanomine:NonSpherical a owl:Class ; + rdfs:label "Non-spherical Shape" ; + rdfs:subClassOf sio:Shape . + +nanomine:Notched a owl:Class ; + rdfs:label "Notched" ; +<<<<<<< HEAD + nanomine:hasSelector "//Notch" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:MechanicalProperty, + sio:Quality ; + skos:definition "Property of a material sample, in which a uniform notch has been created for the purpose of concentrating stress in a region of interest." . + +nanomine:NuclearMagneticResonance a owl:Class ; + rdfs:label "Nuclear Magnetic Resonance" ; + nanomine:hasSelector "//Nuclear_Magnetic_Resonance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Molecular analysis due to observed NMR under applied magnetic field" . + +nanomine:NucleationParameterOfAvramiEquation a owl:Class ; + rdfs:label "Nucleation Parameter Of Avrami Equation" ; +<<<<<<< HEAD + nanomine:hasSelector "//NucleationParameterOfAvramiEquation" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "Nucleation Parameter in Avrami Equation" . + +nanomine:OpticalMicroscopy a owl:Class ; + rdfs:label "Optical Microscopy" ; + nanomine:hasSelector "//OpticalMicroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:ViscoelasticProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:MechanicalProperty ], +======= + owl:someValuesFrom nanomine:MechanicalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], +>>>>>>> nanomine/master + sio:Measuring ; + skos:definition "Magnification of small objects with visible light" . + +nanomine:Other a owl:Class ; + rdfs:label "Other Processing Parameter" ; + rdfs:subClassOf sio:Procedure . + +nanomine:OtherProcessing a owl:Class ; + rdfs:label "Other Processing" ; + rdfs:subClassOf sio:Procedure . + +nanomine:Other_Processing a owl:Class ; + rdfs:label "Other Processing" ; + rdfs:subClassOf sio:Procedure . + +nanomine:Output a owl:Class ; + rdfs:label "Output" . + +nanomine:Particle a owl:Class ; + rdfs:label "Particle" ; + rdfs:subClassOf nanomine:Nanomaterial ; + skos:definition "particles between 1 and 100 nanometers in size. In nanotechnology, a particle is defined as a small object that behaves as a whole unit with respect to its transport and properties." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanoparticle" . + +nanomine:ParticleDiameter a owl:Class ; + rdfs:label "Particle Diameter" ; + rdfs:subClassOf sio:MeasurementValue ; + skos:definition "Assuming sphere-like particles comprising the filler, the particle diameter is the \"average\" diameter of those particles." . + +nanomine:ParticleSurfaceTreatmentComposition a owl:Class ; + rdfs:label "Particle Surface Treatment Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:PlasticElastic a owl:Class ; + rdfs:label "Plastic Elastic" ; +<<<<<<< HEAD + nanomine:hasSelector "//PlasticElastic" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:FractureToughnessProperty ; + skos:definition "Material deformation that undergoes both elastic and plastic deformation" . + +nanomine:PlateRheometery a owl:Class ; + rdfs:label "Plate Rheometry" ; + nanomine:hasSelector "//Rheometery[RheometerType='plate']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + nanomine:Rheometery ; + skos:definition "The falling plate rheometer sandwiches liquid between two solid surfaces. The top plate is fixed, and bottom plate falls under the influence of gravity, drawing out a string of the liquid" . + +nanomine:PoissonsRatio a owl:Class ; + rdfs:label "Poissons Ratio" ; +<<<<<<< HEAD + nanomine:hasSelector "//PoissonsRatio" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "Negative ratio of traverse to axial strain" . + +nanomine:Polydispersity a owl:Class ; + rdfs:label "Polydispersity" ; + rdfs:subClassOf sio:SpatialQuantity ; + skos:altLabel "Dispersity" . + +nanomine:PolymerBlend a owl:Class ; + rdfs:label "Polymer Blend" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "a member of a class of materials analogous to metal alloys, in which at least two polymers are blended together to create a new material with different physical properties." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_blend" . + +nanomine:PolymerNanocomposite a owl:Class ; + rdfs:label "Polymer Nanocomposite" ; + rdfs:subClassOf nanomine:Nanocomposite ; + skos:altLabel "PNC" ; + skos:definition "Polymer nanocomposites (PNC) consist of a polymer or copolymer having nanoparticles or nanofillers dispersed in the polymer matrix. These may be of different shape (e.g., platelets, fibers, spheroids), but at least one dimension must be in the range of 1–50 nm." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_nanocomposite" . + +nanomine:Power a owl:Class ; + rdfs:label "Power" ; + rdfs:subClassOf sio:Quantity . + +nanomine:PreCrackingProcess a owl:Class ; + rdfs:label "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//preCrackingProcess" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Procedure . + +nanomine:PreLoad a owl:Class ; + rdfs:label "Pre-Load" ; +<<<<<<< HEAD + nanomine:hasSelector "//PreLoad" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:Condition ; + skos:definition "Pre-stress or pre-strain before testing" . + +nanomine:ProbabilityOfFailure a owl:Class ; + rdfs:label "Probability of Failure" ; + rdfs:subClassOf nanomine:ElectricalProperty . + +nanomine:ProceedingsArticle a owl:Class ; + rdfs:label "Conference Proceedings Article" ; + rdfs:subClassOf bibo:AcademicArticle ; + skos:definition "An article published in the proceedings of a conference." . + +nanomine:Profile a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//profile" . +======= + rdfs:label "nan" . +>>>>>>> nanomine/master + +nanomine:PubChemReference a owl:Class ; + rdfs:label "PubChem Reference" ; + rdfs:subClassOf sio:Reference . + +nanomine:PulsedElectroAcoustic a owl:Class ; + rdfs:label "Pulsed Electro Acoustic" ; + nanomine:hasSelector "//Pulsed_Electro_Acoustic" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of space charge in dielectric materials" . + +nanomine:RadialClearence a owl:Class ; + rdfs:label "Radial Clearence" ; + rdfs:subClassOf nanomine:Dimension, + sio:Height . + +nanomine:RamanSpectroscopy a owl:Class ; + rdfs:label "Raman Spectroscopy" ; + nanomine:hasSelector "//Raman_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Molecular analysis with spectroscopic techniques that observe low-frequency modes in a material" . + +nanomine:ResearchArticle a owl:Class ; + rdfs:label "Research Article" ; + rdfs:subClassOf bibo:AcademicArticle . + +nanomine:ReviewArticle a owl:Class ; + rdfs:label "Review Article" ; + rdfs:subClassOf bibo:AcademicArticle . + +nanomine:RheologicalLossModulus a owl:Class ; + rdfs:label "Rheological Loss Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheologicalLossModulus" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalComplexModulus . + +nanomine:RheologicalLossTangent a owl:Class ; + rdfs:label "Rheological Loss Tangent" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheologicalLossTangent" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalComplexModulus . + +nanomine:RheologicalMasterCurve a owl:Class ; + rdfs:label "Rheological Master Curve" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheologicalMasterCurve" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalComplexModulus . + +nanomine:RheologicalStorageModulus a owl:Class ; + rdfs:label "Rheological Storage Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheologicalStorageModulus" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalComplexModulus . + +nanomine:RheometerMode a owl:Class ; + rdfs:label "Rheometer Mode" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheometerMode" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalComplexModulus, + nanomine:RheologicalViscosity . + +nanomine:RollMilling a owl:Class ; + rdfs:label "Roll Milling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Grinding process with a roller and flat plate" . + +nanomine:RotationSpeed a owl:Class ; + rdfs:label "Rotation Speed" ; + rdfs:subClassOf sio:Speed . + +nanomine:RotationalMolding a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:SMILES a owl:Class ; + rdfs:label "SMILES" ; + rdfs:subClassOf sio:Representation . + +nanomine:ScanningElectronMicroscopy a owl:Class ; + rdfs:label "Scanning Electron Microscopy" ; + nanomine:hasSelector "//Scanning_Electron_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:EmissionCurrent ], +======= + owl:someValuesFrom nanomine:Magnification ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:WorkingDistance ], + [ a owl:Restriction ; + owl:onProperty prov:used ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:ExposureTime ], +======= + owl:someValuesFrom nanomine:EmissionCurrent ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:AcceleratingVoltage ], + [ a owl:Restriction ; + owl:onProperty prov:used ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:Magnification ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], +======= + owl:someValuesFrom nanomine:ExposureTime ], +>>>>>>> nanomine/master + sio:Measuring ; + skos:definition "Scanning electron microscopy for obtaining microstructure at microscale" . + +nanomine:ScrewChannelDiameter a owl:Class ; + rdfs:label "Screw Channel Diameter" ; + rdfs:subClassOf . + +nanomine:Shear a owl:Class ; + rdfs:label "Shear" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing opposing in-plane forces on a material." . + +nanomine:ShearLoadingProfile a owl:Class ; + rdfs:label "Shear Loading Profile" ; +<<<<<<< HEAD + nanomine:hasSelector "//Shear/LoadingProfile" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ShearProperty ; + skos:definition "Stress vs. strain curve of during shear loading and/or unloading test" . + +nanomine:ShearModulus a owl:Class ; + rdfs:label "Shear Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//ShearModulus" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ShearProperty ; + skos:definition "Ratio of shear stress to shear strain" . + +nanomine:ShearStressAtBreak a owl:Class ; + rdfs:label "Shear Stress At Break" ; +<<<<<<< HEAD + nanomine:hasSelector "//ShearStressAtBreak" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ShearProperty ; + skos:definition "Shear stress when specimen breaks" . + +nanomine:ShearStressAtYield a owl:Class ; + rdfs:label "Shear Stress At Yield" ; +<<<<<<< HEAD + nanomine:hasSelector "//ShearStressAtYield" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ShearProperty ; + skos:definition "Shear stress at yield point" . + +nanomine:SingleScrew a owl:Class ; + rdfs:label "Single Screw Extruder" ; + rdfs:subClassOf nanomine:Extruder . + +nanomine:SolutionProcessing a owl:Class ; + rdfs:label "Solution Processing" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of dissolvable polymer with nanoparticles" . + +nanomine:SolventAmount a owl:Class ; + rdfs:label "Solvent Amount" ; + rdfs:subClassOf sio:Quantity . + +nanomine:SolventName a owl:Class ; + rdfs:label "Solvent Name" ; + rdfs:subClassOf sio:Name . + +nanomine:SpecificHeatCapacity_Cp a owl:Class ; + rdfs:label "Specific Heat Capacity Cp" ; +<<<<<<< HEAD + nanomine:hasSelector "//SpecificHeatCapacity_Cp" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "Cp for a gas is the change in the enthalpy (H) of the system with respect to change in temperature at a fixed pressure of the system" . + +nanomine:SpecificHeatCapacity_Cv a owl:Class ; + rdfs:label "Specific Heat Capacity Cv" ; +<<<<<<< HEAD + nanomine:hasSelector "//SpecificHeatCapacity_Cv" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "Cv for a gas is the change in internal energy (U) of a system with respect to change in temperature at a fixed volume of the system" . + +nanomine:SpecificSurfaceArea a owl:Class ; + rdfs:label "Specific Surface Area" ; + rdfs:subClassOf sio:SurfaceArea . + +nanomine:StdChemicalName a owl:Class ; + rdfs:label "StdChemicalName" ; + rdfs:subClassOf nanomine:ChemicalName . + +nanomine:Stirring a owl:Class ; + rdfs:label "Stirring" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Solvent ], + nanomine:Mixing ; + skos:definition "Manual stirring of liquid solutions" . + +nanomine:StrainAmplitude a owl:Class ; + rdfs:label "Strain Amplitude", + "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//StrainAmplitude", + "//strainAmplitude" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Condition ; + skos:definition "The magnitude of forced displacement of a material sample." . + +nanomine:StrainAtBreak a owl:Class ; + rdfs:label "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//StrainAtBreak" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:Strain . + +nanomine:StrainRate a owl:Class ; + rdfs:label "Strain Rate", + "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//StrainRate", + "//strainRate" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:Condition ; + skos:definition "Rate of strain change" . + +nanomine:StrainSweep a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//StrainSweep" . +======= + rdfs:label "nan" . +>>>>>>> nanomine/master + +nanomine:Stress a owl:Class ; + rdfs:label "Stress" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "When a material is loaded with a force, it produces a stress, which then causes a material to deform. " . + +nanomine:StressRelaxation a owl:Class ; + rdfs:label "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//StressRelaxation" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:RateOfChange . + +nanomine:SurfaceChemistryProcessing a owl:Class ; + rdfs:label "Surface Chemistry Processing" ; + rdfs:subClassOf nanomine:Processing . + +nanomine:SurfaceResistivity a owl:Class ; + rdfs:label "Surface Resistivity" ; +<<<<<<< HEAD + nanomine:hasSelector "//SurfaceResistivity" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "Ability to resist leakage current along the surface of an insulating material" . + +nanomine:SurfaceTension a owl:Class ; + rdfs:label "Surface Tension" ; +<<<<<<< HEAD + nanomine:hasSelector "//SurfaceTension" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "the force that causes the molecules on the surface of a liquid to be pushed together and form a layer" . + +nanomine:SurfaceTreatment a owl:Class ; + rdfs:label "Surface Treatment" ; + rdfs:subClassOf sio:Role . + +nanomine:Syndiotactic a owl:Class ; + rdfs:label "Syndiotactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition "In syndiotactic or syntactic macromolecules the substituents have alternate positions along the chain. The macromolecule consists 100% of racemo diads. Syndiotactic polystyrene, made by metallocene catalysis polymerization, is crystalline with a melting point of 161 °C. Gutta percha is also an example for Syndiotactic polymer." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Syndiotactic_polymers" . + +nanomine:TechnicalComment a owl:Class ; + rdfs:label "Technical Comment" ; + rdfs:subClassOf bibo:Document . + +nanomine:TemperatureSweep a owl:Class ; + rdfs:label "Temperature Sweep" ; +<<<<<<< HEAD + nanomine:hasSelector "//TemperatureSweep" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:DMA_Mode . + +nanomine:Tensile a owl:Class ; + rdfs:label "Tensile" ; +<<<<<<< HEAD + nanomine:hasSelector "//MeasurementMode" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing countervailing forces applied outward along the central axis of a material." . + +nanomine:TensileCreepCompliance a owl:Class ; + rdfs:label "Tensile Creep Compliance" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileCreepCompliance" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileCreep ; + skos:definition "Inverse of tensile creep modulus " . + +nanomine:TensileCreepModulus a owl:Class ; + rdfs:label "Tensile Creep Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileCreepModulus" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileCreep ; + skos:definition "Elastic modulus during creep test" . + +nanomine:TensileCreepRecovery a owl:Class ; + rdfs:label "Tensile Creep Recovery" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileCreepRecovery" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileCreep ; + skos:definition "Ability of material to recover to original state after creep" . + +nanomine:TensileCreepRuptureStrength a owl:Class ; + rdfs:label "Tensile Creep Rupture Strength" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileCreepRuptureStrength" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileCreep ; + skos:definition "Material strength at rupture during a tensile creep test" . + +nanomine:TensileCreepRuptureTime a owl:Class ; + rdfs:label "Tensile Creep Rupture Time" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileCreepRuptureTime" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileCreep ; + skos:definition "Time taken to rupture from applying load during a tensile creep test" . + +nanomine:TensileCreepStrain a owl:Class ; + rdfs:label "Tensile Creep Strain" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileCreepStrain" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileCreep ; + skos:definition "Profile of strain as a function of time during a tensile creep test" . + +nanomine:TensileLoadingProfile a owl:Class ; + rdfs:label "Tensile Loading Profile" ; +<<<<<<< HEAD + nanomine:hasSelector "//Tensile/LoadingProfile" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "Stress vs. strain curve of during tensile loading and/or unloading test" . + +nanomine:TensileModulus a owl:Class ; + rdfs:label "Tensile Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileModulus" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Young's modulus, or elastic modulus, describes tensile elasticity, or the tendency of an object to deform along an axis when opposing forces are applied along that axis; it is defined as the ratio of tensile stress to tensile strain." . + +nanomine:TensileStrength a owl:Class ; + rdfs:label "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileStrength" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileProperty . + +nanomine:TensileStressAtBreak a owl:Class ; + rdfs:label "Tensile Stress At Break" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileStressAtBreak" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile stress at the moment at which a test specimen tears" . + +nanomine:TensileStressAtYield a owl:Class ; + rdfs:label "Tensile Stress At Yield" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileStressAtYield" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile stress corresponding to the yield point (an increase in strain does not result in an increase in stress)." . + +nanomine:TensileToughness a owl:Class ; + rdfs:label "Tensile Toughness" ; +<<<<<<< HEAD + nanomine:hasSelector "//TensileToughness" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied tensile load." . + +nanomine:ThermalConductivity a owl:Class ; + rdfs:label "Thermal Conductivity" ; +<<<<<<< HEAD + nanomine:hasSelector "//ThermalConductivity" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "a measure of the ability of a substance to conduct heat, determined by the rate of heat flownormally through an area in the substance divided by the area and by minus the component of the temperaturegradient in the direction of flow" . + +nanomine:ThermalDecompositionTemperature a owl:Class ; + rdfs:label "Thermal Decomposition Temperature" ; +<<<<<<< HEAD + nanomine:hasSelector "//ThermalDecompositionTemperature" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "Thermal decomposition temperature of a substance is the temperature at which the substance chemically decomposes by heat" . + +nanomine:ThermalDiffusivity a owl:Class ; + rdfs:label "Thermal Diffusivity" ; +<<<<<<< HEAD + nanomine:hasSelector "//ThermalDiffusivity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "thermal diffusivity is the thermal conductivity divided by density and specific heat capacity at constant pressure. It measures the rate of transfer of heat of a material from the hot side to the cold side" . + +nanomine:ThermogravimetricAnalysis a owl:Class ; + rdfs:label "Thermogravimetric Analysis" ; + nanomine:hasSelector "//Thermogravimetric_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ThermalProperty ], + sio:Measuring ; + skos:definition "Thermal analysis of material properties as function of temperature and time" . + +nanomine:Thermoplastic a owl:Class ; + rdfs:label "Thermoplastic" ; + rdfs:subClassOf nanomine:Plastic ; + skos:definition "a plastic material, a polymer, that becomes pliable or moldable above a specific temperature and solidifies upon cooling." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermoplastic" . + +nanomine:Thermoset a owl:Class ; + rdfs:label "Thermoset" ; + rdfs:subClassOf nanomine:Plastic ; + skos:definition "a cured thermosetting resin. A thermosetting resin is a prepolymer in a soft solid or viscous liquid state that changes irreversibly into an infusible, insoluble polymer network by curing." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermosetting_polymer" . + +nanomine:Torsion a owl:Class ; + rdfs:label "Torsion" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing countervailing rotational forces about the central axis of a material, separated by some distance along the central axis of the material; \"twisting\" force" . + +nanomine:Total a owl:Class ; + rdfs:label "Total" ; + rdfs:subClassOf sio:Quantity . + +nanomine:TradeName a owl:Class ; + rdfs:label "Trade Name" ; + rdfs:subClassOf sio:Name ; + skos:definition "The common, non-chemical name for a chemical substance." . + +nanomine:TransmissionElectronMicroscopy a owl:Class ; + rdfs:label "Transmission Electron Microscopy" ; + nanomine:hasSelector "//Transmission_Electron_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:AcceleratingVoltage ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:WorkingDistance ], +======= + owl:someValuesFrom nanomine:ExposureTime ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:AcceleratingVoltage ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:ExposureTime ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:EmissionCurrent ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:Magnification ], +======= + owl:someValuesFrom nanomine:Magnification ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:WorkingDistance ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:EmissionCurrent ], +>>>>>>> nanomine/master + sio:Measuring ; + skos:definition "Transmission electron microscopy for obtaining microstructure at nanoscale" . + +nanomine:TwinScrew a owl:Class ; + rdfs:label "Twin Screw Extruder" ; + rdfs:subClassOf nanomine:Extruder . + +nanomine:Ultra-sonication a owl:Class ; + rdfs:label "Ultra Sonication" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "The irradiation of a liquid sample with ultrasonic (>20 kHz) waves resulting in agitation" . + +nanomine:Vacuum a owl:Class ; + rdfs:label "Vacuum" ; + rdfs:subClassOf nanomine:AmbientCondition . + +nanomine:VacuumMolding a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:Viscosity a owl:Class ; + rdfs:label "Viscosity" ; + rdfs:subClassOf ; + skos:definition "a measure of its resistance to gradual deformation by shear stress or tensile stress." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Viscosity" . + +nanomine:VolumeExpansionCoefficient a owl:Class ; + rdfs:label "Volume Expansion Coefficient" ; +<<<<<<< HEAD + nanomine:hasSelector "//VolumeExpansionCoefficient" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "volumetric coefficient of thermal expansion" . + +nanomine:VolumeFraction a owl:Class ; + rdfs:label "Volume Fraction" ; + rdfs:subClassOf sio:Concentration ; + skos:definition "The volume of a constituent divided by the volume of all constituents of the mixture prior to mixing." . + +nanomine:VolumeResistivity a owl:Class ; + rdfs:label "Volume Resistivity" ; +<<<<<<< HEAD + nanomine:hasSelector "//VolumeResistivity" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "Ability to oppose the flow of electric current." . + +nanomine:WaterAbsorption a owl:Class ; + rdfs:label "Water Absorption" ; +<<<<<<< HEAD + nanomine:hasSelector "//WaterAbsorption" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:VolumetricProperty ; + skos:definition "The amount of weight gain (%) experienced in a polymer after immersion in water for a specific length of time under controlled environment." . + +nanomine:WeibullPlot a owl:Class ; + rdfs:label "Weilbull Plot" ; +<<<<<<< HEAD + nanomine:hasSelector "//WeibullPlot" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:DielectricBreakdownStrength . + +nanomine:WeightLoss a owl:Class ; + rdfs:label "Weight Loss" ; +<<<<<<< HEAD + nanomine:hasSelector "//WeightLoss" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:VolumetricProperty . + +nanomine:XRayDiffractionAndScattering a owl:Class ; + rdfs:label "XRay Diffraction and Scattering" ; + nanomine:hasSelector "//XRay_Diffraction_and_Scattering" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Non-destructive X-ray measurement for crystal structure, chemical composition, and physical properties" . + +nanomine:XRayPhotoelectronSpectroscopy a owl:Class ; + rdfs:label "X-Ray Photoelectron Spectroscopy" ; + nanomine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring . + +nanomine:XRay_Photoelectron_Spectroscopy a owl:Class ; + rdfs:label "nan" ; + nanomine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; + rdfs:subClassOf sio:Measuring ; + skos:definition "XRay_Photoelectron_Spectroscopy (abbr. XPS) is a spectroscopy for material characterization;" . + +nanomine:sampleShape a owl:Class ; +<<<<<<< HEAD + rdfs:label "nan" ; + nanomine:hasSelector "//sampleShape" . +======= + rdfs:label "nan" . +>>>>>>> nanomine/master + +nanomine:uSMILES a owl:Class ; + rdfs:label "uSMILES" ; + rdfs:subClassOf sio:Representation . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Centimeter" ; + skos:notation "J/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Celsius" ; + skos:notation "J/gC" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Kelvin" ; + skos:notation "J/gK" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Kilojoule per Square Meter" ; + skos:notation "kJ/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Centimeter" ; + skos:notation "kV/cm" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Millimeter" ; + skos:notation "kV/mm" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Log Hertz" ; + skos:notation "log(Hz)" . + + a sio:UnitOfMeasurement ; + rdfs:label "Square Millimeter per Second" ; + skos:notation "mm^2/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Millimeters per millimeter" ; + skos:notation "mm/mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Centimeter" ; + skos:notation "Ω cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Parts per million per degree centigrade" ; + skos:notation "ppm/C" . + + a sio:UnitOfMeasurement ; + rdfs:label "Rotation per Minute" ; + skos:notation "rpm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Megavolt per Meter" ; + skos:notation "MV/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Radian per Minute" ; + skos:notation "rad/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Centimeter" ; + skos:notation "S/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Volt per Centimeter" ; + skos:notation "V/cm" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram" ; + skos:notation "J/gm" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Kelvin per Minute" ; + skos:notation "K/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "per Kelvin" ; + skos:notation "1/K" . + +sio:AspectRatio a owl:Class ; + rdfs:label "Aspect Ratio" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "The aspect ratio of a geometric shape is the ratio of its sizes in different dimensions." . + +sio:Chapter a owl:Class ; + rdfs:label "Chapter" . + +sio:Citation a owl:Class ; + rdfs:label "Citation Type" . + +sio:Day a sio:UnitOfMeasurement ; + rdfs:label "Day" ; + skos:notation "dy" . + +sio:Description a owl:Class ; + rdfs:label "Description" ; + nanomine:hasSelector "//Description" ; + rdfs:subClassOf sio:LanguageEntity . + +sio:Hour a sio:UnitOfMeasurement ; + rdfs:label "Hour" ; + skos:notation "Hr" . + +sio:Publication a owl:Class ; + rdfs:label "Publication" . + +sio:Rotation a owl:Class ; + rdfs:label "Rotation" ; + rdfs:subClassOf sio:Quantity . + +sio:Week a sio:UnitOfMeasurement ; + rdfs:label "Week" ; + skos:notation "wk" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ampere per Square Meter" ; + skos:notation "A/m^2" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Celsius" ; + skos:notation "C" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Celsius per Minute" ; + skos:notation "C/min" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Gigapascal" ; + skos:notation "GPa" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Gram per Cubic Centimeter" ; + skos:notation "g/cm^3" . + +<<<<<<< HEAD + a nanomine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Hertz" ; + skos:notation "Hz" . + +======= +>>>>>>> nanomine/master + a nanomine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Kelvin" ; + skos:notation "K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kiloelectronvolt" ; + skos:notation "keV" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Cubic Meter" ; + skos:notation "kg/m^3" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Liter" ; + skos:notation "kg/L" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilohertz" ; + skos:notation "kHz" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilopascal" ; + skos:notation "kPa" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt" ; + skos:notation "kV" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Megapascal" ; + skos:notation "MPa" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Micrometer" ; + skos:notation "µm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Millimeter" ; + skos:notation "mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Minute" ; + skos:notation "min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Mole per Cubic Meter" ; + skos:notation "mol/m^3" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Nanometer" ; + skos:notation "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Meter" ; + skos:notation "Ω m" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Pascal" ; + skos:notation "Pa" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Percent" ; + skos:notation "%" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Radian per Second" ; + skos:notation "rad/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Second" ; + skos:notation "s" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Meter" ; + skos:notation "S/m" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "Square Meter per Gram" ; + skos:notation "m^2/g" . + + a sio:UnitOfMeasurement ; + rdfs:label "nan" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "Watt per Meter-Kelvin" ; + skos:notation "W/mK" . + +======= +>>>>>>> nanomine/master +nanomine:Amperage a owl:Class ; + rdfs:label "Amperage" ; + rdfs:subClassOf sio:Quantity . + +nanomine:CapillarySize a owl:Class ; + rdfs:label "Capillar Size" ; + nanomine:hasSelector "//CapillarySize" ; + rdfs:subClassOf sio:Parameter . + +nanomine:ChannelDepth a owl:Class ; + rdfs:label "Channel Depth" ; + rdfs:subClassOf sio:Depth . + +nanomine:ChannelsPerScrew a owl:Class ; + rdfs:label "Channels per Screw" ; + rdfs:subClassOf sio:Quantity . + +nanomine:ChemicalName a owl:Class ; + rdfs:label "Chemical Name" ; + rdfs:subClassOf sio:Name . + +nanomine:CoolingRate a owl:Class ; + rdfs:label "Cooling Rate" ; + nanomine:hasSelector "//CoolingRate" ; + rdfs:subClassOf sio:Parameter . + +nanomine:DLRatio a owl:Class ; + rdfs:label "Screw Diameter/Length Ratio" ; + rdfs:subClassOf sio:Ratio . + +nanomine:DMA_Mode a owl:Class ; + rdfs:label "Dynamic Mechanical Analysis" ; +<<<<<<< HEAD + nanomine:hasSelector "//DMA_Mode" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:DynamicProperties, + . + +nanomine:DielectricBreakdownStrength a owl:Class ; + rdfs:label "Dielectric Breakdown Strength" ; +<<<<<<< HEAD + nanomine:hasSelector "//DielectricBreakdownStrength" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "Maximum voltage required to produce a dielectric breakdown through the material and is expressed as Volts per unit thickness." . + +nanomine:ExtrusionTemperature a owl:Class ; + rdfs:label "Extrusion Temperature" ; + rdfs:subClassOf . + +<<<<<<< HEAD +======= +nanomine:FillerComponent a owl:Class ; + rdfs:label "Filler Component" ; + rdfs:subClassOf nanomine:Component . + +>>>>>>> nanomine/master +nanomine:FlightClearance a owl:Class ; + rdfs:label "Flight Clearance" ; + rdfs:subClassOf sio:Height ; + skos:altLabel "Radial Flight Clearance" . + +nanomine:FlightWidth a owl:Class ; + rdfs:label "Flight Width" ; + rdfs:subClassOf sio:Width . + +nanomine:HeatingRate a owl:Class ; + rdfs:label "Heating Rate" ; + nanomine:hasSelector "//HeatingRate" ; + rdfs:subClassOf sio:Parameter . + +nanomine:Impact a owl:Class ; + rdfs:label "Impact" ; +<<<<<<< HEAD + nanomine:hasSelector "//Impact" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:FractureToughnessProperty ; + skos:definition "Izod impact resistance of materials" . + +nanomine:InnerBarrelDiameter a owl:Class ; + rdfs:label "Inner Barrel Diameter" ; + rdfs:subClassOf . + +nanomine:MeltTemperature a owl:Class ; + rdfs:label "Melt Temperature" ; + rdfs:subClassOf . + +nanomine:Nanocomposite a owl:Class ; + rdfs:label "Nanocomposite" ; + rdfs:subClassOf nanomine:Nanomaterial ; + skos:definition "a multiphase solid material where one of the phases has one, two or three dimensions of less than 100 nanometers (nm), or structures having nano-scale repeat distances between the different phases that make up the material. In the broadest sense this definition can include porous media, colloids, gels and copolymers, but is more usually taken to mean the solid combination of a bulk matrix and nano-dimensional phase(s) differing in properties due to dissimilarities in structure and chemistry." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanocomposite" . + +nanomine:PressureAtDie a owl:Class ; + rdfs:label "Pressure at Die" ; + rdfs:subClassOf . + +nanomine:ProcessingCondition a owl:Class ; + rdfs:label "Processing Condition" ; + rdfs:subClassOf sio:Quality . + +nanomine:ResidenceTime a owl:Class ; + rdfs:label "Residence Time" ; + rdfs:subClassOf sio:TimeInterval . + +nanomine:RotationalFrequency a owl:Class ; + rdfs:label "Rotational Frequency" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + sio:Frequency ; + skos:definition """The number of rotations of an object around an axis per unit time. +""" . + +nanomine:ScrewChannelWidth a owl:Class ; + rdfs:label "Screw Channel Width" ; + rdfs:subClassOf sio:Width . + +nanomine:ScrewDiameter a owl:Class ; + rdfs:label "Screw Diameter" ; + rdfs:subClassOf . + +nanomine:ScrewLead a owl:Class ; + rdfs:label "Screw Lead" ; + rdfs:subClassOf sio:Length . + +nanomine:ScrewLength a owl:Class ; + rdfs:label "Screw Length" ; + rdfs:subClassOf sio:Length . + +nanomine:Strain a owl:Class ; + rdfs:label "Strain" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Engineering strain is defined as the amount of deformation in the direction of the applied force divided by the initial length of the material." . + +nanomine:Throughput a owl:Class ; + rdfs:label "Throughput" ; + rdfs:subClassOf sio:Quantity . + +nanomine:Torque a owl:Class ; + rdfs:label "Torque" ; + rdfs:subClassOf . + +nanomine:Voltage a owl:Class ; + rdfs:label "Voltage" ; + rdfs:subClassOf sio:Quantity . + + a sio:UnitOfMeasurement ; + rdfs:label "1/Pa" . + +<<<<<<< HEAD + a sio:UnitOfMeasurement ; + rdfs:label "1/s", + "Per Second" ; + skos:notation "1/s" . + +======= +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "C/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "J/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "kg/m^3" . + +<<<<<<< HEAD +======= + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Millimeter" ; + skos:notation "kV/mm" . + +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^2/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^3/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "m/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "nanomine:revolutions_per_minute" . + + a sio:UnitOfMeasurement ; + rdfs:label "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "S/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "V/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "W/(m*K)" . + +bibo: rdfs:label "BIBO" . + + rdfs:label "SIO" . + +sio:Depth a owl:Class ; + rdfs:label "Depth" ; + rdfs:subClassOf nanomine:Dimension, + . + +sio:Frequency a owl:Class ; + rdfs:label "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//frequency" ; +======= + nanomine:hasPreferredUnit ; +>>>>>>> nanomine/master + rdfs:subClassOf sio:RateOfChange . + +sio:SurfaceArea a owl:Class ; + rdfs:label "Surface Area" ; + rdfs:subClassOf sio:Area . + + rdfs:label "Nanopub" . + +<<<<<<< HEAD +======= + a nanomine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Hertz" ; + skos:notation "Hz" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Cubic Meter" ; + skos:notation "kg/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Nanometer" ; + skos:notation "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Meter" ; + skos:notation "S/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Watt per Meter-Kelvin" ; + skos:notation "W/mK" . + +>>>>>>> nanomine/master +nanomine:AcceleratingVoltage a owl:Class ; + rdfs:label "Accelerating Voltage" ; + nanomine:hasSelector "//AcceleratingVoltage" ; + rdfs:subClassOf sio:Parameter . + +nanomine:EmissionCurrent a owl:Class ; + rdfs:label "Emission Current" ; + nanomine:hasSelector "//EmissionCurrent" ; + rdfs:subClassOf sio:Parameter . + +nanomine:ExposureTime a owl:Class ; + rdfs:label "Exposure Time" ; + nanomine:hasSelector "//ExposureTime" ; + rdfs:subClassOf sio:Parameter . + +nanomine:Magnification a owl:Class ; + rdfs:label "Magnification" ; + nanomine:hasSelector "//Magnification" ; + rdfs:subClassOf sio:Parameter . + +nanomine:Nanomaterial a owl:Class ; + rdfs:label "Nanomaterial" ; + rdfs:subClassOf sio:MaterialEntity ; + skos:definition "materials of which a single unit is sized (in at least one dimension) between 1 and 1000 nanometres (10−9 meter) but is usually 1—100 nm" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanomaterials" . + +nanomine:RheologicalProperty a owl:Class ; + rdfs:label "Rheological Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Rheological" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity . + +nanomine:RotationMode a owl:Class ; + rdfs:label "Rotation Mode" ; + rdfs:subClassOf sio:Quality . + +nanomine:WorkingDistance a owl:Class ; + rdfs:label "Working Distance" ; + nanomine:hasSelector "//WorkingDistance" ; + rdfs:subClassOf sio:Parameter . + +<<<<<<< HEAD +======= + a sio:UnitOfMeasurement ; + rdfs:label "1/s", + "Per Second" ; + skos:notation "1/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Kelvin" ; + skos:notation "J/gK" . + +>>>>>>> nanomine/master + a sio:UnitOfMeasurement ; + rdfs:label "J/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm*m" . + +<<<<<<< HEAD +======= + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram" ; + skos:notation "J/gm" . + +>>>>>>> nanomine/master +sio:Width a owl:Class ; + rdfs:label "Width" ; + rdfs:subClassOf nanomine:Dimension . + +<<<<<<< HEAD +======= + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Meter" ; + skos:notation "Ω m" . + +>>>>>>> nanomine/master +nanomine:CompressiveCreep a owl:Class ; + rdfs:label "Compressive Creep" ; + rdfs:subClassOf nanomine:Creep ; + skos:definition "creep during compressive test" . + +nanomine:Condition a owl:Class ; + rdfs:label "Condition", + "nan" ; +<<<<<<< HEAD + nanomine:hasSelector "//Condition", + "//condition" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:CompressionProperty . + +nanomine:Creep a owl:Class ; + rdfs:label "Creep" ; +<<<<<<< HEAD + nanomine:hasSelector "//Creep" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "creep is the tendency of material to move slowly or deform permanently under the influence of mechanical stresses" . + +nanomine:Extruder a owl:Class ; + rdfs:label "Extruder" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:FlightWidth ], +======= + owl:someValuesFrom nanomine:Voltage ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewLength ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:ScrewChannelWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ChannelsPerScrew ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ResidenceTime ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Voltage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Torque ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Throughput ], +======= + owl:someValuesFrom nanomine:MeltTemperature ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Throughput ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewDiameter ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ChannelsPerScrew ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ChannelDepth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ExtrusionTemperature ], +>>>>>>> nanomine/master + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:InnerBarrelDiameter ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom nanomine:Dimension ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewLead ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Amperage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ExtrusionTemperature ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:MeltTemperature ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:FlightClearance ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ChannelDepth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:DLRatio ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:PressureAtDie ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewDiameter ], +======= + owl:someValuesFrom nanomine:PressureAtDie ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewChannelWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewLead ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Amperage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:DLRatio ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:FlightWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Torque ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:FlightClearance ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ResidenceTime ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Dimension ], +>>>>>>> nanomine/master + sio:Device . + +nanomine:FlexuralCreep a owl:Class ; + rdfs:label "Flexural Creep" ; + rdfs:subClassOf nanomine:Creep ; + skos:definition "creep during flexural or bending test" . + +nanomine:HardnessProperty a owl:Class ; + rdfs:label "Hardness Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Hardness" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "Materials property representing the material's resistance to deformation under an applied compressive load from a test fixture of known tip geometry." . + +nanomine:Plastic a owl:Class ; + rdfs:label "Plastic" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "a material consisting of any of a wide range of synthetic or semi-synthetic organic compounds that are malleable and can be molded into solid objects. Plastics are typically organic polymers of high molecular mass, but they often contain other substances." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Plastic" . + +nanomine:RheologicalViscosity a owl:Class ; + rdfs:label "Rheological Viscosity" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheologicalViscosity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalProperty . + +nanomine:Rheometery a owl:Class ; + rdfs:label "Rheometry" ; + nanomine:hasSelector "//Rheometery" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:CapillarySize ], + sio:Measuring ; + skos:definition "Measurement of the quantitative and qualitative relationships between deformations and stresses and their derivatives" . + +nanomine:Solvent a owl:Class ; + rdfs:label "Solvent" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:Quantity ], + sio:ChemicalEntity ; + skos:definition "Solvent used in composite synthesis" . + + a sio:UnitOfMeasurement ; + rdfs:label "m" . + + a sio:UnitOfMeasurement ; + rdfs:label "s" . + +sio:Length a owl:Class ; + rdfs:label "Length" ; + rdfs:subClassOf nanomine:Dimension, + . + +sio:Ratio a owl:Class ; + rdfs:label "Fraction" ; + rdfs:subClassOf sio:DimensionlessQuantity . + +<<<<<<< HEAD +nanomine:FractureToughnessProperty a owl:Class ; + rdfs:label "Fracture Toughness Property" ; + nanomine:hasSelector "//FractureToughness" ; +======= + a sio:UnitOfMeasurement ; + rdfs:label "Percent" ; + skos:notation "%" . + +nanomine:FractureToughnessProperty a owl:Class ; + rdfs:label "Fracture Toughness Property" ; +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Ability of material containing a crack to resist fracture" . + +nanomine:ShearProperty a owl:Class ; + rdfs:label "Shear Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Shear" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in shear" . + +nanomine:Tacticity a owl:Class ; + rdfs:label "Tacticity" ; + rdfs:subClassOf sio:ChemicalQuality ; + skos:definition "the relative stereochemistry of adjacent chiral centers within a macromolecule." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity" . + + a sio:UnitOfMeasurement ; + rdfs:label "N" . + +sio:Polymer a owl:Class ; + rdfs:label "Polymer" ; + rdfs:subClassOf sio:Molecule . + + a owl:Class ; + rdfs:label "Diameter" ; + rdfs:subClassOf nanomine:Dimension, + . + +nanomine:Crystallinity a owl:Class ; + rdfs:label "Crystallinity" ; +<<<<<<< HEAD + nanomine:hasSelector "//Crystallinity" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:ThermalProperty ; + skos:definition "degree of structural order in a solid" . + +nanomine:FlexuralProperty a owl:Class ; + rdfs:label "Flexural Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Flexural" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in bending" . + +nanomine:Molding a owl:Class ; + rdfs:label "Molding" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD +======= + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +>>>>>>> nanomine/master + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], +<<<<<<< HEAD + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], +======= +>>>>>>> nanomine/master + sio:Procedure ; + skos:definition "Methods to shape final composite" . + +nanomine:RheologicalComplexModulus a owl:Class ; + rdfs:label "Rheological Complex Modulus" ; +<<<<<<< HEAD + nanomine:hasSelector "//RheologicalComplexModulus" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:RheologicalProperty . + +nanomine:Spectroscopy a owl:Class ; + rdfs:label "Spectroscopy" ; +<<<<<<< HEAD + nanomine:hasSelector "//Spectrocopy" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "The chemical composition ,composition variation ,crystal structure & photo-electric properties of the materials." . + + a sio:UnitOfMeasurement ; + rdfs:label "J" . + + a sio:UnitOfMeasurement ; + rdfs:label "K" . + +<<<<<<< HEAD +nanomine:CompressionProperty a owl:Class ; + rdfs:label "Compression Property" ; + nanomine:hasSelector "//Compression" ; +======= + a sio:UnitOfMeasurement ; + rdfs:label "Celsius" ; + skos:notation "C" . + + a sio:UnitOfMeasurement ; + rdfs:label "Gigapascal" ; + skos:notation "GPa" . + +nanomine:CompressionProperty a owl:Class ; + rdfs:label "Compression Property" ; +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in compression" . + +nanomine:Dimension a owl:Class ; + rdfs:label "Dimension" ; + rdfs:subClassOf sio:DimensionalQuantity . + +nanomine:TensileCreep a owl:Class ; + rdfs:label "Tensile Creep" ; + rdfs:subClassOf nanomine:Creep ; + skos:definition "creep during tensile test" . + + a owl:Class ; + rdfs:label "Pressure" ; + rdfs:subClassOf . + +nanomine:AmbientCondition a owl:Class ; + rdfs:label "Ambient Condition" ; + rdfs:subClassOf nanomine:ProcessingCondition ; + skos:definition "Ambient conditions" . + +nanomine:Mixing a owl:Class ; + rdfs:label "Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:RotationalFrequency ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], +======= + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:RotationalFrequency ], +>>>>>>> nanomine/master + sio:Procedure ; + skos:definition "Processes for mixing of multiple substances" . + +sio:TimeInterval a owl:Class ; + rdfs:label "Time" ; + rdfs:subClassOf sio:TimeMeasurement . + +nanomine:Additive a owl:Class ; + rdfs:label "Additive" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:Quantity ], + sio:ChemicalEntity, + sio:ChemicalSubstance ; + skos:definition "A chemical substance that is blended in to a polymer to acheive a desired effect.", + "Additive used in composite synthesis" . + +nanomine:VolumetricProperty a owl:Class ; + rdfs:label "Volumetric Property" ; + rdfs:subClassOf . + +<<<<<<< HEAD +nanomine:TensileProperty a owl:Class ; + rdfs:label "Tensile Property" ; + nanomine:hasSelector "//Tensile" ; +======= + a sio:UnitOfMeasurement ; + rdfs:label "Megapascal" ; + skos:notation "MPa" . + +nanomine:TensileProperty a owl:Class ; + rdfs:label "Tensile Property" ; +>>>>>>> nanomine/master + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in tension." . + +nanomine:MechanicalProperty a owl:Class ; + rdfs:label "Mechanical Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Mechanical" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "A materials property related to the response of a material under some external applied load." . + +nanomine:ViscoelasticProperty a owl:Class ; + rdfs:label "Viscoelastic Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Viscoelastic" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "Properties of materials that exhibit both viscous and elastic behaviors" . + + a owl:Class ; + rdfs:label "Temperature" ; +<<<<<<< HEAD + nanomine:hasSelector "//temperature" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "The average kinetic energy of all constituents within a materials system" . + +nanomine:ThermalProperty a owl:Class ; + rdfs:label "Thermal Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Thermal" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "A material's property describing the materials ability to absorb, conduct, or otherwise interact with energy in the form of heat." . + + a sio:UnitOfMeasurement ; + rdfs:label "Pa" . + +sio:Procedure a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Solvent ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; +<<<<<<< HEAD + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], +======= + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], +>>>>>>> nanomine/master + sio:Process . + +sio:Quantity a owl:Class ; + rdfs:label "Amount" ; + rdfs:subClassOf sio:MeasurementValue . + +nanomine:ElectricalProperty a owl:Class ; + rdfs:label "Electrical Property" ; +<<<<<<< HEAD + nanomine:hasSelector "//Electrical" ; +======= +>>>>>>> nanomine/master + rdfs:subClassOf sio:Quantity ; + skos:definition "A materials property describing the material's behavior under some applied electrical field." . + diff --git a/whyis/materialsmine/requirements.txt b/whyis/materialsmine/requirements.txt new file mode 100644 index 00000000..49b64393 --- /dev/null +++ b/whyis/materialsmine/requirements.txt @@ -0,0 +1,117 @@ +amqp==5.0.6 +an-example-pypi-project==0.0.4 +anyascii==0.3.0 +arrow==1.2.1 +Babel==2.9.1 +beautifulsoup4==4.7.1 +bibtexparser==1.1.0 +billiard==3.6.4.0 +binaryornot==0.4.4 +bleach==4.1.0 +blinker==1.4 +bsddb3==6.2.6 +celery==5.1.2 +celery-once==3.0.1 +certifi==2021.10.8 +chardet==4.0.0 +charset-normalizer==2.0.8 +click==7.1.2 +click-didyoumean==0.3.0 +click-plugins==1.1.1 +click-repl==0.2.0 +colorama==0.4.4 +cookiecutter==1.7.3 +Cython==0.29.24 +Deprecated==1.2.13 +dnspython==2.1.0 +docutils==0.18.1 +email-validator==1.1.3 +et-xmlfile==1.1.0 +eventlet==0.33.0 +filedepot==0.8.0 +Flask==1.1.4 +Flask-BabelEx==0.9.4 +Flask-Caching==1.10.1 +Flask-Login==0.5.0 +Flask-Mail==0.9.1 +Flask-Principal==0.4.0 +Flask-Script==2.0.6 +Flask-Security==3.0.0 +Flask-WTF==0.14.3 +future==0.18.2 +greenlet==1.1.2 +html5lib==1.1 +idna==3.3 +ijson==2.4 +importlib-metadata==4.8.2 +isodate==0.6.0 +itsdangerous==1.1.0 +Jinja2==2.11.3 +jinja2-time==0.2.0 +joblib==1.1.0 +keepalive==0.1.1 +keyring==23.4.0 +kombu==5.2.2 +lptrace==1.0.0 +lxml==4.6.4 +Markdown==3.3.6 +MarkupSafe==2.0.1 +mod-wsgi==4.9.0 +nltk==3.6.5 +nose==1.3.7 +numpy==1.21.4 +openpyxl==3.0.9 +packaging==21.3 +pandas==1.3.4 +passlib==1.7.4 +pip==21.3.1 +pkginfo==1.8.2 +poyo==0.5.0 +prompt-toolkit==3.0.23 +psutil==5.8.0 +Pygments==2.10.0 +PyJWT==2.3.0 +pyparsing==3.0.6 +pyshp==2.1.3 +python-dateutil==2.8.2 +python-magic==0.4.24 +python-slugify==5.0.2 +pytidylib==0.3.2 +pytz==2021.3 +rdflib==6.0.2 +rdflib-jsonld==0.6.2 +readme-renderer==32.0 +redis==4.0.2 +redislite==6.0.674960 +regex==2021.11.10 +requests==2.26.0 +requests-testadapter==0.3.0 +requests-toolbelt==0.9.1 +rfc3986==1.5.0 +sadi==0.5.7 +scipy==1.7.3 +sdd2rdf==0.1.6 +setlr==0.2.18 +setuptools==60.3.1 +six==1.16.0 +soupsieve==2.3.1 +speaklater==1.3 +text-unidecode==1.3 +toposort==1.7 +tqdm==4.62.3 +twine==3.7.1 +urllib3==1.26.7 +vine==5.0.0 +wcwidth==0.2.5 +webencodings==0.5.1 +WebOb==1.8.7 +Werkzeug==1.0.1 +wheel==0.37.0 +whyis==2.0a1 +wrapt==1.13.3 +WTForms==3.0.0 +xlrd==2.0.1 +zipp==3.6.0 + +mod-wsgi==4.9.0 +whyis-unit-converter==0.0.2 diff --git a/whyis/materialsmine/run/log4j2.properties b/whyis/materialsmine/run/log4j2.properties new file mode 100644 index 00000000..37f97599 --- /dev/null +++ b/whyis/materialsmine/run/log4j2.properties @@ -0,0 +1,68 @@ +## Licensed under the terms of http://www.apache.org/licenses/LICENSE-2.0 +status = error +name = PropertiesConfig +filters = threshold + +filter.threshold.type = ThresholdFilter +filter.threshold.level = ALL + +appender.console.type = Console +appender.console.name = OUT +appender.console.target = SYSTEM_ERR +appender.console.layout.type = PatternLayout +appender.console.layout.pattern = %d{HH:mm:ss} %-5p %-15c{1} :: %m%n +#appender.console.layout.pattern = [%d{yyyy-MM-dd HH:mm:ss}] %-5p %-15c{1} :: %m%n + +rootLogger.level = WARN +rootLogger.appenderRef.stdout.ref = OUT + +logger.jena.name = org.apache.jena +logger.jena.level = WARN + +logger.arq-exec.name = org.apache.jena.arq.exec +logger.arq-exec.level = WARN + +logger.arq-info.name = org.apache.jena.arq.exec +logger.arq-info.level = WARN + +logger.riot.name = org.apache.jena.riot +logger.riot.level = WARN + +logger.fuseki.name = org.apache.jena.fuseki +logger.fuseki.level = WARN + +logger.fuseki-fuseki.name = org.apache.jena.fuseki.Fuseki +logger.fuseki-fuseki.level = WARN + +logger.fuseki-server.name = org.apache.jena.fuseki.Server +logger.fuseki-server.level = WARN + +logger.fuseki-config.name = org.apache.jena.fuseki.Config +logger.fuseki-config.level = WARN + +logger.fuseki-admin.name = org.apache.jena.fuseki.Admin +logger.fuseki-admin.level = WARN + +logger.jetty.name = org.eclipse.jetty +logger.jetty.level = WARN + +# May be useful to turn up to DEBUG if debugging HTTP communication issues +logger.apache-http.name = org.apache.http +logger.apache-http.level = WARN + +logger.shiro.name = org.apache.shiro +logger.shiro.level = WARN +# Hide bug in Shiro 1.5.0 +logger.shiro-realm.name = org.apache.shiro.realm.text.IniRealm +logger.shiro-realm.level = ERROR + +# This goes out in NCSA format +appender.plain.type = Console +appender.plain.name = PLAIN +appender.plain.layout.type = PatternLayout +appender.plain.layout.pattern = %m%n + +logger.fuseki-request.name = org.apache.jena.fuseki.Request +logger.fuseki-request.additivity = false +logger.fuseki-request.level = OFF +logger.fuseki-request.appenderRef.plain.ref = PLAIN diff --git a/whyis/materialsmine/script/bootstrap b/whyis/materialsmine/script/bootstrap new file mode 100755 index 00000000..4f8e76a2 --- /dev/null +++ b/whyis/materialsmine/script/bootstrap @@ -0,0 +1,14 @@ +#!/bin/bash + +set -e + +sudo apt-get install python3-venv +python3.8 -m venv venv +source venv/bin/activate +pip install requests wheel +sudo apt-get install -y libdb5.3-dev \ + software-properties-common \ + build-essential \ + python3.8-dev \ + npm +pip install -r requirements.txt diff --git a/whyis/materialsmine/script/load-dev b/whyis/materialsmine/script/load-dev new file mode 100755 index 00000000..f7d7b08f --- /dev/null +++ b/whyis/materialsmine/script/load-dev @@ -0,0 +1,21 @@ +#!/bin/bash + +pushd /apps/nanomine-graph + +#setlr setl/dev_nanomine_files.setl.ttl +setlr setl/ontology.setl.ttl + +popd + +pushd /apps/whyis + +python manage.py load -f xml -i https://github.com/MaastrichtU-IDS/semanticscience/raw/master/ontology/sio/release/sio-subset-labels.owl +python manage.py load -f turtle -i /apps/nanomine-graph/nanomine.ttl +python manage.py load -f turtle -i /apps/nanomine-graph/nanomine-files.ttl +python manage.py load -i /apps/nanomine-graph/setl/xml_ingest.setl.ttl -f turtle + +for query_file in /apps/nanomine-graph/data/parameterized_queries/*.ttl ; do + python manage.py load -f turtle -i "$query_file" +done + +popd diff --git a/whyis/materialsmine/script/load-metamine.sh b/whyis/materialsmine/script/load-metamine.sh new file mode 100755 index 00000000..51e36d48 --- /dev/null +++ b/whyis/materialsmine/script/load-metamine.sh @@ -0,0 +1,6 @@ +whyis load -i setl/materialsmine.ttl -f turtle +whyis load -i 'http://vocab.deri.ie/void' -f xml +whyis load -i 'http://purl.org/dc/terms' -f xml +whyis load -i 'https://www.w3.org/ns/dcat2.ttl' -f turtle +whyis load -i https://raw.githubusercontent.com/tetherless-world/SemanticDataDictionary/master/sdd-ontology.ttl -f turtle +whyis load -f xml -i https://github.com/MaastrichtU-IDS/semanticscience/raw/master/ontology/sio/release/sio-subset-labels.owl diff --git a/whyis/materialsmine/script/server b/whyis/materialsmine/script/server new file mode 100755 index 00000000..dd38a49b --- /dev/null +++ b/whyis/materialsmine/script/server @@ -0,0 +1,2 @@ +source venv/bin/activate +whyis runserver -h 0.0.0.0 \ No newline at end of file diff --git a/whyis/materialsmine/script/setup b/whyis/materialsmine/script/setup new file mode 100755 index 00000000..bacd5a5e --- /dev/null +++ b/whyis/materialsmine/script/setup @@ -0,0 +1,97 @@ +#!/bin/bash + +# exit when any command fails +set -e + +sudo apt-get update +sudo apt-get install -y software-properties-common + +export CURRENT_USER=$(id -u -n) +export WHYIS_USER=${WHYIS_USER:-$CURRENT_USER} +export WHYIS_GROUP=${WHYIS_GROUP:-whyis} + +export WHYIS_HOME=${WHYIS_HOME:-/home/$WHYIS_USER} + +export FUSEKI_SERVER=`which fuseki-server` +export FUSEKI_HOME=$PWD/fuseki +export WHYIS_APP_HOME=$PWD +export PYTHON_HOME=$(python -c 'import sys; print(sys.prefix)') + +sudo groupadd -f $WHYIS_GROUP +sudo usermod -a -G $WHYIS_GROUP $WHYIS_USER + +sudo apt-get install -y apache2-dev \ + unzip \ + zip \ + default-jdk \ + build-essential \ + automake libblas3 \ + libblas-dev \ + python3-celery \ + redis-server \ + apache2 \ + libffi-dev \ + libssl-dev \ + maven \ + libdb5.3-dev \ + python3-dev + +mkdir -p $WHYIS_APP_HOME/data/nanopublications +mkdir -p $WHYIS_APP_HOME/fuseki +mkdir -p $WHYIS_APP_HOME/data/files +mkdir -p $WHYIS_APP_HOME/celery + +sudo mkdir -p /var/log/celery +sudo chown -R $WHYIS_USER /var/log/celery +sudo mkdir -p /var/run/celery +sudo chown -R $WHYIS_USER /var/run/celery + +sudo mkdir -p /var/log/whyis +sudo chown -R $WHYIS_USER /var/log/whyis + +# These are here to re-substitute these variables back into the +# script, while rewriting the ones we need to. +export CELERY_BIN='${CELERY_BIN}' +export CELERYD_NODES='${CELERYD_NODES}' +export CELERY_APP='${CELERY_APP}' +export CELERYD_PID_FILE='${CELERYD_PID_FILE}' +export CELERYD_LOG_FILE='${CELERYD_LOG_FILE}' +export CELERYD_LOG_LEVEL='${CELERYD_LOG_LEVEL}' +export CELERYD_OPTS='${CELERYD_OPTS}' + + +# configure celery +sudo mkdir -p /etc/conf.d +sudo -E sh -c "envsubst < $PWD/install_files/etc/conf.d/celery \ + > /etc/conf.d/celery" +sudo -E sh -c "envsubst < $PWD/install_files/celerybeat.service \ + > /etc/systemd/system/celerybeat.service" +sudo -E sh -c "envsubst < $PWD/install_files/celery.service \ + > /etc/systemd/system/celery.service" + +# Initialize the fuseki datasets if they aren't already set up. +whyis init + +envsubst < install_files/system.conf > system.conf + +# enable wsgi +export WSGI_EXPRESS=$(which mod_wsgi-express) +sudo sh -c "$WSGI_EXPRESS module-config > /etc/apache2/mods-available/wsgi.load" +sudo a2enmod wsgi +sudo a2enmod headers +sudo -E sh -c "envsubst < $PWD/install_files/etc/apache2/sites-available/000-default.conf \ + > /etc/apache2/sites-available/000-default.conf" + +# set up fuseki +sudo -E sh -c "envsubst < $PWD/install_files/fuseki.service \ + > /etc/systemd/system/fuseki.service" + +sudo systemctl enable fuseki.service + +# start services +sudo service apache2 restart +sudo service celery restart +sudo service celerybeat restart +sudo service fuseki start + +echo "Complete!" diff --git a/whyis/materialsmine/setl/chem_props.setl.ttl b/whyis/materialsmine/setl/chem_props.setl.ttl new file mode 100644 index 00000000..cd925166 --- /dev/null +++ b/whyis/materialsmine/setl/chem_props.setl.ttl @@ -0,0 +1,79 @@ +@prefix : . +@prefix api_vocab: . +@prefix csvw: . +@prefix dcat: . +@prefix dcterms: . +@prefix nanomine: . +@prefix owl: . +@prefix prov: . +@prefix pv: . +@prefix rdfs: . +@prefix setl: . +@prefix void: . + +# Extracts the data out of the specified json +:table + a setl:JSON; + api_vocab:selector "item"; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used [ a ] + ]. + +:NanomineJSONImport rdfs:subClassOf setl:SemanticETLScript; + rdfs:label "Nanomine JSON Import SETL Script"; + setl:hasTemplatePrefix "http://nanomine.org/setl/json/"; + rdfs:subClassOf [ a owl:Restriction; + owl:onProperty prov:used; + owl:someValuesFrom + ]. + +# Transformation +:dataset + a void:Dataset; + prov:wasGeneratedBy [ + a setl:Transform, setl:JSLDT, :NanomineJSONImport; + prov:used :table; + setl:hasContext ''' + { + "sio": "http://semanticscience.org/resource/", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "dcterms": "http://purl.org/dc/terms/", + "skos": "http://www.w3.org/2004/02/skos/core#", + "xsd": "http://www.w3.org/2001/XMLSchema#" + + } + '''; + prov:value ''' + [{ + "@id": "http://example.com/{{slugify(row['_id'])}}", + "@type": "sio:ChemicalSubstance", + "dcterms:identifier": "{{row['_id'].strip()}}", + "sio:hasAttribute" : {"@type": "sio:Density", "sio:hasValue": {"@value": "{{row['_density']}}", "@type": "xsd:double"}}, + "rdfs:label": "{{row['_stdname']}}", + "skos:altLabel": [ + { + "@for": "name in row['_synonyms']", + "@do": "{{name}}" + }, + { + "@for": "name in row['_tradenames']", + "@do": "{{name}}" + } + ], + "skos:notation": [{ + "@for": "abbrev in row['_abbreviations']", + "@do": "{{abbrev}}" + }] + }] + ''' + ]. + +# Load to file +# +# a pv:File; +# dcterms:format "text/turtle"; +# prov:wasGeneratedBy [ +# a setl:Load; +# prov:used :dataset; +# ] . diff --git a/whyis/materialsmine/setl/dev_nanomine_files.setl.ttl b/whyis/materialsmine/setl/dev_nanomine_files.setl.ttl new file mode 100644 index 00000000..ad3d099d --- /dev/null +++ b/whyis/materialsmine/setl/dev_nanomine_files.setl.ttl @@ -0,0 +1,88 @@ +@prefix rdf: . +@prefix rdfs: . +@prefix xsd: . +@prefix owl: . +@prefix skos: . +@prefix prov: . +@prefix sio: . +@prefix dcat: . +@prefix dcterms: . +@prefix void: . +@prefix foaf: . +@prefix ov: . +@prefix setl: . +@prefix csvw: . +@prefix pv: . +@prefix sp: . +@prefix api_vocab: . + +@prefix : . + +@prefix nanopub: . + +:nanomine_files a setl:JSON; + api_vocab:selector "results.bindings.item"; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used + ]. + +:get a owl:Class, prov:SoftwareAgent, setl:PythonScript; + rdfs:subClassOf prov:Activity; + prov:value '''from requests import get as result'''. + +:b64encode a owl:Class, prov:SoftwareAgent, setl:PythonScript; + rdfs:subClassOf prov:Activity; + prov:value '''from base64 import b64encode as result'''. + +:nanomine_dev_files_import a setl:SemanticETLScript; + rdfs:label "Nanomine MDCS Import SETL Script". + +:nanopubs a void:Dataset; + prov:wasGeneratedBy :nanomine_dev_files_import, [ + a setl:Transform, setl:JSLDT; + prov:used :nanomine_files; + prov:qualifiedUsage [ a prov:Usage; prov:entity :b64encode; prov:hadRole [ dcterms:identifier "b64encode"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :get; prov:hadRole [ dcterms:identifier "get"]]; + setl:hasContext '''{ + "@base" : "http://nanomine.org/", + "schema": "http://schema.org/", + "xsd": "http://www.w3.org/2001/XMLSchema#", + "whyis": "http://vocab.rpi.edu/whyis/", + "np": "http://www.nanopub.org/nschema#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "sio": "http://semanticscience.org/resource/", + "dc": "http://purl.org/dc/terms/", + "prov": "http://www.w3.org/ns/prov#", + "mt" : "https://www.iana.org/assignments/media-types/" +}'''; + prov:value """[ + { + "@id" : "{{row['file']['value']}}", + "@type": [ + "schema:DataDownload", + "mt:text/xml", + "mt:text", + "http://nanomine.org/ns/NanomineXMLFile", + "http://purl.org/net/provenance/ns#File" + ], + "http://open.vocab.org/terms/hasContentType": "text/xml", + "whyis:hasContent" : {"@id" : "data:text/xml;charset=UTF-8;base64,{{b64encode(get(row['file']['value']+'?format=xml').text.encode('utf8')).decode('ascii')}}"}, + "dc:conformsTo" : {"@id" : "{{row['schema']['value']}}"} + }, + { + "@id" : "{{row['dataset']['value']}}", + "@type" : "schema:Dataset", + "schema:distribution" : [ {"@id" : "{{row['file']['value']}}"} ] + } +]""" + ]. + + + + a pv:File; + dcterms:format "text/turtle"; + prov:wasGeneratedBy [ + a setl:Load; + prov:used :nanopubs ; + ]. diff --git a/whyis/materialsmine/setl/materialsmine.ontology.setl b/whyis/materialsmine/setl/materialsmine.ontology.setl new file mode 100644 index 00000000..04b374fd --- /dev/null +++ b/whyis/materialsmine/setl/materialsmine.ontology.setl @@ -0,0 +1,435 @@ +@prefix rdf: . +@prefix rdfs: . +@prefix xsd: . +@prefix owl: . +@prefix skos: . +@prefix prov: . +@prefix sio: . +@prefix dcat: . +@prefix dcterms: . +@prefix void: . +@prefix foaf: . +@prefix ov: . +@prefix setl: . +@prefix csvw: . +@prefix pv: . +@prefix bibo: . + +@prefix : . + + +:imports_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:ontology_annotations_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:publication_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:property_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:processing_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:material_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:characterization_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:units_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:materialsmine_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:ontology a setl:SemanticETLScript; + rdfs:label "Materialsmine Ontology SETL Script". + +:materialsmine_ontology a void:Dataset; + prov:wasGeneratedBy :ontology, [ + a setl:Transform, setl:JSLDT; + prov:used :imports_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "bibo" : "http://purl.org/ontology/bibo/", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "http://materialsmine.org/ns", + "owl:imports": {"@id": "{{row.uri}}", "rdfs:label": "{{row.label}}"} + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :ontology_annotations_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "dcterms" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "http://materialsmine.org/ns", + "@type" : "owl:Ontology", + "{{row.annotation}}": [ + { "@if" : "not isempty(row.URI)", "@id" : "{{row.URI}}"}, + { "@if" : "isempty(row.URI)", "@value" : "{{row.value}}"} + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :publication_classes_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "bibo" : "http://purl.org/ontology/bibo/", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :property_classes_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "materialsmine:hasPreferredUnit" : [ { "@if" : "not isempty(row.preferredUnit)", "@id" : "{{row.preferredUnit}}"} ], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "materialsmine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :processing_classes_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "materialsmine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + }, + { "@if" : "not isempty(row.hasInput)", + "@for" : "input in row.hasInput.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasInput"}, + "owl:someValuesFrom" : { "@id": "{{input}}" } + } + }, + { "@if" : "not isempty(row.hasAttribute)", + "@for" : "attr in row.hasAttribute.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasAttribute"}, + "owl:someValuesFrom" : { "@id": "{{attr}}" } + } + }, + { "@if" : "not isempty(row.duration)", + "@for" : "attr in row.duration.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasAttribute"}, + "owl:someValuesFrom" : { "@id": "{{attr}}" } + } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :material_classes_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "materialsmine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :units_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "bibo" : "http://purl.org/ontology/bibo/", + "materialsmine" : "http://materialsmine.org/ns/" + }'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : [ + "sio:UnitOfMeasurement", + {"@if" : "row.absolute == 'y'", "@id" : "materialsmine:AbsoluteUnitOfMeasurement"} + ], + "rdfs:label" : "{{row.label}}", + "skos:notation" : [ { "@if" : "not isempty(row.notation)", "@value": "{{row.notation}}" }], + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :characterization_classes_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@context": "https://raw.githubusercontent.com/jimmccusker/ontext/master/owl-context.jsonld", + "@graph": [ + { + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "materialsmine:hasSelector" : [ { "@if" : "not isempty(row.xpath)", "@value": "{{row.xpath}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.generates)", + "@for" : "generate_type in row.generates.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"prov:generated"}, + "owl:someValuesFrom" : { "@id": "{{generate_type}}" } + } + }, + { "@if" : "not isempty(row.parameters)", + "@for" : "parameter in row.parameters.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"prov:used"}, + "owl:someValuesFrom" : { "@id": "{{parameter}}" } + } + } + ] + } + ] +}]'''],[ + a setl:Transform, setl:JSLDT; + prov:used :materialsmine_table; + setl:hasContext '''{ + "@vocab" : "http://materialsmine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "materialsmine" : "http://materialsmine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://materialsmine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : [ + "owl:Class", + { + "@if" : "not isempty(row.hasType)", + "@id" : "row.hasType" + } + ], + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "materialsmine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + } + ] + }] +}]''']. + + +# a pv:File; +# dcterms:format "application/trig"; +# prov:wasGeneratedBy [ +# a setl:Load; +# prov:used ; +# ]. + + a pv:File; + dcterms:format "text/turtle"; + prov:wasGeneratedBy [ + a setl:Load; + prov:used :materialsmine_ontology ; + ]. diff --git a/whyis/materialsmine/setl/materialsmine.ttl b/whyis/materialsmine/setl/materialsmine.ttl new file mode 100644 index 00000000..f5fb83a5 --- /dev/null +++ b/whyis/materialsmine/setl/materialsmine.ttl @@ -0,0 +1,2889 @@ +@prefix : . +@prefix bibo: . +@prefix dc: . +@prefix materialsmine: . +@prefix owl: . +@prefix prov: . +@prefix rdfs: . +@prefix sio: . +@prefix skos: . + +:ns a owl:Ontology ; + rdfs:label "Materialsmine Ontology" ; + dc:contributor , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + ; + rdfs:comment "A materials ontology to support data publication involving nanomaterials and metamaterials." ; + owl:imports bibo:, + , + ; + owl:versionIRI materialsmine:1.0 . + +materialsmine:1DGeometry a owl:Class ; + rdfs:label "1D Geometry" ; + rdfs:subClassOf materialsmine:Geometry ; + skos:definition "One-dimensional geometry, which can be fully described as a function of one coordinate. " . + +materialsmine:AC_DielectricConstant a owl:Class ; + rdfs:label "AC Dielectric Constant" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "A frequency-dependent measure of the electric polarizability of a dielectric material under an oscillating electric field." . + +materialsmine:AC_DielectricDispersion a owl:Class ; + rdfs:label "AC Dielectric Dispersion" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "Frequency dependence of dielectric permittivity under an oscillating electric field." . + +materialsmine:Abbreviation a owl:Class ; + rdfs:label "Abbreviation" ; + rdfs:subClassOf sio:Name ; + skos:definition "a shortened form of a word or phrase. It consists of a group of letters taken from the word or phrase." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Abbreviation" . + +materialsmine:Air a owl:Class ; + rdfs:label "Air" ; + rdfs:subClassOf materialsmine:AmbientCondition ; + skos:definition "Gaseous medium surrounding the solid boundaries of a material." . + +materialsmine:ArcResistance a owl:Class ; + rdfs:label "Arc Resistance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "A measure of the durability of an insulating or dielectric material against the formation of conductive paths along thesurface by arc discharges." . + +materialsmine:AspectRatio a owl:Class ; + rdfs:label "Aspect Ratio" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "is the ratio of its sizes in different dimensions. For example, the aspect ratio of a rectangle is the ratio of its longer side to its shorter side – the ratio of width to height, when the rectangle is oriented as a \"landscape\"." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Aspect_ratio" . + +materialsmine:Atactic a owl:Class ; + rdfs:label "Atactic" ; + rdfs:subClassOf materialsmine:Tacticity ; + skos:definition "In atactic macromolecules the substituents are placed randomly along the chain. The percentage of meso diads is between 1 and 99%. With the aid of spectroscopic techniques such as NMR it is possible to pinpoint the composition of a polymer in terms of the percentages for each triad." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Atactic_polymers" . + +materialsmine:AtomicForceMicroscopy a owl:Class ; + rdfs:label "Atomic Force Microscopy" ; + materialsmine:hasSelector "//Atomic_Force_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:MechanicalProperty ], + sio:Measuring ; + skos:definition "Nanoscale probing of material surface characteristics" . + +materialsmine:BallMilling a owl:Class ; + rdfs:label "Ball Milling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Additive ], + materialsmine:Mixing ; + skos:definition "Grinding process with rotating cylindrical shells and ball " . + +materialsmine:BandGapIndex a owl:Class ; + rdfs:label "Band Gap Index" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "Integer rank of a band gap." . + +materialsmine:BandGapLocation a owl:Class ; + rdfs:label "Band Gap Location" ; + rdfs:subClassOf sio:Position ; + skos:definition "The center of the band gap. This can be computed as the average of the upper bound and lower bound of the bandgap." . + +materialsmine:BandGapSize a owl:Class ; + rdfs:label "Band Gap Size" ; + rdfs:subClassOf sio:Width ; + skos:definition "The width of the band gap. This can be computed as the upper bound of the bandgap minus the lower bound of the bandgap." . + +materialsmine:BandGapType a owl:Class ; + rdfs:label "Band Gap Type" ; + rdfs:subClassOf materialsmine:BandGap ; + skos:definition "If the band gap is particular to a specific type of mode, which type of mode?" . + +materialsmine:BarrelTemperature a owl:Class ; + rdfs:label "Barrel Temperature" ; + rdfs:subClassOf . + +materialsmine:Book a owl:Class ; + rdfs:label "Book" ; + rdfs:subClassOf sio:Document . + +materialsmine:BreakdownStrength a owl:Class ; + rdfs:label "Breakdown Strength" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "The electric field at which the probability of failure is ln(-ln(1-p)) = 0, or approximately p = 0.632." . + +materialsmine:BrittleTemperature a owl:Class ; + rdfs:label "Brittle Temperature" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty, + ; + skos:definition "Brittleness temperature is the temperature at which 50% of the tested specimens exhibit brittle failure at specified impact conditions" . + +materialsmine:C11 a owl:Class ; + rdfs:label "C11" ; + rdfs:subClassOf materialsmine:CMatrixElement ; + skos:definition "C matrix element with indices 1 and 1" . + +materialsmine:C12 a owl:Class ; + rdfs:label "C12" ; + rdfs:subClassOf materialsmine:CMatrixElement ; + skos:definition "C matrix element with indices 1 and 2" . + +materialsmine:C16 a owl:Class ; + rdfs:label "C16" ; + rdfs:subClassOf materialsmine:CMatrixElement ; + skos:definition "C matrix element with indices 1 and 6" . + +materialsmine:C22 a owl:Class ; + rdfs:label "C22" ; + rdfs:subClassOf materialsmine:CMatrixElement ; + skos:definition "C matrix element with indices 2 and 2" . + +materialsmine:C26 a owl:Class ; + rdfs:label "C26" ; + rdfs:subClassOf materialsmine:CMatrixElement ; + skos:definition "C matrix element with indices 2 and 6" . + +materialsmine:C66 a owl:Class ; + rdfs:label "C66" ; + rdfs:subClassOf materialsmine:CMatrixElement ; + skos:definition "C matrix element with indices 6 and 6" . + +materialsmine:CMatrix a owl:Class ; + rdfs:label "Material Stiffness Matrix" ; + rdfs:subClassOf sio:Matrix ; + skos:definition "The material stiffness matrix of a linear elastic material defines the relationship between the stress and strain vector such that $\\sigma = C\\epsilon$, where $\\sigma$ = ..." . + +materialsmine:CMatrixIndexI a owl:Class ; + rdfs:label "C Matrix Index I" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "The corresponding row of an element within a stiffness matrix (Voigt notation)." . + +materialsmine:CMatrixIndexJ a owl:Class ; + rdfs:label "C Matrix Index J" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "The corresponding column of an element within a stiffness matrix (Voigt notation)." . + +materialsmine:CMatrixIndicesIJ a owl:Class ; + rdfs:label "C Matrix Indices I J" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "The location of an element within a material stiffness matrix, in the form of the full string IJ (Voigt notation)." . + +materialsmine:CTensor a owl:Class ; + rdfs:label "Material Stiffness Tensor" ; + rdfs:subClassOf sio:Tensor ; + skos:definition "The material stiffness tensor of a linear elastic material defines the relationship between the stress and strain tensors such that $\\sigma = C\\epsilon$, where $\\sigma$ is the Cauchy stress tensor (a second order tensor), and $\\epsilon$ is the infinitesimal strain tensor (a second order tensor)." . + +materialsmine:CTensorElement a owl:Class ; + rdfs:label "C Tensor Element" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "An element within a material stiffness tensor." . + +materialsmine:CTensorIndexI a owl:Class ; + rdfs:label "C Tensor Index I" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "The i component of an element's location within a material stiffness tensor." . + +materialsmine:CTensorIndexJ a owl:Class ; + rdfs:label "C Tensor Index J" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "The j component of an element's location within a material stiffness tensor." . + +materialsmine:CTensorIndexK a owl:Class ; + rdfs:label "C Tensor Index K" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "The k component of an element's location within a material stiffness tensor." . + +materialsmine:CTensorIndexL a owl:Class ; + rdfs:label "C Tensor Index L" ; + rdfs:subClassOf materialsmine:Index ; + skos:definition "The l component of an element's location within a material stiffness tensor." . + +materialsmine:CTensorIndicesIJKL a owl:Class ; + rdfs:label "C Tensor Indices I J K L" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "The location of an element within a material stiffness tensor, in the form of the full string IJKL." . + +materialsmine:CU_Formula a owl:Class ; + rdfs:label "Constitutional Unit Formula" ; + rdfs:subClassOf sio:Name ; + skos:definition "a way of expressing information about the proportions of atoms that constitute a particular chemical compound, using a single line of chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas and plus (+) and minus (−) signs. " ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Chemical_formula" . + +materialsmine:CartesianVector a owl:Class ; + rdfs:label "Cartesian Vector" ; + rdfs:subClassOf sio:Vector ; + skos:definition "A vector defined in the Cartesian coordinate system." . + +materialsmine:Casting a owl:Class ; + rdfs:label "Casting" ; + rdfs:subClassOf materialsmine:Molding . + +materialsmine:Centrifugation a owl:Class ; + rdfs:label "Centrifugation" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "process which involves the application of the centripetal force for the sedimentation of heterogeneous mixtures with a centrifuge" . + +materialsmine:CharpyImpactEnergy a owl:Class ; + rdfs:label "Charpy Impact Energy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:MechanicalProperty ; + skos:definition "Energy absorbed by the sample during Charpy impact testing" . + +materialsmine:ChemicalUsed a owl:Class ; + rdfs:label "Chemical Used" ; + rdfs:subClassOf sio:ChemicalEntity . + +materialsmine:CoRotation a owl:Class ; + rdfs:label "Co-Rotation" ; + rdfs:subClassOf materialsmine:RotationMode . + +materialsmine:Communication a owl:Class ; + rdfs:label "Communication" ; + rdfs:subClassOf bibo:AcademicArticle . + +materialsmine:Compression a owl:Class ; + rdfs:label "Compression" ; + rdfs:subClassOf materialsmine:ViscoelasticProperty ; + skos:definition "Describing countervailing forces applied inward along the central axis of a material." . + +materialsmine:CompressionModulus a owl:Class ; + rdfs:label "Compression Modulus" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:CompressionProperty ; + skos:definition "The ratio of compressive stress to compressive strain" . + +materialsmine:CompressionStressAtBreak a owl:Class ; + rdfs:label "Compression Stress At Break" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:CompressionProperty ; + skos:definition "Compression stress when specimen breaks" . + +materialsmine:CompressionStressAtYield a owl:Class ; + rdfs:label "Compression Stress At Yield" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:CompressionProperty ; + skos:definition "Compression stress at yield point" . + +materialsmine:CompressiveCreepRuptureStrength a owl:Class ; + rdfs:label "Compressive Creep Rupture Strength" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:CompressiveCreep ; + skos:definition "Material strength at rupture during a compressive creep test" . + +materialsmine:CompressiveCreepRuptureTime a owl:Class ; + rdfs:label "Compressive Creep Rupture Time" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:CompressiveCreep ; + skos:definition "Time taken to rupture from applying load during a compressive creep test" . + +materialsmine:CompressiveCreepStrain a owl:Class ; + rdfs:label "Compressive Creep Strain" ; + rdfs:subClassOf materialsmine:CompressiveCreep ; + skos:definition "Profile of strain as a function of time during a compressive creep test" . + +materialsmine:CompressiveLoadingProfile a owl:Class ; + rdfs:label "Compressive Loading Profile" ; + rdfs:subClassOf materialsmine:CompressionProperty ; + skos:definition "Stress vs. strain curve of during compressive loading and/or unloading test" . + +materialsmine:CompressiveToughness a owl:Class ; + rdfs:label "Compressive Toughness" ; + rdfs:subClassOf materialsmine:CompressionProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied compressive load." . + +materialsmine:CondensedBinary2DGeometry a owl:Class ; + rdfs:label "Condensed Binary 2D Geometry" ; + rdfs:subClassOf materialsmine:Binary2DGeometry ; + skos:definition "If a representative unit cell geometry has a given symmetry type, the condensed binary 2D geometry is a string that represents only the unique pixels in the pixelated geometry." . + +materialsmine:ConePlateRheometery a owl:Class ; + rdfs:label "Cone-Plate Rheometry" ; + materialsmine:hasSelector "//Rheometery[RheometerType='cone-plate']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + materialsmine:Rheometery ; + skos:definition "The liquid is placed on horizontal plate and a shallow cone placed into it. The angle between the surface of the cone and the plate is around 1–2 degrees but can vary depending on the types of tests being run. Typically the plate is rotated and the torque on the cone measured." . + +materialsmine:Constituent a owl:Class ; + rdfs:label "Constituent" ; + rdfs:subClassOf sio:MaterialEntity . + +materialsmine:ConstitutionalUnit a owl:Class ; + rdfs:label "Constitutional Unit" ; + rdfs:subClassOf sio:UnitOfMeasurement . + +materialsmine:Cooling a owl:Class ; + rdfs:label "Cooling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:AmbientCondition ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + sio:Procedure . + +materialsmine:Copolymer a owl:Class ; + rdfs:label "Copolymer" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "polymers containing a mixture of repeat units" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . + +materialsmine:CounterRotation a owl:Class ; + rdfs:label "Counter-Rotation" ; + rdfs:subClassOf materialsmine:RotationMode . + +materialsmine:CrystalPhase a owl:Class ; + rdfs:label "Crystal Phase" ; + rdfs:subClassOf sio:CrystalStructure ; + skos:definition "A single material may have several distinct solid states capable of forming separate phases. Water is a well-known example of such a material. For example, water ice is ordinarily found in the hexagonal form ice Ih, but can also exist as the cubic ice Ic, the rhombohedral ice II, and many other forms. Polymorphism is the ability of a solid to exist in more than one crystal form. For pure chemical elements, polymorphism is known as allotropy. For example, diamond, graphite, and fullerenes are different allotropes of carbon." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Phase_(matter)#Crystal_phases" . + +materialsmine:CrystallizationTemperature a owl:Class ; + rdfs:label "Crystallization Temperature" ; + rdfs:subClassOf materialsmine:ThermalProperty, + ; + skos:definition "It is the temperature at which a solid phase begins to form, resulting in a mixture of solid particles and solution" . + +materialsmine:CubeGeomtry a owl:Class ; + rdfs:label "Cube Geomtry" ; + rdfs:subClassOf materialsmine:CuboidalGeometry . + +materialsmine:Curing a owl:Class ; + rdfs:label "Curing" ; + rdfs:subClassOf sio:Procedure . + +materialsmine:CurrentDensity a owl:Class ; + rdfs:label "Current Density" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "the amount of electric current flowing per unit cross-sectional area of a material." . + +materialsmine:CycleInformation a owl:Class ; + rdfs:label "Cycle Information" ; + materialsmine:hasSelector "//CycleInformation" ; + rdfs:subClassOf sio:InformationContentEntity . + +materialsmine:DC_DielectricConstant a owl:Class ; + rdfs:label "DC Dielectric Constant" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "A measure of the electric polarizability of a dielectric material" . + +materialsmine:DSC_Profile a owl:Class ; + rdfs:label "DSC Profile" ; + rdfs:subClassOf materialsmine:ThermalProperty ; + skos:definition "Heat flow vs temperature out of a differential scanning calorimetry experiment" . + +materialsmine:DateOfCitation a owl:Class ; + rdfs:label "Date of Citation" ; + rdfs:subClassOf sio:TimeInstant . + +materialsmine:DateOfMeasurement a owl:Class ; + rdfs:label "Date of Measurement" ; + rdfs:subClassOf sio:TimeInstant . + +materialsmine:DateOfSampleMade a owl:Class ; + rdfs:label "Date of Sample Made" ; + rdfs:subClassOf sio:TimeInstant . + +materialsmine:DegreeOfCrystallization a owl:Class ; + rdfs:label "Degree of Crystallinity" ; + rdfs:subClassOf materialsmine:Crystallinity ; + skos:definition "The percentage of the crystallized region in a polymer/material. It describes the extent of the crystallization process" . + +materialsmine:Density a owl:Class ; + rdfs:label "Density" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:VolumetricProperty, + sio:Density ; + skos:definition "The density, or more precisely, the volumetric mass density, of a substance is its mass per unit volume.", + "degree of consistency measured by the quantity of mass per unit volume" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Density" . + +materialsmine:DieDiameter a owl:Class ; + rdfs:label "Die Diameter" ; + rdfs:subClassOf . + +materialsmine:DielectricLossPermittivity a owl:Class ; + rdfs:label "Dielectric Loss Permittivity" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "The imaginary component of the frequency-dependent complex permittivity of a material under an oscillating electric field." . + +materialsmine:DielectricLossTangent a owl:Class ; + rdfs:label "Dielectric Loss Tangent" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "The ratio of the imaginary to real components of permittivity, representing the dissipation of electromagnetic energy in the presence of an oscillating electric field." . + +materialsmine:DielectricRealPermittivity a owl:Class ; + rdfs:label "Dielectric Real Permittivity" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "The real component of the frequency-dependent complex permittivity of a material under an oscillating electric field." . + +materialsmine:DielectricandImpedanceSpectroscopyAnalysis a owl:Class ; + rdfs:label "Dielectric and Impedance Spectroscopy Analysis" ; + materialsmine:hasSelector "//Dielectric_and_Impedance_Spectroscopy_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of dielectric spectroscopy (variation of dielectric constant with frequency) " . + +materialsmine:DifferentialScanningCalorimetry a owl:Class ; + rdfs:label "Differential Scanning Calorimetry" ; + materialsmine:hasSelector "//Differential_Scanning_Calorimetry" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ThermalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:HeatingRate ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:CoolingRate ], + sio:Measuring ; + skos:definition "Measurement of heat required to increase unit temperature in a material" . + +materialsmine:DispersionRelation1D a owl:Class ; + rdfs:label "1D Dispersion Relation" ; + rdfs:subClassOf materialsmine:DispersionRelation ; + skos:definition "Frequency-wavevector pairs that represent the propogation of wave modes found in a specific 1D geometry." . + +materialsmine:DispersionRelation2D a owl:Class ; + rdfs:label "2D Dispersion Relation" ; + rdfs:subClassOf materialsmine:DispersionRelation ; + skos:definition "Frequency-wavevector pairs that represent the propogation of wave modes found in a specific 2D geometry." . + +materialsmine:DispersionRelation3D a owl:Class ; + rdfs:label "3D Dispersion Relation" ; + rdfs:subClassOf materialsmine:DispersionRelation ; + skos:definition "Frequency-wavevector pairs that represent the propogation of wave modes found in a specific 3D geometry." . + +materialsmine:Dissolving a owl:Class ; + rdfs:label "Dissolving" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Solvent ], + sio:Procedure ; + skos:definition "Dissolving into solution without external force" . + +materialsmine:Drying-Evaporation a owl:Class ; + rdfs:label "Drying Evaporation" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:AmbientCondition ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + sio:Procedure ; + skos:definition "Process for drying and evaporation of liquid solutions" . + +materialsmine:DynamicMechanicalAnalysis a owl:Class ; + rdfs:label "Dynamic Mechanical Analysis" ; + materialsmine:hasSelector "//Dynamic_Mechanical_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + sio:Measuring ; + skos:definition "Method to get viscoelastic behavior of materials with controlled temperature and frequency" . + +materialsmine:DynamicProperty a owl:Class ; + rdfs:label "Dynamic Property" ; + rdfs:subClassOf materialsmine:ViscoelasticProperty ; + skos:definition "A materials property representing the behavior of the material under some dynamic environmental force." . + +materialsmine:DynamicPropertyProfile a owl:Class ; + rdfs:label "Dynamic Property Profile" ; + rdfs:subClassOf materialsmine:Profile ; + skos:definition "A profile describing a dynamic property measurement (e.g., in dynamic mechanical analysis)." . + +materialsmine:DynamicViscosity a owl:Class ; + rdfs:label "Dynamic Viscosity" ; + rdfs:subClassOf materialsmine:RheologicalViscosity ; + skos:definition "A measure of a fluid's resistance to flow." . + +materialsmine:Editor a owl:Class ; + rdfs:label "Editor" ; + rdfs:subClassOf prov:Agent . + +materialsmine:Eigenfrequency a owl:Class ; + rdfs:label "Eigenfrequency" ; + rdfs:subClassOf sio:Frequency ; + skos:definition "The eigenvalue associated with a solution to the wave equation. This is the inverse time component of the dispersion relation." . + +materialsmine:Eigenvector a owl:Class ; + rdfs:label "Eigenvector" ; + rdfs:subClassOf sio:Vector ; + skos:definition "The mode shape associated a solution to the wave equation for a particular eigenvalue." . + +materialsmine:ElasticityTensor a owl:Class ; + rdfs:label "Elasticity Tensor" ; + rdfs:subClassOf sio:Tensor . + +materialsmine:Elastomer a owl:Class ; + rdfs:label "Elastomer" ; + rdfs:subClassOf materialsmine:Plastic ; + skos:definition "a polymer with viscoelasticity (having both viscosity and elasticity) and very weak inter-molecular forces, generally having low Young's modulus and high failure strain compared with other materials." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Elastomer" . + +materialsmine:ElectricPercolationThreshold a owl:Class ; + rdfs:label "Electric Percolation Threshold" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "minimum filler content in the polymer matrix after which there is no significant change in the electrical properties of the composites." . + +materialsmine:ElectricalConductivity a owl:Class ; + rdfs:label "Electric Conductivity" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "ability of electric current to flow through a material" . + +materialsmine:Electrometry a owl:Class ; + rdfs:label "Electrometry" ; + materialsmine:hasSelector "//Electrometry" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of electric charge or electrical potential difference" . + +materialsmine:ElongationAtBreak a owl:Class ; + rdfs:label "Elongation At Break" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Elongation of specimen when breaks" . + +materialsmine:ElongationAtYield a owl:Class ; + rdfs:label "Elongation At Yield" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Tensile elongation corresponding to the yield (an increase in strain does not result in an increase in stress)." . + +materialsmine:EnergyDensity a owl:Class ; + rdfs:label "Energy Density" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "amount of energy stored in a given system or region of space per unit volume or mass" . + +materialsmine:Equipment a owl:Class ; + rdfs:label "Equipment", + "Equipment Used" ; + materialsmine:hasSelector "//Equipment", + "//EquipmentUsed" ; + rdfs:subClassOf sio:Device . + +materialsmine:EssentialWorkOfFracture a owl:Class ; + rdfs:label "Essential Work Of Fracture" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:FractureToughnessProperty ; + skos:definition "Energy associated with cracking at the process zone" . + +materialsmine:Eutactic a owl:Class ; + rdfs:label "Eutactic" ; + rdfs:subClassOf materialsmine:Tacticity ; + skos:definition "In eutactic macromolecules, substituents may occupy any specific (but potentially complex) sequence of positions along the chain. Isotactic and syndiotactic polymers are instances of the more general class of eutactic polymers, which also includes heterogeneous macromolecules in which the sequence consists of substituents of different kinds (for example, the side-chains in proteins and the bases in nucleic acids)." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Eutactic_polymers" . + +materialsmine:ExperimentalProcedure a owl:Class ; + rdfs:label "Experimental Procedure" ; + rdfs:subClassOf sio:Procedure . + +materialsmine:Experimenter a owl:Class ; + rdfs:label "Experimenter" ; + rdfs:subClassOf prov:Agent . + +materialsmine:Extrusion a owl:Class ; + rdfs:label "Extrusion" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Extruder ], + sio:Procedure ; + skos:definition "Process used to create objects of a fixed cross-sectional profile. A material is pushed through a die of the desired cross-section." . + +materialsmine:FiberTensileElongation a owl:Class ; + rdfs:label "Fiber Tensile Elongation" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Elongation along grain direction in fibers" . + +materialsmine:FiberTensileModulus a owl:Class ; + rdfs:label "Fiber Tensile Modulus" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Tensile modulus along grain direction in fibers" . + +materialsmine:FiberTensileStrength a owl:Class ; + rdfs:label "Fiber Tensile Strength" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Tensile Stress along grain direction in fibers" . + +materialsmine:Filler a owl:Class ; + rdfs:label "Filler" ; + rdfs:subClassOf sio:Role . + +materialsmine:FillerComponentComposition a owl:Class ; + rdfs:label "Filler Component Composition" ; + rdfs:subClassOf materialsmine:Composition . + +materialsmine:FillerComponentInComposite a owl:Class ; + rdfs:label "Filler Component in Composite" ; + rdfs:subClassOf materialsmine:FillerComponent . + +materialsmine:FillerComposition a owl:Class ; + rdfs:label "Filler Composition" ; + rdfs:subClassOf materialsmine:Composition . + +materialsmine:FillerProcessing a owl:Class ; + rdfs:label "Filler Processing" ; + rdfs:subClassOf materialsmine:Processing . + +materialsmine:FlexuralCreepRuptureStrength a owl:Class ; + rdfs:label "Flexural Creep Rupture Strength" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:FlexuralCreep ; + skos:definition "Material strength at rupture during a flexural creep test" . + +materialsmine:FlexuralCreepRuptureTime a owl:Class ; + rdfs:label "Flexural Creep Rupture Time" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:FlexuralCreep ; + skos:definition "Time taken to rupture from applying load during a flexural creep test" . + +materialsmine:FlexuralCreepStrain a owl:Class ; + rdfs:label "Flexural Creep Strain" ; + rdfs:subClassOf materialsmine:FlexuralCreep ; + skos:definition "Profile of strain as a function of time during a flexural creep test" . + +materialsmine:FlexuralLoadingProfile a owl:Class ; + rdfs:label "Flexural Loading Profile" ; + rdfs:subClassOf materialsmine:FlexuralProperty ; + skos:definition "Stress vs. strain curve of during flexural loading and/or unloading test" . + +materialsmine:FlexuralModulus a owl:Class ; + rdfs:label "Flexural Modulus" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:FlexuralProperty ; + skos:definition "Ratio of stress to strain in flexural deformation, or the tendency for a material to bend" . + +materialsmine:FlexuralStressAtBreak a owl:Class ; + rdfs:label "Flexural Stress At Break" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:FlexuralProperty ; + skos:definition "Flexural stress at the moment at which a test specimen tears" . + +materialsmine:FlexuralStressAtYield a owl:Class ; + rdfs:label "Flexural Stress At Yield" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:FlexuralProperty ; + skos:definition "Flexural stress corresponding to the yield point" . + +materialsmine:FlexuralToughness a owl:Class ; + rdfs:label "Flexural Toughness" ; + rdfs:subClassOf materialsmine:FlexuralProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied flexural load." . + +materialsmine:FourierTransformInfraredSpectroscopy a owl:Class ; + rdfs:label "Fourier Transform Infrared Spectroscopy" ; + materialsmine:hasSelector "//Fourier_Transform_Infrared_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:Spectroscopy ], + sio:Measuring ; + skos:definition "Measurement of infrared spectrum of absorption or emission of a solid, liquid or gas" . + +materialsmine:FractureEnergy a owl:Class ; + rdfs:label "Fracture Energy" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "The energy required to create a new surface in the material, measured by the energy absorbed by the material during fracture." . + +materialsmine:FrequencySweep a owl:Class ; + rdfs:label "Frequency Sweep" ; + rdfs:subClassOf materialsmine:MeasurementMethod ; + skos:definition "A continuous variation of frequency within a pre-defined range." . + +materialsmine:GeometryEncoding a owl:Class ; + rdfs:label "Geometry Encoding" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "The string-based representation scheme for a geometric arrangement." . + +materialsmine:GlassTransitionTemperature a owl:Class ; + rdfs:label "Glass Transition Temperature" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty, + ; + skos:definition "is the temperature region where the polymer transitions from a hard, glassy material to a soft, rubbery material." . + +materialsmine:GraftDensity a owl:Class ; + rdfs:label "Graft Density" ; + rdfs:subClassOf sio:Density ; + skos:definition "A result of surface treatment process, the graft density quantifies the area density of surface-treatment molecules on the surface of the filler, typically in units of chains/nm^2." . + +materialsmine:GroupVelocity a owl:Class ; + rdfs:label "Group Velocity" ; + rdfs:subClassOf sio:Velocity ; + skos:definition "The group velocity associated with a solution to the wave equation. This can be computed as the gradient of the eigenfrequency with respect to the wavevector." . + +materialsmine:GrowthRateOfCrystal a owl:Class ; + rdfs:label "Growth Rate Of Crystal" ; + rdfs:subClassOf materialsmine:Crystallinity ; + skos:definition "Rate of the crystallization process" . + +materialsmine:GrowthRateParameterOfAvramiEquation a owl:Class ; + rdfs:label "Growth Rate Parameter Of Avrami Equation" ; + rdfs:subClassOf materialsmine:Crystallinity ; + skos:definition "Growth Rate Parameter in Avrami Equation" . + +materialsmine:HalflifeOfCrystallization a owl:Class ; + rdfs:label "Halflife Of Crystallization" ; + rdfs:subClassOf materialsmine:Crystallinity ; + skos:definition "The time required for half of a material to form a crystalline structure under some condition." . + +materialsmine:Hardener a owl:Class ; + rdfs:label "Hardener" ; + rdfs:subClassOf materialsmine:Additive ; + skos:definition "A chemical additive that increases the viscosity of a polymer." . + +materialsmine:HardnessScale a owl:Class ; + rdfs:label "Hardness Scale" ; + rdfs:subClassOf materialsmine:HardnessProperty ; + skos:definition "A standard numerical scale associated with a particular hardness test tip geometry." . + +materialsmine:HardnessTestStandard a owl:Class ; + rdfs:label "Hardness Test Standard" ; + rdfs:subClassOf materialsmine:HardnessProperty ; + skos:definition "A materials testing standard, created by a standards body such as ASTM, defining test parameters such as pre-load, load, and tip geometry of the testing apparatus." . + +materialsmine:HardnessValue a owl:Class ; + rdfs:label "Hardness Value" ; + rdfs:subClassOf materialsmine:HardnessProperty ; + skos:definition "The numerical value of hardness output by the testing apparatus, given a particular hardness scale as input." . + +materialsmine:HeatOfCrystallization a owl:Class ; + rdfs:label "Heat Of Crystallization" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty ; + skos:definition "The amount of heat that must be removed from one gram of a liquid at its freezing point to freeze it with no change in temperature." . + +materialsmine:HeatOfFusion a owl:Class ; + rdfs:label "Heat Of Fusion" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty ; + skos:definition "change in enthalpy with energy dissipation" . + +materialsmine:Heating a owl:Class ; + rdfs:label "Heating" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:AmbientCondition ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + sio:Procedure ; + skos:definition "Process for applying heat" . + +materialsmine:HeatingZone a owl:Class ; + rdfs:label "Heating Zone" ; + rdfs:subClassOf sio:SpatialRegion . + +materialsmine:HeatingZoneNumber a owl:Class ; + rdfs:label "Heating Zone Number" ; + rdfs:subClassOf sio:Number . + +materialsmine:HexagonalGeometry a owl:Class ; + rdfs:label "Hexagonal Geometry" ; + rdfs:subClassOf materialsmine:2DGeometry . + +materialsmine:HighPressureCapillaryRheometery a owl:Class ; + rdfs:label "High Pressure Capillary Rheometry" ; + materialsmine:hasSelector "//Rheometery[RheometerType='high pressure capillary']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + materialsmine:Rheometery . + +materialsmine:HighShearMixing a owl:Class ; + rdfs:label "High Shear Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Additive ], + materialsmine:Mixing ; + skos:definition "A stator-rotator setup that disperses substance into continuous phase through high shear" . + +materialsmine:Homopolymer a owl:Class ; + rdfs:label "Homopolymer" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "polymers that contain only a single type of repeat unit" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . + +materialsmine:HotPressing a owl:Class ; + rdfs:label "Hot-Processing (Compression Molding)" ; + rdfs:subClassOf materialsmine:Molding ; + skos:definition "Applying heat and pressure" . + +materialsmine:ISBN a owl:Class ; + rdfs:label "ISBN" ; + rdfs:subClassOf sio:InformationalEntityIdentifier . + +materialsmine:ISSN a owl:Class ; + rdfs:label "ISSN" ; + rdfs:subClassOf sio:InformationalEntityIdentifier . + +materialsmine:IZOD_Area a owl:Class ; + rdfs:label "IZOD Area" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:MechanicalProperty ; + skos:definition "Area associated in Izod impact testing" . + +materialsmine:IZOD_ImpactEnergy a owl:Class ; + rdfs:label "IZOD Impact Energy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:MechanicalProperty ; + skos:definition "Energy absorbed by the sample during Izod impact testing, as calculated by the height of swing arm" . + +materialsmine:ImpactToughness a owl:Class ; + rdfs:label "Impact Toughness" ; + rdfs:subClassOf materialsmine:Impact ; + skos:definition "The amount of impact energy a material can absorb prior to fracture." . + +materialsmine:Impedance a owl:Class ; + rdfs:label "Impedance" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "The effective resistance to an alternating current." . + +materialsmine:In-SituPolymerization a owl:Class ; + rdfs:label "In-Situ Polymerization" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of nanoparticles within liquid monomer so that polymer formation results in embedding of particles" . + +materialsmine:Inert a owl:Class ; + rdfs:label "Inert" ; + rdfs:subClassOf materialsmine:AmbientCondition . + +materialsmine:InjectionMolding a owl:Class ; + rdfs:label "Injection Molding" ; + rdfs:subClassOf materialsmine:Molding . + +materialsmine:Institution a owl:Class ; + rdfs:label "Institution or Lab" ; + rdfs:subClassOf sio:Institute . + +materialsmine:InterfacialTension a owl:Class ; + rdfs:label "Interfacial Tension" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:VolumetricProperty ; + skos:definition "Interfacial tension is the force that holds the surfaceof a particular phase together" . + +materialsmine:InterphaseThickness a owl:Class ; + rdfs:label "Interphase Thickness" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:VolumetricProperty ; + skos:definition "Thickness of matrix-particle interaction area with a gradient property as a function of distance from particle surface" . + +materialsmine:IrreducibleBrillouinZone a owl:Class ; + rdfs:label "Irreducible Brillouin Zone" ; + rdfs:subClassOf sio:SpatialRegion ; + skos:definition "The smallest subspace of wavevector space that can be tesselated to form the dispersion relation over the entire wavevector space. Also the largest subspace of wavevector space that does not contain redundant information. The shape and size of this subspace depends on the geometry and symmetry of the unit cell." . + +materialsmine:IrreducibleBrillouinZoneContour a owl:Class ; + rdfs:label "Irreducible Brillouin Zone Contour" ; + rdfs:subClassOf sio:SpatialBoundary ; + skos:definition "A contour in wavevector space that traverses the perimeter of the Irreducible Brillouin Zone." . + +materialsmine:Isotactic a owl:Class ; + rdfs:label "Isotactic" ; + rdfs:subClassOf materialsmine:Tacticity ; + skos:definition """Isotactic polymers are composed of isotactic macromolecules (IUPAC definition). In isotactic macromolecules all the substituents are located on the same side of the macromolecular backbone. An isotactic macromolecule consists of 100% meso diads. Polypropylene formed by Ziegler-Natta catalysis is an isotactic polymer. Isotactic polymers are usually semicrystalline and often form a helix configuration. + +""" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Isotactic_polymers" . + +materialsmine:JIntegral a owl:Class ; + rdfs:label "J Integral" ; + rdfs:subClassOf sio:Equation ; + skos:definition "In fracture mechanics, the J-integral represents the energy required to advance a crack in a material (related to the fracture toughness)." . + +materialsmine:KFactor a owl:Class ; + rdfs:label "K Factor" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "In fracture mechanics, the Stress Intensity Factor, K, describes the stress state at the tip of a crack in a material." . + +materialsmine:LC_PhaseTransitionTemperature a owl:Class ; + rdfs:label "LC Phase Transition Temperature" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty, + ; + skos:definition "temperature of transition to liquid crystal phase" . + +materialsmine:LatticeVector a owl:Class ; + rdfs:label "Lattice vector" ; + rdfs:subClassOf sio:Length ; + skos:definition "A matrix composed of multiple Cartesian vectors, each representing a lattice vector. The combination of lattice vectors define the lattice geometry." . + +materialsmine:LengthOfHeatingZone a owl:Class ; + rdfs:label "Length Of Heating Zone" ; + rdfs:subClassOf sio:Length . + +materialsmine:LinearElastic a owl:Class ; + rdfs:label "Linear Elastic" ; + rdfs:subClassOf materialsmine:FractureToughnessProperty ; + skos:definition "If a material is linear elastic, it means that it can be well-modeled by the theory of linear elasiticity. This means that deformations and strains are linearly proportional to loads. It also means that the technique of superposition can be applied.", + "Infinitesimal material deformation or deformation within the linear regime" . + +materialsmine:LinearExpansionCoefficient a owl:Class ; + rdfs:label "Linear Expansion Coefficient" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:VolumetricProperty ; + skos:definition "It is the fractional change in length per degree of temperature change" . + +materialsmine:ManufacturerOrSourceName a owl:Class ; + rdfs:label "Manufacturer Or Source Name" ; + rdfs:subClassOf sio:Organization ; + skos:definition "An organization that enages in the value added production of merchandise for use or sale using labour and machines, tools, chemical and biological processing, or formulation." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Manufacturing" . + +materialsmine:MassFraction a owl:Class ; + rdfs:label "Mass Fraction" ; + rdfs:subClassOf sio:Concentration . + +materialsmine:MasterCurve a owl:Class ; + rdfs:label "Master Curve" ; + rdfs:subClassOf sio:Curve ; + skos:definition "see Rheological Master Curve" . + +materialsmine:Matrix a owl:Class ; + rdfs:label "Matrix" ; + rdfs:subClassOf sio:Role . + +materialsmine:MatrixComponent a owl:Class ; + rdfs:label "Matrix Component" ; + rdfs:subClassOf materialsmine:Component . + +materialsmine:MatrixComponentComposition a owl:Class ; + rdfs:label "Matrix Component Composition" ; + rdfs:subClassOf materialsmine:Composition . + +materialsmine:MatrixProcessing a owl:Class ; + rdfs:label "Matrix Processing" ; + rdfs:subClassOf materialsmine:Processing . + +materialsmine:MechanicalMixing a owl:Class ; + rdfs:label "Mechanical Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Additive ], + materialsmine:Mixing ; + skos:definition "Manual mixing" . + +materialsmine:MeltMixing a owl:Class ; + rdfs:label "Melt Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Additive ], + materialsmine:Mixing ; + skos:definition "Mixing of polymer and nanoparticles in molten state" . + +materialsmine:MeltProcessing a owl:Class ; + rdfs:label "Melt Processing" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of polymer and nanoparticles in molten state" . + +materialsmine:MeltViscosity a owl:Class ; + rdfs:label "Melt Viscosity" ; + rdfs:subClassOf materialsmine:RheologicalViscosity ; + skos:definition "The viscosity of a polymer in its melt (liquid) state." . + +materialsmine:MeltingTemperature a owl:Class ; + rdfs:label "Melting Temperature" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty, + ; + skos:definition "the temperature at which a solid turns into a liquid" . + +materialsmine:Metamaterial a owl:Class ; + rdfs:label "Metamaterial" ; + rdfs:subClassOf sio:MaterialEntity ; + skos:definition "A material which has a structure above the atomic scale, but below the macroscopic scale." . + +materialsmine:MetamaterialChart a owl:Class ; + rdfs:label "Metamaterial Chart" ; + rdfs:subClassOf sio:Chart ; + skos:definition "Charts that have the primary topic of metamaterials." . + +materialsmine:MetamaterialDataset a owl:Class ; + rdfs:label "Metamaterial Dataset" ; + rdfs:subClassOf ; + skos:definition "Datasets that have the primary topic of metamaterials." . + +materialsmine:Mixer a owl:Class ; + rdfs:label "Mixer" ; + rdfs:subClassOf sio:Device . + +materialsmine:MixingMethod a owl:Class ; + rdfs:label "Mixing Method" ; + rdfs:subClassOf sio:Procedure . + +materialsmine:MolecularWeight_Mn a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf materialsmine:MolecularWeight ; + skos:altLabel "Number Average Molar Mass" ; + skos:definition "Mn, the number averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the arithmetic mean of the matrix polymer chains." . + +materialsmine:MolecularWeight_Mw a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf materialsmine:MolecularWeight ; + skos:altLabel "Mass Average Molar Mass" ; + skos:definition "Mw, the weight averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the average size of the matrix polymer chains." . + +materialsmine:MolecularWeight_zAverage a owl:Class ; + rdfs:label "Molecular Weight Z Average" ; + rdfs:subClassOf materialsmine:MolecularWeight . + +materialsmine:NanomaterialChart a owl:Class ; + rdfs:label "Nanomaterial Chart" ; + rdfs:subClassOf sio:Chart ; + skos:definition "Charts that have the primary topic of nanomaterials." . + +materialsmine:NanomaterialDataset a owl:Class ; + rdfs:label "Nanomaterial Dataset" ; + rdfs:subClassOf ; + skos:definition "Datasets that have the primary topic of nanomaterials." . + +materialsmine:NonSpherical a owl:Class ; + rdfs:label "Non-spherical Shape" ; + rdfs:subClassOf sio:Shape . + +materialsmine:Notched a owl:Class ; + rdfs:label "Notched" ; + rdfs:subClassOf materialsmine:MechanicalProperty, + sio:Quality ; + skos:definition "Property of a material sample, in which a uniform notch has been created for the purpose of concentrating stress in a region of interest." . + +materialsmine:NuclearMagneticResonance a owl:Class ; + rdfs:label "Nuclear Magnetic Resonance" ; + materialsmine:hasSelector "//Nuclear_Magnetic_Resonance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:Spectroscopy ], + sio:Measuring ; + skos:definition "Molecular analysis due to observed NMR under applied magnetic field" . + +materialsmine:NucleationParameterOfAvramiEquation a owl:Class ; + rdfs:label "Nucleation Parameter Of Avrami Equation" ; + rdfs:subClassOf materialsmine:Crystallinity ; + skos:definition "Nucleation Parameter in Avrami Equation" . + +materialsmine:OpticalMicroscopy a owl:Class ; + rdfs:label "Optical Microscopy" ; + materialsmine:hasSelector "//OpticalMicroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:MechanicalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + sio:Measuring ; + skos:definition "Magnification of small objects with visible light" . + +materialsmine:Other a owl:Class ; + rdfs:label "Other Processing Parameter" ; + rdfs:subClassOf sio:Procedure . + +materialsmine:OtherProcessing a owl:Class ; + rdfs:label "Other Processing" ; + rdfs:subClassOf sio:Procedure . + +materialsmine:Other_Processing a owl:Class ; + rdfs:label "Other Processing" ; + rdfs:subClassOf sio:Procedure . + +materialsmine:Output a owl:Class ; + rdfs:label "Output" . + +materialsmine:ParallelepipedGeometry a owl:Class ; + rdfs:label "Parallelepiped Geometry" ; + rdfs:subClassOf materialsmine:3DGeometry . + +materialsmine:Particle a owl:Class ; + rdfs:label "Particle" ; + rdfs:subClassOf materialsmine:Nanomaterial ; + skos:definition "particles between 1 and 100 nanometers in size. In nanotechnology, a particle is defined as a small object that behaves as a whole unit with respect to its transport and properties." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanoparticle" . + +materialsmine:ParticleDiameter a owl:Class ; + rdfs:label "Particle Diameter" ; + rdfs:subClassOf sio:MeasurementValue ; + skos:definition "Assuming sphere-like particles comprising the filler, the particle diameter is the \"average\" diameter of those particles." . + +materialsmine:ParticleSurfaceTreatmentComposition a owl:Class ; + rdfs:label "Particle Surface Treatment Composition" ; + rdfs:subClassOf materialsmine:Composition . + +materialsmine:PhaseVelocity a owl:Class ; + rdfs:label "Phase Velocity" ; + rdfs:subClassOf sio:Velocity ; + skos:definition "The phase velocity associated with a solution to the wave equation. This can be computed as the eigenfrequency divided by each component of the wavevector." . + +materialsmine:Pixel a owl:Class ; + rdfs:label "Pixel" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "A discretized, symbolic representation of a material substance in 2D space." . + +materialsmine:PixelCountVector a owl:Class ; + rdfs:label "Pixel Count Vector" ; + rdfs:subClassOf sio:Vector ; + skos:definition "A vector with each entry representing the number (count) of pixels along each of the lattice vectors." . + +materialsmine:PixelLengthVector a owl:Class ; + rdfs:label "Pixel Length Vector" ; + rdfs:subClassOf sio:Vector ; + skos:definition "A vector with each entry representing the length (defined in physical units, e.g. m) per pixel along each of the lattice vectors." . + +materialsmine:PlaneStrain a owl:Class ; + rdfs:label "Plane Strain" ; + rdfs:subClassOf materialsmine:Strain ; + skos:definition "A state of strain where the out of plane component of strain is zero." . + +materialsmine:PlaneStress a owl:Class ; + rdfs:label "Plane Stress" ; + rdfs:subClassOf materialsmine:Stress ; + skos:definition "A state of stress where the out of plane component of stress is zero." . + +materialsmine:PlasticElastic a owl:Class ; + rdfs:label "Plastic Elastic" ; + rdfs:subClassOf materialsmine:FractureToughnessProperty ; + skos:definition "Material deformation that undergoes both elastic and plastic deformation" . + +materialsmine:PlateRheometery a owl:Class ; + rdfs:label "Plate Rheometry" ; + materialsmine:hasSelector "//Rheometery[RheometerType='plate']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + materialsmine:Rheometery ; + skos:definition "The falling plate rheometer sandwiches liquid between two solid surfaces. The top plate is fixed, and bottom plate falls under the influence of gravity, drawing out a string of the liquid" . + +materialsmine:PoissonsRatio a owl:Class ; + rdfs:label "Poissons Ratio" ; + rdfs:subClassOf materialsmine:TensileProperty ; + skos:definition "Negative ratio of traverse to axial strain" . + +materialsmine:Polydispersity a owl:Class ; + rdfs:label "Polydispersity" ; + rdfs:subClassOf sio:SpatialQuantity ; + skos:altLabel "Dispersity" . + +materialsmine:PolymerBlend a owl:Class ; + rdfs:label "Polymer Blend" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "a member of a class of materials analogous to metal alloys, in which at least two polymers are blended together to create a new material with different physical properties." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_blend" . + +materialsmine:PolymerMixture a owl:Class ; + rdfs:label "Polymer" ; + rdfs:subClassOf sio:Polymer . + +materialsmine:PolymerNanocomposite a owl:Class ; + rdfs:label "Polymer Nanocomposite" ; + rdfs:subClassOf materialsmine:Nanocomposite ; + skos:altLabel "PNC" ; + skos:definition "Polymer nanocomposites (PNC) consist of a polymer or copolymer having nanoparticles or nanofillers dispersed in the polymer matrix. These may be of different shape (e.g., platelets, fibers, spheroids), but at least one dimension must be in the range of 1–50 nm." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_nanocomposite" . + +materialsmine:Power a owl:Class ; + rdfs:label "Power" ; + rdfs:subClassOf sio:Quantity . + +materialsmine:PreCrackingProcess a owl:Class ; + rdfs:label "Precracking Process" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "The process of establishing an initiator crack or groove in a test specimen such that the failure of the test specimen deterministically begins at the established location." . + +materialsmine:PreLoad a owl:Class ; + rdfs:label "Pre-Load" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:Condition ; + skos:definition "Pre-stress or pre-strain before testing" . + +materialsmine:ProbabilityOfFailure a owl:Class ; + rdfs:label "Probability of Failure" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "As the electric field is intensified, the probability of failure is the likelihood that a breakdown channel forms across the test specimen." . + +materialsmine:ProceedingsArticle a owl:Class ; + rdfs:label "Conference Proceedings Article" ; + rdfs:subClassOf bibo:AcademicArticle ; + skos:definition "An article published in the proceedings of a conference." . + +materialsmine:PubChemReference a owl:Class ; + rdfs:label "PubChem Reference" ; + rdfs:subClassOf sio:Reference . + +materialsmine:PublicationYear a owl:Class ; + rdfs:label "Publication Year" ; + rdfs:subClassOf sio:Year . + +materialsmine:PulsedElectroAcoustic a owl:Class ; + rdfs:label "Pulsed Electro Acoustic" ; + materialsmine:hasSelector "//Pulsed_Electro_Acoustic" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of space charge in dielectric materials" . + +materialsmine:RadialClearence a owl:Class ; + rdfs:label "Radial Clearence" ; + rdfs:subClassOf materialsmine:Dimension, + sio:Height . + +materialsmine:RamanSpectroscopy a owl:Class ; + rdfs:label "Raman Spectroscopy" ; + materialsmine:hasSelector "//Raman_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:Spectroscopy ], + sio:Measuring ; + skos:definition "Molecular analysis with spectroscopic techniques that observe low-frequency modes in a material" . + +materialsmine:RelatedDOI a owl:Class ; + rdfs:label "related DOI" ; + rdfs:subClassOf materialsmine:DOI . + +materialsmine:ResearchArticle a owl:Class ; + rdfs:label "Research Article" ; + rdfs:subClassOf bibo:AcademicArticle . + +materialsmine:ReviewArticle a owl:Class ; + rdfs:label "Review Article" ; + rdfs:subClassOf bibo:AcademicArticle . + +materialsmine:RheologicalLossModulus a owl:Class ; + rdfs:label "Rheological Loss Modulus" ; + rdfs:subClassOf materialsmine:RheologicalComplexModulus ; + skos:definition "The deformation energy dissipated within a material when subject to shear; the viscous component of the complex modulus." . + +materialsmine:RheologicalLossTangent a owl:Class ; + rdfs:label "Rheological Loss Tangent" ; + rdfs:subClassOf materialsmine:RheologicalComplexModulus ; + skos:definition "The damping factor, or the ratio of storage to loss moduli; for ideally elastic materials, the damping factor is zero; for ideally viscous materials, the damping factor is infinite." . + +materialsmine:RheologicalMasterCurve a owl:Class ; + rdfs:label "Rheological Master Curve" ; + rdfs:subClassOf materialsmine:RheologicalComplexModulus ; + skos:definition "The superposition of rheological data taken at different temperatures in a given frequency range, where the curves are horizontally shifted to form a continuous master curve spanning a much larger frequency range that would otherwise be experimentally intractable or infeasible." . + +materialsmine:RheologicalStorageModulus a owl:Class ; + rdfs:label "Rheological Storage Modulus" ; + rdfs:subClassOf materialsmine:RheologicalComplexModulus ; + skos:definition "The deformation energy stored within a material when subject to shear; the elastic component of the complex modulus." . + +materialsmine:RheometerMode a owl:Class ; + rdfs:label "Rheometer Mode" ; + rdfs:subClassOf materialsmine:RheologicalComplexModulus, + materialsmine:RheologicalViscosity ; + skos:definition "The type of condition (e.g., temperature sweep or frequency sweep) under which a material's rheological response is measured." . + +materialsmine:RollMilling a owl:Class ; + rdfs:label "Roll Milling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Additive ], + materialsmine:Mixing ; + skos:definition "Grinding process with a roller and flat plate" . + +materialsmine:RotationSpeed a owl:Class ; + rdfs:label "Rotation Speed" ; + rdfs:subClassOf sio:Speed . + +materialsmine:RotationalMolding a owl:Class ; + rdfs:label "Rotational Molding" ; + rdfs:subClassOf materialsmine:Molding . + +materialsmine:SMILES a owl:Class ; + rdfs:label "SMILES" ; + rdfs:subClassOf sio:Representation . + +materialsmine:SampleShape a owl:Class ; + rdfs:label "Sample Shape" ; + rdfs:subClassOf sio:Shape ; + skos:definition "The geometric form of a test specimen." . + +materialsmine:ScanningElectronMicroscopy a owl:Class ; + rdfs:label "Scanning Electron Microscopy" ; + materialsmine:hasSelector "//Scanning_Electron_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:Magnification ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:WorkingDistance ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ElectricalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:AcceleratingVoltage ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:EmissionCurrent ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:ExposureTime ], + sio:Measuring ; + skos:definition "Scanning electron microscopy for obtaining microstructure at microscale" . + +materialsmine:ScrewChannelDiameter a owl:Class ; + rdfs:label "Screw Channel Diameter" ; + rdfs:subClassOf . + +materialsmine:Shear a owl:Class ; + rdfs:label "Shear" ; + rdfs:subClassOf materialsmine:ViscoelasticProperty ; + skos:definition "Describing opposing in-plane forces on a material." . + +materialsmine:ShearLoadingProfile a owl:Class ; + rdfs:label "Shear Loading Profile" ; + rdfs:subClassOf materialsmine:ShearProperty ; + skos:definition "Stress vs. strain curve of during shear loading and/or unloading test" . + +materialsmine:ShearModulus a owl:Class ; + rdfs:label "Shear Modulus" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ShearProperty ; + skos:definition "Ratio of shear stress to shear strain" . + +materialsmine:ShearStressAtBreak a owl:Class ; + rdfs:label "Shear Stress At Break" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ShearProperty ; + skos:definition "Shear stress when specimen breaks" . + +materialsmine:ShearStressAtYield a owl:Class ; + rdfs:label "Shear Stress At Yield" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ShearProperty ; + skos:definition "Shear stress at yield point" . + +materialsmine:SingleScrew a owl:Class ; + rdfs:label "Single Screw Extruder" ; + rdfs:subClassOf materialsmine:Extruder . + +materialsmine:SolutionProcessing a owl:Class ; + rdfs:label "Solution Processing" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of dissolvable polymer with nanoparticles" . + +materialsmine:SolventAmount a owl:Class ; + rdfs:label "Solvent Amount" ; + rdfs:subClassOf sio:Quantity . + +materialsmine:SolventName a owl:Class ; + rdfs:label "Solvent Name" ; + rdfs:subClassOf sio:Name . + +materialsmine:SpecificHeatCapacity_Cp a owl:Class ; + rdfs:label "Specific Heat Capacity Cp" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty ; + skos:definition "Cp for a gas is the change in the enthalpy (H) of the system with respect to change in temperature at a fixed pressure of the system" . + +materialsmine:SpecificHeatCapacity_Cv a owl:Class ; + rdfs:label "Specific Heat Capacity Cv" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty ; + skos:definition "Cv for a gas is the change in internal energy (U) of a system with respect to change in temperature at a fixed volume of the system" . + +materialsmine:SpecificSurfaceArea a owl:Class ; + rdfs:label "Specific Surface Area" ; + rdfs:subClassOf sio:SurfaceArea . + +materialsmine:SquareGeometry a owl:Class ; + rdfs:label "Square Geometry" ; + rdfs:subClassOf materialsmine:RectangularGeometry . + +materialsmine:StdChemicalName a owl:Class ; + rdfs:label "StdChemicalName" ; + rdfs:subClassOf materialsmine:ChemicalName . + +materialsmine:Stirring a owl:Class ; + rdfs:label "Stirring" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Solvent ], + materialsmine:Mixing ; + skos:definition "Manual stirring of liquid solutions" . + +materialsmine:StrainAmplitude a owl:Class ; + rdfs:label "Strain Amplitude" ; + rdfs:subClassOf materialsmine:Condition ; + skos:definition "The magnitude of forced displacement of a material sample.", + "The maximum magnitude of forced displacement under oscillatory loading conditions." . + +materialsmine:StrainAtBreak a owl:Class ; + rdfs:label "Strain at Break" ; + rdfs:subClassOf materialsmine:Strain ; + skos:definition "The strain at which the material fractures (e.g. during a tensile test)" . + +materialsmine:StrainRate a owl:Class ; + rdfs:label "Strain Rate" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:Condition ; + skos:definition "Rate of strain change", + "see Strain Rate" . + +materialsmine:StrainSweep a owl:Class ; + rdfs:label "Strain Sweep" ; + rdfs:subClassOf materialsmine:MeasurementMethod ; + skos:definition "A continuous variation of strain (amplitude) within a pre-defined range." . + +materialsmine:StressRelaxation a owl:Class ; + rdfs:label "Stress Relaxation" ; + rdfs:subClassOf sio:RateOfChange ; + skos:definition "Stress relaxation, which occurs when a viscoelastic test specimen is brought to a fixed strain and held, is the gradual release of internal stress due to the viscous nature of the test specimen. " . + +materialsmine:StressTensor a owl:Class ; + rdfs:label "Stress Tensor" ; + rdfs:subClassOf sio:Tensor . + +materialsmine:StressVector a owl:Class ; + rdfs:label "Stress Vector" ; + rdfs:subClassOf sio:Vector . + +materialsmine:SurfaceChemistryProcessing a owl:Class ; + rdfs:label "Surface Chemistry Processing" ; + rdfs:subClassOf materialsmine:Processing . + +materialsmine:SurfaceResistivity a owl:Class ; + rdfs:label "Surface Resistivity" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "Ability to resist leakage current along the surface of an insulating material" . + +materialsmine:SurfaceTension a owl:Class ; + rdfs:label "Surface Tension" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:VolumetricProperty ; + skos:definition "the force that causes the molecules on the surface of a liquid to be pushed together and form a layer" . + +materialsmine:SurfaceTreatment a owl:Class ; + rdfs:label "Surface Treatment" ; + rdfs:subClassOf sio:Role . + +materialsmine:Symmetry a owl:Class ; + rdfs:label "Symmetry" ; + skos:definition "Symmetry group? Bravais lattice? (wondering if we need to separate out into more specific terms)" . + +materialsmine:Syndiotactic a owl:Class ; + rdfs:label "Syndiotactic" ; + rdfs:subClassOf materialsmine:Tacticity ; + skos:definition "In syndiotactic or syntactic macromolecules the substituents have alternate positions along the chain. The macromolecule consists 100% of racemo diads. Syndiotactic polystyrene, made by metallocene catalysis polymerization, is crystalline with a melting point of 161 °C. Gutta percha is also an example for Syndiotactic polymer." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Syndiotactic_polymers" . + +materialsmine:TangoBlack a owl:Class ; + rdfs:label "Tango Black" ; + rdfs:subClassOf sio:MaterialEntity ; + skos:definition "A specific 3D printable material." . + +materialsmine:TechnicalComment a owl:Class ; + rdfs:label "Technical Comment" ; + rdfs:subClassOf bibo:Document . + +materialsmine:TemperatureSweep a owl:Class ; + rdfs:label "Temperature Sweep" ; + rdfs:subClassOf materialsmine:DMA_Mode ; + skos:definition "A continuous variation of temperature within a pre-defined range." . + +materialsmine:Tensile a owl:Class ; + rdfs:label "Tensile" ; + rdfs:subClassOf materialsmine:ViscoelasticProperty ; + skos:definition "Describing countervailing forces applied outward along the central axis of a material." . + +materialsmine:TensileCreepCompliance a owl:Class ; + rdfs:label "Tensile Creep Compliance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileCreep ; + skos:definition "Inverse of tensile creep modulus " . + +materialsmine:TensileCreepModulus a owl:Class ; + rdfs:label "Tensile Creep Modulus" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileCreep ; + skos:definition "Elastic modulus during creep test" . + +materialsmine:TensileCreepRecovery a owl:Class ; + rdfs:label "Tensile Creep Recovery" ; + rdfs:subClassOf materialsmine:TensileCreep ; + skos:definition "Ability of material to recover to original state after creep" . + +materialsmine:TensileCreepRuptureStrength a owl:Class ; + rdfs:label "Tensile Creep Rupture Strength" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileCreep ; + skos:definition "Material strength at rupture during a tensile creep test" . + +materialsmine:TensileCreepRuptureTime a owl:Class ; + rdfs:label "Tensile Creep Rupture Time" ; + rdfs:subClassOf materialsmine:TensileCreep ; + skos:definition "Time taken to rupture from applying load during a tensile creep test" . + +materialsmine:TensileCreepStrain a owl:Class ; + rdfs:label "Tensile Creep Strain" ; + rdfs:subClassOf materialsmine:TensileCreep ; + skos:definition "Profile of strain as a function of time during a tensile creep test" . + +materialsmine:TensileLoadingProfile a owl:Class ; + rdfs:label "Tensile Loading Profile" ; + rdfs:subClassOf materialsmine:TensileProperty ; + skos:definition "Stress vs. strain curve of during tensile loading and/or unloading test" . + +materialsmine:TensileModulus a owl:Class ; + rdfs:label "Tensile Modulus" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Young's modulus, or elastic modulus, describes tensile elasticity, or the tendency of an object to deform along an axis when opposing forces are applied along that axis; it is defined as the ratio of tensile stress to tensile strain." . + +materialsmine:TensileStrength a owl:Class ; + rdfs:label "Tensile Strength" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf materialsmine:TensileProperty ; + skos:definition "The maximum engineering stress experienced by a test specimen during a tensile test, at which point the material begins to fail catastrophically." . + +materialsmine:TensileStressAtBreak a owl:Class ; + rdfs:label "Tensile Stress At Break" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Tensile stress at the moment at which a test specimen tears" . + +materialsmine:TensileStressAtYield a owl:Class ; + rdfs:label "Tensile Stress At Yield" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:TensileProperty ; + skos:definition "Tensile stress corresponding to the yield point (an increase in strain does not result in an increase in stress)." . + +materialsmine:TensileToughness a owl:Class ; + rdfs:label "Tensile Toughness" ; + rdfs:subClassOf materialsmine:TensileProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied tensile load." . + +materialsmine:ThermalConductivity a owl:Class ; + rdfs:label "Thermal Conductivity" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty ; + skos:definition "a measure of the ability of a substance to conduct heat, determined by the rate of heat flownormally through an area in the substance divided by the area and by minus the component of the temperaturegradient in the direction of flow" . + +materialsmine:ThermalDecompositionTemperature a owl:Class ; + rdfs:label "Thermal Decomposition Temperature" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty, + ; + skos:definition "Thermal decomposition temperature of a substance is the temperature at which the substance chemically decomposes by heat" . + +materialsmine:ThermalDiffusivity a owl:Class ; + rdfs:label "Thermal Diffusivity" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ThermalProperty ; + skos:definition "thermal diffusivity is the thermal conductivity divided by density and specific heat capacity at constant pressure. It measures the rate of transfer of heat of a material from the hot side to the cold side" . + +materialsmine:ThermogravimetricAnalysis a owl:Class ; + rdfs:label "Thermogravimetric Analysis" ; + materialsmine:hasSelector "//Thermogravimetric_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ThermalProperty ], + sio:Measuring ; + skos:definition "Thermal analysis of material properties as function of temperature and time" . + +materialsmine:Thermoplastic a owl:Class ; + rdfs:label "Thermoplastic" ; + rdfs:subClassOf materialsmine:Plastic ; + skos:definition "a plastic material, a polymer, that becomes pliable or moldable above a specific temperature and solidifies upon cooling." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermoplastic" . + +materialsmine:Thermoset a owl:Class ; + rdfs:label "Thermoset" ; + rdfs:subClassOf materialsmine:Plastic ; + skos:definition "a cured thermosetting resin. A thermosetting resin is a prepolymer in a soft solid or viscous liquid state that changes irreversibly into an infusible, insoluble polymer network by curing." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermosetting_polymer" . + +materialsmine:Torsion a owl:Class ; + rdfs:label "Torsion" ; + rdfs:subClassOf materialsmine:ViscoelasticProperty ; + skos:definition "Describing countervailing rotational forces about the central axis of a material, separated by some distance along the central axis of the material; \"twisting\" force" . + +materialsmine:Total a owl:Class ; + rdfs:label "Total" ; + rdfs:subClassOf sio:Quantity . + +materialsmine:TradeName a owl:Class ; + rdfs:label "Trade Name" ; + rdfs:subClassOf sio:Name ; + skos:definition "The common, non-chemical name for a chemical substance." . + +materialsmine:TransmissionElectronMicroscopy a owl:Class ; + rdfs:label "Transmission Electron Microscopy" ; + materialsmine:hasSelector "//Transmission_Electron_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:EmissionCurrent ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:WorkingDistance ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:Magnification ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:AcceleratingVoltage ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ElectricalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:ExposureTime ], + sio:Measuring ; + skos:definition "Transmission electron microscopy for obtaining microstructure at nanoscale" . + +materialsmine:TriangularGeometry a owl:Class ; + rdfs:label "Triangular Geometry" ; + rdfs:subClassOf materialsmine:2DGeometry . + +materialsmine:TwinScrew a owl:Class ; + rdfs:label "Twin Screw Extruder" ; + rdfs:subClassOf materialsmine:Extruder . + +materialsmine:Ultra-sonication a owl:Class ; + rdfs:label "Ultra Sonication" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom materialsmine:Additive ], + materialsmine:Mixing ; + skos:definition "The irradiation of a liquid sample with ultrasonic (>20 kHz) waves resulting in agitation" . + +materialsmine:UnitCellExtent_X a owl:Class ; + rdfs:label "Unit Cell Extent X" ; + rdfs:subClassOf sio:1DExtentQuantity ; + skos:definition "Extent of the unit cell in the x direction (requires units, such as mm:Pixel)" . + +materialsmine:UnitCellExtent_Y a owl:Class ; + rdfs:label "Unit Cell Extent Y" ; + rdfs:subClassOf sio:1DExtentQuantity ; + skos:definition "Extent of the unit cell in the y direction (requires units, such as mm:Pixel)" . + +materialsmine:UnitCellExtent_Z a owl:Class ; + rdfs:label "Unit Cell Extent Z" ; + rdfs:subClassOf sio:1DExtentQuantity ; + skos:definition "Extent of the unit cell in the z direction (requires units, such as mm:Pixel)" . + +materialsmine:Vacuum a owl:Class ; + rdfs:label "Vacuum" ; + rdfs:subClassOf materialsmine:AmbientCondition . + +materialsmine:VacuumMolding a owl:Class ; + rdfs:label "Vacuum Molding" ; + rdfs:subClassOf materialsmine:Molding . + +materialsmine:VeroWhite a owl:Class ; + rdfs:label "Vero White" ; + rdfs:subClassOf sio:MaterialEntity ; + skos:definition "A specific 3D printable material." . + +materialsmine:Viscosity a owl:Class ; + rdfs:label "Viscosity" ; + rdfs:subClassOf sio:3DExtentQuantity ; + skos:definition "a measure of its resistance to gradual deformation by shear stress or tensile stress." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Viscosity" . + +materialsmine:VolumeExpansionCoefficient a owl:Class ; + rdfs:label "Volume Expansion Coefficient" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:VolumetricProperty ; + skos:definition "volumetric coefficient of thermal expansion" . + +materialsmine:VolumeFraction a owl:Class ; + rdfs:label "Volume Fraction" ; + rdfs:subClassOf sio:Concentration ; + skos:definition "The volume of a constituent divided by the volume of all constituents of the mixture prior to mixing." . + +materialsmine:VolumeResistivity a owl:Class ; + rdfs:label "Volume Resistivity" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "Ability to oppose the flow of electric current." . + +materialsmine:Voxel a owl:Class ; + rdfs:label "Voxel" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "A discretized, symbolic representation of a material substance in 3D space." . + +materialsmine:WaterAbsorption a owl:Class ; + rdfs:label "Water Absorption" ; + rdfs:subClassOf materialsmine:VolumetricProperty ; + skos:definition "The amount of weight gain (%) experienced in a polymer after immersion in water for a specific length of time under controlled environment." . + +materialsmine:Wavenumber a owl:Class ; + rdfs:label "Wavenumber" ; + rdfs:subClassOf sio:MeasurementValue ; + skos:definition "The wavenumber of a wave is the inverse of the wavelength. This is the inverse space component of the dispersion relation for a one-dimensional analysis." . + +materialsmine:Wavevector a owl:Class ; + rdfs:label "Wavevector" ; + rdfs:subClassOf sio:Vector ; + skos:definition "The wavevector is the multi-dimensional generalization of wavenumber. The wavevector of a wave is the inverse of the wavelength in each of the spatial directions. It also points in the same direction as the phase velocity of the wave." . + +materialsmine:WeibullParameter a owl:Class ; + rdfs:label "Weibull Parameter" . + +materialsmine:WeibullPlot a owl:Class ; + rdfs:label "Weilbull Plot" ; + rdfs:subClassOf materialsmine:DielectricBreakdownStrength ; + skos:definition "A plot of failure probability versus electric field, typically with the probability y-axis scaled according to the Weibull distribution as ln(-ln(1-p))." . + +materialsmine:WeightLoss a owl:Class ; + rdfs:label "Weight Loss" ; + rdfs:subClassOf materialsmine:VolumetricProperty ; + skos:definition "The loss of mass of a material under some condition (e.g., increasing temperature during thermogravimetric analysis)" . + +materialsmine:XRayDiffractionAndScattering a owl:Class ; + rdfs:label "XRay Diffraction and Scattering" ; + materialsmine:hasSelector "//XRay_Diffraction_and_Scattering" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:Spectroscopy ], + sio:Measuring ; + skos:definition "Non-destructive X-ray measurement for crystal structure, chemical composition, and physical properties" . + +materialsmine:XRayPhotoelectronSpectroscopy a owl:Class ; + rdfs:label "X-Ray Photoelectron Spectroscopy" ; + materialsmine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:Spectroscopy ], + sio:Measuring . + +materialsmine:XRay_Photoelectron_Spectroscopy a owl:Class ; + rdfs:label "X-Ray Photoelectron Spectroscopy" ; + materialsmine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; + rdfs:subClassOf sio:Measuring ; + skos:definition "X-Ray Photoelectron Spectroscopy (abbr. XPS) is a spectroscopy for material characterization;" . + +materialsmine:uSMILES a owl:Class ; + rdfs:label "uSMILES" ; + rdfs:subClassOf sio:Representation . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Centimeter" ; + skos:notation "J/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Celsius" ; + skos:notation "J/gC" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilojoule per Square Meter" ; + skos:notation "kJ/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Centimeter" ; + skos:notation "kV/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Log Hertz" ; + skos:notation "log(Hz)" . + + a sio:UnitOfMeasurement ; + rdfs:label "Square Millimeter per Second" ; + skos:notation "mm^2/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Millimeters per millimeter" ; + skos:notation "mm/mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Centimeter" ; + skos:notation "Ω cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Parts per million per degree centigrade" ; + skos:notation "ppm/C" . + + a sio:UnitOfMeasurement ; + rdfs:label "Rotation per Minute" ; + skos:notation "rpm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Megavolt per Meter" ; + skos:notation "MV/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Radian per Minute" ; + skos:notation "rad/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Centimeter" ; + skos:notation "S/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Volt per Centimeter" ; + skos:notation "V/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kelvin per Minute" ; + skos:notation "K/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "per Kelvin" ; + skos:notation "1/K" . + +sio:AspectRatio a owl:Class ; + rdfs:label "Aspect Ratio" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "The aspect ratio of a geometric shape is the ratio of its sizes in different dimensions." . + +sio:AuthorRole a owl:Class ; + rdfs:label "Author" ; + rdfs:subClassOf sio:PublishingRole . + +sio:Chapter a owl:Class ; + rdfs:label "Chapter" ; + rdfs:subClassOf sio:DocumentSection . + +sio:Citation a owl:Class ; + rdfs:label "Citation Type" ; + rdfs:subClassOf sio:DocumentComponent . + +sio:Day a sio:UnitOfMeasurement ; + rdfs:label "Day" ; + skos:notation "dy" . + +sio:Description a owl:Class ; + rdfs:label "Description" ; + materialsmine:hasSelector "//Description" ; + rdfs:subClassOf sio:LanguageEntity . + +sio:EditionNumber a owl:Class ; + rdfs:label "Edition" ; + rdfs:subClassOf sio:Count . + +sio:Hour a sio:UnitOfMeasurement ; + rdfs:label "Hour" ; + skos:notation "Hr" . + +sio:Issue a owl:Class ; + rdfs:label "Issue" ; + rdfs:subClassOf sio:EditedPublication . + +sio:Journal a owl:Class ; + rdfs:label "Journal" ; + rdfs:subClassOf sio:Periodical . + +sio:Keyword a owl:Class ; + rdfs:label "Keyword" ; + rdfs:subClassOf sio:Descriptor . + +sio:Language a owl:Class ; + rdfs:label "Language" ; + rdfs:subClassOf sio:LanguageEntity . + +sio:OrdinalPosition a owl:Class ; + rdfs:label "Ordinal Position" ; + rdfs:subClassOf sio:LinearPosition ; + skos:definition "An ordinal position is a number that designates the position of an entity from the first entity in an ordered sequence of entities." . + +sio:Publication a owl:Class ; + rdfs:label "Publication" ; + rdfs:subClassOf sio:Document . + +sio:PublisherRole a owl:Class ; + rdfs:label "Publisher" ; + rdfs:subClassOf sio:PublishingRole . + +sio:Rotation a owl:Class ; + rdfs:label "Rotation" ; + rdfs:subClassOf sio:Quantity . + +sio:Thickness a owl:Class ; + rdfs:label "Thickness" ; + rdfs:subClassOf sio:Depth ; + skos:definition "Out-of-plane thickness for metamaterials with 2D geometry" . + +sio:Title a owl:Class ; + rdfs:label "Title" ; + rdfs:subClassOf sio:Label . + +sio:URL a owl:Class ; + rdfs:label "URL" ; + rdfs:subClassOf sio:InformationalEntityIdentifier ; + skos:definition "A Uniform Resource Locator or Universal Resource Locator (URL) is a specific character string that constitutes a reference to an Internet resource." ; + prov:wasQuotedFrom "https://raw.githubusercontent.com/micheldumontier/semanticscience/master/ontology/sio/release/sio-release.owl" . + +sio:VolumeNumber a owl:Class ; + rdfs:label "Volume" ; + rdfs:subClassOf sio:Count . + +sio:Week a sio:UnitOfMeasurement ; + rdfs:label "Week" ; + skos:notation "wk" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ampere per Square Meter" ; + skos:notation "A/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "Celsius per Minute" ; + skos:notation "C/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Gram per Cubic Centimeter" ; + skos:notation "g/cm^3" . + + a materialsmine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Kelvin" ; + skos:notation "K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kiloelectronvolt" ; + skos:notation "keV" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Liter" ; + skos:notation "kg/L" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilohertz" ; + skos:notation "kHz" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilopascal" ; + skos:notation "kPa" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt" ; + skos:notation "kV" . + + a sio:UnitOfMeasurement ; + rdfs:label "Micrometer" ; + skos:notation "µm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Millimeter" ; + skos:notation "mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Minute" ; + skos:notation "min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Mole per Cubic Meter" ; + skos:notation "mol/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Pascal" ; + skos:notation "Pa" . + + a sio:UnitOfMeasurement ; + rdfs:label "Radian per Second" ; + skos:notation "rad/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Second" ; + skos:notation "s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Square Meter per Gram" ; + skos:notation "m^2/g" . + + a sio:UnitOfMeasurement ; + rdfs:label "Strain" ; + skos:notation "ε" . + +materialsmine:Amperage a owl:Class ; + rdfs:label "Amperage" ; + rdfs:subClassOf sio:Quantity . + +materialsmine:BandGap a owl:Class ; + rdfs:label "Band Gap" ; + rdfs:subClassOf materialsmine:ElectricalProperty ; + skos:definition "A band of frequencies for which there do not exist eigenfrequency solutions in the dispersion relation (for any wavevector)." . + +materialsmine:Binary2DGeometry a owl:Class ; + rdfs:label "Binary 2D Geometry" ; + rdfs:subClassOf materialsmine:Geometry ; + skos:definition "A string that represents the entire pixelated unit cell, e.g, using 0s and 1s to represent different material compositions at each pixel. " . + +materialsmine:CapillarySize a owl:Class ; + rdfs:label "Capillar Size" ; + materialsmine:hasSelector "//CapillarySize" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:ChannelDepth a owl:Class ; + rdfs:label "Channel Depth" ; + rdfs:subClassOf sio:Depth . + +materialsmine:ChannelsPerScrew a owl:Class ; + rdfs:label "Channels per Screw" ; + rdfs:subClassOf sio:Quantity . + +materialsmine:ChemicalName a owl:Class ; + rdfs:label "Chemical Name" ; + rdfs:subClassOf sio:Name . + +materialsmine:CoolingRate a owl:Class ; + rdfs:label "Cooling Rate" ; + materialsmine:hasSelector "//CoolingRate" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:CuboidalGeometry a owl:Class ; + rdfs:label "Cuboidal Geometry" ; + rdfs:subClassOf materialsmine:3DGeometry . + +materialsmine:DLRatio a owl:Class ; + rdfs:label "Screw Diameter/Length Ratio" ; + rdfs:subClassOf sio:Ratio . + +materialsmine:DMA_Mode a owl:Class ; + rdfs:label "Dynamic Mechanical Analysis" ; + rdfs:subClassOf materialsmine:DynamicProperties, + ; + skos:definition "The type of condition (e.g., temperature sweep or frequency sweep) under which a material's dynamic mechanical response is measured." . + +materialsmine:DOI a owl:Class ; + rdfs:label "DOI" ; + rdfs:subClassOf sio:InformationalEntityIdentifier . + +materialsmine:DielectricBreakdownStrength a owl:Class ; + rdfs:label "Dielectric Breakdown Strength" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + materialsmine:ElectricalProperty ; + skos:definition "Maximum voltage required to produce a dielectric breakdown through the material and is expressed as Volts per unit thickness." . + +materialsmine:ExtrusionTemperature a owl:Class ; + rdfs:label "Extrusion Temperature" ; + rdfs:subClassOf . + +materialsmine:FillerComponent a owl:Class ; + rdfs:label "Filler Component" ; + rdfs:subClassOf materialsmine:Component . + +materialsmine:FlightClearance a owl:Class ; + rdfs:label "Flight Clearance" ; + rdfs:subClassOf sio:Height ; + skos:altLabel "Radial Flight Clearance" . + +materialsmine:FlightWidth a owl:Class ; + rdfs:label "Flight Width" ; + rdfs:subClassOf sio:Width . + +materialsmine:HeatingRate a owl:Class ; + rdfs:label "Heating Rate" ; + materialsmine:hasSelector "//HeatingRate" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:Impact a owl:Class ; + rdfs:label "Impact" ; + rdfs:subClassOf materialsmine:FractureToughnessProperty ; + skos:definition "Izod impact resistance of materials" . + +materialsmine:InnerBarrelDiameter a owl:Class ; + rdfs:label "Inner Barrel Diameter" ; + rdfs:subClassOf . + +materialsmine:MeltTemperature a owl:Class ; + rdfs:label "Melt Temperature" ; + rdfs:subClassOf . + +materialsmine:Nanocomposite a owl:Class ; + rdfs:label "Nanocomposite" ; + rdfs:subClassOf materialsmine:Nanomaterial ; + skos:definition "a multiphase solid material where one of the phases has one, two or three dimensions of less than 100 nanometers (nm), or structures having nano-scale repeat distances between the different phases that make up the material. In the broadest sense this definition can include porous media, colloids, gels and copolymers, but is more usually taken to mean the solid combination of a bulk matrix and nano-dimensional phase(s) differing in properties due to dissimilarities in structure and chemistry." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanocomposite" . + +materialsmine:PressureAtDie a owl:Class ; + rdfs:label "Pressure at Die" ; + rdfs:subClassOf . + +materialsmine:ProcessingCondition a owl:Class ; + rdfs:label "Processing Condition" ; + rdfs:subClassOf sio:Quality . + +materialsmine:Profile a owl:Class ; + rdfs:label "Profile" ; + rdfs:subClassOf sio:DataSeries ; + skos:definition "A data series." . + +materialsmine:RectangularGeometry a owl:Class ; + rdfs:label "Rectangular Geometry" ; + rdfs:subClassOf materialsmine:2DGeometry . + +materialsmine:ResidenceTime a owl:Class ; + rdfs:label "Residence Time" ; + rdfs:subClassOf sio:TimeInterval . + +materialsmine:RotationalFrequency a owl:Class ; + rdfs:label "Rotational Frequency" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + sio:Frequency ; + skos:definition """The number of rotations of an object around an axis per unit time. +""" . + +materialsmine:ScrewChannelWidth a owl:Class ; + rdfs:label "Screw Channel Width" ; + rdfs:subClassOf sio:Width . + +materialsmine:ScrewDiameter a owl:Class ; + rdfs:label "Screw Diameter" ; + rdfs:subClassOf . + +materialsmine:ScrewLead a owl:Class ; + rdfs:label "Screw Lead" ; + rdfs:subClassOf sio:Length . + +materialsmine:ScrewLength a owl:Class ; + rdfs:label "Screw Length" ; + rdfs:subClassOf sio:Length . + +materialsmine:Stress a owl:Class ; + rdfs:label "Stress" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "When a material is loaded with a force, it produces a stress, which then causes a material to deform. " . + +materialsmine:Throughput a owl:Class ; + rdfs:label "Throughput" ; + rdfs:subClassOf sio:Quantity . + +materialsmine:Torque a owl:Class ; + rdfs:label "Torque" ; + rdfs:subClassOf sio:1DExtentQuantity . + +materialsmine:Voltage a owl:Class ; + rdfs:label "Voltage" ; + rdfs:subClassOf sio:Quantity . + + a sio:UnitOfMeasurement ; + rdfs:label "1/Pa" . + + a sio:UnitOfMeasurement ; + rdfs:label "C/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "J/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "kg/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Millimeter" ; + skos:notation "kV/mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^2/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^3/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "m/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "materialsmine:revolutions_per_minute" . + + a sio:UnitOfMeasurement ; + rdfs:label "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "S/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "V/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "W/(m*K)" . + +bibo: rdfs:label "BIBO" . + + rdfs:label "SIO" . + +sio:DimensionalQuantity a owl:Class ; + rdfs:label "Dimensional Quantity" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A dimensional quantity is a quantity that has an associated unit." ; + prov:wasQuotedFrom "https://raw.githubusercontent.com/micheldumontier/semanticscience/master/ontology/sio/release/sio-release.owl" . + +sio:Matrix a owl:Class ; + rdfs:label "Matrix" ; + rdfs:subClassOf sio:RankNonzeroTensor . + +sio:SurfaceArea a owl:Class ; + rdfs:label "Surface Area" ; + rdfs:subClassOf sio:Area . + + rdfs:label "Nanopub" . + + a materialsmine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Hertz" ; + skos:notation "Hz" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Cubic Meter" ; + skos:notation "kg/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Nanometer" ; + skos:notation "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Meter" ; + skos:notation "S/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Watt per Meter-Kelvin" ; + skos:notation "W/mK" . + +materialsmine:3DGeometry a owl:Class ; + rdfs:label "3D Geometry" ; + rdfs:subClassOf materialsmine:Geometry ; + skos:definition "Three-dimensional geometry which can be fully described as a function of three coordinates." . + +materialsmine:AcceleratingVoltage a owl:Class ; + rdfs:label "Accelerating Voltage" ; + materialsmine:hasSelector "//AcceleratingVoltage" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:EmissionCurrent a owl:Class ; + rdfs:label "Emission Current" ; + materialsmine:hasSelector "//EmissionCurrent" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:ExposureTime a owl:Class ; + rdfs:label "Exposure Time" ; + materialsmine:hasSelector "//ExposureTime" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:Magnification a owl:Class ; + rdfs:label "Magnification" ; + materialsmine:hasSelector "//Magnification" ; + rdfs:subClassOf sio:Parameter . + +materialsmine:MeasurementMethod a owl:Class ; + rdfs:label "Measurement Method" ; + rdfs:subClassOf sio:Measuring ; + skos:definition "A method or process used to obtain a measure of some property." . + +materialsmine:Nanomaterial a owl:Class ; + rdfs:label "Nanomaterial" ; + rdfs:subClassOf sio:MaterialEntity ; + skos:definition "materials of which a single unit is sized (in at least one dimension) between 1 and 1000 nanometres (10−9 meter) but is usually 1—100 nm" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanomaterials" . + +materialsmine:RheologicalProperty a owl:Class ; + rdfs:label "Rheological Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A property related to the flow of a material." . + +materialsmine:RotationMode a owl:Class ; + rdfs:label "Rotation Mode" ; + rdfs:subClassOf sio:Quality . + +materialsmine:Solvent a owl:Class ; + rdfs:label "Solvent" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:Quantity ], + sio:ChemicalEntity ; + skos:definition "Solvent used in composite synthesis" . + +materialsmine:Strain a owl:Class ; + rdfs:label "Strain" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "Engineering strain is defined as the amount of deformation in the direction of the applied force divided by the initial length of the material." . + +materialsmine:WorkingDistance a owl:Class ; + rdfs:label "Working Distance" ; + materialsmine:hasSelector "//WorkingDistance" ; + rdfs:subClassOf sio:Parameter . + + a sio:UnitOfMeasurement ; + rdfs:label "1/s", + "Per Second" ; + skos:notation "1/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Kelvin" ; + skos:notation "J/gK" . + + a sio:UnitOfMeasurement ; + rdfs:label "J/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm*m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram" ; + skos:notation "J/gm" . + +sio:Count a owl:Class ; + rdfs:label "Count" ; + rdfs:subClassOf sio:DimensionlessQuantity . + +sio:Density a owl:Class ; + rdfs:label "Density" ; + rdfs:subClassOf sio:3DExtentQuantity . + +sio:Depth a owl:Class ; + rdfs:label "Depth" ; + rdfs:subClassOf materialsmine:Dimension, + sio:1DExtentQuantity . + +sio:Frequency a owl:Class ; + rdfs:label "Frequency" ; + materialsmine:hasPreferredUnit ; + rdfs:subClassOf sio:RateOfChange ; + skos:definition "The rate of occurrence of some periodic event." . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Meter" ; + skos:notation "Ω m" . + +materialsmine:2DGeometry a owl:Class ; + rdfs:label "2D Geometry" ; + rdfs:subClassOf materialsmine:Geometry ; + skos:definition "Two-dimensional geometry which can be fully described as a function of two coordinates" . + +materialsmine:CompressiveCreep a owl:Class ; + rdfs:label "Compressive Creep" ; + rdfs:subClassOf materialsmine:Creep ; + skos:definition "creep during compressive test" . + +materialsmine:Condition a owl:Class ; + rdfs:label "Condition" ; + rdfs:subClassOf materialsmine:CompressionProperty ; + skos:definition "Description of the material's environment (e.g., during characterization)", + "The approximation, such as Plane Stress or Plane Strain, used to calculate the stress state of the material.", + "see Condition" . + +materialsmine:Creep a owl:Class ; + rdfs:label "Creep" ; + rdfs:subClassOf materialsmine:ViscoelasticProperty ; + skos:definition "creep is the tendency of material to move slowly or deform permanently under the influence of mechanical stresses" . + +materialsmine:DispersionRelation a owl:Class ; + rdfs:label "Dispersion Relation" ; + rdfs:subClassOf sio:Function ; + skos:definition "Frequency-wavevector pairs that represent the propogation of wave modes" . + +materialsmine:Extruder a owl:Class ; + rdfs:label "Extruder" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:FlightWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:Throughput ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ExtrusionTemperature ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ResidenceTime ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:MeltTemperature ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ScrewLead ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:Amperage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ChannelsPerScrew ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ScrewDiameter ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ScrewChannelWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:Voltage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:Dimension ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ScrewLength ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:DLRatio ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:PressureAtDie ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:Torque ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:FlightClearance ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:InnerBarrelDiameter ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:ChannelDepth ], + sio:Device . + +materialsmine:FlexuralCreep a owl:Class ; + rdfs:label "Flexural Creep" ; + rdfs:subClassOf materialsmine:Creep ; + skos:definition "creep during flexural or bending test" . + +materialsmine:HardnessProperty a owl:Class ; + rdfs:label "Hardness Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "Materials property representing the material's resistance to deformation under an applied compressive load from a test fixture of known tip geometry." . + +materialsmine:MolecularWeight a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf sio:Mass . + +materialsmine:Plastic a owl:Class ; + rdfs:label "Plastic" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "a material consisting of any of a wide range of synthetic or semi-synthetic organic compounds that are malleable and can be molded into solid objects. Plastics are typically organic polymers of high molecular mass, but they often contain other substances." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Plastic" . + +materialsmine:RheologicalViscosity a owl:Class ; + rdfs:label "Rheological Viscosity" ; + rdfs:subClassOf materialsmine:RheologicalProperty ; + skos:definition "The resistance of a fluid to flow." . + +materialsmine:Rheometery a owl:Class ; + rdfs:label "Rheometry" ; + materialsmine:hasSelector "//Rheometery" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom materialsmine:CapillarySize ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom materialsmine:ViscoelasticProperty ], + sio:Measuring ; + skos:definition "Measurement of the quantitative and qualitative relationships between deformations and stresses and their derivatives" . + + a sio:UnitOfMeasurement ; + rdfs:label "m" . + + a sio:UnitOfMeasurement ; + rdfs:label "s" . + +sio:Width a owl:Class ; + rdfs:label "Width" ; + rdfs:subClassOf materialsmine:Dimension . + + a sio:UnitOfMeasurement ; + rdfs:label "Percent" ; + skos:notation "%" . + +materialsmine:FractureToughnessProperty a owl:Class ; + rdfs:label "Fracture Toughness Property" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "Ability of material containing a crack to resist fracture" . + +materialsmine:Geometry a owl:Class ; + rdfs:label "Geometry" ; + rdfs:subClassOf sio:GeometricEntity ; + skos:definition "Representation of the spatial extent and form of an object." . + +materialsmine:ShearProperty a owl:Class ; + rdfs:label "Shear Property" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in shear" . + +materialsmine:Tacticity a owl:Class ; + rdfs:label "Tacticity" ; + rdfs:subClassOf sio:ChemicalQuality ; + skos:definition "the relative stereochemistry of adjacent chiral centers within a macromolecule." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity" . + + a sio:UnitOfMeasurement ; + rdfs:label "N" . + +sio:Length a owl:Class ; + rdfs:label "Length" ; + rdfs:subClassOf materialsmine:Dimension, + sio:1DExtentQuantity . + +sio:Ratio a owl:Class ; + rdfs:label "Fraction" ; + rdfs:subClassOf sio:DimensionlessQuantity . + + a owl:Class ; + rdfs:label "Diameter" ; + rdfs:subClassOf materialsmine:Dimension, + sio:1DExtentQuantity . + +materialsmine:Crystallinity a owl:Class ; + rdfs:label "Crystallinity" ; + rdfs:subClassOf materialsmine:ThermalProperty ; + skos:definition "degree of structural order in a solid" . + +materialsmine:FlexuralProperty a owl:Class ; + rdfs:label "Flexural Property" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in bending" . + +materialsmine:Molding a owl:Class ; + rdfs:label "Molding" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:AmbientCondition ], + sio:Procedure ; + skos:definition "Methods to shape final composite" . + +materialsmine:RheologicalComplexModulus a owl:Class ; + rdfs:label "Rheological Complex Modulus" ; + rdfs:subClassOf materialsmine:RheologicalProperty ; + skos:definition "The ratio of shear-stress amplitude to strain amplitude of a material under oscillating shear stress." . + +materialsmine:Spectroscopy a owl:Class ; + rdfs:label "Spectroscopy" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "The chemical composition ,composition variation ,crystal structure & photo-electric properties of the materials." . + + a sio:UnitOfMeasurement ; + rdfs:label "J" . + + a sio:UnitOfMeasurement ; + rdfs:label "K" . + +sio:MaterialEntity a owl:Class ; + rdfs:label "Material Entity" ; + rdfs:subClassOf sio:Object ; + skos:definition "A material entity is a physical entity that is spatially extended, exists as a whole at any point in time and has mass." ; + prov:wasQuotedFrom "https://raw.githubusercontent.com/micheldumontier/semanticscience/master/ontology/sio/release/sio-release.owl" . + +sio:Polymer a owl:Class ; + rdfs:label "Polymer" ; + rdfs:subClassOf sio:Molecule . + + a sio:UnitOfMeasurement ; + rdfs:label "Celsius" ; + skos:notation "C" . + + a sio:UnitOfMeasurement ; + rdfs:label "Gigapascal" ; + skos:notation "GPa" . + + a owl:Class ; + rdfs:label "Pressure" ; + rdfs:subClassOf sio:2DExtentQuantity . + +materialsmine:CMatrixElement a owl:Class ; + rdfs:label "C Matrix Element" ; + rdfs:subClassOf sio:InformationContentEntity ; + skos:definition "An element within a material stiffness matrix." . + +materialsmine:CompressionProperty a owl:Class ; + rdfs:label "Compression Property" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in compression" . + +materialsmine:Dimension a owl:Class ; + rdfs:label "Dimension" ; + rdfs:subClassOf sio:DimensionalQuantity . + +materialsmine:TensileCreep a owl:Class ; + rdfs:label "Tensile Creep" ; + rdfs:subClassOf materialsmine:Creep ; + skos:definition "creep during tensile test" . + +sio:TimeInterval a owl:Class ; + rdfs:label "Time" ; + rdfs:subClassOf sio:TimeMeasurement . + +sio:Vector a owl:Class ; + rdfs:label "Vector" ; + rdfs:subClassOf sio:RankNonzeroTensor . + +materialsmine:Additive a owl:Class ; + rdfs:label "Additive" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:Quantity ], + sio:ChemicalEntity, + sio:ChemicalSubstance ; + skos:definition "A chemical substance that is blended in to a polymer to acheive a desired effect.", + "Additive used in composite synthesis" . + +materialsmine:AmbientCondition a owl:Class ; + rdfs:label "Ambient Condition" ; + rdfs:subClassOf materialsmine:ProcessingCondition ; + skos:definition "Ambient conditions" . + +materialsmine:Index a owl:Class ; + rdfs:label "Index" ; + rdfs:subClassOf sio:InformationContentEntity . + +materialsmine:Mixing a owl:Class ; + rdfs:label "Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom materialsmine:RotationalFrequency ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + sio:Procedure ; + skos:definition "Processes for mixing of multiple substances" . + +materialsmine:VolumetricProperty a owl:Class ; + rdfs:label "Volumetric Property" ; + rdfs:subClassOf sio:3DExtentQuantity ; + skos:definition "A property related to the three-dimensional volume of a material." . + + a sio:UnitOfMeasurement ; + rdfs:label "Megapascal" ; + skos:notation "MPa" . + +materialsmine:TensileProperty a owl:Class ; + rdfs:label "Tensile Property" ; + rdfs:subClassOf materialsmine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in tension." . + +materialsmine:ViscoelasticProperty a owl:Class ; + rdfs:label "Viscoelastic Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "Properties of materials that exhibit both viscous and elastic behaviors" . + +materialsmine:MechanicalProperty a owl:Class ; + rdfs:label "Mechanical Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A materials property related to the response of a material under some external applied load." . + + a owl:Class ; + rdfs:label "Temperature" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "The average kinetic energy of all constituents within a materials system" . + +materialsmine:ThermalProperty a owl:Class ; + rdfs:label "Thermal Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A material's property describing the materials ability to absorb, conduct, or otherwise interact with energy in the form of heat." . + + a sio:UnitOfMeasurement ; + rdfs:label "Pa" . + +sio:Procedure a owl:Class ; + rdfs:label "Procedure" ; + rdfs:subClassOf sio:Process . + +sio:Quantity a owl:Class ; + rdfs:label "Amount" ; + rdfs:subClassOf sio:MeasurementValue . + +materialsmine:ElectricalProperty a owl:Class ; + rdfs:label "Electrical Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A materials property describing the material's behavior under some applied electrical field." . + +sio:UnitOfMeasurement a owl:Class ; + rdfs:label "unit of measurement" ; + rdfs:subClassOf sio:Quantity . + diff --git a/whyis/materialsmine/setl/mdcs_files.setl.ttl b/whyis/materialsmine/setl/mdcs_files.setl.ttl new file mode 100644 index 00000000..8c08f5d4 --- /dev/null +++ b/whyis/materialsmine/setl/mdcs_files.setl.ttl @@ -0,0 +1,91 @@ +@prefix rdf: . +@prefix rdfs: . +@prefix xsd: . +@prefix owl: . +@prefix skos: . +@prefix prov: . +@prefix sio: . +@prefix dcat: . +@prefix dcterms: . +@prefix void: . +@prefix foaf: . +@prefix ov: . +@prefix setl: . +@prefix csvw: . +@prefix pv: . +@prefix sp: . +@prefix api_vocab: . + +@prefix : . + +@prefix nanopub: . + +:nanomine_json a setl:JSON; + api_vocab:selector "item"; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used +# prov:used +# prov:used ; + ]. + +:b64encode a owl:Class, prov:SoftwareAgent, setl:PythonScript; + rdfs:subClassOf prov:Activity; + prov:value ''' +from base64 import b64encode as result +'''. + + +:mdcs_files_import a setl:SemanticETLScript; + rdfs:label "Nanomine MDCS Import SETL Script". + +:nanopubs a void:Dataset, dcat:Dataset, setl:Persisted; + prov:wasGeneratedBy :mdcs_files_import, [ + a setl:Transform, setl:JSLDT; + prov:used :nanomine_json; + prov:qualifiedUsage [ a prov:Usage; prov:entity :b64encode; prov:hadRole [ dcterms:identifier "b64encode"]]; + setl:hasContext '''{ + "@base" : "http://nanomine.org/", + "schema": "http://schema.org/", + "xsd": "http://www.w3.org/2001/XMLSchema#", + "whyis": "http://vocab.rpi.edu/whyis/", + "np": "http://www.nanopub.org/nschema#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "sio": "http://semanticscience.org/resource/", + "dc": "http://purl.org/dc/terms/", + "prov": "http://www.w3.org/ns/prov#", + "mt" : "https://www.iana.org/assignments/media-types/" +}'''; + prov:value """[{ + "@if" : "row['schema'] == '5abe807ce74a1d06fd9943a0' and ' ' not in row['title']", + "@id": "nanopublication/{{row['_id']}}", + "@graph": { + "@id": "nanopublication/{{row['_id']}}", + "@type": "np:Nanopublication", + "np:hasAssertion": { + "@id": "nanopublication/{{row['_id']}}_assertion", + "@type": "np:Assertion", + "@graph": [ + { + "@id" : "http://nanomine.org/nmr/xml/{{row['title']}}", + "@type": [ "schema:DataDownload", "mt:text/xml", "http://nanomine.org/ns/NanomineXMLFile"], + "whyis:hasContent" : "data:text/xml;charset=UTF-8;base64,{{b64encode(row['content'].encode('utf-8'))}}", + "dc:conformsTo" : {"@id" : "http://nanomine.org/nmr/schema/{{row['schema']}}"} + }, + { + "@id" : "http://nanomine.org/nmr/dataset/{{'_'.join(row['title'].split('_')[:1]+row['title'].replace('.xml','').split('_')[2:])}}", + "@type" : "schema:Dataset", + "schema:distribution" : [ {"@id" : "http://nanomine.org/nmr/xml/{{row['title']}}"} ] + } + ] + } + } +}]""" + ]. + + a pv:File; + dcterms:format "application/trig"; + prov:wasGeneratedBy [ + a setl:Load; + prov:used :nanopubs ; + ]. diff --git a/whyis/materialsmine/setl/nanomine.ttl b/whyis/materialsmine/setl/nanomine.ttl new file mode 100644 index 00000000..0213390e --- /dev/null +++ b/whyis/materialsmine/setl/nanomine.ttl @@ -0,0 +1,2430 @@ +@prefix : . +@prefix bibo: . +@prefix dcterms: . +@prefix nanomine: . +@prefix owl: . +@prefix prov: . +@prefix rdfs: . +@prefix sio: . +@prefix skos: . + + a owl:Class ; + rdfs:label "Author", + "DOI", + "Date of Citation", + "Date of Measurement", + "Date of Sample Made", + "Edition", + "Editor", + "ISBN", + "ISSN", + "Institution or Lab", + "Issue", + "Keyword", + "Language", + "Publication Year", + "Publisher", + "Title", + "URL", + "Volume", + "nan", + "related DOI" ; + rdfs:subClassOf prov:Agent . + +:ns a owl:Ontology ; + rdfs:label "Nanomaterials Ontology" ; + dcterms:contributor , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + , + ; + rdfs:comment "A nanomaterials ontology to support data publication using Nanomine." ; + owl:imports bibo:, + , + . + +nanomine:AC_DielectricConstant a owl:Class ; + rdfs:label "AC Dielectric Constant" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "A frequency-dependent measure of the electric polarizability of a dielectric material under an oscillating electric field." . + +nanomine:AC_DielectricDispersion a owl:Class ; + rdfs:label "AC Dielectric Dispersion" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "Frequency dependence of dielectric permittivity under an oscillating electric field." . + +nanomine:Abbreviation a owl:Class ; + rdfs:label "Abbreviation" ; + rdfs:subClassOf sio:Name ; + skos:definition "a shortened form of a word or phrase. It consists of a group of letters taken from the word or phrase." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Abbreviation" . + +nanomine:Air a owl:Class ; + rdfs:label "Air" ; + rdfs:subClassOf nanomine:AmbientCondition . + +nanomine:ArcResistance a owl:Class ; + rdfs:label "Arc Resistance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "A measure of the durability of an insulating or dielectric material against the formation of conductive paths along thesurface by arc discharges." . + +nanomine:AspectRatio a owl:Class ; + rdfs:label "Aspect Ratio" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "is the ratio of its sizes in different dimensions. For example, the aspect ratio of a rectangle is the ratio of its longer side to its shorter side – the ratio of width to height, when the rectangle is oriented as a \"landscape\"." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Aspect_ratio" . + +nanomine:Atactic a owl:Class ; + rdfs:label "Atactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition "In atactic macromolecules the substituents are placed randomly along the chain. The percentage of meso diads is between 1 and 99%. With the aid of spectroscopic techniques such as NMR it is possible to pinpoint the composition of a polymer in terms of the percentages for each triad." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Atactic_polymers" . + +nanomine:AtomicForceMicroscopy a owl:Class ; + rdfs:label "Atomic Force Microscopy" ; + nanomine:hasSelector "//Atomic_Force_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:MechanicalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + sio:Measuring ; + skos:definition "Nanoscale probing of material surface characteristics" . + +nanomine:BallMilling a owl:Class ; + rdfs:label "Ball Milling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Grinding process with rotating cylindrical shells and ball " . + +nanomine:BarrelTemperature a owl:Class ; + rdfs:label "Barrel Temperature" ; + rdfs:subClassOf . + +nanomine:Book a owl:Class ; + rdfs:label "Book" . + +nanomine:BreakdownStrength a owl:Class ; + rdfs:label "Breakdown Strength" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "The electric field at which the probability of failure is ln(-ln(1-p)) = 0, or approximately p = 0.632." . + +nanomine:BrittleTemperature a owl:Class ; + rdfs:label "Brittle Temperature" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "Brittleness temperature is the temperature at which 50% of the tested specimens exhibit brittle failure at specified impact conditions" . + +nanomine:CU_Formula a owl:Class ; + rdfs:label "Constitutional Unit Formula" ; + rdfs:subClassOf sio:Name ; + skos:definition "a way of expressing information about the proportions of atoms that constitute a particular chemical compound, using a single line of chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas and plus (+) and minus (−) signs. " ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Chemical_formula" . + +nanomine:Casting a owl:Class ; + rdfs:label "Casting" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:Centrifugation a owl:Class ; + rdfs:label "Centrifugation" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "process which involves the application of the centripetal force for the sedimentation of heterogeneous mixtures with a centrifuge" . + +nanomine:CharpyImpactEnergy a owl:Class ; + rdfs:label "Charpy Impact Energy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:MechanicalProperty ; + skos:definition "Energy absorbed by the sample during Charpy impact testing" . + +nanomine:ChemicalUsed a owl:Class ; + rdfs:label "Chemical Used" ; + rdfs:subClassOf sio:ChemicalEntity . + +nanomine:CoRotation a owl:Class ; + rdfs:label "Co-Rotation" ; + rdfs:subClassOf nanomine:RotationMode . + +nanomine:Communication a owl:Class ; + rdfs:label "Communication" ; + rdfs:subClassOf bibo:AcademicArticle . + +nanomine:Compression a owl:Class ; + rdfs:label "Compression" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing countervailing forces applied inward along the central axis of a material." . + +nanomine:CompressionModulus a owl:Class ; + rdfs:label "Compression Modulus" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressionProperty ; + skos:definition "The ratio of compressive stress to compressive strain" . + +nanomine:CompressionStressAtBreak a owl:Class ; + rdfs:label "Compression Stress At Break" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressionProperty ; + skos:definition "Compression stress when specimen breaks" . + +nanomine:CompressionStressAtYield a owl:Class ; + rdfs:label "Compression Stress At Yield" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressionProperty ; + skos:definition "Compression stress at yield point" . + +nanomine:CompressiveCreepRuptureStrength a owl:Class ; + rdfs:label "Compressive Creep Rupture Strength" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressiveCreep ; + skos:definition "Material strength at rupture during a compressive creep test" . + +nanomine:CompressiveCreepRuptureTime a owl:Class ; + rdfs:label "Compressive Creep Rupture Time" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:CompressiveCreep ; + skos:definition "Time taken to rupture from applying load during a compressive creep test" . + +nanomine:CompressiveCreepStrain a owl:Class ; + rdfs:label "Compressive Creep Strain" ; + rdfs:subClassOf nanomine:CompressiveCreep ; + skos:definition "Profile of strain as a function of time during a compressive creep test" . + +nanomine:CompressiveLoadingProfile a owl:Class ; + rdfs:label "Compressive Loading Profile" ; + rdfs:subClassOf nanomine:CompressionProperty ; + skos:definition "Stress vs. strain curve of during compressive loading and/or unloading test" . + +nanomine:CompressiveToughness a owl:Class ; + rdfs:label "Compressive Toughness" ; + rdfs:subClassOf nanomine:CompressionProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied compressive load." . + +nanomine:ConePlateRheometery a owl:Class ; + rdfs:label "Cone-Plate Rheometry" ; + nanomine:hasSelector "//Rheometery[RheometerType='cone-plate']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + nanomine:Rheometery ; + skos:definition "The liquid is placed on horizontal plate and a shallow cone placed into it. The angle between the surface of the cone and the plate is around 1–2 degrees but can vary depending on the types of tests being run. Typically the plate is rotated and the torque on the cone measured." . + +nanomine:Constituent a owl:Class ; + rdfs:label "Constituent" . + +nanomine:ConstitutionalUnit a owl:Class ; + rdfs:label "Constitutional Unit" ; + rdfs:subClassOf sio:UnitOfMeasurement . + +nanomine:Cooling a owl:Class ; + rdfs:label "Cooling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + sio:Procedure . + +nanomine:Copolymer a owl:Class ; + rdfs:label "Copolymer" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "polymers containing a mixture of repeat units" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . + +nanomine:CounterRotation a owl:Class ; + rdfs:label "Counter-Rotation" ; + rdfs:subClassOf nanomine:RotationMode . + +nanomine:CrystalPhase a owl:Class ; + rdfs:label "Crystal Phase" ; + rdfs:subClassOf sio:CrystalStructure ; + skos:definition "A single material may have several distinct solid states capable of forming separate phases. Water is a well-known example of such a material. For example, water ice is ordinarily found in the hexagonal form ice Ih, but can also exist as the cubic ice Ic, the rhombohedral ice II, and many other forms. Polymorphism is the ability of a solid to exist in more than one crystal form. For pure chemical elements, polymorphism is known as allotropy. For example, diamond, graphite, and fullerenes are different allotropes of carbon." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Phase_(matter)#Crystal_phases" . + +nanomine:CrystallizationTemperature a owl:Class ; + rdfs:label "Crystallization Temperature" ; + rdfs:subClassOf nanomine:ThermalProperty, + ; + skos:definition "It is the temperature at which a solid phase begins to form, resulting in a mixture of solid particles and solution" . + +nanomine:Curing a owl:Class ; + rdfs:label "Curing" ; + rdfs:subClassOf sio:Procedure . + +nanomine:CurrentDensity a owl:Class ; + rdfs:label "Current Density" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "the amount of electric current flowing per unit cross-sectional area of a material." . + +nanomine:CycleInformation a owl:Class ; + rdfs:label "Cycle Information" ; + nanomine:hasSelector "//CycleInformation" ; + rdfs:subClassOf sio:InformationContentEntity . + +nanomine:DC_DielectricConstant a owl:Class ; + rdfs:label "DC Dielectric Constant" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "A measure of the electric polarizability of a dielectric material" . + +nanomine:DSC_Profile a owl:Class ; + rdfs:label "DSC Profile" ; + rdfs:subClassOf nanomine:ThermalProperty ; + skos:definition "Heat flow vs temperature out of a differential scanning calorimetry experiment" . + +nanomine:DegreeOfCrystallization a owl:Class ; + rdfs:label "Degree of Crystallinity" ; + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "The percentage of the crystallized region in a polymer/material. It describes the extent of the crystallization process" . + +nanomine:Density a owl:Class ; + rdfs:label "Density" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty, + ; + skos:definition "The density, or more precisely, the volumetric mass density, of a substance is its mass per unit volume.", + "degree of consistency measured by the quantity of mass per unit volume" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Density" . + +nanomine:DieDiameter a owl:Class ; + rdfs:label "Die Diameter" ; + rdfs:subClassOf . + +nanomine:DielectricLossPermittivity a owl:Class ; + rdfs:label "Dielectric Loss Permittivity" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "The imaginary component of the frequency-dependent complex permittivity of a material under an oscillating electric field." . + +nanomine:DielectricLossTangent a owl:Class ; + rdfs:label "Dielectric Loss Tangent" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "The ratio of the imaginary to real components of permittivity, representing the dissipation of electromagnetic energy in the presence of an oscillating electric field." . + +nanomine:DielectricRealPermittivity a owl:Class ; + rdfs:label "Dielectric Real Permittivity" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "The real component of the frequency-dependent complex permittivity of a material under an oscillating electric field." . + +nanomine:DielectricandImpedanceSpectroscopyAnalysis a owl:Class ; + rdfs:label "Dielectric and Impedance Spectroscopy Analysis" ; + nanomine:hasSelector "//Dielectric_and_Impedance_Spectroscopy_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of dielectric spectroscopy (variation of dielectric constant with frequency) " . + +nanomine:DifferentialScanningCalorimetry a owl:Class ; + rdfs:label "Differential Scanning Calorimetry" ; + nanomine:hasSelector "//Differential_Scanning_Calorimetry" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:HeatingRate ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:CoolingRate ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ThermalProperty ], + sio:Measuring ; + skos:definition "Measurement of heat required to increase unit temperature in a material" . + +nanomine:Dissolving a owl:Class ; + rdfs:label "Dissolving" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Solvent ], + sio:Procedure ; + skos:definition "Dissolving into solution without external force" . + +nanomine:Drying-Evaporation a owl:Class ; + rdfs:label "Drying Evaporation" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + sio:Procedure ; + skos:definition "Process for drying and evaporation of liquid solutions" . + +nanomine:DynamicMechanicalAnalysis a owl:Class ; + rdfs:label "Dynamic Mechanical Analysis" ; + nanomine:hasSelector "//Dynamic_Mechanical_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + sio:Measuring ; + skos:definition "Method to get viscoelastic behavior of materials with controlled temperature and frequency" . + +nanomine:DynamicProperty a owl:Class ; + rdfs:label "Dynamic Property" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "A materials property representing the behavior of the material under some dynamic environmental force." . + +nanomine:DynamicPropertyProfile a owl:Class ; + rdfs:label "Dynamic Property Profile" ; + skos:definition "A profile describing a dynamic property measurement (e.g., in dynamic mechanical analysis)." . + +nanomine:DynamicViscosity a owl:Class ; + rdfs:label "Dynamic Viscosity" ; + rdfs:subClassOf nanomine:RheologicalViscosity ; + skos:definition "A measure of a fluid's resistance to flow." . + +nanomine:Elastomer a owl:Class ; + rdfs:label "Elastomer" ; + rdfs:subClassOf nanomine:Plastic ; + skos:definition "a polymer with viscoelasticity (having both viscosity and elasticity) and very weak inter-molecular forces, generally having low Young's modulus and high failure strain compared with other materials." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Elastomer" . + +nanomine:ElectricPercolationThreshold a owl:Class ; + rdfs:label "Electric Percolation Threshold" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "minimum filler content in the polymer matrix after which there is no significant change in the electrical properties of the composites." . + +nanomine:ElectricalConductivity a owl:Class ; + rdfs:label "Electric Conductivity" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "ability of electric current to flow through a material" . + +nanomine:Electrometry a owl:Class ; + rdfs:label "Electrometry" ; + nanomine:hasSelector "//Electrometry" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of electric charge or electrical potential difference" . + +nanomine:ElongationAtBreak a owl:Class ; + rdfs:label "Elongation At Break" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Elongation of specimen when breaks" . + +nanomine:ElongationAtYield a owl:Class ; + rdfs:label "Elongation At Yield" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile elongation corresponding to the yield (an increase in strain does not result in an increase in stress)." . + +nanomine:EnergyDensity a owl:Class ; + rdfs:label "Energy Density" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "amount of energy stored in a given system or region of space per unit volume or mass" . + +nanomine:Equipment a owl:Class ; + rdfs:label "Equipment", + "Equipment Used" ; + nanomine:hasSelector "//Equipment", + "//EquipmentUsed" ; + rdfs:subClassOf sio:Device . + +nanomine:EssentialWorkOfFracture a owl:Class ; + rdfs:label "Essential Work Of Fracture" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FractureToughnessProperty ; + skos:definition "Energy associated with cracking at the process zone" . + +nanomine:Eutactic a owl:Class ; + rdfs:label "Eutactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition "In eutactic macromolecules, substituents may occupy any specific (but potentially complex) sequence of positions along the chain. Isotactic and syndiotactic polymers are instances of the more general class of eutactic polymers, which also includes heterogeneous macromolecules in which the sequence consists of substituents of different kinds (for example, the side-chains in proteins and the bases in nucleic acids)." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Eutactic_polymers" . + +nanomine:ExperimentalProcedure a owl:Class ; + rdfs:label "Experimental Procedure" ; + rdfs:subClassOf sio:Procedure . + +nanomine:Experimenter a owl:Class ; + rdfs:label "Experimenter" ; + rdfs:subClassOf prov:Agent . + +nanomine:Extrusion a owl:Class ; + rdfs:label "Extrusion" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Extruder ], + sio:Procedure ; + skos:definition "Process used to create objects of a fixed cross-sectional profile. A material is pushed through a die of the desired cross-section." . + +nanomine:FiberTensileElongation a owl:Class ; + rdfs:label "Fiber Tensile Elongation" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Elongation along grain direction in fibers" . + +nanomine:FiberTensileModulus a owl:Class ; + rdfs:label "Fiber Tensile Modulus" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile modulus along grain direction in fibers" . + +nanomine:FiberTensileStrength a owl:Class ; + rdfs:label "Fiber Tensile Strength" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile Stress along grain direction in fibers" . + +nanomine:Filler a owl:Class ; + rdfs:label "Filler" ; + rdfs:subClassOf sio:Role . + +nanomine:FillerComponentComposition a owl:Class ; + rdfs:label "Filler Component Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:FillerComponentInComposite a owl:Class ; + rdfs:label "Filler Component in Composite" ; + rdfs:subClassOf nanomine:FillerComponent . + +nanomine:FillerComposition a owl:Class ; + rdfs:label "Filler Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:FillerProcessing a owl:Class ; + rdfs:label "Filler Processing" ; + rdfs:subClassOf nanomine:Processing . + +nanomine:FlexuralCreepRuptureStrength a owl:Class ; + rdfs:label "Flexural Creep Rupture Strength" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralCreep ; + skos:definition "Material strength at rupture during a flexural creep test" . + +nanomine:FlexuralCreepRuptureTime a owl:Class ; + rdfs:label "Flexural Creep Rupture Time" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralCreep ; + skos:definition "Time taken to rupture from applying load during a flexural creep test" . + +nanomine:FlexuralCreepStrain a owl:Class ; + rdfs:label "Flexural Creep Strain" ; + rdfs:subClassOf nanomine:FlexuralCreep ; + skos:definition "Profile of strain as a function of time during a flexural creep test" . + +nanomine:FlexuralLoadingProfile a owl:Class ; + rdfs:label "Flexural Loading Profile" ; + rdfs:subClassOf nanomine:FlexuralProperty ; + skos:definition "Stress vs. strain curve of during flexural loading and/or unloading test" . + +nanomine:FlexuralModulus a owl:Class ; + rdfs:label "Flexural Modulus" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralProperty ; + skos:definition "Ratio of stress to strain in flexural deformation, or the tendency for a material to bend" . + +nanomine:FlexuralStressAtBreak a owl:Class ; + rdfs:label "Flexural Stress At Break" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralProperty ; + skos:definition "Flexural stress at the moment at which a test specimen tears" . + +nanomine:FlexuralStressAtYield a owl:Class ; + rdfs:label "Flexural Stress At Yield" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:FlexuralProperty ; + skos:definition "Flexural stress corresponding to the yield point" . + +nanomine:FlexuralToughness a owl:Class ; + rdfs:label "Flexural Toughness" ; + rdfs:subClassOf nanomine:FlexuralProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied flexural load." . + +nanomine:FourierTransformInfraredSpectroscopy a owl:Class ; + rdfs:label "Fourier Transform Infrared Spectroscopy" ; + nanomine:hasSelector "//Fourier_Transform_Infrared_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Measurement of infrared spectrum of absorption or emission of a solid, liquid or gas" . + +nanomine:FractureEnergy a owl:Class ; + rdfs:label "Fracture Energy" ; + skos:definition "The energy required to create a new surface in the material, measured by the energy absorbed by the material during fracture." . + +nanomine:FrequencySweep a owl:Class ; + rdfs:label "Frequency Sweep" ; + skos:definition "A continuous variation of frequency within a pre-defined range." . + +nanomine:GlassTransitionTemperature a owl:Class ; + rdfs:label "Glass Transition Temperature" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "is the temperature region where the polymer transitions from a hard, glassy material to a soft, rubbery material." . + +nanomine:GraftDensity a owl:Class ; + rdfs:label "Graft Density" ; + rdfs:subClassOf sio:Density ; + skos:definition "A result of surface treatment process, the graft density quantifies the area density of surface-treatment molecules on the surface of the filler, typically in units of chains/nm^2." . + +nanomine:GrowthRateOfCrystal a owl:Class ; + rdfs:label "Growth Rate Of Crystal" ; + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "Rate of the crystallization process" . + +nanomine:GrowthRateParameterOfAvramiEquation a owl:Class ; + rdfs:label "Growth Rate Parameter Of Avrami Equation" ; + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "Growth Rate Parameter in Avrami Equation" . + +nanomine:HalflifeOfCrystallization a owl:Class ; + rdfs:label "Halflife Of Crystallization" ; + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "The time required for half of a material to form a crystalline structure under some condition." . + +nanomine:Hardener a owl:Class ; + rdfs:label "Hardener" ; + rdfs:subClassOf nanomine:Additive ; + skos:definition "A chemical additive that increases the viscosity of a polymer." . + +nanomine:HardnessScale a owl:Class ; + rdfs:label "Hardness Scale" ; + rdfs:subClassOf nanomine:HardnessProperty ; + skos:definition "A standard numerical scale associated with a particular hardness test tip geometry." . + +nanomine:HardnessTestStandard a owl:Class ; + rdfs:label "Hardness Test Standard" ; + rdfs:subClassOf nanomine:HardnessProperty ; + skos:definition "A materials testing standard, created by a standards body such as ASTM, defining test parameters such as pre-load, load, and tip geometry of the testing apparatus." . + +nanomine:HardnessValue a owl:Class ; + rdfs:label "Hardness Value" ; + rdfs:subClassOf nanomine:HardnessProperty ; + skos:definition "The numerical value of hardness output by the testing apparatus, given a particular hardness scale as input." . + +nanomine:HeatOfCrystallization a owl:Class ; + rdfs:label "Heat Of Crystallization" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "The amount of heat that must be removed from one gram of a liquid at its freezing point to freeze it with no change in temperature." . + +nanomine:HeatOfFusion a owl:Class ; + rdfs:label "Heat Of Fusion" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "change in enthalpy with energy dissipation" . + +nanomine:Heating a owl:Class ; + rdfs:label "Heating" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + sio:Procedure ; + skos:definition "Process for applying heat" . + +nanomine:HeatingZone a owl:Class ; + rdfs:label "Heating Zone" ; + rdfs:subClassOf sio:SpatialRegion . + +nanomine:HeatingZoneNumber a owl:Class ; + rdfs:label "Heating Zone Number" ; + rdfs:subClassOf sio:Number . + +nanomine:HighPressureCapillaryRheometery a owl:Class ; + rdfs:label "High Pressure Capillary Rheometry" ; + nanomine:hasSelector "//Rheometery[RheometerType='high pressure capillary']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + nanomine:Rheometery . + +nanomine:HighShearMixing a owl:Class ; + rdfs:label "High Shear Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "A stator-rotator setup that disperses substance into continuous phase through high shear" . + +nanomine:Homopolymer a owl:Class ; + rdfs:label "Homopolymer" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "polymers that contain only a single type of repeat unit" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . + +nanomine:HotPressing a owl:Class ; + rdfs:label "Hot-Processing (Compression Molding)" ; + rdfs:subClassOf nanomine:Molding ; + skos:definition "Applying heat and pressure" . + +nanomine:IZOD_Area a owl:Class ; + rdfs:label "IZOD Area" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:MechanicalProperty ; + skos:definition "Area associated in Izod impact testing" . + +nanomine:IZOD_ImpactEnergy a owl:Class ; + rdfs:label "IZOD Impact Energy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:MechanicalProperty ; + skos:definition "Energy absorbed by the sample during Izod impact testing, as calculated by the height of swing arm" . + +nanomine:ImpactToughness a owl:Class ; + rdfs:label "Impact Toughness" ; + rdfs:subClassOf nanomine:Impact ; + skos:definition "The amount of impact energy a material can absorb prior to fracture." . + +nanomine:Impedance a owl:Class ; + rdfs:label "Impedance" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "The effective resistance to an alternating current." . + +nanomine:In-SituPolymerization a owl:Class ; + rdfs:label "In-Situ Polymerization" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of nanoparticles within liquid monomer so that polymer formation results in embedding of particles" . + +nanomine:Inert a owl:Class ; + rdfs:label "Inert" ; + rdfs:subClassOf nanomine:AmbientCondition . + +nanomine:InjectionMolding a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:InterfacialTension a owl:Class ; + rdfs:label "Interfacial Tension" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "Interfacial tension is the force that holds the surfaceof a particular phase together" . + +nanomine:InterphaseThickness a owl:Class ; + rdfs:label "Interphase Thickness" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "Thickness of matrix-particle interaction area with a gradient property as a function of distance from particle surface" . + +nanomine:Isotactic a owl:Class ; + rdfs:label "Isotactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition """Isotactic polymers are composed of isotactic macromolecules (IUPAC definition). In isotactic macromolecules all the substituents are located on the same side of the macromolecular backbone. An isotactic macromolecule consists of 100% meso diads. Polypropylene formed by Ziegler-Natta catalysis is an isotactic polymer. Isotactic polymers are usually semicrystalline and often form a helix configuration. + +""" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Isotactic_polymers" . + +nanomine:JIntegral a owl:Class ; + rdfs:label "J Integral" ; + skos:definition "In fracture mechanics, the J-integral represents the energy required to advance a crack in a material (related to the fracture toughness)." . + +nanomine:Journal a owl:Class ; + rdfs:label "Journal" . + +nanomine:KFactor a owl:Class ; + rdfs:label "K Factor" ; + skos:definition "In fracture mechanics, the Stress Intensity Factor, K, describes the stress state at the tip of a crack in a material." . + +nanomine:LC_PhaseTransitionTemperature a owl:Class ; + rdfs:label "LC Phase Transition Temperature" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "temperature of transition to liquid crystal phase" . + +nanomine:LengthOfHeatingZone a owl:Class ; + rdfs:label "Length Of Heating Zone" ; + rdfs:subClassOf sio:Length . + +nanomine:LinearElastic a owl:Class ; + rdfs:label "Linear Elastic" ; + rdfs:subClassOf nanomine:FractureToughnessProperty ; + skos:definition "Infinitesimal material deformation or deformation within the linear regime" . + +nanomine:LinearExpansionCoefficient a owl:Class ; + rdfs:label "Linear Expansion Coefficient" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "It is the fractional change in length per degree of temperature change" . + +nanomine:ManufacturerOrSourceName a owl:Class ; + rdfs:label "Manufacturer Or Source Name" ; + rdfs:subClassOf sio:Organization ; + skos:definition "An organization that enages in the value added production of merchandise for use or sale using labour and machines, tools, chemical and biological processing, or formulation." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Manufacturing" . + +nanomine:MassFraction a owl:Class ; + rdfs:label "Mass Fraction" ; + rdfs:subClassOf sio:Concentration . + +nanomine:MasterCurve a owl:Class ; + rdfs:label "Master Curve" ; + skos:definition "see Rheological Master Curve" . + +nanomine:Matrix a owl:Class ; + rdfs:label "Matrix" ; + rdfs:subClassOf sio:Role . + +nanomine:MatrixComponent a owl:Class ; + rdfs:label "Matrix Component" ; + rdfs:subClassOf nanomine:Component . + +nanomine:MatrixComponentComposition a owl:Class ; + rdfs:label "Matrix Component Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:MatrixProcessing a owl:Class ; + rdfs:label "Matrix Processing" ; + rdfs:subClassOf nanomine:Processing . + +nanomine:MeasurementMethod a owl:Class ; + rdfs:label "Measurement Method" ; + rdfs:subClassOf sio:Measuring ; + skos:definition "A method or process used to obtain a measure of some property." . + +nanomine:MechanicalMixing a owl:Class ; + rdfs:label "Mechanical Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Manual mixing" . + +nanomine:MeltMixing a owl:Class ; + rdfs:label "Melt Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Mixing of polymer and nanoparticles in molten state" . + +nanomine:MeltProcessing a owl:Class ; + rdfs:label "Melt Processing" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of polymer and nanoparticles in molten state" . + +nanomine:MeltViscosity a owl:Class ; + rdfs:label "Melt Viscosity" ; + rdfs:subClassOf nanomine:RheologicalViscosity ; + skos:definition "The viscosity of a polymer in its melt (liquid) state." . + +nanomine:MeltingTemperature a owl:Class ; + rdfs:label "Melting Temperature" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "the temperature at which a solid turns into a liquid" . + +nanomine:Mixer a owl:Class ; + rdfs:label "Mixer" ; + rdfs:subClassOf sio:Device . + +nanomine:MixingMethod a owl:Class ; + rdfs:label "Mixing Method" ; + rdfs:subClassOf sio:Procedure . + +nanomine:MolecularWeight_Mn a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf sio:Mass ; + skos:altLabel "Number Average Molar Mass" ; + skos:definition "Mn, the number averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the arithmetic mean of the matrix polymer chains." . + +nanomine:MolecularWeight_Mw a owl:Class ; + rdfs:label "Molecular Weight" ; + rdfs:subClassOf sio:Mass ; + skos:altLabel "Mass Average Molar Mass" ; + skos:definition "Mw, the weight averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the average size of the matrix polymer chains." . + +nanomine:NonSpherical a owl:Class ; + rdfs:label "Non-spherical Shape" ; + rdfs:subClassOf sio:Shape . + +nanomine:Notched a owl:Class ; + rdfs:label "Notched" ; + rdfs:subClassOf nanomine:MechanicalProperty, + sio:Quality ; + skos:definition "Property of a material sample, in which a uniform notch has been created for the purpose of concentrating stress in a region of interest." . + +nanomine:NuclearMagneticResonance a owl:Class ; + rdfs:label "Nuclear Magnetic Resonance" ; + nanomine:hasSelector "//Nuclear_Magnetic_Resonance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Molecular analysis due to observed NMR under applied magnetic field" . + +nanomine:NucleationParameterOfAvramiEquation a owl:Class ; + rdfs:label "Nucleation Parameter Of Avrami Equation" ; + rdfs:subClassOf nanomine:Crystallinity ; + skos:definition "Nucleation Parameter in Avrami Equation" . + +nanomine:OpticalMicroscopy a owl:Class ; + rdfs:label "Optical Microscopy" ; + nanomine:hasSelector "//OpticalMicroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:MechanicalProperty ], + sio:Measuring ; + skos:definition "Magnification of small objects with visible light" . + +nanomine:Other a owl:Class ; + rdfs:label "Other Processing Parameter" ; + rdfs:subClassOf sio:Procedure . + +nanomine:OtherProcessing a owl:Class ; + rdfs:label "Other Processing" ; + rdfs:subClassOf sio:Procedure . + +nanomine:Other_Processing a owl:Class ; + rdfs:label "Other Processing" ; + rdfs:subClassOf sio:Procedure . + +nanomine:Output a owl:Class ; + rdfs:label "Output" . + +nanomine:Particle a owl:Class ; + rdfs:label "Particle" ; + rdfs:subClassOf nanomine:Nanomaterial ; + skos:definition "particles between 1 and 100 nanometers in size. In nanotechnology, a particle is defined as a small object that behaves as a whole unit with respect to its transport and properties." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanoparticle" . + +nanomine:ParticleDiameter a owl:Class ; + rdfs:label "Particle Diameter" ; + rdfs:subClassOf sio:MeasurementValue ; + skos:definition "Assuming sphere-like particles comprising the filler, the particle diameter is the \"average\" diameter of those particles." . + +nanomine:ParticleSurfaceTreatmentComposition a owl:Class ; + rdfs:label "Particle Surface Treatment Composition" ; + rdfs:subClassOf nanomine:Composition . + +nanomine:PlasticElastic a owl:Class ; + rdfs:label "Plastic Elastic" ; + rdfs:subClassOf nanomine:FractureToughnessProperty ; + skos:definition "Material deformation that undergoes both elastic and plastic deformation" . + +nanomine:PlateRheometery a owl:Class ; + rdfs:label "Plate Rheometry" ; + nanomine:hasSelector "//Rheometery[RheometerType='plate']" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + nanomine:Rheometery ; + skos:definition "The falling plate rheometer sandwiches liquid between two solid surfaces. The top plate is fixed, and bottom plate falls under the influence of gravity, drawing out a string of the liquid" . + +nanomine:PoissonsRatio a owl:Class ; + rdfs:label "Poissons Ratio" ; + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "Negative ratio of traverse to axial strain" . + +nanomine:Polydispersity a owl:Class ; + rdfs:label "Polydispersity" ; + rdfs:subClassOf sio:SpatialQuantity ; + skos:altLabel "Dispersity" . + +nanomine:PolymerBlend a owl:Class ; + rdfs:label "Polymer Blend" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "a member of a class of materials analogous to metal alloys, in which at least two polymers are blended together to create a new material with different physical properties." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_blend" . + +nanomine:PolymerNanocomposite a owl:Class ; + rdfs:label "Polymer Nanocomposite" ; + rdfs:subClassOf nanomine:Nanocomposite ; + skos:altLabel "PNC" ; + skos:definition "Polymer nanocomposites (PNC) consist of a polymer or copolymer having nanoparticles or nanofillers dispersed in the polymer matrix. These may be of different shape (e.g., platelets, fibers, spheroids), but at least one dimension must be in the range of 1–50 nm." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_nanocomposite" . + +nanomine:Power a owl:Class ; + rdfs:label "Power" ; + rdfs:subClassOf sio:Quantity . + +nanomine:PreCrackingProcess a owl:Class ; + rdfs:label "Precracking Process" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "The process of establishing an initiator crack or groove in a test specimen such that the failure of the test specimen deterministically begins at the established location." . + +nanomine:PreLoad a owl:Class ; + rdfs:label "Pre-Load" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:Condition ; + skos:definition "Pre-stress or pre-strain before testing" . + +nanomine:ProbabilityOfFailure a owl:Class ; + rdfs:label "Probability of Failure" ; + rdfs:subClassOf nanomine:ElectricalProperty ; + skos:definition "As the electric field is intensified, the probability of failure is the likelihood that a breakdown channel forms across the test specimen." . + +nanomine:ProceedingsArticle a owl:Class ; + rdfs:label "Conference Proceedings Article" ; + rdfs:subClassOf bibo:AcademicArticle ; + skos:definition "An article published in the proceedings of a conference." . + +nanomine:Profile a owl:Class ; + rdfs:label "Profile" ; + skos:definition "A data series." . + +nanomine:PubChemReference a owl:Class ; + rdfs:label "PubChem Reference" ; + rdfs:subClassOf sio:Reference . + +nanomine:PulsedElectroAcoustic a owl:Class ; + rdfs:label "Pulsed Electro Acoustic" ; + nanomine:hasSelector "//Pulsed_Electro_Acoustic" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + sio:Measuring ; + skos:definition "Measurement of space charge in dielectric materials" . + +nanomine:RadialClearence a owl:Class ; + rdfs:label "Radial Clearence" ; + rdfs:subClassOf nanomine:Dimension, + sio:Height . + +nanomine:RamanSpectroscopy a owl:Class ; + rdfs:label "Raman Spectroscopy" ; + nanomine:hasSelector "//Raman_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Molecular analysis with spectroscopic techniques that observe low-frequency modes in a material" . + +nanomine:ResearchArticle a owl:Class ; + rdfs:label "Research Article" ; + rdfs:subClassOf bibo:AcademicArticle . + +nanomine:ReviewArticle a owl:Class ; + rdfs:label "Review Article" ; + rdfs:subClassOf bibo:AcademicArticle . + +nanomine:RheologicalLossModulus a owl:Class ; + rdfs:label "Rheological Loss Modulus" ; + rdfs:subClassOf nanomine:RheologicalComplexModulus ; + skos:definition "The deformation energy dissipated within a material when subject to shear; the viscous component of the complex modulus." . + +nanomine:RheologicalLossTangent a owl:Class ; + rdfs:label "Rheological Loss Tangent" ; + rdfs:subClassOf nanomine:RheologicalComplexModulus ; + skos:definition "The damping factor, or the ratio of storage to loss moduli; for ideally elastic materials, the damping factor is zero; for ideally viscous materials, the damping factor is infinite." . + +nanomine:RheologicalMasterCurve a owl:Class ; + rdfs:label "Rheological Master Curve" ; + rdfs:subClassOf nanomine:RheologicalComplexModulus ; + skos:definition "The superposition of rheological data taken at different temperatures in a given frequency range, where the curves are horizontally shifted to form a continuous master curve spanning a much larger frequency range that would otherwise be experimentally intractable or infeasible." . + +nanomine:RheologicalStorageModulus a owl:Class ; + rdfs:label "Rheological Storage Modulus" ; + rdfs:subClassOf nanomine:RheologicalComplexModulus ; + skos:definition "The deformation energy stored within a material when subject to shear; the elastic component of the complex modulus." . + +nanomine:RheometerMode a owl:Class ; + rdfs:label "Rheometer Mode" ; + rdfs:subClassOf nanomine:RheologicalComplexModulus, + nanomine:RheologicalViscosity ; + skos:definition "The type of condition (e.g., temperature sweep or frequency sweep) under which a material's rheological response is measured." . + +nanomine:RollMilling a owl:Class ; + rdfs:label "Roll Milling" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "Grinding process with a roller and flat plate" . + +nanomine:RotationSpeed a owl:Class ; + rdfs:label "Rotation Speed" ; + rdfs:subClassOf sio:Speed . + +nanomine:RotationalMolding a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:SMILES a owl:Class ; + rdfs:label "SMILES" ; + rdfs:subClassOf sio:Representation . + +nanomine:ScanningElectronMicroscopy a owl:Class ; + rdfs:label "Scanning Electron Microscopy" ; + nanomine:hasSelector "//Scanning_Electron_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:Magnification ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:AcceleratingVoltage ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:WorkingDistance ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:ExposureTime ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:EmissionCurrent ], + sio:Measuring ; + skos:definition "Scanning electron microscopy for obtaining microstructure at microscale" . + +nanomine:ScrewChannelDiameter a owl:Class ; + rdfs:label "Screw Channel Diameter" ; + rdfs:subClassOf . + +nanomine:Shear a owl:Class ; + rdfs:label "Shear" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing opposing in-plane forces on a material." . + +nanomine:ShearLoadingProfile a owl:Class ; + rdfs:label "Shear Loading Profile" ; + rdfs:subClassOf nanomine:ShearProperty ; + skos:definition "Stress vs. strain curve of during shear loading and/or unloading test" . + +nanomine:ShearModulus a owl:Class ; + rdfs:label "Shear Modulus" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ShearProperty ; + skos:definition "Ratio of shear stress to shear strain" . + +nanomine:ShearStressAtBreak a owl:Class ; + rdfs:label "Shear Stress At Break" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ShearProperty ; + skos:definition "Shear stress when specimen breaks" . + +nanomine:ShearStressAtYield a owl:Class ; + rdfs:label "Shear Stress At Yield" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ShearProperty ; + skos:definition "Shear stress at yield point" . + +nanomine:SingleScrew a owl:Class ; + rdfs:label "Single Screw Extruder" ; + rdfs:subClassOf nanomine:Extruder . + +nanomine:SolutionProcessing a owl:Class ; + rdfs:label "Solution Processing" ; + rdfs:subClassOf sio:Procedure ; + skos:definition "Mixing of dissolvable polymer with nanoparticles" . + +nanomine:SolventAmount a owl:Class ; + rdfs:label "Solvent Amount" ; + rdfs:subClassOf sio:Quantity . + +nanomine:SolventName a owl:Class ; + rdfs:label "Solvent Name" ; + rdfs:subClassOf sio:Name . + +nanomine:SpecificHeatCapacity_Cp a owl:Class ; + rdfs:label "Specific Heat Capacity Cp" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "Cp for a gas is the change in the enthalpy (H) of the system with respect to change in temperature at a fixed pressure of the system" . + +nanomine:SpecificHeatCapacity_Cv a owl:Class ; + rdfs:label "Specific Heat Capacity Cv" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "Cv for a gas is the change in internal energy (U) of a system with respect to change in temperature at a fixed volume of the system" . + +nanomine:SpecificSurfaceArea a owl:Class ; + rdfs:label "Specific Surface Area" ; + rdfs:subClassOf sio:SurfaceArea . + +nanomine:StdChemicalName a owl:Class ; + rdfs:label "StdChemicalName" ; + rdfs:subClassOf nanomine:ChemicalName . + +nanomine:Stirring a owl:Class ; + rdfs:label "Stirring" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Solvent ], + nanomine:Mixing ; + skos:definition "Manual stirring of liquid solutions" . + +nanomine:StrainAmplitude a owl:Class ; + rdfs:label "Strain Amplitude" ; + rdfs:subClassOf nanomine:Condition ; + skos:definition "The magnitude of forced displacement of a material sample.", + "The maximum magnitude of forced displacement under oscillatory loading conditions." . + +nanomine:StrainAtBreak a owl:Class ; + rdfs:label "Strain at Break" ; + rdfs:subClassOf nanomine:Strain ; + skos:definition "The strain at which the material fractures (e.g. during a tensile test)" . + +nanomine:StrainRate a owl:Class ; + rdfs:label "Strain Rate" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:Condition ; + skos:definition "Rate of strain change", + "see Strain Rate" . + +nanomine:StrainSweep a owl:Class ; + rdfs:label "Strain Sweep" ; + skos:definition "A continuous variation of strain (amplitude) within a pre-defined range." . + +nanomine:Stress a owl:Class ; + rdfs:label "Stress" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "When a material is loaded with a force, it produces a stress, which then causes a material to deform. " . + +nanomine:StressRelaxation a owl:Class ; + rdfs:label "Stress Relaxation" ; + rdfs:subClassOf sio:RateOfChange ; + skos:definition "Stress relaxation, which occurs when a viscoelastic test specimen is brought to a fixed strain and held, is the gradual release of internal stress due to the viscous nature of the test specimen. " . + +nanomine:SurfaceChemistryProcessing a owl:Class ; + rdfs:label "Surface Chemistry Processing" ; + rdfs:subClassOf nanomine:Processing . + +nanomine:SurfaceResistivity a owl:Class ; + rdfs:label "Surface Resistivity" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "Ability to resist leakage current along the surface of an insulating material" . + +nanomine:SurfaceTension a owl:Class ; + rdfs:label "Surface Tension" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "the force that causes the molecules on the surface of a liquid to be pushed together and form a layer" . + +nanomine:SurfaceTreatment a owl:Class ; + rdfs:label "Surface Treatment" ; + rdfs:subClassOf sio:Role . + +nanomine:Syndiotactic a owl:Class ; + rdfs:label "Syndiotactic" ; + rdfs:subClassOf nanomine:Tacticity ; + skos:definition "In syndiotactic or syntactic macromolecules the substituents have alternate positions along the chain. The macromolecule consists 100% of racemo diads. Syndiotactic polystyrene, made by metallocene catalysis polymerization, is crystalline with a melting point of 161 °C. Gutta percha is also an example for Syndiotactic polymer." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Syndiotactic_polymers" . + +nanomine:TechnicalComment a owl:Class ; + rdfs:label "Technical Comment" ; + rdfs:subClassOf bibo:Document . + +nanomine:TemperatureSweep a owl:Class ; + rdfs:label "Temperature Sweep" ; + rdfs:subClassOf nanomine:DMA_Mode ; + skos:definition "A continuous variation of temperature within a pre-defined range." . + +nanomine:Tensile a owl:Class ; + rdfs:label "Tensile" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing countervailing forces applied outward along the central axis of a material." . + +nanomine:TensileCreepCompliance a owl:Class ; + rdfs:label "Tensile Creep Compliance" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileCreep ; + skos:definition "Inverse of tensile creep modulus " . + +nanomine:TensileCreepModulus a owl:Class ; + rdfs:label "Tensile Creep Modulus" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileCreep ; + skos:definition "Elastic modulus during creep test" . + +nanomine:TensileCreepRecovery a owl:Class ; + rdfs:label "Tensile Creep Recovery" ; + rdfs:subClassOf nanomine:TensileCreep ; + skos:definition "Ability of material to recover to original state after creep" . + +nanomine:TensileCreepRuptureStrength a owl:Class ; + rdfs:label "Tensile Creep Rupture Strength" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileCreep ; + skos:definition "Material strength at rupture during a tensile creep test" . + +nanomine:TensileCreepRuptureTime a owl:Class ; + rdfs:label "Tensile Creep Rupture Time" ; + rdfs:subClassOf nanomine:TensileCreep ; + skos:definition "Time taken to rupture from applying load during a tensile creep test" . + +nanomine:TensileCreepStrain a owl:Class ; + rdfs:label "Tensile Creep Strain" ; + rdfs:subClassOf nanomine:TensileCreep ; + skos:definition "Profile of strain as a function of time during a tensile creep test" . + +nanomine:TensileLoadingProfile a owl:Class ; + rdfs:label "Tensile Loading Profile" ; + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "Stress vs. strain curve of during tensile loading and/or unloading test" . + +nanomine:TensileModulus a owl:Class ; + rdfs:label "Tensile Modulus" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Young's modulus, or elastic modulus, describes tensile elasticity, or the tendency of an object to deform along an axis when opposing forces are applied along that axis; it is defined as the ratio of tensile stress to tensile strain." . + +nanomine:TensileStrength a owl:Class ; + rdfs:label "Tensile Strength" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "The maximum engineering stress experienced by a test specimen during a tensile test, at which point the material begins to fail catastrophically." . + +nanomine:TensileStressAtBreak a owl:Class ; + rdfs:label "Tensile Stress At Break" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile stress at the moment at which a test specimen tears" . + +nanomine:TensileStressAtYield a owl:Class ; + rdfs:label "Tensile Stress At Yield" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:TensileProperty ; + skos:definition "Tensile stress corresponding to the yield point (an increase in strain does not result in an increase in stress)." . + +nanomine:TensileToughness a owl:Class ; + rdfs:label "Tensile Toughness" ; + rdfs:subClassOf nanomine:TensileProperty ; + skos:definition "The amount of energy a material can absorb prior to fracture under an applied tensile load." . + +nanomine:ThermalConductivity a owl:Class ; + rdfs:label "Thermal Conductivity" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "a measure of the ability of a substance to conduct heat, determined by the rate of heat flownormally through an area in the substance divided by the area and by minus the component of the temperaturegradient in the direction of flow" . + +nanomine:ThermalDecompositionTemperature a owl:Class ; + rdfs:label "Thermal Decomposition Temperature" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty, + ; + skos:definition "Thermal decomposition temperature of a substance is the temperature at which the substance chemically decomposes by heat" . + +nanomine:ThermalDiffusivity a owl:Class ; + rdfs:label "Thermal Diffusivity" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ThermalProperty ; + skos:definition "thermal diffusivity is the thermal conductivity divided by density and specific heat capacity at constant pressure. It measures the rate of transfer of heat of a material from the hot side to the cold side" . + +nanomine:ThermogravimetricAnalysis a owl:Class ; + rdfs:label "Thermogravimetric Analysis" ; + nanomine:hasSelector "//Thermogravimetric_Analysis" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ThermalProperty ], + sio:Measuring ; + skos:definition "Thermal analysis of material properties as function of temperature and time" . + +nanomine:Thermoplastic a owl:Class ; + rdfs:label "Thermoplastic" ; + rdfs:subClassOf nanomine:Plastic ; + skos:definition "a plastic material, a polymer, that becomes pliable or moldable above a specific temperature and solidifies upon cooling." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermoplastic" . + +nanomine:Thermoset a owl:Class ; + rdfs:label "Thermoset" ; + rdfs:subClassOf nanomine:Plastic ; + skos:definition "a cured thermosetting resin. A thermosetting resin is a prepolymer in a soft solid or viscous liquid state that changes irreversibly into an infusible, insoluble polymer network by curing." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermosetting_polymer" . + +nanomine:Torsion a owl:Class ; + rdfs:label "Torsion" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "Describing countervailing rotational forces about the central axis of a material, separated by some distance along the central axis of the material; \"twisting\" force" . + +nanomine:Total a owl:Class ; + rdfs:label "Total" ; + rdfs:subClassOf sio:Quantity . + +nanomine:TradeName a owl:Class ; + rdfs:label "Trade Name" ; + rdfs:subClassOf sio:Name ; + skos:definition "The common, non-chemical name for a chemical substance." . + +nanomine:TransmissionElectronMicroscopy a owl:Class ; + rdfs:label "Transmission Electron Microscopy" ; + nanomine:hasSelector "//Transmission_Electron_Microscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:AcceleratingVoltage ], + [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ElectricalProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:WorkingDistance ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:EmissionCurrent ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:ExposureTime ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:Magnification ], + sio:Measuring ; + skos:definition "Transmission electron microscopy for obtaining microstructure at nanoscale" . + +nanomine:TwinScrew a owl:Class ; + rdfs:label "Twin Screw Extruder" ; + rdfs:subClassOf nanomine:Extruder . + +nanomine:Ultra-sonication a owl:Class ; + rdfs:label "Ultra Sonication" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + nanomine:Mixing ; + skos:definition "The irradiation of a liquid sample with ultrasonic (>20 kHz) waves resulting in agitation" . + +nanomine:Vacuum a owl:Class ; + rdfs:label "Vacuum" ; + rdfs:subClassOf nanomine:AmbientCondition . + +nanomine:VacuumMolding a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf nanomine:Molding . + +nanomine:Viscosity a owl:Class ; + rdfs:label "Viscosity" ; + rdfs:subClassOf ; + skos:definition "a measure of its resistance to gradual deformation by shear stress or tensile stress." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Viscosity" . + +nanomine:VolumeExpansionCoefficient a owl:Class ; + rdfs:label "Volume Expansion Coefficient" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:VolumetricProperty ; + skos:definition "volumetric coefficient of thermal expansion" . + +nanomine:VolumeFraction a owl:Class ; + rdfs:label "Volume Fraction" ; + rdfs:subClassOf sio:Concentration ; + skos:definition "The volume of a constituent divided by the volume of all constituents of the mixture prior to mixing." . + +nanomine:VolumeResistivity a owl:Class ; + rdfs:label "Volume Resistivity" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "Ability to oppose the flow of electric current." . + +nanomine:WaterAbsorption a owl:Class ; + rdfs:label "Water Absorption" ; + rdfs:subClassOf nanomine:VolumetricProperty ; + skos:definition "The amount of weight gain (%) experienced in a polymer after immersion in water for a specific length of time under controlled environment." . + +nanomine:WeibullPlot a owl:Class ; + rdfs:label "Weilbull Plot" ; + rdfs:subClassOf nanomine:DielectricBreakdownStrength ; + skos:definition "A plot of failure probability versus electric field, typically with the probability y-axis scaled according to the Weibull distribution as ln(-ln(1-p))." . + +nanomine:WeightLoss a owl:Class ; + rdfs:label "Weight Loss" ; + rdfs:subClassOf nanomine:VolumetricProperty ; + skos:definition "The loss of mass of a material under some condition (e.g., increasing temperature during thermogravimetric analysis)" . + +nanomine:XRayDiffractionAndScattering a owl:Class ; + rdfs:label "XRay Diffraction and Scattering" ; + nanomine:hasSelector "//XRay_Diffraction_and_Scattering" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring ; + skos:definition "Non-destructive X-ray measurement for crystal structure, chemical composition, and physical properties" . + +nanomine:XRayPhotoelectronSpectroscopy a owl:Class ; + rdfs:label "X-Ray Photoelectron Spectroscopy" ; + nanomine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:Spectroscopy ], + sio:Measuring . + +nanomine:XRay_Photoelectron_Spectroscopy a owl:Class ; + rdfs:label "nan" ; + nanomine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; + rdfs:subClassOf sio:Measuring ; + skos:definition "XRay_Photoelectron_Spectroscopy (abbr. XPS) is a spectroscopy for material characterization;" . + +nanomine:sampleShape a owl:Class ; + rdfs:label "Sample Shape" ; + skos:definition "The geometric form of a test specimen." . + +nanomine:uSMILES a owl:Class ; + rdfs:label "uSMILES" ; + rdfs:subClassOf sio:Representation . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Centimeter" ; + skos:notation "J/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Celsius" ; + skos:notation "J/gC" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilojoule per Square Meter" ; + skos:notation "kJ/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Centimeter" ; + skos:notation "kV/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Log Hertz" ; + skos:notation "log(Hz)" . + + a sio:UnitOfMeasurement ; + rdfs:label "Square Millimeter per Second" ; + skos:notation "mm^2/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Millimeters per millimeter" ; + skos:notation "mm/mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Centimeter" ; + skos:notation "Ω cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Parts per million per degree centigrade" ; + skos:notation "ppm/C" . + + a sio:UnitOfMeasurement ; + rdfs:label "Rotation per Minute" ; + skos:notation "rpm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Megavolt per Meter" ; + skos:notation "MV/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Radian per Minute" ; + skos:notation "rad/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Centimeter" ; + skos:notation "S/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Volt per Centimeter" ; + skos:notation "V/cm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kelvin per Minute" ; + skos:notation "K/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "per Kelvin" ; + skos:notation "1/K" . + +sio:AspectRatio a owl:Class ; + rdfs:label "Aspect Ratio" ; + rdfs:subClassOf sio:Ratio ; + skos:definition "The aspect ratio of a geometric shape is the ratio of its sizes in different dimensions." . + +sio:Chapter a owl:Class ; + rdfs:label "Chapter" . + +sio:Citation a owl:Class ; + rdfs:label "Citation Type" . + +sio:Day a sio:UnitOfMeasurement ; + rdfs:label "Day" ; + skos:notation "dy" . + +sio:Description a owl:Class ; + rdfs:label "Description" ; + nanomine:hasSelector "//Description" ; + rdfs:subClassOf sio:LanguageEntity . + +sio:Hour a sio:UnitOfMeasurement ; + rdfs:label "Hour" ; + skos:notation "Hr" . + +sio:Publication a owl:Class ; + rdfs:label "Publication" . + +sio:Rotation a owl:Class ; + rdfs:label "Rotation" ; + rdfs:subClassOf sio:Quantity . + +sio:Week a sio:UnitOfMeasurement ; + rdfs:label "Week" ; + skos:notation "wk" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ampere per Square Meter" ; + skos:notation "A/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "Celsius per Minute" ; + skos:notation "C/min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Gram per Cubic Centimeter" ; + skos:notation "g/cm^3" . + + a nanomine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Kelvin" ; + skos:notation "K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kiloelectronvolt" ; + skos:notation "keV" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Liter" ; + skos:notation "kg/L" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilohertz" ; + skos:notation "kHz" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilopascal" ; + skos:notation "kPa" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt" ; + skos:notation "kV" . + + a sio:UnitOfMeasurement ; + rdfs:label "Micrometer" ; + skos:notation "µm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Millimeter" ; + skos:notation "mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Minute" ; + skos:notation "min" . + + a sio:UnitOfMeasurement ; + rdfs:label "Mole per Cubic Meter" ; + skos:notation "mol/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Pascal" ; + skos:notation "Pa" . + + a sio:UnitOfMeasurement ; + rdfs:label "Radian per Second" ; + skos:notation "rad/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Second" ; + skos:notation "s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Square Meter per Gram" ; + skos:notation "m^2/g" . + + a sio:UnitOfMeasurement ; + rdfs:label "nan" . + +nanomine:Amperage a owl:Class ; + rdfs:label "Amperage" ; + rdfs:subClassOf sio:Quantity . + +nanomine:CapillarySize a owl:Class ; + rdfs:label "Capillar Size" ; + nanomine:hasSelector "//CapillarySize" ; + rdfs:subClassOf sio:Parameter . + +nanomine:ChannelDepth a owl:Class ; + rdfs:label "Channel Depth" ; + rdfs:subClassOf sio:Depth . + +nanomine:ChannelsPerScrew a owl:Class ; + rdfs:label "Channels per Screw" ; + rdfs:subClassOf sio:Quantity . + +nanomine:ChemicalName a owl:Class ; + rdfs:label "Chemical Name" ; + rdfs:subClassOf sio:Name . + +nanomine:CoolingRate a owl:Class ; + rdfs:label "Cooling Rate" ; + nanomine:hasSelector "//CoolingRate" ; + rdfs:subClassOf sio:Parameter . + +nanomine:DLRatio a owl:Class ; + rdfs:label "Screw Diameter/Length Ratio" ; + rdfs:subClassOf sio:Ratio . + +nanomine:DMA_Mode a owl:Class ; + rdfs:label "Dynamic Mechanical Analysis" ; + rdfs:subClassOf nanomine:DynamicProperties, + ; + skos:definition "The type of condition (e.g., temperature sweep or frequency sweep) under which a material's dynamic mechanical response is measured." . + +nanomine:DielectricBreakdownStrength a owl:Class ; + rdfs:label "Dielectric Breakdown Strength" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + nanomine:ElectricalProperty ; + skos:definition "Maximum voltage required to produce a dielectric breakdown through the material and is expressed as Volts per unit thickness." . + +nanomine:ExtrusionTemperature a owl:Class ; + rdfs:label "Extrusion Temperature" ; + rdfs:subClassOf . + +nanomine:FillerComponent a owl:Class ; + rdfs:label "Filler Component" ; + rdfs:subClassOf nanomine:Component . + +nanomine:FlightClearance a owl:Class ; + rdfs:label "Flight Clearance" ; + rdfs:subClassOf sio:Height ; + skos:altLabel "Radial Flight Clearance" . + +nanomine:FlightWidth a owl:Class ; + rdfs:label "Flight Width" ; + rdfs:subClassOf sio:Width . + +nanomine:HeatingRate a owl:Class ; + rdfs:label "Heating Rate" ; + nanomine:hasSelector "//HeatingRate" ; + rdfs:subClassOf sio:Parameter . + +nanomine:Impact a owl:Class ; + rdfs:label "Impact" ; + rdfs:subClassOf nanomine:FractureToughnessProperty ; + skos:definition "Izod impact resistance of materials" . + +nanomine:InnerBarrelDiameter a owl:Class ; + rdfs:label "Inner Barrel Diameter" ; + rdfs:subClassOf . + +nanomine:MeltTemperature a owl:Class ; + rdfs:label "Melt Temperature" ; + rdfs:subClassOf . + +nanomine:Nanocomposite a owl:Class ; + rdfs:label "Nanocomposite" ; + rdfs:subClassOf nanomine:Nanomaterial ; + skos:definition "a multiphase solid material where one of the phases has one, two or three dimensions of less than 100 nanometers (nm), or structures having nano-scale repeat distances between the different phases that make up the material. In the broadest sense this definition can include porous media, colloids, gels and copolymers, but is more usually taken to mean the solid combination of a bulk matrix and nano-dimensional phase(s) differing in properties due to dissimilarities in structure and chemistry." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanocomposite" . + +nanomine:PressureAtDie a owl:Class ; + rdfs:label "Pressure at Die" ; + rdfs:subClassOf . + +nanomine:ProcessingCondition a owl:Class ; + rdfs:label "Processing Condition" ; + rdfs:subClassOf sio:Quality . + +nanomine:ResidenceTime a owl:Class ; + rdfs:label "Residence Time" ; + rdfs:subClassOf sio:TimeInterval . + +nanomine:RotationalFrequency a owl:Class ; + rdfs:label "Rotational Frequency" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:hasValue ; + owl:onProperty sio:hasUnit ], + sio:Frequency ; + skos:definition """The number of rotations of an object around an axis per unit time. +""" . + +nanomine:ScrewChannelWidth a owl:Class ; + rdfs:label "Screw Channel Width" ; + rdfs:subClassOf sio:Width . + +nanomine:ScrewDiameter a owl:Class ; + rdfs:label "Screw Diameter" ; + rdfs:subClassOf . + +nanomine:ScrewLead a owl:Class ; + rdfs:label "Screw Lead" ; + rdfs:subClassOf sio:Length . + +nanomine:ScrewLength a owl:Class ; + rdfs:label "Screw Length" ; + rdfs:subClassOf sio:Length . + +nanomine:Strain a owl:Class ; + rdfs:label "Strain" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Engineering strain is defined as the amount of deformation in the direction of the applied force divided by the initial length of the material." . + +nanomine:Throughput a owl:Class ; + rdfs:label "Throughput" ; + rdfs:subClassOf sio:Quantity . + +nanomine:Torque a owl:Class ; + rdfs:label "Torque" ; + rdfs:subClassOf . + +nanomine:Voltage a owl:Class ; + rdfs:label "Voltage" ; + rdfs:subClassOf sio:Quantity . + + a sio:UnitOfMeasurement ; + rdfs:label "1/Pa" . + + a sio:UnitOfMeasurement ; + rdfs:label "C/m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "J/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "kg/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilovolt per Millimeter" ; + skos:notation "kV/mm" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^2" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^2/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "m^3/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "m/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "nanomine:revolutions_per_minute" . + + a sio:UnitOfMeasurement ; + rdfs:label "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "S/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "V/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "W/(m*K)" . + +bibo: rdfs:label "BIBO" . + + rdfs:label "SIO" . + +sio:Depth a owl:Class ; + rdfs:label "Depth" ; + rdfs:subClassOf nanomine:Dimension, + . + +sio:Frequency a owl:Class ; + rdfs:label "Frequency" ; + nanomine:hasPreferredUnit ; + rdfs:subClassOf sio:RateOfChange ; + skos:definition "The rate of occurrence of some periodic event." . + +sio:SurfaceArea a owl:Class ; + rdfs:label "Surface Area" ; + rdfs:subClassOf sio:Area . + + rdfs:label "Nanopub" . + + a nanomine:AbsoluteUnitOfMeasurement, + sio:UnitOfMeasurement ; + rdfs:label "Hertz" ; + skos:notation "Hz" . + + a sio:UnitOfMeasurement ; + rdfs:label "Kilogram per Cubic Meter" ; + skos:notation "kg/m^3" . + + a sio:UnitOfMeasurement ; + rdfs:label "Nanometer" ; + skos:notation "nm" . + + a sio:UnitOfMeasurement ; + rdfs:label "Siemens per Meter" ; + skos:notation "S/m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Watt per Meter-Kelvin" ; + skos:notation "W/mK" . + +nanomine:AcceleratingVoltage a owl:Class ; + rdfs:label "Accelerating Voltage" ; + nanomine:hasSelector "//AcceleratingVoltage" ; + rdfs:subClassOf sio:Parameter . + +nanomine:EmissionCurrent a owl:Class ; + rdfs:label "Emission Current" ; + nanomine:hasSelector "//EmissionCurrent" ; + rdfs:subClassOf sio:Parameter . + +nanomine:ExposureTime a owl:Class ; + rdfs:label "Exposure Time" ; + nanomine:hasSelector "//ExposureTime" ; + rdfs:subClassOf sio:Parameter . + +nanomine:Magnification a owl:Class ; + rdfs:label "Magnification" ; + nanomine:hasSelector "//Magnification" ; + rdfs:subClassOf sio:Parameter . + +nanomine:Nanomaterial a owl:Class ; + rdfs:label "Nanomaterial" ; + rdfs:subClassOf sio:MaterialEntity ; + skos:definition "materials of which a single unit is sized (in at least one dimension) between 1 and 1000 nanometres (10−9 meter) but is usually 1—100 nm" ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanomaterials" . + +nanomine:RheologicalProperty a owl:Class ; + rdfs:label "Rheological Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A property related to the flow of a material." . + +nanomine:RotationMode a owl:Class ; + rdfs:label "Rotation Mode" ; + rdfs:subClassOf sio:Quality . + +nanomine:WorkingDistance a owl:Class ; + rdfs:label "Working Distance" ; + nanomine:hasSelector "//WorkingDistance" ; + rdfs:subClassOf sio:Parameter . + + a sio:UnitOfMeasurement ; + rdfs:label "1/s", + "Per Second" ; + skos:notation "1/s" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram-Kelvin" ; + skos:notation "J/gK" . + + a sio:UnitOfMeasurement ; + rdfs:label "J/K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm*m" . + + a sio:UnitOfMeasurement ; + rdfs:label "Joule per Gram" ; + skos:notation "J/gm" . + +sio:Width a owl:Class ; + rdfs:label "Width" ; + rdfs:subClassOf nanomine:Dimension . + + a sio:UnitOfMeasurement ; + rdfs:label "Ohm Meter" ; + skos:notation "Ω m" . + +nanomine:CompressiveCreep a owl:Class ; + rdfs:label "Compressive Creep" ; + rdfs:subClassOf nanomine:Creep ; + skos:definition "creep during compressive test" . + +nanomine:Condition a owl:Class ; + rdfs:label "Condition" ; + rdfs:subClassOf nanomine:CompressionProperty ; + skos:definition "Description of the material's environment (e.g., during characterization)", + "see Condition" . + +nanomine:Creep a owl:Class ; + rdfs:label "Creep" ; + rdfs:subClassOf nanomine:ViscoelasticProperty ; + skos:definition "creep is the tendency of material to move slowly or deform permanently under the influence of mechanical stresses" . + +nanomine:Extruder a owl:Class ; + rdfs:label "Extruder" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:FlightClearance ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Throughput ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:DLRatio ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ExtrusionTemperature ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:FlightWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Torque ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:InnerBarrelDiameter ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewDiameter ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Amperage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Dimension ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ResidenceTime ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:Voltage ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewLead ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewChannelWidth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ChannelsPerScrew ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:PressureAtDie ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ScrewLength ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:ChannelDepth ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:MeltTemperature ], + sio:Device . + +nanomine:FlexuralCreep a owl:Class ; + rdfs:label "Flexural Creep" ; + rdfs:subClassOf nanomine:Creep ; + skos:definition "creep during flexural or bending test" . + +nanomine:HardnessProperty a owl:Class ; + rdfs:label "Hardness Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "Materials property representing the material's resistance to deformation under an applied compressive load from a test fixture of known tip geometry." . + +nanomine:Plastic a owl:Class ; + rdfs:label "Plastic" ; + rdfs:subClassOf sio:Polymer ; + skos:definition "a material consisting of any of a wide range of synthetic or semi-synthetic organic compounds that are malleable and can be molded into solid objects. Plastics are typically organic polymers of high molecular mass, but they often contain other substances." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Plastic" . + +nanomine:RheologicalViscosity a owl:Class ; + rdfs:label "Rheological Viscosity" ; + rdfs:subClassOf nanomine:RheologicalProperty ; + skos:definition "The resistance of a fluid to flow." . + +nanomine:Rheometery a owl:Class ; + rdfs:label "Rheometry" ; + nanomine:hasSelector "//Rheometery" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty prov:generated ; + owl:someValuesFrom nanomine:ViscoelasticProperty ], + [ a owl:Restriction ; + owl:onProperty prov:used ; + owl:someValuesFrom nanomine:CapillarySize ], + sio:Measuring ; + skos:definition "Measurement of the quantitative and qualitative relationships between deformations and stresses and their derivatives" . + +nanomine:Solvent a owl:Class ; + rdfs:label "Solvent" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:Quantity ], + sio:ChemicalEntity ; + skos:definition "Solvent used in composite synthesis" . + + a sio:UnitOfMeasurement ; + rdfs:label "m" . + + a sio:UnitOfMeasurement ; + rdfs:label "s" . + +sio:Length a owl:Class ; + rdfs:label "Length" ; + rdfs:subClassOf nanomine:Dimension, + . + +sio:Ratio a owl:Class ; + rdfs:label "Fraction" ; + rdfs:subClassOf sio:DimensionlessQuantity . + + a sio:UnitOfMeasurement ; + rdfs:label "Percent" ; + skos:notation "%" . + +nanomine:FractureToughnessProperty a owl:Class ; + rdfs:label "Fracture Toughness Property" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Ability of material containing a crack to resist fracture" . + +nanomine:ShearProperty a owl:Class ; + rdfs:label "Shear Property" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in shear" . + +nanomine:Tacticity a owl:Class ; + rdfs:label "Tacticity" ; + rdfs:subClassOf sio:ChemicalQuality ; + skos:definition "the relative stereochemistry of adjacent chiral centers within a macromolecule." ; + prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity" . + + a sio:UnitOfMeasurement ; + rdfs:label "N" . + +sio:Polymer a owl:Class ; + rdfs:label "Polymer" ; + rdfs:subClassOf sio:Molecule . + + a owl:Class ; + rdfs:label "Diameter" ; + rdfs:subClassOf nanomine:Dimension, + . + +nanomine:Crystallinity a owl:Class ; + rdfs:label "Crystallinity" ; + rdfs:subClassOf nanomine:ThermalProperty ; + skos:definition "degree of structural order in a solid" . + +nanomine:FlexuralProperty a owl:Class ; + rdfs:label "Flexural Property" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in bending" . + +nanomine:Molding a owl:Class ; + rdfs:label "Molding" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:AmbientCondition ], + sio:Procedure ; + skos:definition "Methods to shape final composite" . + +nanomine:RheologicalComplexModulus a owl:Class ; + rdfs:label "Rheological Complex Modulus" ; + rdfs:subClassOf nanomine:RheologicalProperty ; + skos:definition "The ratio of shear-stress amplitude to strain amplitude of a material under oscillating shear stress." . + +nanomine:Spectroscopy a owl:Class ; + rdfs:label "Spectroscopy" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "The chemical composition ,composition variation ,crystal structure & photo-electric properties of the materials." . + + a sio:UnitOfMeasurement ; + rdfs:label "J" . + + a sio:UnitOfMeasurement ; + rdfs:label "K" . + + a sio:UnitOfMeasurement ; + rdfs:label "Celsius" ; + skos:notation "C" . + + a sio:UnitOfMeasurement ; + rdfs:label "Gigapascal" ; + skos:notation "GPa" . + +nanomine:CompressionProperty a owl:Class ; + rdfs:label "Compression Property" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in compression" . + +nanomine:Dimension a owl:Class ; + rdfs:label "Dimension" ; + rdfs:subClassOf sio:DimensionalQuantity . + +nanomine:TensileCreep a owl:Class ; + rdfs:label "Tensile Creep" ; + rdfs:subClassOf nanomine:Creep ; + skos:definition "creep during tensile test" . + + a owl:Class ; + rdfs:label "Pressure" ; + rdfs:subClassOf . + +nanomine:AmbientCondition a owl:Class ; + rdfs:label "Ambient Condition" ; + rdfs:subClassOf nanomine:ProcessingCondition ; + skos:definition "Ambient conditions" . + +nanomine:Mixing a owl:Class ; + rdfs:label "Mixing" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom nanomine:RotationalFrequency ], + sio:Procedure ; + skos:definition "Processes for mixing of multiple substances" . + +sio:TimeInterval a owl:Class ; + rdfs:label "Time" ; + rdfs:subClassOf sio:TimeMeasurement . + +nanomine:Additive a owl:Class ; + rdfs:label "Additive" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:Quantity ], + sio:ChemicalEntity, + sio:ChemicalSubstance ; + skos:definition "A chemical substance that is blended in to a polymer to acheive a desired effect.", + "Additive used in composite synthesis" . + +nanomine:VolumetricProperty a owl:Class ; + rdfs:label "Volumetric Property" ; + rdfs:subClassOf ; + skos:definition "A property related to the three-dimensional volume of a material." . + + a sio:UnitOfMeasurement ; + rdfs:label "Megapascal" ; + skos:notation "MPa" . + +nanomine:TensileProperty a owl:Class ; + rdfs:label "Tensile Property" ; + rdfs:subClassOf nanomine:MechanicalProperty ; + skos:definition "Properties of how the material will react to forces being applied in tension." . + +nanomine:MechanicalProperty a owl:Class ; + rdfs:label "Mechanical Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A materials property related to the response of a material under some external applied load." . + +nanomine:ViscoelasticProperty a owl:Class ; + rdfs:label "Viscoelastic Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "Properties of materials that exhibit both viscous and elastic behaviors" . + + a owl:Class ; + rdfs:label "Temperature" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "The average kinetic energy of all constituents within a materials system" . + +nanomine:ThermalProperty a owl:Class ; + rdfs:label "Thermal Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A material's property describing the materials ability to absorb, conduct, or otherwise interact with energy in the form of heat." . + + a sio:UnitOfMeasurement ; + rdfs:label "Pa" . + +sio:Procedure a owl:Class ; + rdfs:label "nan" ; + rdfs:subClassOf [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Solvent ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom ], + [ a owl:Restriction ; + owl:onProperty sio:hasInput ; + owl:someValuesFrom nanomine:Additive ], + [ a owl:Restriction ; + owl:onProperty sio:hasAttribute ; + owl:someValuesFrom sio:TimeInterval ], + sio:Process . + +sio:Quantity a owl:Class ; + rdfs:label "Amount" ; + rdfs:subClassOf sio:MeasurementValue . + +nanomine:ElectricalProperty a owl:Class ; + rdfs:label "Electrical Property" ; + rdfs:subClassOf sio:Quantity ; + skos:definition "A materials property describing the material's behavior under some applied electrical field." . + +sio:UnitOfMeasurement a owl:Class ; + rdfs:label "unit of measurement" ; + rdfs:subClassOf sio:Quantity . + diff --git a/whyis/materialsmine/setl/ontology.setl.ttl b/whyis/materialsmine/setl/ontology.setl.ttl new file mode 100644 index 00000000..71854fed --- /dev/null +++ b/whyis/materialsmine/setl/ontology.setl.ttl @@ -0,0 +1,389 @@ +@prefix rdf: . +@prefix rdfs: . +@prefix xsd: . +@prefix owl: . +@prefix skos: . +@prefix prov: . +@prefix sio: . +@prefix dcat: . +@prefix dcterms: . +@prefix void: . +@prefix foaf: . +@prefix ov: . +@prefix setl: . +@prefix csvw: . +@prefix pv: . +@prefix bibo: . + +@prefix : . + + +:imports_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:ontology_annotations_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:publication_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:property_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + + :processing_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:material_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:characterization_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + + +:units_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:ontology a setl:SemanticETLScript; + rdfs:label "Nanomine Ontology SETL Script". + + +:nanomine_ontology a void:Dataset; + prov:wasGeneratedBy :ontology, [ + a setl:Transform, setl:JSLDT; + prov:used :imports_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "bibo" : "http://purl.org/ontology/bibo/", + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "http://nanomine.org/ns", + "owl:imports": {"@id": "{{row.uri}}", "rdfs:label": "{{row.label}}"} + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :ontology_annotations_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "dcterms" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "http://nanomine.org/ns", + "@type" : "owl:Ontology", + "{{row.annotation}}": [ + { "@if" : "not isempty(row.URI)", "@id" : "{{row.URI}}"}, + { "@if" : "isempty(row.URI)", "@value" : "{{row.value}}"} + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :publication_classes_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "bibo" : "http://purl.org/ontology/bibo/", + + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :property_classes_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "nanomine:hasPreferredUnit" : [ { "@if" : "not isempty(row.preferredUnit)", "@id" : "{{row.preferredUnit}}"} ], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "nanomine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :processing_classes_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "nanomine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + }, + { "@if" : "not isempty(row.hasInput)", + "@for" : "input in row.hasInput.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasInput"}, + "owl:someValuesFrom" : { "@id": "{{input}}" } + } + }, + { "@if" : "not isempty(row.hasAttribute)", + "@for" : "attr in row.hasAttribute.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasAttribute"}, + "owl:someValuesFrom" : { "@id": "{{attr}}" } + } + }, + { "@if" : "not isempty(row.duration)", + "@for" : "attr in row.duration.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasAttribute"}, + "owl:someValuesFrom" : { "@id": "{{attr}}" } + } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :material_classes_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.unit)", + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"sio:hasUnit"}, + "owl:hasValue" : { "@id": "nanomine:unit/{{slugify(row.unit)}}", "rdfs:label" : "{{row.unit}}", "@type" : "sio:UnitOfMeasurement" } + } + ] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :units_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "bibo" : "http://purl.org/ontology/bibo/", + "nanomine" : "http://nanomine.org/ns/" + }'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@graph": [{ + "@id": "{{row.uri}}", + "@type" : [ + "sio:UnitOfMeasurement", + {"@if" : "row.absolute == 'y'", "@id" : "nanomine:AbsoluteUnitOfMeasurement"} + ], + "rdfs:label" : "{{row.label}}", + "skos:notation" : [ { "@if" : "not isempty(row.notation)", "@value": "{{row.notation}}" }], + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }] + }] +}]'''], [ + a setl:Transform, setl:JSLDT; + prov:used :characterization_classes_table; + setl:hasContext '''{ + "@vocab" : "http://nanomine.org/", + "sio" : "http://semanticscience.org/resource/", + "chear" : "http://hadatac.org/ont/chear#", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "prov" : "http://www.w3.org/ns/prov#", + "dc" : "http://purl.org/dc/terms/", + "cmo" : "http://purl.org/twc/ontologies/cmo.owl#", + "owl": "http://www.w3.org/2002/07/owl#", + "rdfs": "http://www.w3.org/2000/01/rdf-schema#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "nanomine" : "http://nanomine.org/ns/" +}'''; + prov:value '''[{ + "@id": "http://nanomine.org/ns", + "@context": "https://raw.githubusercontent.com/jimmccusker/ontext/master/owl-context.jsonld", + "@graph": [ + { + "@id": "{{row.uri}}", + "@type" : "owl:Class", + "rdfs:label" : "{{row.label}}", + "skos:altLabel" : [ { "@if" : "not isempty(row.altLabel)", "@value": "{{row.altLabel}}" }], + "skos:definition" : [ { "@if" : "not isempty(row.definition)", "@value": "{{row.definition}}" }], + "prov:wasQuotedFrom" : [ { "@if" : "not isempty(row.wasQuotedFrom)", "@value": "{{row.wasQuotedFrom}}" }], + "nanomine:hasSelector" : [ { "@if" : "not isempty(row.xpath)", "@value": "{{row.xpath}}" }], + "rdfs:subClassOf" : [ + { "@if" : "not isempty(row.subClassOf)", + "@for" : "superClass in row.subClassOf.split(', ')", + "@do" : { "@id": "{{superClass}}" } + }, + { "@if" : "not isempty(row.generates)", + "@for" : "generate_type in row.generates.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"prov:generated"}, + "owl:someValuesFrom" : { "@id": "{{generate_type}}" } + } + }, + { "@if" : "not isempty(row.parameters)", + "@for" : "parameter in row.parameters.split(', ')", + "@do" : { + "@type" : "owl:Restriction", + "owl:onProperty" : { "@id":"prov:used"}, + "owl:someValuesFrom" : { "@id": "{{parameter}}" } + } + } + ] + } + ] +}]''']. + + +# a pv:File; +# dcterms:format "application/trig"; +# prov:wasGeneratedBy [ +# a setl:Load; +# prov:used ; +# ]. + + a pv:File; + dcterms:format "text/turtle"; + prov:wasGeneratedBy [ + a setl:Load; + prov:used :nanomine_ontology ; + ]. diff --git a/whyis/materialsmine/setl/xml_ingest.setl.ttl b/whyis/materialsmine/setl/xml_ingest.setl.ttl new file mode 100644 index 00000000..f7748909 --- /dev/null +++ b/whyis/materialsmine/setl/xml_ingest.setl.ttl @@ -0,0 +1,1363 @@ +@prefix rdf: . +@prefix rdfs: . +@prefix xsd: . +@prefix owl: . +@prefix skos: . +@prefix prov: . +@prefix sio: . +@prefix dcat: . +@prefix dcterms: . +@prefix void: . +@prefix foaf: . +@prefix ov: . +@prefix setl: . +@prefix csvw: . +@prefix pv: . +@prefix sp: . +@prefix dc: . +@prefix api_vocab: . + +@prefix : . + +@prefix nanopub: . + +:property_classes_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:characterization_methods_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:materials_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:processing_methods_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:microstructure_descriptors_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:units_table a csvw:Table, setl:Table; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used ; + ]. + +:units a owl:Class, prov:SoftwareAgent, setl:PythonScript; + rdfs:subClassOf prov:Activity; + prov:qualifiedDerivation [ a prov:Usage; prov:entity :units_table; prov:hadRole [ dcterms:identifier "units"]]; + prov:value ''' +result = units.set_index(units.code) +'''. + +:reverse a owl:Class, prov:SoftwareAgent, setl:PythonScript; + rdfs:subClassOf prov:Activity; + prov:value ''' +def result(l): + l.reverse() + return l +'''. + +:xml a setl:XML; + prov:wasGeneratedBy [ + a setl:Extract; + prov:used [ a ]; + ]. + + +:MaterialsmineXMLImport rdfs:subClassOf setl:SemanticETLScript; + rdfs:label "Materialsmine XML Import SETL Script"; + setl:hasTemplatePrefix "http://materialsmine.org/setl/xml/"; + rdfs:subClassOf [ a owl:Restriction; + owl:onProperty prov:used; + owl:someValuesFrom + ]. + +:get_uuid a owl:Class, prov:SoftwareAgent, setl:PythonScript; + rdfs:subClassOf prov:Activity; + prov:value ''' +def result(): + from uuid import uuid4 + return uuid4().hex +'''. + +:nanopubs a void:Dataset, dcat:Dataset; + prov:wasGeneratedBy [a :MaterialsmineXMLImport], [ + a setl:Transform, setl:JSLDT; + prov:used :xml; + prov:qualifiedUsage [ a prov:Usage; prov:entity :property_classes_table; prov:hadRole [ dcterms:identifier "properties"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :characterization_methods_table; prov:hadRole [ dcterms:identifier "methods"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :processing_methods_table; prov:hadRole [dcterms:identifier "processing"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :materials_table; prov:hadRole [dcterms:identifier "materials"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :units; prov:hadRole [ dcterms:identifier "units"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :reverse; prov:hadRole [ dcterms:identifier "reverse"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :microstructure_descriptors_table; prov:hadRole [ dcterms:identifier "microstructures"]]; + prov:qualifiedUsage [ a prov:Usage; prov:entity :get_uuid; prov:hadRole [ dcterms:identifier "get_uuid"]]; + setl:hasContext """{ + "owl" : "http://www.w3.org/2002/07/owl#", + "sio" : "http://semanticscience.org/resource/", + "skos" : "http://www.w3.org/2004/02/skos/core#", + "dcterms" : "http://purl.org/dc/terms/", + "prov" : "http://www.w3.org/ns/prov#", + "rdfs" : "http://www.w3.org/2000/01/rdf-schema#", + "doi" : "http://dx.doi.org/", + "nanomine": "http://nanomine.org/ns/", + "materialsmine" : "http://materialsmine.org/ns/", + "unit" : "http://materialsmine.org/ns/unit/", + "author" : "http://materialsmine.org/author/", + "publication" : "http://materialsmine.org/publication/", + "bibo" : "http://purl.org/ontology/bibo/", + "authorList" : {"@id" : "bibo:authorList", "@container": "@list"}, + "foaf" : "http://xmlns.com/foaf/0.1/", + "nanopub" : "http://www.nanopub.org/nschema#", + "entry" : "http://materialsmine.org/entry/", + "materialsminenp" : "http://materialsmine.org/nanpub/", + "sample" : "http://materialsmine.org/sample/", + "article" : "http://materialsmine.org/article/", + "compound" : "http://materialsmine.org/compound/", + "location" : "http://materialsmine.org/location/", + "lang" : "http://materialsmine.org/language/", + "void" : "http://rdfs.org/ns/void#", + "dcat" : "http://www.w3.org/ns/dcat#", + "pubchem" : "http://rdf.ncbi.nlm.nih.gov/pubchem/compound/CID", + "dc" : "http://purl.org/dc/terms/", + "xsd" : "http://www.w3.org/2001/XMLSchema#" +}"""; + prov:value """[{ + "@for": "id in row.findall('ID')", + "@do": { + "@if": "id.text.replace(' ','') is not None", + "@id": "materialsminenp:{{id.text.replace(' ','')}}", + "@graph": [{ + "@id": "materialsminenp:{{id.text.replace(' ','')}}_nanopub", + "@type": "nanopub:Nanopublication", + "nanopub:hasAssertion": { + "@id": "materialsminenp:{{id.text.replace(' ','')}}_assertion", + "@type": "nanopub:Assertion", + "@graph": [ + { + "@if": "row.findtext('Control_ID') is not None", + "@id": "sample:{{slugify(row.findtext('Control_ID').replace(' ',''))}}", + "sio:hasRole": { + "@type": "sio:ControlRole", + "@id": "sample:{{slugify(row.findtext('Control_ID').replace(' ',''))}}_control_role", + "sio:inRelationTo": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}" + } + } + }, + { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}", + "@type": [ + "materialsmine:PolymerNanocomposite" + ], + "rdfs:label" : "{{row.find('MATERIALS/Filler/FillerComponent/ChemicalName').text}} in {{row.find('MATERIALS/Matrix/MatrixComponent/ChemicalName').text}}" + }, + { + "@for": "material in row.findall('MATERIALS')", + "@do": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}", + "sio:hasComponentPart" : [ + { + "@for": "pi, part in enumerate(material.findall('Filler/FillerComponent'))", + "@do": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}_filler_{{pi}}", + "@type": [{ + "@id": "{% if part.find('StdChemicalName') is not none %}compound:{{camelcase(part.find('StdChemicalName').text)}}{% elif part.find('PubChemRef') is not none %}pubchem:{{part.find('PubChemRef').text.replace(' ','')}}{% elif part.find('ChemicalName') is not none %}compound:{{camelcase(part.find('ChemicalName').text)}}{% elif part.find('Abbreviation') is not none %}compound:{{camelcase(part.find('Abbreviation').text)}}{% endif %}", + "@type": "owl:Class", + "rdfs:label": [ + { + "@if" : "part.find('StdChemicalName') is not None", + "@value" : "{{part.find('StdChemicalName').text}}" + }, + { + "@if" : "part.find('StdChemicalName') is None and part.find('ChemicalName') is not None", + "@value" : "{{part.find('ChemicalName').text}}" + } + ], + "skos:altLabel" : [ + { + "@if" : "part.find('StdChemicalName') is not None and part.find('ChemicalName') is not None", + "@value" : "{{part.find('ChemicalName').text}}" + }, + { + "@if" : "part.find('TradeName') is not None", + "@value" : "{{part.find('TradeName').text}}" + } + ], + "skos:notation" : [ + { + "@if" : "part.find('Abbreviation') is not None", + "@value" : "{{part.find('Abbreviation').text}}" + } + ], + "rdfs:subClassOf" : [ + { + "@if" : "part.find('PubChemRef') is not None", + "@id" : "pubchem:{{part.find('PubChemRef').text.replace(' ','')}}" + } + ] + } + ], + "rdfs:label": [ + { + "@if" : "part.find('ChemicalName') is not None", + "@value" : "{{part.find('ChemicalName').text}}" + } + ], + "sio:hasRole": { + "@type": "materialsmine:Filler", + "sio:inRelationTo": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}" + } + }, + "sio:hasAttribute": [ + { + "@if": "part.find('ManufacturerOrSourceName') is not None", + "@for": "manufacturer in part.findall('ManufacturerOrSourceName')", + "@do": { + "@type": "materialsmine:ManufacturerOrSourceName", + "sio:hasValue": "{{manufacturer.text}}" + } + }, + { + "@if": "part.find('TradeName') is not None", + "@for": "tradename in part.findall('TradeName')", + "@do":{ + "@type": "materialsmine:TradeName", + "sio:hasValue": "{{tradename.text}}" + } + }, + { + "@if": "part.find('Abbreviation') is not None", + "@for": "abbreviation in part.findall('Abbreviation')", + "@do": { + "@type": "materialsmine:Abbreviation", + "sio:hasValue": "{{abbreviation.text}}" + } + }, + { + "@if": "part.find('PubChemRef') is not None", + "@for": "ref in part.findall('PubChemRef')", + "@do": { + "@type": "materialsmine:PubChemReference", + "sio:hasValue": "{{ref.text}}" + } + }, + { + "@for": "fraction in part.findall('../FillerComposition/Fraction/*')", + "@do": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}_filler_{{pi}}_{{fraction.tag}}_fraction", + "sio:hasValue": { + "@value": "{{fraction.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "fraction.find('source') is not None", + "@value" : "{{fraction.find('source').text}}" + }], + "@type": "materialsmine:{{fraction.tag.title()}}Fraction" + } + }, + { + "@for": "density in part.findall('Density')", + "@do": { + "@type": "materialsmine:Density", + "sio:hasValue": { + "@value": "{{density.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "density.find('source') is not None", + "@value" : "{{density.find('source').text}}" + }], + "sio:hasUnit": [ + { + "@if": "density.find('unit') is not None and density.find('unit').text in units.index", + "@id": "{{units.loc[density.find('unit').text].uri}}" + } + ] + } + }, + { + "@if": "part.find('SurfaceArea').find('specific') is not None", + "@for": "area in part.findall('SurfaceArea')", + "@do": { + "@type": "materialsmine:SpecificSurfaceArea", + "sio:hasValue": { + "@value": "{{area.find('.//value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "area.find('.//unit') is not None and area.find('.//unit').text in units.index", + "@id": "{{units.loc[area.find('.//unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@if": "area.find('.//uncertainty')", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "area.find('.//uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "area.find('.//uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{area.find('.//uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + } + }, + { + "@for": "ratio in part.findall('ParticleAspectRatio')", + "@do": { + "@type": "sio:AspectRatio", + "sio:hasValue": { + "@value": "{{ratio.find('value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "ratio.find('.//unit') is not None and ratio.find('.//unit').text in units.index", + "@id": "{{units.loc[ratio.find('.//unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@if": "ratio.find('.//uncertainty')", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "ratio.find('.//uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "ratio.find('.//uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{ratio.find('.//uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + } + }, + { + "@for": "size in part.findall('SphericalParticleDiameter')", + "@do": { + "@type": "sio:Width", + "sio:hasValue": { + "@value": "{{size.find('value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "size.find('.//unit') is not None and size.find('.//unit').text in units.index", + "@id": "{{units.loc[size.find('.//unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@if": "size.find('.//uncertainty') is not None", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "size.find('.//uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "size.find('.//uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{size.find('.//uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + } + }, + { + "@for": "phase in part.findall('CrystalPhase')", + "@do": { + "@type": [ + "materialsmine:CrystalPhase", + { + "@id": "materialsmine:{{camelcase(phase.text)}}", + "@type": "owl:Class", + "rdfs:label": "{{phase.text}}", + "rdfs:subClassOf": { + "@id": "materialsmine:CrystalPhase" + } + } + ] + } + }, + { + "@for": "shape in part.findall('NonSphericalShape')", + "@do": { + "sio:hasAttribute": [{ + "@type": "materialsmine:NonSpherical", + "@id": "sio:Shape" + }, + { + "@if": "shape.find('.//Width') is not None", + "@type": "sio:Width", + "dc:Description": [{ + "@if": "shape.find('..//Width/description').text is not None", + "@value": "{{shape.find('..//Width/description').text}}" + }], + "sio:hasValue": { + "@value": "{{shape.find('.//Width/value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "shape.find('.//Width/unit') is not None and shape.find('.//Width/unit').text in units.index", + "@id": "{{units.loc[shape.find('.//Width/unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@if": "shape.find('.//Width/uncertainty') is not None", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "shape.find('.//Width/uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "shape.find('.//Width/uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{shape.find('.//Width/uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + }, + { + "@if": "shape.find('.//Length') is not None", + "@type": "sio:Length", + "dc:Description": [{ + "@if": "shape.find('..//Length/description').text is not None", + "@value": "{{shape.find('..//Length/description').text}}" + }], + "sio:hasValue": { + "@value": "{{shape.find('.//Length/value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "shape.find('.//Length/unit') is not None and shape.find('.//Length/unit').text in units.index", + "@id": "{{units.loc[shape.find('.//Length/unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@if": "shape.find('.//Length/uncertainty') is not None", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "shape.find('.//Length/uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "shape.find('.//Length/uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{shape.find('.//Length/uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + }, + { + "@if": "shape.find('.//Depth') is not None", + "@type": "sio:Depth", + "dc:Description": [{ + "@if": "shape.find('..//Depth/description').text is not None", + "@value": "{{shape.find('..//Depth/description').text}}" + }], + "sio:hasValue": { + "@value": "{{shape.find('.//Depth/value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "shape.find('.//Depth/unit') is not None and shape.find('.//Depth/unit').text in units.index", + "@id": "{{units.loc[shape.find('.//Depth/unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@if": "shape.find('.//Depth/uncertainty') is not None", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "shape.find('.//Depth/uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "shape.find('.//Depth/uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{shape.find('.//Depth/uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + } + + ] + } + } + ], + "sio:isSurroundedBy": [{ + "@for": "s, surface in enumerate(part.findall('ParticleSurfaceTreatment'))", + "@do": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}_filler_{{pi}}_surface_{{s}}", + "@type": [{ + "@id": "{% if surface.find('StdChemicalName') is not none %}compound:{{ camelcase(surface.find('StdChemicalName').text)}}{% elif surface.find('PubChemRef') is not none %}pubchem:{{surface.find('PubChemRef').text.replace(' ','')}}{% elif surface.find('ChemicalName') is not none %}compound:{{camelcase(surface.find('ChemicalName').text)}}{% elif surface.find('Abbreviation') is not none %}compound:{{camelcase(surface.find('Abbreviation').text)}}{% endif %}", + "@type": "owl:Class" + } + ], + "rdfs:label": [ + { + "@if" : "surface.find('StdChemicalName') is not None", + "@value" : "{{surface.find('StdChemicalName').text}}" + }, + { + "@if" : "surface.find('StdChemicalName') is None and surface.find('ChemicalName') is not None", + "@value" : "{{surface.find('ChemicalName').text}}" + } + ], + "skos:altLabel" : [ + { + "@if" : "surface.find('StdChemicalName') is not None and surface.find('ChemicalName') is not None", + "@value" : "{{surface.find('ChemicalName').text}}" + }, + { + "@if" : "surface.find('TradeName') is not None", + "@value" : "{{surface.find('TradeName').text}}" + } + ], + "skos:notation" : [ + { + "@if" : "surface.find('Abbreviation') is not None", + "@value" : "{{surface.find('Abbreviation').text}}" + } + ], + "rdfs:subClassOf" : [ + { + "@if" : "surface.find('PubChemRef') is not None", + "@id" : "pubchem:{{surface.find('PubChemRef').text.replace(' ','')}}" + } + ], + "sio:hasAttribute": [ + { + "@if": "surface.find('ManufacturerOrSourceName') is not None", + "@for": "manufacturer in surface.findall('ManufacturerOrSourceName')", + "@do": { + "@type": "materialsmine:ManufacturerOrSourceName", + "sio:hasValue": "{{manufacturer.text}}" + } + }, + { + "@if": "surface.find('TradeName') is not None", + "@for": "tradename in surface.findall('TradeName')", + "@do":{ + "@type": "materialsmine:TradeName", + "sio:hasValue": "{{tradename.text}}" + } + }, + { + "@if": "surface.find('ChemicalName') is not None", + "@for": "name in surface.findall('ChemicalName')", + "@do": { + "@type": "materialsmine:ChemicalName", + "sio:hasValue": "{{name.text}}" + } + }, + { + "@if": "surface.find('Abbreviation') is not None", + "@for": "abbreviation in surface.findall('Abbreviation')", + "@do": { + "@type": "materialsmine:Abbreviation", + "sio:hasValue": "{{abbreviation.text}}" + } + }, + { + "@for": "density in surface.findall('Density')", + "@do": { + "@type": "materialsmine:Density", + "sio:hasValue": { + "@value": "{{density.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "density.find('source') is not None", + "@value" : "{{density.find('source').text}}" + }], + "sio:hasUnit": [ + { + "@if": "density.find('unit') is not None and density.find('unit').text in units.index", + "@id": "{{units.loc[density.find('unit').text].uri}}" + } + ] + } + }, + { + "@for": "gdensity in surface.findall('GraftDensity')", + "@do": { + "@type": "materialsmine:GraftDensity", + "sio:hasValue": { + "@value": "{{gdensity.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "gdensity.find('source') is not None", + "@value" : "{{gdensity.find('source').text}}" + }], + "sio:hasUnit": [ + { + "@if": "gdensity.find('unit') is not None and gdensity.find('unit').text in units.index", + "@id": "{{units.loc[gdensity.find('unit').text].uri}}" + } + ] + } + }, + { + "@for": "mw in surface.findall('MolecularWeight')", + "@do": { + "@type": [{ + "@id": "{% if mw.find('description') is not none and mw.find('description').text == 'weight average (Mw)' %}materialsmine:MolecularWeight_Mw{% elif mw.find('description') is not none and mw.find('description').text == 'number average (Mn)' %}materialsmine:MolecularWeight_Mn{% elif mw.find('description') is not none and mw.find('description').text == 'z-average' %}materialsmine:MoleculeWeight_zAverage{% else %}materialsmine:MolecularWeight{% endif %}", + "@type": "owl:Class" + }], + "sio:hasValue": { + "@value": "{{mw.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "mw.find('description') is not None", + "@value" : "{{mw.find('description').text}}" + }], + "sio:hasUnit": [ + { + "@if": "mw.find('unit') is not None and mw.find('unit').text in units.index", + "@id": "{{units.loc[mw.find('unit').text].uri}}" + } + ] + } + } + ], + "sio:hasRole": { + "@type": "materialsmine:SurfaceTreatment", + "sio:inRelationTo": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}" + } + } + } + }] + } + }, + { + "@for": "pi, part in enumerate(row.findall('MATERIALS/Matrix/MatrixComponent'))", + "@do": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}_matrix_{{pi}}", + "@type": [{ + "@id": "{% if part.find('StdChemicalName') is not none %}compound:{{camelcase(part.find('StdChemicalName').text)}}{% elif part.find('PubChemRef') is not none %}pubchem:{{part.find('PubChemRef').text.replace(' ','')}}{% elif part.find('ChemicalName') is not none %}compound:{{camelcase(part.find('ChemicalName').text)}}{% elif part.find('Abbreviation') is not none %}compound:{{camelcase(part.find('Abbreviation').text)}}{% endif %}", + "@type": "owl:Class", + "rdfs:label": [ + { + "@if" : "part.find('StdChemicalName') is not None", + "@value" : "{{part.find('StdChemicalName').text}}" + }, + { + "@if" : "part.find('StdChemicalName') is None and part.find('ChemicalName') is not None", + "@value" : "{{part.find('ChemicalName').text}}" + } + ], + "skos:altLabel" : [ + { + "@if" : "part.find('StdChemicalName') and part.find('ChemicalName')", + "@value" : "{{part.find('ChemicalName').text}}" + }, + { + "@if" : "part.find('TradeName') is not None", + "@value" : "{{part.find('TradeName').text}}" + } + ], + "skos:notation" : [ + { + "@if" : "part.find('Abbreviation') is not None", + "@value" : "{{part.find('Abbreviation').text}}" + } + ], + "rdfs:subClassOf" : [ + { + "@if" : "part.find('PubChemRef') is not None", + "@id" : "pubchem:{{part.find('PubChemRef').text.replace(' ','')}}" + } + ] + }, + { + "@if": "part.find('PlasticType') is not None", + "@for": "plasticT in part.findall('PlasticType')", + "@do": { + "@id": "materialsmine:{{camelcase(plasticT.text)}}", + "@type": "owl:Class", + "rdfs:label": "{{camelcase(plasticT.text)}}" + } + }, + { + "@if": "part.find('PolymerClass') is not None", + "@for": "polymerC in part.findall('PolymerClass')", + "@do": { + "@id": "materialsmine:{{camelcase(polymerC.text)}}", + "@type": "owl:Class", + "rdfs:label": "{{camelcase(polymerC.text)}}" + } + }, + { + "@if": "part.find('PolymerType') is not None", + "@for": "polymerT in part.findall('PolymerType')", + "@do": { + "@id": "materialsmine:{{camelcase(polymerT.text)}}", + "@type": "owl:Class", + "rdfs:label": "{{camelcase(polymerT.text)}}" + } + } + ], + "rdfs:label": [ + { + "@if" : "part.find('ChemicalName') is not None", + "@value" : "{{part.find('ChemicalName').text}}" + } + ], + "sio:hasRole": { + "@type": "materialsmine:Matrix", + "sio:inRelationTo": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}" + } + }, + "sio:hasComponentPart": [ + { + "@if": "part.find('Hardener') is not None", + "@for": "hardener in part.findall('Hardener')", + "@do": { + "@type": "materialsmine:Hardener", + "sio:hasValue": "{{hardener.text}}" + } + }, + { + "@for": "additive in part.findall('Additive')", + "@do": { + "@type": "materialsmine:Additive", + "sio:hasValue": { + "@value": "{{additive.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "additive.find('description') is not None", + "@value" : "{{additive.find('description').text}}" + }], + "sio:hasUnit": [ + { + "@if": "additive.find('unit') is not None and additive.find('unit').text in units.index", + "@id": "{{units.loc[additive.find('unit').text].uri}}" + } + ] + } + } + ], + "sio:hasAttribute": [ + { + "@for": "density in part.findall('Density')", + "@do": { + "@type": "materialsmine:Density", + "sio:hasValue": { + "@value": "{{density.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "density.find('source') is not None", + "@value" : "{{density.find('source').text}}" + }], + "sio:hasUnit": [ + { + "@if": "density.find('unit') is not None and density.find('unit').text in units.index", + "@id": "{{units.loc[density.find('unit').text].uri}}" + } + ] + } + }, + { + "@if": "part.find('ManufacturerOrSourceName') is not None", + "@for": "manufacturer in part.findall('ManufacturerOrSourceName')", + "@do": { + "@type": "materialsmine:ManufacturerOrSourceName", + "sio:hasValue": "{{manufacturer.text}}" + } + }, + { + "@if": "part.find('TradeName') is not None", + "@for": "tradename in part.findall('TradeName')", + "@do":{ + "@type": "materialsmine:TradeName", + "sio:hasValue": "{{tradename.text}}" + } + }, + { + "@if": "part.find('Abbreviation') is not None", + "@for": "abbreviation in part.findall('Abbreviation')", + "@do": { + "@type": "materialsmine:Abbreviation", + "sio:hasValue": "{{abbreviation.text}}" + } + }, + { + "@if": "part.find('PubChemRef') is not None", + "@for": "ref in part.findall('PubChemRef')", + "@do": { + "@type": "materialsmine:PubChemReference", + "sio:hasValue": "{{ref.text}}" + } + }, + { + "@for": "mw in part.findall('MolecularWeight')", + "@do": { + "@type": [{ + "@id": "{% if mw.find('description') is not none and mw.find('description').text == 'weight average (Mw)' %}materialsmine:MolecularWeight_Mw{% elif mw.find('description') is not none and mw.find('description').text == 'number average (Mn)' %}materialsmine:MolecularWeight_Mn{% elif mw.find('description') is not none and mw.find('description').text == 'z-average' %}materialsmine:MoleculeWeight_zAverage{% else %}materialsmine:MolecularWeight{% endif %}", + "@type": "owl:Class" + }], + "sio:hasValue": { + "@value": "{{mw.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "mw.find('description') is not None", + "@value" : "{{mw.find('description').text}}" + }], + "sio:hasUnit": [ + { + "@if": "mw.find('unit') is not None and mw.find('unit').text in units.index", + "@id": "{{units.loc[mw.find('unit').text].uri}}" + } + ] + } + }, + { + "@if": "part.find('Polydispersity') is not None", + "@for": "polydispersity in part.findall('Polydispersity')", + "@do": { + "@type": "materialsmine:Polydispersity", + "sio:hasValue": "{{polydispersity.text}}" + } + }, + { + "@if": "part.find('Tacticity') is not None", + "@for": "tacticity in part.findall('Tacticity')", + "@do": { + "@type": "materialsmine:Tacticity", + "sio:hasValue": "{{tacticity.text}}" + } + }, + { + "@for": "viscosity in part.findall('Viscosity')", + "@do": { + "@type": "materialsmine:Viscosity", + "sio:hasValue": { + "@value": "{{viscosity.find('value').text}}", + "@type": "xsd:double" + }, + "dc:description" : [ { + "@if" : "viscosity.find('source') is not None", + "@value" : "{{viscosity.find('source').text}}" + }], + "sio:hasUnit": [ + { + "@if": "viscosity.find('unit') is not None and viscosity.find('unit').text in units.index", + "@id": "{{units.loc[viscosity.find('unit').text].uri}}" + } + ] + } + } + ] + } + }], +"sio:hasAttribute": [ + { + "@for": "i, property in properties.iterrows()", + "@do": { + "@if": "not isempty(property.xpath) and row.find('PROPERTIES')", + "@for": "value in row.find('PROPERTIES').findall('.'+property.xpath)", + "@do": [ + { + "@if" : "not row.find('PROPERTIES').findall('.'+property.xpath+'/data')", + "@type": "{{property.uri}}", + "dc:description": [{ + "@if": "value.find('description') is not None", + "@value": "{{value.find('description').text}}" + }], + "sio:hasValue": [{ + "@if": "value.find('value') is not None", + "@value": "{{value.find('value').text}}", + "@type": "xsd:double" + }], + "sio:hasUnit": [ + { + "@if": "value.find('unit') is not None and value.find('unit').text in units.index", + "@id": "{{units.loc[value.find('unit').text].uri}}" + } + ], + "sio:hasAttribute": [{ + "@for": "uncertainty in value.findall('uncertainty')", + "@do": { + "@type": [ + "sio:UncertaintyValue", + { + "@if": "uncertainty.find('type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "uncertainty.find('type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{uncertainty.find('value').text}}", + "@type": "xsd:double" + } + } + }] + }, + { + "@for": "table in value.findall('.//data')", + "@do": { + "@for": "row in table.findall('rows/row')", + "@do": + { + "@type": [{ + "@if": "not isempty(property.curveDependentVar)", + "@id": "{{property.curveDependentVar}}" + }, + { + "@if": "isempty(property.curveDependentVar) and row.find('../../../AxisLabel/yName') is not None", + "@id": "materialsmine:{{camelcase(row.find('../../../AxisLabel/yName').text)}}", + "@type": "owl:Class", + "rdfs:subClassOf": { + "@id": "sio:Quantity" + }, + "rdfs:label": "{{row.find('../../../AxisLabel/yName').text}}" + } + ], + "sio:hasUnit" : [ + { + "@if": "row.find('../../../AxisLabel/yUnit') is not None and row.find('../../../AxisLabel/yUnit').text in units.index", + "@id": "{{units.loc[row.find('../../../AxisLabel/yUnit').text].uri}}" + } + ], + "sio:hasValue": { + "@value": "{{row.findall('column')[1].text}}", + "@type": "xsd:double" + }, + "sio:inRelationTo": [{ + "@type": [{ + "@if": "not isempty(property.curveIndependentVar)", + "@id": "{{property.curveIndependentVar}}" + }, + { + "@if": "isempty(property.curveIndependentVar) and row.find('../../../AxisLabel/xName') is not None", + "@id": "materialsmine:{{camelcase(row.find('../../../AxisLabel/xName').text)}}", + "@type": "owl:Class", + "rdfs:subClassOf": { + "@id": "sio:Quantity" + }, + "rdfs:label": "{{row.find('../../../AxisLabel/xName').text}}" + } + ], + "sio:hasUnit" : [ + { + "@if": "row.find('../../../AxisLabel/xUnit') is not None and row.find('../../../AxisLabel/xUnit').text in units.index", + "@id": "{{units.loc[row.find('../../../AxisLabel/xUnit').text].uri}}" + } + ], + "sio:hasValue": { + "@value": "{{row.findall('column')[0].text}}", + "@type": "xsd:double" + } + }] + } + + } + } + ] + } + }] + } + }, + { + "@for": "microstructure in row.findall('MICROSTRUCTURE')", + "@do": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}", + "foaf:depiction" : [ + { + "@for" : "image in microstructure.findall('ImageFile')", + "@do" : { + "@if" : "image.find('File') is not None", + "@id" : "{{image.find('File').text.strip()}}", + "@type" : [ + "sio:Image", + { + "@if" : "image.find('Type') is not None" , + "@id" : "materialsmine:{{image.find('Type').text.title()}}Image", + "rdfs:label" : "{{image.find('Type').text.title()}} Image" + } + ], + "foaf:depiction": "{{image.find('File').text.strip()}}", + "prov:wasGeneratedBy" : { + "@type" : [ + "materialsmine:Microscopy", + "prov:Activity", + { + "@if" : "image.find('MicroscopyType') is not None", + "@id" : "materialsmine:{{image.find('MicroscopyType').text}}Microscopy", + "rdfs:label" : "{{image.find('MicroscopyType').text}} Microscopy" + } + ], + "prov:used" : { + "@id" : "sample:{{slugify(id.text.replace(' ',''))}}" + } + } + } + }] + } + } + ] + }, + "nanopub:hasPublicationInfo": { + "@id": "materialsminenp:{{id.text.replace(' ','')}}_pubinfo", + "@type": "nanopub:PublicationInfo", + "@graph": [ + { + "@for": "citation in row.findall('DATA_SOURCE/Citation')", + "@do": { + "@id": "materialsminenp:{{id.text.replace(' ','')}}_assertion", + "prov:generatedAtTime": [{ + "@if": "citation.find('CommonFields/DateOfCitation')", + "@type": "xsd:date", + "@value": "{{citation.find('CommonFields/DateOfCitation').text" + }], + "prov:wasQuotedFrom": [{ + "@id": "{%if citation.find('CommonFields/DOI') != None %}doi:{{citation.find('CommonFields/DOI').text.replace('<','%3C').replace('>','%3E')}}{%else%}materialsminenp:{{id.text.replace(' ','-')}}{%endif%}", + "@type": [ + "dcterms:BibliographicResource", + { + "@id": "{{ {'research article':'materialsmine:ResearchArticle','conference proceeding':'materialsmine:ProceedingsArticle','communication':'materialsmine:Communication','review':'materialsmine:ReviewArticle','letter':'bibo:Letter','technical comment':'materialsmine:TechnicalComment'}[citation.find('CommonFields/CitationType').text] }}" + } + ], + "dcterms:title": "{{citation.find('CommonFields/Title').text}}", + "rdfs:label": "{{citation.find('CommonFields/Title').text}}", + "rdfs:seeAlso": { + "@if": "citation.find('CommonFields/URL').text", + "@id": "{{citation.find('CommonFields/URL').text.replace('<','%3C').replace('>','%3E')}}" + }, + "dcterms:created": { + "@value": "{{citation.find('CommonFields/PublicationYear').text}}", + "@type": "xsd:integer" + }, + "bibo:volume": { + "@if": "citation.find('CommonFields/Volume').text", + "@value": "{{citation.find('CommonFields/Volume').text}}", + "@type": "xsd:integer" + }, + "prov:atLocation": { + "@if": "citation.find('CommonFields/Location').text", + "@type": "dcterms:Location", + "@id": "location:{{slugify(citation.find('CommonFields/Location').text)}}", + "rdfs:label": "{{citation.find('CommonFields/Location').text}}" + }, + "dcterms:language": { + "@if": "citation.find('CommonFields/Language').text", + "@id": "lang:{{slugify(citation.find('CommonFields/Language').text)}}", + "@type": "dcterms:LinguisticSystem", + "rdfs:label": "{{citation.find('CommonFields/Language').text}}" + }, + "authorList": [{ + "@for": "author in reverse(citation.findall('CommonFields/Author'))", + "@do": { + "@id": "author:{{slugify(author.text)}}" + } + }], + "dcterms:creator": [{ + "@for": "author in reverse(citation.findall('CommonFields/Author'))", + "@do": { + "@id": "author:{{slugify(author.text)}}", + "@type": "prov:Agent", + "foaf:name": "{{author.text}}", + "rdfs:label": "{{author.text}}", + "@reverse": { + "prov:wasAttributedTo": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}" + } + } + } + }], + "dcterms:isPartOf": { + "@if": "citation.find('CommonFields/Publication').text", + "@id": "publication:{{slugify(citation.find('CommonFields/Publication').text)}}", + "dcterms:title": "{{citation.find('CommonFields/Publication').text}}", + "dcterms:publisher": { + "@if": "citation.find('CommonFields/Publisher').text", + "@id": "publisher:{{slugify(citation.find('CommonFields/Publisher').text)}}", + "rdfs:label": "{{citation.find('CommonFields/Publisher').text}}" + } + }, + "sio:hasPart": { + "@id": "sample:{{slugify(id.text.replace(' ',''))}}" + }, + "dcat:keyword": [{ + "@for": "keyword in citation.findall('CommonFields/Keyword')", + "@do": [{ + "@if": "';' in keyword.text", + "@for": "k in re.split('\\\\s*[;]\\\\s*', keyword.text)", + "@do": "{{k.strip().title()}}" + }, + { + "@if": "';' not in keyword", + "@value": "{{keyword.text.strip().title()}}" + } + ] + }] + }] + } + } + ] + }, + "nanopub:hasProvenance": { + "@id": "materialsminenp:{{id.text.replace(' ','')}}_provenance", + "@type": "nanopub:Provenance", + "@graph": [ + { + "@for": "proc in row.findall('PROCESSING')", + "@do": { + "@for": "i, procedure in processing.iterrows()", + "@do": { + "@if": "proc.find(procedure.xpath[2:])", + "@id": "sample:{{slugify(id.text.replace(' ',''))}}", + "prov:wasGeneratedBy": [{ + "@id": "entry:{{id.text.replace(' ','')}}_material_{{procedure.label.lower().replace(' ','_')}}_procedure", + "@type" : ["sio:Procedure","{{procedure.uri}}"], + "dc:description": [{ + "@if": "proc.find('ExperimentalProcedure').text is not None", + "@value": "{{proc.find('ExperimentalProcedure').text}}" + }], + "sio:hasPart" : [{ + "@for": "pn, param in enumerate(proc.findall('.//ChooseParameter'))", + "@do": { + "@for": "i, process in processing.iterrows()", + "@do": { + "@if": "param.find(process.xpath[2:])", + "@type": ["{{process.uri}}"], + "@id" : "sample:{{id.text.replace(' ','')}}_{{procedure.label.lower().replace(' ','_')}}_step_{{pn}}", + "sio:hasOutput" : [{ + "@id": "sample:{{id.text.replace(' ','')}}_{{procedure.label.lower().replace(' ','_')}}_step_{{pn}}_output" + }], + "sio:hasInput": [{ + "@if" : "pn > 0", + "@id": "sample:{{id.text.replace(' ','')}}_{{procedure.label.lower().replace(' ','_')}}_step_{{pn-1}}_output" + }], + "sio:hasParameter": [ + { + "@for": "i, parameter in processing.iterrows()", + "@do": { + "@if": "not isempty(parameter.xpath) and row.findall('.'+parameter.xpath)", + "@for": "value in param.findall('.'+parameter.xpath)", + "@do": [{ + "@id": "sample:{{id.text.replace(' ','')}}_{{procedure.label.lower().replace(' ','_')}}_step_{{pn}}_{{slugify(value.tag)}}", + "@type": [ + "sio:Parameter", + "{{parameter.uri}}" + ], + "dc:description": [{ + "@if": "value.find('Description')", + "@value": "{{value.find('Description').text}}" + }], + "sio:hasAttribute" : [{ + "@for": "i, parameter_attr in processing.iterrows()", + "@do": { + "@if": "not isempty(parameter_attr.xpath) and row.findall('.'+parameter_attr.xpath)", + "@for": "val in value.findall('.'+parameter_attr.xpath)", + "@do": [{ + "@id": "sample:{{id.text.replace(' ','')}}_{{procedure.label.lower().replace(' ','_')}}_step_{{pn}}_{{slugify(value.tag)}}_{{slugify(val.tag)}}", + "@type": [ + "{{parameter_attr.uri}}" + ], + "dc:description": [{ + "@if": "val.find('Description')", + "@value": "{{val.find('Description').text}}" + }, + { + "@if": "val.find('description')", + "@value": "{{val.find('description').text}}" + }], + "sio:hasValue": [{ + "@if": "val.find('value').text is not None", + "@value": "{{val.find('value').text}}" + }, + { + "@if": "val.text is not None", + "@value": "{{val.text}}" + }], + "sio:hasUnit": [ + { + "@if": "val.find('unit') is not None and val.find('unit').text in units.index", + "@id": "{{units.loc[val.find('unit').text].uri}}", + "rdfs:label": "{{val.find('unit').text}}" + } + ], + "sio:hasAttribute": [{ + "@if": "val.find('.//uncertainty') is not None", + "@id": "sample:{{id.text.replace(' ','')}}_{{procedure.label.lower().replace(' ','_')}}_step_{{pn}}_{{slugify(value.tag)}}_{{slugify(val.tag)}}_uncertainty", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "val.find('.//uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "val.find('.//uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": [{ + "@if": "val.find('.//uncertainty/value').text is not None", + "@value": "{{val.find('.//uncertainty/value').text}}" + }] + }] + }] + } + }] + }] + } + } + ] + } + } + }] + }] + } + } + }, + { + "@for": "characterization in row.findall('CHARACTERIZATION')", + "@do": + { + "@id": "materialsminenp:{{id.text.replace(' ','')}}_assertion", + "prov:wasGeneratedBy": [{ + "@for": "i, method in methods.iterrows()", + "@do": { + "@if": "not isempty(method.xpath) and characterization.findall('.'+method.xpath)", + "@for": "value in characterization.findall('.'+method.xpath)", + "@do": [{ + "@id": "entry:{{id.text.replace(' ','')}}_characterization_{{slugify(value.tag)}}", + "@type": [ + "prov:Activity", + "sio:Measuring", + "{{method.uri}}" + ], + "dc:description": [{ + "@if": "value.find('Description')", + "@value": "{{value.find('Description').text}}" + }], + "prov:used": [{ + "@for": "equipment in list(value.findall('./Equipment')) + list(value.findall('./EquipmentUsed'))", + "@do": { + "@type": [{ + "@id": "materialsmine:{{slugify(equipment.text)}}", + "@type": "owl:Class", + "rdfs:subClassOf": { + "@id": "sio:Device" + }, + "rdfs:label": "{{equipment.text}}" + }, + "sio:Device" + ], + "sio:hasAttribute": [{ + "@for": "i, method_attr in methods.iterrows()", + "@do": { + "@if": "not isempty('.'+method_attr.xpath) and value.findall('.'+method_attr.xpath)", + "@id": "sample:{{id.text.replace(' ','')}}_{{method_attr.label.lower().replace(' ','_')}}_attr_{{i}}", + "@type": "method_attr.uri", + "sio:hasValue": { + "@value": "{{value.findall('.'+method_attr.xpath)[0].find('value').text}}", + "@type": "xsd:double" + }, + "sio:hasUnit": [ + { + "@if": "value.findall('.'+method_attr.xpath)[0].find('unit') is not None and value.findall('.'+method_attr.xpath)[0].find('unit').text in units.index", + "@id": "{{units.loc[value.findall('.'+method_attr.xpath)[0].find('unit').text].uri}}", + "rdfs:label": "{{value.findall('.'+method_attr.xpath)[0].find('unit').text}}" + } + ], + "sio:hasAttribute": [{ + "@if": "value.findall('.'+method_attr.xpath)[0].find('.//uncertainty') is not None", + "@id": "sample:{{id.text.replace(' ','')}}_{{method_attr.label.lower().replace(' ','_')}}_attr_uncertainty_{{i}}", + "@type": [ + "sio:UncertaintyValue", + { + "@if": "value.findall('.'+method_attr.xpath)[0].find('.//uncertainty/type').text == 'relative'", + "@id": "sio:Ratio" + }, + { + "@if": "value.findall('.'+method_attr.xpath)[0].find('.//uncertainty/type').text == 'absolute'", + "@id": "sio:StandardDeviation" + } + ], + "sio:hasValue": { + "@value": "{{value.findall('.'+method_attr.xpath)[0].find('.//uncertainty/value').text}}", + "@type": "xsd:double" + } + }] + } + }] + } + }] + }] + } + }] + } + } + ] + } + }] + } +}]""" + ]. + +# a pv:File; +# dcterms:format "application/trig"; +# prov:wasGeneratedBy [ +# a setl:Load; +# prov:used :nanopubs ; +# ]. diff --git a/whyis/materialsmine/static/css/nanomine.css b/whyis/materialsmine/static/css/nanomine.css new file mode 100644 index 00000000..e69de29b diff --git a/whyis/materialsmine/static/html/README.md b/whyis/materialsmine/static/html/README.md new file mode 100644 index 00000000..0619537d --- /dev/null +++ b/whyis/materialsmine/static/html/README.md @@ -0,0 +1 @@ +A directory for static HTML files, such as Angular.js templates. diff --git a/whyis/materialsmine/static/images/README.md b/whyis/materialsmine/static/images/README.md new file mode 100644 index 00000000..660a4f2a --- /dev/null +++ b/whyis/materialsmine/static/images/README.md @@ -0,0 +1 @@ +A directory for serving static images. diff --git a/whyis/materialsmine/static/js/nanomine.js b/whyis/materialsmine/static/js/nanomine.js new file mode 100644 index 00000000..e69de29b diff --git a/whyis/materialsmine/templates/facet_values_20201008_HARDCODED.json b/whyis/materialsmine/templates/facet_values_20201008_HARDCODED.json new file mode 100644 index 00000000..bd53a659 --- /dev/null +++ b/whyis/materialsmine/templates/facet_values_20201008_HARDCODED.json @@ -0,0 +1,2733 @@ +[ + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_GlassTransitionTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Glass Transition Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://nanomine.org/ns/GlassTransitionTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_TensileModulus__http_www_ontology_of_units_of_measure_org_resource_om_2_gigapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Tensile Modulus", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gigapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "GPa", + "value": "\u003chttp://nanomine.org/ns/TensileModulus\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_CrystallizationTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Crystallization Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://nanomine.org/ns/CrystallizationTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_ElongationAtBreak__http_www_ontology_of_units_of_measure_org_resource_om_2_percent", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Elongation at Break", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/percent", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u0025", + "value": "\u003chttp://nanomine.org/ns/ElongationAtBreak\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_DielectricRealPermittivity", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Dielectric Real Permittivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://nanomine.org/ns/DielectricRealPermittivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_TensileStressAtBreak__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Tensile Stress at Break", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://nanomine.org/ns/TensileStressAtBreak\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_ElectricalConductivity__http_qudt_org_vocab_unit_S_PER_CentiM", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Electrical conductivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://qudt.org/vocab/unit/S-PER-CentiM", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "S\u002fcm", + "value": "\u003chttp://nanomine.org/ns/ElectricalConductivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_ThermalDecompositionTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Thermal Decomposition Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://nanomine.org/ns/ThermalDecompositionTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_MeltingTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Melting Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://nanomine.org/ns/MeltingTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_TensileStressAtYield__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Tensile Stress at Yield", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://nanomine.org/ns/TensileStressAtYield\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_FiberTensileStrength__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Fiber Tensile Strength", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://nanomine.org/ns/FiberTensileStrength\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_HalflifeOfCrystallization__http_www_ontology_of_units_of_measure_org_resource_om_2_second_Time", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Halflife Of Crystallization", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/second-Time", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "s", + "value": "\u003chttp://nanomine.org/ns/HalflifeOfCrystallization\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_FlexuralModulus__http_www_ontology_of_units_of_measure_org_resource_om_2_gigapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Flexural Modulus", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gigapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "GPa", + "value": "\u003chttp://nanomine.org/ns/FlexuralModulus\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_VolumeResistivity__http_nanomine_org_ns_unit_ohm_cm", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Volume Resistivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://nanomine.org/ns/unit/ohm-cm", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u03a9-cm", + "value": "\u003chttp://nanomine.org/ns/VolumeResistivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_ThermalConductivity__http_www_ontology_of_units_of_measure_org_resource_om_2_wattPerMetreKelvin", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Thermal Conductivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/wattPerMetreKelvin", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "W\u002fm-K", + "value": "\u003chttp://nanomine.org/ns/ThermalConductivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_ElongationAtYield__http_www_ontology_of_units_of_measure_org_resource_om_2_percent", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Elongation at Yield", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/percent", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u0025", + "value": "\u003chttp://nanomine.org/ns/ElongationAtYield\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_FlexuralStressAtBreak__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Flexural Stress at Break", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://nanomine.org/ns/FlexuralStressAtBreak\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_SurfaceResistivity__http_nanomine_org_ns_unit_ohm_cm", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Surface Resistivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://nanomine.org/ns/unit/ohm-cm", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u03a9-cm", + "value": "\u003chttp://nanomine.org/ns/SurfaceResistivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_HeatOfCrystallization__http_qudt_org_vocab_unit_j_per_gm", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Heat Of Crystallization", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://qudt.org/vocab/unit/j-per-gm", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "J\u002fg", + "value": "\u003chttp://nanomine.org/ns/HeatOfCrystallization\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_Density__http_www_ontology_of_units_of_measure_org_resource_om_2_gramPerCubicCentimetre", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Density", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "g\u002fcm\u00b3", + "value": "\u003chttp://nanomine.org/ns/Density\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_IZOD_ImpactEnergy__http_nanomine_org_ns_unit_kj_m_2", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "IZOD Impact Energy", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://nanomine.org/ns/unit/kj-m-2", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "kJ\u002fm\u00b2", + "value": "\u003chttp://nanomine.org/ns/IZOD_ImpactEnergy\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_ThermalDiffusivity__http_nanomine_org_ns_unit_mm_2_s", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Thermal Diffusivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://nanomine.org/ns/unit/mm-2-s", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "mm\u00b2\u002fs", + "value": "\u003chttp://nanomine.org/ns/ThermalDiffusivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_SpecificHeatCapacity_Cp__http_nanomine_org_ns_unit_j_gk", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Specific Heat Capacity Cp", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://nanomine.org/ns/unit/j-gk", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "J\u002fg-K", + "value": "\u003chttp://nanomine.org/ns/SpecificHeatCapacity_Cp\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_InterphaseThickness__http_www_ontology_of_units_of_measure_org_resource_om_2_nanometre", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Interphase Thickness", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/nanometre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "nm", + "value": "\u003chttp://nanomine.org/ns/InterphaseThickness\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_nanomine_org_ns_CharpyImpactEnergy__http_nanomine_org_ns_unit_kj_m_2", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Charpy Impact Energy", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://nanomine.org/ns/unit/kj-m-2", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "kJ\u002fm\u00b2", + "value": "\u003chttp://nanomine.org/ns/CharpyImpactEnergy\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "facetId": "FillerType", + "field": "FillerType", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Filler Material", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_SiliconDioxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silicon dioxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SiliconDioxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_MultiWallCarbonNanotubes", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Multi-wall carbon nanotubes", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/MultiWallCarbonNanotubes\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_BariumTitanate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Barium titanate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/BariumTitanate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_TitaniumDioxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Titanium dioxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/TitaniumDioxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Graphene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Graphene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_CarbonBlack", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Carbon black", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CarbonBlack\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_AluminiumOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Aluminium oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/AluminiumOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Graphite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Graphite\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Silver", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silver", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Silver\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_GrapheneOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphene oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/GrapheneOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_ZincOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Zinc oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/ZincOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Montmorillonite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Montmorillonite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Montmorillonite\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_ReducedGrapheneOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Reduced graphene oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/ReducedGrapheneOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_SingleWallCarbonNanotubes", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Single-wall carbon nanotubes", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SingleWallCarbonNanotubes\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_AluminiumHydroxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Aluminium hydroxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/AluminiumHydroxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_GraphiteOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphite oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/GraphiteOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_BariumStrontiumTitanate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Barium strontium titanate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/BariumStrontiumTitanate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Cellulose", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Cellulose", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Cellulose\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_OctaAminophenylPolyhedralOligomericSilsesquioxane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Octa(aminophenyl) polyhedral oligomeric silsesquioxane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/OctaAminophenylPolyhedralOligomericSilsesquioxane\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_CarbonNanofibers", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Carbon nanofibers", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CarbonNanofibers\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_MagnesiumOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Magnesium oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/MagnesiumOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_CalciumCarbonate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Calcium carbonate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CalciumCarbonate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_IronOxideBariumTitanateCoreShellNanoparticles", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Iron oxide - barium titanate core-shell nanoparticles", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/IronOxideBariumTitanateCoreShellNanoparticles\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_CalciumCopperTitanate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Calcium copper titanate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CalciumCopperTitanate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_SilverHexafluoroantimonate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silver hexafluoroantimonate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SilverHexafluoroantimonate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_IronIiIiiOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Iron(II,III) oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/IronIiIiiOxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_SilverNitrate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silver nitrate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SilverNitrate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_ZirconiumDioxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Zirconium dioxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/ZirconiumDioxide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_OctakisDimethylsiloxyhexafluoropropylglycidylEtherSilsesquioxane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Octakis(dimethylsiloxyhexafluoropropylglycidyl ether)silsesquioxane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/OctakisDimethylsiloxyhexafluoropropylglycidylEtherSilsesquioxane\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Polyaniline", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Polyaniline", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polyaniline\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Bentonite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Bentonite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Bentonite\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_DodecylbenzenesulfonicAcid", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Dodecylbenzenesulfonic acid", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/DodecylbenzenesulfonicAcid\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Gold", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Gold", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Gold\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_SodiumTitanateNanotubes", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Sodium titanate nanotubes", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SodiumTitanateNanotubes\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_TriphenylPhosphate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Triphenyl phosphate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/TriphenylPhosphate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Clay", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Clay", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Clay\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Aluminium", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Aluminium", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Aluminium\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_FluorineMica", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Fluorine mica", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/FluorineMica\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_Sepiolite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Sepiolite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Sepiolite\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_SiliconCarbide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silicon carbide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SiliconCarbide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_9Anthracenemethanol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "9-Anthracenemethanol", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/9Anthracenemethanol\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_nanomine_org_compound_MineralOil", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Mineral oil", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/MineralOil\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "facetId": "MatrixType", + "field": "MatrixType", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Matrix Material", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_DgebaEpoxyResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "DGEBA Epoxy Resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/DgebaEpoxyResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyMethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyMethylMethacrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polystyrene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polystyrene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polystyrene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyEthylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyEthylene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyEthyleneGlycol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene glycol)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyEthyleneGlycol\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylideneFluoride", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylideneFluoride\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyBisphenolACarbonate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(bisphenol A carbonate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyBisphenolACarbonate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_SiliconeRubber", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Silicone rubber", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SiliconeRubber\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyPropylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(propylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyPropylene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_CycloaliphaticEpoxyResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Cycloaliphatic Epoxy Resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CycloaliphaticEpoxyResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylideneFluorideCoTrifluoroethyleneCoChlorotrifluoroethylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-trifluoroethylene-co-chlorotrifluoroethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylideneFluorideCoTrifluoroethyleneCoChlorotrifluoroethylene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_BisphenolAPhthalonitrileResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Bisphenol-A phthalonitrile resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/BisphenolAPhthalonitrileResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Poly2VinylPyridine", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(2-vinyl pyridine)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Poly2VinylPyridine\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylAlcohol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl alcohol)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylAlcohol\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polyimide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyimide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polyimide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylideneFluorideCoHexafluoropropylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-hexafluoropropylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylideneFluorideCoHexafluoropropylene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolylacticAcid", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polylactic acid", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolylacticAcid\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polyurethane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyurethane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polyurethane\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_BisphenolAEpoxyVinylEsterResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Bisphenol-A-epoxy vinyl ester resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/BisphenolAEpoxyVinylEsterResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_DgebfEpoxyResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "DGEBF Epoxy Resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/DgebfEpoxyResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylButyral", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl butyral)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylButyral\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyStyreneBButadiene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(styrene-b-butadiene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyStyreneBButadiene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polybenzimidazole", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polybenzimidazole", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polybenzimidazole\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_NeopentylGlycolDiglycidylEther", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Neopentyl glycol diglycidyl ether", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/NeopentylGlycolDiglycidylEther\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylChloride", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl chloride)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylChloride\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyamideImide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyamide-imide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyamideImide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyStyreneCoAcrylonitrile", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(styrene-co-acrylonitrile)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyStyreneCoAcrylonitrile\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_BisphenolECyanateEsterResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Bisphenol E cyanate ester resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/BisphenolECyanateEsterResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Nylon66", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 6-6", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Nylon66\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyEthyleneTerephthalate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene terephthalate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyEthyleneTerephthalate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Nylon6", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 6", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Nylon6\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyButyleneAdipateCoTerephthalate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(butylene adipate-co-terephthalate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyButyleneAdipateCoTerephthalate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyStyreneBEthyleneRanButyleneBStyrene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly[styrene-b-(ethylene-ran-butylene)-b-styrene]", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyStyreneBEthyleneRanButyleneBStyrene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Poly2HydroxyethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(2-hydroxyethyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Poly2HydroxyethylMethacrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Tetraglycidyl44DiaminodiphenylMethane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Tetraglycidyl 4,4\u0027-diaminodiphenyl methane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Tetraglycidyl44DiaminodiphenylMethane\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_TriglycidylParaAminophenol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Triglycidyl para-aminophenol", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/TriglycidylParaAminophenol\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_CyclicOlefinCopolymer", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Cyclic olefin copolymer", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CyclicOlefinCopolymer\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyEthyleneVinylAcetate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene-vinyl acetate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyEthyleneVinylAcetate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polyrotaxane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyrotaxane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polyrotaxane\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Poly2HydroxyethylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(2-hydroxyethyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Poly2HydroxyethylAcrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylideneFluorideCoChlorotrifluoroethylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-chlorotrifluoroethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylideneFluorideCoChlorotrifluoroethylene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyAcrylamide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(acrylamide)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyAcrylamide\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolybutyleneSuccinate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polybutylene succinate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolybutyleneSuccinate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polybutadiene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polybutadiene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polybutadiene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Nylon12", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 12", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Nylon12\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylAcetate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl acetate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylAcetate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Nylon63T", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 6(3)T", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Nylon63T\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyMethylMethacrylateBlockPolyNButylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)-block-poly(n-butyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyMethylMethacrylateBlockPolyNButylAcrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Nylon11", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 11", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Nylon11\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_UnsaturatedPolyesterResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Unsaturated polyester resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/UnsaturatedPolyesterResin\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polyphenylsulfone", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyphenylsulfone", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polyphenylsulfone\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Pullulan", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Pullulan", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Pullulan\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_EthylenePropyleneDieneMonomerRubber", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Ethylene propylene diene monomer rubber", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/EthylenePropyleneDieneMonomerRubber\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyMethylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyMethylAcrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylideneFluorideCoTrifluoroethylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-trifluoroethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylideneFluorideCoTrifluoroethylene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyMethylMethacrylateBlockPolyNButylAcrylateBlockPolyMethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)-block-poly(n-butyl acrylate)-block-poly(methyl methacrylate)\n", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyMethylMethacrylateBlockPolyNButylAcrylateBlockPolyMethylMethacrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyVinylPyrrolidone", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl pyrrolidone)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyVinylPyrrolidone\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_SodiumPolyacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Sodium polyacrylate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SodiumPolyacrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyButyleneTerephthalate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(butylene terephthalate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyButyleneTerephthalate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyGlycidylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(glycidyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyGlycidylMethacrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyAcrylonitrile", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(acrylonitrile)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyAcrylonitrile\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyAcrylicAcid", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(acrylic acid)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyAcrylicAcid\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_CelluloseAcetateButyrate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Cellulose acetate butyrate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CelluloseAcetateButyrate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_PolyMethylMethacrylateBlockPolyTButylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)-block-poly(t-butyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyMethylMethacrylateBlockPolyTButylAcrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_Polyisoprene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyisoprene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polyisoprene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_nanomine_org_compound_CarboxylatedAcrylonitrileButadieneRubber", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Carboxylated acrylonitrile butadiene rubber", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/CarboxylatedAcrylonitrileButadieneRubber\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod", + "label": "Processing Method", + "multiType": "union", + "name": "Processing Method", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Mixing", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Mixing", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Mixing\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Molding", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Molding", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Molding\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Drying_Evaporation", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Drying\u002fEvaporation", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Drying-Evaporation\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Heating", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Heating", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Heating\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Additive", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Additive", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Additive\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Solvent", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Solvent", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Solvent\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Cooling", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Cooling", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Cooling\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Extrusion", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Extrusion", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Extrusion\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_nanomine_org_ns_Curing", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Curing", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/ns/Curing\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_nanomine_org_ns_MassFraction", + "indep_vals": [], + "label": "Filler Property", + "name": "Mass Fraction", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://nanomine.org/ns/MassFraction\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_nanomine_org_ns_VolumeFraction", + "indep_vals": [], + "label": "Filler Property", + "name": "Volume Fraction", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://nanomine.org/ns/VolumeFraction\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_nanomine_org_ns_Density__http_www_ontology_of_units_of_measure_org_resource_om_2_gramPerCubicCentimetre", + "indep_vals": [], + "label": "Filler Property", + "name": "Filler Density", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "g\u002fcm\u00b3", + "value": "\u003chttp://nanomine.org/ns/Density\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_semanticscience_org_resource_Width__http_www_ontology_of_units_of_measure_org_resource_om_2_nanometre", + "indep_vals": [], + "label": "Filler Property", + "name": "Width", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/nanometre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "nm", + "value": "\u003chttp://semanticscience.org/resource/Width\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_nanomine_org_ns_SpecificSurfaceArea__http_www_ontology_of_units_of_measure_org_resource_om_2_squareMetrePerGram", + "indep_vals": [], + "label": "Filler Property", + "name": "Specific Surface Area", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/squareMetrePerGram", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "m\u00b2\u002fg", + "value": "\u003chttp://nanomine.org/ns/SpecificSurfaceArea\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_semanticscience_org_resource_AspectRatio", + "indep_vals": [], + "label": "Filler Property", + "name": "Aspect Ratio", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://semanticscience.org/resource/AspectRatio\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_nanomine_org_ns_Density__http_www_ontology_of_units_of_measure_org_resource_om_2_gramPerCubicCentimetre", + "indep_vals": [], + "label": "Matrix Property", + "name": "Matrix Density", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "g\u002fcm\u00b3", + "value": "\u003chttp://nanomine.org/ns/Density\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_nanomine_org_ns_Abbreviation", + "indep_vals": [], + "label": "Matrix Property", + "name": "Abbreviation", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://nanomine.org/ns/Abbreviation\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_nanomine_org_ns_ManufacturerOrSourceName", + "indep_vals": [], + "label": "Matrix Property", + "name": "Manufacturer Or Source Name", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://nanomine.org/ns/ManufacturerOrSourceName\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_nanomine_org_ns_TradeName", + "indep_vals": [], + "label": "Matrix Property", + "name": "Trade Name", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://nanomine.org/ns/TradeName\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Surface Treatment", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment__http_nanomine_org_compound_PolyMethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Poly(methyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/PolyMethylMethacrylate\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment__http_nanomine_org_compound_Polystyrene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Polystyrene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/Polystyrene\u003e" + }, + { + "class": "http://nanomine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment__http_nanomine_org_compound_SodiumPolyacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Sodium polyacrylate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://nanomine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "value": "\u003chttp://nanomine.org/compound/SodiumPolyacrylate\u003e" + } +] \ No newline at end of file diff --git a/whyis/materialsmine/templates/facet_values_20210625_HARDCODED.json b/whyis/materialsmine/templates/facet_values_20210625_HARDCODED.json new file mode 100644 index 00000000..99d5acf9 --- /dev/null +++ b/whyis/materialsmine/templates/facet_values_20210625_HARDCODED.json @@ -0,0 +1,2733 @@ +[ + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_GlassTransitionTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Glass Transition Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://materialsmine.org/ns/GlassTransitionTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_TensileModulus__http_www_ontology_of_units_of_measure_org_resource_om_2_gigapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Tensile Modulus", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gigapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "GPa", + "value": "\u003chttp://materialsmine.org/ns/TensileModulus\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_CrystallizationTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Crystallization Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://materialsmine.org/ns/CrystallizationTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_ElongationAtBreak__http_www_ontology_of_units_of_measure_org_resource_om_2_percent", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Elongation at Break", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/percent", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u0025", + "value": "\u003chttp://materialsmine.org/ns/ElongationAtBreak\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_DielectricRealPermittivity", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Dielectric Real Permittivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://materialsmine.org/ns/DielectricRealPermittivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_TensileStressAtBreak__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Tensile Stress at Break", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://materialsmine.org/ns/TensileStressAtBreak\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_ElectricalConductivity__http_qudt_org_vocab_unit_S_PER_CentiM", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Electrical conductivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://qudt.org/vocab/unit/S-PER-CentiM", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "S\u002fcm", + "value": "\u003chttp://materialsmine.org/ns/ElectricalConductivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_ThermalDecompositionTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Thermal Decomposition Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://materialsmine.org/ns/ThermalDecompositionTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_MeltingTemperature__http_www_ontology_of_units_of_measure_org_resource_om_2_degreeCelsius", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Melting Temperature", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/degreeCelsius", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u00b0C", + "value": "\u003chttp://materialsmine.org/ns/MeltingTemperature\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_TensileStressAtYield__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Tensile Stress at Yield", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://materialsmine.org/ns/TensileStressAtYield\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_FiberTensileStrength__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Fiber Tensile Strength", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://materialsmine.org/ns/FiberTensileStrength\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_HalflifeOfCrystallization__http_www_ontology_of_units_of_measure_org_resource_om_2_second_Time", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Halflife Of Crystallization", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/second-Time", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "s", + "value": "\u003chttp://materialsmine.org/ns/HalflifeOfCrystallization\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_FlexuralModulus__http_www_ontology_of_units_of_measure_org_resource_om_2_gigapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Flexural Modulus", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gigapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "GPa", + "value": "\u003chttp://materialsmine.org/ns/FlexuralModulus\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_VolumeResistivity__http_materialsmine_org_ns_unit_ohm_cm", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Volume Resistivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://materialsmine.org/ns/unit/ohm-cm", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u03a9-cm", + "value": "\u003chttp://materialsmine.org/ns/VolumeResistivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_ThermalConductivity__http_www_ontology_of_units_of_measure_org_resource_om_2_wattPerMetreKelvin", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Thermal Conductivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/wattPerMetreKelvin", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "W\u002fm-K", + "value": "\u003chttp://materialsmine.org/ns/ThermalConductivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_ElongationAtYield__http_www_ontology_of_units_of_measure_org_resource_om_2_percent", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Elongation at Yield", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/percent", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u0025", + "value": "\u003chttp://materialsmine.org/ns/ElongationAtYield\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_FlexuralStressAtBreak__http_www_ontology_of_units_of_measure_org_resource_om_2_megapascal", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Flexural Stress at Break", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/megapascal", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "MPa", + "value": "\u003chttp://materialsmine.org/ns/FlexuralStressAtBreak\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_SurfaceResistivity__http_materialsmine_org_ns_unit_ohm_cm", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Surface Resistivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://materialsmine.org/ns/unit/ohm-cm", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "\u03a9-cm", + "value": "\u003chttp://materialsmine.org/ns/SurfaceResistivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_HeatOfCrystallization__http_qudt_org_vocab_unit_j_per_gm", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Heat Of Crystallization", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://qudt.org/vocab/unit/j-per-gm", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "J\u002fg", + "value": "\u003chttp://materialsmine.org/ns/HeatOfCrystallization\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_Density__http_www_ontology_of_units_of_measure_org_resource_om_2_gramPerCubicCentimetre", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Density", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "g\u002fcm\u00b3", + "value": "\u003chttp://materialsmine.org/ns/Density\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_IZOD_ImpactEnergy__http_materialsmine_org_ns_unit_kj_m_2", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "IZOD Impact Energy", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://materialsmine.org/ns/unit/kj-m-2", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "kJ\u002fm\u00b2", + "value": "\u003chttp://materialsmine.org/ns/IZOD_ImpactEnergy\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_ThermalDiffusivity__http_materialsmine_org_ns_unit_mm_2_s", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Thermal Diffusivity", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://materialsmine.org/ns/unit/mm-2-s", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "mm\u00b2\u002fs", + "value": "\u003chttp://materialsmine.org/ns/ThermalDiffusivity\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_SpecificHeatCapacity_Cp__http_materialsmine_org_ns_unit_j_gk", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Specific Heat Capacity Cp", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://materialsmine.org/ns/unit/j-gk", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "J\u002fg-K", + "value": "\u003chttp://materialsmine.org/ns/SpecificHeatCapacity_Cp\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_InterphaseThickness__http_www_ontology_of_units_of_measure_org_resource_om_2_nanometre", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Interphase Thickness", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/nanometre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "nm", + "value": "\u003chttp://materialsmine.org/ns/InterphaseThickness\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "NanocompositeProperty", + "field": "NanocompositeProperty__http_materialsmine_org_ns_CharpyImpactEnergy__http_materialsmine_org_ns_unit_kj_m_2", + "indep_vals": [], + "independentVariables": "\u003chttp://semanticscience.org/resource/inRelationTo\u003e", + "label": "Nanocomposite Property", + "name": "Charpy Impact Energy", + "predicate": "\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://materialsmine.org/ns/unit/kj-m-2", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "kJ\u002fm\u00b2", + "value": "\u003chttp://materialsmine.org/ns/CharpyImpactEnergy\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "facetId": "FillerType", + "field": "FillerType", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Filler Material", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_SiliconDioxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silicon dioxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SiliconDioxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_MultiWallCarbonNanotubes", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Multi-wall carbon nanotubes", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/MultiWallCarbonNanotubes\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_BariumTitanate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Barium titanate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/BariumTitanate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_TitaniumDioxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Titanium dioxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/TitaniumDioxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Graphene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Graphene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_CarbonBlack", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Carbon black", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CarbonBlack\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_AluminiumOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Aluminium oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/AluminiumOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Graphite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Graphite\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Silver", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silver", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Silver\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_GrapheneOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphene oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/GrapheneOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_ZincOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Zinc oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/ZincOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Montmorillonite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Montmorillonite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Montmorillonite\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_ReducedGrapheneOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Reduced graphene oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/ReducedGrapheneOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_SingleWallCarbonNanotubes", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Single-wall carbon nanotubes", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SingleWallCarbonNanotubes\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_AluminiumHydroxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Aluminium hydroxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/AluminiumHydroxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_GraphiteOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Graphite oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/GraphiteOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_BariumStrontiumTitanate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Barium strontium titanate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/BariumStrontiumTitanate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Cellulose", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Cellulose", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Cellulose\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_OctaAminophenylPolyhedralOligomericSilsesquioxane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Octa(aminophenyl) polyhedral oligomeric silsesquioxane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/OctaAminophenylPolyhedralOligomericSilsesquioxane\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_CarbonNanofibers", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Carbon nanofibers", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CarbonNanofibers\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_MagnesiumOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Magnesium oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/MagnesiumOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_CalciumCarbonate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Calcium carbonate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CalciumCarbonate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_IronOxideBariumTitanateCoreShellNanoparticles", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Iron oxide - barium titanate core-shell nanoparticles", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/IronOxideBariumTitanateCoreShellNanoparticles\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_CalciumCopperTitanate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Calcium copper titanate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CalciumCopperTitanate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_SilverHexafluoroantimonate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silver hexafluoroantimonate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SilverHexafluoroantimonate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_IronIiIiiOxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Iron(II,III) oxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/IronIiIiiOxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_SilverNitrate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silver nitrate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SilverNitrate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_ZirconiumDioxide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Zirconium dioxide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/ZirconiumDioxide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_OctakisDimethylsiloxyhexafluoropropylglycidylEtherSilsesquioxane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Octakis(dimethylsiloxyhexafluoropropylglycidyl ether)silsesquioxane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/OctakisDimethylsiloxyhexafluoropropylglycidylEtherSilsesquioxane\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Polyaniline", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Polyaniline", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polyaniline\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Bentonite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Bentonite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Bentonite\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_DodecylbenzenesulfonicAcid", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Dodecylbenzenesulfonic acid", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/DodecylbenzenesulfonicAcid\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Gold", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Gold", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Gold\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_SodiumTitanateNanotubes", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Sodium titanate nanotubes", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SodiumTitanateNanotubes\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_TriphenylPhosphate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Triphenyl phosphate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/TriphenylPhosphate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Clay", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Clay", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Clay\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Aluminium", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Aluminium", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Aluminium\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_FluorineMica", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Fluorine mica", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/FluorineMica\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_Sepiolite", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Sepiolite", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Sepiolite\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_SiliconCarbide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Silicon carbide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SiliconCarbide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_9Anthracenemethanol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "9-Anthracenemethanol", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/9Anthracenemethanol\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "FillerType", + "field": "FillerType__http_materialsmine_org_compound_MineralOil", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "name": "Mineral oil", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/MineralOil\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "facetId": "MatrixType", + "field": "MatrixType", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Matrix Material", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_DgebaEpoxyResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "DGEBA Epoxy Resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/DgebaEpoxyResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyMethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyMethylMethacrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polystyrene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polystyrene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polystyrene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyEthylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyEthylene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyEthyleneGlycol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene glycol)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyEthyleneGlycol\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylideneFluoride", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylideneFluoride\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyBisphenolACarbonate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(bisphenol A carbonate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyBisphenolACarbonate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_SiliconeRubber", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Silicone rubber", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SiliconeRubber\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyPropylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(propylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyPropylene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_CycloaliphaticEpoxyResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Cycloaliphatic Epoxy Resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CycloaliphaticEpoxyResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylideneFluorideCoTrifluoroethyleneCoChlorotrifluoroethylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-trifluoroethylene-co-chlorotrifluoroethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylideneFluorideCoTrifluoroethyleneCoChlorotrifluoroethylene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_BisphenolAPhthalonitrileResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Bisphenol-A phthalonitrile resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/BisphenolAPhthalonitrileResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Poly2VinylPyridine", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(2-vinyl pyridine)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Poly2VinylPyridine\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylAlcohol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl alcohol)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylAlcohol\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polyimide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyimide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polyimide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylideneFluorideCoHexafluoropropylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-hexafluoropropylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylideneFluorideCoHexafluoropropylene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolylacticAcid", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polylactic acid", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolylacticAcid\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polyurethane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyurethane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polyurethane\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_BisphenolAEpoxyVinylEsterResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Bisphenol-A-epoxy vinyl ester resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/BisphenolAEpoxyVinylEsterResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_DgebfEpoxyResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "DGEBF Epoxy Resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/DgebfEpoxyResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylButyral", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl butyral)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylButyral\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyStyreneBButadiene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(styrene-b-butadiene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyStyreneBButadiene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polybenzimidazole", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polybenzimidazole", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polybenzimidazole\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_NeopentylGlycolDiglycidylEther", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Neopentyl glycol diglycidyl ether", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/NeopentylGlycolDiglycidylEther\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylChloride", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl chloride)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylChloride\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyamideImide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyamide-imide", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyamideImide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyStyreneCoAcrylonitrile", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(styrene-co-acrylonitrile)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyStyreneCoAcrylonitrile\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_BisphenolECyanateEsterResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Bisphenol E cyanate ester resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/BisphenolECyanateEsterResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Nylon66", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 6-6", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Nylon66\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyEthyleneTerephthalate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene terephthalate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyEthyleneTerephthalate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Nylon6", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 6", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Nylon6\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyButyleneAdipateCoTerephthalate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(butylene adipate-co-terephthalate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyButyleneAdipateCoTerephthalate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyStyreneBEthyleneRanButyleneBStyrene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly[styrene-b-(ethylene-ran-butylene)-b-styrene]", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyStyreneBEthyleneRanButyleneBStyrene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Poly2HydroxyethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(2-hydroxyethyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Poly2HydroxyethylMethacrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Tetraglycidyl44DiaminodiphenylMethane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Tetraglycidyl 4,4\u0027-diaminodiphenyl methane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Tetraglycidyl44DiaminodiphenylMethane\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_TriglycidylParaAminophenol", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Triglycidyl para-aminophenol", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/TriglycidylParaAminophenol\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_CyclicOlefinCopolymer", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Cyclic olefin copolymer", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CyclicOlefinCopolymer\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyEthyleneVinylAcetate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(ethylene-vinyl acetate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyEthyleneVinylAcetate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polyrotaxane", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyrotaxane", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polyrotaxane\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Poly2HydroxyethylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(2-hydroxyethyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Poly2HydroxyethylAcrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylideneFluorideCoChlorotrifluoroethylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-chlorotrifluoroethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylideneFluorideCoChlorotrifluoroethylene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyAcrylamide", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(acrylamide)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyAcrylamide\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolybutyleneSuccinate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polybutylene succinate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolybutyleneSuccinate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polybutadiene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polybutadiene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polybutadiene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Nylon12", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 12", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Nylon12\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylAcetate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl acetate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylAcetate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Nylon63T", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 6(3)T", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Nylon63T\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyMethylMethacrylateBlockPolyNButylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)-block-poly(n-butyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyMethylMethacrylateBlockPolyNButylAcrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Nylon11", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Nylon 11", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Nylon11\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_UnsaturatedPolyesterResin", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Unsaturated polyester resin", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/UnsaturatedPolyesterResin\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polyphenylsulfone", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyphenylsulfone", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polyphenylsulfone\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Pullulan", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Pullulan", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Pullulan\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_EthylenePropyleneDieneMonomerRubber", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Ethylene propylene diene monomer rubber", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/EthylenePropyleneDieneMonomerRubber\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyMethylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyMethylAcrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylideneFluorideCoTrifluoroethylene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinylidene fluoride-co-trifluoroethylene)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylideneFluorideCoTrifluoroethylene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyMethylMethacrylateBlockPolyNButylAcrylateBlockPolyMethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)-block-poly(n-butyl acrylate)-block-poly(methyl methacrylate)\n", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyMethylMethacrylateBlockPolyNButylAcrylateBlockPolyMethylMethacrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyVinylPyrrolidone", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(vinyl pyrrolidone)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyVinylPyrrolidone\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_SodiumPolyacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Sodium polyacrylate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SodiumPolyacrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyButyleneTerephthalate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(butylene terephthalate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyButyleneTerephthalate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyGlycidylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(glycidyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyGlycidylMethacrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyAcrylonitrile", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(acrylonitrile)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyAcrylonitrile\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyAcrylicAcid", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(acrylic acid)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyAcrylicAcid\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_CelluloseAcetateButyrate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Cellulose acetate butyrate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CelluloseAcetateButyrate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_PolyMethylMethacrylateBlockPolyTButylAcrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Poly(methyl methacrylate)-block-poly(t-butyl acrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyMethylMethacrylateBlockPolyTButylAcrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_Polyisoprene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Polyisoprene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polyisoprene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixType", + "field": "MatrixType__http_materialsmine_org_compound_CarboxylatedAcrylonitrileButadieneRubber", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "multiType": "union", + "name": "Carboxylated acrylonitrile butadiene rubber", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/CarboxylatedAcrylonitrileButadieneRubber\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod", + "label": "Processing Method", + "multiType": "union", + "name": "Processing Method", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Mixing", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Mixing", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Mixing\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Molding", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Molding", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Molding\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Drying_Evaporation", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Drying\u002fEvaporation", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Drying-Evaporation\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Heating", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Heating", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Heating\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Additive", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Additive", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Additive\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Solvent", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Solvent", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Solvent\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Cooling", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Cooling", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Cooling\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Extrusion", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Extrusion", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Extrusion\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "ProcessingMethod", + "field": "ProcessingMethod__http_materialsmine_org_ns_Curing", + "indep_vals": [], + "label": "Processing Method", + "multiType": "union", + "name": "Curing", + "predicate": "\u003chttp://www.w3.org/ns/prov#wasGeneratedBy\u003e/\u003chttp://semanticscience.org/resource/hasPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/ns/Curing\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_materialsmine_org_ns_MassFraction", + "indep_vals": [], + "label": "Filler Property", + "name": "Mass Fraction", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://materialsmine.org/ns/MassFraction\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_materialsmine_org_ns_VolumeFraction", + "indep_vals": [], + "label": "Filler Property", + "name": "Volume Fraction", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://materialsmine.org/ns/VolumeFraction\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_materialsmine_org_ns_Density__http_www_ontology_of_units_of_measure_org_resource_om_2_gramPerCubicCentimetre", + "indep_vals": [], + "label": "Filler Property", + "name": "Filler Density", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "g\u002fcm\u00b3", + "value": "\u003chttp://materialsmine.org/ns/Density\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_semanticscience_org_resource_Width__http_www_ontology_of_units_of_measure_org_resource_om_2_nanometre", + "indep_vals": [], + "label": "Filler Property", + "name": "Width", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/nanometre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "nm", + "value": "\u003chttp://semanticscience.org/resource/Width\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_materialsmine_org_ns_SpecificSurfaceArea__http_www_ontology_of_units_of_measure_org_resource_om_2_squareMetrePerGram", + "indep_vals": [], + "label": "Filler Property", + "name": "Specific Surface Area", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/squareMetrePerGram", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "m\u00b2\u002fg", + "value": "\u003chttp://materialsmine.org/ns/SpecificSurfaceArea\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "facetId": "FillerProperty", + "field": "FillerProperty__http_semanticscience_org_resource_AspectRatio", + "indep_vals": [], + "label": "Filler Property", + "name": "Aspect Ratio", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?fillerPart. ?fillerPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Filler\u003e]. ?fillerPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://semanticscience.org/resource/AspectRatio\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_materialsmine_org_ns_Density__http_www_ontology_of_units_of_measure_org_resource_om_2_gramPerCubicCentimetre", + "indep_vals": [], + "label": "Matrix Property", + "name": "Matrix Density", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "unit": "http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "unit_label": "g\u002fcm\u00b3", + "value": "\u003chttp://materialsmine.org/ns/Density\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_materialsmine_org_ns_Abbreviation", + "indep_vals": [], + "label": "Matrix Property", + "name": "Abbreviation", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://materialsmine.org/ns/Abbreviation\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_materialsmine_org_ns_ManufacturerOrSourceName", + "indep_vals": [], + "label": "Matrix Property", + "name": "Manufacturer Or Source Name", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://materialsmine.org/ns/ManufacturerOrSourceName\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "MatrixProperty", + "field": "MatrixProperty__http_materialsmine_org_ns_TradeName", + "indep_vals": [], + "label": "Matrix Property", + "name": "Trade Name", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/hasAttribute\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e ?matrixPart. ?matrixPart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/Matrix\u003e]. ?matrixPart \u003chttp://semanticscience.org/resource/hasAttribute\u003e/rdf:type ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unitPredicate": "\u003chttp://semanticscience.org/resource/hasUnit\u003e", + "value": "\u003chttp://materialsmine.org/ns/TradeName\u003e", + "valuePredicate": "\u003chttp://semanticscience.org/resource/hasValue\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Surface Treatment", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "unit_label": "All" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment__http_materialsmine_org_compound_PolyMethylMethacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Poly(methyl methacrylate)", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/PolyMethylMethacrylate\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment__http_materialsmine_org_compound_Polystyrene", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Polystyrene", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "nominal", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/Polystyrene\u003e" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "1", + "facetId": "SurfaceTreatment", + "field": "SurfaceTreatment__http_materialsmine_org_compound_SodiumPolyacrylate", + "indep_vals": [], + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "multiType": "union", + "name": "Sodium polyacrylate", + "predicate": "\u003chttp://semanticscience.org/resource/hasComponentPart\u003e", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty", + "specifier": "?id \u003chttp://semanticscience.org/resource/hasComponentPart\u003e/\u003chttp://semanticscience.org/resource/isSurroundedBy\u003e ?surfacePart. ?surfacePart \u003chttp://semanticscience.org/resource/hasRole\u003e [ a \u003chttp://materialsmine.org/ns/SurfaceTreatment\u003e]. ?surfacePart a ?value.", + "type": "quantitative", + "typeProperty": "rdf:type", + "value": "\u003chttp://materialsmine.org/compound/SodiumPolyacrylate\u003e" + } +] \ No newline at end of file diff --git a/whyis/materialsmine/templates/home_view.html b/whyis/materialsmine/templates/home_view.html new file mode 100644 index 00000000..7c53e0e4 --- /dev/null +++ b/whyis/materialsmine/templates/home_view.html @@ -0,0 +1,25 @@ +{% extends "base.html" %} + +{% from "_macros.html" import render_resource_link, render_rdfa_resource_link, get_label, facts_panel, summary_panel, content %} +{% block title %}{{config['site_name']}}{% endblock %} + +{% block pageheader %} +

+
+

{{title()}}

+ {% if 'site_description' in config %} +

{{config['site_description']}}

+ {% else %} + {% for property, value in g.get_summary(this.description())%} +

{{value}}

+ {% endfor %} + {% endif %} +
+
+{% endblock %} + +{% block content %} + + + +{% endblock %} diff --git a/whyis/materialsmine/templates/pnc_facets.json b/whyis/materialsmine/templates/pnc_facets.json new file mode 100644 index 00000000..ea8fcda4 --- /dev/null +++ b/whyis/materialsmine/templates/pnc_facets.json @@ -0,0 +1,78 @@ +[ + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "label": "Nanocomposite Property", + "facetId" : "NanocompositeProperty", + "predicate": "", + "typeProperty" : "rdf:type", + "independentVariables" : "", + "valuePredicate" : "", + "unitPredicate" : "", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Filler Material", + "multiType": "union", + "facetId" : "FillerType", + "predicate": "", + "typeProperty" : "rdf:type", + "specifier" : "?id ?fillerPart. ?fillerPart [ a ]. ?fillerPart a ?value.", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Matrix Material", + "facetId" : "MatrixType", + "multiType": "union", + "predicate": "", + "typeProperty" : "rdf:type", + "specifier" : "?id ?matrixPart. ?matrixPart [ a ]. ?matrixPart a ?value.", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "label": "Processing Method", + "facetId" : "ProcessingMethod", + "multiType": "union", + "predicate": "/", + "typeProperty" : "rdf:type", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "count": "25", + "label": "Filler Property", + "facetId" : "FillerProperty", + "predicate": "/", + "typeProperty" : "rdf:type", + "valuePredicate" : "", + "unitPredicate" : "", + "specifier" : "?id ?fillerPart. ?fillerPart [ a ]. ?fillerPart /rdf:type ?value.", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "label": "Matrix Property", + "facetId" : "MatrixProperty", + "typeProperty" : "rdf:type", + "valuePredicate" : "", + "unitPredicate" : "", + "predicate": "/", + "specifier" : "?id ?matrixPart. ?matrixPart [ a ]. ?matrixPart /rdf:type ?value.", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + }, + { + "class": "http://materialsmine.org/ns/PolymerNanocomposite", + "inverse": "http://semanticscience.org/resource/isComponentPartOf", + "label": "Surface Treatment", + "facetId" : "SurfaceTreatment", + "multiType": "union", + "predicate": "", + "typeProperty" : "rdf:type", + "specifier" : "?id / ?surfacePart. ?surfacePart [ a ]. ?surfacePart a ?value.", + "propertyType": "http://www.w3.org/2002/07/owl#ObjectProperty" + } +] diff --git a/whyis/materialsmine/templates/readme.md b/whyis/materialsmine/templates/readme.md new file mode 100644 index 00000000..e69de29b diff --git a/whyis/materialsmine/templates/visualization.html b/whyis/materialsmine/templates/visualization.html new file mode 100644 index 00000000..6d0a5bd3 --- /dev/null +++ b/whyis/materialsmine/templates/visualization.html @@ -0,0 +1,707 @@ + + + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+

Nanomine Visualization Dashboard

+

Welcome! Explore a series of visualization revealing data information by clicking on the buttons in the navigation bar.

+
+ +
+
+
+

In this prototype data visualizer, data in NanoMine are visualized in various ways. At present, four functions are being developed and preliminary versions are available in the navigation bar:

+

• Filler Descriptors vs. Material Property:to see impact of the filler features on the final properties.

+

• Material Property Dashboard:to explore the correlations between two selected properties.

+

• Material Spectrum:to examine the relationshipsbetween the features and the properties of a specific composite or a certain matrix or filler of interest.

+

• Database Overview (under construction) will offera visual summary of the data in NanoMine.

+ +
+ + +

While many of these functions are under construction, an example illustrating the types of visualizations which will be readily available in the next months is below.

+

To re-createthe sample visualization shown below:

+

• select the first tab (“filler descriptor vs material property”)

+

• select“mass fraction”as the x-axis

+

• select “glass transition temperature” as the y-axis

+

• Refinement can be obtained by playing with other features on the page

+

• A table below the graph contains the information of the graph in tabular form and will eventually point to individual records for each sample.

+

• In a month, there will be control samples labeled as such in NanoMine allowing for difference in property plots. ????

+ +
+
+
+
+ + + \ No newline at end of file diff --git a/whyis/materialsmine/tests/README.md b/whyis/materialsmine/tests/README.md new file mode 100644 index 00000000..d959d628 --- /dev/null +++ b/whyis/materialsmine/tests/README.md @@ -0,0 +1,53 @@ +* The autoparser currently allows for automatic testing of the following categories: + * PNC Present + * Authors + * Keywords + * DOI Number + * Language + * Journal Volume + * Matrix Chemical Names + * Matrix Chemical Trade Names + * Filler Chemical Names + * Filler Chemical Trade Names + * Devices + * Temperatures + * Material Properties Combined (ensuring properties are properly associated) + +* This list will be expanded as new automated tests are developed + +* The autoparser and all actual testing code are in `ingest_tester.py` + +# An Intro to Unit Tests for Nanomine +* Tristan Protzman +* protzt@rpi.edu + +Hopefully this should outline the basics of expanding the unit tests for the xml ingest SELTr script use by the Nanomine project. + +### Identifying tests +* To start, I had been printing all the triples generated and seeing what was in there, and writing tests to verify that those work more broadly than in a specific file. +* Now that a lot of the backlog has been worked through, I have been addressing topics as Neha or I added them. +* Effective tests will target a specific property that has a definite value to be compared against. + * i.e. the mass of a sample or the chemical abbreviation. + +### Writing tests +* All reusable test code (queries, comparison, general processing) should go in `ingest_tester.py`. + * This file is then imported by files which test specific files. + * The general pattern for this file is query the graph, process the results, and compare to expected values. + * Determining the query has mostly been done by examining the ingest SETLr script to determine what the expected structure is, and verifying with those more knowledgeable in the subject than I when questions arise. + * Processing the data usually is just a list comprehension to pull desired parameter out of the returned results + * Finally, using `unittest.assertEqual()` (or `unittest.assertCountEqual()` for lists of data) to verify that the query matches the expected result. +* Then, in a python file per xml file we wish to test, we fill in the expected results and call the testing function. + * `auto_test_template.py` can be used as a template, though it should not be modified + * Extend `template.IngestTestSetup` to get all the functionality needed. + * Can instead extend `template.IngestTestTests` to get an automated test suite, + * In most cases `rdflib` will need to be imported as well to instantiate the expected data as a `rdflib.Literal()`. + * Each test should be its own function within the class for more granular pass/fail results. + +### Automated testing +* Things have kinda fallen off here, but the infrastructure is in place to run automatic testing on large numbers of files. + * At the top of `ingest_tester.py` is the `autoparse` function which can read through the xml file to pull information from it, in effect loading the expected data automatically. + * The tests can then look for this data to automatically run tests. + * Tests which we want to be ran automatically should be placed in the `IngestTestTests` class in `template.py` +* These tests can be then executed automatically with the `auto_tester.py` script, which can be supplied with a number of files to test and a `--scramble` parameter to randomize which files are tested. +* I believe this functionally works, though I admit it's been a while since I've worked on it. +* The tests can also be run through whyis using `python manage.py test --apponly` diff --git a/whyis/materialsmine/tests/__init__.py b/whyis/materialsmine/tests/__init__.py new file mode 100644 index 00000000..e69de29b diff --git a/whyis/materialsmine/tests/auto_test_template.py b/whyis/materialsmine/tests/auto_test_template.py new file mode 100644 index 00000000..4d0611ab --- /dev/null +++ b/whyis/materialsmine/tests/auto_test_template.py @@ -0,0 +1,16 @@ +# Note: Do not edit this, it is copied and used as a template for batch testing +# Add any new tests to test_template.IngestTestTests instead, as this will then run +# them while doing batch testing. If you wish to test a specific file, this serves +# as a starting point which can be worked from + +from . import ingest_tester +from . import template + +file_under_test = "" + +class IngestTestRunner(test_template.IngestTestTests): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() diff --git a/whyis/materialsmine/tests/auto_tester.py b/whyis/materialsmine/tests/auto_tester.py new file mode 100644 index 00000000..90e7918e --- /dev/null +++ b/whyis/materialsmine/tests/auto_tester.py @@ -0,0 +1,69 @@ +import os +import subprocess +import sys +import time +import random +from SPARQLWrapper import SPARQLWrapper, JSON + +def main(argv): + run_all = True + to_run = 0 + if len(argv) >= 2: + run_all = False + to_run = int(argv[1]) + endpoint = SPARQLWrapper("https://materialsmine.org/wi/sparql") + endpoint.setQuery( + ''' + SELECT DISTINCT ?article WHERE { + ?doi a . + ?doi ?article . + } + ''' + ) + endpoint.setReturnFormat(JSON) + results = endpoint.query().convert() + files = [uri["article"]["value"].replace("http://nanomine.org/sample/", "").replace("-", "_").title() + for uri in results["results"]["bindings"]] + + + if os.path.exists("/apps/nanomine-graph/tests/output.txt"): + os.remove("/apps/nanomine-graph/tests/output.txt") + + tests_ran = 0 + tests_failed = 0 + if "--scramble" in argv: + random.shuffle(files) + for uri in files: + sys.stdout.write(uri + "...") + tests_ran += 1 + test_text = str() + with open("/apps/nanomine-graph/tests/auto_tester.py", "r") as f: + test_text = f.read() + test_text = test_text.replace("", uri) + with open("/apps/nanomine-graph/tests/test_auto_active.py", "w") as f: + f.write(test_text) + std_err = subprocess.run(["/apps/whyis/venv/bin/python", "manage.py", "test", "--test=test_auto_active"], stdout=subprocess.DEVNULL, stderr=subprocess.PIPE).stderr.decode("utf-8") + if "FAILED" in std_err or "ERROR" in std_err: # We want to catch any tests that fail or error to investigate them + print(" FAIL") + tests_failed += 1 + with open("/apps/nanomine-graph/tests/output.txt", "a") as outfile: + outfile.write("*" * 20 + uri + "*" * 20) + # outfile.write("\nSTDOUT\n") + # outfile.write(std_out) + outfile.write("\nSTDERR\n") + outfile.write(std_err) + outfile.write("\n" + "*" * 45) + outfile.write("\n\n\n") + else: + print(" PASS") + os.remove("/apps/nanomine-graph/tests/test_auto_active.py") + if not run_all and tests_ran >= to_run: + break + return tests_ran, tests_failed + + +if __name__ == "__main__": + start = time.time() + tests_ran, tests_failed = main(sys.argv) + end = time.time() + print("{}/{} tests passed in {:.1f} seconds".format(tests_ran - tests_failed, tests_ran, end - start)) \ No newline at end of file diff --git a/whyis/materialsmine/tests/ingest_tester.py b/whyis/materialsmine/tests/ingest_tester.py new file mode 100644 index 00000000..bfaaf521 --- /dev/null +++ b/whyis/materialsmine/tests/ingest_tester.py @@ -0,0 +1,756 @@ +import json +import requests +import tempfile +import xml.etree.ElementTree as ET +import pandas as pd +import rdflib +import slugify +import os + +from urllib3.util.retry import Retry +from requests.adapters import HTTPAdapter + +from base64 import b64encode + +import autonomic + +disabled = [] + +files = { + "template": ''' a , + , + ; + "data:text/xml;charset=UTF-8;base64,%s" .''' +} + + +def get_remote_xml(file_under_test): + """ Given an nanomine file returns the xml string """ + s = requests.Session() + retries = Retry(total=5, backoff_factor=1, status_forcelist=[500, 502, 503, 504], raise_on_redirect=True, raise_on_status=True) + s.mount("http://", HTTPAdapter(max_retries=retries)) + response = s.get('https://materialsmine.org/nmr/xml/' + file_under_test + '.xml', timeout=5) + j = json.loads(response.text) + xml_str = j["data"][0]["xml_str"] + return xml_str + + +def get_local_xml(file_under_test): + """ Attempts to load a given file from the local /tests/xml/ folder """ + file_under_test += ".xml" + test_folder_path = os.path.abspath(os.path.dirname(__file__)) + file_path = os.path.join(test_folder_path, "xml", file_under_test) + print (file_path) + with open(file_path) as f: + return f.read() + +def get_xml(file_under_test): + #try: + return get_local_xml(file_under_test) + #except FileNotFoundError: + # print("File not found locally, loading from server...") + # return get_remote_xml(file_under_test) + +def disable_test(func): + disabled.append(func.__name__) + print(func.__name__, "is disabled and will not run") + def disable(*args, **kwargs): + print(func.__name__, "has been disabled") + return disable + + +def setUp(runner, file_under_test): + # Skip setting up disabled tests + if os.getenv("CI") is not None: + if runner._testMethodName in disabled: + print("Skipping test", str(runner._testMethodName), "in CI since it is disabled") + return + # Initialization + runner.login(*runner.create_user("user@example.com", "password")) + + xml_str = get_xml(file_under_test) + encoded_file = b64encode(xml_str.encode('utf8')) + + print ("XML length:", len(encoded_file)) + files[file_under_test] = files["template"] % (file_under_test, encoded_file) + upload = files[file_under_test] + + response = runner.client.post("/pub", data=upload, content_type="text/turtle", follow_redirects=True) + runner.assertEquals(response.status, '201 CREATED') + + response = runner.client.post("/pub", data=open('/apps/nanomine-graph/setl/xml_ingest.setl.ttl', 'rb').read(), + content_type="text/turtle", follow_redirects=True) + runner.assertEquals(response.status, '201 CREATED') + + fileid = runner.app.db.value(rdflib.URIRef('https://materialsmine.org/nmr/xml/'+file_under_test), + rdflib.URIRef('http://vocab.rpi.edu/whyis/hasFileID')) + runner.assertNotEquals(fileid,None) + setlmaker = autonomic.SETLMaker() + results = runner.run_agent(setlmaker) + + # confirm this is creating a SETL script for the XML file. + runner.assertTrue(len(results) > 0) + + setlr = autonomic.SETLr() + + print(len(runner.app.db)) + for setlr_np in results: + print (setlr_np.serialize(format="trig").decode('utf8')) + setlr_results = runner.run_agent(setlr, nanopublication=setlr_np) + + +def test_non_spherical_shape(runner, expected_widthDescription=None, expected_width=None, expected_lengthDescription=None, expected_length=None, expected_depthDescription=None, expected_depth=None): + print("\n\nNon Spherical Shape") + dimensions = runner.app.db.query( + """ + SELECT ?widthValue ?lengthValue ?depthValue ?lengthDesc ?widthDesc ?depthDesc WHERE{ + ?bnode . + ?bnode . + ?bnode ?widthValue . + ?bnode ?widthDesc . + ?bnode1 . + ?bnode1 . + ?bnode1 ?lengthValue . + ?bnode1 ?lengthDesc . + ?bnode2 . + ?bnode2 . + ?bnode2 ?depthValue . + ?bnode2 ?depthDesc . + } + """ + ) + width_value = [dim["widthValue"] for dim in dimensions] + runner.assertEqual(expected_width, width_value[0]) + length_value = [dim["lengthValue"] for dim in dimensions] + runner.assertEqual(expected_length, length_value[0]) + depth_value = [dim["depthValue"] for dim in dimensions] + runner.assertEqual(expected_depth, depth_value[0]) + width_desc = [dim["widthDesc"] for dim in dimensions] + runner.assertEqual(expected_widthDescription, width_desc[0]) + length_desc = [dim["lengthDesc"] for dim in dimensions] + runner.assertEqual(expected_lengthDescription, length_desc[0]) + depth_desc = [dim["depthDesc"] for dim in dimensions] + runner.assertEqual(expected_depthDescription, depth_desc[0]) + print("Expected Non Spherical Dimensions and descriptions found") + +def query_table(runner, dependentVar, independentVar, + measurement_description=None, x_description=None, y_description=None): + + if measurement_description is not None: + measurement_description = '?sample "{}" .'.format(measurement_description) + else: + measurement_description = "" + + if x_description is not None: + x_description = '?independentVarNode "{}" .'.format(x_description) + else: + x_description = "" + + if y_description is not None: + y_description = '?dependentVarNode "{}" .'.format(y_description) + else: + y_description = "" + + + + query = """ + SELECT ?dependentVar ?independentVar + WHERE {{ + ?sample ?dependentVarNode . + ?dependentVarNode a {} . + ?dependentVarNode ?dependentVar . + ?dependentVarNode ?independentVarNode . + ?independentVarNode a {} . + ?independentVarNode ?independentVar . + {} + {} + {} + }} + """.format(dependentVar, independentVar, measurement_description, x_description, y_description) + # print(query) + values = runner.app.db.query(query) + return values + + + + +def autoparse(file_under_test): + # Parses out information from the specified file for verification the the correct data + # ends up in the graph + with tempfile.TemporaryFile() as temp: + xml_str = get_remote_xml(file_under_test) + temp.write(xml_str.encode('utf-8')) + temp.seek(0) + tree = ET.parse(temp) + + root = tree.getroot() + expected_data = dict() + # CommonFields Data + # common_fields = next(root.iter("CommonFields")) + expected_data["authors"] = [ + elem.text for elem in root.findall(".//CommonFields//Author")] + expected_data["keywords"] = [elem.text.title() + for elem in root.findall(".//CommonFields//Keyword")] + expected_data["DOI"] = [elem.text.title() + for elem in root.findall(".//CommonFields//DOI")] + expected_data["language"] = ["http://nanomine.org/language/" + elem.text.lower() + for elem in root.findall(".//CommonFields//Language")] + expected_data["journ_vol"] = [ + rdflib.Literal(int(val.text)) for val in root.findall(".//CommonFields//Volume")] + + # Matrix Data + # matrix_data = next(root.iter("Matrix")) + expected_data["m_name"] = [rdflib.Literal(elem.text) + for elem in root.findall(".//Matrix//ChemicalName")] + expected_data["m_trd_name"] = [ + rdflib.Literal(elem.text) for elem in root.findall(".//Matrix//TradeName")] + expected_data["abbrev"] = [rdflib.Literal(elem.text) + for elem in root.findall(".//Matrix//Abbreviation")] + expected_data["manufac"] = [ + rdflib.Literal(elem.text) for elem in root.findall(".//Matrix//ManufacturerOrSourceName")] + expected_data["specific_surface_area"] = [ + rdflib.Literal(elem.text, datatype=rdflib.XSD.double) for elem in root.findall(".//Matrix//SurfaceArea/specific/value")] + expected_data["specific_surface_area_units"] = [ + rdflib.Literal(elem.text) for elem in root.findall(".//Matrix//SurfaceArea/specific/unit")] + + # Filler data + # filler_data = next(root.iter("Filler")) + expected_data["f_name"] = [rdflib.Literal(elem.text) + for elem in root.findall(".//Filler//ChemicalName")] + expected_data["f_trd_name"] = [ + rdflib.Literal(elem.text) for elem in root.findall(".//Filler//TradeName")] + expected_data["abbrev"] += [rdflib.Literal(elem.text) + for elem in root.findall(".//Filler//Abbreviation")] + expected_data["manufac"] += [rdflib.Literal(elem.text) + for elem in root.findall(".//Filler//ManufacturerOrSourceName")] + expected_data["specific_surface_area"] += [ + rdflib.Literal(elem.text, datatype=rdflib.XSD.double) for elem in root.findall(".//Filler//SurfaceArea/specific/value")] + expected_data["specific_surface_area_units"] += [ + rdflib.Literal(elem.text) for elem in root.findall(".//Filler//SurfaceArea/specific/unit")] + + #Viscoleastic Properties,hardness, hardnessteststandard - Neha + expected_data["viscoelastic_measurement_mode"] = [rdflib.Literal(elem.text) + for elem in root.iter(".//Viscoelastic//MeasurementMode")] + + expected_data["hardness"] = [rdflib.Literal(elem.text) + for elem in root.iter("Hardness")] + + expected_data["hardnessteststandard"] = [rdflib.Literal(elem.text) + for elem in root.iter(".//HardnessTestStandard")] + + expected_data["melt_viscosity_values"] = [rdflib.Literal(elem.text) + for elem in root.iter("Author")] + + + # Check that matrix and filler components are properly constructed + def build_component_dict(component): + material = dict() + material["name"] = component.find(".//ChemicalName") + material["abbrev"] = component.find(".//Abbreviation") + material["manufac"] = component.find(".//ManufacturerOrSourceName") + material["trade"] = component.find(".//TradeName") + for key, value in material.items(): + if value is not None: + material[key] = rdflib.Literal(material[key].text) + return material + + expected_data["compiled_material"] = [build_component_dict( + component) for component in root.findall(".//MatrixComponent")] + expected_data["compiled_material"] += [build_component_dict( + component) for component in root.findall(".//FillerComponent")] + + def extract_choose_parameter(section): + if section is None: + return None + order = list() + for param in section.findall(".//ChooseParameter"): + for component in param: + order.append(component.tag) + return order + + expected_data["filler_processing"] = extract_choose_parameter(root.find(".//FillerProcessing")) + expected_data["solution_processing"] = extract_choose_parameter(root.find(".//SolutionProcessing")) + + # Table data + + def extract_table_data(data_tag): + if data_tag is None: + return None + if data_tag.find("data") is None: + return None + table = dict() # Holds the description, headers, and dataframe + table["description"] = data_tag.find(".//description").text + table["headers"] = [elem.text for elem in data_tag.find( + ".//headers").iter("column")] + data = dict() + for i, category in enumerate(table["headers"]): + data[category] = data_tag.find( + ".//rows").findall("row/column[@id='" + str(i) + "']") + data[category] = [float(elem.text) for elem in data[category]] + + table["data"] = pd.DataFrame(data) + return table + + expected_data["Dielectric_Real_Permittivity"] = [extract_table_data( + data) for data in root.iter("Dielectric_Real_Permittivity")] + expected_data["Dielectric_Loss_Permittivity"] = [extract_table_data( + data) for data in root.iter("Dielectric_Loss_Permittivity")] + expected_data["Dielectric_Loss_Tangent"] = [extract_table_data( + data) for data in root.iter("Dielectric_Loss_Tangent")] + expected_data["ElectricConductivity"] = [extract_table_data( + data) for data in root.iter("ElectricConductivity")] + + + # Other Data + expected_data["equipment"] = [elem.text.lower() + for elem in root.iter("EquipmentUsed")] + expected_data["equipment"] += [elem.text.lower() + for elem in root.iter("Equipment")] + expected_data["equipment"] = ["http://nanomine.org/ns/" + slugify.slugify(elem) + for elem in expected_data["equipment"]] + expected_data["values"] = [ + rdflib.Literal(val.text, datatype=rdflib.XSD.double) for val in root.iter("value")] + + expected_data["temps"] = [] + for node in root.iter("Temperature"): + expected_data["temps"] += [rdflib.Literal(val.text, datatype=rdflib.XSD.double) + for val in node.iter("value")] + return expected_data + + +def test_nanocomposites(runner): + # Ensure there is a nanocomposite in the graph + nanocomposites = list(runner.app.db.subjects( + rdflib.RDF.type, rdflib.URIRef("http://nanomine.org/ns/PolymerNanocomposite"))) + print(nanocomposites, len(runner.app.db)) + runner.assertEquals(len(nanocomposites), 1) + print("Correct Number of Nanocomposites") + + +def test_authors(runner, expected_authors=None): + # Ensure that the proper number of authors are in the graph + print("\n\nauthors") + authors = runner.app.db.query( + """SELECT ?name + WHERE { + ?paper ?author . + ?author ?name . + } + """ + ) + # for author in authors: + # print(author) + authors = [str(author[0]) for author in authors] + if expected_authors is None: + expected_authors = runner.expected_data["authors"] + runner.assertCountEqual(expected_authors, authors) + print("Expected Authors Found") + + +def test_language(runner, expected_language=None): + # Ensure the paper is marked as being in English + languages = list(runner.app.db.objects( + None, rdflib.URIRef("http://purl.org/dc/terms/language"))) + print("\n\nLanguage") + processed_langs = [str(language) for language in languages] + # print(processed_langs) + if expected_language is None: + expected_language = runner.expected_data["language"] + runner.assertCountEqual(expected_language, processed_langs) + print("Correct Language") + + +def test_keywords(runner, expected_keywords=None): + # Check how many keywords exist + print("\n\nKeywords") + keywords_lst = list(runner.app.db.objects( + None, rdflib.URIRef("http://www.w3.org/ns/dcat#keyword"))) + keywords = [str(keyword) for keyword in keywords_lst] + # print(keywords) + if expected_keywords is None: + expected_keywords = runner.expected_data["keywords"] + runner.assertCountEqual(expected_keywords, keywords) + print("Expected Keywords Found") + + +def test_devices(runner, expected_devices=None): + # Check if all used devices are showing up + print("\n\nDevices") + devices_lst = list(runner.app.db.subjects(rdflib.URIRef( + "http://www.w3.org/2000/01/rdf-schema#subClassOf"), rdflib.URIRef("http://semanticscience.org/resource/Device"))) + devices_lst = [str(device) for device in devices_lst] + if expected_devices is None: + expected_devices = runner.expected_data["equipment"] + runner.assertCountEqual(expected_devices, devices_lst) + print("Expected Devices Found") + + +def test_volume(runner, expected_volume=None): + # Checks the volume of the journal + print("Journal Volume") + volume = runner.app.db.query( + """ + SELECT ?volume + WHERE { + ?publication a . + ?publication ?volume . + } + """ + ) + volume = [vol[0] for vol in volume] + if expected_volume is None: + expected_volume = runner.expected_data["journ_vol"] + runner.assertCountEqual(expected_volume, volume) + print("Expected Journal Volume Found") + + +def test_matrix_chemical_names(runner, expected_names=None): + # Check if the names of the chemicals are present + print("\n\nMatrix Chemical Names") + names = runner.app.db.query( + """ + SELECT ?chemName WHERE { + ?matrix ?bnode . + ?matrix a ?chemURI . + ?bnode a . + ?chemURI ?chemName . + } + """ + ) + names = [name[0] for name in names] + if expected_names is None: + expected_names = runner.expected_data["m_name"] + runner.assertCountEqual(expected_names, names) + print("Expected Matrix Chemical Names found") + + + +# TODO Reimplement +@disable_test +def test_matrix_trade_names(runner, expected_names=None): + # Check if the names of the chemicals are present + print("\n\nMatrix Trade Names") + names = runner.app.db.query( + """ + SELECT ?trade + WHERE { + ?mat ?bnode_mat . + ?bnode_mat a . + ?mat ?prop . + ?prop a . + ?prop ?trade . + } + """ + ) + names = [name[0] for name in names] + if expected_names is None: + expected_names = runner.expected_data["m_trd_name"] + runner.assertCountEqual(expected_names, names) + print("Expected Matrix Chemical Trade Names found") + + +def test_filler_chemical_names(runner, expected_names=None): + # Check if the names of the chemicals are present + print("\n\nFiller Chemical Names") + names = runner.app.db.query( + """ + SELECT ?chemName WHERE { + ?Filler ?bnode . + ?Filler a ?chemURI . + ?bnode a . + ?chemURI ?chemName . + } + """ + ) + names = [name[0] for name in names] + if expected_names is None: + expected_names = runner.expected_data["f_name"] + runner.assertCountEqual(expected_names, names) + print("Expected Filler Chemical Names found") + + +# TODO Reimplement +@disable_test +def test_filler_trade_names(runner, expected_names=None): + # Check if the names of the chemicals are present + print("\n\nFiller Trade Names") + names = list(runner.app.db.query( + """ + SELECT ?trade + WHERE { + ?mat ?bnode_mat . + ?bnode_mat a . + ?mat ?prop . + ?prop a . + ?prop ?trade . + } + """ + )) + names = [name[0] for name in names] + if expected_names is None: + expected_names = runner.expected_data["f_trd_name"] + runner.assertCountEqual(expected_names, names) + print("Expected Filler Chemical Trade Names found") + + +# TODO Fix or remove +@disable_test +def test_temperatures(runner, expected_temperatures=None): + print("Checking if the expected temperatures are present") + temperatures = list(runner.app.db.objects( + None, rdflib.URIRef("http://purl.obolibrary.org/obo/PATO_0000146"))) + if expected_temperatures is None: + expected_temperatures = runner.expected_data["temps"] + runner.assertCountEqual(expected_temperatures, temperatures) + print("Expected Temperatures Found") + + +# TODO Reimplement +@disable_test +def test_abbreviations(runner, expected_abbreviations=None): + print("Checking if the expected abbreviations are present") + abbreviations = list(runner.app.db.query( + """ + SELECT ?abbrev + WHERE { + ?prop a . + ?prop ?abbrev . + } + """ + )) + abbreviations = [a[0] for a in abbreviations] + if expected_abbreviations is None: + expected_abbreviations = runner.expected_data["abbrev"] + runner.assertCountEqual(expected_abbreviations, abbreviations) + print("Expected Abbreviations Found") + + +# TODO Reimplement +@disable_test +def test_manufacturers(runner, expected_manufacturers=None): + print("Checking if the expected manufactures are present") + manufacturers = list(runner.app.db.query( + """ + SELECT ?manufac + WHERE { + ?prop a . + ?prop ?manufac . + } + """ + )) + manufacturers = [m[0] for m in manufacturers] + if expected_manufacturers is None: + expected_manufacturers = runner.expected_data["manufac"] + runner.assertCountEqual(expected_manufacturers, manufacturers) + print("Expected Manufactures Found") + + +# TODO Reimplement +@disable_test +def test_complete_material(runner, expected_materials=None): + materials = runner.app.db.query( + """ + SELECT ?abbrev ?manufac ?name ?trade + WHERE { + ?mat ?bnode_mat . + ?mat a ?compound . + { ?bnode_mat a } UNION { ?bnode_mat a } . + OPTIONAL {?mat ?bnode_abbrev . + ?bnode_abbrev a . + ?bnode_abbrev ?abbrev} . + + OPTIONAL {?mat ?bnode_manufac . + ?bnode_manufac a . + ?bnode_manufac ?manufac} . + + OPTIONAL {?compound ?name} . + + + OPTIONAL {?mat ?bnode_trade . + ?bnode_trade a . + ?bnode_trade ?trade} . + } + """ + ) + material_properties = list() + for material in materials: + material_dict = dict() + for key in material.labels.keys(): + material_dict[key] = material[key] + material_properties.append(material_dict) + + if expected_materials is None: + expected_materials = runner.expected_data["compiled_material"] + + runner.assertCountEqual(expected_materials, material_properties) + + +def test_dielectric_real_permittivity(runner, expected_frequency, expected_real_permittivity, descriptions): + print("Checking if the Dielectric Real Permittivity Table is as expected") + values = query_table(runner, "", "", **descriptions) + frequency = [v["independentVar"] for v in values] + real_permittivity = [v["dependentVar"] for v in values] + runner.assertCountEqual(expected_frequency, frequency) + runner.assertCountEqual(expected_real_permittivity, real_permittivity) + + +def test_dielectric_loss_tangent(runner, expected_frequency, expected_tan_delta, descriptions): + print("Checking if Dielectric Loss Tangent Table is as expected") + values = query_table(runner, "", "", **descriptions) + frequency = [v["independentVar"] for v in values] + tan_delta = [v["dependentVar"] for v in values] + runner.assertCountEqual(expected_frequency, frequency) + runner.assertCountEqual(expected_tan_delta, tan_delta) + +# TODO Fix or remove +@disable_test +def test_filler_processing(runner, expected_process=None): + print("Testing Filler Processing") + process = runner.app.db.query( + """ + SELECT ?method + WHERE { + ?sequence a . + ?sequence ?method . + } + """ + ) + if expected_process is None: + expected_process = runner.expected_data["filler_processing"] + runner.assertTrue(expected_process is not None) + runner.assertTrue(process is not None) + runner.assertCountEqual(expected_process, process) # TODO figure out how to query ordering in process order + + +# TODO Reimplement +@disable_test +def test_viscoelastic_measurement_mode(runner, expected_mode=None): + print("Testing viscoelastic measurement mode") + mode = list(runner.app.db.objects( + None, rdflib.URIRef("http://nanomine.org/ns/tensile"))) + if expected_mode is None: + expected_mode = runner.expected_data["viscoelastic_measurement_mode"] + runner.assertCountEqual(expected_mode, mode) + print("Expected mode Found") + +# TODO Add autoparsing +def test_tensile_loading_profile(runner, expected_strain=None, expected_stress=None): + print("Stress value") + values = query_table(runner, "", "") + + if expected_strain is None: + raise NotImplementedError + if expected_stress is None: + raise NotImplementedError + + stress = [value["dependentVar"] for value in values] + strain = [value["independentVar"] for value in values] + runner.assertCountEqual(expected_strain, strain) + runner.assertCountEqual(expected_stress, stress) + print("Expected Stress value Found") + +# TODO Add autoparsing +# TODO Verify node type, currently doesn't +def test_flexural_loading_profile(runner, expected_strain=None, expected_stress=None): + print("Testing Flexural Loading Profile") + values = query_table(runner, "", "") + print("Finished Query", flush=True) + if expected_strain is None: + raise NotImplementedError + if expected_stress is None: + raise NotImplementedError + + stress = [value["dependentVar"] for value in values] + strain = [value["independentVar"] for value in values] + + runner.assertCountEqual(expected_strain, strain) + runner.assertCountEqual(expected_stress, stress) + print("Expected Flexural Loading Profile Found") + + +# TODO Refactor to remove usage of specific bnodes +# TODO Reimplement +@disable_test +def test_melt_viscosity(runner, expected_value=None): + print("\n\nMelt Viscosity") + values = runner.app.db.query( + """ + SELECT ?value + WHERE { + ?value . + . + . + } + """ + ) + values = [value[0] for value in values] + if expected_value is None: + expected_authors = runner.expected_data["melt_viscosity_data"] + runner.assertCountEqual(expected_value, values) + print("Expected Melt Viscosity values found") + + +# TODO Add autoparsing +def test_rheometer_mode(runner, expected_modes=None): + print("\n\nTesting for Rheometer Mode") + modes = runner.app.db.objects(None, rdflib.URIRef("http://nanomine.org/ns/RheometerMode")) + modes = list(modes) + if expected_modes is None: + raise NotImplementedError + runner.assertCountEqual(expected_modes, modes) + print("Expected Rheometer Modes Found") + + +def test_specific_surface_area(runner, expected_area=None, expected_units=None): + print("\n\nTesting for specific surface area") + query_results = runner.app.db.query( + ''' + SELECT ?area ?unit_label + WHERE + { + ?aNode a . + ?aNode ?area . + ?aNode ?unit . + ?unit ?unit_label . + } + ''' + ) + surface_area =[result["area"] for result in query_results] + units = [result["unit_label"] for result in query_results] + if expected_area is None: + expected_area = runner.expected_data["specific_surface_area"] + if expected_units is None: + expected_units = runner.expected_data["specific_surface_area_units"] + runner.assertCountEqual(expected_area, surface_area) + runner.assertCountEqual(expected_units, units) + + +def test_shear_loading_profile(runner, expected_aspect_ratio, expected_number, descriptions, types): + print("Testing shear loading profile") + values = query_table(runner, types["y_type"], types["x_type"], **descriptions) + + number = [value["dependentVar"] for value in values] + aspect_ratio = [value["independentVar"] for value in values] + + runner.assertCountEqual(expected_aspect_ratio, aspect_ratio) + runner.assertCountEqual(expected_number, number) + + +def test_weibull_plot(runner, expected_breakdown, expected_failure, descriptions): + print("Testing Weibull Plot") + values = query_table(runner, "", "", **descriptions) + + breakdown = [value["independentVar"] for value in values] + failure = [value["dependentVar"] for value in values] + + runner.assertCountEqual(expected_breakdown, breakdown) + runner.assertCountEqual(expected_failure, failure) + + + +disabled.append("test_triples") # Prevent triples from being printed in CI +def print_triples(runner): + if os.getenv("CI") is None: + print("Printing SPO Triples") + for s, p, o in runner.app.db.triples((None, None, None)): + print(str(s.n3()) + " " + str(p.n3()) + " " + str(o.n3()) + " .") diff --git a/whyis/materialsmine/tests/interesting_files.txt b/whyis/materialsmine/tests/interesting_files.txt new file mode 100644 index 00000000..60d39f77 --- /dev/null +++ b/whyis/materialsmine/tests/interesting_files.txt @@ -0,0 +1 @@ +L138_S2_Zikry_2007 \ No newline at end of file diff --git a/whyis/materialsmine/tests/template.py b/whyis/materialsmine/tests/template.py new file mode 100644 index 00000000..15022bb7 --- /dev/null +++ b/whyis/materialsmine/tests/template.py @@ -0,0 +1,134 @@ +from . import ingest_tester +from whyis.test.agent_unit_test_case import AgentUnitTestCase +from base64 import b64encode +import autonomic + +class IngestTest(AgentUnitTestCase): + + upload_template = ''' a , + , + ; + "data:text/xml;charset=UTF-8;base64,%s" .''' + + def setUp(self): + # Initialization + self.login(*self.create_user("user@example.com", "password")) + + encoded_file = b64encode(self.data.encode('utf8')).decode('ascii') + + print ("XML length:", len(encoded_file)) + upload = self.upload_template % (encoded_file) + response = self.client.post("/pub", data=upload, content_type="text/turtle", follow_redirects=True) + self.assertEquals(response.status, '201 CREATED') + + response = self.client.post("/pub", data=open('/apps/nanomine-graph/setl/xml_ingest.setl.ttl', 'rb').read(), + content_type="text/turtle", follow_redirects=True) + self.assertEquals(response.status, '201 CREATED') + + setlmaker = autonomic.SETLMaker() + setlmaker.dry_run = False + results = self.run_agent(setlmaker) + + # confirm this is creating a SETL script for the XML file. + self.assertTrue(len(results) > 0) + + setlr = autonomic.SETLr() + setlr.dry_run = False + + print(len(self.app.db)) + for setlr_np in results: + setlr_results = self.run_agent(setlr, nanopublication=setlr_np) + +class IngestTestSetup(AgentUnitTestCase): + @classmethod + def setUpClass(cls): + print("Setting Up Class") + cls.maxDiff = None + cls.expected_data = ingest_tester.autoparse(cls.file_under_test) + + def setUp(self): + ingest_tester.setUp(self, self.file_under_test) + + def run_agent(self, agent, nanopublication=None): + app = self.app + agent.dry_run = True + agent.app = app + results = [] + if nanopublication is not None: + results.extend(agent.process_graph(nanopublication)) + elif agent.query_predicate == app.NS.whyis.globalChangeQuery: + results.extend(agent.process_graph(app.db)) + else: + print("Running as update agent") + for resource in agent.getInstances(app.db): + print(resource.identifier) + for np_uri, in app.db.query('''select ?np where { + graph ?assertion { ?e ?p ?o.} + ?np a np:Nanopublication; + np:hasAssertion ?assertion. +}''', initBindings={'e': resource.identifier}, initNs=app.NS.prefixes): + print(np_uri) + np = app.nanopub_manager.get(np_uri) + results.extend(agent.process_graph(np)) + return results + +class IngestTestTests(IngestTestSetup): + pass + +class OldIngestTestTests(IngestTestSetup): + def test_nanocomposites(self): + ingest_tester.test_nanocomposites(self) + + def test_authors(self): + ingest_tester.test_authors(self, self.expected_data["authors"]) + + def test_language(self): + ingest_tester.test_language(self, self.expected_data["language"]) + + def test_keywords(self): + ingest_tester.test_keywords(self, self.expected_data["keywords"]) + + def test_devices(self): + ingest_tester.test_devices(self, self.expected_data["equipment"]) + + def test_volume(self): + ingest_tester.test_volume(self, self.expected_data["journ_vol"]) + + def test_matrix_chemical_names(self): + ingest_tester.test_matrix_chemical_names(self) + + def test_matrix_trade_names(self): + ingest_tester.test_matrix_trade_names(self) + + def test_filler_chemical_names(self): + ingest_tester.test_filler_chemical_names(self) + + def test_filler_trade_names(self): + ingest_tester.test_filler_trade_names(self) + + # TODO Fix or remove + def test_temperatures(self): + ingest_tester.test_temperatures(self) + + def test_abbreviations(self): + ingest_tester.test_abbreviations(self) + + def test_manufacturers(self): + ingest_tester.test_manufacturers(self) + + def test_complete_material(self): + ingest_tester.test_complete_material(self) + + # TODO Fix or remove + def test_filler_processing(self): + ingest_tester.test_filler_processing(self) + + def test_viscoelastic_measurement_mode(self): + ingest_tester.test_viscoelastic_measurement_mode(self) + + # TODO add the following tests once completed + # test_stress + # test_melt_viscosity + # test_rheometer_mode + # test_specific_surface_area + # test_dielectric_real_permittivity diff --git a/whyis/materialsmine/tests/test_L101_S11_Dang_2007.py b/whyis/materialsmine/tests/test_L101_S11_Dang_2007.py new file mode 100644 index 00000000..f60bbe81 --- /dev/null +++ b/whyis/materialsmine/tests/test_L101_S11_Dang_2007.py @@ -0,0 +1,14 @@ +from . import ingest_tester +from . import template + +file_under_test = "L101_S11_Dang_2007" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L101_S3_Dang_2007.py b/whyis/materialsmine/tests/test_L101_S3_Dang_2007.py new file mode 100644 index 00000000..a184a642 --- /dev/null +++ b/whyis/materialsmine/tests/test_L101_S3_Dang_2007.py @@ -0,0 +1,35 @@ +import rdflib + +from . import ingest_tester +from . import template + +class L101_S3_Dang_2007(template.IngestTestSetup): + @classmethod + def setUpClass(cls): + cls.file_under_test = "L101_S3_Dang_2007" + super().setUpClass() + + def no_test_chemprops_id(self): + print (len(self.app.db)) + component_types = [x.asdict() for x in self.app.db.query(''' + SELECT ?sample ?part ?parttype ?role WHERE { + ?sample a . + ?sample /? ?part. + ?part a ?parttype. +# [ +# a ?role; +# ?sample +# ]. + }''')] + print (component_types) + + + + def no_test_specific_surface_area(self): + expected_surface_area = [rdflib.Literal(9.0)] + expected_units = [rdflib.Literal("m^2/g")] + ingest_tester.test_specific_surface_area(self, expected_surface_area, expected_units) + ingest_tester.test_specific_surface_area(self) + + def no_test_print_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L102_S3_Hu_2007.py b/whyis/materialsmine/tests/test_L102_S3_Hu_2007.py new file mode 100644 index 00000000..26ca4a29 --- /dev/null +++ b/whyis/materialsmine/tests/test_L102_S3_Hu_2007.py @@ -0,0 +1,84 @@ +from . import ingest_tester +from . import template +import rdflib + + +class L102Test(template.IngestTestSetup): + @classmethod + def setUpClass(cls): + cls.file_under_test = "L102_S3_Hu_2007" + super().setUpClass() + + def no_test_authors(self): + expected_authors = ["Hu, Tao", + "Juuti, Jari", + "Vilkman, Taisto", + "Jantunen, Heli"] + ingest_tester.test_authors(self, expected_authors) + ingest_tester.test_authors(self) + + def no_test_language(self): + ingest_tester.test_language(self, ["http://nanomine.org/language/english"]) + ingest_tester.test_language(self) + + def no_test_keywords(self): + expected_keywords = ["Composites", + "Dielectric Properties", + "Microstructure-Final", + "Bst-Coc"] + ingest_tester.test_keywords(self, expected_keywords) + ingest_tester.test_keywords(self) + + def no_test_devices(self): + expected_devices = ["http://nanomine.org/ns/jeol-jsm-6400", + "http://nanomine.org/ns/agilent-e4991a", + "http://nanomine.org/ns/siemens-d5000"] + ingest_tester.test_devices(self, expected_devices) + ingest_tester.test_devices(self) + + def no_test_volume(self): + excepted_volume = [rdflib.Literal(27)] + ingest_tester.test_volume(self, excepted_volume) + ingest_tester.test_volume(self) + + def no_test_matrix_chemical_names(self): + expected_names = [rdflib.Literal("cyclo olefin copolymer")] + ingest_tester.test_matrix_chemical_names(self, expected_names) + ingest_tester.test_matrix_chemical_names(self) + + def no_test_matrix_trade_names(self): + expected_names = [rdflib.Literal("Topas 8007S-04")] + ingest_tester.test_matrix_trade_names(self, expected_names) + ingest_tester.test_matrix_trade_names(self) + + def no_test_filler_chemical_names(self): + expected_names = [rdflib.Literal("barium strontium titanate")] + ingest_tester.test_filler_chemical_names(self, expected_names) + ingest_tester.test_filler_chemical_names(self) + + def no_test_filler_trade_names(self): + expected_names = [] + ingest_tester.test_filler_trade_names(self, expected_names) + ingest_tester.test_filler_trade_names(self) + + def no_test_complete_material(self): + expected_material = list() + expected_material.append({"abbrev": rdflib.Literal("COC"), + "manufac": rdflib.Literal("Ticona GmbH, Germany"), + "name": rdflib.Literal("cyclo olefin copolymer"), + "trade": rdflib.Literal("Topas 8007S-04")}) + + expected_material.append({"abbrev": rdflib.Literal("BST"), + "manufac": rdflib.Literal("Sigma–Aldrich Chemie GmbH, Germany"), + "name": rdflib.Literal("barium strontium titanate"), + "trade": None}) + + ingest_tester.test_complete_material(self, expected_material) + + + def no_test_manufacturer(self): + ingest_tester.test_manufacturers(self) + + + # def test_print_triples(self): + # ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L104_S4_He_2009.py b/whyis/materialsmine/tests/test_L104_S4_He_2009.py new file mode 100644 index 00000000..3e35e001 --- /dev/null +++ b/whyis/materialsmine/tests/test_L104_S4_He_2009.py @@ -0,0 +1,14 @@ +from . import ingest_tester +from . import template + +file_under_test = "L104_S4_He_2009" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L141_S19_Gao_2013.py b/whyis/materialsmine/tests/test_L141_S19_Gao_2013.py new file mode 100644 index 00000000..9da0482c --- /dev/null +++ b/whyis/materialsmine/tests/test_L141_S19_Gao_2013.py @@ -0,0 +1,14 @@ +from . import ingest_tester +from . import template + +file_under_test = "L141_S19_Gao_2013" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L150_S7_Akcora_2009.py b/whyis/materialsmine/tests/test_L150_S7_Akcora_2009.py new file mode 100644 index 00000000..3a848a13 --- /dev/null +++ b/whyis/materialsmine/tests/test_L150_S7_Akcora_2009.py @@ -0,0 +1,15 @@ +import rdflib + +from . import ingest_tester, template + +file_under_test = "L150_S7_Akcora_2009" + +# TODO Add test for shear loading profile +class Test_L150_S7_Akcora_2009(template.IngestTestSetup): + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L155_S2_Roy_2005.py b/whyis/materialsmine/tests/test_L155_S2_Roy_2005.py new file mode 100644 index 00000000..e31b9a41 --- /dev/null +++ b/whyis/materialsmine/tests/test_L155_S2_Roy_2005.py @@ -0,0 +1,182 @@ +from . import ingest_tester +from . import template +import rdflib + +file_under_test = "L155_S2_Roy_2005" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) + + def no_test_dielectric_real_permittivity(self): + frequency = [ + 0.002078949, + 0.005239995, + 0.013207416, + 0.033289313, + 0.082305244, + 0.203493333, + 0.512905286, + 1.292778627, + 3.258450684, + 7.902591204, + 20.30583336, + 50.20459806, + 126.540773, + 318.9462293, + 773.5276395, + 1949.677704, + 4914.165902, + 12386.16334, + 30623.82819, + 78688.41195, + 190839.8845, + 481012.2468, + ] + + real_permittivity = [ + 3.21, + 2.88, + 2.595, + 2.385, + 2.2425, + 2.175, + 2.1, + 2.055, + 2.025, + 2.01, + 1.995, + 1.965, + 1.95, + 1.95, + 1.95, + 1.935, + 1.9275, + 1.935, + 1.9275, + 1.92, + 1.92, + 1.905, + ] + frequency = [rdflib.Literal(f) for f in frequency] + real_permittivity = [rdflib.Literal(p) for p in real_permittivity] + + descriptions = {} + descriptions["measurement_description"] = rdflib.Literal("Measured at 25 Celsius") + descriptions["x_description"] = rdflib.Literal("Frequency (Hz)") + descriptions["y_description"] = rdflib.Literal("Real Part of Dielectric Permittivity") + + ingest_tester.test_dielectric_real_permittivity(self, frequency, real_permittivity, descriptions) + + def no_test_dielectric_loss_tangent(self): + return + frequency = [ + 0.002132876, + 0.005323618, + 0.013287653, + 0.033643142, + 0.08278107, + 0.209594224, + 0.523143327, + 1.305756117, + 3.25914324, + 8.134761557, + 20.30421516, + 50.67894742, + 126.4937202, + 315.7259981, + 788.0462816, + 1966.949018, + 4909.468555, + 12430.33287, + 30585.61668, + 77440.03084, + 190546.0718, + 489390.0918, + ] + + tan_delta = [ + 0.189265537, + 0.152777778, + 0.12405838, + 0.093691149, + 0.066148776, + 0.045433145, + 0.032015066, + 0.02306968, + 0.016949153, + 0.013182674, + 0.010122411, + 0.007768362, + 0.006355932, + 0.005178908, + 0.004237288, + 0.003766478, + 0.003295669, + 0.003060264, + 0.002589454, + 0.002589454, + 0.002354049, + 0.002354049, + ] + + frequency = [rdflib.Literal(f) for f in frequency] + tan_delta = [rdflib.Literal(t) for t in tan_delta] + + descriptions = {} + descriptions["measurement_description"] = rdflib.Literal("Measured at 25 Celsius") + descriptions["x_description"] = rdflib.Literal("Frequency (Hz)") + descriptions["y_description"] = rdflib.Literal("tan delta") + + ingest_tester.test_dielectric_loss_tangent(self, frequency, tan_delta, descriptions) + + def no_test_weibull_plot(self): + breakdown_strength = [ + 134.3096058, + 135.4974638, + 136.6958274, + 137.9047896, + 145.3864394, + 150.5983687, + 168.8625957, + 208.5987317, + 271.6654549, + 281.4043353, + 460.765468, + 554.3522963, + 559.2550864, + 940.2240538, + ] + + failure_probability = [ + 12.5086297, + 18.69779897, + 24.93299398, + 31.18775889, + 37.44027712, + 43.73113085, + 49.92556641, + 56.22166161, + 62.45004225, + 68.73755053, + 74.97001936, + 81.0239571, + 87.5667591, + 93.3498204, + ] + + breakdown_strength = [rdflib.Literal(b) for b in breakdown_strength] + failure_probability = [rdflib.Literal(f) for f in failure_probability] + + descriptions = {} + descriptions["measurement_description"] = rdflib.Literal("Measured at 25 Celsius") + descriptions["x_description"] = rdflib.Literal("Frequency (Hz)") + descriptions["y_description"] = rdflib.Literal("tan delta") + + ingest_tester.test_weibull_plot(self, breakdown_strength, failure_probability, {}) diff --git a/whyis/materialsmine/tests/test_L157_S5_Zhao_2008.py b/whyis/materialsmine/tests/test_L157_S5_Zhao_2008.py new file mode 100644 index 00000000..92cd135f --- /dev/null +++ b/whyis/materialsmine/tests/test_L157_S5_Zhao_2008.py @@ -0,0 +1,20 @@ +from . import template +from . import ingest_tester + +class L157_S5_Zhao_2008(template.IngestTestSetup): + @classmethod + def setUpClass(cls): + cls.file_under_test = "L157_S5_Zhao_2008" + super().setUpClass() + + # def test_triples(self): + # ingest_tester.print_triples(self) + + def no_test_filler_trade_names(self): + ingest_tester.test_filler_trade_names(self) + + def no_test_matrix_trade_names(self): + ingest_tester.test_matrix_trade_names(self) + + def no_test_complete_material(self): + ingest_tester.test_complete_material(self) diff --git a/whyis/materialsmine/tests/test_L168_S4_Luo_2013.py b/whyis/materialsmine/tests/test_L168_S4_Luo_2013.py new file mode 100644 index 00000000..4a13a8e1 --- /dev/null +++ b/whyis/materialsmine/tests/test_L168_S4_Luo_2013.py @@ -0,0 +1,63 @@ +from . import ingest_tester +from . import template +import rdflib + +file_under_test = "L168_S4_Luo_2013" + +class L168Test(template.IngestTestTests): + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_authors(self): + expected_authors = ["Luo, Suibin", + "Yu, Shuhui", + "Sun, Rong", + "Wong, Ching-Ping"] + ingest_tester.test_authors(self, expected_authors) + ingest_tester.test_authors(self) + + def no_test_language(self): + ingest_tester.test_language(self, ["http://nanomine.org/language/english"]) + ingest_tester.test_language(self) + + def no_test_keywords(self): + expected_keywords = ["Ag-Deposited Batio3", + "Hetero-Epitaxial Interface", + "Polymer Matrix", + "Dielectric Composites"] + ingest_tester.test_keywords(self, expected_keywords) + ingest_tester.test_keywords(self) + + def no_test_devices(self): + expected_devices = ["http://nanomine.org/ns/cs9912bx", + "http://nanomine.org/ns/agilent-4294a-impedance-analyzer", + "http://nanomine.org/ns/xrd-d-max-2500-pc-rigaku-co", + "http://nanomine.org/ns/fei-nova-nanosem450", + "http://nanomine.org/ns/fei-tecnai-spirit"] + ingest_tester.test_devices(self, expected_devices) + ingest_tester.test_devices(self) + + def no_test_abbreviations(self): + expected_abbreviations = ["PVDF", + "AgNO3", + "BaTiO3"] + expected_abbreviations = [rdflib.Literal(v) for v in expected_abbreviations] + ingest_tester.test_abbreviations(self, expected_abbreviations) + ingest_tester.test_abbreviations(self) + + # def test_filler_processing(self): + # ingest_tester.test_filler_processing(self) + + def no_test_manufacturers(self): + expected_manufacturers = ["Shanghai 3F Co.", + "Guoyao Chemical Co. China", + "Shanghai Lingfeng Chemical Co. China", + "Shangdong Guoci Functional Materials Co., China"] + expected_manufacturers = [rdflib.Literal(v) for v in expected_manufacturers] + # ingest_tester.test_manufacturers(self, expected_manufacturers) + ingest_tester.test_manufacturers(self) + + def no_test_complete_material(self): + ingest_tester.test_complete_material(self) diff --git a/whyis/materialsmine/tests/test_L172_S18_Huo_2015.py b/whyis/materialsmine/tests/test_L172_S18_Huo_2015.py new file mode 100644 index 00000000..ec003514 --- /dev/null +++ b/whyis/materialsmine/tests/test_L172_S18_Huo_2015.py @@ -0,0 +1,8 @@ +from . import ingest_tester +from . import template + +class L172Test(template.IngestTestTests): + @classmethod + def setUpClass(cls): + cls.file_under_test = "L172_S18_Huo_2015" + super().setUpClass() diff --git a/whyis/materialsmine/tests/test_L199_S1_Duncan_2010.py b/whyis/materialsmine/tests/test_L199_S1_Duncan_2010.py new file mode 100644 index 00000000..6cffdc43 --- /dev/null +++ b/whyis/materialsmine/tests/test_L199_S1_Duncan_2010.py @@ -0,0 +1,129 @@ +import rdflib + +from . import ingest_tester, template + +file_under_test = "L199_S1_Duncan_2010" + +# TODO Add test for shear loading profile +class Test_L199_S1_Duncan_2010(template.IngestTestSetup): + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) + + def no_test_shear_loading_profile_1(self): + descriptions = {} + descriptions["measurement_description"] = rdflib.Literal("Number of MWNT within grip region dissolved in THF") + descriptions["x_description"] = rdflib.Literal("Aspect ratio (L/d)") + descriptions["y_description"] = rdflib.Literal("Number of MWNT within grip region dissolved in THF") + + types = {} + types["y_type"] = "" + types["x_type"] = "" + + aspect_ratio = [ + "0-199", + "200-399", + "400-599", + "600-799", + "800-999", + "1000-1199", + "1200-1399", + "1400-1599", + "1600-1799", + "1800-1999", + ">2000", + ] + + number = [ + 0.0, + 0.0, + 0.0, + 0.0, + 18.4393465415, + 17.0142509559, + 10.4362182829, + 16.7014250956, + 11.9742787626, + 22.540841154, + 21.8456725756, + ] + + aspect_ratio = [rdflib.Literal(a, datatype=rdflib.XSD.double) for a in aspect_ratio] + number = [rdflib.Literal(n) for n in number] + ingest_tester.test_shear_loading_profile(self, aspect_ratio, number, descriptions, types) + + def no_test_shear_loading_profile_2(self): + descriptions = {} + descriptions["measurement_description"] = rdflib.Literal("Number of MWNT along the fracture edge dissolved in THF") + descriptions["x_description"] = rdflib.Literal("Aspect ratio (L/d)") + descriptions["y_description"] = rdflib.Literal("Number of MWNT along the fracture edge dissolved in THF") + + types = {} + types["y_type"] = "" + types["x_type"] = "" + + aspect_ratio = [ + "0-49.99", + "50-99.99", + "100-149.99", + "150-199.99", + "200-249.99", + "250-299.99", + "300-349.99", + "350-399.99", + ">400", + ] + + number = [ + 0.0, + 0.0, + 3.09094256259, + 0.0, + 7.79270986745, + 13.9304123711, + 34.486377025, + 43.1148748159, + 11.1800441826, + ] + + aspect_ratio = [rdflib.Literal(a, datatype=rdflib.XSD.double) for a in aspect_ratio] + number = [rdflib.Literal(n) for n in number] + ingest_tester.test_shear_loading_profile(self, aspect_ratio, number, descriptions, types) + + def no_test_shear_loading_profile_3(self): + descriptions = {} + descriptions["measurement_description"] = rdflib.Literal("Number of MWNT along the fracture for ARNT/PC") + descriptions["x_description"] = rdflib.Literal("Aspect ratio (L/d)") + descriptions["y_description"] = rdflib.Literal("Number of MWNT along the fracture for ARNT/PC") + + types = {} + types["y_type"] = "" + types["x_type"] = "" + + aspect_ratio = [ + "0-16", + "16-31", + "32-48", + "49-64", + "65-80", + "81-96", + ">97", + ] + + number = [ + 0.0, + 8.95470779757, + 16.0864952961, + 29.1779569873, + 27.8728191726, + 14.8469887788, + 23.6376183327, + ] + + aspect_ratio = [rdflib.Literal(a, datatype=rdflib.XSD.double) for a in aspect_ratio] + number = [rdflib.Literal(n) for n in number] + ingest_tester.test_shear_loading_profile(self, aspect_ratio, number, descriptions, types) diff --git a/whyis/materialsmine/tests/test_L203_S9_Ma_2009.py b/whyis/materialsmine/tests/test_L203_S9_Ma_2009.py new file mode 100644 index 00000000..af0f6266 --- /dev/null +++ b/whyis/materialsmine/tests/test_L203_S9_Ma_2009.py @@ -0,0 +1,365 @@ +from . import ingest_tester +from . import template +import rdflib + +file_under_test = "L203_S9_Ma_2009" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) + + def no_test_flexural_loading_profile(self): + strain = [ + 0.0455199451544, + 0.0984788280365, + 0.179423054029, + 0.1570619867, + 0.224083753163, + 0.341314431514, + 0.433387994902, + 0.491957257436, + 0.550558700481, + 0.620298988801, + 0.684450107351, + 0.753087481772, + 0.832297373221, + 0.843503017436, + 0.922369928714, + 0.893651956553, + 0.996215269668, + 1.0476737362, + 1.11125833147, + 1.16150351957, + 1.24238777279, + 1.21165977244, + 1.31216477615, + 1.29535250667, + 1.39583469147, + 1.37066368038, + 1.46276723015, + 1.44597485409, + 1.54090004963, + 1.53384593521, + 1.61337348731, + 1.64019535865, + 1.71380081897, + 1.68028115923, + 1.75063185335, + 1.79742407255, + 1.91449092284, + 1.8893155235, + 1.96461353245, + 2.02317913811, + 2.10410142284, + 2.09848153531, + 2.16548136052, + 2.17795715977, + 2.25468573874, + 2.24070915744, + 2.32156561841, + 2.39127226346, + 2.46655754649, + 2.550199377, + 2.61990675343, + 2.70075151239, + 2.77184667339, + 2.85367831878, + 2.92028915683, + 2.99943221451, + 3.08172391236, + 3.17145293044, + 3.25267459145, + 3.33630073571, + 3.41434558119, + 3.50352948091, + 3.58991513886, + 3.65403597848, + 3.73761637347, + 3.80451790184, + 3.8936816156, + 3.97449126855, + 4.05530238424, + 4.13889916204, + 4.22248306764, + 4.30607399443, + 4.39174451366, + 4.47324882683, + 4.56160965772, + 4.64039908501, + 4.7184110813, + 4.8075528538, + 4.89672549034, + 4.94549030177, + 4.97468731428, + 5.05826653907, + 5.14556836645, + 5.22261533745, + 5.29704844291, + 5.34794526547, + 5.40686130437, + 5.49836185265, + 5.5691956863, + 5.65990138987, + 5.74106323135, + 5.82701039849, + 5.91532007491, + 5.99410555974, + 6.07765679724, + 6.16675790528, + 6.25031314097, + 6.32829793009, + 6.41184380417, + 6.4953765135, + 6.57892268013, + 6.66246094791, + 6.74599453489, + 6.82953982387, + 6.91307809165, + 6.99662513593, + 7.08016340371, + 7.16369640559, + 7.24720834386, + 7.25047759129, + 7.26382226436, + 7.26373449933, + 7.2636467343, + 7.26355896926, + 7.26347120423, + 7.2633834392, + 7.26329567417, + 7.26320790914, + 7.26312014411, + 7.26303237907, + 7.26294461404, + 7.26285684901, + 7.26276908398, + 7.26268131895, + 7.26259355392, + 7.26250578888, + 7.26241802385, + 7.26233025882, + 7.26224249379, + 7.26215472876, + 7.26206696373, + 7.26197919869, + 7.26189143366, + 7.26180366863, + 7.2617159036, + 7.26162813857, + 7.26154037354, + 7.2614526085, + 7.26136484347, + 7.26127707844, + 7.26118931341, + 7.26110154838, + 7.26101378334, + 7.26092601831, + 7.26083825328, + 7.26075048825, + 7.26066272322, + 7.26057495819, + 7.26048719315, + 7.26039942812, + 7.26031166309, + 7.26022389806, + 7.26013613303, + 7.260048368, + 7.25996060296, + 7.25987283793, + 7.2597850729, + 7.25969730787, + 7.25960954284, + 7.25952177781, + 7.25943401277, + 7.25934624774, + 7.25925848271, + 7.25917071768, + 7.25908295265, + 7.25899518762, + 7.25890742258, + 0.255895025071, + 0.298562831401 + ] + + + stress = [ + 0.97757885763, + 1.81445012788, + 5.30622335891, + 3.71905370844, + 7.26854219949, + 12.347485081, + 15.622826087, + 17.2532821824, + 19.5186061381, + 21.7550724638, + 23.6163895993, + 26.072173913, + 28.3153736857, + 29.6043478261, + 31.360540738, + 29.9506393862, + 34.1277813299, + 35.5836487639, + 37.2573913043, + 39.502514919, + 41.8111253197, + 39.9930946292, + 44.7719181586, + 42.76342711, + 47.0920716113, + 45.0143222506, + 48.8812446718, + 47.2652173913, + 51.8535805627, + 50.0499786871, + 53.065601023, + 54.7451150895, + 56.312084399, + 54.3641943734, + 57.6539641944, + 57.7116794544, + 59.5585677749, + 57.3942455243, + 59.3854219949, + 60.9437340153, + 64.0026427962, + 63.021483376, + 66.1381074169, + 65.0126598465, + 67.7541346974, + 66.7441176471, + 68.5044330776, + 70.077173913, + 71.8172890026, + 73.5833759591, + 75.1705456095, + 76.7, + 78.1933823529, + 79.5692729266, + 80.8987851662, + 82.2159298502, + 83.510400682, + 85.0109974425, + 86.1268258028, + 87.5834490318, + 88.8202046036, + 90.0322250639, + 90.9845268542, + 92.2484910486, + 92.8025575448, + 93.9799488491, + 94.7937340153, + 95.6306052856, + 96.4963341858, + 97.3736061381, + 97.9969309463, + 98.7587723785, + 99.3388107417, + 100.143938619, + 100.81673365, + 101.044296675, + 101.632992327, + 102.013913043, + 103.003729753, + 103.515952685, + 102.602608696, + 103.133589088, + 103.845410628, + 103.710741688, + 104.337364511, + 103.739599318, + 104.362099622, + 104.182082978, + 104.444549994, + 104.282122762, + 104.217811472, + 104.368695652, + 104.032298137, + 104.182082978, + 104.160920716, + 103.739599318, + 103.797314578, + 103.849258312, + 103.72228474, + 103.335592498, + 103.214390452, + 102.937357204, + 102.56797954, + 102.429462916, + 102.152429668, + 102.048542199, + 101.771508951, + 101.390588235, + 100.594117647, + 0.256138107417, + 98.6895140665, + 96.958056266, + 95.2265984655, + 93.495140665, + 91.7636828645, + 90.0322250639, + 88.3007672634, + 86.5693094629, + 84.8378516624, + 83.1063938619, + 81.3749360614, + 79.6434782609, + 77.9120204604, + 76.1805626598, + 74.4491048593, + 72.7176470588, + 70.9861892583, + 69.2547314578, + 67.5232736573, + 65.7918158568, + 64.0603580563, + 62.3289002558, + 60.5974424552, + 58.8659846547, + 57.1345268542, + 55.4030690537, + 53.6716112532, + 51.9401534527, + 50.2086956522, + 48.4772378517, + 46.7457800512, + 45.0143222506, + 43.2828644501, + 41.5514066496, + 39.8199488491, + 38.0884910486, + 36.3570332481, + 34.6255754476, + 32.8941176471, + 31.1626598465, + 29.431202046, + 27.6997442455, + 25.968286445, + 24.2368286445, + 22.505370844, + 20.7739130435, + 19.042455243, + 17.3109974425, + 15.5795396419, + 13.8480818414, + 12.1166240409, + 10.3851662404, + 8.6537084399, + 6.92225063939, + 5.19079283887, + 3.45933503836, + 1.72787723785, + 8.38235294118, + 10.1470588235, + ] + + strain = [rdflib.Literal(s) for s in strain] + stress = [rdflib.Literal(s) for s in stress] + ingest_tester.test_flexural_loading_profile(self, strain, stress) diff --git a/whyis/materialsmine/tests/test_L217_S2_Ash_2002.py b/whyis/materialsmine/tests/test_L217_S2_Ash_2002.py new file mode 100644 index 00000000..c265e4ce --- /dev/null +++ b/whyis/materialsmine/tests/test_L217_S2_Ash_2002.py @@ -0,0 +1,14 @@ +from . import ingest_tester +from . import template + +file_under_test = "L217_S2_Ash_2002" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L254_S35_Castillo_2011.py b/whyis/materialsmine/tests/test_L254_S35_Castillo_2011.py new file mode 100644 index 00000000..7d3c9fa1 --- /dev/null +++ b/whyis/materialsmine/tests/test_L254_S35_Castillo_2011.py @@ -0,0 +1,24 @@ +import rdflib +from . import ingest_tester +from . import template + +file_under_test = "L254_S35_Castillo_2011" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) + + def no_test_non_spherical_shape(self): + width_description = rdflib.Literal("50th percentile value measured by TEM, diameter") + length_description = rdflib.Literal("50th percentile value measured by TEM") + depth_description = rdflib.Literal("50th percentile value measured by TEM, diameter") + expected_width_value = rdflib.Literal(10.5) + expected_length_value = rdflib.Literal(727.0) + expected_depth_value = rdflib.Literal(10.5) + ingest_tester.test_non_spherical_shape(self, width_description, expected_width_value, length_description, expected_length_value, depth_description, expected_depth_value) diff --git a/whyis/materialsmine/tests/test_L256_S3_Potschke_2004.py b/whyis/materialsmine/tests/test_L256_S3_Potschke_2004.py new file mode 100644 index 00000000..2bd069a4 --- /dev/null +++ b/whyis/materialsmine/tests/test_L256_S3_Potschke_2004.py @@ -0,0 +1,18 @@ +import rdflib + +from . import ingest_tester, template + +file_under_test = "L256_S3_Potschke_2004" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) + + def no_test_melt_viscosity(self): + ingest_tester.test_melt_viscosity(self, [rdflib.Literal(1793550.45609)]) diff --git a/whyis/materialsmine/tests/test_L260_S5_Haggenmueller_2006.py b/whyis/materialsmine/tests/test_L260_S5_Haggenmueller_2006.py new file mode 100644 index 00000000..0d9ebc8c --- /dev/null +++ b/whyis/materialsmine/tests/test_L260_S5_Haggenmueller_2006.py @@ -0,0 +1,14 @@ +from . import ingest_tester +from . import template + +file_under_test = "L260_S5_Haggenmueller_2006" + +class IngestTestRunner(template.IngestTestSetup): + first_run = bool() + @classmethod + def setUpClass(cls): + cls.file_under_test = file_under_test + super().setUpClass() + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_L300_S5_Nakane_1999.py b/whyis/materialsmine/tests/test_L300_S5_Nakane_1999.py new file mode 100644 index 00000000..15f12f84 --- /dev/null +++ b/whyis/materialsmine/tests/test_L300_S5_Nakane_1999.py @@ -0,0 +1,66 @@ +from . import ingest_tester +from . import template +import rdflib + +class L300_S5_Nakane_1999(template.IngestTestSetup): + @classmethod + def setUpClass(cls): + cls.file_under_test = "L300_S5_Nakane_1999" + super().setUpClass() + + # def test_viscoelastic_measurement_mode(self): + # expected_properties = ["tensile"] + # ingest_tester.test_viscoelastic_measurement_mode(self, expected_properties) + # ingest_tester.test_viscoelastic_measurement_mode(self) + + def no_test_tensile_loading_profile(self): + strain = [ + 0.488947522403, + 0.206702455438, + 0.0792094406024, + 0.458310507435, + 0.160242593969, + 0.90212884315, + 0.940644788598, + 1.3802561525, + 1.22448532952, + 0.93220689301, + 1.80212313252, + 1.9786885736, + 1.79906431079, + 2.00943420192, + 2.30809720581, + 2.1881058389, + 2.54316050748, + 2.71920844731, + 2.81124282387, + 2.90484571504 + ] + stress = [ + 24.9897478167, + 10.2678907707, + 4.02476970038, + 19.158611338, + 15.5440079659, + 41.2782263019, + 32.5323892337, + 60.5980280682, + 51.9931198677, + 47.4921877784, + 79.3363291472, + 73.9835174962, + 67.1880712416, + 88.0281205131, + 99.0291856973, + 94.3884072907, + 106.063545902, + 111.225327822, + 115.638172539, + 120.767514725 + ] + strain = [rdflib.Literal(val) for val in strain] + stress = [rdflib.Literal(val) for val in stress] + ingest_tester.test_tensile_loading_profile(self, strain, stress) + + def no_test_triples(self): + ingest_tester.print_triples(self) diff --git a/whyis/materialsmine/tests/test_article_metadata.py b/whyis/materialsmine/tests/test_article_metadata.py new file mode 100644 index 00000000..dab6aa33 --- /dev/null +++ b/whyis/materialsmine/tests/test_article_metadata.py @@ -0,0 +1,62 @@ +import rdflib + +from . import template + +SKOS = rdflib.Namespace("http://www.w3.org/2004/02/skos/core#") + +class TestArticleMetadata(template.IngestTest): + + data = ''' + + L101_S3_Dang_2007 + L101_S1_Dang_2007 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c1081c941bb7a1270dd9d + + + + research article + Composites Science and Technology + Study on microstructure and dielectric property of the BaTiO3/epoxy resin composites + Dang, Zhi-Min + Yu, Yan-Fei + Xu, Hai-Ping + Bai, Jinbo + Dielectric properties + Microstructure + Silane coupling agent + BaTiO3 + Elsevier + 2008 + 10.1016/j.compscitech.2007.05.021 + 68 + https://www.sciencedirect.com/science/article/pii/S0266353807002199?via%3Dihub + English + Key Laboratory of Beijing City on Preparation and Processing of Novel Polymer Materials and Key Laboratory of the Ministry of Education on Nanomaterials, Beijing University of Chemical Technology, Beijing 100029, PR China + 2015-07-24 + + + + 0266-3538 + 1 + + + + + +''' + + def test_author_list(self): + first_author = set(self.app.db.query('''select distinct ?firstAuthor where { + ?pub bibo:authorList/rdf:first ?firstAuthor. + }''', initNs={"bibo": rdflib.URIRef('http://purl.org/ontology/bibo/'), 'rdf': rdflib.RDF})) + print ("First Author:") + print ('\n'.join(['\t'.join(x) for x in first_author])) + self.assertIn((rdflib.URIRef('http://nanomine.org/author/bai-jinbo'),), first_author) + last_author = set(self.app.db.query('''select distinct ?lastAuthor where { + ?pub bibo:authorList/rdf:rest* [rdf:first ?lastAuthor; rdf:rest rdf:nil]. + }''', initNs={"bibo": rdflib.URIRef('http://purl.org/ontology/bibo/'), 'rdf': rdflib.RDF})) + print ("Last Author:") + print ('\n'.join(['\t'.join(x) for x in last_author])) + self.assertIn((rdflib.URIRef('http://nanomine.org/author/dang-zhi-min'),), last_author) diff --git a/whyis/materialsmine/tests/test_chem_props_ingest.py b/whyis/materialsmine/tests/test_chem_props_ingest.py new file mode 100644 index 00000000..e9d98062 --- /dev/null +++ b/whyis/materialsmine/tests/test_chem_props_ingest.py @@ -0,0 +1,149 @@ +from whyis.test.agent_unit_test_case import AgentUnitTestCase + +import autonomic +import rdflib + +class ChemPropsTest(AgentUnitTestCase): + def setUp(self): + self.maxDiff = 10000 + self.login(*self.create_user("user@example.com", "password")) + + upload = '''<{}> a , + , + ; + "data:application/json;charset=UTF-8;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0idXRmLTgiPz4KPFBvbHltZXJOYW5vY29tcG9zaXRlPjxJRD5MMTAyX1MzX0h1XzIwMDc8L0lEPjxDb250cm9sX0lEPkwxMDJfUzFfSHVfMjAwNzwvQ29udHJvbF9JRD48REFUQV9TT1VSQ0U+PENpdGF0aW9uPjxDb21tb25GaWVsZHM+PENpdGF0aW9uVHlwZT5yZXNlYXJjaCBhcnRpY2xlPC9DaXRhdGlvblR5cGU+PFB1YmxpY2F0aW9uPkpvdXJuYWwgb2YgdGhlIEV1cm9wZWFuIENlcmFtaWMgU29jaWV0eTwvUHVibGljYXRpb24+PFRpdGxlPkRpZWxlY3RyaWMgcHJvcGVydGllcyBvZiBCU1QvcG9seW1lciBjb21wb3NpdGU8L1RpdGxlPjxBdXRob3I+SHUsIFRhbzwvQXV0aG9yPjxBdXRob3I+SnV1dGksIEphcmk8L0F1dGhvcj48QXV0aG9yPkphbnR1bmVuLCBIZWxpPC9BdXRob3I+PEF1dGhvcj5WaWxrbWFuLCBUYWlzdG88L0F1dGhvcj48S2V5d29yZD5Db21wb3NpdGVzPC9LZXl3b3JkPjxLZXl3b3JkPkRpZWxlY3RyaWMgcHJvcGVydGllczwvS2V5d29yZD48S2V5d29yZD5NaWNyb3N0cnVjdHVyZS1maW5hbDwvS2V5d29yZD48S2V5d29yZD5CU1QtQ09DPC9LZXl3b3JkPjxQdWJsaXNoZXI+RWxzZXZpZXI8L1B1Ymxpc2hlcj48UHVibGljYXRpb25ZZWFyPjIwMDc8L1B1YmxpY2F0aW9uWWVhcj48RE9JPjEwLjEwMTYvai5qZXVyY2VyYW1zb2MuMjAwNy4wMi4wODI8L0RPST48Vm9sdW1lPjI3PC9Wb2x1bWU+PFVSTD5odHRwczovL3d3dy5zY2llbmNlZGlyZWN0LmNvbS9zY2llbmNlL2FydGljbGUvcGlpL1MwOTU1MjIxOTA3MDAxMjUyP3ZpYSUzRGlodWI8L1VSTD48TGFuZ3VhZ2U+RW5nbGlzaDwvTGFuZ3VhZ2U+PExvY2F0aW9uPk1pY3JvZWxlY3Ryb25pY3MgYW5kIE1hdGVyaWFscyBQaHlzaWNzIExhYm9yYXRvcmllcywgRU1QQVJUIFJlc2VhcmNoIEdyb3VwIG9mIEluZm90ZWNoIE91bHUsIFAuTy4gQm94IDQ1MDAsIEZJTi05MDAxNCBVbml2ZXJzaXR5IG9mIE91bHUsIEZpbmxhbmQ8L0xvY2F0aW9uPjxEYXRlT2ZDaXRhdGlvbj4yMDE1LTA3LTI0PC9EYXRlT2ZDaXRhdGlvbj48L0NvbW1vbkZpZWxkcz48Q2l0YXRpb25UeXBlPjxKb3VybmFsPjxJU1NOPjA5NTUtMjIxOTwvSVNTTj48SXNzdWU+MTMtMTU8L0lzc3VlPjwvSm91cm5hbD48L0NpdGF0aW9uVHlwZT48L0NpdGF0aW9uPjwvREFUQV9TT1VSQ0U+PE1BVEVSSUFMUz48TWF0cml4PjxNYXRyaXhDb21wb25lbnQ+PENoZW1pY2FsTmFtZT5jeWNsbyBvbGVmaW4gY29wb2x5bWVyPC9DaGVtaWNhbE5hbWU+PEFiYnJldmlhdGlvbj5DT0M8L0FiYnJldmlhdGlvbj48UG9seW1lclR5cGU+Y29wb2x5bWVyPC9Qb2x5bWVyVHlwZT48TWFudWZhY3R1cmVyT3JTb3VyY2VOYW1lPlRpY29uYSBHbWJILCBHZXJtYW55PC9NYW51ZmFjdHVyZXJPclNvdXJjZU5hbWU+PFRyYWRlTmFtZT5Ub3BhcyA4MDA3Uy0wNDwvVHJhZGVOYW1lPjxEZW5zaXR5Pjx2YWx1ZT4xLjAyPC92YWx1ZT48dW5pdD5nL2NtXjM8L3VuaXQ+PC9EZW5zaXR5PjwvTWF0cml4Q29tcG9uZW50PjwvTWF0cml4PjxGaWxsZXI+PEZpbGxlckNvbXBvbmVudD48Q2hlbWljYWxOYW1lPmJhcml1bSBzdHJvbnRpdW0gdGl0YW5hdGU8L0NoZW1pY2FsTmFtZT48QWJicmV2aWF0aW9uPkJTVDwvQWJicmV2aWF0aW9uPjxNYW51ZmFjdHVyZXJPclNvdXJjZU5hbWU+U2lnbWHigJNBbGRyaWNoIENoZW1pZSBHbWJILCBHZXJtYW55PC9NYW51ZmFjdHVyZXJPclNvdXJjZU5hbWU+PERlbnNpdHk+PHZhbHVlPjQuOTwvdmFsdWU+PHVuaXQ+Zy9jbV4zPC91bml0PjwvRGVuc2l0eT48U3BoZXJpY2FsUGFydGljbGVEaWFtZXRlcj48ZGVzY3JpcHRpb24+bGVzcyB0aGFuIDIwMCBubTwvZGVzY3JpcHRpb24+PHZhbHVlPjIwMDwvdmFsdWU+PHVuaXQ+bm08L3VuaXQ+PC9TcGhlcmljYWxQYXJ0aWNsZURpYW1ldGVyPjwvRmlsbGVyQ29tcG9uZW50PjxGaWxsZXJDb21wb3NpdGlvbj48RnJhY3Rpb24+PHZvbHVtZT4wLjA1PC92b2x1bWU+PC9GcmFjdGlvbj48L0ZpbGxlckNvbXBvc2l0aW9uPjxEZXNjcmlwdGlvbj5CYTAuNVNyMC41VGlPMzwvRGVzY3JpcHRpb24+PC9GaWxsZXI+PC9NQVRFUklBTFM+PFBST0NFU1NJTkc+PE1lbHRNaXhpbmc+PENob29zZVBhcmFtZXRlcj48TWl4aW5nPjxNaXhlcj5Ub3JxdWUgUmhlb21ldGVyPC9NaXhlcj48UlBNPjxkZXNjcmlwdGlvbj4zMi02NCBycG08L2Rlc2NyaXB0aW9uPjx2YWx1ZT40ODwvdmFsdWU+PHVuaXQ+cnBtPC91bml0PjwvUlBNPjxUaW1lPjx2YWx1ZT4xNTwvdmFsdWU+PHVuaXQ+bWludXRlczwvdW5pdD48dW5jZXJ0YWludHk+PHR5cGU+YWJzb2x1dGU8L3R5cGU+PHZhbHVlPjU8L3ZhbHVlPjwvdW5jZXJ0YWludHk+PC9UaW1lPjxUZW1wZXJhdHVyZT48dmFsdWU+MjMwPC92YWx1ZT48dW5pdD5DZWxzaXVzPC91bml0PjwvVGVtcGVyYXR1cmU+PC9NaXhpbmc+PC9DaG9vc2VQYXJhbWV0ZXI+PENob29zZVBhcmFtZXRlcj48TW9sZGluZz48TW9sZGluZ01vZGU+aG90LXByZXNzaW5nPC9Nb2xkaW5nTW9kZT48TW9sZGluZ0luZm8+PFRlbXBlcmF0dXJlPjx2YWx1ZT4yMDA8L3ZhbHVlPjx1bml0PkNlbHNpdXM8L3VuaXQ+PC9UZW1wZXJhdHVyZT48L01vbGRpbmdJbmZvPjwvTW9sZGluZz48L0Nob29zZVBhcmFtZXRlcj48L01lbHRNaXhpbmc+PC9QUk9DRVNTSU5HPjxDSEFSQUNURVJJWkFUSU9OPjxTY2FubmluZ19FbGVjdHJvbl9NaWNyb3Njb3B5PjxFcXVpcG1lbnRVc2VkPkpFT0wgSlNNLTY0MDA8L0VxdWlwbWVudFVzZWQ+PC9TY2FubmluZ19FbGVjdHJvbl9NaWNyb3Njb3B5PjxEaWVsZWN0cmljX2FuZF9JbXBlZGFuY2VfU3BlY3Ryb3Njb3B5X0FuYWx5c2lzPjxFcXVpcG1lbnQ+QWdpbGVudCBFNDk5MUE8L0VxdWlwbWVudD48L0RpZWxlY3RyaWNfYW5kX0ltcGVkYW5jZV9TcGVjdHJvc2NvcHlfQW5hbHlzaXM+PFhSYXlfRGlmZnJhY3Rpb25fYW5kX1NjYXR0ZXJpbmc+PEVxdWlwbWVudD5TaWVtZW5zIEQ1MDAwPC9FcXVpcG1lbnQ+PC9YUmF5X0RpZmZyYWN0aW9uX2FuZF9TY2F0dGVyaW5nPjwvQ0hBUkFDVEVSSVpBVElPTj48UFJPUEVSVElFUz48RWxlY3RyaWNhbD48QUNfRGllbGVjdHJpY0Rpc3BlcnNpb24+PERpZWxlY3RyaWNfUmVhbF9QZXJtaXR0aXZpdHk+PGRlc2NyaXB0aW9uPlJlbGF0aXZlIHBlcm1pdHRpdml0eSBhdCAxR0h6PC9kZXNjcmlwdGlvbj48dmFsdWU+Mi45PC92YWx1ZT48L0RpZWxlY3RyaWNfUmVhbF9QZXJtaXR0aXZpdHk+PERpZWxlY3RyaWNfTG9zc19UYW5nZW50PjxkZXNjcmlwdGlvbj5Mb3NzIFRhbmdlbnQgYXQgMSBHSHo8L2Rlc2NyaXB0aW9uPjx2YWx1ZT41ZS0wNTwvdmFsdWU+PC9EaWVsZWN0cmljX0xvc3NfVGFuZ2VudD48L0FDX0RpZWxlY3RyaWNEaXNwZXJzaW9uPjwvRWxlY3RyaWNhbD48L1BST1BFUlRJRVM+PC9Qb2x5bWVyTmFub2NvbXBvc2l0ZT4=" . + '''.format("/apps/nanomine-graph/ChemDatabase/chemprops_example.json") + + response = self.client.post( + "/pub", data=upload, content_type="text/turtle", follow_redirects=True) + self.assertEquals(response.status, "201 CREATED") + + response = self.client.post( + "/pub", data=open("/apps/nanomine-graph/setl/chem_props.setl.ttl", "rb").read(), + content_type="text/turtle", follow_redirects=True) + self.assertEquals(response.status, "201 CREATED") + + setlmaker = autonomic.SETLMaker() + results = self.run_agent(setlmaker) + + self.assertTrue(len(results) > 0) + + setlr = autonomic.SETLr() + + print(len(self.app.db)) + for setlr_np in results: + setlr_results = self.run_agent(setlr, nanopublication=setlr_np) + + # def test_print_triples(self): + # print("\n\n\nPrinting SPO Triples") + # for s, p, o in self.app.db.triples((None, None, None)): + # print(str(s.n3()) + " " + str(p.n3()) + " " + str(o.n3()) + " .") + + def no_test_material(self): + expected_materials = list() + + # Initialize Expected Materials + # Poly(ether ether ketone) + expected_materials.append(dict()) + mat_num = 0 + expected_materials[mat_num]["id"] = rdflib.Literal("O(C1=CC=C(C=C1)C(=O)C2=CC=C(OC3=CC=C(C=C3)[*])C=C2)[*]") + expected_materials[mat_num]["stdname"] = rdflib.Literal("Poly(ether ether ketone)") + expected_materials[mat_num]["density"] = rdflib.Literal(1.29) + expected_materials[mat_num]["abbrev"] = [rdflib.Literal("PEEK")] + expected_materials[mat_num]["altname"] = [rdflib.Literal("Zeniva"), rdflib.Literal("KetaSpire")] + + # Polystyrene + expected_materials.append(dict()) + mat_num += 1 + expected_materials[mat_num]["id"] = rdflib.Literal("C(C(C1=CC=CC=C1)[*])[*]") + expected_materials[mat_num]["stdname"] = rdflib.Literal("Polystyrene") + expected_materials[mat_num]["density"] = rdflib.Literal(1.04) + expected_materials[mat_num]["abbrev"] = [rdflib.Literal("PS")] + expected_materials[mat_num]["altname"] = [ + rdflib.Literal("Pelaspan"), + rdflib.Literal("Afcolene"), + rdflib.Literal("Aim"), + rdflib.Literal("Amoco"), + rdflib.Literal("Bextrene"), + rdflib.Literal("Carinex"), + rdflib.Literal("Distrene"), + rdflib.Literal("Dylene"), + rdflib.Literal("Edistir"), + rdflib.Literal("Erinoid"), + rdflib.Literal("Fina"), + rdflib.Literal("Fostarene"), + rdflib.Literal("Gedex"), + rdflib.Literal("Hostyren"), + rdflib.Literal("Huntsman PS"), + rdflib.Literal("Lacqrene"), + rdflib.Literal("Ladene"), + rdflib.Literal("Lorkalene"), + rdflib.Literal("Luron"), + rdflib.Literal("Lustran"), + rdflib.Literal("Lustrex"), + rdflib.Literal("Neste PS"), + rdflib.Literal("Polystyrol"), + rdflib.Literal("Restirolo"), + rdflib.Literal("Sicostyrol"), + rdflib.Literal("Sternite"), + rdflib.Literal("Stiroplasto"), + rdflib.Literal("Stymer"), + rdflib.Literal("Styrodur"), + rdflib.Literal("Styron"), + rdflib.Literal("Styvarene"), + rdflib.Literal("Vestyron"), + rdflib.Literal("Polystyrol"), + rdflib.Literal("Polyzote"), + rdflib.Literal("Pyrochek 68") + ] + expected_materials[mat_num]["altname"] += [ + rdflib.Literal("polyphenylethene"), + rdflib.Literal("poly-1-phenylethylene"), + rdflib.Literal("polyvinylbenzene") + ] + + # Nylon + expected_materials.append(dict()) + mat_num += 1 + expected_materials[mat_num]["id"] = rdflib.Literal("N(CCCCCC(=O)[*])[*]") + expected_materials[mat_num]["stdname"] = rdflib.Literal("Nylon 6") + expected_materials[mat_num]["density"] = rdflib.Literal(1.08) + expected_materials[mat_num]["abbrev"] = [rdflib.Literal("PA 6"), rdflib.Literal("Nylon 6")] + expected_materials[mat_num]["altname"] = [rdflib.Literal("Perlon"), rdflib.Literal("Plaskon")] + expected_materials[mat_num]["altname"] += [ + rdflib.Literal("Poly(caprolactam)"), + rdflib.Literal("polyamide 6"), + rdflib.Literal("poly(ω-aminocaproamide)"), + rdflib.Literal("poly(6-aminocaproic acid)"), + rdflib.Literal("poly(ε-aminocaproic acid)"), + rdflib.Literal("poly(ω-caproamide)"), + rdflib.Literal("polycaprolactam"), + rdflib.Literal("poly-[imino-(1-oxohexamethylene)]") + ] + + for mat in expected_materials: + mat["abbrev"] = mat["abbrev"].sort() + mat["altname"] = mat["altname"].sort() + + # Query the graph for the materials + # Get everything but the alt names and abbreviations + + props = self.app.db.query( + ''' + SELECT ?chem ?id ?stdname ?abbrev ?density + WHERE + { + ?chem a . + ?chem ?id . + ?chem ?den . + ?den ?density . + ?chem ?stdname . + } + ''' + ) + materials = [{"chem": chem, "id": chem_id, "stdname": stdname, "density": density} for chem, chem_id, stdname, abbrev, density in props] + for chem in materials: + chem["altname"] = [name for name in self.app.db.objects(chem["chem"], rdflib.URIRef("http://www.w3.org/2004/02/skos/core#altLabel"))].sort() + chem["abbrev"] = [abbrev for abbrev in self.app.db.objects(chem["chem"], rdflib.URIRef("http://www.w3.org/2004/02/skos/core#notation"))].sort() + chem.pop("chem", None) + self.assertCountEqual(expected_materials, materials) diff --git a/whyis/materialsmine/tests/test_chemical_names.py b/whyis/materialsmine/tests/test_chemical_names.py new file mode 100644 index 00000000..d2dfc24d --- /dev/null +++ b/whyis/materialsmine/tests/test_chemical_names.py @@ -0,0 +1,105 @@ +import rdflib + +from whyis.test.agent_unit_test_case import AgentUnitTestCase +from base64 import b64encode +import autonomic +from . import template + +SKOS = rdflib.Namespace("http://www.w3.org/2004/02/skos/core#") + +class TestChemicalNames(template.IngestTest): + + data = ''' + + L101_S3_Dang_2007 + + + + bisphenol A + 6623 + CC(C)(C1=CC=C(OCC2CO2)C=C1)C3=CC=C(OCC4CO4)C=C3 + BPA + Dow chemical + DER661 + + + + + barium titanate + Barium titanate + BaTiO3 + Guoteng electronic ceramic company + + silane coupling agent + KH550 + + + phosphated ester + BYK-9010 + + + + + ''' + + def test_chemprops_id(self): + print (len(self.app.db)) + component_types = set(self.app.db.query(''' + SELECT ?parttype ?role WHERE { + ?sample a . + ?sample /? ?part. + ?part a ?parttype; + [ + a ?role; + ?sample + ]. + }''')) + print ('\n'.join(['\t'.join(x) for x in component_types])) + self.assertIn((rdflib.URIRef('http://nanomine.org/compound/BariumTitanate'), + rdflib.URIRef('http://nanomine.org/ns/Filler')), component_types) + filler_type = self.app.db.resource(rdflib.URIRef('http://nanomine.org/compound/BariumTitanate')) + print ('\n'.join(["%s\t%s" %(p,o) for p,o in filler_type.predicate_objects()])) + + self.assertEquals(filler_type.value(rdflib.RDFS.label), rdflib.Literal("Barium titanate")) + self.assertEquals(filler_type.value(SKOS.altLabel), rdflib.Literal("barium titanate")) + self.assertEquals(filler_type.value(SKOS.notation), rdflib.Literal("BaTiO3")) + + def test_pubchem_id(self): + print (len(self.app.db)) + component_types = set(self.app.db.query(''' + SELECT ?parttype ?role WHERE { + ?sample a . + ?sample /? ?part. + ?part a ?parttype; + [ + a ?role; + ?sample + ]. + }''')) + print ('\n'.join(['\t'.join(x) for x in component_types])) + self.assertIn((rdflib.URIRef('http://rdf.ncbi.nlm.nih.gov/pubchem/compound/CID6623'), + rdflib.URIRef('http://nanomine.org/ns/Matrix')), component_types) + matrix_type = self.app.db.resource(rdflib.URIRef('http://rdf.ncbi.nlm.nih.gov/pubchem/compound/CID6623')) + print ('\n'.join(["%s\t%s" %(p,o) for p,o in matrix_type.predicate_objects()])) + + self.assertEquals(matrix_type.value(rdflib.RDFS.label), rdflib.Literal("bisphenol A")) + self.assertEquals(matrix_type.value(SKOS.notation), rdflib.Literal("BPA")) + + + def test_nonchemprops_id(self): + print (len(self.app.db)) + component_types = set(self.app.db.query(''' + SELECT ?parttype ?role WHERE { + ?sample a . + ?sample /? ?part. + ?part a ?parttype; + [ + a ?role; + ?sample + ]. + }''')) + print ('\n'.join(['\t'.join(x) for x in component_types])) + self.assertIn((rdflib.URIRef('http://nanomine.org/compound/PhosphatedEster'), + rdflib.URIRef('http://nanomine.org/ns/SurfaceTreatment')), component_types) + self.assertIn((rdflib.URIRef('http://nanomine.org/compound/SilaneCouplingAgent'), + rdflib.URIRef('http://nanomine.org/ns/SurfaceTreatment')), component_types) diff --git a/whyis/materialsmine/tests/test_component_properties.py b/whyis/materialsmine/tests/test_component_properties.py new file mode 100644 index 00000000..c8347aee --- /dev/null +++ b/whyis/materialsmine/tests/test_component_properties.py @@ -0,0 +1,112 @@ +import rdflib + +from . import template + +SKOS = rdflib.Namespace("http://www.w3.org/2004/02/skos/core#") + +class TestComponentProperties(template.IngestTest): + + data = ''' + + L101_S3_Dang_2007 + L101_S1_Dang_2007 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c1081c941bb7a1270dd9d + + + + DGEBA Epoxy Resin + + inserted from ChemProps, NanoMine + 1.13 + g/cm3 + + + + + + Barium titanate + + inserted from ChemProps, NanoMine + 6.02 + g/cm3 + + + 0.1 + micrometers + + + + value ranges from 9 - 1.3 + 9 + m^2/g + + + + + + + 0.7802981205443941 + computed by NanoMine + + + 0.4 + reported + + + + + + +''' + + def test_fractions(self): + print (len(self.app.db)) + component_types = set(self.app.db.query(''' + SELECT ?role ?fractiontype ?value WHERE { + ?sample a . + ?sample ?part. + ?part [ + a ?role; + ?sample + ]. + ?part [ + ?value; + a ?fractiontype + ] + }''')) + print(component_types) + print ('\n'.join(['\t'.join(x) for x in component_types])) + self.assertIn((rdflib.URIRef('http://nanomine.org/ns/Filler'), + rdflib.URIRef('http://nanomine.org/ns/VolumeFraction'), + rdflib.Literal(0.4)), component_types) + self.assertIn((rdflib.URIRef('http://nanomine.org/ns/Filler'), + rdflib.URIRef('http://nanomine.org/ns/MassFraction'), + rdflib.Literal(0.7802981205443941)), component_types) + + def test_density(self): + print (len(self.app.db)) + component_types = set(self.app.db.query(''' + SELECT ?role ?fractiontype ?value ?unit WHERE { + ?sample a . + ?sample ?part. + ?part [ + a ?role; + ?sample + ]. + ?part [ + ?value; + a ?fractiontype; + ?unit; + ] + }''')) + print ('\n'.join(['\t'.join(x) for x in component_types])) + self.assertIn((rdflib.URIRef('http://nanomine.org/ns/Filler'), + rdflib.URIRef('http://nanomine.org/ns/Density'), + rdflib.Literal(6.02), + rdflib.URIRef('http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre')), component_types) + self.assertIn((rdflib.URIRef('http://nanomine.org/ns/Matrix'), + rdflib.URIRef('http://nanomine.org/ns/Density'), + rdflib.Literal(1.13), + rdflib.URIRef('http://www.ontology-of-units-of-measure.org/resource/om-2/gramPerCubicCentimetre')), component_types) diff --git a/whyis/materialsmine/tests/test_pnc_properties.py b/whyis/materialsmine/tests/test_pnc_properties.py new file mode 100644 index 00000000..310f6f84 --- /dev/null +++ b/whyis/materialsmine/tests/test_pnc_properties.py @@ -0,0 +1,188 @@ +import rdflib + +from . import template + +SKOS = rdflib.Namespace("http://www.w3.org/2004/02/skos/core#") + +class TestStaticProperties(template.IngestTest): + + data = ''' + + L141_S19_Gao_2013 + L141_S1_Gao_2013 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c12fec941bb7a1270ddbb + + + + + Modulus + 3.2 + GPa + + absolute + 0.1 + + + + Yield Stress + 76 + MPa + + absolute + 0.5 + + + + strain at break + 0.079 + + absolute + 0.02 + + + + + Tensile test strain rate + 0.1 + mm/min + + + + + + +''' + + def test_property(self): + print (len(self.app.db)) + properties = set(self.app.db.query(''' + SELECT ?sample ?property ?unit ?value ?uncertainty WHERE { + ?sample a . + ?sample ?attr. + ?attr ?value; + a ?property. + optional { + ?attr ?unit. + } + optional { + ?attr [ + a ; + ?uncertainty + ]. + } + }''')) + print ('\n'.join(['\t'.join([(val if val is not None else '-') for val in x]) for x in properties])) + self.assertIn((rdflib.URIRef('http://nanomine.org/sample/l141-s19-gao-2013'), + rdflib.URIRef('http://nanomine.org/ns/TensileModulus'), + rdflib.URIRef('http://www.ontology-of-units-of-measure.org/resource/om-2/gigapascal'), + rdflib.Literal(3.2), + rdflib.Literal(0.1)), properties) + self.assertIn((rdflib.URIRef('http://nanomine.org/sample/l141-s19-gao-2013'), + rdflib.URIRef('http://nanomine.org/ns/ElongationAtBreak'), + None, # no unit + rdflib.Literal(0.079), + rdflib.Literal(0.02)), properties) + +import rdflib + +from . import template + +SKOS = rdflib.Namespace("http://www.w3.org/2004/02/skos/core#") + +class TestDynamicProperties(template.IngestTest): + + data = ''' + + L104_S4_He_2009 + L104_S1_He_2009 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c10bbc941bb7a1270dd9f + + + + + measured at 1000 Hz and room temperature + 25.4423 + + + + + + + + 25 + Celsius + + + + + + + dependence of dielectric constants on the frequency for PVDF/xGnP nano composites at room temperature + + Frequency + Hz + Dielectric permittivity + dimensionless + + + + frequency (Hz) + Dielectric Permittivity + + + + 53 + 33.8412508779 + + + 54 + 24.9339073612 + + + + + + + + + ''' + + def test_curve(self): + print (len(self.app.db)) + properties = set(self.app.db.query(''' + SELECT ?sample ?property ?unit ?value ?independentVar ?indepValue ?indepUnit WHERE { + ?sample a . + ?sample ?attr. + ?attr ?value. + ?attr a ?property. + optional { + ?attr ?unit. + } + optional { + ?attr ?irt. + ?irt a ?independentVar; + ?indepValue. + optional { + ?irt ?indepUnit. + } + } + }''')) + print ('\n'.join(['\t'.join([(val if val is not None else '-') for val in x]) for x in properties])) + self.assertIn((rdflib.URIRef('http://nanomine.org/sample/l104-s4-he-2009'), + rdflib.URIRef('http://nanomine.org/ns/DielectricPermittivity'), + None, + rdflib.Literal(33.8412508779), + rdflib.URIRef('http://nanomine.org/ns/Frequency'), + rdflib.Literal(53.0), + rdflib.URIRef('http://www.ontology-of-units-of-measure.org/resource/om-2/hertz')), properties) + self.assertIn((rdflib.URIRef('http://nanomine.org/sample/l104-s4-he-2009'), + rdflib.URIRef('http://nanomine.org/ns/DielectricPermittivity'), + None, + rdflib.Literal(24.9339073612), + rdflib.URIRef('http://nanomine.org/ns/Frequency'), + rdflib.Literal(54.0), + rdflib.URIRef('http://www.ontology-of-units-of-measure.org/resource/om-2/hertz')), properties) diff --git a/whyis/materialsmine/tests/xml/L101_S11_Dang_2007.xml b/whyis/materialsmine/tests/xml/L101_S11_Dang_2007.xml new file mode 100644 index 00000000..895d66fb --- /dev/null +++ b/whyis/materialsmine/tests/xml/L101_S11_Dang_2007.xml @@ -0,0 +1,489 @@ + + + L101_S11_Dang_2007 + L101_S1_Dang_2007 + + + + research article + Composites Science and Technology + Study on microstructure and dielectric property of the BaTiO3/epoxy resin composites + Dang, Zhi-Min + Yu, Yan-Fei + Xu, Hai-Ping + Bai, Jinbo + Dielectric properties + Microstructure + Silane coupling agent + BaTiO3 + Elsevier + 2008 + 10.1016/j.compscitech.2007.05.021 + 68 + https://www.sciencedirect.com/science/article/pii/S0266353807002199?via%3Dihub + English + Key Laboratory of Beijing City on Preparation and Processing of Novel Polymer Materials and Key Laboratory of the Ministry of Education on Nanomaterials, Beijing University of Chemical Technology, Beijing 100029, PR China + 2015-07-24 + + + + 0266-3538 + 1 + + + + + + + + bisphenol A epoxy resin + EPR + Dow chemical + DER661 + + + + + dissolving + + acetone + + + + + + MeTHPA was chosen as a hardener in 10/4 (EPR/MeTHPA) weight ratio + MeTHPA + + + + + + + barium titanate + BaTiO3 + Guoteng electronic ceramic company + + 0.7 + micrometers + + + + value ranges from 9 - 1.3 + 9 + m^2/g + + + + phosphated ester + BYK-9010 + + The amount of KH550 and BYK-9010 was 1.0 wt% in comparison with the BaTiO3 powders + + + + + + 0.6 + + + + + + + + Suspensions containing BaTiO3 powde and solvent were prepared in a polytetrafluoroethylene (PTFE) bottle + + + + Ultrasonic was applied to the suspensions. + ultra-sonication + + + + + EPR and curing agent were added into the suspensions. + EPR + + + + + Catalyst 2,4-EMI was added into suspensions + 2-ethyl-4- methyl-imidazole + + + + + ball milling + + + + + + + 75 + Celsius + + + + + + + To remove solvent residue + + 75 + Celsius + + + + + + + hot-pressing + + Samples were cured at temperature range between 150 and 160 degrees celsius + + 150 + Celsius + + + + + + + + + Hitachi S-4700 + + + Dupont TA 2010 + + + Nexus 670 + + + + + + + Dielectric Permittivity of 60 vol% BaTiO3/EPR composite without KH550. Taken at room temperature + + + Frequency + Hz + Dielectric Permittivity + + + + Frequency (Hz) + Dielectric Permittivity + + + + 1037.79237 + 36.81818 + + + 1272.6532 + 36.73295 + + + 1530.63225 + 36.64773 + + + 1951.22856 + 36.13636 + + + 2416.25708 + 36.22159 + + + 2963.07568 + 36.13636 + + + 3633.51004 + 35.88068 + + + 4543.23067 + 35.79545 + + + 5680.71772 + 35.71023 + + + 7171.68299 + 35.19886 + + + 9143.53871 + 35.28409 + + + 10680.9252 + 35.11364 + + + 13750.59549 + 35.19886 + + + 16376.87057 + 34.77273 + + + 20677.81907 + 34.85795 + + + 25603.52549 + 34.51705 + + + 31704.34482 + 34.43182 + + + 40029.90925 + 34.43182 + + + 49088.09946 + 34.26136 + + + 60783.71494 + 34.09091 + + + 76742.70088 + 33.92045 + + + 94110.19717 + 33.83523 + + + 115408.09887 + 33.75 + + + 140160.12385 + 33.75 + + + 178674.1632 + 33.23864 + + + 217003.09354 + 33.40909 + + + 268705.74179 + 33.23864 + + + 335987.68558 + 33.23864 + + + 420124.26433 + 33.32386 + + + 535588.2391 + 32.98295 + + + 650457.93715 + 32.98295 + + + 797676.52709 + 32.98295 + + + 978233.20119 + 33.06818 + + + + + + + Loss Tangent of 60 vol% BaTiO3/EPR composite without KH550. Taken at room temperature + + + Frequency + Hz + Loss Tangent + + + + Frequency (Hz) + Loss Tangent + + + + 1059.93907 + 0.03011 + + + 1262.18669 + 0.02879 + + + 1547.41478 + 0.0286 + + + 1972.1676 + 0.02784 + + + 2348.47811 + 0.02727 + + + 3022.29657 + 0.02633 + + + 3705.27311 + 0.02652 + + + 4498.72957 + 0.02727 + + + 5678.23658 + 0.02443 + + + 6961.40065 + 0.02576 + + + 8786.58723 + 0.02273 + + + 10877.19349 + 0.025 + + + 13206.46294 + 0.02386 + + + 16508.08245 + 0.02405 + + + 20043.16456 + 0.02292 + + + 25298.21549 + 0.02386 + + + 31622.7766 + 0.02348 + + + 39146.83264 + 0.02424 + + + 48461.09895 + 0.0233 + + + 61763.27794 + 0.02292 + + + 72838.25798 + 0.02292 + + + 94650.64885 + 0.02254 + + + 116039.73854 + 0.02348 + + + 138181.35219 + 0.02311 + + + 174410.66328 + 0.02311 + + + 222284.97711 + 0.02348 + + + 277856.28495 + 0.02348 + + + 334099.94527 + 0.0233 + + + 421696.50343 + 0.0233 + + + 507056.29618 + 0.02424 + + + 646239.14082 + 0.02424 + + + 799999.81699 + 0.025 + + + 961935.75439 + 0.02727 + + + + + + + + null + + + micrometers + + https://nanomine.org/nmr/blob?id=5b201f0ae74a1d61fc4405a0 + Microstructure of fractured surface of 0.7 micrometers loading nanocomposite without KH550 + SEM + + + diff --git a/whyis/materialsmine/tests/xml/L101_S3_Dang_2007.xml b/whyis/materialsmine/tests/xml/L101_S3_Dang_2007.xml new file mode 100644 index 00000000..be5d2a61 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L101_S3_Dang_2007.xml @@ -0,0 +1,228 @@ + + + L101_S3_Dang_2007 + L101_S1_Dang_2007 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c1081c941bb7a1270dd9d + + + + research article + Composites Science and Technology + Study on microstructure and dielectric property of the BaTiO3/epoxy resin composites + Dang, Zhi-Min + Yu, Yan-Fei + Xu, Hai-Ping + Bai, Jinbo + Dielectric properties + Microstructure + Silane coupling agent + BaTiO3 + Elsevier + 2008 + 10.1016/j.compscitech.2007.05.021 + 68 + https://www.sciencedirect.com/science/article/pii/S0266353807002199?via%3Dihub + English + Key Laboratory of Beijing City on Preparation and Processing of Novel Polymer Materials and Key Laboratory of the Ministry of Education on Nanomaterials, Beijing University of Chemical Technology, Beijing 100029, PR China + 2015-07-24 + + + + 0266-3538 + 1 + + + + + + + + bisphenol A epoxy resin + DGEBA Epoxy Resin + CC(C)(C1=CC=C(OCC2CO2)C=C1)C3=CC=C(OCC4CO4)C=C3 + EPR + Dow chemical + DER661 + + inserted from ChemProps, NanoMine + 1.13 + g/cm3 + + + + + + dissolving + + acetone + + + + + + MeTHPA was chosen as a hardener in 10/4 (EPR/MeTHPA) weight ratio + MeTHPA + + + + + + + barium titanate + Barium titanate + BaTiO3 + Guoteng electronic ceramic company + + inserted from ChemProps, NanoMine + 6.02 + g/cm3 + + + 0.1 + micrometers + + + + value ranges from 9 - 1.3 + 9 + m^2/g + + + + silane coupling agent + KH550 + + The amount of KH550 and BYK-9010 was 1.0 wt% in comparison with the BaTiO3 powders + + + + phosphated ester + BYK-9010 + + The amount of KH550 and BYK-9010 was 1.0 wt% in comparison with the BaTiO3 powders + + + + + + + 0.7802981205443941 + computed by NanoMine + + + 0.4 + reported + + + + + + + + + Suspensions containing BaTiO3 powder, KH550 and solvent were prepared in a polytetrafluoroethylene (PTFE) bottle + + + + Ultrasonic was applied to the suspensions. + ultra-sonication + + + + + EPR and curing agent were added into the suspensions. + EPR + + + + + Catalyst 2,4-EMI was added into suspensions + 2-ethyl-4- methyl-imidazole + + + + + ball milling + + + + + + + 75 + Celsius + + + + + + + To remove solvent residue + + 75 + Celsius + + + + + + + hot-pressing + + Samples were cured at temperature range between 150 and 160 degrees celsius + + 150 + Celsius + + + + + + + + + Hitachi S-4700 + + + Dupont TA 2010 + + + Nexus 670 + + + + + + + Dielectric Permittivity at 10^3 Hz, taken at room temperature + 16.27129074 + + + Loss Tangent at 10^3 Hz, taken at room temperature + 0.023529412 + + + + + Dielectric Permittivity at 10^6 Hz, taken at room temperature + 15.2407932 + + + Loss Tangent at 10^6 Hz, taken at room temperature + 0.024242424 + + + + + diff --git a/whyis/materialsmine/tests/xml/L102_S3_Hu_2007.xml b/whyis/materialsmine/tests/xml/L102_S3_Hu_2007.xml new file mode 100644 index 00000000..f1af4ea5 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L102_S3_Hu_2007.xml @@ -0,0 +1,135 @@ + + + L102_S3_Hu_2007 + L102_S1_Hu_2007 + + + + research article + Journal of the European Ceramic Society + Dielectric properties of BST/polymer composite + Hu, Tao + Juuti, Jari + Jantunen, Heli + Vilkman, Taisto + Composites + Dielectric properties + Microstructure-final + BST-COC + Elsevier + 2007 + 10.1016/j.jeurceramsoc.2007.02.082 + 27 + https://www.sciencedirect.com/science/article/pii/S0955221907001252?via%3Dihub + English + Microelectronics and Materials Physics Laboratories, EMPART Research Group of Infotech Oulu, P.O. Box 4500, FIN-90014 University of Oulu, Finland + 2015-07-24 + + + + 0955-2219 + 13-15 + + + + + + + + cyclo olefin copolymer + COC + copolymer + Ticona GmbH, Germany + Topas 8007S-04 + + 1.02 + g/cm^3 + + + + + + barium strontium titanate + BST + Sigma–Aldrich Chemie GmbH, Germany + + 4.9 + g/cm^3 + + + less than 200 nm + 200 + nm + + + + + 0.05 + + + Ba0.5Sr0.5TiO3 + + + + + + + Torque Rheometer + + 32-64 rpm + 48 + rpm + + + + 230 + Celsius + + + + + + hot-pressing + + + 200 + Celsius + + + + + + + + + JEOL JSM-6400 + + + Agilent E4991A + + + Siemens D5000 + + + + + + + Relative permittivity at 1GHz + 2.9 + + + Loss Tangent at 1 GHz + 0.00005 + + + + + diff --git a/whyis/materialsmine/tests/xml/L104_S4_He_2009.xml b/whyis/materialsmine/tests/xml/L104_S4_He_2009.xml new file mode 100644 index 00000000..76e34fbf --- /dev/null +++ b/whyis/materialsmine/tests/xml/L104_S4_He_2009.xml @@ -0,0 +1,1579 @@ + + + L104_S4_He_2009 + L104_S1_He_2009 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c10bbc941bb7a1270dd9f + + + + research article + Advanced Materials + High Dielectric Permittivity and Low Percolation Threshold in Nanocomposites Based on Poly(vinylidene fluoride) and Exfoliated Graphite Nanoplates + He, Fuan + Lau, Sienting + Chan, Helen Laiwa + Fan, Jintu + poly(vinylidene fluoride) + exfoliated graphite nanoplates + nanocomposites + dielectrics + WILEY‐VCH Verlag + 2009 + 10.1002/adma.200801758 + 21 + http://onlinelibrary.wiley.com/doi/10.1002/adma.200801758/abstract + English + Institute of Textiles and Clothing The Hong Kong Polytechnic University Hung Hom, Kowloon, Hong Kong (China) + 2017-06-26 + + + + 1521-4095 + 6 + + + + + + + + poly(vinylidene flouride) + Poly(vinylidene fluoride) + C(C(F)(F)[*])[*] + PVDF + + inserted from ChemProps, NanoMine + 1.68 + g/cm3 + + + + + + graphite nanoplates + Graphite + xGnPs + + inserted from ChemProps, NanoMine + 2.266 + g/cm3 + + + + exfoliated graphite nanoplates with diameters of 0.5-25 micrometer + 12.75 + micrometer + + absolute + 12.25 + + + + exfoliated graphite nanoplates with diameters of 0.5-25 micrometer + 12.75 + micrometer + + absolute + 12.25 + + + + exfoliated graphite nanoplates with thicknesses of 20-60 nm + 40 + nm + + absolute + 20 + + + + + + + acidic intercalation + + + + rapid thermal treatment + + + + ultrasonic powdering + + + + + + 0.010492168094092574 + computed by NanoMine + + + 0.0078 + reported + + + + + + + + + + Desired amount of xGnPs was first ultrasonically dispersed in 200 mL of N,N-dimethylformamide (DMF) for 1 hr. + ultra-sonication + + N,N-dimethylformamide + + + + + + + PVDF was added into the xGnP suspension, stirring for 30 min at 80 deg C. + stirring + + + 80 + Celsius + + + + + + Then ultrasonicating for 2 hours. + ultra-sonication + + N,N-dimethylformamide + + + + + + + Poured onto a glass plate to form a thin film and dried at 70 deg C for 3 days. + + 70 + Celsius + + + + + + + hot-pressing + + + 200 + Celsius + + + + + + + + + JEOL JSM-2010 + + + JEOL JSM-6490 + + + Agilen 4294 A + The dielectric porperties of the samples were measured in the frequency range of 50-10^7 Hz at room temperature + + + + + + + measured at 1000 Hz and room temperature + 25.4423 + + + + + + + + 25 + Celsius + + + + + + + dependence of dielectric constants on the frequency for PVDF/xGnP nano composites at room temperature + + Frequency + Hz + Dielectric permittivity + dimensionless + + + + frequency (Hz) + Dielectric Permittivity + + + + 53.4586372606 + 33.8412508779 + + + 53.4586372606 + 24.9339073612 + + + 51.6552840554 + 20.3792069301 + + + 59.2553097555 + 33.4761096982 + + + 59.2553097555 + 25.2486363287 + + + 65.6805319803 + 34.5366595745 + + + 65.9628714676 + 25.2443568671 + + + 72.8024593747 + 34.6774468093 + + + 72.8024593747 + 25.3137735357 + + + 80.6966376674 + 34.7716236622 + + + 80.3129466931 + 25.3515613288 + + + 89.4468042254 + 34.5600843575 + + + 89.4468042254 + 25.4687169669 + + + 99.1457762975 + 34.7009670824 + + + 99.1457762975 + 25.3988754048 + + + 109.896435572 + 34.5600843575 + + + 109.896435572 + 25.3446866278 + + + 121.81281949 + 34.5600843575 + + + 121.81281949 + 25.3601573275 + + + 135.021330901 + 34.5366595745 + + + 135.021330901 + 25.2828981485 + + + 149.662078873 + 34.5835250286 + + + 150.09067161 + 25.3744904695 + + + 165.890364901 + 34.466480446 + + + 165.890364901 + 25.3962923617 + + + 185.008560727 + 33.6321138545 + + + 183.00403788 + 25.203026115 + + + 204.254383641 + 34.3731300551 + + + 203.380117911 + 25.6193970584 + + + 225.91721694 + 33.4590907062 + + + 225.91721694 + 24.8916784067 + + + 249.877569335 + 33.9734440788 + + + 250.951712657 + 25.5024128482 + + + 278.893239195 + 32.9208875367 + + + 277.567176279 + 24.807434938 + + + 307.005425593 + 33.7152865483 + + + 308.545647023 + 25.0893607214 + + + 341.61115342 + 32.6821752203 + + + 341.025524265 + 24.4733025684 + + + 378.003894419 + 34.5132506687 + + + 375.694641726 + 26.2867870129 + + + 384.54559341 + 23.9805233694 + + + 418.991934706 + 33.5215360105 + + + 428.279322647 + 24.3739432178 + + + 464.424425093 + 33.1598444983 + + + 472.461709465 + 24.1764330483 + + + 514.783289981 + 33.3176018344 + + + 523.283810313 + 24.3469152919 + + + 570.602710205 + 33.1823354448 + + + 582.139840294 + 24.3189179878 + + + 632.474789353 + 33.2950192045 + + + 645.934262186 + 25.0502137454 + + + 713.188239247 + 33.4307449448 + + + 713.188239247 + 24.4733025684 + + + 790.521273943 + 32.935771769 + + + 790.521273943 + 24.3739432178 + + + 876.239750135 + 32.9804648552 + + + 876.239750135 + 24.2996885191 + + + 971.252925158 + 32.9581107363 + + + 966.634876725 + 24.3189179878 + + + 1076.56864971 + 33.1149083279 + + + 1076.56864971 + 24.4733025684 + + + 1193.30405863 + 33.0924630834 + + + 1193.30405863 + 24.354119807 + + + 1322.69742084 + 31.7732213663 + + + 1322.69742084 + 24.489901794 + + + 1466.12127434 + 29.8923102931 + + + 1466.12127434 + 23.657528706 + + + 1625.09698529 + 29.8720493216 + + + 1625.09698529 + 23.5508334901 + + + 1799.10462078 + 28.7981081001 + + + 1804.40420331 + 23.3705548016 + + + 2013.83481675 + 28.8714235442 + + + 1962.66644592 + 23.8184785408 + + + 2213.13268191 + 29.9938214697 + + + 2213.13268191 + 23.5508334901 + + + 2453.10897015 + 28.5841217338 + + + 2453.10897015 + 23.4181408952 + + + 2719.10657172 + 28.7006436994 + + + 2719.10657172 + 23.2598962827 + + + 3013.94705181 + 26.5028213057 + + + 3299.61539895 + 23.0349419486 + + + 3340.757926 + 31.9460348524 + + + 3640.01213585 + 23.4181408952 + + + 3703.0058353 + 31.0280873853 + + + 4059.50886109 + 23.9665907209 + + + 4083.46009574 + 30.9860400403 + + + 4472.20403939 + 23.4578699802 + + + 4549.59957177 + 30.1978791576 + + + 4957.13787749 + 23.1811754222 + + + 5042.92562817 + 30.1978791576 + + + 5494.65447462 + 23.1811754222 + + + 5589.74443577 + 29.9125850068 + + + 6090.4555293 + 22.830215545 + + + 6195.85636612 + 30.2183611259 + + + 6742.59246347 + 23.8415605884 + + + 6903.1323459 + 29.8963641362 + + + 7482.87610133 + 23.0635933927 + + + 7659.16441495 + 28.8819124047 + + + 8437.80546046 + 29.7911426713 + + + 8437.80546046 + 23.1027209847 + + + 9352.74077 + 28.9940309625 + + + 9352.74077 + 22.8689472094 + + + 10357.0079669 + 26.607851954 + + + 10546.29344 + 22.6759437509 + + + 11490.9960434 + 29.0727728204 + + + 11761.7112453 + 23.5523543143 + + + 12969.77986 + 26.7283967539 + + + 12920.4220849 + 22.5609244114 + + + 14348.7491135 + 26.607851954 + + + 14610.9879544 + 22.5609244114 + + + 15919.7926485 + 28.8959034798 + + + 16294.8454171 + 23.6346248277 + + + 17951.4015092 + 28.0275666874 + + + 17951.4015092 + 22.2570503852 + + + 19897.9231698 + 25.5933542785 + + + 20698.8562635 + 23.0245320687 + + + 22437.202287 + 27.7439589652 + + + 22965.7980435 + 23.0781187566 + + + 25421.4042221 + 25.8257769694 + + + 24941.3536205 + 22.1066516695 + + + 28043.9410933 + 25.2315228338 + + + 31046.7525708 + 27.489835137 + + + 31138.2063005 + 22.2872526916 + + + 34455.4418934 + 24.8495209727 + + + 38028.0732611 + 26.3460521841 + + + 38520.5957796 + 22.1066516695 + + + 42292.4287439 + 25.7791241842 + + + 43065.36842 + 22.1066516695 + + + 46967.7728374 + 25.7791241842 + + + 49684.9137773 + 22.9466077754 + + + 52684.6444687 + 25.5803428176 + + + 57403.9632582 + 26.3460521841 + + + 58147.4335981 + 22.1066516695 + + + 63901.9569007 + 27.4818482 + + + 63901.9569007 + 21.9820960365 + + + 70831.0283271 + 27.6688161197 + + + 70831.0283271 + 21.7105383595 + + + 78511.4387289 + 24.1682382811 + + + 87024.6579342 + 27.6125925756 + + + 87024.6579342 + 21.8088962618 + + + 96460.9897763 + 24.2092399129 + + + 106920.529991 + 27.6125925756 + + + 106920.529991 + 21.7350861699 + + + 118514.227981 + 23.8588868021 + + + 131365.063707 + 26.8373539349 + + + 131365.063707 + 21.58821455 + + + 145609.3522 + 23.6174614719 + + + 161398.189517 + 26.2969736679 + + + 161398.189517 + 21.4423353932 + + + 178899.055492 + 23.7217777153 + + + 198297.590274 + 26.1015721568 + + + 198297.590274 + 21.369765891 + + + 219799.563505 + 23.2598962827 + + + 243633.057014 + 25.6976845068 + + + 243633.057014 + 20.6574428847 + + + 270050.884195 + 22.799277449 + + + 299333.271716 + 25.3343780715 + + + 299333.271716 + 20.1047185472 + + + 329662.877206 + 23.8588868021 + + + 339274.653635 + 20.0502661252 + + + 367767.858164 + 25.6976845068 + + + 374132.413297 + 20.4831035116 + + + 407645.975848 + 25.1973306346 + + + 414700.657846 + 20.1958014079 + + + 451848.191559 + 24.7234765831 + + + 459667.832845 + 19.811526636 + + + 500843.379579 + 24.5231340285 + + + 512642.697593 + 20.0852542982 + + + 564758.649726 + 21.7978087897 + + + 625997.04073 + 23.5774620971 + + + 625997.04073 + 19.2379075231 + + + 689636.749172 + 23.2261260899 + + + 705883.830893 + 19.205325517 + + + 769114.604489 + 22.7144136917 + + + 787234.096884 + 18.7322351616 + + + 864082.576482 + 22.1452282824 + + + 871741.018123 + 18.3337322022 + + + 961305.442026 + 19.9350439147 + + + 1065542.53262 + 20.7697980243 + + + 1065542.53262 + 17.7346304713 + + + 1181082.34821 + 19.5535209292 + + + 1320429.9007 + 18.8825251003 + + + 1451105.39509 + 18.2716834656 + + + 1608452.89143 + 18.2716834656 + + + 1782862.02553 + 17.4602102876 + + + 1962666.44592 + 17.2133628816 + + + 2190465.98052 + 17.1434782164 + + + 2448903.56843 + 16.4684203424 + + + 2691257.73229 + 16.1833897503 + + + 2971468.57786 + 16.2033525998 + + + 3335030.81428 + 15.7432583049 + + + 3652524.55746 + 15.6439453363 + + + 3976293.10823 + 13.7763534178 + + + 4087465.6845 + 16.2462130943 + + + 4518481.91559 + 15.5045570705 + + + 4991276.4477 + 15.1122323389 + + + 5532494.78735 + 14.7428240747 + + + 6127618.16432 + 14.9925450119 + + + 6785699.68075 + 14.4039155145 + + + 7534408.79972 + 16.194366272 + + + 7534408.79972 + 13.2346304135 + + + 8351386.23297 + 14.6233580673 + + + 9200399.48763 + 14.7606849856 + + + 9629562.5246 + 12.7645958007 + + + 9914577.62975 + 17.1434782164 + + + 10173059.0369 + 12.7645958007 + + + + + + + + + measured at 1000 Hz and room temperature + 0.040229885 + + + + measured at 1000 Hz and room temperature + 3.93e-08 + S/m + + + + dependence of effective conductivities on the frequency for PVDF/xGnP nanocomposites at room temperature. + + Frequency + Hz + Conductivity + S/m + + + + frequency (Hz) + Conductivity (S/m) + + + + 50.5167164867 + 5.3187318445e-09 + + + 56.3360319205 + 4.97664502021e-09 + + + 62.8090779026 + 5.89003239432e-09 + + + 62.8213314277 + 4.95360235356e-09 + + + 70.0435597069 + 5.57176611684e-09 + + + 78.0963415248 + 6.24907163218e-09 + + + 78.1125393039 + 5.19843161236e-09 + + + 87.8760737692 + 6.53478416542e-09 + + + 84.7581014525 + 5.51016437285e-09 + + + 97.0947521873 + 7.24204236272e-09 + + + 109.044194649 + 8.29454841555e-09 + + + 104.409712971 + 7.25088549603e-09 + + + 120.721926393 + 7.96934453536e-09 + + + 134.609614129 + 8.45059997199e-09 + + + 150.088308277 + 9.31837981187e-09 + + + 167.352963506 + 9.94954493728e-09 + + + 186.619838078 + 9.83252172979e-09 + + + 208.92650523 + 1.14672355677e-08 + + + 198.863048334 + 9.95871193363e-09 + + + 231.987064838 + 1.28579927574e-08 + + + 260.07439259 + 1.42623837945e-08 + + + 251.74933335 + 1.24545073583e-08 + + + 288.419965119 + 1.50086460168e-08 + + + 323.920675677 + 1.69610345341e-08 + + + 310.166644577 + 1.42893357505e-08 + + + 358.570441291 + 1.79680951331e-08 + + + 399.814460274 + 1.92847160967e-08 + + + 445.812188542 + 2.03027754208e-08 + + + 497.069365313 + 2.26510321765e-08 + + + 554.239282741 + 2.44956256656e-08 + + + 617.991013775 + 2.62452238226e-08 + + + 689.059528913 + 2.8716436267e-08 + + + 768.303112027 + 3.13391060187e-08 + + + 856.657131068 + 3.42998149166e-08 + + + 955.1841465 + 3.71108158079e-08 + + + 1064.98441672 + 4.216422581e-08 + + + 1187.46492717 + 4.58565372725e-08 + + + 1336.01606038 + 5.30114122115e-08 + + + 1476.19613103 + 5.78822549001e-08 + + + 1645.91440634 + 6.48251470224e-08 + + + 1835.17789917 + 7.14613906506e-08 + + + 2046.1782555 + 7.96885389575e-08 + + + 2281.43477079 + 8.8990740653e-08 + + + 2543.74782136 + 9.90933855194e-08 + + + 2836.15105285 + 1.12781473004e-07 + + + 3162.1987587 + 1.27184357456e-07 + + + 3525.72820099 + 1.4346783651e-07 + + + 3959.57048238 + 1.66871233062e-07 + + + 4382.84871363 + 1.86966533834e-07 + + + 4906.85878318 + 2.13051850698e-07 + + + 5448.45563262 + 2.39072192859e-07 + + + 6049.82685576 + 2.68452877655e-07 + + + 6699.38781856 + 3.20659195099e-07 + + + 7446.27948416 + 3.56757320306e-07 + + + 8327.8747603 + 4.25277698346e-07 + + + 9218.40387529 + 4.63861474739e-07 + + + 10278.0106697 + 5.30066255296e-07 + + + 11563.22893 + 6.3941840336e-07 + + + 12723.7885578 + 7.02022838388e-07 + + + 14115.1916477 + 8.56703212565e-07 + + + 15660.792173 + 9.31239053922e-07 + + + 17460.639175 + 1.0793104795e-06 + + + 19387.4060726 + 1.23686928863e-06 + + + 21772.3094248 + 1.48177845536e-06 + + + 24273.9301946 + 1.75575510616e-06 + + + 26979.8251505 + 1.97420450439e-06 + + + 30173.7615862 + 2.37526310907e-06 + + + 33399.3096784 + 2.66329267369e-06 + + + 37391.0992112 + 3.13791650505e-06 + + + 41688.0738432 + 3.65784097375e-06 + + + 46098.1628639 + 4.15266763884e-06 + + + 51140.2324828 + 4.97788432425e-06 + + + 56737.0432949 + 5.6707668137e-06 + + + 63455.1574179 + 6.68608922734e-06 + + + 69948.84536 + 7.52818437063e-06 + + + 77458.857372 + 9.02234424094e-06 + + + 86092.5307265 + 1.02416436591e-05 + + + 95986.0792405 + 1.19585866352e-05 + + + 106576.945983 + 1.38323529489e-05 + + + 118823.744617 + 1.62444300708e-05 + + + 133681.172253 + 1.97181362221e-05 + + + 147703.395581 + 2.20711991991e-05 + + + 165361.293783 + 2.534131356e-05 + + + 183151.820754 + 2.94451022608e-05 + + + 200108.590115 + 3.47817728744e-05 + + + 221695.225654 + 3.9947332889e-05 + + + 247173.386524 + 4.6398037923e-05 + + + 273590.468097 + 5.29664962499e-05 + + + 307252.102484 + 6.22837562846e-05 + + + 340091.192173 + 7.09173053773e-05 + + + 379177.962099 + 8.19767178926e-05 + + + 422764.108315 + 9.33541104511e-05 + + + 473262.089094 + 0.000116262882068 + + + 525518.863685 + 0.000126075808339 + + + 585920.681771 + 0.00014490115202 + + + 655974.576147 + 0.000164746688648 + + + 723155.825365 + 0.000174016672449 + + + 872543.127478 + 0.000215863565332 + + + 978058.988407 + 0.000249343690735 + + + 1091473.21988 + 0.00028470939215 + + + 1205357.50636 + 0.0003202242385 + + + 1334781.81675 + 0.000380758340795 + + + 1483551.03129 + 0.000434144878018 + + + 1647396.70171 + 0.000462104499324 + + + 1836796.71694 + 0.000517831050679 + + + 2056256.02514 + 0.000628655468807 + + + 2304056.71548 + 0.000701264829763 + + + 2222280.43123 + 0.000597235507231 + + + 2545950.42156 + 0.000728461915318 + + + 2838674.90928 + 0.000811627061072 + + + 3187871.29025 + 0.000971682830986 + + + 3560963.1451 + 0.00105565323688 + + + 3963279.75644 + 0.00115196178432 + + + 4387309.05875 + 0.00120134465439 + + + 4912009.11057 + 0.00133073316054 + + + 5454198.36977 + 0.00148745129523 + + + 6081523.75965 + 0.00160473146126 + + + 6781000.02001 + 0.00173175675903 + + + 7560819.8688 + 0.0018926377944 + + + 8430540.83366 + 0.00202083250152 + + + + + + + + diff --git a/whyis/materialsmine/tests/xml/L141_S19_Gao_2013.xml b/whyis/materialsmine/tests/xml/L141_S19_Gao_2013.xml new file mode 100644 index 00000000..3f2c5796 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L141_S19_Gao_2013.xml @@ -0,0 +1,253 @@ + + + L141_S19_Gao_2013 + L141_S1_Gao_2013 + PNC_schema_010720 + 5e496fa88aba2cf1302d73e3 + 5e4c12fec941bb7a1270ddbb + + + + research article + Polymer + Effect of graft density and molecular weight on mechanical properties of rubbery block copolymer grafted SiO2 nanoparticle toughened epoxy + Gao, Jianing + Li, Junting + Zhao, Su + Benicewicz, Brian C. + Hillborg, Henrik + Schadler, Linda S. + Rubbery copolymer + Grafted particle + Toughening epoxy + Elsevier + 2013 + 10.1016/j.polymer.2013.05.033 + 54 + https://www.sciencedirect.com/science/article/pii/S0032386113004643?via%3Dihub + English + Department of Materials Science & Engineering, Rensselaer Polytechnic Institute, Troy, NY 12180, USA + 2016-07-12 + + + + 0032-3861 + 15 + + + + + + + + BISPHENOL A DIGLYCIDYL ETHER + DGEBA Epoxy Resin + CC(C)(C1=CC=C(OCC2CO2)C=C1)C3=CC=C(OCC4CO4)C=C3 + 2286 + DGEBA + C2H3OCH2OC6H3C3H6C6H5OCH2C2H3O + thermoset + homopolymer + Huntsman Corporation + Araldite F + + molecular weight between crosslinks + 312 + g/mol + + + inserted from ChemProps, NanoMine + 1.13 + g/cm3 + + + Aradur HY 90F + + + benzyldimethylamine + + + + + + Curing Agent + Aradur HY 90F + + + + + + + Catalyst + benzyldimethylamine + + + + + + + Silicon dioxide + Silicon dioxide + 24261 + SiO2 + Nissan + + inserted from ChemProps, NanoMine + 2.65 + g/cm3 + + Amorphous + + nanoparticle diameter + 15 + nm + + + polyglycidylmethacrylate + PGMA + C7H10O13 + + 0.7 + chains/nm2 + + + short brush + 20000 + g/mol + + + + Reversible addition-fragmentation chain-transfer polymerization + + + + + Polyhexylmethacrylate + PHMA + C10H18O2 + + Long brush + 40000 + g/mol + + + + + Nanoparticle volume fraction + + + 0.009330328850080982 + computed by NanoMine + + + 0.004 + reported + + + + Silica nanoparticle with grafted PHMA/PGMA + + + + Mixing and Epoxy Curing + + + + CHCl2 + + + + + Mixing of nanoparticles and epoxy + + + + + First curing step + + 80 + Celsius + + + + + + + + + Second curing step + + 135 + Celsius + + + + + + + + + JOEL High Resolution TEM + + + + + + + Modulus + 3.2 + GPa + + absolute + 0.1 + + + + Yield Stress + 76 + MPa + + absolute + 0.5 + + + + strain at break + 0.079 + + absolute + 0.02 + + + + + Tensile test strain rate + 0.1 + mm/min + + + + + + + + http://localhost/nmr/blob?id=5ac63561e74a1d06fd9ada29 + TEM micrograph showing particle disperison + TEM + grayscale + + + + TEM sample thickness + 100 + nm + + + + diff --git a/whyis/materialsmine/tests/xml/L150_S7_Akcora_2009.xml b/whyis/materialsmine/tests/xml/L150_S7_Akcora_2009.xml new file mode 100644 index 00000000..d0eb0d8f --- /dev/null +++ b/whyis/materialsmine/tests/xml/L150_S7_Akcora_2009.xml @@ -0,0 +1,538 @@ + + + L150_S7_Akcora_2009 + + + + research article + Nature Materials + Anisotropic self-assembly of spherical polymer-grafted nanoparticles + Akcora, Pinar + Liu, Hongjun + Kumar, Sanat K. + Moll, Joseph + Li, Yu + Benicewicz, Brian C. + Schadler, Linda S. + Acehan, Devrim + Panagiotopoulos, Athanassios Z. + Pryamitsyn, Victor + Ganesan, Venkat + Ilavsky, Jan + Thiyagarajan, Pappanan + Colby, Ralph H. + Douglas, Jack F. + Nature Publishing Group + 2009 + 10.1038/nmat2404 + 8 + http://www.nature.com/articles/nmat2404 + English + Department of Chemical Engineering, Columbia University, New York, New York 10027, USA + 2016-06-30 + + + + 1476-4660 + 4 + + + + + + + + polystyrene + PS + homopolymer + + 42 + kg/mol + + + + + + silica + SiO2 + Nissan Chemicals + + 14 + nm + + absolute + 4 + + + + + + 0.05 + + + + + + + + + ultra-sonication + + SiO2 + + + benzene or tetrahydrofuran + + + + + + + ultra-sonication + + polystyrene + + + SiO2 + + + benzene or tetrahydrofuran + + + + + + + annealing + + 150 + Celsius + + + + + + casting + + + + + + + used + + + ultrasmall-angle X-ray scattering (USAXS) + + + + + + + shear-stress response at 180 C with 37 chains grafted + + + Strain + Shear stress (Pa) + + + + 1.552618473 + 115.3782823 + + + 2.397249904 + 118.6468288 + + + 3.244094955 + 89.98576175 + + + 4.094070214 + 111.1087434 + + + 4.97019461 + 96.68628205 + + + 5.917928187 + 86.91468994 + + + 6.991933083 + 90.7802812 + + + 8.14582768 + 88.58562957 + + + 8.961824622 + 79.93498128 + + + 9.989841114 + 113.1311566 + + + 10.90780728 + 87.47647137 + + + 10.87964058 + 58.07657662 + + + 12.77601067 + 118.1871894 + + + 12.12765094 + 87.28921089 + + + 14.95313466 + 119.8214627 + + + 17.09570692 + 79.42427089 + + + 17.65709257 + 116.4697434 + + + 20.07907805 + 81.5688492 + + + 21.31724466 + 115.4157344 + + + 23.08770716 + 84.17132396 + + + 25.04218402 + 122.1945636 + + + 29.43214238 + 129.029571 + + + 30.39606706 + 71.29667984 + + + 33.83255545 + 109.2873889 + + + 35.47776926 + 141.220228 + + + 37.9296784 + 167.8997387 + + + 40.08494767 + 115.2378369 + + + 40.94918974 + 69.7897194 + + + 42.28061546 + 145.5416236 + + + 42.1351059 + 94.5299493 + + + 49.3759866 + 150.0044467 + + + 49.3759866 + 123.8084085 + + + 49.3759866 + 98.93340777 + + + 49.3759866 + 79.01570258 + + + 59.65247142 + 145.7847021 + + + 58.56359399 + 116.3520368 + + + 57.49459259 + 86.30609339 + + + 58.56359399 + 74.93001947 + + + 66.07392394 + 169.4341397 + + + 67.33870474 + 214.2518137 + + + 69.46077997 + 128.4865156 + + + 73.14721874 + 101.3961668 + + + 78.56301717 + 177.8764662 + + + 78.09888307 + 146.2138407 + + + 86.62995534 + 110.4426312 + + + 86.31056033 + 94.59236946 + + + 91.83616305 + 188.6141521 + + + 91.83616305 + 163.8957693 + + + 91.69380303 + 139.64724 + + + 102.3707466 + 103.8157991 + + + 109.6875957 + 180.2078591 + + + 108.9245226 + 145.7144794 + + + 110.3418359 + 123.9922642 + + + 116.2155979 + 86.36392383 + + + 127.2038192 + 187.8926724 + + + 129.1925884 + 162.4657802 + + + 129.1925884 + 137.7473974 + + + 129.1925884 + 113.0290145 + + + 138.3549381 + 87.5701016 + + + 153.2320226 + 161.0153627 + + + 153.2320226 + 136.3174083 + + + 153.2320226 + 111.5990254 + + + 164.85867 + 84.0790313 + + + 173.8528222 + 63.18269935 + + + 182.7340904 + 140.6584466 + + + 182.8758881 + 106.614492 + + + 192.9517716 + 167.7577126 + + + 199.6803474 + 85.49151032 + + + 208.9770076 + 194.9923574 + + + 217.8902468 + 118.5761151 + + + 228.6523704 + 165.6389941 + + + 224.6673346 + 140.7208667 + + + 233.9837148 + 89.00130667 + + + 261.5573504 + 123.8424558 + + + 270.4910591 + 170.6694018 + + + 275.2252144 + 137.287758 + + + 278.8276163 + 92.11392198 + + + 300.9044069 + 179.9831466 + + + 305.6088994 + 149.459689 + + + 303.2475302 + 127.2880486 + + + 308.9457397 + 94.70472574 + + + 307.9886563 + 80.54783375 + + + + + + steady-shear application at 180 C with 37 chains grafted + + + Strain + Shear stress (Pa) + + + + 922.6457063 + 39.65014577 + + + 724.6692949 + 37.31778426 + + + 560.0821712 + 41.98250729 + + + 380.5568822 + 37.31778426 + + + 275.7778875 + 37.31778426 + + + 203.0917621 + 39.65014577 + + + 140.2339435 + 39.65014577 + + + 95.28421909 + 39.65014577 + + + 59.73429965 + 39.65014577 + + + 29.88990093 + 39.65014577 + + + + + + + + + 0.5 um + + https://nanomine.org/nmr/blob?id=595d18bde74a1d5e0d187d64 + TEM + grayscale + + + diff --git a/whyis/materialsmine/tests/xml/L155_S2_Roy_2005.xml b/whyis/materialsmine/tests/xml/L155_S2_Roy_2005.xml new file mode 100644 index 00000000..77fecc1d --- /dev/null +++ b/whyis/materialsmine/tests/xml/L155_S2_Roy_2005.xml @@ -0,0 +1,2418 @@ + + + L155_S2_Roy_2005 + L155_S1_Roy_2005 + + + + research article + IEEE Transactions on Dielectrics and Electrical Insulation + Polymer nanocomposite dielectrics-the role of the interface + Roy, M. + Nelson, J.K. + MacCrone, R.K. + Schadler, L.S. + Reed, C.W. + Keefe, R. + Polymers + Dielectrics + Silicon compounds + Polyethylene + Breakdown voltage + Bonding + Infrared spectra + Spectroscopy + Paramagnetic resonance + Nanoparticles + X-ray photoelectron spectra + nanocomposites + filled polymers + nanoparticles + polyethylene insulation + electric breakdown + bonding processes + permittivity + paramagnetic resonance + Fourier transform spectroscopy + electrical insulation + polymer nanocomposite dielectrics + silica nanoparticles + polyethylene + breakdown strength + voltage endurance + micron scale fillers + dielectric spectroscopy + dielectric permittivity + space charge distribution + nanoscale fillers + interfacial region + Fourier transformed infrared spectroscopy + electron paramagnetic resonance + x-ray photoelectron spectroscopy + particle-polymer bonding + IEEE + 2005 + 10.1109/TDEI.2005.1511089 + 12 + http://ieeexplore.ieee.org:80/document/1511089/?reload=true + English + Rensselaer Polytech. Inst., Troy, NY, USA + + + + 1070-9878 + 4 + + + + + + + + Polyethylene + XLPE + thermoset + + non-ionic antioxidants + + + + + + nanosilica + SiO2 + + + + + + 195 + Celsius + + + vacuum + + + + + + 0.05 + + + + + + + + + melt mixed at unspecified temperature above the matrix polymer melting point (> 105 Celsius). + + + + + + + hot-pressing + + hot pressed at unspecified temperature and then isobarically cooled + + + + + + + + post-press curing of the matrix under vacuum (hardening/curing agent/additive was already in the matrix) + dicumyl peroxide + + + + + + + SEM micrograph of XLPE with 5% untreated nanosilica + + + Novocontrol Alpha Analyzer (type K) in combination with a Novocontrol active BDS-1200 sample cell + Measurements were performed on circularly laminar samples of 0.5 mm thickness with sputtered gold electrodes (15 nm thick) on both sides, at multiple temperatures + + + Rheometric Scientific DMTA (Model - V) + 2 cycles with the following ramps were performed and the second cycle was used for calculations/measurements with ~ 5 mg og materials and for four specimens. + + 10 + Celsius/minute + + + 10 + Celsius/minute + + Dwell time of 5 minutes at 150 Celsius is used after the sample is heated to 150 Celsius + + + Nicolet NEXUS 470-ESP + FTIR spectrum of only untreated nanosilica particles powder + + only filler FTIR spectrum + + + Wavenumber + 1/cm + Absorbance + a.u. + + + + Wavenumber (cm-1) + Absorbance (a.u.) + + + + 3991.24248983 + 0.847711836541 + + + 4002.35536316 + 0.705205339876 + + + 4003.09622138 + 0.606714555061 + + + 4002.35536316 + 0.484100719355 + + + 4002.35536316 + 0.400952283545 + + + 4002.35536316 + 0.301110018458 + + + 4002.35536316 + 0.209538710242 + + + 4002.35536316 + 0.121225146262 + + + 4003.09622138 + 0.0326426301893 + + + 3935.67812317 + 0.871587089002 + + + 3871.96431607 + 0.905874321112 + + + 3830.10582652 + 0.934168609387 + + + 3777.87532186 + 0.98700689618 + + + 3766.76244853 + 1.05400172683 + + + 3753.42700053 + 1.97087621485 + + + 3751.20442587 + 1.87706501248 + + + 3751.20442587 + 1.758900046 + + + 3735.39945046 + 1.54698211543 + + + 3742.3141272 + 1.45672660854 + + + 3753.42700053 + 1.37005027643 + + + 3753.42700053 + 1.24013717529 + + + 3753.42700053 + 1.17154731152 + + + 3736.75769054 + 1.65803161108 + + + 3700.08520854 + 1.77760965602 + + + 3680.08203655 + 1.89987142208 + + + 3666.74658855 + 1.95065856916 + + + 3630.07410655 + 2.0517746568 + + + 3602.29192323 + 2.11420792155 + + + 3568.95330323 + 2.2130545359 + + + 3537.8372579 + 2.3094232231 + + + 3508.94378724 + 2.37519272977 + + + 3455.60199525 + 2.41741212871 + + + 3393.92554826 + 2.38816376848 + + + 3349.87094326 + 2.37385508909 + + + 3297.79919394 + 2.30886700672 + + + 3238.23419288 + 2.21042776512 + + + 3206.67363262 + 2.13930890369 + + + 3164.44471396 + 2.04341168264 + + + 3131.10609397 + 1.94453178926 + + + 3111.10292197 + 1.87419841675 + + + 3091.84060819 + 1.77846251095 + + + 3075.54172731 + 1.6945467377 + + + 3059.98370464 + 1.60383808412 + + + 3042.20310731 + 1.52316937542 + + + 3010.64254705 + 1.44230260054 + + + 3001.75224839 + 1.33254537891 + + + 2991.82474821 + 1.20198316351 + + + 2987.75002799 + 1.05949992521 + + + 2986.63874066 + 0.926690309216 + + + 2991.08388999 + 0.821714955018 + + + 2986.63874066 + 0.0165896620742 + + + 2984.41616599 + 0.723044175494 + + + 2984.41616599 + 0.578775056357 + + + 2984.41616599 + 0.498664931233 + + + 2985.15702421 + 0.379170417167 + + + 2984.41616599 + 0.293072574722 + + + 2984.41616599 + 0.179642309061 + + + 2984.41616599 + 0.10343134932 + + + 2975.52586732 + 4.43661160001 + + + 2982.19359132 + 4.36119843015 + + + 2977.74844199 + 4.17787185913 + + + 2976.26672555 + 4.02515230839 + + + 2975.08135239 + 3.83647817456 + + + 2977.00758377 + 3.68356290958 + + + 2977.00758377 + 3.49321274502 + + + 2976.26672555 + 3.33354277193 + + + 2975.08135239 + 3.24330877907 + + + 2977.74844199 + 3.11897275932 + + + 2974.41457999 + 3.03665200585 + + + 2979.97101666 + 2.92624313137 + + + 2974.7850091 + 2.83814960092 + + + 2975.52586732 + 2.69636288881 + + + 2971.08071799 + 2.54944822078 + + + 2973.30329266 + 2.44202760513 + + + 2967.08008359 + 2.31345208067 + + + 2963.67213577 + 2.23258060192 + + + 2963.67213577 + 2.11438468969 + + + 2963.67213577 + 2.03880389809 + + + 2963.67213577 + 1.92234094824 + + + 2961.23788733 + 1.84298109439 + + + 2960.52348833 + 1.72630466416 + + + 2961.87290866 + 1.63985410541 + + + 2961.07913199 + 1.52653235656 + + + 2958.69780199 + 1.43577610439 + + + 2975.52586732 + 4.27818339042 + + + 2973.30329266 + 3.92636897218 + + + 2971.08071799 + 3.6073429901 + + + 2971.08071799 + 3.4194741126 + + + 2935.34855605 + 1.36489233574 + + + 2922.69697718 + 1.29214721874 + + + 2912.34124467 + 1.18845505451 + + + 2889.7344852 + 4.47297652038 + + + 2871.62050167 + 1.45808787852 + + + 2885.88202245 + 4.38586570504 + + + 2885.88202245 + 4.28740193277 + + + 2885.88202245 + 4.18192753991 + + + 2885.88202245 + 4.09283751875 + + + 2895.51317934 + 3.98296650847 + + + 2895.51317934 + 3.90852789662 + + + 2895.51317934 + 3.78233672608 + + + 2895.51317934 + 3.71002493172 + + + 2889.7344852 + 3.55383689894 + + + 2881.066444 + 3.41570472341 + + + 2885.88202245 + 3.30260666798 + + + 2888.84545534 + 3.18469093417 + + + 2881.066444 + 2.94718455579 + + + 2887.36373889 + 2.77007744194 + + + 2876.99172378 + 2.63343343199 + + + 2882.17773134 + 2.50693501714 + + + 2882.17773134 + 2.40555671721 + + + 2882.17773134 + 2.30807758265 + + + 2885.88202245 + 2.18697274259 + + + 2882.17773134 + 2.11170143523 + + + 2889.7344852 + 1.99556499312 + + + 2887.734168 + 1.8160822051 + + + 2882.17773134 + 1.72178489702 + + + 2880.84418654 + 1.61189731122 + + + 2881.43687312 + 1.51678220317 + + + 2869.58314156 + 3.1040790638 + + + 2842.41834009 + 1.89621947609 + + + 2845.50524934 + 1.30197206762 + + + 2842.17138734 + 4.46551589702 + + + 2839.94881268 + 1.4158475702 + + + 2839.94881268 + 4.36778921241 + + + 2840.93662364 + 4.23037128921 + + + 2838.67877001 + 3.80625346303 + + + 2837.72623801 + 3.68760599073 + + + 2841.43052912 + 3.59303854392 + + + 2841.06010001 + 3.48367286545 + + + 2839.94881268 + 3.3846458884 + + + 2839.94881268 + 3.28954001208 + + + 2839.20795446 + 3.18807619466 + + + 2838.04374868 + 3.01985571101 + + + 2839.05978281 + 2.90491554231 + + + 2840.6896709 + 2.80361116287 + + + 2839.94881268 + 2.70324732644 + + + 2839.20795446 + 2.5959544537 + + + 2839.94881268 + 2.49812759604 + + + 2839.94881268 + 2.40401423455 + + + 2839.94881268 + 2.30751748712 + + + 2839.94881268 + 2.20403600101 + + + 2839.94881268 + 2.10951077962 + + + 2839.94881268 + 2.01883408511 + + + 2838.04374868 + 1.7325282955 + + + 2841.21885534 + 1.61474309499 + + + 2838.17075294 + 4.05590055653 + + + 2837.72623801 + 3.95220065284 + + + 2842.17138734 + 3.09582574641 + + + 2842.17138734 + 1.8194398664 + + + 2835.50366335 + 1.51340438247 + + + 2835.50366335 + 1.21065360197 + + + 2835.50366335 + 1.12348784425 + + + 2835.50366335 + 1.0313257534 + + + 2836.61495068 + 0.934565677715 + + + 2835.50366335 + 0.817673433821 + + + 2820.39015561 + 0.707790335889 + + + 2823.94627508 + 0.620629954011 + + + 2825.72433481 + 0.529760145174 + + + 2825.13164824 + 0.436195034233 + + + 2833.72560361 + 0.34412470602 + + + 2831.05851401 + 0.222048102522 + + + 2831.05851401 + 0.107807620677 + + + 2831.05851401 + 0.0290140968518 + + + 2833.28108868 + 4.13792755331 + + + 2835.50366335 + 3.87653491707 + + + 2768.33251787 + 0.769310575471 + + + 2722.15235536 + 0.70651934125 + + + 2677.2563471 + 0.774686865432 + + + 2637.37700738 + 0.762473336455 + + + 2578.79628939 + 0.725798454531 + + + 2541.23477752 + 0.770227604514 + + + 2497.67231407 + 0.846097011629 + + + 2432.970696 + 0.783770097093 + + + 2397.65645408 + 0.771605668005 + + + 2358.39096831 + 0.845886457818 + + + 2288.75029543 + 0.861427969452 + + + 2225.24816211 + 0.813501596454 + + + 2183.97177545 + 0.800273185309 + + + 2128.72491946 + 0.867201297924 + + + 2097.60887413 + 0.922687826871 + + + 2070.93797813 + 1.01977217303 + + + 2050.93480614 + 1.09276266744 + + + 2026.48648481 + 1.20615597418 + + + 1998.92655894 + 1.2635383834 + + + 1948.69637148 + 1.32005942594 + + + 1922.02547549 + 1.4426065036 + + + 1908.69002749 + 1.51436643419 + + + 1875.3514075 + 1.61840119421 + + + 1843.3463323 + 1.47414169661 + + + 1824.23219017 + 1.37245092586 + + + 1810.89674217 + 1.26697606635 + + + 1769.30284485 + 1.2123501921 + + + 1735.32920352 + 1.27217887341 + + + 1701.99058352 + 1.36517673969 + + + 1682.72826975 + 1.47267005987 + + + 1666.42938886 + 1.55889968511 + + + 1631.85600516 + 1.63919385815 + + + 1635.31334353 + 1.74081369766 + + + 1605.67901465 + 1.44655914741 + + + 1596.19602941 + 1.29993619347 + + + 1573.08125288 + 1.2066521196 + + + 1538.40908808 + 1.1153828665 + + + 1484.98647519 + 1.04037552375 + + + 1474.3001566 + 0.916873011133 + + + 1477.82805289 + 0.802870960375 + + + 1477.19303156 + 0.687496180445 + + + 1471.47783956 + 0.579733611036 + + + 1469.47507997 + 0.472252661481 + + + 1473.50990783 + 4.156512223 + + + 1475.28796756 + 4.04216808821 + + + 1472.50974923 + 3.87152054447 + + + 1470.84281823 + 3.7846729774 + + + 1473.50990783 + 3.70325703466 + + + 1474.65294623 + 3.58890542923 + + + 1473.50990783 + 3.47653829117 + + + 1473.50990783 + 3.39641466245 + + + 1473.50990783 + 3.2958600823 + + + 1473.50990783 + 3.20608812919 + + + 1474.65294623 + 3.08900686685 + + + 1473.50990783 + 2.98307612474 + + + 1477.51054222 + 2.86500329155 + + + 1470.84281823 + 2.72650250951 + + + 1473.06539289 + 2.61047616016 + + + 1474.65294623 + 2.4909178194 + + + 1473.50990783 + 2.3799917087 + + + 1473.50990783 + 2.28345445046 + + + 1474.17668023 + 2.21219188126 + + + 1475.28796756 + 2.08385963143 + + + 1470.84281823 + 1.94771314908 + + + 1474.65294623 + 1.8175702985 + + + 1473.06539289 + 1.70245450524 + + + 1473.50990783 + 1.61012429134 + + + 1473.50990783 + 1.50990054946 + + + 1473.50990783 + 1.42239720167 + + + 1474.65294623 + 1.30794914192 + + + 1473.50990783 + 1.19656969598 + + + 1470.84281823 + 1.12059776921 + + + 1464.17509423 + 0.371865648561 + + + 1465.90376341 + 0.264979507199 + + + 1464.91595245 + 0.18192522862 + + + 1470.84281823 + 0.0669162263363 + + + 1477.51054222 + 2.80930092895 + + + 1479.73311689 + 0.00367756163181 + + + 1475.28796756 + 3.99499831478 + + + 1439.7267729 + 0.563679020112 + + + 1407.86986935 + 0.944606889215 + + + 1413.0558769 + 0.811767407431 + + + 1413.0558769 + 0.714288272878 + + + 1413.0558769 + 0.613264442524 + + + 1415.27845157 + 1.03685895075 + + + 1381.93983157 + 0.518101399889 + + + 1382.57485291 + 0.356835580377 + + + 1381.19897335 + 0.189152509504 + + + 1384.16240624 + 0.0886057851247 + + + 1388.60755557 + 0.0248079804927 + + + 1373.04953291 + 0.85215584686 + + + 1378.97639868 + 0.753819190848 + + + 1381.93983157 + 0.670995945478 + + + 1373.04953291 + 0.620293355906 + + + 1361.93665958 + 0.966238866666 + + + 1356.75065202 + 1.14630157363 + + + 1357.49151024 + 1.05449507233 + + + 1348.60121158 + 1.26007398924 + + + 1346.37863691 + 1.34762461564 + + + 1334.15447625 + 1.53193031789 + + + 1326.37546492 + 1.73325727978 + + + 1326.37546492 + 1.65881866794 + + + 1317.48516625 + 1.84312941003 + + + 1307.85400936 + 2.08060946919 + + + 1308.59486758 + 1.9636356277 + + + 1301.92714359 + 2.1621285129 + + + 1295.25941959 + 2.28334702962 + + + 1288.59169559 + 2.44332088711 + + + 1281.92397159 + 2.6486077726 + + + 1286.36912092 + 2.52011926958 + + + 1273.03367292 + 2.85330051556 + + + 1277.47882226 + 2.72546187344 + + + 1268.58852359 + 2.91709832019 + + + 1257.47565026 + 3.02814865581 + + + 1255.25307559 + 3.11611283006 + + + 1241.9176276 + 3.24317001515 + + + 1205.61557471 + 3.36127166349 + + + 1163.63360879 + 3.33592270197 + + + 1170.79523827 + 3.20569549673 + + + 1175.24038761 + 3.15090712726 + + + 1150.79206628 + 3.4379905283 + + + 1141.90176761 + 3.54691740634 + + + 1112.26743873 + 3.67385148839 + + + 1081.89225162 + 3.54694906541 + + + 1068.55680362 + 3.46002056072 + + + 1057.44393029 + 3.38379280147 + + + 1037.44075829 + 3.32651572516 + + + 1026.32788496 + 3.22246210387 + + + 1015.21501163 + 3.15420991018 + + + 999.656988966 + 3.03708539577 + + + 986.321540969 + 2.95431290625 + + + 996.323126967 + 2.85450686009 + + + 972.986092971 + 2.79170092631 + + + 979.65381697 + 2.6880286538 + + + 955.20549564 + 2.91307987831 + + + 932.979748977 + 2.74467322871 + + + 921.866875645 + 2.65781138206 + + + 894.24344765 + 2.55082108709 + + + 890.009972095 + 2.49470721658 + + + 853.775269959 + 2.66417483136 + + + 841.854187658 + 2.87391686953 + + + 844.076762324 + 2.78175813858 + + + 818.517153661 + 2.99573050876 + + + 808.515567663 + 3.02953769498 + + + 781.844671667 + 2.96953293885 + + + 779.622097001 + 2.8826845318 + + + 770.731798336 + 2.80291543665 + + + 764.064074337 + 2.70956170083 + + + 750.728626339 + 2.62683197271 + + + 728.502879676 + 2.47191879846 + + + 729.243737898 + 2.36951365671 + + + 729.772922342 + 2.2319043018 + + + 731.169969275 + 2.1101410491 + + + 727.613849809 + 1.97622719356 + + + 732.948029008 + 1.91313967205 + + + 726.280305009 + 1.79615463088 + + + 686.273961016 + 2.54668348871 + + + 664.048214352 + 2.65624006824 + + + 627.153474891 + 2.73712151469 + + + 587.369388364 + 2.7046175595 + + + 548.474331704 + 2.6473217704 + + + 524.026010374 + 2.8015972354 + + + 519.580861042 + 2.91832916401 + + + 510.690562376 + 3.00102529311 + + + + + + + + Perkin Elmer (Model # 5500) + XPS spectrum of just untreated nanosilica particless after 3 minutes of Argon cleaning + + Only untreated silica nanoparticle spectrum + + + Binding Energy + eV + Intensity + C.P.S + + + + Binding Energy (eV) + Intensity (C.P.S) + + + + 988.553954707 + 38485.3407183 + + + 974.945477898 + 38468.0991523 + + + 959.958915053 + 38851.6925336 + + + 945.316044449 + 39013.5618929 + + + 930.22743583 + 39530.5320018 + + + 917.723372117 + 39832.4985239 + + + 903.101519772 + 40411.9226876 + + + 891.02252608 + 40879.9991704 + + + 876.11669559 + 41261.0370804 + + + 860.761049452 + 41991.2936113 + + + 847.476087976 + 42789.2194434 + + + 831.903102942 + 43767.8384891 + + + 818.301436788 + 44748.5849862 + + + 802.668989067 + 46332.0609357 + + + 788.413367863 + 48809.2073085 + + + 778.523606789 + 49115.2821615 + + + 769.001515968 + 51529.9571908 + + + 770.929299241 + 54470.7894409 + + + 759.645107787 + 47162.2532088 + + + 750.561418392 + 51696.5333718 + + + 748.041717492 + 55201.2637137 + + + 748.508341611 + 61456.4343501 + + + 751.876649635 + 58059.3004894 + + + 749.385265176 + 65713.3332536 + + + 749.398826247 + 67700.4821688 + + + 744.180241093 + 48453.6087488 + + + 742.885255141 + 45057.4517304 + + + 741.592927468 + 42050.8210619 + + + 740.304124902 + 39560.7362051 + + + 739.642895563 + 35849.8226229 + + + 737.072167281 + 31877.3406404 + + + 729.893282142 + 28220.1590773 + + + 714.786893209 + 27684.7409504 + + + 697.110226483 + 27901.9137482 + + + 683.378451801 + 28453.6690311 + + + 670.439780167 + 28744.9256461 + + + 654.033279458 + 29238.9811125 + + + 640.082836682 + 29844.3271819 + + + 626.2876534 + 30422.7313818 + + + 612.076764544 + 31171.8823198 + + + 597.300436822 + 31893.1475068 + + + 584.206914711 + 32788.953835 + + + 569.578614553 + 32423.5584861 + + + 558.158352136 + 36236.4989904 + + + 557.155275169 + 38342.2483054 + + + 551.386744288 + 31691.2198229 + + + 545.641776731 + 28493.0037133 + + + 540.530696773 + 24999.2250919 + + + 541.781099742 + 21862.4889189 + + + 541.125068492 + 18913.2687099 + + + 534.379283311 + 55424.3613078 + + + 536.894187753 + 51216.7899434 + + + 533.440930407 + 42166.0165371 + + + 536.803575143 + 37939.0221919 + + + 536.103754541 + 121754.42772 + + + 535.450049285 + 119146.043067 + + + 536.06815673 + 116538.161817 + + + 535.406361062 + 112744.262187 + + + 534.753464847 + 110254.429032 + + + 534.735665942 + 107646.29608 + + + 535.13937748 + 104682.676437 + + + 534.125648908 + 80379.2837896 + + + 535.80279123 + 77653.2705451 + + + 535.784992324 + 75045.137594 + + + 535.767193419 + 72437.0046428 + + + 535.749394513 + 69828.8716916 + + + 533.819022309 + 66508.6746487 + + + 534.434972311 + 63584.6560718 + + + 533.428255429 + 102429.526775 + + + 533.338451861 + 89270.3105209 + + + 533.320652955 + 86662.1775697 + + + 533.30285405 + 84054.0446185 + + + 531.870851199 + 60580.3446545 + + + 531.853052293 + 57972.2117033 + + + 530.417004237 + 33905.7542504 + + + 528.662193964 + 25250.8237079 + + + 525.669921528 + 21628.8887719 + + + 522.66881706 + 16712.7666519 + + + 520.737366134 + 13234.5009452 + + + 511.944976502 + 10757.2528748 + + + 497.891302322 + 9695.26749495 + + + 485.104550639 + 9987.90147754 + + + 469.456723782 + 9317.8212283 + + + 455.212509785 + 9325.11600103 + + + 442.35242465 + 9225.42433319 + + + 427.232336158 + 9270.93149094 + + + 412.959959357 + 9292.82445342 + + + 398.404949339 + 9313.4080586 + + + 381.701485577 + 9259.376095 + + + 370.000808724 + 9254.74478383 + + + 356.919630269 + 9296.98751953 + + + 342.530220703 + 9326.85731911 + + + 326.252069878 + 9474.53070286 + + + 312.347241293 + 9516.44742494 + + + 300.600310401 + 9833.57957333 + + + 285.046794627 + 9671.61312911 + + + 272.071554333 + 9263.4033221 + + + 253.540582171 + 9425.42729814 + + + 237.876081361 + 9566.00469176 + + + 222.756810081 + 9731.26083717 + + + 208.99546944 + 10092.0052981 + + + 194.499959905 + 10548.6173408 + + + 181.150780787 + 11254.6405919 + + + 164.60826228 + 9936.12643913 + + + 154.252688268 + 14459.3652878 + + + 155.783214353 + 21309.5946858 + + + 155.126677453 + 18286.2797907 + + + 155.172388278 + 24984.4394153 + + + 146.676727976 + 10079.1936819 + + + 136.104420827 + 7692.13032837 + + + 122.622720767 + 7615.66335379 + + + 111.796571176 + 5304.71099675 + + + 104.827914419 + 9157.6886107 + + + 104.25646168 + 18602.0395656 + + + 103.372449374 + 13306.4037291 + + + 104.309453876 + 26367.1626702 + + + 104.287744605 + 23186.0308131 + + + 97.8100987797 + 5807.25140711 + + + 87.3351560957 + 3192.47033501 + + + 72.3519481053 + 2588.59475007 + + + 57.9397542822 + 2829.57242625 + + + 45.0086516778 + 2676.92373902 + + + 31.8163658668 + 3077.73980877 + + + 26.5882407695 + 5728.25303265 + + + 17.0261496053 + 2281.54442585 + + + 6.21173014768 + 1689.44765389 + + + + + + + + Novocontrol Alpha Analyzer (type K) in combination with a Novocontrol active BDS-1200 sample cell + + + + + + + + Measured at 25 Celsius + + Frequency + Hz + Real Part of Dielectric Permittivity + + + + Frequency (Hz) + Real Part of Dielectric Permittivity + + + + 0.002078949 + 3.21 + + + 0.005239995 + 2.88 + + + 0.013207416 + 2.595 + + + 0.033289313 + 2.385 + + + 0.082305244 + 2.2425 + + + 0.203493333 + 2.175 + + + 0.512905286 + 2.1 + + + 1.292778627 + 2.055 + + + 3.258450684 + 2.025 + + + 7.902591204 + 2.01 + + + 20.30583336 + 1.995 + + + 50.20459806 + 1.965 + + + 126.540773 + 1.95 + + + 318.9462293 + 1.95 + + + 773.5276395 + 1.95 + + + 1949.677704 + 1.935 + + + 4914.165902 + 1.9275 + + + 12386.16334 + 1.935 + + + 30623.82819 + 1.9275 + + + 78688.41195 + 1.92 + + + 190839.8845 + 1.92 + + + 481012.2468 + 1.905 + + + + + + + + Measured at 25 Celsius + + Frequency + Hz + Loss tangent + + + + Frequency (Hz) + tan delta + + + + 0.002132876 + 0.189265537 + + + 0.005323618 + 0.152777778 + + + 0.013287653 + 0.12405838 + + + 0.033643142 + 0.093691149 + + + 0.08278107 + 0.066148776 + + + 0.209594224 + 0.045433145 + + + 0.523143327 + 0.032015066 + + + 1.305756117 + 0.02306968 + + + 3.25914324 + 0.016949153 + + + 8.134761557 + 0.013182674 + + + 20.30421516 + 0.010122411 + + + 50.67894742 + 0.007768362 + + + 126.4937202 + 0.006355932 + + + 315.7259981 + 0.005178908 + + + 788.0462816 + 0.004237288 + + + 1966.949018 + 0.003766478 + + + 4909.468555 + 0.003295669 + + + 12430.33287 + 0.003060264 + + + 30585.61668 + 0.002589454 + + + 77440.03084 + 0.002589454 + + + 190546.0718 + 0.002354049 + + + 489390.0918 + 0.002354049 + + + + + + + + 25 Celsius + + + + Breakdown Strength + kV/mm + Probability of Failure + % + + + + Breakdown Strength (kV/mm) + Probability of Failure (%) + + + + 134.3096058 + 12.5086297 + + + 135.4974638 + 18.69779897 + + + 136.6958274 + 24.93299398 + + + 137.9047896 + 31.18775889 + + + 145.3864394 + 37.44027712 + + + 150.5983687 + 43.73113085 + + + 168.8625957 + 49.92556641 + + + 208.5987317 + 56.22166161 + + + 271.6654549 + 62.45004225 + + + 281.4043353 + 68.73755053 + + + 460.765468 + 74.97001936 + + + 554.3522963 + 81.0239571 + + + 559.2550864 + 87.5667591 + + + 940.2240538 + 93.3498204 + + + + + + + 25 Celsius + + + Breakdown Strength + kV/mm + Weibull Parameter + + + + Breakdown Strength (kV/mm) + Weibull Parameter + + + + 134.527754422 + -0.856815879695 + + + 134.381128734 + -0.640376906827 + + + 136.248706873 + -0.486164138659 + + + 136.496879483 + -0.365093588212 + + + 148.839039321 + -0.184502320226 + + + 167.598110021 + -0.113483282254 + + + 206.482712325 + -0.0505807057642 + + + 269.668610582 + 0.00961638356449 + + + 280.292146886 + 0.0569624088792 + + + 547.84911383 + 0.148948972348 + + + 558.490395869 + 0.18885490797 + + + 460.021956525 + 0.104984805984 + + + 144.972830719 + -0.265666935051 + + + + + + + + + DSC + + + 44 + % + + absolute + 1 + + + + + 109 + Celsius + + absolute + 0.5 + + + + + + + https://nanomine.org/nmr/blob?id=5ac5c7abe74a1d06fd9ac3c0 + Representative image of nanoparticle dispersion in matrix + SEM + + + diff --git a/whyis/materialsmine/tests/xml/L157_S5_Zhao_2008.xml b/whyis/materialsmine/tests/xml/L157_S5_Zhao_2008.xml new file mode 100644 index 00000000..fcf0f558 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L157_S5_Zhao_2008.xml @@ -0,0 +1,209 @@ + + + L157_S5_Zhao_2008 + L157_S1_Zhao_2008 + + + + research article + Composites Science and Technology + Mechanisms leading to improved mechanical performance in nanoscale alumina filled epoxy + Zhao, Su + Schadler, Linda S. + Duncan, Renee + Hillborg, Henrik + Auletta, Tommaso + Nanocomposites + Interface + Stress/strain curves + Fracture + Mechanisms + Elsevier + 2008 + 10.1016/j.compscitech.2008.01.009 + 68 + https://www.sciencedirect.com/science/article/pii/S0266353808000213?via%3Dihub + English + Department of Materials Science and Engineering and Rensselaer Nanotechnology Center, Rensselaer Polytechnic Institute, 110 8th Street, Troy, NY 12180, USA + + + + 0266-3538 + 14 + + + + + + + + epoxy + ER + thermoset + Polyepoxide + homopolymer + Huntsman + Araldite F + + + + + alumina + Al2O3 + Nanophase Technologies Corporation + NanoTek + + 45 + nm + + + + + 0.061 + + + + + + + + + nanoparticles were dried in vacuum + + 190 + Celsius + + + + + + + Hauschild SpeedMixer (DAC-150) + high shear mixing + + epoxy + + + alumina + + + 3450 + + + + + + + hardener + Aradur HY905 + + + + + catalyst + DY062 + + + + + curing + + 80 + Celsius + + + + + + + post-curing + + 135 + Celsius + + + + + + + casting + + + + + + + JEOL CM12 + + + JEOL 6330F + + + model Q100 + TA Instruments + + 10 + C/min + + + + Nicolet 4700 FT-IR spectrometer + + + model Q50 + TA Instruments + + + + + + + 4.03 + GPa + + absolute + 0.1 + + + + 92 + GPa + + absolute + 1.5 + + + + 4.7 + % + + absolute + 0.5 + + + + + + + 112 + Celsius + + absolute + 1 + + + + + diff --git a/whyis/materialsmine/tests/xml/L168_S4_Luo_2013.xml b/whyis/materialsmine/tests/xml/L168_S4_Luo_2013.xml new file mode 100644 index 00000000..17ec1e91 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L168_S4_Luo_2013.xml @@ -0,0 +1,904 @@ + + + L168_S4_Luo_2013 + L168_S1_Luo_2013 + + + + research article + ACS Applied Materials & Interfaces + Nano Ag-Deposited BaTiO3 Hybrid Particles as Fillers for Polymeric Dielectric Composites: Toward High Dielectric Constant and Suppressed Loss + Luo, Suibin + Yu, Shuhui + Sun, Rong + Wong, Ching-Ping + Ag-deposited BaTiO3 + hetero-epitaxial interface + polymer matrix + dielectric composites + American Chemical Society + 2014 + 10.1021/am404556c + 6 + https://pubs.acs.org/doi/10.1021/am404556c + English + Center for Advanced Materials, Shenzhen Institutes of Advanced Technology, Chinese Academy of Sciences , Shenzhen, Guangdong 518055, China + 2017-07-10 + + + + 1944-8244 + 1 + + + + + + + + poly(vinylidene flouride) + PVDF + Shanghai 3F Co. + + + + + Silver nitrate + AgNO3 + Guoyao Chemical Co. China + + + Ethylene glycol + Shanghai Lingfeng Chemical Co. China + + + barium titanate + BaTiO3 + Shangdong Guoci Functional Materials Co., China + GC-BT-01 + + 100 + nm + + + + + + ethylene glycol + + + + + AgNO3 (5g) was dissolved in 300 mL of ethylene glycol in a 500 mL three-neck flask + stirring + + AgNO3 + + + ethylene glycol + + + + + + Followed by the addition of 5 g of BaTiO3 under magnetic stirring + BaTiO3 + + 5 + g + + + + + + Followed by the addition of 5 g of BaTiO3 under magnetic stirring. The crystal seeds of Ag formed after about 30 min, and the color of the mixture turned to shallow brown red, at room temperature. + stirring + + + 23 + Celsius + + + + + + The temperature of the mixture was increased to 140 deg C in the oil base for 25 min. + + 140 + Celsius + + + + + + Used + + + + The BT-Ag suspension was obtained which was rinsed and centrifuged three times with ethanol. At last, the obtained BT-Ag hybrid particles were dried at room temperature for 24 h. + + 23 + Celsius + + + + + + + + 0.33 + + + + + + + + + BT-Ag and PVDF powders were mixed in ethanol solution. + + Ethanol + + + poly(vinylidene fluoride) + + + BaTiO3 + + + Ag + + + + + + The suspension was stirred under ultrasonic treatment with the frequency and power of 40 kHz and 1kW, respectively, for 1 h. + stirring + + + + + + The suspension was further magnetically stirred for 6 h. + stirring + + + + + + The suspension was dried at 70 deg C in an oven for 12 h. then molded by hot pressing at 180 deg C and 15 MPa for 15 min. + + 70 + Celsius + + + + + + + hot-pressing + + + + null + + + + + + FEI Tecnai Spirit + + + FEI Nova NanoSEM450 + + + CS9912BX + The measurement of DC breakdown strength was carried out with a dielectric strength tester (CS9912BX, Allwin Instrument Science and Technology co. Ltd, China). + + + Agilent 4294A impedance analyzer + The dielectric and electrical properties were measured using an Agilent 4294A impedance analyzer impedance analyzer in the frequency range of 100 Hz to 10 MHz. Effects of temperature on dielectric properties were investigated via Agilent 4294A connected with a THMS 600 Temperature Controlled stage and a T95-Linkpad Temperature programmer (Linkam Scientific Instruments) in a temperature range between -50 and 130 deg C. + + + XRD, D/max-2500/PC, Rigaku Co. + + + + + + + + Dielectric constant on frequency (Hz) at room temp for PVDF with 0.33 vol frac BT-Ag + + + Frequency (Hz) + Dielectric constant, Dk + + + + 103.43386580610871 + 59.28838331283703 + + + 196.45140173268106 + 55.79415381704672 + + + 385.93153242735247 + 54.72637404219091 + + + 784.2023736308834 + 53.66568914956014 + + + 1540.5765554188256 + 51.38823195534957 + + + 3130.409645257355 + 50.32754706271879 + + + 6360.907228304632 + 50.47653958944284 + + + 12496.091412919868 + 49.408759814587086 + + + 24548.746742478295 + 49.55065745908615 + + + 48226.357083404444 + 46.063522845520765 + + + 101359.65009385569 + 46.219610254469785 + + + 192511.85465114895 + 45.144735597389115 + + + 391178.85087022046 + 42.874373285403465 + + + 794864.7819399758 + 41.81368839277269 + + + 1561523.0060004997 + 35.90719894049761 + + + 3067633.8336662822 + 36.049096584996676 + + + 6233348.487129236 + 31.35937943430139 + + + 9036738.8144 + 30.227745719421023 + + + + + + + + imaginary electric modulus on frequency (Hz) at room temp for PVDF with 0.33 vol frac BT-Ag + + + Frequency (Hz) + Imaginary electric modulus + + + + 103.483728547 + 0.00231467679057 + + + 142.906736659 + 0.00198622386672 + + + 203.77147212 + 0.00188671527689 + + + 281.14806522 + 0.00160186539651 + + + 402.084588483 + 0.00153120052655 + + + 567.32694168 + 0.00141781774209 + + + 796.102642785 + 0.00139475331388 + + + 1118.18824198 + 0.00128249257183 + + + 1586.83533781 + 0.00123966355031 + + + 2228.83397357 + 0.00119647102823 + + + 3162.96700199 + 0.00117265055955 + + + 4442.63380286 + 0.0011374905378 + + + 6304.59885616 + 0.00112087345926 + + + 8946.93744768 + 0.00112408268383 + + + 12437.9604084 + 0.00110116870465 + + + 17650.8698316 + 0.00111081011307 + + + 27230.0559693 + 0.00112857696199 + + + 37855.0045806 + 0.00117118595696 + + + 50966.8772557 + 0.00123760451089 + + + 70853.7424288 + 0.00130661577058 + + + 99519.6064249 + 0.00146176845879 + + + 139783.047775 + 0.00164510626463 + + + 198367.923673 + 0.0018964946282 + + + 281506.475705 + 0.00217394937966 + + + 395397.797038 + 0.00252825523007 + + + 555367.039109 + 0.00291851246913 + + + 788128.519002 + 0.00346669819917 + + + 1118443.33337 + 0.00394742079628 + + + 1570940.87807 + 0.00454827119044 + + + 2229342.4357 + 0.00512401522537 + + + 3163688.56714 + 0.00575816440088 + + + 4443647.29738 + 0.00629856238885 + + + 6241449.14533 + 0.00688071250748 + + + 8857320.8796 + 0.00729229336608 + + + + + + + + Loss tangent on frequency (Hz) at room temp for PVDF with 0.33 vol frac BT-Ag + + + Frequency (Hz) + Loss Tangent + + + + 104.178419275 + 0.0871497397247 + + + 140.864614981 + 0.089915770557 + + + 197.972521696 + 0.0931375076183 + + + 280.146167417 + 0.0807910481562 + + + 395.145293097 + 0.0730353713188 + + + 557.186112476 + 0.0703680928935 + + + 785.787236565 + 0.0652796944815 + + + 1103.03909993 + 0.0634106245356 + + + 1578.8044445 + 0.0593145673836 + + + 2282.32234504 + 0.0583872581965 + + + 3154.34750644 + 0.0605447975717 + + + 4397.14105848 + 0.058275981094 + + + 6303.80079475 + 0.0573554159738 + + + 8795.32832983 + 0.0575914583123 + + + 12530.7396707 + 0.0564786872878 + + + 17481.7339195 + 0.058367025996 + + + 24902.3473062 + 0.0599781086241 + + + 35471.285653 + 0.0623460254169 + + + 47952.9910203 + 0.0684887462743 + + + 70467.8649812 + 0.071753998624 + + + 98288.468484 + 0.0774527350827 + + + 141414.675957 + 0.0863549032786 + + + 199262.61072 + 0.0960326391582 + + + 280735.255493 + 0.108091030624 + + + 395496.539871 + 0.121154288044 + + + 557078.691012 + 0.137060169628 + + + 784690.543855 + 0.152649080071 + + + 1116745.97525 + 0.170072376688 + + + 1556705.30063 + 0.186032210805 + + + 2216059.87022 + 0.198744776752 + + + 3122115.48285 + 0.210948165654 + + + 4399939.59162 + 0.217999087509 + + + 6266802.85926 + 0.221843205593 + + + 8474508.92767 + 0.222854815616 + + + + + + + + + + dielectric constant on temperature (C) at 1 kHz for PVDF with 0.33 vol frac BT-Ag + + + Temperature, C + Dielectric Constant, Dk + + + + -49.787595582 + 27.4179231286 + + + -29.940526763 + 35.3617426884 + + + -10.0934579439 + 45.0468557806 + + + 10.0254885302 + 51.2508612418 + + + 29.8725573492 + 56.5827405031 + + + 50.5352591334 + 58.436471001 + + + 69.8385726423 + 64.6360381609 + + + 89.9575191164 + 69.0987500898 + + + 109.804587935 + 77.0425696496 + + + 129.379779099 + 89.3381436065 + + + + + + + + loss tangent on temperature (C) at 1 kHz for PVDF with 0.33 vol frac BT-Ag + + + Temperature, C + Loss tangent + + + + -49.6080483363 + 0.0932629874823 + + + -29.8651094215 + 0.119976294412 + + + -10.3992367957 + 0.0760666069209 + + + 9.96629181001 + 0.063812552398 + + + 29.7175565899 + 0.068608019427 + + + 50.0701338498 + 0.0904483825272 + + + 70.4097597641 + 0.146383163251 + + + 90.1383596889 + 0.21084386112 + + + 110.164840565 + 0.291132953658 + + + 130.168194039 + 0.43230493481 + + + + + + + + at 10 V/s + + 1.68 + V/m + + + + + conductivity on frequency (Hz) at room temp for PVDF with 0.33 vol frac BT-Ag + + + Frequency (Hz) + Conductivity (S/m) + + + + 104.330282686 + 3.25871544443e-07 + + + 139.134212709 + 4.55581622124e-07 + + + 197.824989306 + 6.21884798796e-07 + + + 281.258971543 + 8.95261745874e-07 + + + 395.654079827 + 1.22894311865e-06 + + + 550.676244532 + 1.65842001398e-06 + + + 782.938327814 + 2.35316935959e-06 + + + 1101.40058504 + 3.16460957547e-06 + + + 1565.89819328 + 4.63370975611e-06 + + + 2202.82155454 + 6.26108104215e-06 + + + 3098.73897251 + 8.66961753663e-06 + + + 4405.69624143 + 1.23508846849e-05 + + + 6264.09673017 + 1.69949839343e-05 + + + 8811.7712105 + 2.35851013105e-05 + + + 12395.3589111 + 3.3440061423e-05 + + + 17436.8169392 + 4.60330728579e-05 + + + 24790.9557047 + 6.61363642062e-05 + + + 34874.4274424 + 8.97921806362e-05 + + + 49583.8114933 + 0.000126912973223 + + + 70497.4368602 + 0.00017912053397 + + + 98115.8802513 + 0.000250478301461 + + + 139503.275561 + 0.000343665957728 + + + 198349.103276 + 0.000470684417141 + + + 279013.284123 + 0.000669386460468 + + + 388324.519267 + 0.00092714198719 + + + 552122.333662 + 0.00128630668019 + + + 776689.493245 + 0.00175359993085 + + + 1104330.01758 + 0.00236934849323 + + + 1537008.46596 + 0.00322307668211 + + + 2208786.09587 + 0.00445797718727 + + + 3107251.41351 + 0.00592333926009 + + + 4417980.49558 + 0.00808196708459 + + + 6148971.27652 + 0.010959881249 + + + 8743017.77775 + 0.0145437580673 + + + + + + + + + + https://nanomine.org/nmr/blob?id=5963c49ae74a1d5e0d19807c + TEM image of as-synthesized BT-Ag hybrid nanoparticles + TEM + + + https://nanomine.org/nmr/blob?id=5963c4b6e74a1d5e0d198091 + TEM image of as-synthesized BT-Ag hybrid nanoparticles after being ultrasonically treated for 30 min in ethanol solution + TEM + + + https://nanomine.org/nmr/blob?id=5963c4d4e74a1d5e0d1980a5 + HRTEM image of an individual BT-Ag hybrid nanoparticle + TEM + + + https://nanomine.org/nmr/blob?id=5963c4f0e74a1d5e0d1980ba + SEM image of Ag-deposited BT hybrid particle + SEM + + + https://nanomine.org/nmr/blob?id=5963c82ce74a1d5e0d198e62 + SEM image of fractured cross-section of BT-Ag - PVDF composite with 0.33 vol frac of Bt-Ag + SEM + + + diff --git a/whyis/materialsmine/tests/xml/L172_S18_Huo_2015.xml b/whyis/materialsmine/tests/xml/L172_S18_Huo_2015.xml new file mode 100644 index 00000000..b6118c81 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L172_S18_Huo_2015.xml @@ -0,0 +1,1042 @@ + + + L172_S18_Huo_2015 + + + + research article + The Journal of Physical Chemistry C + Composite Based on Fe3O4@BaTiO3 Particles and Polyvinylidene Fluoride with Excellent Dielectric Properties and High Energy Density + Huo, Xiaoyun + Li, Weiping + Zhu, Jiujun + Li, Lili + Li, Ya + Luo, Laihui + Zhu, Yuejin + American Chemical Society + 2015 + 10.1021/acs.jpcc.5b08809 + 119 + https://pubs.acs.org/doi/10.1021/acs.jpcc.5b08809 + English + Department of Microelectronic Science and Engineering, Faculty of Science, Ningbo University, Ningbo 315211, China + 2016-07-25 + + + + 1932-7447 + 46 + + + + + + + + Polyvinylidene Fluoride + 6369 + PVDF + thermoplastic + homopolymer + 3F Corporation + + + + + Iron Oxide - Barium Titanate core-shell nanoparticles + Fe3O4@BaTiO3 + + Less than 100nm + 100 + nm + + + + + + Distilled Water + + 75 + mL + + + + + + Add PVP to distilled water + Polyvinylpyrrolidone + + 0.002 + g + + + + + + Add BaTiO3 + Barium Titanate + + 3 + g + + + + + + Stirring at 70C + stirring + + + 70 + Celsius + + + + + + Add FECl3.6H2O to solution + Iron Chloride Hexahydrate + + 0.023 + mol + + + + + + Add FeSO4.7H2O to solution + Iron Sulfate Heptahydrate + + 0.046 + mol + + + + + + Cool from 70C to 55C + + 55 + Celsius + + inert (nitrogen, argon, etc) + + + + + Add ammonia solution + 25% Ammonia solution + + Adjust pH to 11-12 + + + + + + Add Ammonia under vigorous stirring + stirring + + + 55 + Celsius + + + + + + Ethanol + + + + + Rinse suspension with Ethanol six times + stirring + + Ethanol + + + + + + Dry obtained particles under vacuum + + 45 + Celsius + + vacuum + + + + + Barium Titanate and Iron Sulfate + + 0.254 + + + + + + Solution Blending + + + + N,N-dimethylformamide + + + + + Add required Fe3O4@BaTiO3 nanoparticles + Fe3O4@BaTiO3 + + 25.4 + vol% + + + + + + Sonicate PVDF-NP Solution + ultra-sonication + + + + + + casting + + Cast onto a glass sheet + + + + + + Dry film under vacuum + + 120 + Celsius + + + vacuum + + + + + Anneal Films + + 135 + Celsius + + + + + + + + + JEOL JEM-2100F + + + Hitachi SU-70 + + Secondary Electrons + 200000 + + + 5 + kV + + + 6.4 + mm + + + + Agilent 4294A + Impedance Analyzer + + + Bruker D8 Advance + + + + + + + measured at 100 Hz + 3902.02702703 + + + measured at 100 Hz + 0.904205607477 + + + + + + Frequency dependent Dielectric constant + + Frequency + Hertz + Dielectric Constant + + + + Frequency (Hz) + Dielectric Constant + + + + 103.879001354 + 3947.51478845 + + + 110.394186681 + 3639.34904762 + + + 128.186908073 + 3491.41803931 + + + 149.806502553 + 3268.93634494 + + + 178.647299392 + 3058.78741855 + + + 213.423221872 + 2834.52158382 + + + 253.824898419 + 2652.00865734 + + + 298.421589724 + 2477.61637036 + + + 356.465927604 + 2314.10497953 + + + 429.873694176 + 2139.76307397 + + + 518.398474117 + 1990.32742981 + + + 624.869967174 + 1837.44302365 + + + 737.328347689 + 1724.25953813 + + + 877.951172291 + 1601.49748276 + + + 1053.72110363 + 1486.60862831 + + + 1282.36391518 + 1372.08258112 + + + 1525.11937385 + 1276.57942196 + + + 1793.08078482 + 1180.99025016 + + + 2152.06394515 + 1078.89891535 + + + 2582.91721332 + 992.402268585 + + + 3114.82270327 + 900.217075988 + + + 3691.26507227 + 827.425045638 + + + 4430.27360576 + 752.349229117 + + + 5275.21275689 + 681.076742112 + + + 6361.54824281 + 613.876729166 + + + 7705.14659338 + 549.435089945 + + + 9163.75469462 + 496.904213602 + + + 10773.8139987 + 448.610119174 + + + 12930.7819562 + 403.681766654 + + + 15519.5849881 + 360.981019072 + + + 18715.5652596 + 322.481774727 + + + 22179.1475572 + 291.88430599 + + + 26619.516642 + 262.502292395 + + + 31696.3750477 + 236.687696973 + + + 38042.1375932 + 214.018495458 + + + 45297.5114833 + 194.214053919 + + + 54366.2851631 + 177.062854782 + + + 64734.9907834 + 161.88168328 + + + 77695.2387386 + 148.056534729 + + + 94554.0240164 + 134.754175398 + + + 112453.393453 + 125.524937904 + + + 133264.497871 + 115.720931452 + + + 159944.673695 + 107.593035653 + + + 193112.110266 + 99.1734198766 + + + 228578.052932 + 92.6403479689 + + + 272172.323443 + 86.5368184101 + + + 328742.597514 + 80.2547147136 + + + 394401.9043 + 74.8317258874 + + + 466835.659521 + 70.2519093752 + + + 568132.49922 + 65.0992103043 + + + 675681.739965 + 61.1023731877 + + + 801634.414315 + 57.2922990792 + + + 953440.324674 + 55.7772280809 + + + + + + + + Frequency dependent Dielectric loss + + Frequency + Hertz + Dielectric Loss + + + + Frequency (Hz) + Dielectric loss + + + + 106.553612888 + 1.18281226977 + + + 129.784549006 + 1.15548709768 + + + 151.073066026 + 1.13730891116 + + + 180.157702079 + 1.11739395523 + + + 212.259801858 + 1.09805792244 + + + 254.755207043 + 1.07565359702 + + + 308.543595982 + 1.05185985607 + + + 360.241137439 + 1.0347237312 + + + 433.508131333 + 1.01191415958 + + + 520.298486976 + 0.989336157221 + + + 619.529505428 + 0.967858108821 + + + 743.562210287 + 0.946785306616 + + + 907.729940202 + 0.923686273431 + + + 1082.486405 + 0.902613471227 + + + 1275.37344886 + 0.882351161415 + + + 1530.70917893 + 0.883566900004 + + + 1853.89935677 + 0.894508547302 + + + 2187.54720393 + 0.904234456012 + + + 2604.75490756 + 0.915349780252 + + + 3126.23902389 + 0.931588574258 + + + 3752.12669958 + 0.9500851685 + + + 4503.32001555 + 0.970492209096 + + + 5454.13994707 + 0.993504403811 + + + 6504.17275249 + 1.01527191378 + + + 7663.14403303 + 1.03692363912 + + + 9197.34131309 + 1.06045686466 + + + 11139.2453766 + 1.08520582879 + + + 13283.7765376 + 1.10361558456 + + + 16045.9856969 + 1.12167798645 + + + 19135.1641083 + 1.13603528026 + + + 22860.0621948 + 1.14282315404 + + + 27491.2314034 + 1.14859791234 + + + 32771.4678615 + 1.1463401121 + + + 39080.6415663 + 1.14008774222 + + + 46044.3774515 + 1.13036183351 + + + 55526.3914399 + 1.11431408414 + + + 66930.7031728 + 1.09250026032 + + + 79816.2240255 + 1.07119588886 + + + 94038.5878658 + 1.04803896336 + + + 113164.456421 + 1.02094536053 + + + 135193.327708 + 0.994199111576 + + + 160446.003973 + 0.968263355017 + + + 191678.817541 + 0.942530221556 + + + 227482.382764 + 0.916391841899 + + + 270458.62866 + 0.893813839537 + + + 328120.007271 + 0.867154429057 + + + 379998.211727 + 0.849931465717 + + + 475609.830095 + 0.823301001393 + + + 588569.023306 + 0.798986229619 + + + 689005.672478 + 0.783876335731 + + + 838695.141311 + 0.764289436246 + + + 957694.410559 + 0.761993041134 + + + + + + + + Conductivity of Film for AC electric field at 100Hz + 0.0000250646 + s/m + + Conductivity of Film for AC electric field + + Frequency + Hertz + Conductivity + s/m + + + + Frequency (Hz) + Conductivity (s/m) + + + + 102.359526534 + 2.51010123645e-05 + + + 126.002044465 + 2.87145406788e-05 + + + 148.45420808 + 3.08893698409e-05 + + + 179.025690541 + 3.37946931652e-05 + + + 212.156948078 + 3.65601555137e-05 + + + 256.253190293 + 4.02850491005e-05 + + + 307.434287491 + 4.37559794972e-05 + + + 363.896032944 + 4.72988018628e-05 + + + 433.298068243 + 5.15383892699e-05 + + + 520.046368274 + 5.63076670473e-05 + + + 619.229302796 + 6.15241343437e-05 + + + 743.201905684 + 6.69432715631e-05 + + + 904.466373745 + 7.32354948953e-05 + + + 1075.68465805 + 7.95454116267e-05 + + + 1274.75544687 + 8.6606210866e-05 + + + 1517.87604867 + 9.58883144023e-05 + + + 1847.23402219 + 0.000107016391502 + + + 2196.92114067 + 0.000119340574492 + + + 2603.49273317 + 0.000130923197172 + + + 3124.72415628 + 0.000145244682534 + + + 3720.66969172 + 0.000161132772955 + + + 4465.56516757 + 0.000179473985229 + + + 5434.53064766 + 0.000200302387078 + + + 6463.30412173 + 0.000221062757143 + + + 7659.43073772 + 0.000241166221974 + + + 9120.23281939 + 0.000265419084598 + + + 11099.1963863 + 0.000297406702425 + + + 13200.3086195 + 0.000321230433603 + + + 15988.2954761 + 0.000352407515846 + + + 18775.0586265 + 0.000380181428813 + + + 22668.4084438 + 0.000414258664061 + + + 26831.5677252 + 0.000447800248024 + + + 32653.6444224 + 0.000482128798097 + + + 38835.0803902 + 0.000518674646112 + + + 45658.3514829 + 0.00055617953583 + + + 55587.6266432 + 0.00060076650182 + + + 66690.0668468 + 0.000646563305761 + + + 79314.7029385 + 0.000691420131734 + + + 96066.458954 + 0.000746508151186 + + + 112810.862271 + 0.000795753087295 + + + 134326.08293 + 0.00085993812884 + + + 161218.793047 + 0.000918759479086 + + + 196201.026951 + 0.00100712531803 + + + 233342.488689 + 0.0010813056366 + + + 274340.448311 + 0.0011621422814 + + + 329264.689301 + 0.00126956432226 + + + 400710.543469 + 0.00138612502413 + + + 476566.289739 + 0.00150254996886 + + + 577220.038856 + 0.00164903852053 + + + 706060.996152 + 0.00184328472728 + + + 833131.395345 + 0.00201718616849 + + + 968691.03952 + 0.00214689820655 + + + + + + + Percolation threshold for Fe3O4@BaTiO3-PVDF nanocomposite + 26 + vol% + + + log(fc-f) + log sigma + log (s/m) + + + + log(fc-f) + log sig + + + + -1.38894261537 + -4.89795918367 + + + -1.19209272559 + -5.25765306122 + + + -1.1207779279 + -5.51020408163 + + + -1.00908056602 + -5.72448979592 + + + -0.929083410368 + -6.32142857143 + + + + + + + + + 200nm + + https://nanomine.org/nmr/blob?id=5ad39e23e74a1d06fd9ca77e + SEM image of Fe3O4@BaTiO3 nanoparticles + SEM + grayscale + + 1000 + 744 + + + + https://nanomine.org/nmr/blob?id=5ad39e48e74a1d06fd9ca7a0 + Image of single Fe3O4@BaTiO3 nanoparticle + TEM + grayscale + + 990 + 752 + + + + diff --git a/whyis/materialsmine/tests/xml/L199_S1_Duncan_2010.xml b/whyis/materialsmine/tests/xml/L199_S1_Duncan_2010.xml new file mode 100644 index 00000000..573e16b7 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L199_S1_Duncan_2010.xml @@ -0,0 +1,342 @@ + + + L199_S1_Duncan_2010 + + + + research article + Composites Science and Technology + Measurement of the critical aspect ratio and interfacial shear strength in MWNT/polymer composites + Duncan, Renée K. + Chen, Xinyu G. + Bult, J.B. + Brinson, L.C. + Schadler, L.S. + Carbon nanotubes + Polymer matrix composites + Fragmentation + Interfacial strength + Mechanical properties + Elsevier + 2010 + 10.1016/j.compscitech.2009.12.010 + 70 + https://www.sciencedirect.com/science/article/pii/S0266353809004357?via%3Dihub + English + Rensselaer Polytechnic Institute, Troy, NY 12180, USA + 2017-06-21 + + + + 0266-3538 + 4 + + + + + + + + poly(bisphenol A carbonate) + PC + GE Plastics + Lexan 124 + + + + + multi-walled carbon nanotubes + MWNT + + + + + vapor deposition of xylene–ferrocene in a quartz tube furnace + + 727 + Celsius + + + + + + + 0.05 + + + + + + + + + PC was dried to remove residual moisture + + 125 + Celsius + + + vacuum + + + + + ultra-sonication + + PC + + + tetrahydrofuran + + + + + + + stirring + + PC solution + + + MWNT dispersion + + + + + + + Precipitation of the composite + dissolving + + PC solution + + + MWNT dispersion + + + methanol + + + + + + the mixture was dried after filtration + + 60 + Celsius + + + vacuum + + + + + + + + + + + 190 + Celsius + + + + + + + + + Phillips CM12 + + + JEOL 6335 + + + + + + + Number of MWNT within grip region dissolved in THF + + + Aspect ratio (L/d) + Number of MWNT within grip region dissolved in THF + + + + 0-199 + 0.0 + + + 200-399 + 0.0 + + + 400-599 + 0.0 + + + 600-799 + 0.0 + + + 800-999 + 18.4393465415 + + + 1000-1199 + 17.0142509559 + + + 1200-1399 + 10.4362182829 + + + 1400-1599 + 16.7014250956 + + + 1600-1799 + 11.9742787626 + + + 1800-1999 + 22.540841154 + + + >2000 + 21.8456725756 + + + + + + Number of MWNT along the fracture edge dissolved in THF + + + Aspect ratio (L/d) + Number of MWNT along the fracture edge dissolved in THF + + + + 0-49.99 + 0.0 + + + 50-99.99 + 0.0 + + + 100-149.99 + 3.09094256259 + + + 150-199.99 + 0.0 + + + 200-249.99 + 7.79270986745 + + + 250-299.99 + 13.9304123711 + + + 300-349.99 + 34.486377025 + + + 350-399.99 + 43.1148748159 + + + >400 + 11.1800441826 + + + + + + Number of MWNT along the fracture for ARNT/PC + + + Aspect ratio (L/d) + Number of MWNT along the fracture for ARNT/PC + + + + 0-16 + 0.0 + + + 16-31 + 8.95470779757 + + + 32-48 + 16.0864952961 + + + 49-64 + 29.1779569873 + + + 65-80 + 27.8728191726 + + + 81-96 + 14.8469887788 + + + >97 + 23.6376183327 + + + + + + + + + + https://nanomine.org/nmr/blob?id=594ac431e74a1d5e0d156d7e + SEM + + + https://nanomine.org/nmr/blob?id=594ac43de74a1d5e0d156d8f + magnification: 2500, accelerating voltage: 23 kV + SEM + + + https://nanomine.org/nmr/blob?id=594ac4ade74a1d5e0d156da8 + magnification: 1300, accelerating voltage: 120 kV + TEM + + + https://nanomine.org/nmr/blob?id=594ac4ede74a1d5e0d156ddc + magnification: 1500, accelerating voltage: 12 kV + SEM + + + diff --git a/whyis/materialsmine/tests/xml/L203_S9_Ma_2009.xml b/whyis/materialsmine/tests/xml/L203_S9_Ma_2009.xml new file mode 100644 index 00000000..2e17bced --- /dev/null +++ b/whyis/materialsmine/tests/xml/L203_S9_Ma_2009.xml @@ -0,0 +1,951 @@ + + + L203_S9_Ma_2009 + L203_S1_Ma_2009 + + + + research article + ACS Applied Materials & Interfaces + Enhanced Electrical Conductivity of Nanocomposites Containing Hybrid Fillers of Carbon Nanotubes and Carbon Black + Ma, Peng-Cheng + Liu, Ming-Yang + Zhang, Hao + Wang, Sheng-Qi + Wang, Rui + Wang, Kai + Wong, Yiu-Kei + Tang, Ben-Zhong + Hong, Soon-Hyung + Paik, Kyung-Wook + Kim, Jang-Kyo + conducting nanocomposites + carbon nanotubes + carbon black + synergic effect + American Chemical Society + 2009 + 10.1021/am9000503 + 1 + https://pubs.acs.org/doi/10.1021/am9000503 + English + Departments of Mechanical Engineering and Chemistry, The Hong Kong University of Science and Technology (HKUST), Clear Water Bay, Kowloon, Hong Kong, China + 2017-08-10 + + + + 1944-8244 + 5 + + + + + + + + diglycidyl ether of bisphenol A + DGEBA + Shell Chemicals, London, U.K. + Epon 828 + m-phenylenediamine + + + + + carbon black + Vulcan XC72, Cabot Corp., Boston, MA + + 40 + nm + + absolute + 20 + + + + + + 0.004 + + + + + + + + + acetone + + + + + The conducting filler and DGEBA were mixed in 200 mL of acetone, and then the mixture was dispersed using a high-speed shear mixer (HSM- 100 L, Ross, Hauppauge, NY) at 3000 rpm for 1 h. + HSM- 100 L, Ross, Hauppauge, NY + high shear mixing + + 200 mL acetone + + + 3000 + rpm + + + + 80 + Celsius + + + + + + The mixture was distilled at 80 °C to remove the solvent + + 80 + Celsius + + + + + + followed by degassing in a vacuum oven at 80 °C for 5 h to eliminate the remaining solvent and entrapped air. + + 80 + Celsius + + + + 0 + Pa + + + + + + The mPDA hardener was added into the mixture in a ratio of 14.5:100 by weight with gentle stirring of the mixture. + mPDA hardener + + + + + hot-pressing + + + + + The composite was molded into a flat plate and cured at 80 °C for 2 h, followed by postcure at 150 °C for 2 h. + + 80 + Celsius + + + + + + + The composite was molded into a flat plate and cured at 80 °C for 2 h, followed by postcure at 150 °C for 2 h. + + 150 + Celsius + + + + + + + + + JEOL 2010F + The dispersion states of fillers in nanocomposites were evaluated on a TEM (JEOL 2010F) + + + JEOL-6700F + A scanning electron microscope (SEM; JEOL-6700F) was employed to examine the morphologies of fracture surfaces. + + + Zwick-Roell HIT5.5P + Specimens were tested on an impact tester (Zwick-Roell HIT5.5P) with an impact energy of 2.7 J. + + + Sony Tektronix 370A + The direct-current (dc) electrical conductivity of nanocomposites was measured at room temperature using a programmable curve tracer (Sony Tektronix 370A). Square specimens of 10mm× 10mmwere cut from the plate and were polished on both sides into a thickness of 0.8 mm. Silver paste of a thickness of about 0.05 mm was applied on the sample surface to reduce the contact resistance between the sample and the electrodes. To minimize any potential problems associated with the silver paste, the samples were heated at 40 °C to remove the solvent quickly. Then, the edges of the samples were grinded again to remove the silver paste that was possibly attached on them. + + + Hewlett-Packard 4284A + The alternating-current (ac) conductivity of nanocomposites was measured with a precision LCR meter (Hewlett-Packard 4284A) in the frequency range of 20-106 Hz. The equipment was calibrated using an internal calibration calculator during the measurement. + + + Leica Quantimet 500+ Image Processing System + The electrical conducting networks in the nanocomposites were visualized by examining the polished samples with a thickness of 0.1 mm using the transmission mode of an optical microscope (Leica Quantimet 500+ Image Processing System). + + + + + + + flexural stress (MPa) vs flexural strain (%) + + + Flexural strain (%) + Flexural stress (MPa) + + + + 0.0455199451544 + 0.97757885763 + + + 0.0984788280365 + 1.81445012788 + + + 0.179423054029 + 5.30622335891 + + + 0.1570619867 + 3.71905370844 + + + 0.224083753163 + 7.26854219949 + + + 0.341314431514 + 12.347485081 + + + 0.433387994902 + 15.622826087 + + + 0.491957257436 + 17.2532821824 + + + 0.550558700481 + 19.5186061381 + + + 0.620298988801 + 21.7550724638 + + + 0.684450107351 + 23.6163895993 + + + 0.753087481772 + 26.072173913 + + + 0.832297373221 + 28.3153736857 + + + 0.843503017436 + 29.6043478261 + + + 0.922369928714 + 31.360540738 + + + 0.893651956553 + 29.9506393862 + + + 0.996215269668 + 34.1277813299 + + + 1.0476737362 + 35.5836487639 + + + 1.11125833147 + 37.2573913043 + + + 1.16150351957 + 39.502514919 + + + 1.24238777279 + 41.8111253197 + + + 1.21165977244 + 39.9930946292 + + + 1.31216477615 + 44.7719181586 + + + 1.29535250667 + 42.76342711 + + + 1.39583469147 + 47.0920716113 + + + 1.37066368038 + 45.0143222506 + + + 1.46276723015 + 48.8812446718 + + + 1.44597485409 + 47.2652173913 + + + 1.54090004963 + 51.8535805627 + + + 1.53384593521 + 50.0499786871 + + + 1.61337348731 + 53.065601023 + + + 1.64019535865 + 54.7451150895 + + + 1.71380081897 + 56.312084399 + + + 1.68028115923 + 54.3641943734 + + + 1.75063185335 + 57.6539641944 + + + 1.79742407255 + 57.7116794544 + + + 1.91449092284 + 59.5585677749 + + + 1.8893155235 + 57.3942455243 + + + 1.96461353245 + 59.3854219949 + + + 2.02317913811 + 60.9437340153 + + + 2.10410142284 + 64.0026427962 + + + 2.09848153531 + 63.021483376 + + + 2.16548136052 + 66.1381074169 + + + 2.17795715977 + 65.0126598465 + + + 2.25468573874 + 67.7541346974 + + + 2.24070915744 + 66.7441176471 + + + 2.32156561841 + 68.5044330776 + + + 2.39127226346 + 70.077173913 + + + 2.46655754649 + 71.8172890026 + + + 2.550199377 + 73.5833759591 + + + 2.61990675343 + 75.1705456095 + + + 2.70075151239 + 76.7 + + + 2.77184667339 + 78.1933823529 + + + 2.85367831878 + 79.5692729266 + + + 2.92028915683 + 80.8987851662 + + + 2.99943221451 + 82.2159298502 + + + 3.08172391236 + 83.510400682 + + + 3.17145293044 + 85.0109974425 + + + 3.25267459145 + 86.1268258028 + + + 3.33630073571 + 87.5834490318 + + + 3.41434558119 + 88.8202046036 + + + 3.50352948091 + 90.0322250639 + + + 3.58991513886 + 90.9845268542 + + + 3.65403597848 + 92.2484910486 + + + 3.73761637347 + 92.8025575448 + + + 3.80451790184 + 93.9799488491 + + + 3.8936816156 + 94.7937340153 + + + 3.97449126855 + 95.6306052856 + + + 4.05530238424 + 96.4963341858 + + + 4.13889916204 + 97.3736061381 + + + 4.22248306764 + 97.9969309463 + + + 4.30607399443 + 98.7587723785 + + + 4.39174451366 + 99.3388107417 + + + 4.47324882683 + 100.143938619 + + + 4.56160965772 + 100.81673365 + + + 4.64039908501 + 101.044296675 + + + 4.7184110813 + 101.632992327 + + + 4.8075528538 + 102.013913043 + + + 4.89672549034 + 103.003729753 + + + 4.94549030177 + 103.515952685 + + + 4.97468731428 + 102.602608696 + + + 5.05826653907 + 103.133589088 + + + 5.14556836645 + 103.845410628 + + + 5.22261533745 + 103.710741688 + + + 5.29704844291 + 104.337364511 + + + 5.34794526547 + 103.739599318 + + + 5.40686130437 + 104.362099622 + + + 5.49836185265 + 104.182082978 + + + 5.5691956863 + 104.444549994 + + + 5.65990138987 + 104.282122762 + + + 5.74106323135 + 104.217811472 + + + 5.82701039849 + 104.368695652 + + + 5.91532007491 + 104.032298137 + + + 5.99410555974 + 104.182082978 + + + 6.07765679724 + 104.160920716 + + + 6.16675790528 + 103.739599318 + + + 6.25031314097 + 103.797314578 + + + 6.32829793009 + 103.849258312 + + + 6.41184380417 + 103.72228474 + + + 6.4953765135 + 103.335592498 + + + 6.57892268013 + 103.214390452 + + + 6.66246094791 + 102.937357204 + + + 6.74599453489 + 102.56797954 + + + 6.82953982387 + 102.429462916 + + + 6.91307809165 + 102.152429668 + + + 6.99662513593 + 102.048542199 + + + 7.08016340371 + 101.771508951 + + + 7.16369640559 + 101.390588235 + + + 7.24720834386 + 100.594117647 + + + 7.25047759129 + 0.256138107417 + + + 7.26382226436 + 98.6895140665 + + + 7.26373449933 + 96.958056266 + + + 7.2636467343 + 95.2265984655 + + + 7.26355896926 + 93.495140665 + + + 7.26347120423 + 91.7636828645 + + + 7.2633834392 + 90.0322250639 + + + 7.26329567417 + 88.3007672634 + + + 7.26320790914 + 86.5693094629 + + + 7.26312014411 + 84.8378516624 + + + 7.26303237907 + 83.1063938619 + + + 7.26294461404 + 81.3749360614 + + + 7.26285684901 + 79.6434782609 + + + 7.26276908398 + 77.9120204604 + + + 7.26268131895 + 76.1805626598 + + + 7.26259355392 + 74.4491048593 + + + 7.26250578888 + 72.7176470588 + + + 7.26241802385 + 70.9861892583 + + + 7.26233025882 + 69.2547314578 + + + 7.26224249379 + 67.5232736573 + + + 7.26215472876 + 65.7918158568 + + + 7.26206696373 + 64.0603580563 + + + 7.26197919869 + 62.3289002558 + + + 7.26189143366 + 60.5974424552 + + + 7.26180366863 + 58.8659846547 + + + 7.2617159036 + 57.1345268542 + + + 7.26162813857 + 55.4030690537 + + + 7.26154037354 + 53.6716112532 + + + 7.2614526085 + 51.9401534527 + + + 7.26136484347 + 50.2086956522 + + + 7.26127707844 + 48.4772378517 + + + 7.26118931341 + 46.7457800512 + + + 7.26110154838 + 45.0143222506 + + + 7.26101378334 + 43.2828644501 + + + 7.26092601831 + 41.5514066496 + + + 7.26083825328 + 39.8199488491 + + + 7.26075048825 + 38.0884910486 + + + 7.26066272322 + 36.3570332481 + + + 7.26057495819 + 34.6255754476 + + + 7.26048719315 + 32.8941176471 + + + 7.26039942812 + 31.1626598465 + + + 7.26031166309 + 29.431202046 + + + 7.26022389806 + 27.6997442455 + + + 7.26013613303 + 25.968286445 + + + 7.260048368 + 24.2368286445 + + + 7.25996060296 + 22.505370844 + + + 7.25987283793 + 20.7739130435 + + + 7.2597850729 + 19.042455243 + + + 7.25969730787 + 17.3109974425 + + + 7.25960954284 + 15.5795396419 + + + 7.25952177781 + 13.8480818414 + + + 7.25943401277 + 12.1166240409 + + + 7.25934624774 + 10.3851662404 + + + 7.25925848271 + 8.6537084399 + + + 7.25917071768 + 6.92225063939 + + + 7.25908295265 + 5.19079283887 + + + 7.25899518762 + 3.45933503836 + + + 7.25890742258 + 1.72787723785 + + + 0.255895025071 + 8.38235294118 + + + 0.298562831401 + 10.1470588235 + + + + + + 3.26 + GPa + + absolute + 0.13 + + + + 104.5 + MPa + + absolute + 4.5 + + + + + + + 1.92e-12 + S/cm + + ac conductivity (S per cm) on frequency (Hz) for CB filler + + + Frequency (Hz) + Conductivity (S/cm) + + + + 20.0061530355 + 6.85492547876e-13 + + + 99.0588367665 + 1.03301822604e-11 + + + 989.028396717 + 9.83852294873e-11 + + + 10031.5704019 + 1.44545049108e-09 + + + 100157.72762 + 1.75674001132e-08 + + + 1000000.0 + 2.19369613757e-07 + + + + + + + + + + https://nanomine.org/nmr/blob?id=598dc024e74a1d1577263541 + TEM image of CB filler + TEM + grayscale + + + diff --git a/whyis/materialsmine/tests/xml/L217_S2_Ash_2002.xml b/whyis/materialsmine/tests/xml/L217_S2_Ash_2002.xml new file mode 100644 index 00000000..4b693ece --- /dev/null +++ b/whyis/materialsmine/tests/xml/L217_S2_Ash_2002.xml @@ -0,0 +1,289 @@ + + + L217_S2_Ash_2002 + L217_S1_Ash_2002 + + + + research article + Polymer Composites + Mechanical properties of Al2O3/polymethylmethacrylate nanocomposites + Ash, Benjamin J. + Rogers, Diana F. + Wiegand, Christopher J. + Schadler, Linda S. + Siegel, Richard W. + Benicewicz, Brian C. + Apple, Tom + Wiley Subscription Services, Inc., A Wiley Company + 2002 + 10.1002/pc.10497 + 23 + http://onlinelibrary.wiley.com/doi/10.1002/pc.10497/abstract + English + Department of Materials Science and Engineering, Rensselaer Nanotechnology Center, Troy, NY 12180‐3590, USA + 2017-07-13 + + + + 1548-0569 + 6 + + + + + + + + poly(methyl methacrylate) + PMMA + Cambridge Isotope Laboratories + + 142000 + g/mol + + 1.5 + + + + + alumina + gamma-Al2O3 + Nanophase Technologies Corporation + + 39 + nm + + + + 43 + m^2/gram + + + + + + + Twenty grams of nanoparticles were suspended in ethanol through 10 minutes of sonication (VCX-400 Sonics Materials Vibracell) at 70% power. The power setting refers to the percentage of maximum sonic power (400 watts) that is directed into the sample. + VCX-400 Sonics Materials Vibracell + ultra-sonication + + ethanol + + + + + + Used + + + + The resulting slurry was centrifuged for 3 minutes at 3000 rpm to remove particles larger than 100 nm. This procedure was used to achieve a narrower particle size distribution than is available from the supplier. + + 3000 + RPM + + + + + + + The silane coupling agent was added to a 95/5 mixture of ethanol and water adjusted to a pH of 4.5 by addition of acetic acid. + + + + + This solution was reacted at room temperature for 10 minutes for silanol formation. + + + + + + The silanol solution was then dropped into the ethanol/nanoparticle sluny at a rate of approximately 20 ml/min while sonicating the mixture at 70% power. + VCX-400 Sonics Materials Vibracell + ultra-sonication + + + + + The slurry was then evaporated at reduced pressure for 2 hours at 60°C to remove the solvent. + + 60 + Celsius + + + + + + + The particles were cured under vacuum at 60°C for a period of 24 hours. + + 60 + Celsius + + + + + + + + 0.02 + + + + + + + + + Coated or uncoated nanoparticles were added to MMA monomer and dispersed via sonication at 70% power for 10 minutes. During the last two minutes of the sonication, the initiator (AIBN) and chain transfer agent (1 - decanethiol) were added. + VCX-400 Sonics Materials Vibracell + ultra-sonication + + 2,2-azobisisobutyronitrile + + + 1 - decanethiol + + + + + + + The polymerization was carried out at 55°C under a nitrogen blanket for 21 hours with two additional sonication steps of 40% power at the 1 and 2 hour points. + VCX-400 Sonics Materials Vibracel + ultra-sonication + + + 55 + Celsius + + + + + + The polymer was then broken into small pieces and dried in a vacuum oven for 2 hours at 115°C to drive off water and residual monomer. + + 115 + Celsius + + + + 0 + Pa + + + + + + hot-pressing + + + + + The resulting nanocomposite was compression molded into tensile specimens (AS" D638-95 Qpe IV) in a hydraulic press (Carver 12 Ton) at 180°C and 2.5 mTons. + + 180 + Celsius + + + + + + Specimens were allowed to cool to room temperature under pressure for a period of 6 hours and, after removal, were sanded (400 grit) to remove flashing. + + 23 + Celsius + + + + + + + + + The speed and duration requirements were chosen by observing the gross distribution of remaining particles through transmission electron microscope (TEM) measurements. + + + JEOL + + + Rheometric Scientific DMTA V + Dynamic mechanical thermal analysis (DMTA) was carried out on a Rheometric Scientific DMTA V using single cantilever bending mode at 1 Hz with 0.1% strain. Temperature ramps from 15°C to 200°C at 2°C mix1 were conducted to determine the Tg of the materials. + + + Seiko Instruments SSC5200 + In specific cases, Tg was also obtained through differential scanning calorimetry (DSC) (Seiko Instruments SSC5200) with a temperature ramp from 25°C to 190°C at 10°C per min. + + + Chemagnetics CMX spectrometer + 7.5 mm coil and a quadrupolar echo sequence. An echo delay of 25 ps was used and the 90" pulse width was 3 ps. Eight scans were acquired for each spectrum with a pulse delay of 5 s. + + + + + + + 2.500735763 + GPA + + + 56 + MPa + + + + + Dynamic Mechanical Thermal Analysis (DMTA) in Single Cantilever Bending at 1 Hz, 0.1% Strain, and 2°C per min and Differential Scanning Calorimetry (DSC) at 10°C per min. + + 102 + Celsius + + absolute + 1 + + + + 97 + Celsius + + absolute + 3 + + + + + + + https://nanomine.org/nmr/blob?id=5967e116e74a1d147250479b + typical nano-alumina particle dispersion-morphology from nanophase technology corporation + + + diff --git a/whyis/materialsmine/tests/xml/L256_S3_Potschke_2004.xml b/whyis/materialsmine/tests/xml/L256_S3_Potschke_2004.xml new file mode 100644 index 00000000..2bf491c7 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L256_S3_Potschke_2004.xml @@ -0,0 +1 @@ +L256_S3_Potschke_2004L256_S1_Potschke_2004research articlePolymerRheological and dielectrical characterization of melt mixed polycarbonate-multiwalled carbon nanotube compositesPötschke, PetraAbdel-Goad, MahmoudAlig, IngoDudkin, SergejLellinger, DirkPolycarbonateMultiwalled carbon nanotubeNanocompositeElsevier200410.1016/j.polymer.2004.10.04045https://www.sciencedirect.com/science/article/pii/S0032386104010225?via%3DihubEnglishLeibniz Institute of Polymer Research Dresden, Hohe Str. 6, 01069 Dresden, Germany2017-08-020032-386126polycarbonateGE EuropeLexan 121Prior to mixing the materials were dried for about 16 h at 80 °C in a vacuum oven.80CelsiusvacuumSheets with a thickness of about 350 mm (for dielectric measurements) and about 500 mm (for rheological measurements) were formed by compression molding from extruded strands at 260 °C using a Vogt-press. The strands were heated to 260 °C for about 5 min, pressed with a force of about 50 kN for 5 min and cooled to room temperature. For dielectric measurements, discs with diameter of 20 mm were cut from the sheets and gold layers were sputtered onto both flat sides of these samples as electrodes. For rheological measurements, discs with a diameter of 25 mm were punched from the sheets.multi-walled carbon nanotubesHyperion Catalysis International, Inc. (Cambridge, MA, USA)1.75g / cm^3a mean diameter of about 12 nm12nma mean diameter of about 12 nm12nmPrior to mixing the materials were dried for about 16 h at 80 °C in a vacuum oven.80Celsiusvacuum0.0025A DACA Micro Compounder (DACA Instruments, Goleta, CA, USA) was operated at 265 °C, 50 rpm for 5 min in order to get 23 compositions with MWNT contents between 0.1 and 12.5 wt% MWNT, corresponding to contents between 0.07 and 8.5 vol.% (assuming a MWNT density of 1.75 g/cm3DACA Micro Compoundermechanical mixing50rpm265Celsiushot-pressingSheets with a thickness of about 350 mm (for dielectric measurements) and about 500 mm (for rheological measurements) were formed by compression molding from extruded strands at 260 °C using a Vogt-press. The strands were heated to 260 °C for about 5 min, pressed with a force of about 50 kN for 5 min and cooled to room temperature.260CelsiusSolartron SI1260 Impedance/Gain Phase AnalyzerThe dielectric measurements were performed at room temperature in a frequency range from 10K3 to 107 Hz using a frequency response analysis system consisting of Solartron SI1260 Impedance/Gain Phase Analyzer and Novocontrol broadband dielectric converter with the BDC active sample cell.plateThe melt rheological properties were determined using an ARES-rheometer (Rheometrics Scientific). The measurements were performed in dynamic mode and 25 mm parallel plates geometry with gap settings of about 1 mm under liquid nitrogen atmosphere. The strain amplitude was selected to be within the linear viscoelastic range. The rheological properties of the samples were measured at eight temperatures in the temperature range between 170 and 280 °C (steps of 10 K between 170 and 200 °C, steps of 20 K up to 280 °C) as a function of the angular frequency u. The frequency was varied between 100 and 0.01 rad/s.ARES-rheometer (Rheometrics Scientific)170Celsiusshear storage modulus (Pa) on frequency (rad per sec) at 170 deg CFrequencyrad/secShear Storage ModulusPafrequency (rad per sec)shear storage modulus (Pa)0.010157613176466307.28607530.0178489915878126140.4947440.0315958400828232779.4995310.0567622111742418822.7870950.101210075602701963.5966590.1804439012891101529.274360.3192846403291569911.322580.5691023326832116167.461911.021789743012630387.216541.780898429683123880.77243.197029562413544542.413845.739003196893921252.5536610.22578602014250992.5901818.35516177494515992.7955331.98637924644846448.9635657.4128242795019788.80583100.7866266765173117.41471220Celsiusshear storage modulus (Pa) on frequency (rad per sec) at 220 deg CFrequencyrad/secShear Storage ModulusPaFrequency (rad / sec)Shear Storage Modulus (Pa)0.1131.2642474610.176753662299200.038529660.316227766017379.9624295660.55894415764751.192658491.01658.042767181.767536622994168.254554773.1431739831510478.92066235.623413251926344.0586749.9395888689365568.215461617.8908748992150637.42237731.6227766017309980.84576946.6037702554588626.50917169.0993057865771754.239079102.4533859391042705.60632shear loss modulus (Pa) on frequency (rad per sec) at 220 deg CFrequencyrad/secShear Loss ModulusPaFrequency (rad / sec)Shear Loss Modulus (Pa)0.09939163236443211.397979280.1763869420465475.376733390.3149439104619469.19541840.55892022256616610.83059530.99189666736629138.66288261.7710597596950392.82345343.1622776601788398.92056475.61198637259148589.33587310.0816953308237629.92604714.7178551023315853.04416321.4859953315393788.12532931.9460348524484017.39291746.352988395562008.04635156.3486339813774059.703603100.0843042.83085tangent delta on frequency (rad per sec) at 220 deg CFrequencyrad/secTangent DeltadimensionlessFrequency (rad / sec)Tangent Delta0.6765399047313.66345511171.0036586752312.28961173111.4566741414110.67011088282.137454640498.73139554633.153628036137.062837209374.627484410275.615281008466.753056705494.511516727459.963546618753.6288130074214.62003639012.9179955098521.33555211122.3790642347331.47874767941.938403736746.69926780821.5223206704467.40736880221.20437205636101.1016232391.00934955106280Celsiusshear storage modulus (Pa) on frequency (rad per sec) at 280 deg CFrequencyrad/secShear Storage ModulusPaFrequency (rad / sec)Shear Storage Modulus (Pa)0.055807638808624.77933251570.099329510795429.31576609060.17677229943843.29554808650.31460218106860.65260219920.55994629781471.75647276740.996532747621101.5908136221.77359860039132.1753650063.15639431182195.205707875.58428384852330.7283680079.93618928951714.41601950417.78239025971626.9074597731.6377345514161.3777343556.287419120211103.504318199.560663237429626.9442475170Celsiuscomplex viscosity (Pa-sec) on frequency (rad per sec) at 170 deg CFrequencyrad/secComplex ViscosityPa-secFrequency (rad / sec)Complex Viscosity (Pa-sec)0.009870034354621643725.30930.017643386877219303614.7860.031306049587216419172.36680.055548787065613965737.72320.099311105660310500744.42650.1775542386287673931.028550.3150557038056344130.49390.5632967232414421529.94940.9849922849642698425.763491.76116221091793550.456093.149023330861158666.149235.58965971719619180.13095910.0686724102427459.20839717.737869176260873.07088931.7186430674151830.78031456.718893800188367.058248398.458450696745036.20022220Celsiuscomplex viscosity (Pa-sec) on frequency (rad per sec) at 220 deg CFrequencyrad/secComplex ViscosityPa-secFrequency (rad / sec)Complex Viscosity (Pa-sec)0.09881910783231894.11641860.17581498580731087.00261510.31280295797330106.77195160.55652645346529533.53269980.99014950310329157.44977311.7616342087428602.28581463.1342287964528057.69229435.5762939319226999.41534719.9211180914625650.209056814.509448416323449.299313621.473372502521300.308808431.404402989419348.260656645.928348097516590.198295767.56949060813688.745095499.407800414311222.5814066280Celsiuscomplex viscosity (Pa-sec) on frequency (rad per sec) at 280 deg CFrequencyrad/secComplex ViscosityPa-secFrequency (rad / sec)Complex Viscosity (Pa-sec)0.055853308500524.56214548120.099419251478629.08895976850.17696691261343.01389943710.31500225252260.32989906420.56070605306370.69734788430.998060412026102.353102191.77655400831130.5276380463.14391277941195.0628081085.59618514345327.4549162889.90339607248708.46988728217.83465676071633.2004306531.74580473614229.2428743956.179570525711185.837430599.419251478629899.6254778 \ No newline at end of file diff --git a/whyis/materialsmine/tests/xml/L260_S5_Haggenmueller_2006.xml b/whyis/materialsmine/tests/xml/L260_S5_Haggenmueller_2006.xml new file mode 100644 index 00000000..7b7ab9ac --- /dev/null +++ b/whyis/materialsmine/tests/xml/L260_S5_Haggenmueller_2006.xml @@ -0,0 +1,264 @@ + + + L260_S5_Haggenmueller_2006 + L260_S1_Haggenmueller_2006 + + + + research article + Polymer + Interfacial in situ polymerization of single wall carbon nanotube/nylon 6,6 nanocomposites + Haggenmueller, Reto + Du, Fangming + Fischer, John E. + Winey, Karen I. + Nanocomposite + Single wall carbon nanotube + In situ polymerization + Elsevier + 2006 + 10.1016/j.polymer.2006.01.087 + 47 + https://www.sciencedirect.com/science/article/pii/S0032386106001297?via%3Dihub + English + Department of Materials Science and Engineering, University of Pennsylvania, Philadelphia, PA 19104-6272, USA + 2017-07-31 + + + + 0032-3861 + 7 + + + + + + + + Poly[imino(1,6-dioxo-1,6-hexanediyl)imino-1,6-hexanediyl] + nylon 6,6 + + viscosity averaged + 35000 + g/mol + + + + + + single-walled carbon nanotubes + SWNT + + dodecylamine + C12H27N + Aldrich + + the surface areas per chain are ~0.13 nm^2, which corresponds to a surface coverage of only 2.9% + 7.69 + chains/nm^2 + + + + + Functionalization was initiated by refluxing the SWNT at 115 °C in 2.6 M nitric acid for 12 or 48 h while stirring to decorate the SWNT with carboxylic acid groups (–COOH). + stirring + + SWNT + + + nitric acid + 2.6 + M + + + + 115 + Celsius + + + + + washing in water + + + + SWNT-COOH was dried + + + + + dimethyl formamide (DMF) + + + + + these nanotubes were suspended in dimethyl formamide (DMF) to which thionyl chloride (SOCl2) was subsequently added and stirred at 70 °C for 24 h to transform the –COOH groups to chloric acid (–COCl) + stirring + + SWNT-COOH + + + dimethyl formamide (DMF) + + + thionyl chloride (SOCl2) + + + + 70 + Celsius + + + + + washing with anhydrous THF + + + + SWNT-COCl was dried + + + + + the nanotubes were stirred in excess f12 (dodecylamine, C12H27N, Aldrich) at 95 °C for 96 h. + stirring + + SWNT-COCl + + + dodecylamine (C12H27N) + + + + 95 + Celsius + + + + + + + + + 0.02 + + + 2wt% SWNT-f12 + + + + + + + toluene + + + + + The SWNT were suspended in toluene. The in situ polymerization of nylon 6,6 in the presence of the nanotubes was performed with the same reagent ratios as described in S1 for the neat nylon 6,6. + Waring, model 51BL31 + blending + + adipoyl chloride + + + toluene + + + 1,6-hexamethylene diamine + + + deionized water + + + sodium hydroxide + + + + + + + To adjust the nanotube loading, the SWNT/nylon composites were dissolved in formic acid, along with commercial nylon 6,6 ( Mv = 22000 g/mol, Scientific Polymer Products) and precipitated in water. + dissolving + + SWNT/nylon 6,6 composites + + + commercial nylon 6,6 + + + formic acid + + + + + precipitated in water + + + + + + Perkin–Elmer differential scanning calorimeter (DSC 7) + + + Perkin–Elmer 2000 FTIR spectrometer + + + SDT 2960 DTA/TGA analyzer + TA instruments + + + Renishaw micro-Raman spectrometer + + + + + + + on individual melt-spun fiber with diameter of 125±7 μm + 2.39908256881 + GPa + + + + + on individual melt-spun fiber with diameter of 171±9 μm + 1.58256880734 + GPa + + + + + + 3.55e-7 + S/m + + + + Perkin–Elmer differential scanning calorimeter (DSC 7) + + + tested at a heating rate of 10 °C/min, the total crystallinity (~29%) did not change upon blending + 0.29 + + + + The melting temperature (261 °C) did not change upon blending + 261 + Celsius + + + + diff --git a/whyis/materialsmine/tests/xml/L300_S5_Nakane_1999.xml b/whyis/materialsmine/tests/xml/L300_S5_Nakane_1999.xml new file mode 100644 index 00000000..b9806248 --- /dev/null +++ b/whyis/materialsmine/tests/xml/L300_S5_Nakane_1999.xml @@ -0,0 +1,571 @@ + + + L300_S5_Nakane_1999 + L300_S1_Nakane_1999 + + + + poly(vinyl alcohol) + PVA + Kuraray Co., Ltd., Japan + Poval 117 + + + + The polymer underwent resaponification with an aqueous solution of sodium hydroxide + + + Subsequently, it was dilated with pure water in a cellophane tube (Visking Tube) for 3 weeks with occasional change of water. + + + + + + silica + Tetraethoxysilane + TEOS + Shin-etsu Kagaku Co., Ltd., Japan + + + + 0.4 + + + + + + + + + Aqueous HCl was added dropwise to TEOS while stirring + stirring + + 0 + Celsius + + + + + PVA was dropped slowly into silica sol + + + + The mixture was heated in a water bath + + 50 + Celsius + + + + + + + casting + + The mixture was cast in a polystyrene Petri dish + + + + + The sol was aged in a sealed dish for 1 week at 40 C. + + + + The wet gel was dried in air and further in vacuo. + + 40 + Celsius + + atmosphere + + + + + + + (DVE-V4, Rheology Co., Ltd., Japan) + + + (RAD-rA model, Rigaku Co., Ltd., Japan) + + + (TG/DTA220, Seiko Co. Ltd., Japan) + + + + + + + + Strain + percentage + Stress + MPa + + + + Strain (%) + Stress (Mpa) + + + + 0.488947522403 + 24.9897478167 + + + 0.206702455438 + 10.2678907707 + + + 0.0792094406024 + 4.02476970038 + + + 0.458310507435 + 19.158611338 + + + 0.160242593969 + 15.5440079659 + + + 0.90212884315 + 41.2782263019 + + + 0.940644788598 + 32.5323892337 + + + 1.3802561525 + 60.5980280682 + + + 1.22448532952 + 51.9931198677 + + + 0.93220689301 + 47.4921877784 + + + 1.80212313252 + 79.3363291472 + + + 1.9786885736 + 73.9835174962 + + + 1.79906431079 + 67.1880712416 + + + 2.00943420192 + 88.0281205131 + + + 2.30809720581 + 99.0291856973 + + + 2.1881058389 + 94.3884072907 + + + 2.54316050748 + 106.063545902 + + + 2.71920844731 + 111.225327822 + + + 2.81124282387 + 115.638172539 + + + 2.90484571504 + 120.767514725 + + + + + + 52.89440172 + MPa + + + 2.492069658 + MPa + + + + + + tensile + DMA + + + + + 110 + Hz + + + + + + + + Temperature + celsius + Storage Modulus + MPa + + + + Temperature ( C) + Log E' (Mpa) + + + + 38.0465329212 + 3.62951713042 + + + 41.1492153113 + 3.60139413433 + + + 45.313920496 + 3.58634652845 + + + 49.9418732349 + 3.55952824103 + + + 54.7873185446 + 3.50450097462 + + + 59.9212066927 + 3.44325002037 + + + 64.3406431134 + 3.39307140246 + + + 69.1877057087 + 3.33854674261 + + + 75.0697865488 + 3.26409269718 + + + 80.3338691644 + 3.20564055275 + + + 85.5643379116 + 3.13581206148 + + + 90.4834820923 + 3.09517753963 + + + 94.5240895122 + 3.07403168239 + + + 99.3867867985 + 3.0412572934 + + + 104.210632809 + 3.0184046003 + + + 109.381862887 + 3.01775156902 + + + 114.299093587 + 3.03245631411 + + + 119.200619019 + 3.04024589486 + + + 124.015036887 + 3.04119158233 + + + 129.649728027 + 3.0717817723 + + + 134.068624748 + 3.0950444387 + + + 139.427533391 + 3.10422957922 + + + 144.071734062 + 3.11127216046 + + + 149.047953961 + 3.11173322539 + + + 154.026320204 + 3.09906119327 + + + 158.638213609 + 3.08738528479 + + + 163.934687276 + 3.07016161374 + + + 169.258497436 + 3.05477555369 + + + 174.054845044 + 3.02929972325 + + + 178.121525307 + 3.00637958957 + + + + + + + + tensile + DMA + + + + + 110 + Hz + + + + + + + + Temperature + celsius + Tan delta + + + + Temperature ( C) + Tan delta + + + + 40.3923865262 + 0.0698148450086 + + + 44.7061201907 + 0.0739126516004 + + + 48.6801332886 + 0.0793925956124 + + + 52.6491687439 + 0.0843243778817 + + + 55.493698125 + 0.0926799902251 + + + 56.4515950246 + 0.101814101458 + + + 58.7657750302 + 0.111554690116 + + + 62.0459712886 + 0.117231650804 + + + 64.7241421491 + 0.125653268808 + + + 67.2802181225 + 0.132542248591 + + + 71.4368416974 + 0.134117272468 + + + 75.6502167922 + 0.128146417884 + + + 79.65609227 + 0.121675747126 + + + 80.988677771 + 0.115677045359 + + + 83.6234173566 + 0.107901010469 + + + 85.6495170592 + 0.100081890008 + + + 88.5291773232 + 0.0932084402686 + + + 91.5208795315 + 0.0852404626735 + + + 94.6723589156 + 0.0786888994034 + + + 97.8870489159 + 0.0710322658122 + + + 101.863903963 + 0.0653876461836 + + + 106.100161254 + 0.0617402890742 + + + 109.898326264 + 0.0570935651093 + + + 113.081175099 + 0.0529889466358 + + + 116.786610309 + 0.0473989510695 + + + 120.39360718 + 0.0418549538968 + + + 124.683511102 + 0.0397364241021 + + + 129.048986069 + 0.0364785527375 + + + 132.831345642 + 0.034788224467 + + + 137.18434643 + 0.0339310018468 + + + 141.984760265 + 0.0333266438831 + + + 146.049891339 + 0.0320728640703 + + + 150.449107738 + 0.0317957812489 + + + 154.994578904 + 0.030870941688 + + + 159.680519372 + 0.0291449700261 + + + 163.720241257 + 0.0310376934981 + + + 167.934671384 + 0.0301753086894 + + + 171.676673058 + 0.0303633415471 + + + 175.646659745 + 0.0309686051712 + + + 179.519183292 + 0.030853661026 + + + + + + + + + + 452.3885182 + Celsius + + + 70.16129032 + Celsius + + + + + + + 50 + micrometers + + + + diff --git a/whyis/materialsmine/vocab.ttl b/whyis/materialsmine/vocab.ttl new file mode 100644 index 00000000..34e3cc1e --- /dev/null +++ b/whyis/materialsmine/vocab.ttl @@ -0,0 +1,48 @@ +@prefix : . +@prefix dc: . +@prefix np: . +@prefix owl: . +@prefix rdf: . +@prefix sio: . +@prefix xml: . +@prefix xsd: . +@prefix auth: . +@prefix foaf: . +@prefix prov: . +@prefix rdfg: . +@prefix rdfs: . +@prefix skos: . +@prefix flaskld: . +@base . +@prefix whyis: . +@prefix bibo: . + + + + a . + + rdfs:subClassOf owl:Class. + + a owl:Class; + whyis:hasConstraints "class_constraints.json"; + whyis:hasOutgoing "outgoing_class.json"; + whyis:hasIncoming "incoming_class.json"; + whyis:newInstanceView "new_instance_view.html"; + whyis:hasView "class_view.html"; + whyis:hasFacets "pnc_facets.json"; + whyis:hasFacetValues "facet_values_20210625_HARDCODED.json". + + a whyis:ChartVizGallery. + +whyis:DatasetClass a owl:Class; + rdfs:subClassOf owl:Class; + whyis:newInstanceView "dataset_new.html". + +:MetamaterialDataset a whyis:DatasetClass. +:NanomaterialDataset a whyis:DatasetClass. + +whyis:ChartVizGallery whyis:hasView "chart_gallery.html". + +:NanomaterialChart a whyis:ChartClass. +:MetamaterialChart a whyis:ChartClass. + diff --git a/whyis/materialsmine/whyis.conf b/whyis/materialsmine/whyis.conf new file mode 100644 index 00000000..3f746d8c --- /dev/null +++ b/whyis/materialsmine/whyis.conf @@ -0,0 +1,142 @@ +# -*- config:utf-8 -*- +from whyis import autonomic, importer +from materialsmine.agent import * +import whyis_unit_converter.unit_converter_agent as converter + + +SITE_NAME = "MaterialsMine" +SITE_DESCRIPTION = 'A knowledge graph for Material Informatics.' +LOD_PREFIX = 'http://materialsmine.org' +SECURITY_EMAIL_SENDER = "Whyis " +DEFAULT_LANGUAGE = 'en' +BASE_RATE_PROBABILITY = 0.5 +VOCAB_FILE = "vocab.ttl" + +# EMAIL CONFIGURATION +## MAIL_SERVER = "", +## MAIL_PORT = 587, +## MAIL_USE_TLS = True, +## MAIL_USE_SSL = False, +## MAIL_DEBUG = False, +## MAIL_USERNAME = '', +## MAIL_PASSWORD = '', +## DEFAULT_MAIL_SENDER = "Whyis ", +DEFAULT_ANONYMOUS_READ = True + +NAMESPACES = [ + importer.LinkedData( + prefix = LOD_PREFIX+'/dcat/', + url = 'http://www.w3.org/ns/dcat#%s', + headers={'Accept':'text/turtle'}, + format='turtle' + ), + importer.LinkedData( + prefix = LOD_PREFIX+'/doi/', + url = 'http://dx.doi.org/%s', + headers={'Accept':'text/turtle'}, + format='turtle', + postprocess_update= ['''insert { + graph ?g { + ?pub a . + } + } where { + graph ?g { + ?pub ?doi. + } + }''', + '''delete { + ?author ?orcid. + } insert { + graph ?g { + ?author ?orcid. + } + } where { + graph ?g { + ?author a ; + ?orcid. + } + } + '''] + ), + importer.LinkedData( + prefix = LOD_PREFIX+'/orcid/', + url = 'http://orcid.org/%s', + headers={'Accept':'application/ld+json'}, + format='json-ld', + replace=[ + ('\\"http:\\/\\/schema\\.org\\",', '{"@vocab" : "http://schema.org/"},'), + ('https://doi.org/', 'http://dx.doi.org/'), + ('https://', 'http://'), + ], + postprocess_update= ['''delete { + ?org ?p ?o. + ?s ?p ?org. + } insert { + graph ?g { + ?s ?p ?o. + } + } where { + graph ?g { + { + ?org a ; + [ + a ; + ?propertyID; + ?idValue; + ]. + ?org ?p ?o. + bind(IRI(concat("%s/organization/", str(?propertyID),"/",str(?idValue))) as ?s) + } union { + ?org a ; + [ + a ; + ?propertyID; + ?idValue; + ]. + ?s ?p ?org. + bind(IRI(concat("%s/organization/", str(?propertyID),"/",str(?idValue))) as ?o) + } + } + }''' % (LOD_PREFIX, LOD_PREFIX) , + ''' + insert { + graph ?g { + ?s ?name. + } + } where { + graph ?g { + ?s ?name. + } + } + '''] + ), + importer.LinkedData( + prefix = LOD_PREFIX+'/dbpedia/', + url = 'http://dbpedia.org/resource/%s', + headers={'Accept':'text/turtle'}, + format='turtle', + postprocess_update= '''insert { + graph ?g { + ?article ?abstract. + } + } where { + graph ?g { + ?article ?abstract. + } + } + ''' + ) +] + +INFERENCERS = { + "SDDAgent": autonomic.SDDAgent(), + "SETLr": autonomic.SETLr(), + "SETLMaker": autonomic.SETLMaker(), + "CacheUpdater" : autonomic.CacheUpdater(), + "UnitConverter": converter.UnitConverter(), + "EntityExtractor" : autonomic.nlp.EntityExtractor(), + "EntityResolver" : autonomic.nlp.EntityResolver(), +} + +INFERENCE_TASKS = [ +] diff --git a/whyis/materialsmine/wsgi.py b/whyis/materialsmine/wsgi.py new file mode 100644 index 00000000..a21ebdac --- /dev/null +++ b/whyis/materialsmine/wsgi.py @@ -0,0 +1 @@ +from whyis.wsgi import * diff --git a/whyis/materialsmine/xml_files/download_xml.py b/whyis/materialsmine/xml_files/download_xml.py new file mode 100644 index 00000000..04e22ba7 --- /dev/null +++ b/whyis/materialsmine/xml_files/download_xml.py @@ -0,0 +1,41 @@ +import os +import logging +import json +import requests +from SPARQLWrapper import JSON, SPARQLWrapper + + +def download(): + logging.basicConfig(level=logging.INFO) + endpoint = SPARQLWrapper("https://materialsmine.org/wi/sparql") + endpoint.setQuery( + """ + SELECT DISTINCT ?article WHERE { + ?doi a . + ?doi ?article . + } + """ + ) + endpoint.setReturnFormat(JSON) + results = endpoint.query().convert() + uris = [r["article"]["value"].replace("http://nanomine.org/sample/", "").replace("-", "_").title() + for r in results["results"]["bindings"]] + files = [uri + ".xml" for uri in uris] + for f in files: + if (os.path.exists(f)): + logging.info("File " + f + " already exists, skipping") + else: + logging.debug("Downloading file " + str(f)) + r = requests.get("http://nanomine.org/nmr/xml/" + f) + try: + j = json.loads(r.text) + xml_str = j["data"][0]["xml_str"] + with open(f, "w") as outfile: + outfile.write(xml_str) + except Exception as e: + logging.error("Something went wrong with file " + f) + logging.error(e) + + +if __name__ == "__main__": + download() From a5e6c77b3f98bcea90eda55c36289d1e4de415bf Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Mon, 31 Jan 2022 15:01:00 -0500 Subject: [PATCH 2/8] Switched to a moduler container approach. --- whyis/Dockerfile | 21 +++- whyis/Dockerfile.dev | 26 +++- whyis/docker-compose.yml | 41 ++++++- whyis/materialsmine/install_files/system.conf | 3 +- whyis/materialsmine/requirements.txt | 115 +----------------- whyis/materialsmine/script/setup | 76 ++++++------ whyis/materialsmine/system.conf | 52 ++++++++ 7 files changed, 163 insertions(+), 171 deletions(-) create mode 100644 whyis/materialsmine/system.conf diff --git a/whyis/Dockerfile b/whyis/Dockerfile index 6f3b7ef5..05a32b67 100644 --- a/whyis/Dockerfile +++ b/whyis/Dockerfile @@ -1,6 +1,15 @@ -FROM alpine -RUN apk update && apk add --no-cache python3 py3-pip -RUN alias python=python3 -WORKDIR '/app' -COPY . . -CMD [ "python3" ] \ No newline at end of file +FROM jrei/systemd-ubuntu:20.04 +RUN apt-get update && apt-get install -y software-properties-common gcc + +RUN apt-get update && apt-get install -y \ + python3.8-distutils \ + python3.8-dev \ + python3-pip \ + python3.8-venv \ + curl \ + libdb5.3-dev \ + default-jdk-headless +RUN python3.8 -m pip install requests wheel gunicorn +RUN python3.8 -m pip install whyis==2.0a5 whyis-unit-converter==0.0.2 +WORKDIR '/apps/materialsmine' +CMD [ "/bin/bash" ] diff --git a/whyis/Dockerfile.dev b/whyis/Dockerfile.dev index 6d179908..ff840898 100644 --- a/whyis/Dockerfile.dev +++ b/whyis/Dockerfile.dev @@ -1,9 +1,23 @@ -FROM ubuntu:20.04 -RUN apt-get update && apt-get install -y software-properties-common gcc && \ - add-apt-repository -y ppa:deadsnakes/ppa +FROM jrei/systemd-ubuntu:20.04 +RUN apt-get update && apt-get install -y software-properties-common gcc -RUN apt-get update && apt-get install -y python3.9 python3.9-distutils python3.9-dev python3-pip curl libdb5.3-dev default-jdk-headless -RUN python3.9 -m pip install requests wheel -RUN python3.9 -m pip install whyis==2.0a4 +RUN apt-get update && apt-get install -y \ + python3.8-distutils \ + apache2-dev \ + apache2 \ + python3.8-dev \ + python3-pip \ + python3.8-venv \ + curl \ + libdb5.3-dev \ + default-jdk-headless +WORKDIR '/apps' +RUN python3.8 -m venv /opt/venv +RUN sh -c ". /opt/venv/bin/activate && pip install requests wheel" +RUN useradd --system whyis +RUN sh -c ". /opt/venv/bin/activate && pip install whyis==2.0a4 mod-wsgi==4.9.0 whyis-unit-converter==0.0.2" +COPY materialsmine /opt/materialsmine +RUN sh -c ". /opt/venv/bin/activate && cd /opt/materialsmine && whyis init" +RUN sh -c ". /opt/venv/bin/activate && cd /opt/materialsmine && ./script/setup" WORKDIR '/apps' CMD [ "/bin/bash" ] diff --git a/whyis/docker-compose.yml b/whyis/docker-compose.yml index a1d0a9ba..7a6b93a9 100644 --- a/whyis/docker-compose.yml +++ b/whyis/docker-compose.yml @@ -1,13 +1,48 @@ version: '3' services: + redis: + image: "redis:alpine" + command: redis-server + volumes: + - $PWD/redis-data:/var/lib/redis + ports: + - '6379:6379' + celery: + command: celery -A wsgi.celery worker -l INFO -c 4 --logfile logs/celery.log + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: Dockerfile + volumes: + - $PWD:/apps + celerybeat: + command: celery -A wsgi.celery beat -l INFO -c 4 --logfile logs/celerybeat.log + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: Dockerfile + volumes: + - $PWD:/apps + fuseki: + command: whyis fuseki + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: Dockerfile + volumes: + - $PWD:/apps web: stdin_open: true + command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} environment: - CHOKIDAR_USEPOLLING=true build: context: . - dockerfile: Dockerfile.dev + dockerfile: Dockerfile ports: - - '5000:5000' + - '8081:5000' volumes: - - .:/apps \ No newline at end of file + - $PWD:/apps diff --git a/whyis/materialsmine/install_files/system.conf b/whyis/materialsmine/install_files/system.conf index 30415fab..b7a537ec 100644 --- a/whyis/materialsmine/install_files/system.conf +++ b/whyis/materialsmine/install_files/system.conf @@ -1,7 +1,8 @@ import logging from datetime import datetime, timedelta -from authenticator import JWTAuthenticator +from whyis.authenticator import JWTAuthenticator +import os authenticator_config = [] # set into config dict later authenticator_secret = os.environ.get('NM_GRAPH_AUTH_SECRET', None) diff --git a/whyis/materialsmine/requirements.txt b/whyis/materialsmine/requirements.txt index 49b64393..f34f8068 100644 --- a/whyis/materialsmine/requirements.txt +++ b/whyis/materialsmine/requirements.txt @@ -1,117 +1,4 @@ -amqp==5.0.6 -an-example-pypi-project==0.0.4 -anyascii==0.3.0 -arrow==1.2.1 -Babel==2.9.1 -beautifulsoup4==4.7.1 -bibtexparser==1.1.0 -billiard==3.6.4.0 -binaryornot==0.4.4 -bleach==4.1.0 -blinker==1.4 -bsddb3==6.2.6 -celery==5.1.2 -celery-once==3.0.1 -certifi==2021.10.8 -chardet==4.0.0 -charset-normalizer==2.0.8 -click==7.1.2 -click-didyoumean==0.3.0 -click-plugins==1.1.1 -click-repl==0.2.0 -colorama==0.4.4 -cookiecutter==1.7.3 -Cython==0.29.24 -Deprecated==1.2.13 -dnspython==2.1.0 -docutils==0.18.1 -email-validator==1.1.3 -et-xmlfile==1.1.0 -eventlet==0.33.0 -filedepot==0.8.0 -Flask==1.1.4 -Flask-BabelEx==0.9.4 -Flask-Caching==1.10.1 -Flask-Login==0.5.0 -Flask-Mail==0.9.1 -Flask-Principal==0.4.0 -Flask-Script==2.0.6 -Flask-Security==3.0.0 -Flask-WTF==0.14.3 -future==0.18.2 -greenlet==1.1.2 -html5lib==1.1 -idna==3.3 -ijson==2.4 -importlib-metadata==4.8.2 -isodate==0.6.0 -itsdangerous==1.1.0 -Jinja2==2.11.3 -jinja2-time==0.2.0 -joblib==1.1.0 -keepalive==0.1.1 -keyring==23.4.0 -kombu==5.2.2 -lptrace==1.0.0 -lxml==4.6.4 -Markdown==3.3.6 -MarkupSafe==2.0.1 -mod-wsgi==4.9.0 -nltk==3.6.5 -nose==1.3.7 -numpy==1.21.4 -openpyxl==3.0.9 -packaging==21.3 -pandas==1.3.4 -passlib==1.7.4 -pip==21.3.1 -pkginfo==1.8.2 -poyo==0.5.0 -prompt-toolkit==3.0.23 -psutil==5.8.0 -Pygments==2.10.0 -PyJWT==2.3.0 -pyparsing==3.0.6 -pyshp==2.1.3 -python-dateutil==2.8.2 -python-magic==0.4.24 -python-slugify==5.0.2 -pytidylib==0.3.2 -pytz==2021.3 -rdflib==6.0.2 -rdflib-jsonld==0.6.2 -readme-renderer==32.0 -redis==4.0.2 -redislite==6.0.674960 -regex==2021.11.10 -requests==2.26.0 -requests-testadapter==0.3.0 -requests-toolbelt==0.9.1 -rfc3986==1.5.0 -sadi==0.5.7 -scipy==1.7.3 -sdd2rdf==0.1.6 -setlr==0.2.18 -setuptools==60.3.1 -six==1.16.0 -soupsieve==2.3.1 -speaklater==1.3 -text-unidecode==1.3 -toposort==1.7 -tqdm==4.62.3 -twine==3.7.1 -urllib3==1.26.7 -vine==5.0.0 -wcwidth==0.2.5 -webencodings==0.5.1 -WebOb==1.8.7 -Werkzeug==1.0.1 -wheel==0.37.0 -whyis==2.0a1 -wrapt==1.13.3 -WTForms==3.0.0 -xlrd==2.0.1 -zipp==3.6.0 +whyis==2.0a4 mod-wsgi==4.9.0 whyis-unit-converter==0.0.2 diff --git a/whyis/materialsmine/script/setup b/whyis/materialsmine/script/setup index bacd5a5e..a7409e68 100755 --- a/whyis/materialsmine/script/setup +++ b/whyis/materialsmine/script/setup @@ -3,24 +3,20 @@ # exit when any command fails set -e -sudo apt-get update -sudo apt-get install -y software-properties-common - export CURRENT_USER=$(id -u -n) -export WHYIS_USER=${WHYIS_USER:-$CURRENT_USER} +export WHYIS_USER=whyis export WHYIS_GROUP=${WHYIS_GROUP:-whyis} -export WHYIS_HOME=${WHYIS_HOME:-/home/$WHYIS_USER} +export WHYIS_HOME=/opt/materialsmine export FUSEKI_SERVER=`which fuseki-server` export FUSEKI_HOME=$PWD/fuseki export WHYIS_APP_HOME=$PWD export PYTHON_HOME=$(python -c 'import sys; print(sys.prefix)') +groupadd -f $WHYIS_GROUP +usermod -a -G $WHYIS_GROUP $WHYIS_USER -sudo groupadd -f $WHYIS_GROUP -sudo usermod -a -G $WHYIS_GROUP $WHYIS_USER - -sudo apt-get install -y apache2-dev \ +apt-get install -y apache2-dev \ unzip \ zip \ default-jdk \ @@ -36,18 +32,20 @@ sudo apt-get install -y apache2-dev \ libdb5.3-dev \ python3-dev -mkdir -p $WHYIS_APP_HOME/data/nanopublications -mkdir -p $WHYIS_APP_HOME/fuseki -mkdir -p $WHYIS_APP_HOME/data/files -mkdir -p $WHYIS_APP_HOME/celery +pip install -r $WHYIS_HOME/requirements.txt -sudo mkdir -p /var/log/celery -sudo chown -R $WHYIS_USER /var/log/celery -sudo mkdir -p /var/run/celery -sudo chown -R $WHYIS_USER /var/run/celery +mkdir -p $WHYIS_HOME/data/nanopublications +mkdir -p $WHYIS_HOME/fuseki +mkdir -p $WHYIS_HOME/data/files +mkdir -p $WHYIS_HOME/celery -sudo mkdir -p /var/log/whyis -sudo chown -R $WHYIS_USER /var/log/whyis +mkdir -p /var/log/celery +chown -R $WHYIS_USER /var/log/celery +mkdir -p /var/run/celery +chown -R $WHYIS_USER /var/run/celery + +mkdir -p /var/log/whyis +chown -R $WHYIS_USER /var/log/whyis # These are here to re-substitute these variables back into the # script, while rewriting the ones we need to. @@ -61,37 +59,33 @@ export CELERYD_OPTS='${CELERYD_OPTS}' # configure celery -sudo mkdir -p /etc/conf.d -sudo -E sh -c "envsubst < $PWD/install_files/etc/conf.d/celery \ - > /etc/conf.d/celery" -sudo -E sh -c "envsubst < $PWD/install_files/celerybeat.service \ - > /etc/systemd/system/celerybeat.service" -sudo -E sh -c "envsubst < $PWD/install_files/celery.service \ - > /etc/systemd/system/celery.service" - -# Initialize the fuseki datasets if they aren't already set up. -whyis init +mkdir -p /etc/conf.d +envsubst < $PWD/install_files/etc/conf.d/celery > /etc/conf.d/celery +envsubst < $PWD/install_files/celerybeat.service > /etc/systemd/system/celerybeat.service +envsubst < $PWD/install_files/celery.service > /etc/systemd/system/celery.service +systemctl enable celery.service +systemctl enable celerybeat.service envsubst < install_files/system.conf > system.conf # enable wsgi export WSGI_EXPRESS=$(which mod_wsgi-express) -sudo sh -c "$WSGI_EXPRESS module-config > /etc/apache2/mods-available/wsgi.load" -sudo a2enmod wsgi -sudo a2enmod headers -sudo -E sh -c "envsubst < $PWD/install_files/etc/apache2/sites-available/000-default.conf \ - > /etc/apache2/sites-available/000-default.conf" +$WSGI_EXPRESS module-config > /etc/apache2/mods-available/wsgi.load +a2enmod wsgi +a2enmod headers +envsubst < $PWD/install_files/etc/apache2/sites-available/000-default.conf \ + > /etc/apache2/sites-available/000-default.conf # set up fuseki -sudo -E sh -c "envsubst < $PWD/install_files/fuseki.service \ - > /etc/systemd/system/fuseki.service" +envsubst < $PWD/install_files/fuseki.service > /etc/systemd/system/fuseki.service -sudo systemctl enable fuseki.service +systemctl enable fuseki.service # start services -sudo service apache2 restart -sudo service celery restart -sudo service celerybeat restart -sudo service fuseki start +service apache2 start +service redis-server start +systemctl start celery +systemctl start celerybeat +systemctl start fuseki echo "Complete!" diff --git a/whyis/materialsmine/system.conf b/whyis/materialsmine/system.conf new file mode 100644 index 00000000..109fcb35 --- /dev/null +++ b/whyis/materialsmine/system.conf @@ -0,0 +1,52 @@ +import logging +from datetime import datetime, timedelta + +from whyis.authenticator import JWTAuthenticator +import os + +authenticator_config = [] # set into config dict later +authenticator_secret = os.environ.get('NM_GRAPH_AUTH_SECRET', None) +if authenticator_secret: + authenticator_config.append(JWTAuthenticator(key=authenticator_secret)) + +AUTHENTICATORS = authenticator_config + +DEBUG=False + +# LOGGING +LOGGER_NAME = "whyis_log" +LOG_FILENAME = "/var/log/whyis/output-whyis-%s.log" % (str(datetime.now()).replace(' ','_')) +LOG_LEVEL = logging.INFO +LOG_FORMAT = "%(asctime)s %(levelname)s\t: %(message)s" # used by logging.Formatter + +PERMANENT_SESSION_LIFETIME = timedelta(days=7) +# EMAIL CONFIGURATION +## MAIL_SERVER = "smtp.mailgun.org" +## MAIL_PORT = 587 +## MAIL_USE_TLS = True +## MAIL_USE_SSL = False +## MAIL_DEBUG = False +## MAIL_USERNAME = '' +## MAIL_PASSWORD = '' +## DEFAULT_MAIL_SENDER = "Whyis Admin " +EMBEDDED_FUSEKI = False +ADMIN_ENDPOINT = 'http://localhost:3030/admin/sparql' + +KNOWLEDGE_ENDPOINT = 'http://localhost:3030/knowledge/sparql' + +EMBEDDED_CELERY = False +CELERY_BROKER_URL = 'redis://localhost:6379/0' +CELERY_RESULT_BACKEND = 'redis://localhost:6379/0' + +NANOPUB_ARCHIVE = { + 'depot.storage_path' : "nanopublications", +} +FILE_ARCHIVE = { + 'cache_max_age' : 3600*24*7, + 'depot.storage_path' : 'files' +} +CACHE_TYPE = "redis" # Flask-Caching related configs +CACHE_KEY_PREFIX = 'whyis_cache_' +CACHE_REDIS_URL = 'redis://localhost:6379/0' +CACHE_DEFAULT_TIMEOUT = 0 +MULTIUSER = True From 483e9301326358292d24eaa666fe5780fdc7f063 Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Mon, 31 Jan 2022 17:52:03 -0500 Subject: [PATCH 3/8] Integrated with main project --- docker-compose.yml | 57 ++++++++++++++++++++++- nginx/default.conf | 16 +++---- whyis/Dockerfile | 3 +- whyis/docker-compose.yml | 27 +++++++---- whyis/materialsmine/run/log4j2.properties | 18 +++---- whyis/materialsmine/system.conf | 10 ++-- whyis/materialsmine/whyis.conf | 4 +- 7 files changed, 99 insertions(+), 36 deletions(-) diff --git a/docker-compose.yml b/docker-compose.yml index 5035bee8..8016c35d 100644 --- a/docker-compose.yml +++ b/docker-compose.yml @@ -49,5 +49,60 @@ services: volumes: - /app/node_modules - ./app:/app + redis: + image: "redis:alpine" + command: redis-server + volumes: + - ./redis-data:/var/lib/redis + ports: + - '6379:6379' + celery: + depends_on: + - redis + - fuseki + command: celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: whyis/Dockerfile + volumes: + - ./whyis/materialsmine:/app + celerybeat: + depends_on: + - redis + - fuseki + command: celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: whyis/Dockerfile + volumes: + - ./whyis/materialsmine:/app + fuseki: + command: fuseki-server --mem /ds + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: whyis/Dockerfile + volumes: + - ./whyis/materialsmine:/app + whyis: + depends_on: + - redis + - fuseki + stdin_open: true + command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 + environment: + - CHOKIDAR_USEPOLLING=true + build: + context: . + dockerfile: whyis/Dockerfile + ports: + - '8000:8000' + volumes: + - ./whyis/materialsmine:/app volumes: - mockDB: \ No newline at end of file + mockDB: diff --git a/nginx/default.conf b/nginx/default.conf index facee883..224a43e9 100644 --- a/nginx/default.conf +++ b/nginx/default.conf @@ -6,9 +6,9 @@ upstream api { server api:3000; } -# upstream whyis { -# server whyis:5000; -# } +upstream whyis { + server whyis:8000; +} server { listen 80; @@ -29,8 +29,8 @@ server { proxy_pass http://api; } - # location /whyis { - # rewrite /whyis/(.*) /$1 break; - # proxy_pass http://whyis; - # } -} \ No newline at end of file + location /whyis { + rewrite /whyis/(.*) /$1 break; + proxy_pass http://whyis; + } +} diff --git a/whyis/Dockerfile b/whyis/Dockerfile index 05a32b67..a2d4910f 100644 --- a/whyis/Dockerfile +++ b/whyis/Dockerfile @@ -11,5 +11,6 @@ RUN apt-get update && apt-get install -y \ default-jdk-headless RUN python3.8 -m pip install requests wheel gunicorn RUN python3.8 -m pip install whyis==2.0a5 whyis-unit-converter==0.0.2 -WORKDIR '/apps/materialsmine' +WORKDIR '/app' +RUN whyis init CMD [ "/bin/bash" ] diff --git a/whyis/docker-compose.yml b/whyis/docker-compose.yml index 7a6b93a9..61120d87 100644 --- a/whyis/docker-compose.yml +++ b/whyis/docker-compose.yml @@ -4,45 +4,52 @@ services: image: "redis:alpine" command: redis-server volumes: - - $PWD/redis-data:/var/lib/redis + - ./redis-data:/var/lib/redis ports: - '6379:6379' celery: - command: celery -A wsgi.celery worker -l INFO -c 4 --logfile logs/celery.log + depends_on: + - redis + - fuseki + command: celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup environment: - CHOKIDAR_USEPOLLING=true build: context: . dockerfile: Dockerfile volumes: - - $PWD:/apps + - ./materialsmine:/app celerybeat: - command: celery -A wsgi.celery beat -l INFO -c 4 --logfile logs/celerybeat.log + - redis + - fuseki + command: celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup environment: - CHOKIDAR_USEPOLLING=true build: context: . dockerfile: Dockerfile volumes: - - $PWD:/apps + - ./materialsmine:/app fuseki: - command: whyis fuseki + command: fuseki-server --mem /ds environment: - CHOKIDAR_USEPOLLING=true build: context: . dockerfile: Dockerfile volumes: - - $PWD:/apps + - ./materialsmine:/app web: + - redis + - fuseki stdin_open: true - command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} + command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 environment: - CHOKIDAR_USEPOLLING=true build: context: . dockerfile: Dockerfile ports: - - '8081:5000' + - '8000:8000' volumes: - - $PWD:/apps + - ./materialsmine:/app diff --git a/whyis/materialsmine/run/log4j2.properties b/whyis/materialsmine/run/log4j2.properties index 37f97599..4d0691b3 100644 --- a/whyis/materialsmine/run/log4j2.properties +++ b/whyis/materialsmine/run/log4j2.properties @@ -17,31 +17,31 @@ rootLogger.level = WARN rootLogger.appenderRef.stdout.ref = OUT logger.jena.name = org.apache.jena -logger.jena.level = WARN +logger.jena.level = INFO logger.arq-exec.name = org.apache.jena.arq.exec -logger.arq-exec.level = WARN +logger.arq-exec.level = INFO logger.arq-info.name = org.apache.jena.arq.exec -logger.arq-info.level = WARN +logger.arq-info.level = INFO logger.riot.name = org.apache.jena.riot -logger.riot.level = WARN +logger.riot.level = INFO logger.fuseki.name = org.apache.jena.fuseki -logger.fuseki.level = WARN +logger.fuseki.level = INFO logger.fuseki-fuseki.name = org.apache.jena.fuseki.Fuseki -logger.fuseki-fuseki.level = WARN +logger.fuseki-fuseki.level = INFO logger.fuseki-server.name = org.apache.jena.fuseki.Server -logger.fuseki-server.level = WARN +logger.fuseki-server.level = INFO logger.fuseki-config.name = org.apache.jena.fuseki.Config -logger.fuseki-config.level = WARN +logger.fuseki-config.level = INFO logger.fuseki-admin.name = org.apache.jena.fuseki.Admin -logger.fuseki-admin.level = WARN +logger.fuseki-admin.level = INFO logger.jetty.name = org.eclipse.jetty logger.jetty.level = WARN diff --git a/whyis/materialsmine/system.conf b/whyis/materialsmine/system.conf index 109fcb35..b689f827 100644 --- a/whyis/materialsmine/system.conf +++ b/whyis/materialsmine/system.conf @@ -30,13 +30,13 @@ PERMANENT_SESSION_LIFETIME = timedelta(days=7) ## MAIL_PASSWORD = '' ## DEFAULT_MAIL_SENDER = "Whyis Admin " EMBEDDED_FUSEKI = False -ADMIN_ENDPOINT = 'http://localhost:3030/admin/sparql' +ADMIN_ENDPOINT = 'http://fuseki:3030/admin/sparql' -KNOWLEDGE_ENDPOINT = 'http://localhost:3030/knowledge/sparql' +KNOWLEDGE_ENDPOINT = 'http://fuseki:3030/knowledge/sparql' EMBEDDED_CELERY = False -CELERY_BROKER_URL = 'redis://localhost:6379/0' -CELERY_RESULT_BACKEND = 'redis://localhost:6379/0' +CELERY_BROKER_URL = 'redis://redis:6379/0' +CELERY_RESULT_BACKEND = 'redis://redis:6379/0' NANOPUB_ARCHIVE = { 'depot.storage_path' : "nanopublications", @@ -47,6 +47,6 @@ FILE_ARCHIVE = { } CACHE_TYPE = "redis" # Flask-Caching related configs CACHE_KEY_PREFIX = 'whyis_cache_' -CACHE_REDIS_URL = 'redis://localhost:6379/0' +CACHE_REDIS_URL = 'redis://redis:6379/0' CACHE_DEFAULT_TIMEOUT = 0 MULTIUSER = True diff --git a/whyis/materialsmine/whyis.conf b/whyis/materialsmine/whyis.conf index 3f746d8c..0233afaf 100644 --- a/whyis/materialsmine/whyis.conf +++ b/whyis/materialsmine/whyis.conf @@ -134,8 +134,8 @@ INFERENCERS = { "SETLMaker": autonomic.SETLMaker(), "CacheUpdater" : autonomic.CacheUpdater(), "UnitConverter": converter.UnitConverter(), - "EntityExtractor" : autonomic.nlp.EntityExtractor(), - "EntityResolver" : autonomic.nlp.EntityResolver(), + #"EntityExtractor" : autonomic.nlp.EntityExtractor(), + #"EntityResolver" : autonomic.nlp.EntityResolver(), } INFERENCE_TASKS = [ From 817671df0a5e5910186657255f897bc276413ce1 Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Mon, 31 Jan 2022 18:02:40 -0500 Subject: [PATCH 4/8] ngnix now connecting, but there's an auth setup issue in whyis to take care of. --- docker-compose.yml | 2 +- whyis/materialsmine/system.conf | 1 + 2 files changed, 2 insertions(+), 1 deletion(-) diff --git a/docker-compose.yml b/docker-compose.yml index 8016c35d..45c6dde8 100644 --- a/docker-compose.yml +++ b/docker-compose.yml @@ -94,7 +94,7 @@ services: - redis - fuseki stdin_open: true - command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 + command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 environment: - CHOKIDAR_USEPOLLING=true build: diff --git a/whyis/materialsmine/system.conf b/whyis/materialsmine/system.conf index b689f827..b6094869 100644 --- a/whyis/materialsmine/system.conf +++ b/whyis/materialsmine/system.conf @@ -7,6 +7,7 @@ import os authenticator_config = [] # set into config dict later authenticator_secret = os.environ.get('NM_GRAPH_AUTH_SECRET', None) if authenticator_secret: + print("Adding JWT authenticator") authenticator_config.append(JWTAuthenticator(key=authenticator_secret)) AUTHENTICATORS = authenticator_config From 6172d3a5774c8918bec22c7c524932925b60b9b9 Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Mon, 7 Feb 2022 16:07:00 -0500 Subject: [PATCH 5/8] Trying to debug CSRF --- docker-compose.yml | 38 ++++--------- whyis/Dockerfile | 9 +-- whyis/Dockerfile.dev | 17 ++---- whyis/docker-compose.yml | 43 +++++++------- whyis/materialsmine/run/log4j2.properties | 68 ----------------------- whyis/materialsmine/system.conf | 4 +- whyis/materialsmine/vocab.ttl | 3 +- whyis/materialsmine/whyis.conf | 4 +- 8 files changed, 53 insertions(+), 133 deletions(-) delete mode 100644 whyis/materialsmine/run/log4j2.properties diff --git a/docker-compose.yml b/docker-compose.yml index 45c6dde8..cb152a81 100644 --- a/docker-compose.yml +++ b/docker-compose.yml @@ -53,56 +53,42 @@ services: image: "redis:alpine" command: redis-server volumes: - - ./redis-data:/var/lib/redis - ports: - - '6379:6379' + - ./mockDB/redis-data:/var/lib/redis celery: depends_on: - redis - fuseki - command: celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup + command: /opt/venv/bin/celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup environment: - CHOKIDAR_USEPOLLING=true - build: - context: . - dockerfile: whyis/Dockerfile - volumes: - - ./whyis/materialsmine:/app + build: ./whyis celerybeat: depends_on: - redis - fuseki - command: celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup + command: /opt/venv/bin/celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup environment: - CHOKIDAR_USEPOLLING=true - build: - context: . - dockerfile: whyis/Dockerfile - volumes: - - ./whyis/materialsmine:/app + build: ./whyis fuseki: - command: fuseki-server --mem /ds + command: /opt/venv/bin/whyis fuseki # ; /opt/venv/bin/fuseki-server --mem /ds environment: - CHOKIDAR_USEPOLLING=true - build: - context: . - dockerfile: whyis/Dockerfile + build: ./whyis + ports: + - '3030:3030' volumes: - - ./whyis/materialsmine:/app + - ./mockDB/fuseki:/app/run whyis: depends_on: - redis - fuseki stdin_open: true - command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 + command: /opt/venv/bin/gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 environment: - CHOKIDAR_USEPOLLING=true - build: - context: . - dockerfile: whyis/Dockerfile + build: ./whyis ports: - '8000:8000' - volumes: - - ./whyis/materialsmine:/app volumes: mockDB: diff --git a/whyis/Dockerfile b/whyis/Dockerfile index a2d4910f..6fd76672 100644 --- a/whyis/Dockerfile +++ b/whyis/Dockerfile @@ -1,4 +1,4 @@ -FROM jrei/systemd-ubuntu:20.04 +FROM ubuntu:20.04 RUN apt-get update && apt-get install -y software-properties-common gcc RUN apt-get update && apt-get install -y \ @@ -9,8 +9,9 @@ RUN apt-get update && apt-get install -y \ curl \ libdb5.3-dev \ default-jdk-headless -RUN python3.8 -m pip install requests wheel gunicorn -RUN python3.8 -m pip install whyis==2.0a5 whyis-unit-converter==0.0.2 +RUN python3.8 -m venv /opt/venv +RUN /opt/venv/bin/pip install requests>=2.27.1 wheel gunicorn +RUN /opt/venv/bin/pip install whyis==2.0a7 whyis-unit-converter==0.0.2 +COPY /materialsmine /app WORKDIR '/app' -RUN whyis init CMD [ "/bin/bash" ] diff --git a/whyis/Dockerfile.dev b/whyis/Dockerfile.dev index ff840898..fccb9b6f 100644 --- a/whyis/Dockerfile.dev +++ b/whyis/Dockerfile.dev @@ -1,23 +1,18 @@ -FROM jrei/systemd-ubuntu:20.04 +FROM ubuntu:20.04 as dependencies RUN apt-get update && apt-get install -y software-properties-common gcc RUN apt-get update && apt-get install -y \ python3.8-distutils \ - apache2-dev \ - apache2 \ python3.8-dev \ python3-pip \ python3.8-venv \ curl \ libdb5.3-dev \ default-jdk-headless -WORKDIR '/apps' RUN python3.8 -m venv /opt/venv -RUN sh -c ". /opt/venv/bin/activate && pip install requests wheel" -RUN useradd --system whyis -RUN sh -c ". /opt/venv/bin/activate && pip install whyis==2.0a4 mod-wsgi==4.9.0 whyis-unit-converter==0.0.2" -COPY materialsmine /opt/materialsmine -RUN sh -c ". /opt/venv/bin/activate && cd /opt/materialsmine && whyis init" -RUN sh -c ". /opt/venv/bin/activate && cd /opt/materialsmine && ./script/setup" -WORKDIR '/apps' +RUN /opt/venv/bin/pip install requests>=2.27.1 wheel gunicorn +COPY ./whyis /opt/whyis +RUN /opt/venv/bin/pip install -e /opt/whyis +RUN /opt/venv/bin/pip install whyis-unit-converter==0.0.2 +WORKDIR '/app' CMD [ "/bin/bash" ] diff --git a/whyis/docker-compose.yml b/whyis/docker-compose.yml index 61120d87..1bc0f1b7 100644 --- a/whyis/docker-compose.yml +++ b/whyis/docker-compose.yml @@ -4,52 +4,57 @@ services: image: "redis:alpine" command: redis-server volumes: - - ./redis-data:/var/lib/redis - ports: - - '6379:6379' + - ./mockDB/redis-data:/var/lib/redis celery: depends_on: - redis - fuseki - command: celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup + command: /opt/venv/bin/celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup + volumes: + - ./materialsmine:/app + - ./whyis:/opt/whyis environment: - CHOKIDAR_USEPOLLING=true build: + dockerfile: Dockerfile.dev context: . - dockerfile: Dockerfile - volumes: - - ./materialsmine:/app celerybeat: + depends_on: - redis - fuseki - command: celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup + command: /opt/venv/bin/celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup + volumes: + - ./materialsmine:/app + - ./whyis:/opt/whyis environment: - CHOKIDAR_USEPOLLING=true build: + dockerfile: Dockerfile.dev context: . - dockerfile: Dockerfile - volumes: - - ./materialsmine:/app fuseki: - command: fuseki-server --mem /ds + command: /opt/venv/bin/whyis fuseki # ; /opt/venv/bin/fuseki-server --mem /ds environment: - CHOKIDAR_USEPOLLING=true build: + dockerfile: Dockerfile.dev context: . - dockerfile: Dockerfile + ports: + - '3030:3030' volumes: - - ./materialsmine:/app - web: + - ./mockDB/fuseki:/app/run + whyis: + depends_on: - redis - fuseki stdin_open: true - command: gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 + command: /bin/bash #/opt/venv/bin/gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 environment: - CHOKIDAR_USEPOLLING=true build: + dockerfile: Dockerfile.dev context: . - dockerfile: Dockerfile - ports: - - '8000:8000' volumes: - ./materialsmine:/app + - ./whyis:/opt/whyis + ports: + - '5000:5000' diff --git a/whyis/materialsmine/run/log4j2.properties b/whyis/materialsmine/run/log4j2.properties deleted file mode 100644 index 4d0691b3..00000000 --- a/whyis/materialsmine/run/log4j2.properties +++ /dev/null @@ -1,68 +0,0 @@ -## Licensed under the terms of http://www.apache.org/licenses/LICENSE-2.0 -status = error -name = PropertiesConfig -filters = threshold - -filter.threshold.type = ThresholdFilter -filter.threshold.level = ALL - -appender.console.type = Console -appender.console.name = OUT -appender.console.target = SYSTEM_ERR -appender.console.layout.type = PatternLayout -appender.console.layout.pattern = %d{HH:mm:ss} %-5p %-15c{1} :: %m%n -#appender.console.layout.pattern = [%d{yyyy-MM-dd HH:mm:ss}] %-5p %-15c{1} :: %m%n - -rootLogger.level = WARN -rootLogger.appenderRef.stdout.ref = OUT - -logger.jena.name = org.apache.jena -logger.jena.level = INFO - -logger.arq-exec.name = org.apache.jena.arq.exec -logger.arq-exec.level = INFO - -logger.arq-info.name = org.apache.jena.arq.exec -logger.arq-info.level = INFO - -logger.riot.name = org.apache.jena.riot -logger.riot.level = INFO - -logger.fuseki.name = org.apache.jena.fuseki -logger.fuseki.level = INFO - -logger.fuseki-fuseki.name = org.apache.jena.fuseki.Fuseki -logger.fuseki-fuseki.level = INFO - -logger.fuseki-server.name = org.apache.jena.fuseki.Server -logger.fuseki-server.level = INFO - -logger.fuseki-config.name = org.apache.jena.fuseki.Config -logger.fuseki-config.level = INFO - -logger.fuseki-admin.name = org.apache.jena.fuseki.Admin -logger.fuseki-admin.level = INFO - -logger.jetty.name = org.eclipse.jetty -logger.jetty.level = WARN - -# May be useful to turn up to DEBUG if debugging HTTP communication issues -logger.apache-http.name = org.apache.http -logger.apache-http.level = WARN - -logger.shiro.name = org.apache.shiro -logger.shiro.level = WARN -# Hide bug in Shiro 1.5.0 -logger.shiro-realm.name = org.apache.shiro.realm.text.IniRealm -logger.shiro-realm.level = ERROR - -# This goes out in NCSA format -appender.plain.type = Console -appender.plain.name = PLAIN -appender.plain.layout.type = PatternLayout -appender.plain.layout.pattern = %m%n - -logger.fuseki-request.name = org.apache.jena.fuseki.Request -logger.fuseki-request.additivity = false -logger.fuseki-request.level = OFF -logger.fuseki-request.appenderRef.plain.ref = PLAIN diff --git a/whyis/materialsmine/system.conf b/whyis/materialsmine/system.conf index b6094869..97de1e10 100644 --- a/whyis/materialsmine/system.conf +++ b/whyis/materialsmine/system.conf @@ -40,11 +40,11 @@ CELERY_BROKER_URL = 'redis://redis:6379/0' CELERY_RESULT_BACKEND = 'redis://redis:6379/0' NANOPUB_ARCHIVE = { - 'depot.storage_path' : "nanopublications", + 'depot.storage_path' : "run/nanopublications", } FILE_ARCHIVE = { 'cache_max_age' : 3600*24*7, - 'depot.storage_path' : 'files' + 'depot.storage_path' : 'run/files' } CACHE_TYPE = "redis" # Flask-Caching related configs CACHE_KEY_PREFIX = 'whyis_cache_' diff --git a/whyis/materialsmine/vocab.ttl b/whyis/materialsmine/vocab.ttl index 34e3cc1e..8cef719d 100644 --- a/whyis/materialsmine/vocab.ttl +++ b/whyis/materialsmine/vocab.ttl @@ -32,7 +32,7 @@ whyis:hasFacets "pnc_facets.json"; whyis:hasFacetValues "facet_values_20210625_HARDCODED.json". - a whyis:ChartVizGallery. + a whyis:ChartVizGallery. whyis:DatasetClass a owl:Class; rdfs:subClassOf owl:Class; @@ -45,4 +45,3 @@ whyis:ChartVizGallery whyis:hasView "chart_gallery.html". :NanomaterialChart a whyis:ChartClass. :MetamaterialChart a whyis:ChartClass. - diff --git a/whyis/materialsmine/whyis.conf b/whyis/materialsmine/whyis.conf index 0233afaf..9b65557c 100644 --- a/whyis/materialsmine/whyis.conf +++ b/whyis/materialsmine/whyis.conf @@ -22,7 +22,9 @@ VOCAB_FILE = "vocab.ttl" ## MAIL_PASSWORD = '', ## DEFAULT_MAIL_SENDER = "Whyis ", DEFAULT_ANONYMOUS_READ = True - +WHYIS_TEMPLATE_DIR = 'templates' +WHYIS_CDN_DIR = 'static' +EXPLAIN_TEMPLATE_LOADING = True NAMESPACES = [ importer.LinkedData( prefix = LOD_PREFIX+'/dcat/', From 413b67543e32abdae44a2640903a6bd86c4cd750 Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Fri, 11 Feb 2022 17:09:12 -0500 Subject: [PATCH 6/8] Added slightly different initialization setup for fuseki. --- docker-compose.yml | 28 +++++++++++++++++++--------- mockDB/fuseki-init.sh | 1 + whyis/Dockerfile | 4 ++-- whyis/Dockerfile.dev | 4 +--- whyis/docker-compose.yml | 10 ++++++---- whyis/materialsmine/system.conf | 8 ++++---- whyis/materialsmine/whyis.conf | 5 +---- 7 files changed, 34 insertions(+), 26 deletions(-) create mode 100644 mockDB/fuseki-init.sh diff --git a/docker-compose.yml b/docker-compose.yml index cb152a81..e0a15fa4 100644 --- a/docker-compose.yml +++ b/docker-compose.yml @@ -58,36 +58,46 @@ services: depends_on: - redis - fuseki + volumes: + - ./mockDB/fuseki:/app/run + - ./whyis/materialsmine:/app command: /opt/venv/bin/celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup environment: - CHOKIDAR_USEPOLLING=true - build: ./whyis + build: whyis celerybeat: depends_on: - redis - fuseki + volumes: + - ./mockDB/fuseki:/app/run + - ./whyis/materialsmine:/app command: /opt/venv/bin/celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup environment: - CHOKIDAR_USEPOLLING=true - build: ./whyis + build: whyis fuseki: - command: /opt/venv/bin/whyis fuseki # ; /opt/venv/bin/fuseki-server --mem /ds + command: /opt/venv/bin/fuseki-server --mem /ds #/opt/venv/bin/whyis fuseki environment: - CHOKIDAR_USEPOLLING=true - build: ./whyis - ports: - - '3030:3030' + build: whyis +# ports: +# - '3030:3030' volumes: - - ./mockDB/fuseki:/app/run + - ./materialsmine:/app + - ./whyis/materialsmine:/app whyis: depends_on: - redis - fuseki stdin_open: true - command: /opt/venv/bin/gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 + command: /opt/venv/bin/gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-8} --timeout 90 -b :8000 environment: - CHOKIDAR_USEPOLLING=true - build: ./whyis + build: whyis + volumes: + - ./whyis/materialsmine:/app + - ./mockDB/fuseki:/app/run ports: - '8000:8000' volumes: diff --git a/mockDB/fuseki-init.sh b/mockDB/fuseki-init.sh new file mode 100644 index 00000000..6cb21547 --- /dev/null +++ b/mockDB/fuseki-init.sh @@ -0,0 +1 @@ +whyis init diff --git a/whyis/Dockerfile b/whyis/Dockerfile index 6fd76672..25fd9ec0 100644 --- a/whyis/Dockerfile +++ b/whyis/Dockerfile @@ -11,7 +11,7 @@ RUN apt-get update && apt-get install -y \ default-jdk-headless RUN python3.8 -m venv /opt/venv RUN /opt/venv/bin/pip install requests>=2.27.1 wheel gunicorn -RUN /opt/venv/bin/pip install whyis==2.0a7 whyis-unit-converter==0.0.2 -COPY /materialsmine /app +RUN /opt/venv/bin/pip install whyis==2.0b1 whyis-unit-converter==0.0.2 +COPY ./materialsmine /app WORKDIR '/app' CMD [ "/bin/bash" ] diff --git a/whyis/Dockerfile.dev b/whyis/Dockerfile.dev index fccb9b6f..f0dbe426 100644 --- a/whyis/Dockerfile.dev +++ b/whyis/Dockerfile.dev @@ -11,8 +11,6 @@ RUN apt-get update && apt-get install -y \ default-jdk-headless RUN python3.8 -m venv /opt/venv RUN /opt/venv/bin/pip install requests>=2.27.1 wheel gunicorn -COPY ./whyis /opt/whyis -RUN /opt/venv/bin/pip install -e /opt/whyis -RUN /opt/venv/bin/pip install whyis-unit-converter==0.0.2 +RUN /opt/venv/bin/pip install whyis==2.0b1 whyis-unit-converter==0.0.2 WORKDIR '/app' CMD [ "/bin/bash" ] diff --git a/whyis/docker-compose.yml b/whyis/docker-compose.yml index 1bc0f1b7..63de5280 100644 --- a/whyis/docker-compose.yml +++ b/whyis/docker-compose.yml @@ -12,7 +12,7 @@ services: command: /opt/venv/bin/celery -A wsgi.celery worker -l INFO -c 4 --uid=nobody --gid=nogroup volumes: - ./materialsmine:/app - - ./whyis:/opt/whyis + - ./mockDB/fuseki:/app/run environment: - CHOKIDAR_USEPOLLING=true build: @@ -25,7 +25,7 @@ services: command: /opt/venv/bin/celery -A wsgi.celery beat -l INFO --uid=nobody --gid=nogroup volumes: - ./materialsmine:/app - - ./whyis:/opt/whyis + - ./mockDB/fuseki:/app/run environment: - CHOKIDAR_USEPOLLING=true build: @@ -41,13 +41,14 @@ services: ports: - '3030:3030' volumes: + - ./materialsmine:/app - ./mockDB/fuseki:/app/run whyis: depends_on: - redis - fuseki stdin_open: true - command: /bin/bash #/opt/venv/bin/gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 + command: /opt/venv/bin/gunicorn wsgi:application --workers ${WEB_CONCURRENCY:-4} --timeout 90 -b :8000 environment: - CHOKIDAR_USEPOLLING=true build: @@ -55,6 +56,7 @@ services: context: . volumes: - ./materialsmine:/app - - ./whyis:/opt/whyis + - ./mockDB/fuseki:/app/run ports: + - '8000:8000' - '5000:5000' diff --git a/whyis/materialsmine/system.conf b/whyis/materialsmine/system.conf index 97de1e10..63bd5162 100644 --- a/whyis/materialsmine/system.conf +++ b/whyis/materialsmine/system.conf @@ -10,9 +10,9 @@ if authenticator_secret: print("Adding JWT authenticator") authenticator_config.append(JWTAuthenticator(key=authenticator_secret)) -AUTHENTICATORS = authenticator_config +APPLICATION_ROOT= '/whyis/' -DEBUG=False +AUTHENTICATORS = authenticator_config # LOGGING LOGGER_NAME = "whyis_log" @@ -31,9 +31,9 @@ PERMANENT_SESSION_LIFETIME = timedelta(days=7) ## MAIL_PASSWORD = '' ## DEFAULT_MAIL_SENDER = "Whyis Admin " EMBEDDED_FUSEKI = False -ADMIN_ENDPOINT = 'http://fuseki:3030/admin/sparql' +ADMIN_ENDPOINT = 'http://fuseki:3030/admin' -KNOWLEDGE_ENDPOINT = 'http://fuseki:3030/knowledge/sparql' +KNOWLEDGE_ENDPOINT = 'http://fuseki:3030/knowledge' EMBEDDED_CELERY = False CELERY_BROKER_URL = 'redis://redis:6379/0' diff --git a/whyis/materialsmine/whyis.conf b/whyis/materialsmine/whyis.conf index 9b65557c..24b6c7b8 100644 --- a/whyis/materialsmine/whyis.conf +++ b/whyis/materialsmine/whyis.conf @@ -21,10 +21,7 @@ VOCAB_FILE = "vocab.ttl" ## MAIL_USERNAME = '', ## MAIL_PASSWORD = '', ## DEFAULT_MAIL_SENDER = "Whyis ", -DEFAULT_ANONYMOUS_READ = True -WHYIS_TEMPLATE_DIR = 'templates' -WHYIS_CDN_DIR = 'static' -EXPLAIN_TEMPLATE_LOADING = True + NAMESPACES = [ importer.LinkedData( prefix = LOD_PREFIX+'/dcat/', From e970804839596f9a565318ba2e6f3cde8e659508 Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Tue, 22 Mar 2022 13:52:01 -0400 Subject: [PATCH 7/8] Updated dockerfile to use released whyis. --- whyis/Dockerfile | 16 ++-------------- whyis/Dockerfile.dev | 16 ++-------------- 2 files changed, 4 insertions(+), 28 deletions(-) diff --git a/whyis/Dockerfile b/whyis/Dockerfile index 25fd9ec0..9a7a1a38 100644 --- a/whyis/Dockerfile +++ b/whyis/Dockerfile @@ -1,17 +1,5 @@ -FROM ubuntu:20.04 -RUN apt-get update && apt-get install -y software-properties-common gcc - -RUN apt-get update && apt-get install -y \ - python3.8-distutils \ - python3.8-dev \ - python3-pip \ - python3.8-venv \ - curl \ - libdb5.3-dev \ - default-jdk-headless -RUN python3.8 -m venv /opt/venv -RUN /opt/venv/bin/pip install requests>=2.27.1 wheel gunicorn -RUN /opt/venv/bin/pip install whyis==2.0b1 whyis-unit-converter==0.0.2 +FROM tetherlessworld/whyis:latest +RUN /opt/venv/bin/pip install whyis-unit-converter==0.0.2 COPY ./materialsmine /app WORKDIR '/app' CMD [ "/bin/bash" ] diff --git a/whyis/Dockerfile.dev b/whyis/Dockerfile.dev index f0dbe426..83432f03 100644 --- a/whyis/Dockerfile.dev +++ b/whyis/Dockerfile.dev @@ -1,16 +1,4 @@ -FROM ubuntu:20.04 as dependencies -RUN apt-get update && apt-get install -y software-properties-common gcc - -RUN apt-get update && apt-get install -y \ - python3.8-distutils \ - python3.8-dev \ - python3-pip \ - python3.8-venv \ - curl \ - libdb5.3-dev \ - default-jdk-headless -RUN python3.8 -m venv /opt/venv -RUN /opt/venv/bin/pip install requests>=2.27.1 wheel gunicorn -RUN /opt/venv/bin/pip install whyis==2.0b1 whyis-unit-converter==0.0.2 +FROM tetherlessworld/whyis:latest +RUN /opt/venv/bin/pip install whyis-unit-converter==0.0.2 WORKDIR '/app' CMD [ "/bin/bash" ] From da3ba88922bbbf647635bcaa06b2958057200222 Mon Sep 17 00:00:00 2001 From: Jamie McCusker Date: Tue, 5 Apr 2022 14:22:46 -0400 Subject: [PATCH 8/8] We are only using the materialsmine ontology now --- whyis/materialsmine/nanomine.ttl | 3240 ------------------------------ 1 file changed, 3240 deletions(-) delete mode 100644 whyis/materialsmine/nanomine.ttl diff --git a/whyis/materialsmine/nanomine.ttl b/whyis/materialsmine/nanomine.ttl deleted file mode 100644 index 9dce8b18..00000000 --- a/whyis/materialsmine/nanomine.ttl +++ /dev/null @@ -1,3240 +0,0 @@ -@prefix : . -@prefix bibo: . -@prefix dc: . -@prefix nanomine: . -@prefix owl: . -@prefix prov: . -@prefix rdfs: . -@prefix sio: . -@prefix skos: . - -<<<<<<< HEAD - a owl:Class ; -======= - a owl:Class ; ->>>>>>> nanomine/master - rdfs:label "Author", - "DOI", - "Date of Citation", - "Date of Measurement", - "Date of Sample Made", - "Edition", - "Editor", - "ISBN", - "ISSN", - "Institution or Lab", - "Issue", - "Keyword", - "Language", - "Publication Year", - "Publisher", - "Title", - "URL", - "Volume", - "nan", - "related DOI" ; -<<<<<<< HEAD - nanomine:hasSelector "//DegreeOfCrystallization", - "//Rheological", - "//Volumetric", - "//WeibullParameter" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf prov:Agent . - -:ns a owl:Ontology ; - rdfs:label "Nanomaterials Ontology" ; - dc:creator , - , - , - ; - rdfs:comment "A nanomaterials ontology to support data publication using Nanomine." ; - owl:imports bibo:, - , - . - -nanomine:AC_DielectricConstant a owl:Class ; - rdfs:label "AC Dielectric Constant" ; - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:AC_DielectricDispersion a owl:Class ; - rdfs:label "AC Dielectric Dispersion" ; -<<<<<<< HEAD - nanomine:hasSelector "//AC_DielectricDispersion" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ElectricalProperty ; - skos:definition "Frequency dependent dielectric constant" . - -nanomine:Abbreviation a owl:Class ; - rdfs:label "Abbreviation" ; - rdfs:subClassOf sio:Name ; - skos:definition "a shortened form of a word or phrase. It consists of a group of letters taken from the word or phrase." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Abbreviation" . - -nanomine:Air a owl:Class ; - rdfs:label "Air" ; - rdfs:subClassOf nanomine:AmbientCondition . - -nanomine:ArcResistance a owl:Class ; - rdfs:label "Arc Resistance" ; -<<<<<<< HEAD - nanomine:hasSelector "//ArcResistance" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "A measure of the durability of an insulating or dielectric material against the formation of conductive paths along thesurface by arc discharges." . - -nanomine:AspectRatio a owl:Class ; - rdfs:label "Aspect Ratio" ; - rdfs:subClassOf sio:Ratio ; - skos:definition "is the ratio of its sizes in different dimensions. For example, the aspect ratio of a rectangle is the ratio of its longer side to its shorter side – the ratio of width to height, when the rectangle is oriented as a \"landscape\"." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Aspect_ratio" . - -nanomine:Atactic a owl:Class ; - rdfs:label "Atactic" ; - rdfs:subClassOf nanomine:Tacticity ; - skos:definition "In atactic macromolecules the substituents are placed randomly along the chain. The percentage of meso diads is between 1 and 99%. With the aid of spectroscopic techniques such as NMR it is possible to pinpoint the composition of a polymer in terms of the percentages for each triad." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Atactic_polymers" . - -nanomine:AtomicForceMicroscopy a owl:Class ; - rdfs:label "Atomic Force Microscopy" ; - nanomine:hasSelector "//Atomic_Force_Microscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:ViscoelasticProperty ], - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:MechanicalProperty ], -======= - owl:someValuesFrom nanomine:MechanicalProperty ], - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], ->>>>>>> nanomine/master - sio:Measuring ; - skos:definition "Nanoscale probing of material surface characteristics" . - -nanomine:BallMilling a owl:Class ; - rdfs:label "Ball Milling" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - nanomine:Mixing ; - skos:definition "Grinding process with rotating cylindrical shells and ball " . - -nanomine:BarrelTemperature a owl:Class ; - rdfs:label "Barrel Temperature" ; - rdfs:subClassOf . - -nanomine:Book a owl:Class ; - rdfs:label "Book" . - -nanomine:BreakdownStrength a owl:Class ; - rdfs:label "Breakdown Strength" ; - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:BrittleTemperature a owl:Class ; - rdfs:label "Brittle Temperature" ; -<<<<<<< HEAD - nanomine:hasSelector "//BrittleTemperature" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty, - ; - skos:definition "Brittleness temperature is the temperature at which 50% of the tested specimens exhibit brittle failure at specified impact conditions" . - -nanomine:CU_Formula a owl:Class ; - rdfs:label "Constitutional Unit Formula" ; - rdfs:subClassOf sio:Name ; - skos:definition "a way of expressing information about the proportions of atoms that constitute a particular chemical compound, using a single line of chemical element symbols, numbers, and sometimes also other symbols, such as parentheses, dashes, brackets, commas and plus (+) and minus (−) signs. " ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Chemical_formula" . - -nanomine:Casting a owl:Class ; - rdfs:label "Casting" ; - rdfs:subClassOf nanomine:Molding . - -nanomine:Centrifugation a owl:Class ; - rdfs:label "Centrifugation" ; - rdfs:subClassOf sio:Procedure ; - skos:definition "process which involves the application of the centripetal force for the sedimentation of heterogeneous mixtures with a centrifuge" . - -nanomine:CharpyImpactEnergy a owl:Class ; - rdfs:label "Charpy Impact Energy" ; -<<<<<<< HEAD - nanomine:hasSelector "//CharpyImpactEnergy" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:MechanicalProperty ; - skos:definition "Energy absorbed by the sample during Charpy impact testing" . - -nanomine:ChemicalUsed a owl:Class ; - rdfs:label "Chemical Used" ; - rdfs:subClassOf sio:ChemicalEntity . - -nanomine:CoRotation a owl:Class ; - rdfs:label "Co-Rotation" ; - rdfs:subClassOf nanomine:RotationMode . - -nanomine:Communication a owl:Class ; - rdfs:label "Communication" ; - rdfs:subClassOf bibo:AcademicArticle . - -nanomine:Compression a owl:Class ; - rdfs:label "Compression" ; - rdfs:subClassOf nanomine:ViscoelasticProperty ; - skos:definition "Describing countervailing forces applied inward along the central axis of a material." . - -nanomine:CompressionModulus a owl:Class ; - rdfs:label "Compression Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressionModulus" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:CompressionProperty ; - skos:definition "The ratio of compressive stress to compressive strain" . - -nanomine:CompressionStressAtBreak a owl:Class ; - rdfs:label "Compression Stress At Break" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressionStressAtBreak" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:CompressionProperty ; - skos:definition "Compression stress when specimen breaks" . - -nanomine:CompressionStressAtYield a owl:Class ; - rdfs:label "Compression Stress At Yield" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressionStressAtYield" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:CompressionProperty ; - skos:definition "Compression stress at yield point" . - -nanomine:CompressiveCreepRuptureStrength a owl:Class ; - rdfs:label "Compressive Creep Rupture Strength" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressiveCreepRuptureStrength" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:CompressiveCreep ; - skos:definition "Material strength at rupture during a compressive creep test" . - -nanomine:CompressiveCreepRuptureTime a owl:Class ; - rdfs:label "Compressive Creep Rupture Time" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressiveCreepRuptureTime" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:CompressiveCreep ; - skos:definition "Time taken to rupture from applying load during a compressive creep test" . - -nanomine:CompressiveCreepStrain a owl:Class ; - rdfs:label "Compressive Creep Strain" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressiveCreepStrain" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:CompressiveCreep ; - skos:definition "Profile of strain as a function of time during a compressive creep test" . - -nanomine:CompressiveLoadingProfile a owl:Class ; - rdfs:label "Compressive Loading Profile" ; -<<<<<<< HEAD - nanomine:hasSelector "//Compression/LoadingProfile" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:CompressionProperty ; - skos:definition "Stress vs. strain curve of during compressive loading and/or unloading test" . - -nanomine:CompressiveToughness a owl:Class ; - rdfs:label "Compressive Toughness" ; -<<<<<<< HEAD - nanomine:hasSelector "//CompressiveToughness" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:CompressionProperty ; - skos:definition "The amount of energy a material can absorb prior to fracture under an applied compressive load." . - -nanomine:ConePlateRheometery a owl:Class ; - rdfs:label "Cone-Plate Rheometry" ; - nanomine:hasSelector "//Rheometery[RheometerType='cone-plate']" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], - nanomine:Rheometery ; - skos:definition "The liquid is placed on horizontal plate and a shallow cone placed into it. The angle between the surface of the cone and the plate is around 1–2 degrees but can vary depending on the types of tests being run. Typically the plate is rotated and the torque on the cone measured." . - -nanomine:Constituent a owl:Class ; - rdfs:label "Constituent" . - -nanomine:ConstitutionalUnit a owl:Class ; - rdfs:label "Constitutional Unit" ; - rdfs:subClassOf sio:UnitOfMeasurement . - -nanomine:Cooling a owl:Class ; - rdfs:label "Cooling" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:TimeInterval ], -======= - owl:someValuesFrom sio:TimeInterval ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:AmbientCondition ], - sio:Procedure . - -nanomine:Copolymer a owl:Class ; - rdfs:label "Copolymer" ; - rdfs:subClassOf sio:Polymer ; - skos:definition "polymers containing a mixture of repeat units" ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . - -nanomine:CounterRotation a owl:Class ; - rdfs:label "Counter-Rotation" ; - rdfs:subClassOf nanomine:RotationMode . - -nanomine:CrystalPhase a owl:Class ; - rdfs:label "Crystal Phase" ; - rdfs:subClassOf sio:CrystalStructure ; - skos:definition "A single material may have several distinct solid states capable of forming separate phases. Water is a well-known example of such a material. For example, water ice is ordinarily found in the hexagonal form ice Ih, but can also exist as the cubic ice Ic, the rhombohedral ice II, and many other forms. Polymorphism is the ability of a solid to exist in more than one crystal form. For pure chemical elements, polymorphism is known as allotropy. For example, diamond, graphite, and fullerenes are different allotropes of carbon." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Phase_(matter)#Crystal_phases" . - -nanomine:CrystallizationTemperature a owl:Class ; - rdfs:label "Crystallization Temperature" ; -<<<<<<< HEAD - nanomine:hasSelector "//CrystalizationTemperature" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ThermalProperty, - ; - skos:definition "It is the temperature at which a solid phase begins to form, resulting in a mixture of solid particles and solution" . - -nanomine:Curing a owl:Class ; - rdfs:label "Curing" ; - rdfs:subClassOf sio:Procedure . - -nanomine:CurrentDensity a owl:Class ; - rdfs:label "Current Density" ; -<<<<<<< HEAD - nanomine:hasSelector "//CurrentDensity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "the amount of electric current flowing per unit cross-sectional area of a material." . - -nanomine:CycleInformation a owl:Class ; - rdfs:label "Cycle Information" ; - nanomine:hasSelector "//CycleInformation" ; - rdfs:subClassOf sio:InformationContentEntity . - -nanomine:DC_DielectricConstant a owl:Class ; - rdfs:label "DC Dielectric Constant" ; -<<<<<<< HEAD - nanomine:hasSelector "//DC_DielectricConstant" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:DSC_Profile a owl:Class ; - rdfs:label "DSC Profile" ; -<<<<<<< HEAD - nanomine:hasSelector "//DSC_Profile" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ThermalProperty ; - skos:definition "Heat flow vs temperature out of a differential scanning calorimetry experiment" . - -nanomine:DegreeOfCrystallization a owl:Class ; - rdfs:label "Degree of Crystallinity" ; -<<<<<<< HEAD - nanomine:hasSelector "//DegreeOfCrystallinity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Crystallinity ; - skos:definition "The percentage of the crystallized region in a polymer/material. It describes the extent of the crystallization process" . - -nanomine:Density a owl:Class ; - rdfs:label "Density" ; -<<<<<<< HEAD - nanomine:hasSelector "//Density" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:VolumetricProperty, - ; - skos:definition "The density, or more precisely, the volumetric mass density, of a substance is its mass per unit volume.", - "degree of consistency measured by the quantity of mass per unit volume" ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Density" . - -nanomine:DieDiameter a owl:Class ; - rdfs:label "Die Diameter" ; - rdfs:subClassOf . - -nanomine:DielectricLossPermittivity a owl:Class ; - rdfs:label "Dielectric Loss Permittivity" ; -<<<<<<< HEAD - nanomine:hasSelector "//Dielectric_Loss_Permittivity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:DielectricLossTangent a owl:Class ; - rdfs:label "Dielectric Loss Tangent" ; -<<<<<<< HEAD - nanomine:hasSelector "//Dielectric_Loss_Tangent" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:DielectricRealPermittivity a owl:Class ; - rdfs:label "Dielectric Real Permittivity" ; -<<<<<<< HEAD - nanomine:hasSelector "//Dielectric_Real_Permittivity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:DielectricandImpedanceSpectroscopyAnalysis a owl:Class ; - rdfs:label "Dielectric and Impedance Spectroscopy Analysis" ; - nanomine:hasSelector "//Dielectric_and_Impedance_Spectroscopy_Analysis" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ElectricalProperty ], - sio:Measuring ; - skos:definition "Measurement of dielectric spectroscopy (variation of dielectric constant with frequency) " . - -nanomine:DifferentialScanningCalorimetry a owl:Class ; - rdfs:label "Differential Scanning Calorimetry" ; - nanomine:hasSelector "//Differential_Scanning_Calorimetry" ; - rdfs:subClassOf [ a owl:Restriction ; -<<<<<<< HEAD - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ThermalProperty ], -======= - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:CoolingRate ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:HeatingRate ], - [ a owl:Restriction ; -<<<<<<< HEAD - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:CoolingRate ], -======= - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ThermalProperty ], ->>>>>>> nanomine/master - sio:Measuring ; - skos:definition "Measurement of heat required to increase unit temperature in a material" . - -nanomine:Dissolving a owl:Class ; - rdfs:label "Dissolving" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Solvent ], - sio:Procedure ; - skos:definition "Dissolving into solution without external force" . - -nanomine:Drying-Evaporation a owl:Class ; - rdfs:label "Drying Evaporation" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:AmbientCondition ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:TimeInterval ], -======= - owl:someValuesFrom sio:TimeInterval ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], ->>>>>>> nanomine/master - sio:Procedure ; - skos:definition "Process for drying and evaporation of liquid solutions" . - -nanomine:DynamicMechanicalAnalysis a owl:Class ; - rdfs:label "Dynamic Mechanical Analysis" ; - nanomine:hasSelector "//Dynamic_Mechanical_Analysis" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], - sio:Measuring ; - skos:definition "Method to get viscoelastic behavior of materials with controlled temperature and frequency" . - -nanomine:DynamicProperty a owl:Class ; - rdfs:label "Dynamic Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//DynamicProperties" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ViscoelasticProperty ; - skos:definition "A materials property representing the behavior of the material under some dynamic environmental force." . - -nanomine:DynamicPropertyProfile a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//DynamicPropertyProfile" . - -nanomine:DynamicViscosity a owl:Class ; - rdfs:label "Dynamic Viscosity" ; - nanomine:hasSelector "//DynamicViscosity" ; -======= - rdfs:label "nan" . - -nanomine:DynamicViscosity a owl:Class ; - rdfs:label "Dynamic Viscosity" ; ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalViscosity . - -nanomine:Elastomer a owl:Class ; - rdfs:label "Elastomer" ; - rdfs:subClassOf nanomine:Plastic ; - skos:definition "a polymer with viscoelasticity (having both viscosity and elasticity) and very weak inter-molecular forces, generally having low Young's modulus and high failure strain compared with other materials." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Elastomer" . - -<<<<<<< HEAD -nanomine:ElectricConductivity a owl:Class ; - rdfs:label "Electric Conductivity" ; - nanomine:hasSelector "//ElectricConductivity" ; -======= -nanomine:ElectricPercolationThreshold a owl:Class ; - rdfs:label "Electric Percolation Threshold" ; - rdfs:subClassOf nanomine:ElectricalProperty ; - skos:definition "minimum filler content in the polymer matrix after which there is no significant change in the electrical properties of the composites." . - -nanomine:ElectricalConductivity a owl:Class ; - rdfs:label "Electric Conductivity" ; - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "ability of electric current to flow through a material" . - -<<<<<<< HEAD -nanomine:ElectricPercolationThreshold a owl:Class ; - rdfs:label "Electric Percolation Threshold" ; - nanomine:hasSelector "//ElectricPercolationThreshold" ; - rdfs:subClassOf nanomine:ElectricalProperty ; - skos:definition "minimum filler content in the polymer matrix after which there is no significant change in the electrical properties of the composites." . - -======= ->>>>>>> nanomine/master -nanomine:Electrometry a owl:Class ; - rdfs:label "Electrometry" ; - nanomine:hasSelector "//Electrometry" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ElectricalProperty ], - sio:Measuring ; - skos:definition "Measurement of electric charge or electrical potential difference" . - -nanomine:ElongationAtBreak a owl:Class ; - rdfs:label "Elongation At Break" ; -<<<<<<< HEAD - nanomine:hasSelector "//ElongationAtBreak" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Elongation of specimen when breaks" . - -nanomine:ElongationAtYield a owl:Class ; - rdfs:label "Elongation At Yield" ; -<<<<<<< HEAD - nanomine:hasSelector "//ElongationAtYield" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Tensile elongation corresponding to the yield (an increase in strain does not result in an increase in stress)." . - -nanomine:EnergyDensity a owl:Class ; - rdfs:label "Energy Density" ; -<<<<<<< HEAD - nanomine:hasSelector "//EnergyDensity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "amount of energy stored in a given system or region of space per unit volume or mass" . - -nanomine:Equipment a owl:Class ; - rdfs:label "Equipment", - "Equipment Used" ; - nanomine:hasSelector "//Equipment", - "//EquipmentUsed" ; - rdfs:subClassOf sio:Device . - -nanomine:EssentialWorkOfFracture a owl:Class ; - rdfs:label "Essential Work Of Fracture" ; -<<<<<<< HEAD - nanomine:hasSelector "//EssentialWorkOfFracture" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:FractureToughnessProperty ; - skos:definition "Energy associated with cracking at the process zone" . - -nanomine:Eutactic a owl:Class ; - rdfs:label "Eutactic" ; - rdfs:subClassOf nanomine:Tacticity ; - skos:definition "In eutactic macromolecules, substituents may occupy any specific (but potentially complex) sequence of positions along the chain. Isotactic and syndiotactic polymers are instances of the more general class of eutactic polymers, which also includes heterogeneous macromolecules in which the sequence consists of substituents of different kinds (for example, the side-chains in proteins and the bases in nucleic acids)." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Eutactic_polymers" . - -nanomine:ExperimentalProcedure a owl:Class ; - rdfs:label "Experimental Procedure" ; - rdfs:subClassOf sio:Procedure . - -nanomine:Experimenter a owl:Class ; - rdfs:label "Experimenter" ; - rdfs:subClassOf prov:Agent . - -nanomine:Extrusion a owl:Class ; - rdfs:label "Extrusion" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Extruder ], - sio:Procedure ; - skos:definition "Process used to create objects of a fixed cross-sectional profile. A material is pushed through a die of the desired cross-section." . - -nanomine:FiberTensileElongation a owl:Class ; - rdfs:label "Fiber Tensile Elongation" ; -<<<<<<< HEAD - nanomine:hasSelector "//FiberTensileElongation" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Elongation along grain direction in fibers" . - -nanomine:FiberTensileModulus a owl:Class ; - rdfs:label "Fiber Tensile Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//FiberTensileModulus" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Tensile modulus along grain direction in fibers" . - -nanomine:FiberTensileStrength a owl:Class ; - rdfs:label "Fiber Tensile Strength" ; -<<<<<<< HEAD - nanomine:hasSelector "//FiberTensileStrength" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Tensile Stress along grain direction in fibers" . - -nanomine:Filler a owl:Class ; - rdfs:label "Filler" ; - rdfs:subClassOf sio:Role . - -<<<<<<< HEAD -nanomine:FillerComponent a owl:Class ; - rdfs:label "Filler Component" ; - rdfs:subClassOf nanomine:Component . - -======= ->>>>>>> nanomine/master -nanomine:FillerComponentComposition a owl:Class ; - rdfs:label "Filler Component Composition" ; - rdfs:subClassOf nanomine:Composition . - -<<<<<<< HEAD -======= -nanomine:FillerComponentInComposite a owl:Class ; - rdfs:label "Filler Component in Composite" ; - rdfs:subClassOf nanomine:FillerComponent . - ->>>>>>> nanomine/master -nanomine:FillerComposition a owl:Class ; - rdfs:label "Filler Composition" ; - rdfs:subClassOf nanomine:Composition . - -nanomine:FillerProcessing a owl:Class ; - rdfs:label "Filler Processing" ; - rdfs:subClassOf nanomine:Processing . - -nanomine:FlexuralCreepRuptureStrength a owl:Class ; - rdfs:label "Flexural Creep Rupture Strength" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralCreepRuptureStrength" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:FlexuralCreep ; - skos:definition "Material strength at rupture during a flexural creep test" . - -nanomine:FlexuralCreepRuptureTime a owl:Class ; - rdfs:label "Flexural Creep Rupture Time" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralCreepRuptureTime" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:FlexuralCreep ; - skos:definition "Time taken to rupture from applying load during a flexural creep test" . - -nanomine:FlexuralCreepStrain a owl:Class ; - rdfs:label "Flexural Creep Strain" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralCreepStrain" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:FlexuralCreep ; - skos:definition "Profile of strain as a function of time during a flexural creep test" . - -nanomine:FlexuralLoadingProfile a owl:Class ; - rdfs:label "Flexural Loading Profile" ; -<<<<<<< HEAD - nanomine:hasSelector "//Flexural/LoadingProfile" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:FlexuralProperty ; - skos:definition "Stress vs. strain curve of during flexural loading and/or unloading test" . - -nanomine:FlexuralModulus a owl:Class ; - rdfs:label "Flexural Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralModulus" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:FlexuralProperty ; - skos:definition "Ratio of stress to strain in flexural deformation, or the tendency for a material to bend" . - -nanomine:FlexuralStressAtBreak a owl:Class ; - rdfs:label "Flexural Stress At Break" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralStressAtBreak" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:FlexuralProperty ; - skos:definition "Flexural stress at the moment at which a test specimen tears" . - -nanomine:FlexuralStressAtYield a owl:Class ; - rdfs:label "Flexural Stress At Yield" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralStressAtYield" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:FlexuralProperty ; - skos:definition "Flexural stress corresponding to the yield point" . - -nanomine:FlexuralToughness a owl:Class ; - rdfs:label "Flexural Toughness" ; -<<<<<<< HEAD - nanomine:hasSelector "//FlexuralToughness" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:FlexuralProperty ; - skos:definition "The amount of energy a material can absorb prior to fracture under an applied flexural load." . - -nanomine:FourierTransformInfraredSpectroscopy a owl:Class ; - rdfs:label "Fourier Transform Infrared Spectroscopy" ; - nanomine:hasSelector "//Fourier_Transform_Infrared_Spectroscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:Spectroscopy ], - sio:Measuring ; - skos:definition "Measurement of infrared spectrum of absorption or emission of a solid, liquid or gas" . - -nanomine:FractureEnergy a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//FractureEnergy" . - -nanomine:FrequencySweep a owl:Class ; - rdfs:label "nan" ; - nanomine:hasSelector "//FrequencySweep" . - -nanomine:GlassTransitionTemperature a owl:Class ; - rdfs:label "Glass Transition Temperature" ; - nanomine:hasSelector "//GlassTransitionTemperature" ; -======= - rdfs:label "nan" . - -nanomine:FrequencySweep a owl:Class ; - rdfs:label "nan" . - -nanomine:GlassTransitionTemperature a owl:Class ; - rdfs:label "Glass Transition Temperature" ; - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty, - ; - skos:definition "is the temperature region where the polymer transitions from a hard, glassy material to a soft, rubbery material." . - -nanomine:GraftDensity a owl:Class ; - rdfs:label "Graft Density" ; - rdfs:subClassOf sio:Density ; - skos:definition "A result of surface treatment process, the graft density quantifies the area density of surface-treatment molecules on the surface of the filler, typically in units of chains/nm^2." . - -nanomine:GrowthRateOfCrystal a owl:Class ; - rdfs:label "Growth Rate Of Crystal" ; -<<<<<<< HEAD - nanomine:hasSelector "//GrowthRateOfCrystal" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Crystallinity ; - skos:definition "Rate of the crystallization process" . - -nanomine:GrowthRateParameterOfAvramiEquation a owl:Class ; - rdfs:label "Growth Rate Parameter Of Avrami Equation" ; -<<<<<<< HEAD - nanomine:hasSelector "//GrowthRateParameterOfAvramiEquation" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Crystallinity ; - skos:definition "Growth Rate Parameter in Avrami Equation" . - -nanomine:HalflifeOfCrystallization a owl:Class ; - rdfs:label "Halflife Of Crystallization" ; -<<<<<<< HEAD - nanomine:hasSelector "//HalflifeOfCrystallization" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Crystallinity ; - skos:definition "The time required for half of a material to form a crystalline structure under some condition." . - -nanomine:Hardener a owl:Class ; - rdfs:label "Hardener" ; - rdfs:subClassOf nanomine:Additive ; - skos:definition "A chemical additive that increases the viscosity of a polymer." . - -nanomine:HardnessScale a owl:Class ; - rdfs:label "Hardness Scale" ; -<<<<<<< HEAD - nanomine:hasSelector "//HardnessScale" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:HardnessProperty ; - skos:definition "A standard numerical scale associated with a particular hardness test tip geometry." . - -nanomine:HardnessTestStandard a owl:Class ; - rdfs:label "Hardness Test Standard" ; -<<<<<<< HEAD - nanomine:hasSelector "//HardnessTestStandard" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:HardnessProperty ; - skos:definition "A materials testing standard, created by a standards body such as ASTM, defining test parameters such as pre-load, load, and tip geometry of the testing apparatus." . - -nanomine:HardnessValue a owl:Class ; - rdfs:label "Hardness Value" ; -<<<<<<< HEAD - nanomine:hasSelector "//HardnessValue" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:HardnessProperty ; - skos:definition "The numerical value of hardness output by the testing apparatus, given a particular hardness scale as input." . - -nanomine:HeatOfCrystallization a owl:Class ; - rdfs:label "Heat Of Crystallization" ; -<<<<<<< HEAD - nanomine:hasSelector "//HeatOfCrystallization" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty ; - skos:definition "The amount of heat that must be removed from one gram of a liquid at its freezing point to freeze it with no change in temperature." . - -nanomine:HeatOfFusion a owl:Class ; - rdfs:label "Heat Of Fusion" ; -<<<<<<< HEAD - nanomine:hasSelector "//HeatOfFusion" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty ; - skos:definition "change in enthalpy with energy dissipation" . - -nanomine:Heating a owl:Class ; - rdfs:label "Heating" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:TimeInterval ], -======= - owl:someValuesFrom sio:TimeInterval ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:AmbientCondition ], - sio:Procedure ; - skos:definition "Process for applying heat" . - -nanomine:HeatingZone a owl:Class ; - rdfs:label "Heating Zone" ; - rdfs:subClassOf sio:SpatialRegion . - -nanomine:HeatingZoneNumber a owl:Class ; - rdfs:label "Heating Zone Number" ; - rdfs:subClassOf sio:Number . - -nanomine:HighPressureCapillaryRheometery a owl:Class ; - rdfs:label "High Pressure Capillary Rheometry" ; - nanomine:hasSelector "//Rheometery[RheometerType='high pressure capillary']" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], - nanomine:Rheometery . - -nanomine:HighShearMixing a owl:Class ; - rdfs:label "High Shear Mixing" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - nanomine:Mixing ; - skos:definition "A stator-rotator setup that disperses substance into continuous phase through high shear" . - -nanomine:Homopolymer a owl:Class ; - rdfs:label "Homopolymer" ; - rdfs:subClassOf sio:Polymer ; - skos:definition "polymers that contain only a single type of repeat unit" ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer#Monomers_and_repeat_units" . - -nanomine:HotPressing a owl:Class ; - rdfs:label "Hot-Processing (Compression Molding)" ; - rdfs:subClassOf nanomine:Molding ; - skos:definition "Applying heat and pressure" . - -nanomine:IZOD_Area a owl:Class ; - rdfs:label "IZOD Area" ; -<<<<<<< HEAD - nanomine:hasSelector "//IZOD_Area" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:MechanicalProperty ; - skos:definition "Area associated in Izod impact testing" . - -nanomine:IZOD_ImpactEnergy a owl:Class ; - rdfs:label "IZOD Impact Energy" ; -<<<<<<< HEAD - nanomine:hasSelector "//IZOD_ImpactEnergy" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:MechanicalProperty ; - skos:definition "Energy absorbed by the sample during Izod impact testing, as calculated by the height of swing arm" . - -nanomine:ImpactToughness a owl:Class ; - rdfs:label "Impact Toughness" ; -<<<<<<< HEAD - nanomine:hasSelector "//ImpactToughness" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Impact ; - skos:definition "The amount of impact energy a material can absorb prior to fracture." . - -nanomine:Impedance a owl:Class ; - rdfs:label "Impedance" ; -<<<<<<< HEAD - nanomine:hasSelector "//Impedance" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:In-SituPolymerization a owl:Class ; - rdfs:label "In-Situ Polymerization" ; - rdfs:subClassOf sio:Procedure ; - skos:definition "Mixing of nanoparticles within liquid monomer so that polymer formation results in embedding of particles" . - -nanomine:Inert a owl:Class ; - rdfs:label "Inert" ; - rdfs:subClassOf nanomine:AmbientCondition . - -nanomine:InjectionMolding a owl:Class ; - rdfs:label "nan" ; - rdfs:subClassOf nanomine:Molding . - -nanomine:InterfacialTension a owl:Class ; - rdfs:label "Interfacial Tension" ; -<<<<<<< HEAD - nanomine:hasSelector "//InterfacialTension" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:VolumetricProperty ; - skos:definition "Interfacial tension is the force that holds the surfaceof a particular phase together" . - -nanomine:InterphaseThickness a owl:Class ; - rdfs:label "Interphase Thickness" ; -<<<<<<< HEAD - nanomine:hasSelector "//InterphaseThickness" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:VolumetricProperty ; - skos:definition "Thickness of matrix-particle interaction area with a gradient property as a function of distance from particle surface" . - -nanomine:Isotactic a owl:Class ; - rdfs:label "Isotactic" ; - rdfs:subClassOf nanomine:Tacticity ; - skos:definition """Isotactic polymers are composed of isotactic macromolecules (IUPAC definition). In isotactic macromolecules all the substituents are located on the same side of the macromolecular backbone. An isotactic macromolecule consists of 100% meso diads. Polypropylene formed by Ziegler-Natta catalysis is an isotactic polymer. Isotactic polymers are usually semicrystalline and often form a helix configuration. - -""" ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Isotactic_polymers" . - -nanomine:JIntegral a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//J-integral" . -======= - rdfs:label "nan" . ->>>>>>> nanomine/master - -nanomine:Journal a owl:Class ; - rdfs:label "Journal" . - -nanomine:KFactor a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//K-factor" . - -nanomine:LC_PhaseTransitionTemperature a owl:Class ; - rdfs:label "LC Phase Transition Temperature" ; - nanomine:hasSelector "//LC_PhaseTransitionTemperature" ; -======= - rdfs:label "nan" . - -nanomine:LC_PhaseTransitionTemperature a owl:Class ; - rdfs:label "LC Phase Transition Temperature" ; - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty, - ; - skos:definition "temperature of transition to liquid crystal phase" . - -nanomine:LengthOfHeatingZone a owl:Class ; - rdfs:label "Length Of Heating Zone" ; - rdfs:subClassOf sio:Length . - -nanomine:LinearElastic a owl:Class ; - rdfs:label "Linear Elastic" ; -<<<<<<< HEAD - nanomine:hasSelector "//LinearElastic" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:FractureToughnessProperty ; - skos:definition "Infinitesimal material deformation or deformation within the linear regime" . - -nanomine:LinearExpansionCoefficient a owl:Class ; - rdfs:label "Linear Expansion Coefficient" ; -<<<<<<< HEAD - nanomine:hasSelector "//LinearExpansionCoefficient" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:VolumetricProperty ; - skos:definition "It is the fractional change in length per degree of temperature change" . - -nanomine:ManufacturerOrSourceName a owl:Class ; - rdfs:label "Manufacturer Or Source Name" ; - rdfs:subClassOf sio:Organization ; - skos:definition "An organization that enages in the value added production of merchandise for use or sale using labour and machines, tools, chemical and biological processing, or formulation." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Manufacturing" . - -nanomine:MassFraction a owl:Class ; - rdfs:label "Mass Fraction" ; - rdfs:subClassOf sio:Concentration . - -nanomine:MasterCurve a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//MasterCurve" . -======= - rdfs:label "nan" . ->>>>>>> nanomine/master - -nanomine:Matrix a owl:Class ; - rdfs:label "Matrix" ; - rdfs:subClassOf sio:Role . - -nanomine:MatrixComponent a owl:Class ; - rdfs:label "Matrix Component" ; - rdfs:subClassOf nanomine:Component . - -nanomine:MatrixComponentComposition a owl:Class ; - rdfs:label "Matrix Component Composition" ; - rdfs:subClassOf nanomine:Composition . - -nanomine:MatrixProcessing a owl:Class ; - rdfs:label "Matrix Processing" ; - rdfs:subClassOf nanomine:Processing . - -nanomine:MeasurementMethod a owl:Class ; - rdfs:label "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//MeasurementMethod" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Measuring . - -nanomine:MechanicalMixing a owl:Class ; - rdfs:label "Mechanical Mixing" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - nanomine:Mixing ; - skos:definition "Manual mixing" . - -nanomine:MeltMixing a owl:Class ; - rdfs:label "Melt Mixing" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - nanomine:Mixing ; - skos:definition "Mixing of polymer and nanoparticles in molten state" . - -nanomine:MeltProcessing a owl:Class ; - rdfs:label "Melt Processing" ; - rdfs:subClassOf sio:Procedure ; - skos:definition "Mixing of polymer and nanoparticles in molten state" . - -nanomine:MeltViscosity a owl:Class ; - rdfs:label "Melt Viscosity" ; -<<<<<<< HEAD - nanomine:hasSelector "//MeltViscosity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalViscosity . - -nanomine:MeltingTemperature a owl:Class ; - rdfs:label "Melting Temperature" ; -<<<<<<< HEAD - nanomine:hasSelector "//MeltingTemperature" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty, - ; - skos:definition "the temperature at which a solid turns into a liquid" . - -nanomine:Mixer a owl:Class ; - rdfs:label "Mixer" ; - rdfs:subClassOf sio:Device . - -nanomine:MixingMethod a owl:Class ; - rdfs:label "Mixing Method" ; - rdfs:subClassOf sio:Procedure . - -nanomine:MolecularWeight_Mn a owl:Class ; - rdfs:label "Molecular Weight" ; - rdfs:subClassOf sio:Mass ; - skos:altLabel "Number Average Molar Mass" ; - skos:definition "Mn, the number averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the arithmetic mean of the matrix polymer chains." . - -nanomine:MolecularWeight_Mw a owl:Class ; - rdfs:label "Molecular Weight" ; - rdfs:subClassOf sio:Mass ; - skos:altLabel "Mass Average Molar Mass" ; - skos:definition "Mw, the weight averaged molecular weight, typically in units g/mol, kg/mol, or kDa, describes the average size of the matrix polymer chains." . - -nanomine:NonSpherical a owl:Class ; - rdfs:label "Non-spherical Shape" ; - rdfs:subClassOf sio:Shape . - -nanomine:Notched a owl:Class ; - rdfs:label "Notched" ; -<<<<<<< HEAD - nanomine:hasSelector "//Notch" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:MechanicalProperty, - sio:Quality ; - skos:definition "Property of a material sample, in which a uniform notch has been created for the purpose of concentrating stress in a region of interest." . - -nanomine:NuclearMagneticResonance a owl:Class ; - rdfs:label "Nuclear Magnetic Resonance" ; - nanomine:hasSelector "//Nuclear_Magnetic_Resonance" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:Spectroscopy ], - sio:Measuring ; - skos:definition "Molecular analysis due to observed NMR under applied magnetic field" . - -nanomine:NucleationParameterOfAvramiEquation a owl:Class ; - rdfs:label "Nucleation Parameter Of Avrami Equation" ; -<<<<<<< HEAD - nanomine:hasSelector "//NucleationParameterOfAvramiEquation" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Crystallinity ; - skos:definition "Nucleation Parameter in Avrami Equation" . - -nanomine:OpticalMicroscopy a owl:Class ; - rdfs:label "Optical Microscopy" ; - nanomine:hasSelector "//OpticalMicroscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:ViscoelasticProperty ], - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:MechanicalProperty ], -======= - owl:someValuesFrom nanomine:MechanicalProperty ], - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], ->>>>>>> nanomine/master - sio:Measuring ; - skos:definition "Magnification of small objects with visible light" . - -nanomine:Other a owl:Class ; - rdfs:label "Other Processing Parameter" ; - rdfs:subClassOf sio:Procedure . - -nanomine:OtherProcessing a owl:Class ; - rdfs:label "Other Processing" ; - rdfs:subClassOf sio:Procedure . - -nanomine:Other_Processing a owl:Class ; - rdfs:label "Other Processing" ; - rdfs:subClassOf sio:Procedure . - -nanomine:Output a owl:Class ; - rdfs:label "Output" . - -nanomine:Particle a owl:Class ; - rdfs:label "Particle" ; - rdfs:subClassOf nanomine:Nanomaterial ; - skos:definition "particles between 1 and 100 nanometers in size. In nanotechnology, a particle is defined as a small object that behaves as a whole unit with respect to its transport and properties." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanoparticle" . - -nanomine:ParticleDiameter a owl:Class ; - rdfs:label "Particle Diameter" ; - rdfs:subClassOf sio:MeasurementValue ; - skos:definition "Assuming sphere-like particles comprising the filler, the particle diameter is the \"average\" diameter of those particles." . - -nanomine:ParticleSurfaceTreatmentComposition a owl:Class ; - rdfs:label "Particle Surface Treatment Composition" ; - rdfs:subClassOf nanomine:Composition . - -nanomine:PlasticElastic a owl:Class ; - rdfs:label "Plastic Elastic" ; -<<<<<<< HEAD - nanomine:hasSelector "//PlasticElastic" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:FractureToughnessProperty ; - skos:definition "Material deformation that undergoes both elastic and plastic deformation" . - -nanomine:PlateRheometery a owl:Class ; - rdfs:label "Plate Rheometry" ; - nanomine:hasSelector "//Rheometery[RheometerType='plate']" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], - nanomine:Rheometery ; - skos:definition "The falling plate rheometer sandwiches liquid between two solid surfaces. The top plate is fixed, and bottom plate falls under the influence of gravity, drawing out a string of the liquid" . - -nanomine:PoissonsRatio a owl:Class ; - rdfs:label "Poissons Ratio" ; -<<<<<<< HEAD - nanomine:hasSelector "//PoissonsRatio" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileProperty ; - skos:definition "Negative ratio of traverse to axial strain" . - -nanomine:Polydispersity a owl:Class ; - rdfs:label "Polydispersity" ; - rdfs:subClassOf sio:SpatialQuantity ; - skos:altLabel "Dispersity" . - -nanomine:PolymerBlend a owl:Class ; - rdfs:label "Polymer Blend" ; - rdfs:subClassOf sio:Polymer ; - skos:definition "a member of a class of materials analogous to metal alloys, in which at least two polymers are blended together to create a new material with different physical properties." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_blend" . - -nanomine:PolymerNanocomposite a owl:Class ; - rdfs:label "Polymer Nanocomposite" ; - rdfs:subClassOf nanomine:Nanocomposite ; - skos:altLabel "PNC" ; - skos:definition "Polymer nanocomposites (PNC) consist of a polymer or copolymer having nanoparticles or nanofillers dispersed in the polymer matrix. These may be of different shape (e.g., platelets, fibers, spheroids), but at least one dimension must be in the range of 1–50 nm." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Polymer_nanocomposite" . - -nanomine:Power a owl:Class ; - rdfs:label "Power" ; - rdfs:subClassOf sio:Quantity . - -nanomine:PreCrackingProcess a owl:Class ; - rdfs:label "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//preCrackingProcess" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Procedure . - -nanomine:PreLoad a owl:Class ; - rdfs:label "Pre-Load" ; -<<<<<<< HEAD - nanomine:hasSelector "//PreLoad" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:Condition ; - skos:definition "Pre-stress or pre-strain before testing" . - -nanomine:ProbabilityOfFailure a owl:Class ; - rdfs:label "Probability of Failure" ; - rdfs:subClassOf nanomine:ElectricalProperty . - -nanomine:ProceedingsArticle a owl:Class ; - rdfs:label "Conference Proceedings Article" ; - rdfs:subClassOf bibo:AcademicArticle ; - skos:definition "An article published in the proceedings of a conference." . - -nanomine:Profile a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//profile" . -======= - rdfs:label "nan" . ->>>>>>> nanomine/master - -nanomine:PubChemReference a owl:Class ; - rdfs:label "PubChem Reference" ; - rdfs:subClassOf sio:Reference . - -nanomine:PulsedElectroAcoustic a owl:Class ; - rdfs:label "Pulsed Electro Acoustic" ; - nanomine:hasSelector "//Pulsed_Electro_Acoustic" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ElectricalProperty ], - sio:Measuring ; - skos:definition "Measurement of space charge in dielectric materials" . - -nanomine:RadialClearence a owl:Class ; - rdfs:label "Radial Clearence" ; - rdfs:subClassOf nanomine:Dimension, - sio:Height . - -nanomine:RamanSpectroscopy a owl:Class ; - rdfs:label "Raman Spectroscopy" ; - nanomine:hasSelector "//Raman_Spectroscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:Spectroscopy ], - sio:Measuring ; - skos:definition "Molecular analysis with spectroscopic techniques that observe low-frequency modes in a material" . - -nanomine:ResearchArticle a owl:Class ; - rdfs:label "Research Article" ; - rdfs:subClassOf bibo:AcademicArticle . - -nanomine:ReviewArticle a owl:Class ; - rdfs:label "Review Article" ; - rdfs:subClassOf bibo:AcademicArticle . - -nanomine:RheologicalLossModulus a owl:Class ; - rdfs:label "Rheological Loss Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheologicalLossModulus" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalComplexModulus . - -nanomine:RheologicalLossTangent a owl:Class ; - rdfs:label "Rheological Loss Tangent" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheologicalLossTangent" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalComplexModulus . - -nanomine:RheologicalMasterCurve a owl:Class ; - rdfs:label "Rheological Master Curve" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheologicalMasterCurve" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalComplexModulus . - -nanomine:RheologicalStorageModulus a owl:Class ; - rdfs:label "Rheological Storage Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheologicalStorageModulus" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalComplexModulus . - -nanomine:RheometerMode a owl:Class ; - rdfs:label "Rheometer Mode" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheometerMode" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalComplexModulus, - nanomine:RheologicalViscosity . - -nanomine:RollMilling a owl:Class ; - rdfs:label "Roll Milling" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - nanomine:Mixing ; - skos:definition "Grinding process with a roller and flat plate" . - -nanomine:RotationSpeed a owl:Class ; - rdfs:label "Rotation Speed" ; - rdfs:subClassOf sio:Speed . - -nanomine:RotationalMolding a owl:Class ; - rdfs:label "nan" ; - rdfs:subClassOf nanomine:Molding . - -nanomine:SMILES a owl:Class ; - rdfs:label "SMILES" ; - rdfs:subClassOf sio:Representation . - -nanomine:ScanningElectronMicroscopy a owl:Class ; - rdfs:label "Scanning Electron Microscopy" ; - nanomine:hasSelector "//Scanning_Electron_Microscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:used ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:EmissionCurrent ], -======= - owl:someValuesFrom nanomine:Magnification ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:WorkingDistance ], - [ a owl:Restriction ; - owl:onProperty prov:used ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:ExposureTime ], -======= - owl:someValuesFrom nanomine:EmissionCurrent ], - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ElectricalProperty ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:AcceleratingVoltage ], - [ a owl:Restriction ; - owl:onProperty prov:used ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:Magnification ], - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ElectricalProperty ], -======= - owl:someValuesFrom nanomine:ExposureTime ], ->>>>>>> nanomine/master - sio:Measuring ; - skos:definition "Scanning electron microscopy for obtaining microstructure at microscale" . - -nanomine:ScrewChannelDiameter a owl:Class ; - rdfs:label "Screw Channel Diameter" ; - rdfs:subClassOf . - -nanomine:Shear a owl:Class ; - rdfs:label "Shear" ; - rdfs:subClassOf nanomine:ViscoelasticProperty ; - skos:definition "Describing opposing in-plane forces on a material." . - -nanomine:ShearLoadingProfile a owl:Class ; - rdfs:label "Shear Loading Profile" ; -<<<<<<< HEAD - nanomine:hasSelector "//Shear/LoadingProfile" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ShearProperty ; - skos:definition "Stress vs. strain curve of during shear loading and/or unloading test" . - -nanomine:ShearModulus a owl:Class ; - rdfs:label "Shear Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//ShearModulus" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ShearProperty ; - skos:definition "Ratio of shear stress to shear strain" . - -nanomine:ShearStressAtBreak a owl:Class ; - rdfs:label "Shear Stress At Break" ; -<<<<<<< HEAD - nanomine:hasSelector "//ShearStressAtBreak" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ShearProperty ; - skos:definition "Shear stress when specimen breaks" . - -nanomine:ShearStressAtYield a owl:Class ; - rdfs:label "Shear Stress At Yield" ; -<<<<<<< HEAD - nanomine:hasSelector "//ShearStressAtYield" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ShearProperty ; - skos:definition "Shear stress at yield point" . - -nanomine:SingleScrew a owl:Class ; - rdfs:label "Single Screw Extruder" ; - rdfs:subClassOf nanomine:Extruder . - -nanomine:SolutionProcessing a owl:Class ; - rdfs:label "Solution Processing" ; - rdfs:subClassOf sio:Procedure ; - skos:definition "Mixing of dissolvable polymer with nanoparticles" . - -nanomine:SolventAmount a owl:Class ; - rdfs:label "Solvent Amount" ; - rdfs:subClassOf sio:Quantity . - -nanomine:SolventName a owl:Class ; - rdfs:label "Solvent Name" ; - rdfs:subClassOf sio:Name . - -nanomine:SpecificHeatCapacity_Cp a owl:Class ; - rdfs:label "Specific Heat Capacity Cp" ; -<<<<<<< HEAD - nanomine:hasSelector "//SpecificHeatCapacity_Cp" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty ; - skos:definition "Cp for a gas is the change in the enthalpy (H) of the system with respect to change in temperature at a fixed pressure of the system" . - -nanomine:SpecificHeatCapacity_Cv a owl:Class ; - rdfs:label "Specific Heat Capacity Cv" ; -<<<<<<< HEAD - nanomine:hasSelector "//SpecificHeatCapacity_Cv" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty ; - skos:definition "Cv for a gas is the change in internal energy (U) of a system with respect to change in temperature at a fixed volume of the system" . - -nanomine:SpecificSurfaceArea a owl:Class ; - rdfs:label "Specific Surface Area" ; - rdfs:subClassOf sio:SurfaceArea . - -nanomine:StdChemicalName a owl:Class ; - rdfs:label "StdChemicalName" ; - rdfs:subClassOf nanomine:ChemicalName . - -nanomine:Stirring a owl:Class ; - rdfs:label "Stirring" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Solvent ], - nanomine:Mixing ; - skos:definition "Manual stirring of liquid solutions" . - -nanomine:StrainAmplitude a owl:Class ; - rdfs:label "Strain Amplitude", - "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//StrainAmplitude", - "//strainAmplitude" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Condition ; - skos:definition "The magnitude of forced displacement of a material sample." . - -nanomine:StrainAtBreak a owl:Class ; - rdfs:label "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//StrainAtBreak" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:Strain . - -nanomine:StrainRate a owl:Class ; - rdfs:label "Strain Rate", - "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//StrainRate", - "//strainRate" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:Condition ; - skos:definition "Rate of strain change" . - -nanomine:StrainSweep a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//StrainSweep" . -======= - rdfs:label "nan" . ->>>>>>> nanomine/master - -nanomine:Stress a owl:Class ; - rdfs:label "Stress" ; - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "When a material is loaded with a force, it produces a stress, which then causes a material to deform. " . - -nanomine:StressRelaxation a owl:Class ; - rdfs:label "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//StressRelaxation" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:RateOfChange . - -nanomine:SurfaceChemistryProcessing a owl:Class ; - rdfs:label "Surface Chemistry Processing" ; - rdfs:subClassOf nanomine:Processing . - -nanomine:SurfaceResistivity a owl:Class ; - rdfs:label "Surface Resistivity" ; -<<<<<<< HEAD - nanomine:hasSelector "//SurfaceResistivity" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "Ability to resist leakage current along the surface of an insulating material" . - -nanomine:SurfaceTension a owl:Class ; - rdfs:label "Surface Tension" ; -<<<<<<< HEAD - nanomine:hasSelector "//SurfaceTension" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:VolumetricProperty ; - skos:definition "the force that causes the molecules on the surface of a liquid to be pushed together and form a layer" . - -nanomine:SurfaceTreatment a owl:Class ; - rdfs:label "Surface Treatment" ; - rdfs:subClassOf sio:Role . - -nanomine:Syndiotactic a owl:Class ; - rdfs:label "Syndiotactic" ; - rdfs:subClassOf nanomine:Tacticity ; - skos:definition "In syndiotactic or syntactic macromolecules the substituents have alternate positions along the chain. The macromolecule consists 100% of racemo diads. Syndiotactic polystyrene, made by metallocene catalysis polymerization, is crystalline with a melting point of 161 °C. Gutta percha is also an example for Syndiotactic polymer." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity#Syndiotactic_polymers" . - -nanomine:TechnicalComment a owl:Class ; - rdfs:label "Technical Comment" ; - rdfs:subClassOf bibo:Document . - -nanomine:TemperatureSweep a owl:Class ; - rdfs:label "Temperature Sweep" ; -<<<<<<< HEAD - nanomine:hasSelector "//TemperatureSweep" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:DMA_Mode . - -nanomine:Tensile a owl:Class ; - rdfs:label "Tensile" ; -<<<<<<< HEAD - nanomine:hasSelector "//MeasurementMode" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ViscoelasticProperty ; - skos:definition "Describing countervailing forces applied outward along the central axis of a material." . - -nanomine:TensileCreepCompliance a owl:Class ; - rdfs:label "Tensile Creep Compliance" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileCreepCompliance" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileCreep ; - skos:definition "Inverse of tensile creep modulus " . - -nanomine:TensileCreepModulus a owl:Class ; - rdfs:label "Tensile Creep Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileCreepModulus" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileCreep ; - skos:definition "Elastic modulus during creep test" . - -nanomine:TensileCreepRecovery a owl:Class ; - rdfs:label "Tensile Creep Recovery" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileCreepRecovery" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileCreep ; - skos:definition "Ability of material to recover to original state after creep" . - -nanomine:TensileCreepRuptureStrength a owl:Class ; - rdfs:label "Tensile Creep Rupture Strength" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileCreepRuptureStrength" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileCreep ; - skos:definition "Material strength at rupture during a tensile creep test" . - -nanomine:TensileCreepRuptureTime a owl:Class ; - rdfs:label "Tensile Creep Rupture Time" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileCreepRuptureTime" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileCreep ; - skos:definition "Time taken to rupture from applying load during a tensile creep test" . - -nanomine:TensileCreepStrain a owl:Class ; - rdfs:label "Tensile Creep Strain" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileCreepStrain" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileCreep ; - skos:definition "Profile of strain as a function of time during a tensile creep test" . - -nanomine:TensileLoadingProfile a owl:Class ; - rdfs:label "Tensile Loading Profile" ; -<<<<<<< HEAD - nanomine:hasSelector "//Tensile/LoadingProfile" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileProperty ; - skos:definition "Stress vs. strain curve of during tensile loading and/or unloading test" . - -nanomine:TensileModulus a owl:Class ; - rdfs:label "Tensile Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileModulus" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Young's modulus, or elastic modulus, describes tensile elasticity, or the tendency of an object to deform along an axis when opposing forces are applied along that axis; it is defined as the ratio of tensile stress to tensile strain." . - -nanomine:TensileStrength a owl:Class ; - rdfs:label "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileStrength" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileProperty . - -nanomine:TensileStressAtBreak a owl:Class ; - rdfs:label "Tensile Stress At Break" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileStressAtBreak" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Tensile stress at the moment at which a test specimen tears" . - -nanomine:TensileStressAtYield a owl:Class ; - rdfs:label "Tensile Stress At Yield" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileStressAtYield" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:TensileProperty ; - skos:definition "Tensile stress corresponding to the yield point (an increase in strain does not result in an increase in stress)." . - -nanomine:TensileToughness a owl:Class ; - rdfs:label "Tensile Toughness" ; -<<<<<<< HEAD - nanomine:hasSelector "//TensileToughness" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:TensileProperty ; - skos:definition "The amount of energy a material can absorb prior to fracture under an applied tensile load." . - -nanomine:ThermalConductivity a owl:Class ; - rdfs:label "Thermal Conductivity" ; -<<<<<<< HEAD - nanomine:hasSelector "//ThermalConductivity" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty ; - skos:definition "a measure of the ability of a substance to conduct heat, determined by the rate of heat flownormally through an area in the substance divided by the area and by minus the component of the temperaturegradient in the direction of flow" . - -nanomine:ThermalDecompositionTemperature a owl:Class ; - rdfs:label "Thermal Decomposition Temperature" ; -<<<<<<< HEAD - nanomine:hasSelector "//ThermalDecompositionTemperature" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty, - ; - skos:definition "Thermal decomposition temperature of a substance is the temperature at which the substance chemically decomposes by heat" . - -nanomine:ThermalDiffusivity a owl:Class ; - rdfs:label "Thermal Diffusivity" ; -<<<<<<< HEAD - nanomine:hasSelector "//ThermalDiffusivity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ThermalProperty ; - skos:definition "thermal diffusivity is the thermal conductivity divided by density and specific heat capacity at constant pressure. It measures the rate of transfer of heat of a material from the hot side to the cold side" . - -nanomine:ThermogravimetricAnalysis a owl:Class ; - rdfs:label "Thermogravimetric Analysis" ; - nanomine:hasSelector "//Thermogravimetric_Analysis" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ThermalProperty ], - sio:Measuring ; - skos:definition "Thermal analysis of material properties as function of temperature and time" . - -nanomine:Thermoplastic a owl:Class ; - rdfs:label "Thermoplastic" ; - rdfs:subClassOf nanomine:Plastic ; - skos:definition "a plastic material, a polymer, that becomes pliable or moldable above a specific temperature and solidifies upon cooling." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermoplastic" . - -nanomine:Thermoset a owl:Class ; - rdfs:label "Thermoset" ; - rdfs:subClassOf nanomine:Plastic ; - skos:definition "a cured thermosetting resin. A thermosetting resin is a prepolymer in a soft solid or viscous liquid state that changes irreversibly into an infusible, insoluble polymer network by curing." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Thermosetting_polymer" . - -nanomine:Torsion a owl:Class ; - rdfs:label "Torsion" ; - rdfs:subClassOf nanomine:ViscoelasticProperty ; - skos:definition "Describing countervailing rotational forces about the central axis of a material, separated by some distance along the central axis of the material; \"twisting\" force" . - -nanomine:Total a owl:Class ; - rdfs:label "Total" ; - rdfs:subClassOf sio:Quantity . - -nanomine:TradeName a owl:Class ; - rdfs:label "Trade Name" ; - rdfs:subClassOf sio:Name ; - skos:definition "The common, non-chemical name for a chemical substance." . - -nanomine:TransmissionElectronMicroscopy a owl:Class ; - rdfs:label "Transmission Electron Microscopy" ; - nanomine:hasSelector "//Transmission_Electron_Microscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:used ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:AcceleratingVoltage ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:WorkingDistance ], -======= - owl:someValuesFrom nanomine:ExposureTime ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:AcceleratingVoltage ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ElectricalProperty ], - [ a owl:Restriction ; - owl:onProperty prov:used ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:ExposureTime ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:EmissionCurrent ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:Magnification ], -======= - owl:someValuesFrom nanomine:Magnification ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:WorkingDistance ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:EmissionCurrent ], ->>>>>>> nanomine/master - sio:Measuring ; - skos:definition "Transmission electron microscopy for obtaining microstructure at nanoscale" . - -nanomine:TwinScrew a owl:Class ; - rdfs:label "Twin Screw Extruder" ; - rdfs:subClassOf nanomine:Extruder . - -nanomine:Ultra-sonication a owl:Class ; - rdfs:label "Ultra Sonication" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - nanomine:Mixing ; - skos:definition "The irradiation of a liquid sample with ultrasonic (>20 kHz) waves resulting in agitation" . - -nanomine:Vacuum a owl:Class ; - rdfs:label "Vacuum" ; - rdfs:subClassOf nanomine:AmbientCondition . - -nanomine:VacuumMolding a owl:Class ; - rdfs:label "nan" ; - rdfs:subClassOf nanomine:Molding . - -nanomine:Viscosity a owl:Class ; - rdfs:label "Viscosity" ; - rdfs:subClassOf ; - skos:definition "a measure of its resistance to gradual deformation by shear stress or tensile stress." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Viscosity" . - -nanomine:VolumeExpansionCoefficient a owl:Class ; - rdfs:label "Volume Expansion Coefficient" ; -<<<<<<< HEAD - nanomine:hasSelector "//VolumeExpansionCoefficient" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:VolumetricProperty ; - skos:definition "volumetric coefficient of thermal expansion" . - -nanomine:VolumeFraction a owl:Class ; - rdfs:label "Volume Fraction" ; - rdfs:subClassOf sio:Concentration ; - skos:definition "The volume of a constituent divided by the volume of all constituents of the mixture prior to mixing." . - -nanomine:VolumeResistivity a owl:Class ; - rdfs:label "Volume Resistivity" ; -<<<<<<< HEAD - nanomine:hasSelector "//VolumeResistivity" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "Ability to oppose the flow of electric current." . - -nanomine:WaterAbsorption a owl:Class ; - rdfs:label "Water Absorption" ; -<<<<<<< HEAD - nanomine:hasSelector "//WaterAbsorption" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:VolumetricProperty ; - skos:definition "The amount of weight gain (%) experienced in a polymer after immersion in water for a specific length of time under controlled environment." . - -nanomine:WeibullPlot a owl:Class ; - rdfs:label "Weilbull Plot" ; -<<<<<<< HEAD - nanomine:hasSelector "//WeibullPlot" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:DielectricBreakdownStrength . - -nanomine:WeightLoss a owl:Class ; - rdfs:label "Weight Loss" ; -<<<<<<< HEAD - nanomine:hasSelector "//WeightLoss" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:VolumetricProperty . - -nanomine:XRayDiffractionAndScattering a owl:Class ; - rdfs:label "XRay Diffraction and Scattering" ; - nanomine:hasSelector "//XRay_Diffraction_and_Scattering" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:Spectroscopy ], - sio:Measuring ; - skos:definition "Non-destructive X-ray measurement for crystal structure, chemical composition, and physical properties" . - -nanomine:XRayPhotoelectronSpectroscopy a owl:Class ; - rdfs:label "X-Ray Photoelectron Spectroscopy" ; - nanomine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:Spectroscopy ], - sio:Measuring . - -nanomine:XRay_Photoelectron_Spectroscopy a owl:Class ; - rdfs:label "nan" ; - nanomine:hasSelector "//XRay_Photoelectron_Spectroscopy" ; - rdfs:subClassOf sio:Measuring ; - skos:definition "XRay_Photoelectron_Spectroscopy (abbr. XPS) is a spectroscopy for material characterization;" . - -nanomine:sampleShape a owl:Class ; -<<<<<<< HEAD - rdfs:label "nan" ; - nanomine:hasSelector "//sampleShape" . -======= - rdfs:label "nan" . ->>>>>>> nanomine/master - -nanomine:uSMILES a owl:Class ; - rdfs:label "uSMILES" ; - rdfs:subClassOf sio:Representation . - - a sio:UnitOfMeasurement ; - rdfs:label "Joule per Centimeter" ; - skos:notation "J/cm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Joule per Gram-Celsius" ; - skos:notation "J/gC" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Joule per Gram-Kelvin" ; - skos:notation "J/gK" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Kilojoule per Square Meter" ; - skos:notation "kJ/m^2" . - - a sio:UnitOfMeasurement ; - rdfs:label "Kilovolt per Centimeter" ; - skos:notation "kV/cm" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Kilovolt per Millimeter" ; - skos:notation "kV/mm" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Log Hertz" ; - skos:notation "log(Hz)" . - - a sio:UnitOfMeasurement ; - rdfs:label "Square Millimeter per Second" ; - skos:notation "mm^2/s" . - - a sio:UnitOfMeasurement ; - rdfs:label "Millimeters per millimeter" ; - skos:notation "mm/mm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Ohm Centimeter" ; - skos:notation "Ω cm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Parts per million per degree centigrade" ; - skos:notation "ppm/C" . - - a sio:UnitOfMeasurement ; - rdfs:label "Rotation per Minute" ; - skos:notation "rpm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Megavolt per Meter" ; - skos:notation "MV/m" . - - a sio:UnitOfMeasurement ; - rdfs:label "Radian per Minute" ; - skos:notation "rad/min" . - - a sio:UnitOfMeasurement ; - rdfs:label "Siemens per Centimeter" ; - skos:notation "S/cm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Volt per Centimeter" ; - skos:notation "V/cm" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Joule per Gram" ; - skos:notation "J/gm" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Kelvin per Minute" ; - skos:notation "K/min" . - - a sio:UnitOfMeasurement ; - rdfs:label "per Kelvin" ; - skos:notation "1/K" . - -sio:AspectRatio a owl:Class ; - rdfs:label "Aspect Ratio" ; - rdfs:subClassOf sio:Ratio ; - skos:definition "The aspect ratio of a geometric shape is the ratio of its sizes in different dimensions." . - -sio:Chapter a owl:Class ; - rdfs:label "Chapter" . - -sio:Citation a owl:Class ; - rdfs:label "Citation Type" . - -sio:Day a sio:UnitOfMeasurement ; - rdfs:label "Day" ; - skos:notation "dy" . - -sio:Description a owl:Class ; - rdfs:label "Description" ; - nanomine:hasSelector "//Description" ; - rdfs:subClassOf sio:LanguageEntity . - -sio:Hour a sio:UnitOfMeasurement ; - rdfs:label "Hour" ; - skos:notation "Hr" . - -sio:Publication a owl:Class ; - rdfs:label "Publication" . - -sio:Rotation a owl:Class ; - rdfs:label "Rotation" ; - rdfs:subClassOf sio:Quantity . - -sio:Week a sio:UnitOfMeasurement ; - rdfs:label "Week" ; - skos:notation "wk" . - - a sio:UnitOfMeasurement ; - rdfs:label "Ampere per Square Meter" ; - skos:notation "A/m^2" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Celsius" ; - skos:notation "C" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Celsius per Minute" ; - skos:notation "C/min" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Gigapascal" ; - skos:notation "GPa" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Gram per Cubic Centimeter" ; - skos:notation "g/cm^3" . - -<<<<<<< HEAD - a nanomine:AbsoluteUnitOfMeasurement, - sio:UnitOfMeasurement ; - rdfs:label "Hertz" ; - skos:notation "Hz" . - -======= ->>>>>>> nanomine/master - a nanomine:AbsoluteUnitOfMeasurement, - sio:UnitOfMeasurement ; - rdfs:label "Kelvin" ; - skos:notation "K" . - - a sio:UnitOfMeasurement ; - rdfs:label "Kiloelectronvolt" ; - skos:notation "keV" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Kilogram per Cubic Meter" ; - skos:notation "kg/m^3" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Kilogram per Liter" ; - skos:notation "kg/L" . - - a sio:UnitOfMeasurement ; - rdfs:label "Kilohertz" ; - skos:notation "kHz" . - - a sio:UnitOfMeasurement ; - rdfs:label "Kilopascal" ; - skos:notation "kPa" . - - a sio:UnitOfMeasurement ; - rdfs:label "Kilovolt" ; - skos:notation "kV" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Megapascal" ; - skos:notation "MPa" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Micrometer" ; - skos:notation "µm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Millimeter" ; - skos:notation "mm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Minute" ; - skos:notation "min" . - - a sio:UnitOfMeasurement ; - rdfs:label "Mole per Cubic Meter" ; - skos:notation "mol/m^3" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Nanometer" ; - skos:notation "nm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Ohm Meter" ; - skos:notation "Ω m" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Pascal" ; - skos:notation "Pa" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Percent" ; - skos:notation "%" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Radian per Second" ; - skos:notation "rad/s" . - - a sio:UnitOfMeasurement ; - rdfs:label "Second" ; - skos:notation "s" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Siemens per Meter" ; - skos:notation "S/m" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "Square Meter per Gram" ; - skos:notation "m^2/g" . - - a sio:UnitOfMeasurement ; - rdfs:label "nan" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "Watt per Meter-Kelvin" ; - skos:notation "W/mK" . - -======= ->>>>>>> nanomine/master -nanomine:Amperage a owl:Class ; - rdfs:label "Amperage" ; - rdfs:subClassOf sio:Quantity . - -nanomine:CapillarySize a owl:Class ; - rdfs:label "Capillar Size" ; - nanomine:hasSelector "//CapillarySize" ; - rdfs:subClassOf sio:Parameter . - -nanomine:ChannelDepth a owl:Class ; - rdfs:label "Channel Depth" ; - rdfs:subClassOf sio:Depth . - -nanomine:ChannelsPerScrew a owl:Class ; - rdfs:label "Channels per Screw" ; - rdfs:subClassOf sio:Quantity . - -nanomine:ChemicalName a owl:Class ; - rdfs:label "Chemical Name" ; - rdfs:subClassOf sio:Name . - -nanomine:CoolingRate a owl:Class ; - rdfs:label "Cooling Rate" ; - nanomine:hasSelector "//CoolingRate" ; - rdfs:subClassOf sio:Parameter . - -nanomine:DLRatio a owl:Class ; - rdfs:label "Screw Diameter/Length Ratio" ; - rdfs:subClassOf sio:Ratio . - -nanomine:DMA_Mode a owl:Class ; - rdfs:label "Dynamic Mechanical Analysis" ; -<<<<<<< HEAD - nanomine:hasSelector "//DMA_Mode" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:DynamicProperties, - . - -nanomine:DielectricBreakdownStrength a owl:Class ; - rdfs:label "Dielectric Breakdown Strength" ; -<<<<<<< HEAD - nanomine:hasSelector "//DielectricBreakdownStrength" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - nanomine:ElectricalProperty ; - skos:definition "Maximum voltage required to produce a dielectric breakdown through the material and is expressed as Volts per unit thickness." . - -nanomine:ExtrusionTemperature a owl:Class ; - rdfs:label "Extrusion Temperature" ; - rdfs:subClassOf . - -<<<<<<< HEAD -======= -nanomine:FillerComponent a owl:Class ; - rdfs:label "Filler Component" ; - rdfs:subClassOf nanomine:Component . - ->>>>>>> nanomine/master -nanomine:FlightClearance a owl:Class ; - rdfs:label "Flight Clearance" ; - rdfs:subClassOf sio:Height ; - skos:altLabel "Radial Flight Clearance" . - -nanomine:FlightWidth a owl:Class ; - rdfs:label "Flight Width" ; - rdfs:subClassOf sio:Width . - -nanomine:HeatingRate a owl:Class ; - rdfs:label "Heating Rate" ; - nanomine:hasSelector "//HeatingRate" ; - rdfs:subClassOf sio:Parameter . - -nanomine:Impact a owl:Class ; - rdfs:label "Impact" ; -<<<<<<< HEAD - nanomine:hasSelector "//Impact" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:FractureToughnessProperty ; - skos:definition "Izod impact resistance of materials" . - -nanomine:InnerBarrelDiameter a owl:Class ; - rdfs:label "Inner Barrel Diameter" ; - rdfs:subClassOf . - -nanomine:MeltTemperature a owl:Class ; - rdfs:label "Melt Temperature" ; - rdfs:subClassOf . - -nanomine:Nanocomposite a owl:Class ; - rdfs:label "Nanocomposite" ; - rdfs:subClassOf nanomine:Nanomaterial ; - skos:definition "a multiphase solid material where one of the phases has one, two or three dimensions of less than 100 nanometers (nm), or structures having nano-scale repeat distances between the different phases that make up the material. In the broadest sense this definition can include porous media, colloids, gels and copolymers, but is more usually taken to mean the solid combination of a bulk matrix and nano-dimensional phase(s) differing in properties due to dissimilarities in structure and chemistry." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanocomposite" . - -nanomine:PressureAtDie a owl:Class ; - rdfs:label "Pressure at Die" ; - rdfs:subClassOf . - -nanomine:ProcessingCondition a owl:Class ; - rdfs:label "Processing Condition" ; - rdfs:subClassOf sio:Quality . - -nanomine:ResidenceTime a owl:Class ; - rdfs:label "Residence Time" ; - rdfs:subClassOf sio:TimeInterval . - -nanomine:RotationalFrequency a owl:Class ; - rdfs:label "Rotational Frequency" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:hasValue ; - owl:onProperty sio:hasUnit ], - sio:Frequency ; - skos:definition """The number of rotations of an object around an axis per unit time. -""" . - -nanomine:ScrewChannelWidth a owl:Class ; - rdfs:label "Screw Channel Width" ; - rdfs:subClassOf sio:Width . - -nanomine:ScrewDiameter a owl:Class ; - rdfs:label "Screw Diameter" ; - rdfs:subClassOf . - -nanomine:ScrewLead a owl:Class ; - rdfs:label "Screw Lead" ; - rdfs:subClassOf sio:Length . - -nanomine:ScrewLength a owl:Class ; - rdfs:label "Screw Length" ; - rdfs:subClassOf sio:Length . - -nanomine:Strain a owl:Class ; - rdfs:label "Strain" ; - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "Engineering strain is defined as the amount of deformation in the direction of the applied force divided by the initial length of the material." . - -nanomine:Throughput a owl:Class ; - rdfs:label "Throughput" ; - rdfs:subClassOf sio:Quantity . - -nanomine:Torque a owl:Class ; - rdfs:label "Torque" ; - rdfs:subClassOf . - -nanomine:Voltage a owl:Class ; - rdfs:label "Voltage" ; - rdfs:subClassOf sio:Quantity . - - a sio:UnitOfMeasurement ; - rdfs:label "1/Pa" . - -<<<<<<< HEAD - a sio:UnitOfMeasurement ; - rdfs:label "1/s", - "Per Second" ; - skos:notation "1/s" . - -======= ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "C/m^2" . - - a sio:UnitOfMeasurement ; - rdfs:label "J/m^3" . - - a sio:UnitOfMeasurement ; - rdfs:label "kg/m^3" . - -<<<<<<< HEAD -======= - a sio:UnitOfMeasurement ; - rdfs:label "Kilovolt per Millimeter" ; - skos:notation "kV/mm" . - ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "m^2" . - - a sio:UnitOfMeasurement ; - rdfs:label "m^2/s" . - - a sio:UnitOfMeasurement ; - rdfs:label "m^3/K" . - - a sio:UnitOfMeasurement ; - rdfs:label "m/K" . - - a sio:UnitOfMeasurement ; - rdfs:label "nanomine:revolutions_per_minute" . - - a sio:UnitOfMeasurement ; - rdfs:label "nm" . - - a sio:UnitOfMeasurement ; - rdfs:label "S/m" . - - a sio:UnitOfMeasurement ; - rdfs:label "V/m" . - - a sio:UnitOfMeasurement ; - rdfs:label "W/(m*K)" . - -bibo: rdfs:label "BIBO" . - - rdfs:label "SIO" . - -sio:Depth a owl:Class ; - rdfs:label "Depth" ; - rdfs:subClassOf nanomine:Dimension, - . - -sio:Frequency a owl:Class ; - rdfs:label "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//frequency" ; -======= - nanomine:hasPreferredUnit ; ->>>>>>> nanomine/master - rdfs:subClassOf sio:RateOfChange . - -sio:SurfaceArea a owl:Class ; - rdfs:label "Surface Area" ; - rdfs:subClassOf sio:Area . - - rdfs:label "Nanopub" . - -<<<<<<< HEAD -======= - a nanomine:AbsoluteUnitOfMeasurement, - sio:UnitOfMeasurement ; - rdfs:label "Hertz" ; - skos:notation "Hz" . - - a sio:UnitOfMeasurement ; - rdfs:label "Kilogram per Cubic Meter" ; - skos:notation "kg/m^3" . - - a sio:UnitOfMeasurement ; - rdfs:label "Nanometer" ; - skos:notation "nm" . - - a sio:UnitOfMeasurement ; - rdfs:label "Siemens per Meter" ; - skos:notation "S/m" . - - a sio:UnitOfMeasurement ; - rdfs:label "Watt per Meter-Kelvin" ; - skos:notation "W/mK" . - ->>>>>>> nanomine/master -nanomine:AcceleratingVoltage a owl:Class ; - rdfs:label "Accelerating Voltage" ; - nanomine:hasSelector "//AcceleratingVoltage" ; - rdfs:subClassOf sio:Parameter . - -nanomine:EmissionCurrent a owl:Class ; - rdfs:label "Emission Current" ; - nanomine:hasSelector "//EmissionCurrent" ; - rdfs:subClassOf sio:Parameter . - -nanomine:ExposureTime a owl:Class ; - rdfs:label "Exposure Time" ; - nanomine:hasSelector "//ExposureTime" ; - rdfs:subClassOf sio:Parameter . - -nanomine:Magnification a owl:Class ; - rdfs:label "Magnification" ; - nanomine:hasSelector "//Magnification" ; - rdfs:subClassOf sio:Parameter . - -nanomine:Nanomaterial a owl:Class ; - rdfs:label "Nanomaterial" ; - rdfs:subClassOf sio:MaterialEntity ; - skos:definition "materials of which a single unit is sized (in at least one dimension) between 1 and 1000 nanometres (10−9 meter) but is usually 1—100 nm" ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Nanomaterials" . - -nanomine:RheologicalProperty a owl:Class ; - rdfs:label "Rheological Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Rheological" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity . - -nanomine:RotationMode a owl:Class ; - rdfs:label "Rotation Mode" ; - rdfs:subClassOf sio:Quality . - -nanomine:WorkingDistance a owl:Class ; - rdfs:label "Working Distance" ; - nanomine:hasSelector "//WorkingDistance" ; - rdfs:subClassOf sio:Parameter . - -<<<<<<< HEAD -======= - a sio:UnitOfMeasurement ; - rdfs:label "1/s", - "Per Second" ; - skos:notation "1/s" . - - a sio:UnitOfMeasurement ; - rdfs:label "Joule per Gram-Kelvin" ; - skos:notation "J/gK" . - ->>>>>>> nanomine/master - a sio:UnitOfMeasurement ; - rdfs:label "J/K" . - - a sio:UnitOfMeasurement ; - rdfs:label "Ohm*m" . - -<<<<<<< HEAD -======= - a sio:UnitOfMeasurement ; - rdfs:label "Joule per Gram" ; - skos:notation "J/gm" . - ->>>>>>> nanomine/master -sio:Width a owl:Class ; - rdfs:label "Width" ; - rdfs:subClassOf nanomine:Dimension . - -<<<<<<< HEAD -======= - a sio:UnitOfMeasurement ; - rdfs:label "Ohm Meter" ; - skos:notation "Ω m" . - ->>>>>>> nanomine/master -nanomine:CompressiveCreep a owl:Class ; - rdfs:label "Compressive Creep" ; - rdfs:subClassOf nanomine:Creep ; - skos:definition "creep during compressive test" . - -nanomine:Condition a owl:Class ; - rdfs:label "Condition", - "nan" ; -<<<<<<< HEAD - nanomine:hasSelector "//Condition", - "//condition" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:CompressionProperty . - -nanomine:Creep a owl:Class ; - rdfs:label "Creep" ; -<<<<<<< HEAD - nanomine:hasSelector "//Creep" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ViscoelasticProperty ; - skos:definition "creep is the tendency of material to move slowly or deform permanently under the influence of mechanical stresses" . - -nanomine:Extruder a owl:Class ; - rdfs:label "Extruder" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:FlightWidth ], -======= - owl:someValuesFrom nanomine:Voltage ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ScrewLength ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:ScrewChannelWidth ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ChannelsPerScrew ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ResidenceTime ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Voltage ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Torque ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Throughput ], -======= - owl:someValuesFrom nanomine:MeltTemperature ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Throughput ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ScrewDiameter ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ChannelsPerScrew ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ChannelDepth ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ExtrusionTemperature ], ->>>>>>> nanomine/master - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:InnerBarrelDiameter ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom nanomine:Dimension ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ScrewLead ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Amperage ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ExtrusionTemperature ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:MeltTemperature ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:FlightClearance ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ChannelDepth ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:DLRatio ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:PressureAtDie ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ScrewDiameter ], -======= - owl:someValuesFrom nanomine:PressureAtDie ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ScrewChannelWidth ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ScrewLead ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Amperage ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:DLRatio ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:FlightWidth ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Torque ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:FlightClearance ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:ResidenceTime ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:Dimension ], ->>>>>>> nanomine/master - sio:Device . - -nanomine:FlexuralCreep a owl:Class ; - rdfs:label "Flexural Creep" ; - rdfs:subClassOf nanomine:Creep ; - skos:definition "creep during flexural or bending test" . - -nanomine:HardnessProperty a owl:Class ; - rdfs:label "Hardness Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Hardness" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "Materials property representing the material's resistance to deformation under an applied compressive load from a test fixture of known tip geometry." . - -nanomine:Plastic a owl:Class ; - rdfs:label "Plastic" ; - rdfs:subClassOf sio:Polymer ; - skos:definition "a material consisting of any of a wide range of synthetic or semi-synthetic organic compounds that are malleable and can be molded into solid objects. Plastics are typically organic polymers of high molecular mass, but they often contain other substances." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Plastic" . - -nanomine:RheologicalViscosity a owl:Class ; - rdfs:label "Rheological Viscosity" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheologicalViscosity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalProperty . - -nanomine:Rheometery a owl:Class ; - rdfs:label "Rheometry" ; - nanomine:hasSelector "//Rheometery" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty prov:generated ; - owl:someValuesFrom nanomine:ViscoelasticProperty ], - [ a owl:Restriction ; - owl:onProperty prov:used ; - owl:someValuesFrom nanomine:CapillarySize ], - sio:Measuring ; - skos:definition "Measurement of the quantitative and qualitative relationships between deformations and stresses and their derivatives" . - -nanomine:Solvent a owl:Class ; - rdfs:label "Solvent" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:Quantity ], - sio:ChemicalEntity ; - skos:definition "Solvent used in composite synthesis" . - - a sio:UnitOfMeasurement ; - rdfs:label "m" . - - a sio:UnitOfMeasurement ; - rdfs:label "s" . - -sio:Length a owl:Class ; - rdfs:label "Length" ; - rdfs:subClassOf nanomine:Dimension, - . - -sio:Ratio a owl:Class ; - rdfs:label "Fraction" ; - rdfs:subClassOf sio:DimensionlessQuantity . - -<<<<<<< HEAD -nanomine:FractureToughnessProperty a owl:Class ; - rdfs:label "Fracture Toughness Property" ; - nanomine:hasSelector "//FractureToughness" ; -======= - a sio:UnitOfMeasurement ; - rdfs:label "Percent" ; - skos:notation "%" . - -nanomine:FractureToughnessProperty a owl:Class ; - rdfs:label "Fracture Toughness Property" ; ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "Ability of material containing a crack to resist fracture" . - -nanomine:ShearProperty a owl:Class ; - rdfs:label "Shear Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Shear" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "Properties of how the material will react to forces being applied in shear" . - -nanomine:Tacticity a owl:Class ; - rdfs:label "Tacticity" ; - rdfs:subClassOf sio:ChemicalQuality ; - skos:definition "the relative stereochemistry of adjacent chiral centers within a macromolecule." ; - prov:wasQuotedFrom "https://en.wikipedia.org/wiki/Tacticity" . - - a sio:UnitOfMeasurement ; - rdfs:label "N" . - -sio:Polymer a owl:Class ; - rdfs:label "Polymer" ; - rdfs:subClassOf sio:Molecule . - - a owl:Class ; - rdfs:label "Diameter" ; - rdfs:subClassOf nanomine:Dimension, - . - -nanomine:Crystallinity a owl:Class ; - rdfs:label "Crystallinity" ; -<<<<<<< HEAD - nanomine:hasSelector "//Crystallinity" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:ThermalProperty ; - skos:definition "degree of structural order in a solid" . - -nanomine:FlexuralProperty a owl:Class ; - rdfs:label "Flexural Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Flexural" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "Properties of how the material will react to forces being applied in bending" . - -nanomine:Molding a owl:Class ; - rdfs:label "Molding" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD -======= - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; ->>>>>>> nanomine/master - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:TimeInterval ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:AmbientCondition ], -<<<<<<< HEAD - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], -======= ->>>>>>> nanomine/master - sio:Procedure ; - skos:definition "Methods to shape final composite" . - -nanomine:RheologicalComplexModulus a owl:Class ; - rdfs:label "Rheological Complex Modulus" ; -<<<<<<< HEAD - nanomine:hasSelector "//RheologicalComplexModulus" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:RheologicalProperty . - -nanomine:Spectroscopy a owl:Class ; - rdfs:label "Spectroscopy" ; -<<<<<<< HEAD - nanomine:hasSelector "//Spectrocopy" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "The chemical composition ,composition variation ,crystal structure & photo-electric properties of the materials." . - - a sio:UnitOfMeasurement ; - rdfs:label "J" . - - a sio:UnitOfMeasurement ; - rdfs:label "K" . - -<<<<<<< HEAD -nanomine:CompressionProperty a owl:Class ; - rdfs:label "Compression Property" ; - nanomine:hasSelector "//Compression" ; -======= - a sio:UnitOfMeasurement ; - rdfs:label "Celsius" ; - skos:notation "C" . - - a sio:UnitOfMeasurement ; - rdfs:label "Gigapascal" ; - skos:notation "GPa" . - -nanomine:CompressionProperty a owl:Class ; - rdfs:label "Compression Property" ; ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "Properties of how the material will react to forces being applied in compression" . - -nanomine:Dimension a owl:Class ; - rdfs:label "Dimension" ; - rdfs:subClassOf sio:DimensionalQuantity . - -nanomine:TensileCreep a owl:Class ; - rdfs:label "Tensile Creep" ; - rdfs:subClassOf nanomine:Creep ; - skos:definition "creep during tensile test" . - - a owl:Class ; - rdfs:label "Pressure" ; - rdfs:subClassOf . - -nanomine:AmbientCondition a owl:Class ; - rdfs:label "Ambient Condition" ; - rdfs:subClassOf nanomine:ProcessingCondition ; - skos:definition "Ambient conditions" . - -nanomine:Mixing a owl:Class ; - rdfs:label "Mixing" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:RotationalFrequency ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:TimeInterval ], -======= - owl:someValuesFrom sio:TimeInterval ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom nanomine:RotationalFrequency ], ->>>>>>> nanomine/master - sio:Procedure ; - skos:definition "Processes for mixing of multiple substances" . - -sio:TimeInterval a owl:Class ; - rdfs:label "Time" ; - rdfs:subClassOf sio:TimeMeasurement . - -nanomine:Additive a owl:Class ; - rdfs:label "Additive" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:Quantity ], - sio:ChemicalEntity, - sio:ChemicalSubstance ; - skos:definition "A chemical substance that is blended in to a polymer to acheive a desired effect.", - "Additive used in composite synthesis" . - -nanomine:VolumetricProperty a owl:Class ; - rdfs:label "Volumetric Property" ; - rdfs:subClassOf . - -<<<<<<< HEAD -nanomine:TensileProperty a owl:Class ; - rdfs:label "Tensile Property" ; - nanomine:hasSelector "//Tensile" ; -======= - a sio:UnitOfMeasurement ; - rdfs:label "Megapascal" ; - skos:notation "MPa" . - -nanomine:TensileProperty a owl:Class ; - rdfs:label "Tensile Property" ; ->>>>>>> nanomine/master - rdfs:subClassOf nanomine:MechanicalProperty ; - skos:definition "Properties of how the material will react to forces being applied in tension." . - -nanomine:MechanicalProperty a owl:Class ; - rdfs:label "Mechanical Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Mechanical" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "A materials property related to the response of a material under some external applied load." . - -nanomine:ViscoelasticProperty a owl:Class ; - rdfs:label "Viscoelastic Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Viscoelastic" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "Properties of materials that exhibit both viscous and elastic behaviors" . - - a owl:Class ; - rdfs:label "Temperature" ; -<<<<<<< HEAD - nanomine:hasSelector "//temperature" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "The average kinetic energy of all constituents within a materials system" . - -nanomine:ThermalProperty a owl:Class ; - rdfs:label "Thermal Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Thermal" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "A material's property describing the materials ability to absorb, conduct, or otherwise interact with energy in the form of heat." . - - a sio:UnitOfMeasurement ; - rdfs:label "Pa" . - -sio:Procedure a owl:Class ; - rdfs:label "nan" ; - rdfs:subClassOf [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Solvent ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasInput ; - owl:someValuesFrom nanomine:Additive ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; -<<<<<<< HEAD - owl:someValuesFrom sio:TimeInterval ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom ], -======= - owl:someValuesFrom ], - [ a owl:Restriction ; - owl:onProperty sio:hasAttribute ; - owl:someValuesFrom sio:TimeInterval ], ->>>>>>> nanomine/master - sio:Process . - -sio:Quantity a owl:Class ; - rdfs:label "Amount" ; - rdfs:subClassOf sio:MeasurementValue . - -nanomine:ElectricalProperty a owl:Class ; - rdfs:label "Electrical Property" ; -<<<<<<< HEAD - nanomine:hasSelector "//Electrical" ; -======= ->>>>>>> nanomine/master - rdfs:subClassOf sio:Quantity ; - skos:definition "A materials property describing the material's behavior under some applied electrical field." . -