diff --git a/.gitignore b/.gitignore index 127f8eb98..950c5f852 100644 --- a/.gitignore +++ b/.gitignore @@ -61,3 +61,4 @@ MANIFEST .vscode .xz +.exe diff --git a/docker/machine/files/requirements.txt b/docker/machine/files/requirements.txt index a0dfcefdc..e03b94a8a 100644 --- a/docker/machine/files/requirements.txt +++ b/docker/machine/files/requirements.txt @@ -8,4 +8,4 @@ mlxtend==0.16.0 pydot==1.4.1 requests==2.22.0 xgboost==0.90 -joblib==0.16.0 +joblib==0.16.0 \ No newline at end of file diff --git a/intropage/JSfiles/Aliro copy.js b/intropage/JSfiles/Aliro copy.js new file mode 100644 index 000000000..f80be5d0c --- /dev/null +++ b/intropage/JSfiles/Aliro copy.js @@ -0,0 +1,1814 @@ + +function pingURL() { + + // Aliro URL + // var URL = "http://localhost:5080" + var URL = "http://google.com" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + const sele = document.getElementById('temp'); + // make button with id temp always same size + // sele.style.width = "100%"; + // sele.style.height = "100%"; + + + sele.innerHTML = "Aliro is ready to run"; + + // Add URL to the button id temp href + sele.href = URL; + + + // Create flashing/glowing button effect to the button id temp + + + + // if mouse is on the element with id temp, then make the innerHTML bold + + sele.addEventListener('mouseover', function () { + sele.style.fontWeight = 'bold'; + }); + + // if mouse is not on the element with id temp, then make the innerHTML normal + sele.addEventListener('mouseout', function () { + sele.style.fontWeight = 'normal'; + }); + + + + + // d3.select('#temp').text('Aliro is ready to run'); + // d3.select('#temp').style('color', 'red'); + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + +// d3.select('#temp').text('Aliro is ready to run'); +// d3.select('#temp').style('color', 'red'); + + + + +// Below is the code for information visualization with D3.js + + +function int_ml_01_titanic_data(){ + + var svg = d3.select("#dataviz_area") + // svg.append("circle").attr("cx", 2).attr("cy", 2).attr("r", 40).style("fill", "blue"); + // svg.append("circle").attr("cx", 140).attr("cy", 70).attr("r", 40).style("fill", "red"); + // svg.append("circle").attr("cx", 300).attr("cy", 100).attr("r", 40).style("fill", "green"); + + // make bar chart with random data + // Add effect to the bar chart when user scroll down, the bar chart will appear + // data set includes 1 to 30 + var dataset = [ 5, 10, 15, 20, 25,30, 40,2,4,5,6,7,8 ]; + svg.selectAll("rect") + .data(dataset) + .enter() + .append("rect") + .attr("x", function(d, i) { + return i * 30; + } + ) + .attr("y", function(d) { + return 150 - d * 5; + } + ) + .attr("width", 25) + .attr("height", function(d) { + return d * 5; + } + ) + .attr("fill", "teal"); + + // read data from csv file (C:\Users\User\Desktop\python_work\SoftTCBCS\Aliro_ED\Aliro_ED\Aliro_ED_album_template\data\datasets\pmlb_small\titanic.csv) + // d3.csv("data/datasets/pmlb_small/titanic/titanic.csv", function(data) { + + // console.log(data["Class Age Sex class"]); + // console.log("Hello") + // }); + + var positive_Sex =[] + var negative_Sex =[] + + d3.csv('data/datasets/pmlb_small/titanic/titanic.csv') + .then(function(data) { + // data is now whole data set + // draw chart in here! + // console.log(data); + for (var i = 0; i < data.length; i++) { + // console.log(data[i]["Class\tAge\tSex\tclass"]); + // console.log(data[i]["Class\tAge\tSex\tclass"]); + // parse string with \t + var str = data[i]["Class\tAge\tSex\tclass"]; + var string_data = str.split("\t"); + // convert string to float + var float_data = string_data.map(function(x){ return parseFloat(x) }); + + // console.log(float_data); + if (float_data[2]>0) + { + positive_Sex.push(float_data); + } + else + { + negative_Sex.push(float_data); + } + } + console.log(positive_Sex) + console.log(negative_Sex) + + // make the bar chart sex by class + + }) + .catch(function(error){ + // handle error + }); + + + + +} + + + + + + +function int_ml_01_iris_data(){ + + // var svg = d3.select("#dataviz_area") + + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 460 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")"); + + + d3.csv('data/datasets/pmlb_small/iris/iris_two_classes.csv') + .then(function(data) { + // data is now whole data set + // draw chart in here! + // console.log(data); + for (var i = 0; i < data.length; i++) { + // show data column names + // console.log(Object.keys(data[i])); + if (i==0) + { + var colunm_names=Object.keys(data[i])[0].split("\t"); + console.log(colunm_names); + } + + // console.log(data[i][Object.keys(data[i])]); + + + var str = data[i][Object.keys(data[i])]; + var string_data = str.split("\t"); + // convert string to float + var float_data = string_data.map(function(x){ return parseFloat(x) }); + console.log(float_data); + } + + + + + + }) + .catch(function(error){ + // handle error + }); + + + + +} + + + + + + +function colorClass(class_cat) { + if (class_cat==0) + { + return "#ffbe0b"; + } + else if (class_cat==1) + { + return "#ff006e"; + } + else + { + return "#8338ec"; + } + +} + +// if div id = intuition_exp is clicked, then run the function +// the function descrption is below +// when div id = intuition_exp is clicked, show div id addingnuance + +function oneDPlot_v2(){ + + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(0); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + +} + + +function twoDPlot_v2() { + // console.log("mouseleave"); + + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + +} + +function remove_boundaries_on2d_plot() +{ + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + //seclt all class named boundaries + svg.selectAll(".boundaries") + .transition() + .duration(1000) + .attr("opacity", "0") +} + + + +function drawing_boundaries_on_2d_plot() { + + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + + + + // mouseover the circles + svg.selectAll("circle") + .on("mouseover", function(d) { + console.log(x(d['petal-length'])); + console.log(y(d['sepal-length'])); + }) + + + + + +var svg = d3.select("#dataviz_area_div_svg") +// make a box brom 0,0 to 123, 138 on the svg + +var data_class1 = [ +[ + [0,0], + [123,270] +] + +]; + +var rects_class1 = svg.selectAll("hey") + .data(data_class1) + .enter() + .append("rect") + .attr("class","boundaries") + .attr("x", d=> d[0][0]) + .attr("y", d=> d[0][1]) + .transition() + .duration(2000) + .attr("width", d=> d[1][0] - d[0][0]) + .attr("height", d=> d[1][1] - d[0][1]) + .attr("fill", "#ffbe0b") + .attr("opacity", 0.2); + + + // 209.66666666666666 + // 120 +var data_class2 = +[ + [ + [123,0], + [209.7,270] + ] +]; + +var rects_class2 = svg.selectAll("hey") + .data(data_class2) + .enter() + .append("rect") + .attr("class","boundaries") + .attr("x", d=> d[0][0]) + .attr("y", d=> d[0][1]) + .transition() + .duration(2000) + .attr("width", d=> d[1][0] - d[0][0]) + .attr("height", d=> d[1][1] - d[0][1]) + .attr("fill", "#ff006e") + .attr("opacity", 0.2); + +var data_class3 = +[ + [ + [209.7,0], + [400,270] + ] +]; + +var rects_class3 = svg.selectAll("hey") + .data(data_class3) + .enter() + .append("rect") + .attr("class","boundaries") + .attr("x", d=> d[0][0]) + .attr("y", d=> d[0][1]) + .transition() + .duration(2000) + .attr("width", d=> d[1][0] - d[0][0]) + .attr("height", d=> d[1][1] - d[0][1]) + .attr("fill", "#8338ec") + .attr("opacity", 0.2); + + + +} + + + +function show_or_block_each_part(){ + + // console.log("show_or_block is clicked"); + + + + + + + + + // from FSI to adding nuance + d3.select("#fromfsitoaddn").on("click", function() { + + + // non "Adding nuance" div + document.getElementById("intuition_exp").style.display = "none"; + // block "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "block"; + + + + // plot the data on 2D plane + twoDPlot_v2() + + }); + + // document.getElementById("addingnuance").style.display = "none"; + + + + // from adding nuance to FSI + d3.select("#fromaddntofsi").on("click", function() { + + + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + // block "Adding nuance" div + document.getElementById("intuition_exp").style.display = "block"; + + + // project the data on 1D + oneDPlot_v2() + + + }); + + + + + + + + + + // from adding nuance to drawing boundaris + d3.select("#fromaddntodrawb").on("click", function() { + + // block "Adding nuance" div + document.getElementById("drawingboundaries").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + + + // draw boundaries on the 2D plane + drawing_boundaries_on_2d_plot() + + + }); + + + + + + // from drawing boundaris to adding nuance + d3.select("#fromdrawbtoaddn").on("click", function() { + + // block "Adding nuance" div + document.getElementById("addingnuance").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("drawingboundaries").style.display = "none"; + + + // plot the data on 2D plane + remove_boundaries_on2d_plot() + twoDPlot_v2() + + + }); + + + + + + + + + +} + + + + + + +function int_ml_01_test_iris_data(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 560 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + d3.csv("data/datasets/pmlb_small/iris/iris_two_classes.csv", function(data) { + + // show data column names + // console.log(Object.keys(data[0])); + console.log("int_ml_01_test_iris_data") + console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 15]) + .range([ height, 0]); + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr("r", 2) + .style("fill", "#69b3a2") + + // new X axis + x.domain([0,15]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + var tooltip = d3.select("#dataviz_area") + .append("div") + .style("opacity", 0) + .attr("class", "tooltip") + .style("background-color", "white") + .style("border", "solid") + .style("border-width", "1px") + .style("border-radius", "5px") + .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + var mouseover = function(d) { + tooltip + .style("opacity", 1) + } + + var mousemove = function(d) { + tooltip + .html("The exact value of
the Ground Living area is: " + d['petal-length']) + .style("left", (d3.mouse(this)[0]+20) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var mouseleave = function(d) { + tooltip + .transition() + .duration(200) + .style("opacity", 0) + } + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data.filter(function(d,i){return i<50})) // the .filter part is just to keep a few dots on the chart, not all of them + .enter() + .append("circle") + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr("r", 7) + .style("fill", "#69b3a2") + .style("opacity", 0.3) + .style("stroke", "white") + .on("mouseover", mouseover ) + .on("mousemove", mousemove ) + .on("mouseleave", mouseleave ); + + + + + + + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + + } + + +function int_ml_01_test_iris_data_tooltip_1d_barscatter(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 550 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function(data) { + + + + // show data column names + // console.log(Object.keys(data[0])); + // console.log("int_ml_01_test_iris_data_tooltip") + // console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + .range([ height, 0]); + + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + // sepal-length', 'sepal-width' + // sepal-length', 'petal-length' + // sepal-length', 'petal-width + // 'sepal-width', 'petal-length' + // 'sepal-width', 'petal-width' + // 'petal-length', 'petal-width' + // + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // make the x located in the middle of the rect + + .attr('x', 550/8) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr('y', function (d) { return y(d['sepal-length']); } ) + .attr('width', 550/2) + .attr('height',1) + + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + + // .attr("r", 2) + .attr("fill", "#69b3a2") + + // new X axis + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(4000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + svg.selectAll("rect") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + // .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // // A function that change this tooltip when the user hover a point. + // // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + // var mouseover = function(d) { + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + // } + + // var mousemove = function(d) { + // console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + // } + + // // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + // var mouseleave = function(d) { + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + // } + + // // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.2) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + + + + + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + + } + + + + + + + +function onedplotToTwodPlot(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .attr("viewBox", `-25 -15 400 250`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function(data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "1"); + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + .attr("cx", function (d) { return x(0)+165; } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + + + .attr("r", 2) + .style("fill", "#69b3a2") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(0)+165; } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }) + + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(5000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + + + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + + var project_x_axis = function(d) { + + console.log("project_x_axis"); + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*10)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(0); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function(d) { + + console.log("mouseover"); + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*10)}) + .duration(1000) + + .attr("cx", function (d) { return x(0); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function(d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function(d) { + console.log("mouseleave"); + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + + + d3.select("#projectxaxia") + // .on("mousemove", mousemove ) + .on("click", project_x_axis ); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis ); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot ); + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + +function int_ml_01_test_iris_data_tooltip_2d(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 550 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function(data) { + + + + // show data column names + // console.log(Object.keys(data[0])); + console.log("int_ml_01_test_iris_data_tooltip") + console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + .range([ height, 0]); + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + // sepal-length', 'sepal-width' + // sepal-length', 'petal-length' + // sepal-length', 'petal-width + // 'sepal-width', 'petal-length' + // 'sepal-width', 'petal-width' + // 'petal-length', 'petal-width' + // + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + + + .attr("r", 2) + .style("fill", "#69b3a2") + + // new X axis + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + var tooltip = d3.select("#dataviz_area") + .append("div") + .style("opacity", 0) + .attr("class", "tooltip") + .style("background-color", "white") + .style("border", "solid") + .style("border-width", "1px") + .style("border-radius", "5px") + .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + var mouseover = function(d) { + console.log("mouseover"); + tooltip + .style("opacity", 1) + } + + var mousemove = function(d) { + console.log("mousemove"); + tooltip + .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var mouseleave = function(d) { + tooltip + .transition() + .duration(200) + .style("opacity", 0) + } + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + .enter() + .append("circle") + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr("r", 2) + .style("fill", "#69b3a2") + .style("opacity", 0.2) + .style("stroke", "white") + .on("mouseover", mouseover ) + .on("mousemove", mousemove ) + .on("mouseleave", mouseleave ); + + + + + + + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + +// https://d3-graph-gallery.com/graph/scatter_animation_start.html +function int_ml_01_test_data(){ + + + +// set the dimensions and margins of the graph +var margin = {top: 10, right: 30, bottom: 30, left: 60}, +width = 460 - margin.left - margin.right, +height = 400 - margin.top - margin.bottom; +// append the svg object to the body of the page +var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + +//Read the data +d3.csv("https://raw.githubusercontent.com/holtzy/data_to_viz/master/Example_dataset/2_TwoNum.csv", function(data) { + +console.log(data); + +// Add X axis +var x = d3.scaleLinear() +.domain([0, 0]) +.range([ 0, width ]); +svg.append("g") +.attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it +.attr("transform", "translate(0," + height + ")") +.call(d3.axisBottom(x)) +.attr("opacity", "0") + +// Add Y axis +var y = d3.scaleLinear() +.domain([0, 500000]) +.range([ height, 0]); +svg.append("g") +.call(d3.axisLeft(y)); + +// Add dots +svg.append('g') +.selectAll("dot") +.data(data) +.enter() +.append("circle") + .attr("cx", function (d) { return x(d.GrLivArea); } ) + .attr("cy", function (d) { return y(d.SalePrice); } ) + .attr("r", 1.5) + .style("fill", "#69b3a2") + +// new X axis +x.domain([0, 4000]) +svg.select(".myXaxis") +.transition() +.duration(2000) +.attr("opacity", "1") +.call(d3.axisBottom(x)); + +svg.selectAll("circle") +.transition() +.delay(function(d,i){return(i*3)}) +.duration(2000) +.attr("cx", function (d) { return x(d.GrLivArea); } ) +.attr("cy", function (d) { return y(d.SalePrice); } ) +}) + +} + + + + + +function int_ml_01_test_titanic_data(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 460 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + d3.csv("data/datasets/pmlb_small/titanic/titanic_Comma.csv", function(data) { + + console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([-1, 10]) + .range([ height, 0]); + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + .attr("cx", function (d) { return x(d.Class); } ) + .attr("cy", function (d) { return y(d.Age); } ) + .attr("r", 1.5) + .style("fill", "#69b3a2") + + // new X axis + x.domain([-10,10]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + .attr("cx", function (d) { return x(d.Class); } ) + .attr("cy", function (d) { return y(d.Age); } ) + }) + + } \ No newline at end of file diff --git a/intropage/JSfiles/Aliro.js b/intropage/JSfiles/Aliro.js new file mode 100644 index 000000000..3caf3048b --- /dev/null +++ b/intropage/JSfiles/Aliro.js @@ -0,0 +1,4657 @@ +// this js file includes data in the code. + + +function pingURL() { + + // Aliro URL + var URL = "http://localhost:5080" + // var URL = "http://localhost:8000" + // var URL = "http://google.com" + // var URL = "http://www.daum.net" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + const sele = document.getElementById('loadingbutton'); + // make button with id temp always same size + // sele.style.width = "100%"; + // sele.style.height = "100%"; + + console.log(sele.innerHTML) + sele.innerHTML = "Aliro is ready to run"; + + // Add URL to the button id temp href + sele.href = URL; + + + // Create flashing/glowing button effect to the button id temp + + + + // if mouse is on the element with id temp, then make the innerHTML bold + + sele.addEventListener('mouseover', function () { + sele.style.fontWeight = 'bold'; + }); + + // if mouse is not on the element with id temp, then make the innerHTML normal + sele.addEventListener('mouseout', function () { + sele.style.fontWeight = 'normal'; + }); + + + + + + // make loadingeds text changed + const sele2 = document.getElementById('loadingeds'); + + + + + // make the loadingeds clickable and link to the URL + + sele2.innerHTML = "Aliro is ready to run"; + sele2.href = URL; + + // make the mouse cursor pointer like hand + sele2.style.cursor = "pointer"; + + sele2.addEventListener('click', function () { + // move to the URL + window.location.href = URL; + } ); + + + const selcir = document.getElementsByClassName('blinkingcir') + + for (var i = 0; i < selcir.length; i++) { + // selcir.setAttribute("r", "10"); + selcir[i].setAttribute("r", "7"); + } + + + + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + + + +function pingURL_DOWNLOAD() { + + // Aliro URL + var URL = "http://localhost:5080" + // var URL = "http://localhost:8000" + // var URL = "http://google.com" + // var URL = "http://www.daum.net" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + const sele = document.getElementById('loadingbutton'); + // make button with id temp always same size + // sele.style.width = "100%"; + // sele.style.height = "100%"; + + if (sele != null ) + { + + console.log(sele.innerHTML) + sele.innerHTML = "Aliro is ready to run"; + + // Add URL to the button id temp href + sele.href = URL; + + + // Create flashing/glowing button effect to the button id temp + + + + // if mouse is on the element with id temp, then make the innerHTML bold + + sele.addEventListener('mouseover', function () { + sele.style.fontWeight = 'bold'; + }); + + // if mouse is not on the element with id temp, then make the innerHTML normal + sele.addEventListener('mouseout', function () { + sele.style.fontWeight = 'normal'; + }); + } + + + + + + // make loadingeds text changed + const sele2 = document.getElementById('loadingeds'); + + + + + // make the loadingeds clickable and link to the URL + + sele2.innerHTML = "Aliro is ready to run"; + sele2.href = URL; + + // make the mouse cursor pointer like hand + sele2.style.cursor = "pointer"; + + sele2.addEventListener('click', function () { + // move to the URL + window.location.href = URL; + } ); + + + const selcir = document.getElementsByClassName('blinkingcir') + + for (var i = 0; i < selcir.length; i++) { + // selcir.setAttribute("r", "10"); + selcir[i].setAttribute("r", "7"); + } + + + + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + + + + +// Below is the code for information visualization with D3.js + + + + + + +function colorClass(class_cat) { + if (class_cat == 0) { + // return "#ffbe0b"; + return "#ffbe0b"; + } + else if (class_cat == 1) { + // return "#ff006e"; + return "#ff006e"; + } + else { + return "#8338ec"; + } + +} + + + +function locationByColorClass(class_cat) { + if (class_cat == 0) { + return 100; + } + else if (class_cat == 1) { + return 200; + } + else { + return 300; + } + +} + +// if div id = intuition_exp is clicked, then run the function +// the function descrption is below +// when div id = intuition_exp is clicked, show div id addingnuance + +function oneDPlot_v2() { + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + +} + + +function twoDPlot_v2() { + // console.log("mouseleave"); + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // mouseover the circles + svg.selectAll("circle") + .on("mouseover", function (d) { + console.log(x(d['petal-length'])); + console.log(y(d['sepal-length'])); + }) + +} + +function remove_boundaries_on2d_plot() { + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + //seclt all class named boundaries + svg.selectAll(".boundaries") + .transition() + .duration(1000) + .attr("opacity", "0") +} + + + +function drawing_boundaries_on_2d_plot() { + + console.log("drawing boundaries on 2d plot"); + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + + + + + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + var data_class1 = [ + [ + [0, 0], + [156.7, height] + ] + + ]; + + var rects_class1 = svg.selectAll("hey") + .data(data_class1) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#ffbe0b") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_1"); + + + // 209.66666666666666 + // 120 + var data_class2 = + [ + [ + [156.7, 0], + [266.4, height] + ] + ]; + + var rects_class2 = svg.selectAll("hey") + .data(data_class2) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + // .attr("fill", "#ff006e") + + .attr("fill", "#ff006e") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_2"); + + var data_class3 = + [ + [ + [266.4, 0], + [500, height] + ] + ]; + + var rects_class3 = svg.selectAll("hey") + .data(data_class3) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#8338ec!important") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_3"); + + + +} + + + +function show_or_block_each_part() { + + // console.log("show_or_block is clicked"); + + + + + + + + + // from FSI to adding nuance + d3.select("#fromfsitoaddn").on("click", function () { + + + // non "Adding nuance" div + document.getElementById("intuition_exp").style.display = "none"; + // block "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "block"; + + + + // plot the data on 2D plane + twoDPlot_v2() + + }); + + // document.getElementById("addingnuance").style.display = "none"; + + + + // from adding nuance to FSI + d3.select("#fromaddntofsi").on("click", function () { + + + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + // block "Adding nuance" div + document.getElementById("intuition_exp").style.display = "block"; + + + // project the data on 1D + oneDPlot_v2() + + + }); + + + + + + + + + + // from adding nuance to drawing boundaris + d3.select("#fromaddntodrawb").on("click", function () { + + // block "Adding nuance" div + document.getElementById("drawingboundaries").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + + + // draw boundaries on the 2D plane + drawing_boundaries_on_2d_plot() + + + }); + + + + + + // from drawing boundaris to adding nuance + d3.select("#fromdrawbtoaddn").on("click", function () { + + // block "Adding nuance" div + document.getElementById("addingnuance").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("drawingboundaries").style.display = "none"; + + + // plot the data on 2D plane + remove_boundaries_on2d_plot() + twoDPlot_v2() + + + }); + + + + + + + + + +} + + + + + +function onedplotToTwodPlot() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + //commenting out d3.csv call + //d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + .attr("stroke", "black") + .append("text") + .attr("fill", "black")//set the fill here + // make the title of x axis always located in the middle of the x axis + .attr("transform", "translate(" + width / 2 + " ," + (margin.bottom - 3) + ")") + // .attr("transform","translate(150, 30)") + .text("petal-length"); + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "0") + // make y axis white + // .attr("fill", "white") + .attr("stroke", "black") + // .attr("stroke-width", "1px") + // .attr("stroke-width", "1px") + // .attr('text','y axis') + .append("text") + .attr("fill", "black")//set the fill here + + // make the title of y axis always located in the end of the y axis. But make the title of y axia and the y axis not overlap + + // .attr("transform", "translate(" + -margin.left + " ," + height / 2 + ")rotate(-90)") + + .attr("transform", "translate(" + -18 + " ," + height / 2 + ")rotate(-90)") + + .text("sepal-length"); + ; + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + .attr("cx", function (d) { return x(0) + 165; }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + + + // .attr("r", 2) + .attr("r", 3.5) + .style("fill", "#69b3a2") + .style("stroke", "black") + .attr("class", function (d) { return (d['class']); }) + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(0) + 165; }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function (d, i) { return (i * 10) }) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); }) + // .attr("cy", function (d) { return y(0); }) + + // // give color to the dots based on the class + // .style("fill", function (d) { return colorClass(d['class']) }); + + + + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(5000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + + + // console.log(num_circles); + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + // force to click on the button #projectxaxia + + + + + d3.select("#projectxaxia") + // .on("mousemove", mousemove ) + .on("click", project_x_axis); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot); + + + // }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + + +function all_possible_corr() { } + + + + + + + + + +function boxplot() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + {/* + + */} + + + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + //d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var formatxAxis = d3.format('.0f'); + + // d3.format is integer + // d3.format(".2f") is float + + + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([4, 8.5]) + // .domain([0, 0]) + .tickFormat(formatxAxis) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + + .attr("opacity", "1"); + + + + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + + .attr("rx", 3) + .attr("ry", 3) + .attr("width", 5) + .attr("height", 5) + .attr("class", function (d) { return "class " + d['class'] }) + .style("fill", "#69b3a2") + // opacity + .attr("opacity", "0.3") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("rect") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + // .attr("x", function (d) { return x(0)+165; } ) + // .attr("y", function (d) { return y(d['sepal-length']); } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + .attr("rx", 0) + .attr("ry", 0) + .attr("width", 30) + .attr("height", 5) + + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + .attr("opacity", "0.5") + + + + var num_rect = svg.selectAll("rect").size(); + console.log("num_rect: ", num_rect) + // + + + + + + + + + + + + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + + + var rotate_project_on_x_axis = function (d) { + + console.log("rotate_project_on_x_axis"); + + + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + // y.domain([0, 10]) + // svg.select(".myYaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "0") + // .call(d3.axisLeft(y)); + + + // x.domain([4,8.5]) + x.domain([4, 8.5]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + + // count the number of circles + + + + + // svg.selectAll("rect") + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + // // width and height of the rectangle 2 + // .attr('width',2) + // .attr('height',2) + // .attr('rx',3) + // .attr('ry',3) + + + + // calculate frequency of each class by data[1]['sepal-length'] + var frequency_class1 = {}; + var frequency_class2 = {}; + var frequency_class3 = {}; + + for (var i = 0; i < data.length; i++) { + // data[i]['class'] == '0' + + + if (data[i]['class'] == '0') { + // add count to frequency_class1[data[i]['sepal-length']] + if (frequency_class1[data[i]['sepal-length']] == undefined) { + frequency_class1[data[i]['sepal-length']] = 1; + } + else { + frequency_class1[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '1') { + // add count to frequency_class2[data[i]['sepal-length']] + if (frequency_class2[data[i]['sepal-length']] == undefined) { + frequency_class2[data[i]['sepal-length']] = 1; + } + else { + frequency_class2[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '2') { + // add count to frequency_class3[data[i]['sepal-length']] + if (frequency_class3[data[i]['sepal-length']] == undefined) { + frequency_class3[data[i]['sepal-length']] = 1; + } + else { + frequency_class3[data[i]['sepal-length']] += 1; + } + } + + + + + } + + + + + // console.log(frequency_class1[4.3]); + console.log(frequency_class1); + // get all keys of frequency_class1 + var keys_1 = Object.keys(frequency_class1); + console.log(frequency_class2); + var keys_2 = Object.keys(frequency_class2); + console.log(frequency_class3); + var keys_3 = Object.keys(frequency_class3); + + // set union keys_1, keys_2, keys_3 + var keys = keys_1.concat(keys_2, keys_3); + keys = [...new Set(keys)]; + // sort keys + keys.sort(function (a, b) { return a - b }); + console.log("keys:", keys); + // show length of keys + console.log("length of keys:", keys.length); + + + // print if frequency_class1 + + //show how many rectangles exist + console.log("number of rectangles:", svg.selectAll("rect").size()); + + // remove any rectangles if the keys.length is less than the number of rectangles + // that is, for example, if keys.length is 35, only 35 rectangles should be shown + // when rectangles are removed, make it transparent and removed + + if (keys.length < svg.selectAll("rect").size()) { + console.log("remove rectangles"); + svg.selectAll("rect") + .data(keys) + .exit() + .remove(); + console.log("after number of rectangles:", svg.selectAll("rect").size()); + + } + + + + // rotate 90 degree of rectangles + svg.selectAll("rect") + // .attr('opacity',0) + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(0); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // .attr('transform', 'translate(400,100)rotate(90)') + .attr('transform', 'translate(300,100) rotate(90)') + // .attr('transform', 'translate(400,100)') + // .attr('transform', 'rotate(90)') + // .attr('transform', 'translate(100,400)rotate(-90)') + // .attr('transform', 'rotate(-90)translate(10,200)') + .attr('opacity', 0.5) + // .attr("x", function(d){ return x(0) }); + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + .attr("x", function (d) { + // console.log("x(6)") + // console.log(x(6)) + return x(6); + }) + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + // console.log(data[1]['petal-length']); + // console.log(data[1]['sepal-length']); + + + // console.log(data); + // console.log(data[1]['sepal-length']); + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 0" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class1[keys_1[i]]) + return 20 * frequency_class1[keys_1[i]] + }) + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 1" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class2[keys_2[i]]) + return 20 * frequency_class2[keys_2[i]] + + }) + + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 2" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class3[keys_3[i]]) + return 20 * frequency_class3[keys_3[i]] + + }) + + + + + // plot rectangles based on frequency_class1, frequency_class2, frequency_class3 + // each rectangle has height frequency_class1 + // each rectangle has width 0.5 + // each rectangle has x = data[i]['sepal-length'] + + + + + // plot rectangles based on the frequency + + + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + + + // d3.select("#projectxaxia") + // // .on("mousemove", mousemove ) + // .on("click", project_x_axis ); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot); + + + + d3.select("#rotateprojectxaxia") + // .on("mousemove", mousemove ) + .on("click", rotate_project_on_x_axis); + + + + + // select all rectangles and make opacity 0 + // svg.selectAll("rect") + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + // .attr('opacity',0) + + // select all rectangles that have class attr is "class 0" + + + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + + + + + // d3.select("#rotateprojectxaxia") + // // .on("mousemove", mousemove ) + // .on("click", project_x_axis ); + + + //}) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + + + + + + +function boxplot_direct_from_y() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + d3 = d3version4 + console.log("inside!!!!_d3version4") + console.log(d3.version) + + console.log("inside!!!!_d3v3") + console.log(d3v3.version) + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + //d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // show white axis + .attr("stroke", "black") + + // Add Y axis + + // scaleLinear show integer number + // var formatxAxis = d3.format('.0f'); + + var y = d3.scaleLinear() + // .domain([0, 10]) + .domain([4, 8.5]) + // .domain([0, 0]) + // format in y axis is integer + // .tickFormat(formatxAxis) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + + + .attr("opacity", "1") + + .attr("stroke", "black") + // .attr("stroke-width", "1px") + // .attr("stroke-width", "1px") + // .attr('text','y axis') + .append("text") + .attr("fill", "black")//set the fill here + + // make the title of y axis always located in the end of the y axis. But make the title of y axia and the y axis not overlap + + // .attr("transform", "translate(" + -margin.left + " ," + height / 2 + ")rotate(-90)") + + .attr("transform", "translate(" + 30 + " ," + -10 + ")") + + .text("sepal-length"); + + + + + // draw triangles 4, 8.5 + // i=0; + // while (i<=2) { + // svg.append("path") + // .attr("d", d3.symbol().type(d3.symbolTriangle).size(100)) + // // .attr("transform", function(d) { return "translate(" + x(0) + "," + 120+i + ")"; }) + // // .attr("transform", "rotate(90)") + // // rotate and translate + // .attr("transform", "rotate(90) translate(" + x(0) + "," + y(4+i) + ")") + // // .attr("transform", function(d) { return "translate(" + x(0) + "," + y(4+i) + ") rotate(90)"; }) + // .attr("fill", "black") + // .attr("opacity", "0.5") + // .attr("id", "triangle" + i) + + + // i+=30 + // } + + // translate(-1,119.7666625976562510) + // translate(1,238.7666625976562510) + + + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + // .attr("x", function(d){ return x(d['petal-length']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + + .attr("rx", 3) + .attr("ry", 3) + .attr("width", 5) + .attr("height", 5) + .attr("class", function (d) { return "class " + d['class'] }) + .style("fill", "#69b3a2") + // opacity + .attr("opacity", "0.3") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("rect") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { + console.log("x", x(d['petal-length'])) + return locationByColorClass(d['class']) + }) + // .attr("y", function (d) { return y(d['sepal-length']); } ) + // .attr("x", function(d){ return x(d['petal-length']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + .attr("rx", 0) + .attr("ry", 0) + .attr("width", 30) + .attr("height", 5) + + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + .attr("opacity", "0.5") + + + + var num_rect = svg.selectAll("rect").size(); + console.log("num_rect: ", num_rect) + // + + + + + + + + + + + + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + + + var barchart = function (d) { + + console.log("rotate_project_on_x_axis"); + + + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + // y.domain([0, 10]) + // svg.select(".myYaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "0") + // .call(d3.axisLeft(y)); + + + // x.domain([4,8.5]) + x.domain([4, 8.5]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + + + + + + + + + // calculate frequency of each class by data[1]['sepal-length'] + var frequency_class1 = {}; + var frequency_class2 = {}; + var frequency_class3 = {}; + + for (var i = 0; i < data.length; i++) { + // data[i]['class'] == '0' + + + if (data[i]['class'] == '0') { + // add count to frequency_class1[data[i]['sepal-length']] + if (frequency_class1[data[i]['sepal-length']] == undefined) { + frequency_class1[data[i]['sepal-length']] = 1; + } + else { + frequency_class1[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '1') { + // add count to frequency_class2[data[i]['sepal-length']] + if (frequency_class2[data[i]['sepal-length']] == undefined) { + frequency_class2[data[i]['sepal-length']] = 1; + } + else { + frequency_class2[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '2') { + // add count to frequency_class3[data[i]['sepal-length']] + if (frequency_class3[data[i]['sepal-length']] == undefined) { + frequency_class3[data[i]['sepal-length']] = 1; + } + else { + frequency_class3[data[i]['sepal-length']] += 1; + } + } + + + + + } + + + + + // console.log(frequency_class1[4.3]); + console.log(frequency_class1); + // get all keys of frequency_class1 + var keys_1 = Object.keys(frequency_class1); + console.log(frequency_class2); + var keys_2 = Object.keys(frequency_class2); + console.log(frequency_class3); + var keys_3 = Object.keys(frequency_class3); + + // set union keys_1, keys_2, keys_3 + var keys = keys_1.concat(keys_2, keys_3); + keys = [...new Set(keys)]; + // sort keys + keys.sort(function (a, b) { return a - b }); + console.log("keys:", keys); + // show length of keys + console.log("length of keys:", keys.length); + + + // print if frequency_class1 + + //show how many rectangles exist + console.log("number of rectangles:", svg.selectAll("rect").size()); + + // remove any rectangles if the keys.length is less than the number of rectangles + // that is, for example, if keys.length is 35, only 35 rectangles should be shown + // when rectangles are removed, make it fade out + + if (keys.length < svg.selectAll("rect").size()) { + + + console.log("remove rectangles"); + // svg.selectAll("rect") + // .data(keys) + // .transition() + // .duration(1000) + // .attr("opacity", "0") + // .remove(); + console.log("after number of rectangles:", svg.selectAll("rect").size()); + + + + + svg.selectAll("rect") + .data(keys) + .exit() + .remove(); + + + + + + + + + + } + + + + + + + // rotate 90 degree of rectangles + svg.selectAll("rect") + // .attr('opacity',0) + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(0); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // .attr('transform', 'translate(400,100)rotate(90)') + // .attr('transform', 'translate(300,100) rotate(90)') + // .attr('transform', 'translate(400,100)') + // .attr('transform', 'rotate(90)') + // .attr('transform', 'translate(100,400)rotate(-90)') + // .attr('transform', 'rotate(-90)translate(10,200)') + .attr('opacity', 0.5) + // .attr("x", function(d){ return x(0) }); + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + .attr("x", function (d) { + // console.log("x(6)") + // console.log(x(6)) + return x(4); + }) + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + // console.log(data[1]['petal-length']); + // console.log(data[1]['sepal-length']); + + + // console.log(data); + // console.log(data[1]['sepal-length']); + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 0" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class1[keys_1[i]]) + return 20 * frequency_class1[keys_1[i]] + }) + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 1" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class2[keys_2[i]]) + return 20 * frequency_class2[keys_2[i]] + + }) + + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 2" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class3[keys_3[i]]) + return 20 * frequency_class3[keys_3[i]] + + }) + + + + + // plot rectangles based on frequency_class1, frequency_class2, frequency_class3 + // each rectangle has height frequency_class1 + // each rectangle has width 0.5 + // each rectangle has x = data[i]['sepal-length'] + + + + + // plot rectangles based on the frequency + + + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + var mouseover = function (d) { + console.log("mouseover y axis"); + } + + var showboundaries = function (d) { + + // check there are d3.symbolCircle or not + // if there are d3.symbolCircle, then change the candicate_points. + + + + + + + + // translate(-1,119.7666625976562510) + // translate(1,238.7666625976562510) + + candiate_points = [ + [1, 176], + [1, 240], + [1, 112], + [1, 264] + ] + + for (i = 0; i < candiate_points.length; i++) { + svg.append("path") + .attr("d", d3.symbol().type(d3.symbolCircle).size(95)) + .attr("transform", function (d) { + console.log("x point", d3.mouse(this)[0]) + console.log("y point", d3.mouse(this)[1]) + return "translate(" + candiate_points[i][0] + "," + candiate_points[i][1] + ")"; + }) + // show fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + // .style("opacity", 0.5) + .style("opacity", function (d) { + if (i / 2 < 1) { + return 0.5 + } + else if (i / 2 >= 1) { + return 0 + } + }) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "rgb(37, 14, 14)") + .style("stroke", "rgb(37, 14, 14)") + .style("stroke-width", 1) + // .attr("class", "circle_symbol_indicator") + .attr("id", "indicator" + i) + .attr("class", function (d) { + if (i / 2 < 1) { + return "circle_symbol_indicator_first" + } + else if (i / 2 >= 1) { + return "circle_symbol_indicator_second" + } + + }) + + // make rectangles + svg.append("rect") + .attr("x", 0) + .attr("y", 0) + .attr("width", 0) + .attr("height", 0) + .attr("transform", function (d) { + return "translate(" + candiate_points[i][0] + "," + candiate_points[i][1] + ")"; + } + ) + .style("opacity", 0) + .transition() + .duration(2000) + // .style("opacity", 0.5) + .style("opacity", function (d) { + if (i / 2 < 1) { + return 0.5 + } + else if (i / 2 >= 1) { + return 0 + } + }) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "rgb(37, 14, 14)") + .style("stroke", "rgb(37, 14, 14)") + .style("stroke-width", 1) + // .attr("class", "rect_indicator") + .attr("id", "indicator") + .attr("class", function (d) { + if (i / 2 < 1) { + return "rect_indicator_first" + } + else if (i / 2 >= 1) { + return "rect_indicator_second" + } + }) + .attr("width", 500) + .attr("height", 0.5) + // .attr("x", -50) + // .attr("y", -50) + + + + + } + // svg.append("path") + // // .attr("d", d3.symbol().type(d3.symbolDiamond).size(95)) + // .attr("d", d3.symbol().type(d3.symbolCircle).size(95)) + // .attr("transform", function(d) { + // console.log("x point",d3.mouse(this)[0]) + // console.log("y point",d3.mouse(this)[1]) + // return "translate(" + 1+ "," + 200 + ")"; + // }) + // .style("fill", "black") + // .style("stroke", "black") + // .style("stroke-width", 1) + // .style("opacity", 0.5) + // .attr("class", "tri_temp") + + + + + + + + } + + + + + var showboundariesSecondBound = function (d) { + + console.log("showboundariesSecondBound") + + // circle_symbol_indicator_first + // rect_indicator_first + // make class circle_symbol_indicator_first and rect_indicator_first to fade away + d3.selectAll(".circle_symbol_indicator_first") + .transition() + .duration(2000) + .style("opacity", 0) + .style("fill", "red") + .style("stroke", "red") + .style("stroke-width", 1) + + + d3.selectAll(".rect_indicator_first") + .transition() + .duration(2000) + .style("opacity", 0) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "rgb(37, 14, 14)") + .style("stroke", "rgb(37, 14, 14)") + .style("stroke-width", 1) + + + + + d3.selectAll(".circle_symbol_indicator_second") + .transition() + .duration(2000) + .style("opacity", 0.5) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "rgb(37, 14, 14)") + .style("stroke", "rgb(37, 14, 14)") + .style("stroke-width", 1) + + + d3.selectAll(".rect_indicator_second") + .transition() + .duration(2000) + .style("opacity", 0.5) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "rgb(37, 14, 14)") + .style("stroke", "rgb(37, 14, 14)") + .style("stroke-width", 1) + + + + } + + + var showpiechart_v1 = function (d) { + console.log("showpiechart") + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var svg = d3.select("#dataviz_area_div_second") + .append("svg") + .attr("id", "dataviz_area_div_svg_second") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-200 -180 500 400`) + + + // generate random + + // show pie chart + var data_pc = [10, 20, 100]; + + // var width = 960, + // height = 500, + // radius = Math.min(width, height) / 2; + + // var width = 960, + // height = 500, + var radius = Math.min(width, height) / 3; + + + var color = d3.scaleOrdinal() + .range(["#98abc5", "#8a89a6", "#7b6888"]); + + var arc = d3.arc() + .outerRadius(radius - 10) + .innerRadius(0); + + var labelArc = d3.arc() + .outerRadius(radius - 40) + .innerRadius(radius - 40); + + var pie = d3.pie() + .sort(null) + .value(function (d) { return d; }); + + + + var g = svg.selectAll(".arc") + .data(pie(data_pc)) + .enter() + .append("g") + // // show fade in effect + // // .style("opacity", 1) + // .style("opacity", 0) + // .transition() + // .duration(2000) + .style("opacity", 0) + .attr("class", "arc") + .attr("id", "first_piechart"); + + g.append("path") + .attr("d", arc) + .style("fill", function (d) { return color(d.data); }); + + g.append("text") + // fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + .attr("transform", function (d) { return "translate(" + labelArc.centroid(d) + ")"; }) + .attr("dy", ".35em") + .text(function (d) { return d.data; }); + + // fade in effect + g.style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + + + + + } + + var showpiechart_v1_reset = function (d) { + console.log("showpiechart") + + + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + // remove all under svg id = dataviz_area_div_svg_second with fade out effect + d3.select("#dataviz_area_div_svg_second") + .selectAll("*") + .transition() + .duration(2000) + .style("opacity", 0) + .remove() + + // remove svg id = dataviz_area_div_svg_second + d3.select("#dataviz_area_div_svg_second") + .remove() + + + // d3.select("#dataviz_area_div_svg_second").selectAll("*").remove(); + + + + + + var svg = d3.select("#dataviz_area_div_second") + .append("svg") + .attr("id", "dataviz_area_div_svg_second") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-200 -180 500 400`) + + + // generate random + + // show pie chart + var data_pc = [30, 10, 90]; + + // var width = 960, + // height = 500, + // radius = Math.min(width, height) / 2; + + // var width = 960, + // height = 500, + var radius = Math.min(width, height) / 3; + + + var color = d3.scaleOrdinal() + .range(["#98abc5", "#8a89a6", "#7b6888"]); + + var arc = d3.arc() + .outerRadius(radius - 10) + .innerRadius(0); + + var labelArc = d3.arc() + .outerRadius(radius - 40) + .innerRadius(radius - 40); + + var pie = d3.pie() + .sort(null) + .value(function (d) { return d; }); + + + + + + + + var g = svg.selectAll(".arc") + .data(pie(data_pc)) + .enter() + .append("g") + // // show fade in effect + // // .style("opacity", 1) + // .style("opacity", 0) + // .transition() + // .duration(2000) + .style("opacity", 0) + .attr("class", "arc") + .attr("id", "first_piechart"); + + g.append("path") + .attr("d", arc) + .style("fill", function (d) { return color(d.data); }); + + g.append("text") + // fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + .attr("transform", function (d) { return "translate(" + labelArc.centroid(d) + ")"; }) + .attr("dy", ".35em") + .text(function (d) { return d.data; }); + + // fade in effect + g.style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + + // make pie chart fade effecy when change the data of the pie chart + // d3.selectAll("#first_piechart") + // .transition() + // .duration(2000) + // .style("opacity", 0) + // .remove() + + + + + + + + // var data_pc_second = [25, 100, 10]; + + + // var g = svg.selectAll(".arc") + // .data(pie(data_pc_second)) + // .enter() + // .append("g") + // // // show fade in effect + // // // .style("opacity", 1) + // // .style("opacity", 0) + // // .transition() + // // .duration(2000) + // .style("opacity", 0) + // .attr("class", "arc") + // .attr("id","first_piechart"); + + // g.append("path") + // .attr("d", arc) + // .style("fill", function(d) { return color(d.data); }); + + // g.append("text") + // // fade in effect + // .style("opacity", 0) + // .transition() + // .duration(2000) + // .style("opacity", 1) + // .attr("transform", function(d) { return "translate(" + labelArc.centroid(d) + ")"; }) + // .attr("dy", ".35em") + // .text(function(d) { return d.data; }); + + // // fade in effect + // g.style("opacity", 0) + // .transition() + // .duration(2000) + // .style("opacity", 1) + + + } + + var showpiechart_v2 = function (d) { + console.log("showpiechart") + + + + + + + + + + } + + var showdonumchart = function (d) { + + var dataset = { + apples: [53245, 28479, 19697, 24037, 40245], + oranges: [200, 200, 200, 200] + }; + + var width = 960, + height = 500, + radius = Math.min(width, height) / 2; + + var enterClockwise = { + startAngle: 0, + endAngle: 0 + }; + + var enterAntiClockwise = { + startAngle: Math.PI * 2, + endAngle: Math.PI * 2 + }; + + var color = d3.scale.category20(); + + var pie = d3.layout.pie() + .sort(null); + + var arc = d3.svg.arc() + .innerRadius(radius - 100) + .outerRadius(radius - 20); + + var svg = d3.select('#Donut-chart').append('svg') + .attr('id', 'Donut-chart-render') + .attr("width", '100%') + .attr("height", '100%') + .attr('viewBox', (-width / 2) + ' ' + (-height / 2) + ' ' + width + ' ' + height) + .attr('preserveAspectRatio', 'xMinYMin') + + var path = svg.selectAll("path") + .data(pie(dataset.apples)) + .enter().append("path") + .attr("fill", function (d, i) { return color(i); }) + .attr("d", arc(enterClockwise)) + .each(function (d) { + this._current = { + data: d.data, + value: d.value, + startAngle: enterClockwise.startAngle, + endAngle: enterClockwise.endAngle + } + }); + + path.transition() + .duration(750) + .attrTween("d", arcTween); + + d3.selectAll("input").on("change", change); + + var timeout = setTimeout(function () { + d3.select("input[value=\"oranges\"]").property("checked", true).each(change); + }, 2000); + + function change() { + clearTimeout(timeout); + path = path.data(pie(dataset[this.value])); + path.enter().append("path") + .attr("fill", function (d, i) { + return color(i); + }) + .attr("d", arc(enterAntiClockwise)) + .each(function (d) { + this._current = { + data: d.data, + value: d.value, + startAngle: enterAntiClockwise.startAngle, + endAngle: enterAntiClockwise.endAngle + }; + }); // store the initial values + + path.exit() + .transition() + .duration(750) + .attrTween('d', arcTweenOut) + .remove() // now remove the exiting arcs + + path.transition().duration(750).attrTween("d", arcTween); // redraw the arcs + } + + function arcTween(a) { + var i = d3.interpolate(this._current, a); + this._current = i(0); + return function (t) { + return arc(i(t)); + }; + } + function arcTweenOut(a) { + var i = d3.interpolate(this._current, { startAngle: Math.PI * 2, endAngle: Math.PI * 2, value: 0 }); + this._current = i(0); + return function (t) { + return arc(i(t)); + }; + } + + + function type(d) { + d.value = +d.value; + return d; + } + + } + + var test = function (d) { + console.log("test"); + } + + + var thickyaxis = function (d) { + // make it thicker when mouse over on y axis class myYaxis + d3.select(".myYaxis") + .style("stroke-width", 3) + .style("opacity", 1) + } + + + var normalyaxis = function (d) { + // make it thicker when mouse over on y axis class myYaxis + d3.select(".myYaxis") + .style("stroke-width", 1) + .style("opacity", 1) + } + + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + + + + d3.select("#projectyaxia") + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + .on("click", twoDPlot); + + + + // d3.select("#rotateprojectxaxia") + // .on("click", rotate_project_on_x_axis ); + + + + d3.select("#rotateprojectxaxia") + .on("click", barchart); + + + + // mouse over on the class myYaxis + d3.select(".myYaxis") + .on("mouseover", thickyaxis) + .on("mouseout", normalyaxis) + .on("click", showboundaries) + .on("dblclick", showpiechart_v1); + + + d3.select("#show_piechart") + .on("click", showpiechart_v1); + + d3.select("#show_piechart_another") + // .on() + // .on("click", showpiechart_v1 ) + .on("click", showpiechart_v1_reset); + // .on("click", showpiechart_v2 ); + // .on("click", showdonumchart ); + // .on("click", test ); + + + // if select fbbfirsttosecondbound + d3.select("#fbbfirsttosecondbound") + .on("click", showboundariesSecondBound) + // .on("click", showpiechart ); + // .on("click", test ); + + + + + + + + + + //}) + + + + + + + + + +} + + + + +function decisiontree() { + + d3=d3v3 + + + var label_names; + + var TOTAL_SIZE; + // default_colors = [ + // "#c25975", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + + + default_colors = [ + "#74BFA1", "#E37852", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + ] + + + + // default_colors = [ + // "#18dcdc", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#c25975", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + // differnt combination of colors + // default_colors = + + + + + //************************************* Options******************************************************// + + // var file_name = "structureC1.json" // generator_1 + // var file_namev2 = "structureC2_origin.json" // generator_2 + + var file_name = "structure_iris_dc_1.json" // generator_1 + var file_namev2 = "structure_iris_dc_1.json" // generator_2 + + // var file_name = "structure_iris_dc_1_80_size.json" // generator_1 + // var file_namev2 = "structure_iris_dc_1_80_size.json" // generator_2 + + // var file_name = "structure.json" // generator_1 + // var file_namev2 = "structure.json" // generator_2 + var version2 = true // if true json from generator_2 will be used + + + var tree_branch = false // if the thickness of the branches depend on the value of targt + color * / + var tree_branch_parent = true // true: thickness from the root if not the direct parent + // var tree_branch_color = "black" + + var tree_branch_color = "#A3A6A8" + var strokeness = 120 // the degree of separation between the nodes + var default_strokeness = 50 + var hover_percent_parent = false // if the display percentage depends on the direct parent or the root + var square = false + var rect_percent = true //display the percentage or the value in the small rectangles of the labels + var value_percent_top = true /// if we display the value and the percentage above the rectangle / + + var dict_leaf_y = { 1: 0, 2: -17.5, 3: -35, 4: -52.5, 5: -70, 6: -87.5, 6: -105, 7: -122.5, 8: -140, 9: -157.5, 10: -175 } + + + /****************************************************************************************************** */ + + + + + getDepth = function (obj) { + var depth = 0; + if (obj.children) { + obj.children.forEach(function (d) { + var tmpDepth = getDepth(d) + if (tmpDepth > depth) { + depth = tmpDepth + } + }) + } + return 1 + depth + } + + + // var margin = { top: 20, right: 120, bottom: 20, left: 180 }, + // width = 2000 + 960 - margin.right - margin.left, + // height = 800 - margin.top - margin.bottom; + + // current + // var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + // width = 500 - margin.left - margin.right, + // height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var i = 0, + duration = 550, + root; + + var tree + var diagonal + var svg + + var filetochoose = version2 ? file_namev2 : file_name + + // d3.json(filetochoose, function (error, flare) { + // if (error) throw error; + + + + // // console.log(getDepth(flare)) + + + // tree = d3.layout.tree() + // .separation(function (a, b) { return ((a.parent == root) && (b.parent == root)) ? strokeness : strokeness; }) + // .size([height, getDepth(flare) * width / 8]); + + // diagonal = d3.svg.diagonal() + // .projection(function (d) { return [d.y, d.x]; }); + + // // svg = d3.select("body").append("svg") + // // .attr("width", getDepth(flare) * width / 8 + margin.right + margin.left) + // // .attr("height", height + margin.top + margin.bottom) + // // .append("g") + // // .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + + + // svg = d3.select("#dataviz_area_div") + // .append("svg") + // .attr("id", "dataviz_area_div_svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // // .attr("viewBox", `-25 -15 400 250`) + // // .attr("viewBox", `-30 -30 500 400`) + // // current + // // .attr("viewBox", `-90 -30 500 400`) + // // .attr("viewBox", `-90 -30 600 800`) + // // .attr("viewBox", `-90 -30 600 500`) + // .attr("viewBox", `30 -80 600 600`) + + + + // TOTAL_SIZE = flare.size + // l = flare.pred.replace(/of/g, "").split(', ') + // for (var j = 0; j < l.length; j++) { + // l[j] = l[j].split(' ')[2] + // } + // label_names = l + + + // root = flare; + // root.x0 = height / 2; + // root.y0 = 0; + + // function collapse(d) { + // if (d.children) { + // d._children = d.children; + // d._children.forEach(collapse); + // d.children = null; + // } + // } + + // root.children.forEach(collapse); + // update(root, l.length); + // // createLabels(l); + // }); + + // get data from the iris_tree_data.js + + var iris_tree_Data = { + "name": "petal length (cm) > 2.45000004768", + "pred": "100 of no, 50 of yes", + "children": [ + { + "children": [ + { + "children": [ + { + + "name": "The number of data = 43", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "43 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "43 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "The number of data = 3", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "1 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + , + { + + "name": "2 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 3, + "pred": "0 of no, 0 of yes" + } + + ], + "name": "petal length (cm) > 4.85000038147", + "side": "right", + "type": "categorical", + "size": 46, + "pred": "43 of no, 3 of yes" + }, + { + + "name": "petal length (cm) > 4.94999980927", + "children": [ + + { + + "name": "The number of data = 6", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "2 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + , + { + + "name": "4 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 4, + "pred": "4 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 6, + "pred": "0 of no, 0 of yes" + }, + + { + + "name": "The number of data = 48", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "47 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 47, + "pred": "47 of no, 0 of yes" + } + , + { + + "name": "1 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 48, + "pred": "0 of no, 0 of yes" + } + + + + ], + "side": "left", + "type": "categorical", + "size": 54, + "pred": "6 of no, 48 of yes" + } + ], + "name": "petal width (cm) > 1.75", + "side": "right", + "type": "numerical", + "size": 100, + "pred": "46 of no, 54 of yes" + },{ + "name": "The number of data = 50", + "children": [ + + + + { + + "name": "50 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "50 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "0 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "0 of no, 0 of yes" + } + ], + "side": "right", + "size": 150 + } + + function loadDataIrisTree (flare) { + + + + // console.log(getDepth(flare)) + + + tree = d3.layout.tree() + .separation(function (a, b) { return ((a.parent == root) && (b.parent == root)) ? strokeness : strokeness; }) + .size([height, getDepth(flare) * width / 8]); + + diagonal = d3.svg.diagonal() + .projection(function (d) { return [d.y, d.x]; }); + + // svg = d3.select("body").append("svg") + // .attr("width", getDepth(flare) * width / 8 + margin.right + margin.left) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + + + svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + + + TOTAL_SIZE = flare.size + l = flare.pred.replace(/of/g, "").split(', ') + for (var j = 0; j < l.length; j++) { + l[j] = l[j].split(' ')[2] + } + label_names = l + + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root, l.length); + // createLabels(l); + }; + + // make variable for + + loadDataIrisTree(iris_tree_Data) + + + + + // make the + + d3.select(self.frameElement).style("height", "480px"); + + function update(source, n_labels) { + + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + tpaths = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function (d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function (d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function (d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function (d) { + + return d._children ? "lightsteelblue" : "#fff"; + }); + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.name+' '+d.pred : d.name; }) + // .style("fill-opacity", 1e-6); + + function getTextWidth(text, fontSize, fontFace) { + var a = document.createElement('canvas'); + var b = a.getContext('2d'); + b.font = fontSize + 'px ' + fontFace; + return b.measureText(text).width; + } + + + + var rect = nodeEnter.append("rect") + .attr("width", 133 + 8) + .attr("height", 70) + .attr("x", -80) + .attr("y", -80) + .attr("rx", 6) + .attr("ry", 6) + .style("fill", function (d) { return (d.children || d._children) || version2 ? "#f0f0f0" : "#ffffff" }) + .style("stroke", function (d) { return (d.children || d._children) || version2 ? "rgb(155, 155, 155)" : "#ffffff" }) + .style("visibility", function (d) { return (d.children || d._children) || version2 ? "visible" : "hidden" }) + + // nodeEnter.append("svg:image") + // .attr("xlink:href", function (d) { return ((d.children || d._children) || version2) && d.type == 'categorical' ? 'http://fractalytics.io/wp-content/uploads/2019/05/cat.png' : 'http://fractalytics.io/wp-content/uploads/2019/05/num.png' }) + // .attr("x", "-76") + // .attr("y", "-74") + // .attr("width", "20") + // .attr("height", "20") + // .style("visibility", function (d) { + // if (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) { + // return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? 'hidden' : 'visible' + // } + // else return (d.children || d._children) || version2 ? "visible" : "hidden" + // }); + + nodeEnter.append("text") + .attr("x", function (d) { + ttr = 13 + if (default_colors.length > 5) { + ttr = (40 * default_colors.length) / 2 + } + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%", 10, 'Verdana') + 5.7) - (133 + 8)) / 2 : ttr + }) + .attr("y", function (d) { + ttr = dict_leaf_y[label_names.length] - 15 + if (default_colors.length > 5) { + ttr = -20 + } + return (d.children || d._children) || version2 ? -87 : ttr; + + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + // .style("font-size", "10px") + .style("font-size", "12px") + .style("font-family", "Verdana") + // .style("stroke", "#c2c2c2") + // .style("stroke", "#f2efe9") + .style("stroke", "black") + + // .style("stroke-width", "0.05em") + .text(function (d) { return true ? d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%" : ""; }) + .attr('visibility', function () { + return value_percent_top ? 'visible' : 'hidden' + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { + if (((d.children || d._children) || version2) && d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 11) { + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + } + else return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].substring(0, 11), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + }) + .attr("y", function (d) { + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return -65 + else return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? -55 : -65 + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "11px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.05em") + + .text(function (d) { + if ((d.children || d._children) || version2) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 15 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1]).substring(0, 13) + '..' + + } + else return ""; + }) + .append('svg:title') + .text(function (d) { + return (d.children || d._children) || version2 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : "" + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('=', ''), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 }) + .attr("y", -45) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "12px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.04em") + .text(function (d) { + + var toreturn = (d.children || d._children) || version2 ? d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('!=', 'not').replace(/=|\!=/g, '').replace('<', '<=') : ""; + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return toreturn + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? '' : toreturn + }) + + + var labels_w = 133 / n_labels + for (var j = 0; j < n_labels; j++) { + var curr = j + + + + // function temp(d) { + // console.log('temp') + // console.log(d) + // return d ? 133 : 0 + // } + + + // d=4 + // val=temp(d) + // console.log('val') + // console.log(val) + + + + + + nodeEnter.append("rect") + .attr("width", function (d) { + + var v; + if (d.pred) { + console.log(parseInt(d.pred.split(",")[curr].match(/\d+/)[0]), ' *133/', d.size) + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 133 / d.size; + console.log("1") + console.log(d) + } + else if (!d.children) { + v = 40 + console.log("2") + } + + if (square) { + console.log("3") + return (d.children || d._children) || version2 || d==null ? 133 / label_names.length - 4 : 40 + } + else { + console.log("4") + console.log(d) + return (d.children || d._children) || version2 || d==null ? v : 40 + } + + }) + .attr("height", 20) + .attr('rx', function (d) { return square ? 0 : 4 }) + .attr('ry', function (d) { return square ? 0 : 4 }) + .attr("x", function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 13 + if (default_colors.length > 5) { + ttr = 10 + j * 45 + } + + + if (square) return (d.children || d._children) || version2 ? -76 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -76 + ttl : ttr + }) + .attr("y", (function (d) { + console.log(default_colors.length) + if (default_colors.length > 5) { + return (d.children || d._children) || version2 ? -34 : -10 + } else return (d.children || d._children) || version2 ? -34 : dict_leaf_y[label_names.length] - 4 + 20 * j + j * 4; + })) + .style("fill", function (d) { + if (default_colors.length == 0) { + return default_colors[j] + } else { + return default_colors[j] + } + + } + ) + .attr('visibility', function (d) { + + if (d.pred) { + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[curr].match(/\d+/)[0]); + v = v * 133 / d.size + return v != 0 || !d.children ? "visible" : "hidden" + }) + .attr('opacity', function (d) { + var val + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + val = (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + } + else if (!d.children) val = (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + return (d.children || d._children) || version2 ? 1 : val / 100 + 0.3 + + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + + + + + var subg = nodeEnter.append("g") + .attr("width", labels_w) + .attr("height", 20) + .attr("x", function (d) { + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + return -80 + ttl + + }) + .attr("y", -30) + + + subg.append("text") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + .attr("x", (function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 18 + if (default_colors.length > 5) { + ttr = 14 + j * 45 + } + + if (square) return (d.children || d._children) || version2 ? -71 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -71 + ttl : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 5 + } + + return (d.children || d._children) || version2 ? -19 : ttr; + + })) + .style("fill", "white") + .style("font-size", "12px") + .attr('visibility', function (d) { + if (d.pred && !square) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) > 20 ? "vivible" : "hidden" + } + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + subg.append('text') + .text(function (d) { + if (d.pred) { + return '' + } + else if (!d.children) { + return label_names[curr] + } + }) + .attr("x", (function (d) { + ttr = 60 + if (default_colors.length > 5) { + ttr = 18 + j * 45 + } + return (d.children || d._children) || version2 ? -66 + j * labels_w : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 25 + } + return (d.children || d._children) || version2 ? -15 : ttr; + })) + .style("font-size", "14px") + .style("fill", "rgb(78, 74, 74)") + .attr('transform', function (d) { + + return default_colors.length <= 5 ? '' : 'translate(' + (-30 + j * 20) + ',' + (10 + j * (-37)) + ') rotate(55 50 50)' + }) + + + + } + + + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.pred : ''; }) + // .style("fill-opacity", 1e-6) + + + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 10) + .style("fill", function (d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function (d) { return d.target.id; }); + + + if (tree_branch) var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, default_strokeness]); + else var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, 8]); + + var color = d3.scale.linear() + .domain([0, 50, 100]) + .range(["rgb(2, 255, 219)", "blue"]); + + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("id", function (d) { return d.target.id; }) + .attr("d", function (d) { + var o = { x: source.x0, y: source.y0 }; + return diagonal({ source: o, target: o }); + }) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }) + .style("stroke", function (d) { + + if (!d.target) { + return "#fff" + // return "#A3A6A8" + } + else return tree_branch_color; + }) + .append("svg:title") + .text(function (d, i) { + if (hover_percent_parent) { + var val = ((d.target.size / TOTAL_SIZE) * 100).toFixed(2); + } else { + var val = ((d.target.size / d.source.size) * 100).toFixed(2); + } + + return val + "%" + }) + + var tlink = svg.selectAll("text.tlink") + .data(tpaths, function (d) { return d.target.id; }); + + tlink.enter().insert("text", "g") + .attr("class", "tlink") + .attr("dy", function (d) { return d.target.side == "left" ? -10 : 15; }) + .append('textPath') + .attr("xlink:href", function (d) { return '#' + d.target.id; }) //place the ID of the path here + .style("text-anchor", "middle") //place the text halfway on the arc + .attr("startOffset", "45%") + .text(function (d) { return d.target.side == "left" ? "No" : "Yes"; }) + .attr('visibility', function (d) { return d.target.depth == 1 && !version2 ? 'visible' : 'hidden' }) + .attr("opacity", 0.5) + + + tlink.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }); + + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function (d) { + d.x0 = d.x; + d.y0 = d.y; + }); + + + // Toggle children on click. + function click(d) { + + // console.log("d", d) + // // d name has "petal width (cm) > 1.75" + + // var name = d.name; + // convert d.name to string + var name = d.name.toString(); + if (name.includes("petal width (cm) > 1.75")) { + // console.log("petal width (cm) > 1.75") + // dis-show mainDTcon + if (document.getElementById("mainDTcon").style.display == "none"){ + + document.getElementById("mainDTcon").style.display = "block"; + document.getElementById("mainDTfirst").style.display = "none"; + } + else { + document.getElementById("mainDTcon").style.display = "none"; + document.getElementById("mainDTfirst").style.display = "block"; + + } + + + } + // console.log("name", name) + + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d, n_labels); + } + + + } + + + + + function createLabels(labels) { + + + var Size = 400 + + + var svg1 = d3.select("body") + .append("svg") + .attr("width", Size) + .attr("height", Size) + .attr("class", "legends"); + + console.log(labels.length) + console.log(default_colors.slice(0, labels.length)) + default_colors = default_colors.slice(0, labels.length) + if (default_colors.length == 2) default_colors.push('') + if (default_colors.length == 0) { + var c_l = default_colors + } else { + var c_l = default_colors + } + + for (i = 0; i < c_l.length; i++) { + + console.log(labels[i], "", c_l[i]) + + var legendG = svg1 + .append("g") + .attr("transform", function (d) { + return "translate(" + 0 + "," + (30 * i + Size / 33 + Size / 50) + ")"; // place each legend on the right and bump each one down 15 pixels + }) + .attr("class", "legend"); + + legendG.append("rect") // make a matching color rect + .attr("width", 15) + .attr("height", 15) + .attr("fill", c_l[i]) + .style('visibility', function () { + return labels[i] ? "visible" : "hidden" + }) + + legendG.append("text") // add the text + .text(labels[i]) + .style("font-size", 30) + .attr("y", 12) + .attr("x", 21) + + } + + } +} + + + +function decisiontree_Version2(){ + + + d3=d3v3 + + // var margin = {top: 20, right: 120, bottom: 20, left: 180}, + // width = 960 - margin.right - margin.left, + // height = 480 - margin.top - margin.bottom; + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + +var i = 0, + duration = 750, + root; + +var tree = d3.layout.tree() + .size([height, width]); + +var diagonal = d3.svg.diagonal() + .projection(function(d) { return [d.y, d.x]; }); + +// var svg = d3.select("body").append("svg") +// .attr("width", width + margin.right + margin.left) +// .attr("height", height + margin.top + margin.bottom) +// .append("g") +// .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + +// d3.json("structure_iris_dc_2.json", function(error, flare) { +// d3.json("structure_iris_dc_2.json", function(error, flare) { +// if (error) throw error; + +// root = flare; +// root.x0 = height / 2; +// root.y0 = 0; + +// function collapse(d) { +// if (d.children) { +// d._children = d.children; +// d._children.forEach(collapse); +// d.children = null; +// } +// } + +// root.children.forEach(collapse); +// update(root); +// }); + +var iris_tree_Data2 = { + "name": "petal length (cm) > 2.45000004768", + "children": [ + { + "name": "petal width (cm) > 1.75", + "children": [ + { + "name": "petal length (cm) > 4.85000038147", + "children": [ + { + "name": "0 of setosa, 0 of versicolor, 43 of virginica" + }, + { + "name": "0 of setosa, 1 of versicolor, 2 of virginica" + } + ] + }, + { + "name": "petal length (cm) > 4.94999980927", + "children": [ + { + "name": "0 of setosa, 2 of versicolor, 4 of virginica" + }, + { + "name": "0 of setosa, 47 of versicolor, 1 of virginica" + } + ] + } + ] + }, + { + "name": "50 of setosa, 0 of versicolor, 0 of virginica" + } + ] +} + +function loadDataIrisTree2(flare) { + + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root); +}; + + +loadDataIrisTree2(iris_tree_Data2) + +d3.select(self.frameElement).style("height", "480px"); + +function update(source) { + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function(d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function(d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function(d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function(d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeEnter.append("text") + .attr("x", function(d) { return d.children || d._children ? -10 : 10; }) + .attr("dy", ".35em") + .attr("text-anchor", function(d) { return d.children || d._children ? "end" : "start"; }) + .text(function(d) { return d.name; }) + .style("fill-opacity", 1e-6); + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function(d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 4.5) + .style("fill", function(d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function(d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function(d) { return d.target.id; }); + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("d", function(d) { + var o = {x: source.x0, y: source.y0}; + return diagonal({source: o, target: o}); + }); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal); + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function(d) { + var o = {x: source.x, y: source.y}; + return diagonal({source: o, target: o}); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function(d) { + d.x0 = d.x; + d.y0 = d.y; + }); +} + +// Toggle children on click. +function click(d) { + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d); +} + +} + + diff --git a/intropage/JSfiles/Aliro_original.js b/intropage/JSfiles/Aliro_original.js new file mode 100644 index 000000000..13f624713 --- /dev/null +++ b/intropage/JSfiles/Aliro_original.js @@ -0,0 +1,4169 @@ + +function pingURL() { + + // Aliro URL + var URL = "http://localhost:5080" + // var URL = "http://google.com" + // var URL = "http://www.daum.net" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + const sele = document.getElementById('loadingbutton'); + // make button with id temp always same size + // sele.style.width = "100%"; + // sele.style.height = "100%"; + + + sele.innerHTML = "Aliro is ready to run"; + + // Add URL to the button id temp href + sele.href = URL; + + + // Create flashing/glowing button effect to the button id temp + + + + // if mouse is on the element with id temp, then make the innerHTML bold + + sele.addEventListener('mouseover', function () { + sele.style.fontWeight = 'bold'; + }); + + // if mouse is not on the element with id temp, then make the innerHTML normal + sele.addEventListener('mouseout', function () { + sele.style.fontWeight = 'normal'; + }); + + + + + + // make blinkingtextcir text changed + const sele2 = document.getElementById('blinkingtextcir'); + + + + + // make the blinkingtextcir clickable and link to the URL + + sele2.innerHTML = "Aliro is ready to run"; + sele2.href = URL; + + // make the mouse cursor pointer like hand + sele2.style.cursor = "pointer"; + + sele2.addEventListener('click', function () { + // move to the URL + window.location.href = URL; + } ); + + + const selcir = document.getElementsByClassName('blinkingcir') + + for (var i = 0; i < selcir.length; i++) { + // selcir.setAttribute("r", "10"); + selcir[i].setAttribute("r", "7"); + } + + + + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + + + +function pingURL_DOWNLOAD() { + + // Aliro URL + var URL = "http://localhost:5080" + // var URL = "http://google.com" + // var URL = "http://www.daum.net" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + + + + + + + // make blinkingtextcir text changed + const sele2 = document.getElementById('blinkingtextcir'); + + + + + // make the blinkingtextcir clickable and link to the URL + + sele2.innerHTML = "Aliro is ready to run"; + sele2.href = URL; + + // make the mouse cursor pointer like hand + sele2.style.cursor = "pointer"; + + sele2.addEventListener('click', function () { + // move to the URL + window.location.href = URL; + } ); + + + const selcir = document.getElementsByClassName('blinkingcir') + + for (var i = 0; i < selcir.length; i++) { + // selcir.setAttribute("r", "10"); + selcir[i].setAttribute("r", "7"); + } + + + + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + + + + +// Below is the code for information visualization with D3.js + + + + + + +function colorClass(class_cat) { + if (class_cat == 0) { + // return "#ffbe0b"; + return "#c701bb"; + } + else if (class_cat == 1) { + return "#ff006e"; + } + else { + return "#8338ec"; + } + +} + + + +function locationByColorClass(class_cat) { + if (class_cat == 0) { + return 100; + } + else if (class_cat == 1) { + return 200; + } + else { + return 300; + } + +} + +// if div id = intuition_exp is clicked, then run the function +// the function descrption is below +// when div id = intuition_exp is clicked, show div id addingnuance + +function oneDPlot_v2() { + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + +} + + +function twoDPlot_v2() { + // console.log("mouseleave"); + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // mouseover the circles + svg.selectAll("circle") + .on("mouseover", function (d) { + console.log(x(d['petal-length'])); + console.log(y(d['sepal-length'])); + }) + +} + +function remove_boundaries_on2d_plot() { + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + //seclt all class named boundaries + svg.selectAll(".boundaries") + .transition() + .duration(1000) + .attr("opacity", "0") +} + + + +function drawing_boundaries_on_2d_plot() { + + console.log("drawing boundaries on 2d plot"); + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + + + + // // mouseover the circles + // svg.selectAll("circle") + // .on("mouseover", function(d) { + // console.log(x(d['petal-length'])); + // console.log(y(d['sepal-length'])); + // }) + + + + + + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + var data_class1 = [ + [ + [0, 0], + [156.7, height] + ] + + ]; + + var rects_class1 = svg.selectAll("hey") + .data(data_class1) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#ffbe0b") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_1"); + + + // 209.66666666666666 + // 120 + var data_class2 = + [ + [ + [156.7, 0], + [266.4, height] + ] + ]; + + var rects_class2 = svg.selectAll("hey") + .data(data_class2) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#ff006e") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_2"); + + var data_class3 = + [ + [ + [266.4, 0], + [500, height] + ] + ]; + + var rects_class3 = svg.selectAll("hey") + .data(data_class3) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#8338ec!important") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_3"); + + + +} + + + +function show_or_block_each_part() { + + // console.log("show_or_block is clicked"); + + + + + + + + + // from FSI to adding nuance + d3.select("#fromfsitoaddn").on("click", function () { + + + // non "Adding nuance" div + document.getElementById("intuition_exp").style.display = "none"; + // block "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "block"; + + + + // plot the data on 2D plane + twoDPlot_v2() + + }); + + // document.getElementById("addingnuance").style.display = "none"; + + + + // from adding nuance to FSI + d3.select("#fromaddntofsi").on("click", function () { + + + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + // block "Adding nuance" div + document.getElementById("intuition_exp").style.display = "block"; + + + // project the data on 1D + oneDPlot_v2() + + + }); + + + + + + + + + + // from adding nuance to drawing boundaris + d3.select("#fromaddntodrawb").on("click", function () { + + // block "Adding nuance" div + document.getElementById("drawingboundaries").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + + + // draw boundaries on the 2D plane + drawing_boundaries_on_2d_plot() + + + }); + + + + + + // from drawing boundaris to adding nuance + d3.select("#fromdrawbtoaddn").on("click", function () { + + // block "Adding nuance" div + document.getElementById("addingnuance").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("drawingboundaries").style.display = "none"; + + + // plot the data on 2D plane + remove_boundaries_on2d_plot() + twoDPlot_v2() + + + }); + + + + + + + + + +} + + + + + +function onedplotToTwodPlot() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + //commenting out d3.csv call + //d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + .attr("stroke", "white") + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "0") + // make y axis white + // .attr("fill", "white") + .attr("stroke", "white") + // .attr("stroke-width", "1px") + ; + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + .attr("cx", function (d) { return x(0) + 165; }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + + + // .attr("r", 2) + .attr("r", 3.5) + .style("fill", "#69b3a2") + .style("stroke", "black") + .attr("class", function (d) { return (d['class']); }) + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(0) + 165; }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function (d, i) { return (i * 10) }) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); }) + // .attr("cy", function (d) { return y(0); }) + + // // give color to the dots based on the class + // .style("fill", function (d) { return colorClass(d['class']) }); + + + + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(5000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + + + // console.log(num_circles); + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + // force to click on the button #projectxaxia + + + + + d3.select("#projectxaxia") + // .on("mousemove", mousemove ) + .on("click", project_x_axis); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot); + + + // }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + + +function all_possible_corr() { } + + + + + + + + + +function boxplot() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + {/* + + */} + + + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + //d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([4, 8.5]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "1"); + + + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + + .attr("rx", 3) + .attr("ry", 3) + .attr("width", 5) + .attr("height", 5) + .attr("class", function (d) { return "class " + d['class'] }) + .style("fill", "#69b3a2") + // opacity + .attr("opacity", "0.3") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("rect") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + // .attr("x", function (d) { return x(0)+165; } ) + // .attr("y", function (d) { return y(d['sepal-length']); } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + .attr("rx", 0) + .attr("ry", 0) + .attr("width", 30) + .attr("height", 5) + + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + .attr("opacity", "0.5") + + + + var num_rect = svg.selectAll("rect").size(); + console.log("num_rect: ", num_rect) + // + + + + + + + + + + + + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + + + var rotate_project_on_x_axis = function (d) { + + console.log("rotate_project_on_x_axis"); + + + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + // y.domain([0, 10]) + // svg.select(".myYaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "0") + // .call(d3.axisLeft(y)); + + + // x.domain([4,8.5]) + x.domain([4, 8.5]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + + // count the number of circles + + + + + // svg.selectAll("rect") + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + // // width and height of the rectangle 2 + // .attr('width',2) + // .attr('height',2) + // .attr('rx',3) + // .attr('ry',3) + + + + // calculate frequency of each class by data[1]['sepal-length'] + var frequency_class1 = {}; + var frequency_class2 = {}; + var frequency_class3 = {}; + + for (var i = 0; i < data.length; i++) { + // data[i]['class'] == '0' + + + if (data[i]['class'] == '0') { + // add count to frequency_class1[data[i]['sepal-length']] + if (frequency_class1[data[i]['sepal-length']] == undefined) { + frequency_class1[data[i]['sepal-length']] = 1; + } + else { + frequency_class1[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '1') { + // add count to frequency_class2[data[i]['sepal-length']] + if (frequency_class2[data[i]['sepal-length']] == undefined) { + frequency_class2[data[i]['sepal-length']] = 1; + } + else { + frequency_class2[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '2') { + // add count to frequency_class3[data[i]['sepal-length']] + if (frequency_class3[data[i]['sepal-length']] == undefined) { + frequency_class3[data[i]['sepal-length']] = 1; + } + else { + frequency_class3[data[i]['sepal-length']] += 1; + } + } + + + + + } + + + + + // console.log(frequency_class1[4.3]); + console.log(frequency_class1); + // get all keys of frequency_class1 + var keys_1 = Object.keys(frequency_class1); + console.log(frequency_class2); + var keys_2 = Object.keys(frequency_class2); + console.log(frequency_class3); + var keys_3 = Object.keys(frequency_class3); + + // set union keys_1, keys_2, keys_3 + var keys = keys_1.concat(keys_2, keys_3); + keys = [...new Set(keys)]; + // sort keys + keys.sort(function (a, b) { return a - b }); + console.log("keys:", keys); + // show length of keys + console.log("length of keys:", keys.length); + + + // print if frequency_class1 + + //show how many rectangles exist + console.log("number of rectangles:", svg.selectAll("rect").size()); + + // remove any rectangles if the keys.length is less than the number of rectangles + // that is, for example, if keys.length is 35, only 35 rectangles should be shown + // when rectangles are removed, make it transparent and removed + + if (keys.length < svg.selectAll("rect").size()) { + console.log("remove rectangles"); + svg.selectAll("rect") + .data(keys) + .exit() + .remove(); + console.log("after number of rectangles:", svg.selectAll("rect").size()); + + } + + + + // rotate 90 degree of rectangles + svg.selectAll("rect") + // .attr('opacity',0) + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(0); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // .attr('transform', 'translate(400,100)rotate(90)') + .attr('transform', 'translate(300,100) rotate(90)') + // .attr('transform', 'translate(400,100)') + // .attr('transform', 'rotate(90)') + // .attr('transform', 'translate(100,400)rotate(-90)') + // .attr('transform', 'rotate(-90)translate(10,200)') + .attr('opacity', 0.5) + // .attr("x", function(d){ return x(0) }); + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + .attr("x", function (d) { + // console.log("x(6)") + // console.log(x(6)) + return x(6); + }) + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + // console.log(data[1]['petal-length']); + // console.log(data[1]['sepal-length']); + + + // console.log(data); + // console.log(data[1]['sepal-length']); + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 0" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class1[keys_1[i]]) + return 20 * frequency_class1[keys_1[i]] + }) + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 1" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class2[keys_2[i]]) + return 20 * frequency_class2[keys_2[i]] + + }) + + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 2" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class3[keys_3[i]]) + return 20 * frequency_class3[keys_3[i]] + + }) + + + + + // plot rectangles based on frequency_class1, frequency_class2, frequency_class3 + // each rectangle has height frequency_class1 + // each rectangle has width 0.5 + // each rectangle has x = data[i]['sepal-length'] + + + + + // plot rectangles based on the frequency + + + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + + + // d3.select("#projectxaxia") + // // .on("mousemove", mousemove ) + // .on("click", project_x_axis ); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot); + + + + d3.select("#rotateprojectxaxia") + // .on("mousemove", mousemove ) + .on("click", rotate_project_on_x_axis); + + + + + // select all rectangles and make opacity 0 + // svg.selectAll("rect") + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + // .attr('opacity',0) + + // select all rectangles that have class attr is "class 0" + + + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + + + + + // d3.select("#rotateprojectxaxia") + // // .on("mousemove", mousemove ) + // .on("click", project_x_axis ); + + + //}) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + + + + + + +function boxplot_direct_from_y() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + d3 = d3version4 + console.log("inside!!!!_d3version4") + console.log(d3.version) + + console.log("inside!!!!_d3v3") + console.log(d3v3.version) + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + //d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // show white axis + .attr("stroke", "white") + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([4, 8.5]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "1") + .attr("stroke", "white"); + + + + // draw triangles 4, 8.5 + // i=0; + // while (i<=2) { + // svg.append("path") + // .attr("d", d3.symbol().type(d3.symbolTriangle).size(100)) + // // .attr("transform", function(d) { return "translate(" + x(0) + "," + 120+i + ")"; }) + // // .attr("transform", "rotate(90)") + // // rotate and translate + // .attr("transform", "rotate(90) translate(" + x(0) + "," + y(4+i) + ")") + // // .attr("transform", function(d) { return "translate(" + x(0) + "," + y(4+i) + ") rotate(90)"; }) + // .attr("fill", "black") + // .attr("opacity", "0.5") + // .attr("id", "triangle" + i) + + + // i+=30 + // } + + // translate(-1,119.7666625976562510) + // translate(1,238.7666625976562510) + + + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + // .attr("x", function(d){ return x(d['petal-length']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + + .attr("rx", 3) + .attr("ry", 3) + .attr("width", 5) + .attr("height", 5) + .attr("class", function (d) { return "class " + d['class'] }) + .style("fill", "#69b3a2") + // opacity + .attr("opacity", "0.3") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("rect") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { + console.log("x", x(d['petal-length'])) + return locationByColorClass(d['class']) + }) + // .attr("y", function (d) { return y(d['sepal-length']); } ) + // .attr("x", function(d){ return x(d['petal-length']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + .attr("rx", 0) + .attr("ry", 0) + .attr("width", 30) + .attr("height", 5) + + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + .attr("opacity", "0.5") + + + + var num_rect = svg.selectAll("rect").size(); + console.log("num_rect: ", num_rect) + // + + + + + + + + + + + + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + + + var barchart = function (d) { + + console.log("rotate_project_on_x_axis"); + + + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + // y.domain([0, 10]) + // svg.select(".myYaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "0") + // .call(d3.axisLeft(y)); + + + // x.domain([4,8.5]) + x.domain([4, 8.5]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + + + + + + + + + // calculate frequency of each class by data[1]['sepal-length'] + var frequency_class1 = {}; + var frequency_class2 = {}; + var frequency_class3 = {}; + + for (var i = 0; i < data.length; i++) { + // data[i]['class'] == '0' + + + if (data[i]['class'] == '0') { + // add count to frequency_class1[data[i]['sepal-length']] + if (frequency_class1[data[i]['sepal-length']] == undefined) { + frequency_class1[data[i]['sepal-length']] = 1; + } + else { + frequency_class1[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '1') { + // add count to frequency_class2[data[i]['sepal-length']] + if (frequency_class2[data[i]['sepal-length']] == undefined) { + frequency_class2[data[i]['sepal-length']] = 1; + } + else { + frequency_class2[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '2') { + // add count to frequency_class3[data[i]['sepal-length']] + if (frequency_class3[data[i]['sepal-length']] == undefined) { + frequency_class3[data[i]['sepal-length']] = 1; + } + else { + frequency_class3[data[i]['sepal-length']] += 1; + } + } + + + + + } + + + + + // console.log(frequency_class1[4.3]); + console.log(frequency_class1); + // get all keys of frequency_class1 + var keys_1 = Object.keys(frequency_class1); + console.log(frequency_class2); + var keys_2 = Object.keys(frequency_class2); + console.log(frequency_class3); + var keys_3 = Object.keys(frequency_class3); + + // set union keys_1, keys_2, keys_3 + var keys = keys_1.concat(keys_2, keys_3); + keys = [...new Set(keys)]; + // sort keys + keys.sort(function (a, b) { return a - b }); + console.log("keys:", keys); + // show length of keys + console.log("length of keys:", keys.length); + + + // print if frequency_class1 + + //show how many rectangles exist + console.log("number of rectangles:", svg.selectAll("rect").size()); + + // remove any rectangles if the keys.length is less than the number of rectangles + // that is, for example, if keys.length is 35, only 35 rectangles should be shown + // when rectangles are removed, make it fade out + + if (keys.length < svg.selectAll("rect").size()) { + + + console.log("remove rectangles"); + // svg.selectAll("rect") + // .data(keys) + // .transition() + // .duration(1000) + // .attr("opacity", "0") + // .remove(); + console.log("after number of rectangles:", svg.selectAll("rect").size()); + + + + + svg.selectAll("rect") + .data(keys) + .exit() + .remove(); + + + + + + + + + + } + + + + + + + // rotate 90 degree of rectangles + svg.selectAll("rect") + // .attr('opacity',0) + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(0); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // .attr('transform', 'translate(400,100)rotate(90)') + // .attr('transform', 'translate(300,100) rotate(90)') + // .attr('transform', 'translate(400,100)') + // .attr('transform', 'rotate(90)') + // .attr('transform', 'translate(100,400)rotate(-90)') + // .attr('transform', 'rotate(-90)translate(10,200)') + .attr('opacity', 0.5) + // .attr("x", function(d){ return x(0) }); + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + .attr("x", function (d) { + // console.log("x(6)") + // console.log(x(6)) + return x(4); + }) + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + // console.log(data[1]['petal-length']); + // console.log(data[1]['sepal-length']); + + + // console.log(data); + // console.log(data[1]['sepal-length']); + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 0" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class1[keys_1[i]]) + return 20 * frequency_class1[keys_1[i]] + }) + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 1" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class2[keys_2[i]]) + return 20 * frequency_class2[keys_2[i]] + + }) + + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 2" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class3[keys_3[i]]) + return 20 * frequency_class3[keys_3[i]] + + }) + + + + + // plot rectangles based on frequency_class1, frequency_class2, frequency_class3 + // each rectangle has height frequency_class1 + // each rectangle has width 0.5 + // each rectangle has x = data[i]['sepal-length'] + + + + + // plot rectangles based on the frequency + + + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + var mouseover = function (d) { + console.log("mouseover y axis"); + } + + var showboundaries = function (d) { + + // check there are d3.symbolCircle or not + // if there are d3.symbolCircle, then change the candicate_points. + + + + + + + + // translate(-1,119.7666625976562510) + // translate(1,238.7666625976562510) + + candiate_points = [ + [1, 176], + [1, 240], + [1, 112], + [1, 264] + ] + + for (i = 0; i < candiate_points.length; i++) { + svg.append("path") + .attr("d", d3.symbol().type(d3.symbolCircle).size(95)) + .attr("transform", function (d) { + console.log("x point", d3.mouse(this)[0]) + console.log("y point", d3.mouse(this)[1]) + return "translate(" + candiate_points[i][0] + "," + candiate_points[i][1] + ")"; + }) + // show fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + // .style("opacity", 0.5) + .style("opacity", function (d) { + if (i / 2 < 1) { + return 0.5 + } + else if (i / 2 >= 1) { + return 0 + } + }) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + // .attr("class", "circle_symbol_indicator") + .attr("id", "indicator" + i) + .attr("class", function (d) { + if (i / 2 < 1) { + return "circle_symbol_indicator_first" + } + else if (i / 2 >= 1) { + return "circle_symbol_indicator_second" + } + + }) + + // make rectangles + svg.append("rect") + .attr("x", 0) + .attr("y", 0) + .attr("width", 0) + .attr("height", 0) + .attr("transform", function (d) { + return "translate(" + candiate_points[i][0] + "," + candiate_points[i][1] + ")"; + } + ) + .style("opacity", 0) + .transition() + .duration(2000) + // .style("opacity", 0.5) + .style("opacity", function (d) { + if (i / 2 < 1) { + return 0.5 + } + else if (i / 2 >= 1) { + return 0 + } + }) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + // .attr("class", "rect_indicator") + .attr("id", "indicator") + .attr("class", function (d) { + if (i / 2 < 1) { + return "rect_indicator_first" + } + else if (i / 2 >= 1) { + return "rect_indicator_second" + } + }) + .attr("width", 500) + .attr("height", 0.5) + // .attr("x", -50) + // .attr("y", -50) + + + + + } + // svg.append("path") + // // .attr("d", d3.symbol().type(d3.symbolDiamond).size(95)) + // .attr("d", d3.symbol().type(d3.symbolCircle).size(95)) + // .attr("transform", function(d) { + // console.log("x point",d3.mouse(this)[0]) + // console.log("y point",d3.mouse(this)[1]) + // return "translate(" + 1+ "," + 200 + ")"; + // }) + // .style("fill", "black") + // .style("stroke", "black") + // .style("stroke-width", 1) + // .style("opacity", 0.5) + // .attr("class", "tri_temp") + + + + + + + + } + + + + + var showboundariesSecondBound = function (d) { + + console.log("showboundariesSecondBound") + + // circle_symbol_indicator_first + // rect_indicator_first + // make class circle_symbol_indicator_first and rect_indicator_first to fade away + d3.selectAll(".circle_symbol_indicator_first") + .transition() + .duration(2000) + .style("opacity", 0) + .style("fill", "red") + .style("stroke", "red") + .style("stroke-width", 1) + + + d3.selectAll(".rect_indicator_first") + .transition() + .duration(2000) + .style("opacity", 0) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + + + + + d3.selectAll(".circle_symbol_indicator_second") + .transition() + .duration(2000) + .style("opacity", 0.5) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + + + d3.selectAll(".rect_indicator_second") + .transition() + .duration(2000) + .style("opacity", 0.5) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + + + + } + + + var showpiechart_v1 = function (d) { + console.log("showpiechart") + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var svg = d3.select("#dataviz_area_div_second") + .append("svg") + .attr("id", "dataviz_area_div_svg_second") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-200 -180 500 400`) + + + // generate random + + // show pie chart + var data_pc = [10, 20, 100]; + + // var width = 960, + // height = 500, + // radius = Math.min(width, height) / 2; + + // var width = 960, + // height = 500, + var radius = Math.min(width, height) / 3; + + + var color = d3.scaleOrdinal() + .range(["#98abc5", "#8a89a6", "#7b6888"]); + + var arc = d3.arc() + .outerRadius(radius - 10) + .innerRadius(0); + + var labelArc = d3.arc() + .outerRadius(radius - 40) + .innerRadius(radius - 40); + + var pie = d3.pie() + .sort(null) + .value(function (d) { return d; }); + + + + var g = svg.selectAll(".arc") + .data(pie(data_pc)) + .enter() + .append("g") + // // show fade in effect + // // .style("opacity", 1) + // .style("opacity", 0) + // .transition() + // .duration(2000) + .style("opacity", 0) + .attr("class", "arc") + .attr("id", "first_piechart"); + + g.append("path") + .attr("d", arc) + .style("fill", function (d) { return color(d.data); }); + + g.append("text") + // fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + .attr("transform", function (d) { return "translate(" + labelArc.centroid(d) + ")"; }) + .attr("dy", ".35em") + .text(function (d) { return d.data; }); + + // fade in effect + g.style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + + + + + } + + var showpiechart_v1_reset = function (d) { + console.log("showpiechart") + + + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + // remove all under svg id = dataviz_area_div_svg_second with fade out effect + d3.select("#dataviz_area_div_svg_second") + .selectAll("*") + .transition() + .duration(2000) + .style("opacity", 0) + .remove() + + // remove svg id = dataviz_area_div_svg_second + d3.select("#dataviz_area_div_svg_second") + .remove() + + + // d3.select("#dataviz_area_div_svg_second").selectAll("*").remove(); + + + + + + var svg = d3.select("#dataviz_area_div_second") + .append("svg") + .attr("id", "dataviz_area_div_svg_second") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-200 -180 500 400`) + + + // generate random + + // show pie chart + var data_pc = [30, 10, 90]; + + // var width = 960, + // height = 500, + // radius = Math.min(width, height) / 2; + + // var width = 960, + // height = 500, + var radius = Math.min(width, height) / 3; + + + var color = d3.scaleOrdinal() + .range(["#98abc5", "#8a89a6", "#7b6888"]); + + var arc = d3.arc() + .outerRadius(radius - 10) + .innerRadius(0); + + var labelArc = d3.arc() + .outerRadius(radius - 40) + .innerRadius(radius - 40); + + var pie = d3.pie() + .sort(null) + .value(function (d) { return d; }); + + + + + + + + var g = svg.selectAll(".arc") + .data(pie(data_pc)) + .enter() + .append("g") + // // show fade in effect + // // .style("opacity", 1) + // .style("opacity", 0) + // .transition() + // .duration(2000) + .style("opacity", 0) + .attr("class", "arc") + .attr("id", "first_piechart"); + + g.append("path") + .attr("d", arc) + .style("fill", function (d) { return color(d.data); }); + + g.append("text") + // fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + .attr("transform", function (d) { return "translate(" + labelArc.centroid(d) + ")"; }) + .attr("dy", ".35em") + .text(function (d) { return d.data; }); + + // fade in effect + g.style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + + // make pie chart fade effecy when change the data of the pie chart + // d3.selectAll("#first_piechart") + // .transition() + // .duration(2000) + // .style("opacity", 0) + // .remove() + + + + + + + + // var data_pc_second = [25, 100, 10]; + + + // var g = svg.selectAll(".arc") + // .data(pie(data_pc_second)) + // .enter() + // .append("g") + // // // show fade in effect + // // // .style("opacity", 1) + // // .style("opacity", 0) + // // .transition() + // // .duration(2000) + // .style("opacity", 0) + // .attr("class", "arc") + // .attr("id","first_piechart"); + + // g.append("path") + // .attr("d", arc) + // .style("fill", function(d) { return color(d.data); }); + + // g.append("text") + // // fade in effect + // .style("opacity", 0) + // .transition() + // .duration(2000) + // .style("opacity", 1) + // .attr("transform", function(d) { return "translate(" + labelArc.centroid(d) + ")"; }) + // .attr("dy", ".35em") + // .text(function(d) { return d.data; }); + + // // fade in effect + // g.style("opacity", 0) + // .transition() + // .duration(2000) + // .style("opacity", 1) + + + } + + var showpiechart_v2 = function (d) { + console.log("showpiechart") + + + + + + + + + + } + + var showdonumchart = function (d) { + + var dataset = { + apples: [53245, 28479, 19697, 24037, 40245], + oranges: [200, 200, 200, 200] + }; + + var width = 960, + height = 500, + radius = Math.min(width, height) / 2; + + var enterClockwise = { + startAngle: 0, + endAngle: 0 + }; + + var enterAntiClockwise = { + startAngle: Math.PI * 2, + endAngle: Math.PI * 2 + }; + + var color = d3.scale.category20(); + + var pie = d3.layout.pie() + .sort(null); + + var arc = d3.svg.arc() + .innerRadius(radius - 100) + .outerRadius(radius - 20); + + var svg = d3.select('#Donut-chart').append('svg') + .attr('id', 'Donut-chart-render') + .attr("width", '100%') + .attr("height", '100%') + .attr('viewBox', (-width / 2) + ' ' + (-height / 2) + ' ' + width + ' ' + height) + .attr('preserveAspectRatio', 'xMinYMin') + + var path = svg.selectAll("path") + .data(pie(dataset.apples)) + .enter().append("path") + .attr("fill", function (d, i) { return color(i); }) + .attr("d", arc(enterClockwise)) + .each(function (d) { + this._current = { + data: d.data, + value: d.value, + startAngle: enterClockwise.startAngle, + endAngle: enterClockwise.endAngle + } + }); + + path.transition() + .duration(750) + .attrTween("d", arcTween); + + d3.selectAll("input").on("change", change); + + var timeout = setTimeout(function () { + d3.select("input[value=\"oranges\"]").property("checked", true).each(change); + }, 2000); + + function change() { + clearTimeout(timeout); + path = path.data(pie(dataset[this.value])); + path.enter().append("path") + .attr("fill", function (d, i) { + return color(i); + }) + .attr("d", arc(enterAntiClockwise)) + .each(function (d) { + this._current = { + data: d.data, + value: d.value, + startAngle: enterAntiClockwise.startAngle, + endAngle: enterAntiClockwise.endAngle + }; + }); // store the initial values + + path.exit() + .transition() + .duration(750) + .attrTween('d', arcTweenOut) + .remove() // now remove the exiting arcs + + path.transition().duration(750).attrTween("d", arcTween); // redraw the arcs + } + + function arcTween(a) { + var i = d3.interpolate(this._current, a); + this._current = i(0); + return function (t) { + return arc(i(t)); + }; + } + function arcTweenOut(a) { + var i = d3.interpolate(this._current, { startAngle: Math.PI * 2, endAngle: Math.PI * 2, value: 0 }); + this._current = i(0); + return function (t) { + return arc(i(t)); + }; + } + + + function type(d) { + d.value = +d.value; + return d; + } + + } + + var test = function (d) { + console.log("test"); + } + + + var thickyaxis = function (d) { + // make it thicker when mouse over on y axis class myYaxis + d3.select(".myYaxis") + .style("stroke-width", 3) + .style("opacity", 1) + } + + + var normalyaxis = function (d) { + // make it thicker when mouse over on y axis class myYaxis + d3.select(".myYaxis") + .style("stroke-width", 1) + .style("opacity", 1) + } + + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + + + + d3.select("#projectyaxia") + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + .on("click", twoDPlot); + + + + // d3.select("#rotateprojectxaxia") + // .on("click", rotate_project_on_x_axis ); + + + + d3.select("#rotateprojectxaxia") + .on("click", barchart); + + + + // mouse over on the class myYaxis + d3.select(".myYaxis") + .on("mouseover", thickyaxis) + .on("mouseout", normalyaxis) + .on("click", showboundaries) + .on("dblclick", showpiechart_v1); + + + d3.select("#show_piechart") + .on("click", showpiechart_v1); + + d3.select("#show_piechart_another") + // .on() + // .on("click", showpiechart_v1 ) + .on("click", showpiechart_v1_reset); + // .on("click", showpiechart_v2 ); + // .on("click", showdonumchart ); + // .on("click", test ); + + + // if select fbbfirsttosecondbound + d3.select("#fbbfirsttosecondbound") + .on("click", showboundariesSecondBound) + // .on("click", showpiechart ); + // .on("click", test ); + + + + + + + + + + //}) + + + + + + + + + +} + + + + +function decisiontree() { + + d3=d3v3 + + + var label_names; + + var TOTAL_SIZE; + // default_colors = [ + // "#c25975", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + + + default_colors = [ + "#74BFA1", "#E37852", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + ] + + + + // default_colors = [ + // "#18dcdc", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#c25975", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + // differnt combination of colors + // default_colors = + + + + + //************************************* Options******************************************************// + + // var file_name = "structureC1.json" // generator_1 + // var file_namev2 = "structureC2_origin.json" // generator_2 + + var file_name = "structure_iris_dc_1.json" // generator_1 + var file_namev2 = "structure_iris_dc_1.json" // generator_2 + + // var file_name = "structure_iris_dc_1_80_size.json" // generator_1 + // var file_namev2 = "structure_iris_dc_1_80_size.json" // generator_2 + + // var file_name = "structure.json" // generator_1 + // var file_namev2 = "structure.json" // generator_2 + var version2 = true // if true json from generator_2 will be used + + + var tree_branch = false // if the thickness of the branches depend on the value of targt + color * / + var tree_branch_parent = true // true: thickness from the root if not the direct parent + // var tree_branch_color = "black" + + var tree_branch_color = "#A3A6A8" + var strokeness = 120 // the degree of separation between the nodes + var default_strokeness = 50 + var hover_percent_parent = false // if the display percentage depends on the direct parent or the root + var square = false + var rect_percent = true //display the percentage or the value in the small rectangles of the labels + var value_percent_top = true /// if we display the value and the percentage above the rectangle / + + var dict_leaf_y = { 1: 0, 2: -17.5, 3: -35, 4: -52.5, 5: -70, 6: -87.5, 6: -105, 7: -122.5, 8: -140, 9: -157.5, 10: -175 } + + + /****************************************************************************************************** */ + + + + + getDepth = function (obj) { + var depth = 0; + if (obj.children) { + obj.children.forEach(function (d) { + var tmpDepth = getDepth(d) + if (tmpDepth > depth) { + depth = tmpDepth + } + }) + } + return 1 + depth + } + + + // var margin = { top: 20, right: 120, bottom: 20, left: 180 }, + // width = 2000 + 960 - margin.right - margin.left, + // height = 800 - margin.top - margin.bottom; + + // current + // var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + // width = 500 - margin.left - margin.right, + // height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var i = 0, + duration = 550, + root; + + var tree + var diagonal + var svg + + var filetochoose = version2 ? file_namev2 : file_name + + d3.json(filetochoose, function (error, flare) { + if (error) throw error; + + + + // console.log(getDepth(flare)) + + + tree = d3.layout.tree() + .separation(function (a, b) { return ((a.parent == root) && (b.parent == root)) ? strokeness : strokeness; }) + .size([height, getDepth(flare) * width / 8]); + + diagonal = d3.svg.diagonal() + .projection(function (d) { return [d.y, d.x]; }); + + // svg = d3.select("body").append("svg") + // .attr("width", getDepth(flare) * width / 8 + margin.right + margin.left) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + + + svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + + + TOTAL_SIZE = flare.size + l = flare.pred.replace(/of/g, "").split(', ') + for (var j = 0; j < l.length; j++) { + l[j] = l[j].split(' ')[2] + } + label_names = l + + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root, l.length); + // createLabels(l); + }); + + // make variable for + + + + + // make the + + d3.select(self.frameElement).style("height", "480px"); + + function update(source, n_labels) { + + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + tpaths = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function (d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function (d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function (d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function (d) { + + return d._children ? "lightsteelblue" : "#fff"; + }); + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.name+' '+d.pred : d.name; }) + // .style("fill-opacity", 1e-6); + + function getTextWidth(text, fontSize, fontFace) { + var a = document.createElement('canvas'); + var b = a.getContext('2d'); + b.font = fontSize + 'px ' + fontFace; + return b.measureText(text).width; + } + + + + var rect = nodeEnter.append("rect") + .attr("width", 133 + 8) + .attr("height", 70) + .attr("x", -80) + .attr("y", -80) + .attr("rx", 6) + .attr("ry", 6) + .style("fill", function (d) { return (d.children || d._children) || version2 ? "#f0f0f0" : "#ffffff" }) + .style("stroke", function (d) { return (d.children || d._children) || version2 ? "rgb(155, 155, 155)" : "#ffffff" }) + .style("visibility", function (d) { return (d.children || d._children) || version2 ? "visible" : "hidden" }) + + nodeEnter.append("svg:image") + .attr("xlink:href", function (d) { return ((d.children || d._children) || version2) && d.type == 'categorical' ? 'http://fractalytics.io/wp-content/uploads/2019/05/cat.png' : 'http://fractalytics.io/wp-content/uploads/2019/05/num.png' }) + .attr("x", "-76") + .attr("y", "-74") + .attr("width", "20") + .attr("height", "20") + .style("visibility", function (d) { + if (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? 'hidden' : 'visible' + } + else return (d.children || d._children) || version2 ? "visible" : "hidden" + }); + + nodeEnter.append("text") + .attr("x", function (d) { + ttr = 13 + if (default_colors.length > 5) { + ttr = (40 * default_colors.length) / 2 + } + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%", 10, 'Verdana') + 5.7) - (133 + 8)) / 2 : ttr + }) + .attr("y", function (d) { + ttr = dict_leaf_y[label_names.length] - 15 + if (default_colors.length > 5) { + ttr = -20 + } + return (d.children || d._children) || version2 ? -87 : ttr; + + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "10px") + .style("font-family", "Verdana") + .style("stroke", "#c2c2c2") + .style("stroke-width", "0.05em") + .text(function (d) { return true ? d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%" : ""; }) + .attr('visibility', function () { + return value_percent_top ? 'visible' : 'hidden' + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { + if (((d.children || d._children) || version2) && d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 11) { + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + } + else return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].substring(0, 11), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + }) + .attr("y", function (d) { + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return -65 + else return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? -55 : -65 + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "14px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.05em") + + .text(function (d) { + if ((d.children || d._children) || version2) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 15 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1]).substring(0, 13) + '..' + + } + else return ""; + }) + .append('svg:title') + .text(function (d) { + return (d.children || d._children) || version2 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : "" + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('=', ''), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 }) + .attr("y", -45) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "12px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.04em") + .text(function (d) { + + var toreturn = (d.children || d._children) || version2 ? d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('!=', 'not').replace(/=|\!=/g, '').replace('<', '<=') : ""; + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return toreturn + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? '' : toreturn + }) + + + var labels_w = 133 / n_labels + for (var j = 0; j < n_labels; j++) { + var curr = j + + + + nodeEnter.append("rect") + .attr("width", function (d) { + var v; + if (d.pred) { + console.log(parseInt(d.pred.split(",")[curr].match(/\d+/)[0]), ' *133/', d.size) + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 133 / d.size; + } + else if (!d.children) { + v = 40 + } + + if (square) return (d.children || d._children) || version2 ? 133 / label_names.length - 4 : 40 + else return (d.children || d._children) || version2 ? v : 40 + }) + .attr("height", 20) + .attr('rx', function (d) { return square ? 0 : 4 }) + .attr('ry', function (d) { return square ? 0 : 4 }) + .attr("x", function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 13 + if (default_colors.length > 5) { + ttr = 10 + j * 45 + } + + + if (square) return (d.children || d._children) || version2 ? -76 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -76 + ttl : ttr + }) + .attr("y", (function (d) { + console.log(default_colors.length) + if (default_colors.length > 5) { + return (d.children || d._children) || version2 ? -34 : -10 + } else return (d.children || d._children) || version2 ? -34 : dict_leaf_y[label_names.length] - 4 + 20 * j + j * 4; + })) + .style("fill", function (d) { + if (default_colors.length == 0) { + return default_colors[j] + } else { + return default_colors[j] + } + + } + ) + .attr('visibility', function (d) { + + if (d.pred) { + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[curr].match(/\d+/)[0]); + v = v * 133 / d.size + return v != 0 || !d.children ? "visible" : "hidden" + }) + .attr('opacity', function (d) { + var val + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + val = (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + } + else if (!d.children) val = (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + return (d.children || d._children) || version2 ? 1 : val / 100 + 0.3 + + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + + + + + var subg = nodeEnter.append("g") + .attr("width", labels_w) + .attr("height", 20) + .attr("x", function (d) { + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + return -80 + ttl + + }) + .attr("y", -30) + + + subg.append("text") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + .attr("x", (function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 18 + if (default_colors.length > 5) { + ttr = 14 + j * 45 + } + + if (square) return (d.children || d._children) || version2 ? -71 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -71 + ttl : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 5 + } + + return (d.children || d._children) || version2 ? -19 : ttr; + + })) + .style("fill", "white") + .style("font-size", "12px") + .attr('visibility', function (d) { + if (d.pred && !square) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) > 20 ? "vivible" : "hidden" + } + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + subg.append('text') + .text(function (d) { + if (d.pred) { + return '' + } + else if (!d.children) { + return label_names[curr] + } + }) + .attr("x", (function (d) { + ttr = 60 + if (default_colors.length > 5) { + ttr = 18 + j * 45 + } + return (d.children || d._children) || version2 ? -66 + j * labels_w : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 25 + } + return (d.children || d._children) || version2 ? -15 : ttr; + })) + .style("font-size", "14px") + .style("fill", "rgb(78, 74, 74)") + .attr('transform', function (d) { + + return default_colors.length <= 5 ? '' : 'translate(' + (-30 + j * 20) + ',' + (10 + j * (-37)) + ') rotate(55 50 50)' + }) + + + + } + + + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.pred : ''; }) + // .style("fill-opacity", 1e-6) + + + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 10) + .style("fill", function (d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function (d) { return d.target.id; }); + + + if (tree_branch) var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, default_strokeness]); + else var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, 8]); + + var color = d3.scale.linear() + .domain([0, 50, 100]) + .range(["rgb(2, 255, 219)", "blue"]); + + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("id", function (d) { return d.target.id; }) + .attr("d", function (d) { + var o = { x: source.x0, y: source.y0 }; + return diagonal({ source: o, target: o }); + }) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }) + .style("stroke", function (d) { + + if (!d.target) { + return "#fff" + // return "#A3A6A8" + } + else return tree_branch_color; + }) + .append("svg:title") + .text(function (d, i) { + if (hover_percent_parent) { + var val = ((d.target.size / TOTAL_SIZE) * 100).toFixed(2); + } else { + var val = ((d.target.size / d.source.size) * 100).toFixed(2); + } + + return val + "%" + }) + + var tlink = svg.selectAll("text.tlink") + .data(tpaths, function (d) { return d.target.id; }); + + tlink.enter().insert("text", "g") + .attr("class", "tlink") + .attr("dy", function (d) { return d.target.side == "left" ? -10 : 15; }) + .append('textPath') + .attr("xlink:href", function (d) { return '#' + d.target.id; }) //place the ID of the path here + .style("text-anchor", "middle") //place the text halfway on the arc + .attr("startOffset", "45%") + .text(function (d) { return d.target.side == "left" ? "No" : "Yes"; }) + .attr('visibility', function (d) { return d.target.depth == 1 && !version2 ? 'visible' : 'hidden' }) + .attr("opacity", 0.5) + + + tlink.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }); + + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function (d) { + d.x0 = d.x; + d.y0 = d.y; + }); + + + // Toggle children on click. + function click(d) { + + // console.log("d", d) + // // d name has "petal width (cm) > 1.75" + + // var name = d.name; + // convert d.name to string + var name = d.name.toString(); + if (name.includes("petal width (cm) > 1.75")) { + // console.log("petal width (cm) > 1.75") + // dis-show mainDTcon + if (document.getElementById("mainDTcon").style.display == "none"){ + + document.getElementById("mainDTcon").style.display = "block"; + document.getElementById("mainDTfirst").style.display = "none"; + } + else { + document.getElementById("mainDTcon").style.display = "none"; + document.getElementById("mainDTfirst").style.display = "block"; + + } + + + } + // console.log("name", name) + + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d, n_labels); + } + + + } + + + + + function createLabels(labels) { + + + var Size = 400 + + + var svg1 = d3.select("body") + .append("svg") + .attr("width", Size) + .attr("height", Size) + .attr("class", "legends"); + + console.log(labels.length) + console.log(default_colors.slice(0, labels.length)) + default_colors = default_colors.slice(0, labels.length) + if (default_colors.length == 2) default_colors.push('') + if (default_colors.length == 0) { + var c_l = default_colors + } else { + var c_l = default_colors + } + + for (i = 0; i < c_l.length; i++) { + + console.log(labels[i], "", c_l[i]) + + var legendG = svg1 + .append("g") + .attr("transform", function (d) { + return "translate(" + 0 + "," + (30 * i + Size / 33 + Size / 50) + ")"; // place each legend on the right and bump each one down 15 pixels + }) + .attr("class", "legend"); + + legendG.append("rect") // make a matching color rect + .attr("width", 15) + .attr("height", 15) + .attr("fill", c_l[i]) + .style('visibility', function () { + return labels[i] ? "visible" : "hidden" + }) + + legendG.append("text") // add the text + .text(labels[i]) + .style("font-size", 30) + .attr("y", 12) + .attr("x", 21) + + } + + } +} + + + +function decisiontree_Version2(){ + + + d3=d3v3 + + // var margin = {top: 20, right: 120, bottom: 20, left: 180}, + // width = 960 - margin.right - margin.left, + // height = 480 - margin.top - margin.bottom; + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + +var i = 0, + duration = 750, + root; + +var tree = d3.layout.tree() + .size([height, width]); + +var diagonal = d3.svg.diagonal() + .projection(function(d) { return [d.y, d.x]; }); + +// var svg = d3.select("body").append("svg") +// .attr("width", width + margin.right + margin.left) +// .attr("height", height + margin.top + margin.bottom) +// .append("g") +// .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + +// d3.json("structure_iris_dc_2.json", function(error, flare) { + d3.json("structure_iris_dc_2.json", function(error, flare) { + if (error) throw error; + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root); +}); + +d3.select(self.frameElement).style("height", "480px"); + +function update(source) { + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function(d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function(d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function(d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function(d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeEnter.append("text") + .attr("x", function(d) { return d.children || d._children ? -10 : 10; }) + .attr("dy", ".35em") + .attr("text-anchor", function(d) { return d.children || d._children ? "end" : "start"; }) + .text(function(d) { return d.name; }) + .style("fill-opacity", 1e-6); + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function(d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 4.5) + .style("fill", function(d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function(d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function(d) { return d.target.id; }); + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("d", function(d) { + var o = {x: source.x0, y: source.y0}; + return diagonal({source: o, target: o}); + }); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal); + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function(d) { + var o = {x: source.x, y: source.y}; + return diagonal({source: o, target: o}); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function(d) { + d.x0 = d.x; + d.y0 = d.y; + }); +} + +// Toggle children on click. +function click(d) { + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d); +} + +} + + diff --git a/intropage/JSfiles/backgroundOverlayeffect.js b/intropage/JSfiles/backgroundOverlayeffect.js new file mode 100644 index 000000000..a26fb654c --- /dev/null +++ b/intropage/JSfiles/backgroundOverlayeffect.js @@ -0,0 +1,18 @@ +function on() { + document.getElementById("overlay").style.display = "block"; +} + +function off() { + document.getElementById("overlay").style.display = "block"; + } + + + + + + + +// wait until document.getElementById("overlay") is loaded +// then run the on() function + +document.getElementById("overlay").addEventListener("load", on()); diff --git a/intropage/JSfiles/carousel.js b/intropage/JSfiles/carousel.js new file mode 100644 index 000000000..25fb0e5f4 --- /dev/null +++ b/intropage/JSfiles/carousel.js @@ -0,0 +1,36 @@ +let slideIndex = 1; +showSlides(slideIndex); + +// Next/previous controls +function plusSlides(n) { + showSlides(slideIndex += n); +} + +// Thumbnail image controls +function currentSlide(n) { + showSlides(slideIndex = n); +} + +function showSlides(n) { + let i; + let slides = document.getElementsByClassName("mySlides"); + console.log("slides",slides); + let dots = document.getElementsByClassName("dot"); + if (n > slides.length) {slideIndex = 1} + if (n < 1) {slideIndex = slides.length} + for (i = 0; i < slides.length; i++) { + slides[i].style.display = "none"; + } + for (i = 0; i < dots.length; i++) { + dots[i].className = dots[i].className.replace(" active", ""); + } + +// wait until slides[(slideIndex - 1)] is defined + if (slides[(slideIndex - 1)]) { + slides[(slideIndex - 1)].style.display = "block"; + dots[(slideIndex - 1)].className += " active"; + } + +// slides[slideIndex-1].style.display = "block"; +// dots[slideIndex-1].className += " active"; +} \ No newline at end of file diff --git a/intropage/JSfiles/d3-3d.min.js b/intropage/JSfiles/d3-3d.min.js new file mode 100644 index 000000000..624542270 --- /dev/null +++ b/intropage/JSfiles/d3-3d.min.js @@ -0,0 +1 @@ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports):"function"==typeof define&&define.amd?define(["exports"],e):e((t="undefined"!=typeof globalThis?globalThis:t||self).d3={})}(this,function(t){"use strict";function g(t){var e=t.slice(0),r=0;e.push(e[0]);for(var o=0;o<=t.length-1;o++){var n=e[o].rotated,c=e[o+1].rotated;r+=(c.x-n.x)*(c.y+n.y)}return 0 b ? 1 : a >= b ? 0 : NaN; + } + d3.descending = function(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; + }; + d3.min = function(array, f) { + var i = -1, n = array.length, a, b; + if (arguments.length === 1) { + while (++i < n) if ((b = array[i]) != null && b >= b) { + a = b; + break; + } + while (++i < n) if ((b = array[i]) != null && a > b) a = b; + } else { + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b >= b) { + a = b; + break; + } + while (++i < n) if ((b = f.call(array, array[i], i)) != null && a > b) a = b; + } + return a; + }; + d3.max = function(array, f) { + var i = -1, n = array.length, a, b; + if (arguments.length === 1) { + while (++i < n) if ((b = array[i]) != null && b >= b) { + a = b; + break; + } + while (++i < n) if ((b = array[i]) != null && b > a) a = b; + } else { + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b >= b) { + a = b; + break; + } + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b > a) a = b; + } + return a; + }; + d3.extent = function(array, f) { + var i = -1, n = array.length, a, b, c; + if (arguments.length === 1) { + while (++i < n) if ((b = array[i]) != null && b >= b) { + a = c = b; + break; + } + while (++i < n) if ((b = array[i]) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } else { + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b >= b) { + a = c = b; + break; + } + while (++i < n) if ((b = f.call(array, array[i], i)) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } + return [ a, c ]; + }; + function d3_number(x) { + return x === null ? NaN : +x; + } + function d3_numeric(x) { + return !isNaN(x); + } + d3.sum = function(array, f) { + var s = 0, n = array.length, a, i = -1; + if (arguments.length === 1) { + while (++i < n) if (d3_numeric(a = +array[i])) s += a; + } else { + while (++i < n) if (d3_numeric(a = +f.call(array, array[i], i))) s += a; + } + return s; + }; + d3.mean = function(array, f) { + var s = 0, n = array.length, a, i = -1, j = n; + if (arguments.length === 1) { + while (++i < n) if (d3_numeric(a = d3_number(array[i]))) s += a; else --j; + } else { + while (++i < n) if (d3_numeric(a = d3_number(f.call(array, array[i], i)))) s += a; else --j; + } + if (j) return s / j; + }; + d3.quantile = function(values, p) { + var H = (values.length - 1) * p + 1, h = Math.floor(H), v = +values[h - 1], e = H - h; + return e ? v + e * (values[h] - v) : v; + }; + d3.median = function(array, f) { + var numbers = [], n = array.length, a, i = -1; + if (arguments.length === 1) { + while (++i < n) if (d3_numeric(a = d3_number(array[i]))) numbers.push(a); + } else { + while (++i < n) if (d3_numeric(a = d3_number(f.call(array, array[i], i)))) numbers.push(a); + } + if (numbers.length) return d3.quantile(numbers.sort(d3_ascending), .5); + }; + d3.variance = function(array, f) { + var n = array.length, m = 0, a, d, s = 0, i = -1, j = 0; + if (arguments.length === 1) { + while (++i < n) { + if (d3_numeric(a = d3_number(array[i]))) { + d = a - m; + m += d / ++j; + s += d * (a - m); + } + } + } else { + while (++i < n) { + if (d3_numeric(a = d3_number(f.call(array, array[i], i)))) { + d = a - m; + m += d / ++j; + s += d * (a - m); + } + } + } + if (j > 1) return s / (j - 1); + }; + d3.deviation = function() { + var v = d3.variance.apply(this, arguments); + return v ? Math.sqrt(v) : v; + }; + function d3_bisector(compare) { + return { + left: function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (compare(a[mid], x) < 0) lo = mid + 1; else hi = mid; + } + return lo; + }, + right: function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (compare(a[mid], x) > 0) hi = mid; else lo = mid + 1; + } + return lo; + } + }; + } + var d3_bisect = d3_bisector(d3_ascending); + d3.bisectLeft = d3_bisect.left; + d3.bisect = d3.bisectRight = d3_bisect.right; + d3.bisector = function(f) { + return d3_bisector(f.length === 1 ? function(d, x) { + return d3_ascending(f(d), x); + } : f); + }; + d3.shuffle = function(array, i0, i1) { + if ((m = arguments.length) < 3) { + i1 = array.length; + if (m < 2) i0 = 0; + } + var m = i1 - i0, t, i; + while (m) { + i = Math.random() * m-- | 0; + t = array[m + i0], array[m + i0] = array[i + i0], array[i + i0] = t; + } + return array; + }; + d3.permute = function(array, indexes) { + var i = indexes.length, permutes = new Array(i); + while (i--) permutes[i] = array[indexes[i]]; + return permutes; + }; + d3.pairs = function(array) { + var i = 0, n = array.length - 1, p0, p1 = array[0], pairs = new Array(n < 0 ? 0 : n); + while (i < n) pairs[i] = [ p0 = p1, p1 = array[++i] ]; + return pairs; + }; + d3.transpose = function(matrix) { + if (!(n = matrix.length)) return []; + for (var i = -1, m = d3.min(matrix, d3_transposeLength), transpose = new Array(m); ++i < m; ) { + for (var j = -1, n, row = transpose[i] = new Array(n); ++j < n; ) { + row[j] = matrix[j][i]; + } + } + return transpose; + }; + function d3_transposeLength(d) { + return d.length; + } + d3.zip = function() { + return d3.transpose(arguments); + }; + d3.keys = function(map) { + var keys = []; + for (var key in map) keys.push(key); + return keys; + }; + d3.values = function(map) { + var values = []; + for (var key in map) values.push(map[key]); + return values; + }; + d3.entries = function(map) { + var entries = []; + for (var key in map) entries.push({ + key: key, + value: map[key] + }); + return entries; + }; + d3.merge = function(arrays) { + var n = arrays.length, m, i = -1, j = 0, merged, array; + while (++i < n) j += arrays[i].length; + merged = new Array(j); + while (--n >= 0) { + array = arrays[n]; + m = array.length; + while (--m >= 0) { + merged[--j] = array[m]; + } + } + return merged; + }; + var abs = Math.abs; + d3.range = function(start, stop, step) { + if (arguments.length < 3) { + step = 1; + if (arguments.length < 2) { + stop = start; + start = 0; + } + } + if ((stop - start) / step === Infinity) throw new Error("infinite range"); + var range = [], k = d3_range_integerScale(abs(step)), i = -1, j; + start *= k, stop *= k, step *= k; + if (step < 0) while ((j = start + step * ++i) > stop) range.push(j / k); else while ((j = start + step * ++i) < stop) range.push(j / k); + return range; + }; + function d3_range_integerScale(x) { + var k = 1; + while (x * k % 1) k *= 10; + return k; + } + function d3_class(ctor, properties) { + for (var key in properties) { + Object.defineProperty(ctor.prototype, key, { + value: properties[key], + enumerable: false + }); + } + } + d3.map = function(object, f) { + var map = new d3_Map(); + if (object instanceof d3_Map) { + object.forEach(function(key, value) { + map.set(key, value); + }); + } else if (Array.isArray(object)) { + var i = -1, n = object.length, o; + if (arguments.length === 1) while (++i < n) map.set(i, object[i]); else while (++i < n) map.set(f.call(object, o = object[i], i), o); + } else { + for (var key in object) map.set(key, object[key]); + } + return map; + }; + function d3_Map() { + this._ = Object.create(null); + } + var d3_map_proto = "__proto__", d3_map_zero = "\x00"; + d3_class(d3_Map, { + has: d3_map_has, + get: function(key) { + return this._[d3_map_escape(key)]; + }, + set: function(key, value) { + return this._[d3_map_escape(key)] = value; + }, + remove: d3_map_remove, + keys: d3_map_keys, + values: function() { + var values = []; + for (var key in this._) values.push(this._[key]); + return values; + }, + entries: function() { + var entries = []; + for (var key in this._) entries.push({ + key: d3_map_unescape(key), + value: this._[key] + }); + return entries; + }, + size: d3_map_size, + empty: d3_map_empty, + forEach: function(f) { + for (var key in this._) f.call(this, d3_map_unescape(key), this._[key]); + } + }); + function d3_map_escape(key) { + return (key += "") === d3_map_proto || key[0] === d3_map_zero ? d3_map_zero + key : key; + } + function d3_map_unescape(key) { + return (key += "")[0] === d3_map_zero ? key.slice(1) : key; + } + function d3_map_has(key) { + return d3_map_escape(key) in this._; + } + function d3_map_remove(key) { + return (key = d3_map_escape(key)) in this._ && delete this._[key]; + } + function d3_map_keys() { + var keys = []; + for (var key in this._) keys.push(d3_map_unescape(key)); + return keys; + } + function d3_map_size() { + var size = 0; + for (var key in this._) ++size; + return size; + } + function d3_map_empty() { + for (var key in this._) return false; + return true; + } + d3.nest = function() { + var nest = {}, keys = [], sortKeys = [], sortValues, rollup; + function map(mapType, array, depth) { + if (depth >= keys.length) return rollup ? rollup.call(nest, array) : sortValues ? array.sort(sortValues) : array; + var i = -1, n = array.length, key = keys[depth++], keyValue, object, setter, valuesByKey = new d3_Map(), values; + while (++i < n) { + if (values = valuesByKey.get(keyValue = key(object = array[i]))) { + values.push(object); + } else { + valuesByKey.set(keyValue, [ object ]); + } + } + if (mapType) { + object = mapType(); + setter = function(keyValue, values) { + object.set(keyValue, map(mapType, values, depth)); + }; + } else { + object = {}; + setter = function(keyValue, values) { + object[keyValue] = map(mapType, values, depth); + }; + } + valuesByKey.forEach(setter); + return object; + } + function entries(map, depth) { + if (depth >= keys.length) return map; + var array = [], sortKey = sortKeys[depth++]; + map.forEach(function(key, keyMap) { + array.push({ + key: key, + values: entries(keyMap, depth) + }); + }); + return sortKey ? array.sort(function(a, b) { + return sortKey(a.key, b.key); + }) : array; + } + nest.map = function(array, mapType) { + return map(mapType, array, 0); + }; + nest.entries = function(array) { + return entries(map(d3.map, array, 0), 0); + }; + nest.key = function(d) { + keys.push(d); + return nest; + }; + nest.sortKeys = function(order) { + sortKeys[keys.length - 1] = order; + return nest; + }; + nest.sortValues = function(order) { + sortValues = order; + return nest; + }; + nest.rollup = function(f) { + rollup = f; + return nest; + }; + return nest; + }; + d3.set = function(array) { + var set = new d3_Set(); + if (array) for (var i = 0, n = array.length; i < n; ++i) set.add(array[i]); + return set; + }; + function d3_Set() { + this._ = Object.create(null); + } + d3_class(d3_Set, { + has: d3_map_has, + add: function(key) { + this._[d3_map_escape(key += "")] = true; + return key; + }, + remove: d3_map_remove, + values: d3_map_keys, + size: d3_map_size, + empty: d3_map_empty, + forEach: function(f) { + for (var key in this._) f.call(this, d3_map_unescape(key)); + } + }); + d3.behavior = {}; + function d3_identity(d) { + return d; + } + d3.rebind = function(target, source) { + var i = 1, n = arguments.length, method; + while (++i < n) target[method = arguments[i]] = d3_rebind(target, source, source[method]); + return target; + }; + function d3_rebind(target, source, method) { + return function() { + var value = method.apply(source, arguments); + return value === source ? target : value; + }; + } + function d3_vendorSymbol(object, name) { + if (name in object) return name; + name = name.charAt(0).toUpperCase() + name.slice(1); + for (var i = 0, n = d3_vendorPrefixes.length; i < n; ++i) { + var prefixName = d3_vendorPrefixes[i] + name; + if (prefixName in object) return prefixName; + } + } + var d3_vendorPrefixes = [ "webkit", "ms", "moz", "Moz", "o", "O" ]; + function d3_noop() {} + d3.dispatch = function() { + var dispatch = new d3_dispatch(), i = -1, n = arguments.length; + while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(dispatch); + return dispatch; + }; + function d3_dispatch() {} + d3_dispatch.prototype.on = function(type, listener) { + var i = type.indexOf("."), name = ""; + if (i >= 0) { + name = type.slice(i + 1); + type = type.slice(0, i); + } + if (type) return arguments.length < 2 ? this[type].on(name) : this[type].on(name, listener); + if (arguments.length === 2) { + if (listener == null) for (type in this) { + if (this.hasOwnProperty(type)) this[type].on(name, null); + } + return this; + } + }; + function d3_dispatch_event(dispatch) { + var listeners = [], listenerByName = new d3_Map(); + function event() { + var z = listeners, i = -1, n = z.length, l; + while (++i < n) if (l = z[i].on) l.apply(this, arguments); + return dispatch; + } + event.on = function(name, listener) { + var l = listenerByName.get(name), i; + if (arguments.length < 2) return l && l.on; + if (l) { + l.on = null; + listeners = listeners.slice(0, i = listeners.indexOf(l)).concat(listeners.slice(i + 1)); + listenerByName.remove(name); + } + if (listener) listeners.push(listenerByName.set(name, { + on: listener + })); + return dispatch; + }; + return event; + } + d3.event = null; + function d3_eventPreventDefault() { + d3.event.preventDefault(); + } + function d3_eventSource() { + var e = d3.event, s; + while (s = e.sourceEvent) e = s; + return e; + } + function d3_eventDispatch(target) { + var dispatch = new d3_dispatch(), i = 0, n = arguments.length; + while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(dispatch); + dispatch.of = function(thiz, argumentz) { + return function(e1) { + try { + var e0 = e1.sourceEvent = d3.event; + e1.target = target; + d3.event = e1; + dispatch[e1.type].apply(thiz, argumentz); + } finally { + d3.event = e0; + } + }; + }; + return dispatch; + } + d3.requote = function(s) { + return s.replace(d3_requote_re, "\\$&"); + }; + var d3_requote_re = /[\\\^\$\*\+\?\|\[\]\(\)\.\{\}]/g; + var d3_subclass = {}.__proto__ ? function(object, prototype) { + object.__proto__ = prototype; + } : function(object, prototype) { + for (var property in prototype) object[property] = prototype[property]; + }; + function d3_selection(groups) { + d3_subclass(groups, d3_selectionPrototype); + return groups; + } + var d3_select = function(s, n) { + return n.querySelector(s); + }, d3_selectAll = function(s, n) { + return n.querySelectorAll(s); + }, d3_selectMatches = function(n, s) { + var d3_selectMatcher = n.matches || n[d3_vendorSymbol(n, "matchesSelector")]; + d3_selectMatches = function(n, s) { + return d3_selectMatcher.call(n, s); + }; + return d3_selectMatches(n, s); + }; + if (typeof Sizzle === "function") { + d3_select = function(s, n) { + return Sizzle(s, n)[0] || null; + }; + d3_selectAll = Sizzle; + d3_selectMatches = Sizzle.matchesSelector; + } + d3.selection = function() { + return d3.select(d3_document.documentElement); + }; + var d3_selectionPrototype = d3.selection.prototype = []; + d3_selectionPrototype.select = function(selector) { + var subgroups = [], subgroup, subnode, group, node; + selector = d3_selection_selector(selector); + for (var j = -1, m = this.length; ++j < m; ) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subgroup.push(subnode = selector.call(node, node.__data__, i, j)); + if (subnode && "__data__" in node) subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + return d3_selection(subgroups); + }; + function d3_selection_selector(selector) { + return typeof selector === "function" ? selector : function() { + return d3_select(selector, this); + }; + } + d3_selectionPrototype.selectAll = function(selector) { + var subgroups = [], subgroup, node; + selector = d3_selection_selectorAll(selector); + for (var j = -1, m = this.length; ++j < m; ) { + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subgroups.push(subgroup = d3_array(selector.call(node, node.__data__, i, j))); + subgroup.parentNode = node; + } + } + } + return d3_selection(subgroups); + }; + function d3_selection_selectorAll(selector) { + return typeof selector === "function" ? selector : function() { + return d3_selectAll(selector, this); + }; + } + var d3_nsXhtml = "http://www.w3.org/1999/xhtml"; + var d3_nsPrefix = { + svg: "http://www.w3.org/2000/svg", + xhtml: d3_nsXhtml, + xlink: "http://www.w3.org/1999/xlink", + xml: "http://www.w3.org/XML/1998/namespace", + xmlns: "http://www.w3.org/2000/xmlns/" + }; + d3.ns = { + prefix: d3_nsPrefix, + qualify: function(name) { + var i = name.indexOf(":"), prefix = name; + if (i >= 0 && (prefix = name.slice(0, i)) !== "xmlns") name = name.slice(i + 1); + return d3_nsPrefix.hasOwnProperty(prefix) ? { + space: d3_nsPrefix[prefix], + local: name + } : name; + } + }; + d3_selectionPrototype.attr = function(name, value) { + if (arguments.length < 2) { + if (typeof name === "string") { + var node = this.node(); + name = d3.ns.qualify(name); + return name.local ? node.getAttributeNS(name.space, name.local) : node.getAttribute(name); + } + for (value in name) this.each(d3_selection_attr(value, name[value])); + return this; + } + return this.each(d3_selection_attr(name, value)); + }; + function d3_selection_attr(name, value) { + name = d3.ns.qualify(name); + function attrNull() { + this.removeAttribute(name); + } + function attrNullNS() { + this.removeAttributeNS(name.space, name.local); + } + function attrConstant() { + this.setAttribute(name, value); + } + function attrConstantNS() { + this.setAttributeNS(name.space, name.local, value); + } + function attrFunction() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttribute(name); else this.setAttribute(name, x); + } + function attrFunctionNS() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttributeNS(name.space, name.local); else this.setAttributeNS(name.space, name.local, x); + } + return value == null ? name.local ? attrNullNS : attrNull : typeof value === "function" ? name.local ? attrFunctionNS : attrFunction : name.local ? attrConstantNS : attrConstant; + } + function d3_collapse(s) { + return s.trim().replace(/\s+/g, " "); + } + d3_selectionPrototype.classed = function(name, value) { + if (arguments.length < 2) { + if (typeof name === "string") { + var node = this.node(), n = (name = d3_selection_classes(name)).length, i = -1; + if (value = node.classList) { + while (++i < n) if (!value.contains(name[i])) return false; + } else { + value = node.getAttribute("class"); + while (++i < n) if (!d3_selection_classedRe(name[i]).test(value)) return false; + } + return true; + } + for (value in name) this.each(d3_selection_classed(value, name[value])); + return this; + } + return this.each(d3_selection_classed(name, value)); + }; + function d3_selection_classedRe(name) { + return new RegExp("(?:^|\\s+)" + d3.requote(name) + "(?:\\s+|$)", "g"); + } + function d3_selection_classes(name) { + return (name + "").trim().split(/^|\s+/); + } + function d3_selection_classed(name, value) { + name = d3_selection_classes(name).map(d3_selection_classedName); + var n = name.length; + function classedConstant() { + var i = -1; + while (++i < n) name[i](this, value); + } + function classedFunction() { + var i = -1, x = value.apply(this, arguments); + while (++i < n) name[i](this, x); + } + return typeof value === "function" ? classedFunction : classedConstant; + } + function d3_selection_classedName(name) { + var re = d3_selection_classedRe(name); + return function(node, value) { + if (c = node.classList) return value ? c.add(name) : c.remove(name); + var c = node.getAttribute("class") || ""; + if (value) { + re.lastIndex = 0; + if (!re.test(c)) node.setAttribute("class", d3_collapse(c + " " + name)); + } else { + node.setAttribute("class", d3_collapse(c.replace(re, " "))); + } + }; + } + d3_selectionPrototype.style = function(name, value, priority) { + var n = arguments.length; + if (n < 3) { + if (typeof name !== "string") { + if (n < 2) value = ""; + for (priority in name) this.each(d3_selection_style(priority, name[priority], value)); + return this; + } + if (n < 2) { + var node = this.node(); + return d3_window(node).getComputedStyle(node, null).getPropertyValue(name); + } + priority = ""; + } + return this.each(d3_selection_style(name, value, priority)); + }; + function d3_selection_style(name, value, priority) { + function styleNull() { + this.style.removeProperty(name); + } + function styleConstant() { + this.style.setProperty(name, value, priority); + } + function styleFunction() { + var x = value.apply(this, arguments); + if (x == null) this.style.removeProperty(name); else this.style.setProperty(name, x, priority); + } + return value == null ? styleNull : typeof value === "function" ? styleFunction : styleConstant; + } + d3_selectionPrototype.property = function(name, value) { + if (arguments.length < 2) { + if (typeof name === "string") return this.node()[name]; + for (value in name) this.each(d3_selection_property(value, name[value])); + return this; + } + return this.each(d3_selection_property(name, value)); + }; + function d3_selection_property(name, value) { + function propertyNull() { + delete this[name]; + } + function propertyConstant() { + this[name] = value; + } + function propertyFunction() { + var x = value.apply(this, arguments); + if (x == null) delete this[name]; else this[name] = x; + } + return value == null ? propertyNull : typeof value === "function" ? propertyFunction : propertyConstant; + } + d3_selectionPrototype.text = function(value) { + return arguments.length ? this.each(typeof value === "function" ? function() { + var v = value.apply(this, arguments); + this.textContent = v == null ? "" : v; + } : value == null ? function() { + this.textContent = ""; + } : function() { + this.textContent = value; + }) : this.node().textContent; + }; + d3_selectionPrototype.html = function(value) { + return arguments.length ? this.each(typeof value === "function" ? function() { + var v = value.apply(this, arguments); + this.innerHTML = v == null ? "" : v; + } : value == null ? function() { + this.innerHTML = ""; + } : function() { + this.innerHTML = value; + }) : this.node().innerHTML; + }; + d3_selectionPrototype.append = function(name) { + name = d3_selection_creator(name); + return this.select(function() { + return this.appendChild(name.apply(this, arguments)); + }); + }; + function d3_selection_creator(name) { + function create() { + var document = this.ownerDocument, namespace = this.namespaceURI; + return namespace === d3_nsXhtml && document.documentElement.namespaceURI === d3_nsXhtml ? document.createElement(name) : document.createElementNS(namespace, name); + } + function createNS() { + return this.ownerDocument.createElementNS(name.space, name.local); + } + return typeof name === "function" ? name : (name = d3.ns.qualify(name)).local ? createNS : create; + } + d3_selectionPrototype.insert = function(name, before) { + name = d3_selection_creator(name); + before = d3_selection_selector(before); + return this.select(function() { + return this.insertBefore(name.apply(this, arguments), before.apply(this, arguments) || null); + }); + }; + d3_selectionPrototype.remove = function() { + return this.each(d3_selectionRemove); + }; + function d3_selectionRemove() { + var parent = this.parentNode; + if (parent) parent.removeChild(this); + } + d3_selectionPrototype.data = function(value, key) { + var i = -1, n = this.length, group, node; + if (!arguments.length) { + value = new Array(n = (group = this[0]).length); + while (++i < n) { + if (node = group[i]) { + value[i] = node.__data__; + } + } + return value; + } + function bind(group, groupData) { + var i, n = group.length, m = groupData.length, n0 = Math.min(n, m), updateNodes = new Array(m), enterNodes = new Array(m), exitNodes = new Array(n), node, nodeData; + if (key) { + var nodeByKeyValue = new d3_Map(), keyValues = new Array(n), keyValue; + for (i = -1; ++i < n; ) { + if (node = group[i]) { + if (nodeByKeyValue.has(keyValue = key.call(node, node.__data__, i))) { + exitNodes[i] = node; + } else { + nodeByKeyValue.set(keyValue, node); + } + keyValues[i] = keyValue; + } + } + for (i = -1; ++i < m; ) { + if (!(node = nodeByKeyValue.get(keyValue = key.call(groupData, nodeData = groupData[i], i)))) { + enterNodes[i] = d3_selection_dataNode(nodeData); + } else if (node !== true) { + updateNodes[i] = node; + node.__data__ = nodeData; + } + nodeByKeyValue.set(keyValue, true); + } + for (i = -1; ++i < n; ) { + if (i in keyValues && nodeByKeyValue.get(keyValues[i]) !== true) { + exitNodes[i] = group[i]; + } + } + } else { + for (i = -1; ++i < n0; ) { + node = group[i]; + nodeData = groupData[i]; + if (node) { + node.__data__ = nodeData; + updateNodes[i] = node; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + } + } + for (;i < m; ++i) { + enterNodes[i] = d3_selection_dataNode(groupData[i]); + } + for (;i < n; ++i) { + exitNodes[i] = group[i]; + } + } + enterNodes.update = updateNodes; + enterNodes.parentNode = updateNodes.parentNode = exitNodes.parentNode = group.parentNode; + enter.push(enterNodes); + update.push(updateNodes); + exit.push(exitNodes); + } + var enter = d3_selection_enter([]), update = d3_selection([]), exit = d3_selection([]); + if (typeof value === "function") { + while (++i < n) { + bind(group = this[i], value.call(group, group.parentNode.__data__, i)); + } + } else { + while (++i < n) { + bind(group = this[i], value); + } + } + update.enter = function() { + return enter; + }; + update.exit = function() { + return exit; + }; + return update; + }; + function d3_selection_dataNode(data) { + return { + __data__: data + }; + } + d3_selectionPrototype.datum = function(value) { + return arguments.length ? this.property("__data__", value) : this.property("__data__"); + }; + d3_selectionPrototype.filter = function(filter) { + var subgroups = [], subgroup, group, node; + if (typeof filter !== "function") filter = d3_selection_filter(filter); + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = 0, n = group.length; i < n; i++) { + if ((node = group[i]) && filter.call(node, node.__data__, i, j)) { + subgroup.push(node); + } + } + } + return d3_selection(subgroups); + }; + function d3_selection_filter(selector) { + return function() { + return d3_selectMatches(this, selector); + }; + } + d3_selectionPrototype.order = function() { + for (var j = -1, m = this.length; ++j < m; ) { + for (var group = this[j], i = group.length - 1, next = group[i], node; --i >= 0; ) { + if (node = group[i]) { + if (next && next !== node.nextSibling) next.parentNode.insertBefore(node, next); + next = node; + } + } + } + return this; + }; + d3_selectionPrototype.sort = function(comparator) { + comparator = d3_selection_sortComparator.apply(this, arguments); + for (var j = -1, m = this.length; ++j < m; ) this[j].sort(comparator); + return this.order(); + }; + function d3_selection_sortComparator(comparator) { + if (!arguments.length) comparator = d3_ascending; + return function(a, b) { + return a && b ? comparator(a.__data__, b.__data__) : !a - !b; + }; + } + d3_selectionPrototype.each = function(callback) { + return d3_selection_each(this, function(node, i, j) { + callback.call(node, node.__data__, i, j); + }); + }; + function d3_selection_each(groups, callback) { + for (var j = 0, m = groups.length; j < m; j++) { + for (var group = groups[j], i = 0, n = group.length, node; i < n; i++) { + if (node = group[i]) callback(node, i, j); + } + } + return groups; + } + d3_selectionPrototype.call = function(callback) { + var args = d3_array(arguments); + callback.apply(args[0] = this, args); + return this; + }; + d3_selectionPrototype.empty = function() { + return !this.node(); + }; + d3_selectionPrototype.node = function() { + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + var node = group[i]; + if (node) return node; + } + } + return null; + }; + d3_selectionPrototype.size = function() { + var n = 0; + d3_selection_each(this, function() { + ++n; + }); + return n; + }; + function d3_selection_enter(selection) { + d3_subclass(selection, d3_selection_enterPrototype); + return selection; + } + var d3_selection_enterPrototype = []; + d3.selection.enter = d3_selection_enter; + d3.selection.enter.prototype = d3_selection_enterPrototype; + d3_selection_enterPrototype.append = d3_selectionPrototype.append; + d3_selection_enterPrototype.empty = d3_selectionPrototype.empty; + d3_selection_enterPrototype.node = d3_selectionPrototype.node; + d3_selection_enterPrototype.call = d3_selectionPrototype.call; + d3_selection_enterPrototype.size = d3_selectionPrototype.size; + d3_selection_enterPrototype.select = function(selector) { + var subgroups = [], subgroup, subnode, upgroup, group, node; + for (var j = -1, m = this.length; ++j < m; ) { + upgroup = (group = this[j]).update; + subgroups.push(subgroup = []); + subgroup.parentNode = group.parentNode; + for (var i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subgroup.push(upgroup[i] = subnode = selector.call(group.parentNode, node.__data__, i, j)); + subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + return d3_selection(subgroups); + }; + d3_selection_enterPrototype.insert = function(name, before) { + if (arguments.length < 2) before = d3_selection_enterInsertBefore(this); + return d3_selectionPrototype.insert.call(this, name, before); + }; + function d3_selection_enterInsertBefore(enter) { + var i0, j0; + return function(d, i, j) { + var group = enter[j].update, n = group.length, node; + if (j != j0) j0 = j, i0 = 0; + if (i >= i0) i0 = i + 1; + while (!(node = group[i0]) && ++i0 < n) ; + return node; + }; + } + d3.select = function(node) { + var group; + if (typeof node === "string") { + group = [ d3_select(node, d3_document) ]; + group.parentNode = d3_document.documentElement; + } else { + group = [ node ]; + group.parentNode = d3_documentElement(node); + } + return d3_selection([ group ]); + }; + d3.selectAll = function(nodes) { + var group; + if (typeof nodes === "string") { + group = d3_array(d3_selectAll(nodes, d3_document)); + group.parentNode = d3_document.documentElement; + } else { + group = d3_array(nodes); + group.parentNode = null; + } + return d3_selection([ group ]); + }; + d3_selectionPrototype.on = function(type, listener, capture) { + var n = arguments.length; + if (n < 3) { + if (typeof type !== "string") { + if (n < 2) listener = false; + for (capture in type) this.each(d3_selection_on(capture, type[capture], listener)); + return this; + } + if (n < 2) return (n = this.node()["__on" + type]) && n._; + capture = false; + } + return this.each(d3_selection_on(type, listener, capture)); + }; + function d3_selection_on(type, listener, capture) { + var name = "__on" + type, i = type.indexOf("."), wrap = d3_selection_onListener; + if (i > 0) type = type.slice(0, i); + var filter = d3_selection_onFilters.get(type); + if (filter) type = filter, wrap = d3_selection_onFilter; + function onRemove() { + var l = this[name]; + if (l) { + this.removeEventListener(type, l, l.$); + delete this[name]; + } + } + function onAdd() { + var l = wrap(listener, d3_array(arguments)); + onRemove.call(this); + this.addEventListener(type, this[name] = l, l.$ = capture); + l._ = listener; + } + function removeAll() { + var re = new RegExp("^__on([^.]+)" + d3.requote(type) + "$"), match; + for (var name in this) { + if (match = name.match(re)) { + var l = this[name]; + this.removeEventListener(match[1], l, l.$); + delete this[name]; + } + } + } + return i ? listener ? onAdd : onRemove : listener ? d3_noop : removeAll; + } + var d3_selection_onFilters = d3.map({ + mouseenter: "mouseover", + mouseleave: "mouseout" + }); + if (d3_document) { + d3_selection_onFilters.forEach(function(k) { + if ("on" + k in d3_document) d3_selection_onFilters.remove(k); + }); + } + function d3_selection_onListener(listener, argumentz) { + return function(e) { + var o = d3.event; + d3.event = e; + argumentz[0] = this.__data__; + try { + listener.apply(this, argumentz); + } finally { + d3.event = o; + } + }; + } + function d3_selection_onFilter(listener, argumentz) { + var l = d3_selection_onListener(listener, argumentz); + return function(e) { + var target = this, related = e.relatedTarget; + if (!related || related !== target && !(related.compareDocumentPosition(target) & 8)) { + l.call(target, e); + } + }; + } + var d3_event_dragSelect, d3_event_dragId = 0; + function d3_event_dragSuppress(node) { + var name = ".dragsuppress-" + ++d3_event_dragId, click = "click" + name, w = d3.select(d3_window(node)).on("touchmove" + name, d3_eventPreventDefault).on("dragstart" + name, d3_eventPreventDefault).on("selectstart" + name, d3_eventPreventDefault); + if (d3_event_dragSelect == null) { + d3_event_dragSelect = "onselectstart" in node ? false : d3_vendorSymbol(node.style, "userSelect"); + } + if (d3_event_dragSelect) { + var style = d3_documentElement(node).style, select = style[d3_event_dragSelect]; + style[d3_event_dragSelect] = "none"; + } + return function(suppressClick) { + w.on(name, null); + if (d3_event_dragSelect) style[d3_event_dragSelect] = select; + if (suppressClick) { + var off = function() { + w.on(click, null); + }; + w.on(click, function() { + d3_eventPreventDefault(); + off(); + }, true); + setTimeout(off, 0); + } + }; + } + d3.mouse = function(container) { + return d3_mousePoint(container, d3_eventSource()); + }; + var d3_mouse_bug44083 = this.navigator && /WebKit/.test(this.navigator.userAgent) ? -1 : 0; + function d3_mousePoint(container, e) { + if (e.changedTouches) e = e.changedTouches[0]; + var svg = container.ownerSVGElement || container; + if (svg.createSVGPoint) { + var point = svg.createSVGPoint(); + if (d3_mouse_bug44083 < 0) { + var window = d3_window(container); + if (window.scrollX || window.scrollY) { + svg = d3.select("body").append("svg").style({ + position: "absolute", + top: 0, + left: 0, + margin: 0, + padding: 0, + border: "none" + }, "important"); + var ctm = svg[0][0].getScreenCTM(); + d3_mouse_bug44083 = !(ctm.f || ctm.e); + svg.remove(); + } + } + if (d3_mouse_bug44083) point.x = e.pageX, point.y = e.pageY; else point.x = e.clientX, + point.y = e.clientY; + point = point.matrixTransform(container.getScreenCTM().inverse()); + return [ point.x, point.y ]; + } + var rect = container.getBoundingClientRect(); + return [ e.clientX - rect.left - container.clientLeft, e.clientY - rect.top - container.clientTop ]; + } + d3.touch = function(container, touches, identifier) { + if (arguments.length < 3) identifier = touches, touches = d3_eventSource().changedTouches; + if (touches) for (var i = 0, n = touches.length, touch; i < n; ++i) { + if ((touch = touches[i]).identifier === identifier) { + return d3_mousePoint(container, touch); + } + } + }; + d3.behavior.drag = function() { + var event = d3_eventDispatch(drag, "drag", "dragstart", "dragend"), origin = null, mousedown = dragstart(d3_noop, d3.mouse, d3_window, "mousemove", "mouseup"), touchstart = dragstart(d3_behavior_dragTouchId, d3.touch, d3_identity, "touchmove", "touchend"); + function drag() { + this.on("mousedown.drag", mousedown).on("touchstart.drag", touchstart); + } + function dragstart(id, position, subject, move, end) { + return function() { + var that = this, target = d3.event.target.correspondingElement || d3.event.target, parent = that.parentNode, dispatch = event.of(that, arguments), dragged = 0, dragId = id(), dragName = ".drag" + (dragId == null ? "" : "-" + dragId), dragOffset, dragSubject = d3.select(subject(target)).on(move + dragName, moved).on(end + dragName, ended), dragRestore = d3_event_dragSuppress(target), position0 = position(parent, dragId); + if (origin) { + dragOffset = origin.apply(that, arguments); + dragOffset = [ dragOffset.x - position0[0], dragOffset.y - position0[1] ]; + } else { + dragOffset = [ 0, 0 ]; + } + dispatch({ + type: "dragstart" + }); + function moved() { + var position1 = position(parent, dragId), dx, dy; + if (!position1) return; + dx = position1[0] - position0[0]; + dy = position1[1] - position0[1]; + dragged |= dx | dy; + position0 = position1; + dispatch({ + type: "drag", + x: position1[0] + dragOffset[0], + y: position1[1] + dragOffset[1], + dx: dx, + dy: dy + }); + } + function ended() { + if (!position(parent, dragId)) return; + dragSubject.on(move + dragName, null).on(end + dragName, null); + dragRestore(dragged); + dispatch({ + type: "dragend" + }); + } + }; + } + drag.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + return drag; + }; + return d3.rebind(drag, event, "on"); + }; + function d3_behavior_dragTouchId() { + return d3.event.changedTouches[0].identifier; + } + d3.touches = function(container, touches) { + if (arguments.length < 2) touches = d3_eventSource().touches; + return touches ? d3_array(touches).map(function(touch) { + var point = d3_mousePoint(container, touch); + point.identifier = touch.identifier; + return point; + }) : []; + }; + var ε = 1e-6, ε2 = ε * ε, π = Math.PI, τ = 2 * π, τε = τ - ε, halfπ = π / 2, d3_radians = π / 180, d3_degrees = 180 / π; + function d3_sgn(x) { + return x > 0 ? 1 : x < 0 ? -1 : 0; + } + function d3_cross2d(a, b, c) { + return (b[0] - a[0]) * (c[1] - a[1]) - (b[1] - a[1]) * (c[0] - a[0]); + } + function d3_acos(x) { + return x > 1 ? 0 : x < -1 ? π : Math.acos(x); + } + function d3_asin(x) { + return x > 1 ? halfπ : x < -1 ? -halfπ : Math.asin(x); + } + function d3_sinh(x) { + return ((x = Math.exp(x)) - 1 / x) / 2; + } + function d3_cosh(x) { + return ((x = Math.exp(x)) + 1 / x) / 2; + } + function d3_tanh(x) { + return ((x = Math.exp(2 * x)) - 1) / (x + 1); + } + function d3_haversin(x) { + return (x = Math.sin(x / 2)) * x; + } + var ρ = Math.SQRT2, ρ2 = 2, ρ4 = 4; + d3.interpolateZoom = function(p0, p1) { + var ux0 = p0[0], uy0 = p0[1], w0 = p0[2], ux1 = p1[0], uy1 = p1[1], w1 = p1[2], dx = ux1 - ux0, dy = uy1 - uy0, d2 = dx * dx + dy * dy, i, S; + if (d2 < ε2) { + S = Math.log(w1 / w0) / ρ; + i = function(t) { + return [ ux0 + t * dx, uy0 + t * dy, w0 * Math.exp(ρ * t * S) ]; + }; + } else { + var d1 = Math.sqrt(d2), b0 = (w1 * w1 - w0 * w0 + ρ4 * d2) / (2 * w0 * ρ2 * d1), b1 = (w1 * w1 - w0 * w0 - ρ4 * d2) / (2 * w1 * ρ2 * d1), r0 = Math.log(Math.sqrt(b0 * b0 + 1) - b0), r1 = Math.log(Math.sqrt(b1 * b1 + 1) - b1); + S = (r1 - r0) / ρ; + i = function(t) { + var s = t * S, coshr0 = d3_cosh(r0), u = w0 / (ρ2 * d1) * (coshr0 * d3_tanh(ρ * s + r0) - d3_sinh(r0)); + return [ ux0 + u * dx, uy0 + u * dy, w0 * coshr0 / d3_cosh(ρ * s + r0) ]; + }; + } + i.duration = S * 1e3; + return i; + }; + d3.behavior.zoom = function() { + var view = { + x: 0, + y: 0, + k: 1 + }, translate0, center0, center, size = [ 960, 500 ], scaleExtent = d3_behavior_zoomInfinity, duration = 250, zooming = 0, mousedown = "mousedown.zoom", mousemove = "mousemove.zoom", mouseup = "mouseup.zoom", mousewheelTimer, touchstart = "touchstart.zoom", touchtime, event = d3_eventDispatch(zoom, "zoomstart", "zoom", "zoomend"), x0, x1, y0, y1; + if (!d3_behavior_zoomWheel) { + d3_behavior_zoomWheel = "onwheel" in d3_document ? (d3_behavior_zoomDelta = function() { + return -d3.event.deltaY * (d3.event.deltaMode ? 120 : 1); + }, "wheel") : "onmousewheel" in d3_document ? (d3_behavior_zoomDelta = function() { + return d3.event.wheelDelta; + }, "mousewheel") : (d3_behavior_zoomDelta = function() { + return -d3.event.detail; + }, "MozMousePixelScroll"); + } + function zoom(g) { + g.on(mousedown, mousedowned).on(d3_behavior_zoomWheel + ".zoom", mousewheeled).on("dblclick.zoom", dblclicked).on(touchstart, touchstarted); + } + zoom.event = function(g) { + g.each(function() { + var dispatch = event.of(this, arguments), view1 = view; + if (d3_transitionInheritId) { + d3.select(this).transition().each("start.zoom", function() { + view = this.__chart__ || { + x: 0, + y: 0, + k: 1 + }; + zoomstarted(dispatch); + }).tween("zoom:zoom", function() { + var dx = size[0], dy = size[1], cx = center0 ? center0[0] : dx / 2, cy = center0 ? center0[1] : dy / 2, i = d3.interpolateZoom([ (cx - view.x) / view.k, (cy - view.y) / view.k, dx / view.k ], [ (cx - view1.x) / view1.k, (cy - view1.y) / view1.k, dx / view1.k ]); + return function(t) { + var l = i(t), k = dx / l[2]; + this.__chart__ = view = { + x: cx - l[0] * k, + y: cy - l[1] * k, + k: k + }; + zoomed(dispatch); + }; + }).each("interrupt.zoom", function() { + zoomended(dispatch); + }).each("end.zoom", function() { + zoomended(dispatch); + }); + } else { + this.__chart__ = view; + zoomstarted(dispatch); + zoomed(dispatch); + zoomended(dispatch); + } + }); + }; + zoom.translate = function(_) { + if (!arguments.length) return [ view.x, view.y ]; + view = { + x: +_[0], + y: +_[1], + k: view.k + }; + rescale(); + return zoom; + }; + zoom.scale = function(_) { + if (!arguments.length) return view.k; + view = { + x: view.x, + y: view.y, + k: null + }; + scaleTo(+_); + rescale(); + return zoom; + }; + zoom.scaleExtent = function(_) { + if (!arguments.length) return scaleExtent; + scaleExtent = _ == null ? d3_behavior_zoomInfinity : [ +_[0], +_[1] ]; + return zoom; + }; + zoom.center = function(_) { + if (!arguments.length) return center; + center = _ && [ +_[0], +_[1] ]; + return zoom; + }; + zoom.size = function(_) { + if (!arguments.length) return size; + size = _ && [ +_[0], +_[1] ]; + return zoom; + }; + zoom.duration = function(_) { + if (!arguments.length) return duration; + duration = +_; + return zoom; + }; + zoom.x = function(z) { + if (!arguments.length) return x1; + x1 = z; + x0 = z.copy(); + view = { + x: 0, + y: 0, + k: 1 + }; + return zoom; + }; + zoom.y = function(z) { + if (!arguments.length) return y1; + y1 = z; + y0 = z.copy(); + view = { + x: 0, + y: 0, + k: 1 + }; + return zoom; + }; + function location(p) { + return [ (p[0] - view.x) / view.k, (p[1] - view.y) / view.k ]; + } + function point(l) { + return [ l[0] * view.k + view.x, l[1] * view.k + view.y ]; + } + function scaleTo(s) { + view.k = Math.max(scaleExtent[0], Math.min(scaleExtent[1], s)); + } + function translateTo(p, l) { + l = point(l); + view.x += p[0] - l[0]; + view.y += p[1] - l[1]; + } + function zoomTo(that, p, l, k) { + that.__chart__ = { + x: view.x, + y: view.y, + k: view.k + }; + scaleTo(Math.pow(2, k)); + translateTo(center0 = p, l); + that = d3.select(that); + if (duration > 0) that = that.transition().duration(duration); + that.call(zoom.event); + } + function rescale() { + if (x1) x1.domain(x0.range().map(function(x) { + return (x - view.x) / view.k; + }).map(x0.invert)); + if (y1) y1.domain(y0.range().map(function(y) { + return (y - view.y) / view.k; + }).map(y0.invert)); + } + function zoomstarted(dispatch) { + if (!zooming++) dispatch({ + type: "zoomstart" + }); + } + function zoomed(dispatch) { + rescale(); + dispatch({ + type: "zoom", + scale: view.k, + translate: [ view.x, view.y ] + }); + } + function zoomended(dispatch) { + if (!--zooming) dispatch({ + type: "zoomend" + }), center0 = null; + } + function mousedowned() { + var that = this, dispatch = event.of(that, arguments), dragged = 0, subject = d3.select(d3_window(that)).on(mousemove, moved).on(mouseup, ended), location0 = location(d3.mouse(that)), dragRestore = d3_event_dragSuppress(that); + d3_selection_interrupt.call(that); + zoomstarted(dispatch); + function moved() { + dragged = 1; + translateTo(d3.mouse(that), location0); + zoomed(dispatch); + } + function ended() { + subject.on(mousemove, null).on(mouseup, null); + dragRestore(dragged); + zoomended(dispatch); + } + } + function touchstarted() { + var that = this, dispatch = event.of(that, arguments), locations0 = {}, distance0 = 0, scale0, zoomName = ".zoom-" + d3.event.changedTouches[0].identifier, touchmove = "touchmove" + zoomName, touchend = "touchend" + zoomName, targets = [], subject = d3.select(that), dragRestore = d3_event_dragSuppress(that); + started(); + zoomstarted(dispatch); + subject.on(mousedown, null).on(touchstart, started); + function relocate() { + var touches = d3.touches(that); + scale0 = view.k; + touches.forEach(function(t) { + if (t.identifier in locations0) locations0[t.identifier] = location(t); + }); + return touches; + } + function started() { + var target = d3.event.target; + d3.select(target).on(touchmove, moved).on(touchend, ended); + targets.push(target); + var changed = d3.event.changedTouches; + for (var i = 0, n = changed.length; i < n; ++i) { + locations0[changed[i].identifier] = null; + } + var touches = relocate(), now = Date.now(); + if (touches.length === 1) { + if (now - touchtime < 500) { + var p = touches[0]; + zoomTo(that, p, locations0[p.identifier], Math.floor(Math.log(view.k) / Math.LN2) + 1); + d3_eventPreventDefault(); + } + touchtime = now; + } else if (touches.length > 1) { + var p = touches[0], q = touches[1], dx = p[0] - q[0], dy = p[1] - q[1]; + distance0 = dx * dx + dy * dy; + } + } + function moved() { + var touches = d3.touches(that), p0, l0, p1, l1; + d3_selection_interrupt.call(that); + for (var i = 0, n = touches.length; i < n; ++i, l1 = null) { + p1 = touches[i]; + if (l1 = locations0[p1.identifier]) { + if (l0) break; + p0 = p1, l0 = l1; + } + } + if (l1) { + var distance1 = (distance1 = p1[0] - p0[0]) * distance1 + (distance1 = p1[1] - p0[1]) * distance1, scale1 = distance0 && Math.sqrt(distance1 / distance0); + p0 = [ (p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2 ]; + l0 = [ (l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2 ]; + scaleTo(scale1 * scale0); + } + touchtime = null; + translateTo(p0, l0); + zoomed(dispatch); + } + function ended() { + if (d3.event.touches.length) { + var changed = d3.event.changedTouches; + for (var i = 0, n = changed.length; i < n; ++i) { + delete locations0[changed[i].identifier]; + } + for (var identifier in locations0) { + return void relocate(); + } + } + d3.selectAll(targets).on(zoomName, null); + subject.on(mousedown, mousedowned).on(touchstart, touchstarted); + dragRestore(); + zoomended(dispatch); + } + } + function mousewheeled() { + var dispatch = event.of(this, arguments); + if (mousewheelTimer) clearTimeout(mousewheelTimer); else d3_selection_interrupt.call(this), + translate0 = location(center0 = center || d3.mouse(this)), zoomstarted(dispatch); + mousewheelTimer = setTimeout(function() { + mousewheelTimer = null; + zoomended(dispatch); + }, 50); + d3_eventPreventDefault(); + scaleTo(Math.pow(2, d3_behavior_zoomDelta() * .002) * view.k); + translateTo(center0, translate0); + zoomed(dispatch); + } + function dblclicked() { + var p = d3.mouse(this), k = Math.log(view.k) / Math.LN2; + zoomTo(this, p, location(p), d3.event.shiftKey ? Math.ceil(k) - 1 : Math.floor(k) + 1); + } + return d3.rebind(zoom, event, "on"); + }; + var d3_behavior_zoomInfinity = [ 0, Infinity ], d3_behavior_zoomDelta, d3_behavior_zoomWheel; + d3.color = d3_color; + function d3_color() {} + d3_color.prototype.toString = function() { + return this.rgb() + ""; + }; + d3.hsl = d3_hsl; + function d3_hsl(h, s, l) { + return this instanceof d3_hsl ? void (this.h = +h, this.s = +s, this.l = +l) : arguments.length < 2 ? h instanceof d3_hsl ? new d3_hsl(h.h, h.s, h.l) : d3_rgb_parse("" + h, d3_rgb_hsl, d3_hsl) : new d3_hsl(h, s, l); + } + var d3_hslPrototype = d3_hsl.prototype = new d3_color(); + d3_hslPrototype.brighter = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + return new d3_hsl(this.h, this.s, this.l / k); + }; + d3_hslPrototype.darker = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + return new d3_hsl(this.h, this.s, k * this.l); + }; + d3_hslPrototype.rgb = function() { + return d3_hsl_rgb(this.h, this.s, this.l); + }; + function d3_hsl_rgb(h, s, l) { + var m1, m2; + h = isNaN(h) ? 0 : (h %= 360) < 0 ? h + 360 : h; + s = isNaN(s) ? 0 : s < 0 ? 0 : s > 1 ? 1 : s; + l = l < 0 ? 0 : l > 1 ? 1 : l; + m2 = l <= .5 ? l * (1 + s) : l + s - l * s; + m1 = 2 * l - m2; + function v(h) { + if (h > 360) h -= 360; else if (h < 0) h += 360; + if (h < 60) return m1 + (m2 - m1) * h / 60; + if (h < 180) return m2; + if (h < 240) return m1 + (m2 - m1) * (240 - h) / 60; + return m1; + } + function vv(h) { + return Math.round(v(h) * 255); + } + return new d3_rgb(vv(h + 120), vv(h), vv(h - 120)); + } + d3.hcl = d3_hcl; + function d3_hcl(h, c, l) { + return this instanceof d3_hcl ? void (this.h = +h, this.c = +c, this.l = +l) : arguments.length < 2 ? h instanceof d3_hcl ? new d3_hcl(h.h, h.c, h.l) : h instanceof d3_lab ? d3_lab_hcl(h.l, h.a, h.b) : d3_lab_hcl((h = d3_rgb_lab((h = d3.rgb(h)).r, h.g, h.b)).l, h.a, h.b) : new d3_hcl(h, c, l); + } + var d3_hclPrototype = d3_hcl.prototype = new d3_color(); + d3_hclPrototype.brighter = function(k) { + return new d3_hcl(this.h, this.c, Math.min(100, this.l + d3_lab_K * (arguments.length ? k : 1))); + }; + d3_hclPrototype.darker = function(k) { + return new d3_hcl(this.h, this.c, Math.max(0, this.l - d3_lab_K * (arguments.length ? k : 1))); + }; + d3_hclPrototype.rgb = function() { + return d3_hcl_lab(this.h, this.c, this.l).rgb(); + }; + function d3_hcl_lab(h, c, l) { + if (isNaN(h)) h = 0; + if (isNaN(c)) c = 0; + return new d3_lab(l, Math.cos(h *= d3_radians) * c, Math.sin(h) * c); + } + d3.lab = d3_lab; + function d3_lab(l, a, b) { + return this instanceof d3_lab ? void (this.l = +l, this.a = +a, this.b = +b) : arguments.length < 2 ? l instanceof d3_lab ? new d3_lab(l.l, l.a, l.b) : l instanceof d3_hcl ? d3_hcl_lab(l.h, l.c, l.l) : d3_rgb_lab((l = d3_rgb(l)).r, l.g, l.b) : new d3_lab(l, a, b); + } + var d3_lab_K = 18; + var d3_lab_X = .95047, d3_lab_Y = 1, d3_lab_Z = 1.08883; + var d3_labPrototype = d3_lab.prototype = new d3_color(); + d3_labPrototype.brighter = function(k) { + return new d3_lab(Math.min(100, this.l + d3_lab_K * (arguments.length ? k : 1)), this.a, this.b); + }; + d3_labPrototype.darker = function(k) { + return new d3_lab(Math.max(0, this.l - d3_lab_K * (arguments.length ? k : 1)), this.a, this.b); + }; + d3_labPrototype.rgb = function() { + return d3_lab_rgb(this.l, this.a, this.b); + }; + function d3_lab_rgb(l, a, b) { + var y = (l + 16) / 116, x = y + a / 500, z = y - b / 200; + x = d3_lab_xyz(x) * d3_lab_X; + y = d3_lab_xyz(y) * d3_lab_Y; + z = d3_lab_xyz(z) * d3_lab_Z; + return new d3_rgb(d3_xyz_rgb(3.2404542 * x - 1.5371385 * y - .4985314 * z), d3_xyz_rgb(-.969266 * x + 1.8760108 * y + .041556 * z), d3_xyz_rgb(.0556434 * x - .2040259 * y + 1.0572252 * z)); + } + function d3_lab_hcl(l, a, b) { + return l > 0 ? new d3_hcl(Math.atan2(b, a) * d3_degrees, Math.sqrt(a * a + b * b), l) : new d3_hcl(NaN, NaN, l); + } + function d3_lab_xyz(x) { + return x > .206893034 ? x * x * x : (x - 4 / 29) / 7.787037; + } + function d3_xyz_lab(x) { + return x > .008856 ? Math.pow(x, 1 / 3) : 7.787037 * x + 4 / 29; + } + function d3_xyz_rgb(r) { + return Math.round(255 * (r <= .00304 ? 12.92 * r : 1.055 * Math.pow(r, 1 / 2.4) - .055)); + } + d3.rgb = d3_rgb; + function d3_rgb(r, g, b) { + return this instanceof d3_rgb ? void (this.r = ~~r, this.g = ~~g, this.b = ~~b) : arguments.length < 2 ? r instanceof d3_rgb ? new d3_rgb(r.r, r.g, r.b) : d3_rgb_parse("" + r, d3_rgb, d3_hsl_rgb) : new d3_rgb(r, g, b); + } + function d3_rgbNumber(value) { + return new d3_rgb(value >> 16, value >> 8 & 255, value & 255); + } + function d3_rgbString(value) { + return d3_rgbNumber(value) + ""; + } + var d3_rgbPrototype = d3_rgb.prototype = new d3_color(); + d3_rgbPrototype.brighter = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + var r = this.r, g = this.g, b = this.b, i = 30; + if (!r && !g && !b) return new d3_rgb(i, i, i); + if (r && r < i) r = i; + if (g && g < i) g = i; + if (b && b < i) b = i; + return new d3_rgb(Math.min(255, r / k), Math.min(255, g / k), Math.min(255, b / k)); + }; + d3_rgbPrototype.darker = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + return new d3_rgb(k * this.r, k * this.g, k * this.b); + }; + d3_rgbPrototype.hsl = function() { + return d3_rgb_hsl(this.r, this.g, this.b); + }; + d3_rgbPrototype.toString = function() { + return "#" + d3_rgb_hex(this.r) + d3_rgb_hex(this.g) + d3_rgb_hex(this.b); + }; + function d3_rgb_hex(v) { + return v < 16 ? "0" + Math.max(0, v).toString(16) : Math.min(255, v).toString(16); + } + function d3_rgb_parse(format, rgb, hsl) { + var r = 0, g = 0, b = 0, m1, m2, color; + m1 = /([a-z]+)\((.*)\)/.exec(format = format.toLowerCase()); + if (m1) { + m2 = m1[2].split(","); + switch (m1[1]) { + case "hsl": + { + return hsl(parseFloat(m2[0]), parseFloat(m2[1]) / 100, parseFloat(m2[2]) / 100); + } + + case "rgb": + { + return rgb(d3_rgb_parseNumber(m2[0]), d3_rgb_parseNumber(m2[1]), d3_rgb_parseNumber(m2[2])); + } + } + } + if (color = d3_rgb_names.get(format)) { + return rgb(color.r, color.g, color.b); + } + if (format != null && format.charAt(0) === "#" && !isNaN(color = parseInt(format.slice(1), 16))) { + if (format.length === 4) { + r = (color & 3840) >> 4; + r = r >> 4 | r; + g = color & 240; + g = g >> 4 | g; + b = color & 15; + b = b << 4 | b; + } else if (format.length === 7) { + r = (color & 16711680) >> 16; + g = (color & 65280) >> 8; + b = color & 255; + } + } + return rgb(r, g, b); + } + function d3_rgb_hsl(r, g, b) { + var min = Math.min(r /= 255, g /= 255, b /= 255), max = Math.max(r, g, b), d = max - min, h, s, l = (max + min) / 2; + if (d) { + s = l < .5 ? d / (max + min) : d / (2 - max - min); + if (r == max) h = (g - b) / d + (g < b ? 6 : 0); else if (g == max) h = (b - r) / d + 2; else h = (r - g) / d + 4; + h *= 60; + } else { + h = NaN; + s = l > 0 && l < 1 ? 0 : h; + } + return new d3_hsl(h, s, l); + } + function d3_rgb_lab(r, g, b) { + r = d3_rgb_xyz(r); + g = d3_rgb_xyz(g); + b = d3_rgb_xyz(b); + var x = d3_xyz_lab((.4124564 * r + .3575761 * g + .1804375 * b) / d3_lab_X), y = d3_xyz_lab((.2126729 * r + .7151522 * g + .072175 * b) / d3_lab_Y), z = d3_xyz_lab((.0193339 * r + .119192 * g + .9503041 * b) / d3_lab_Z); + return d3_lab(116 * y - 16, 500 * (x - y), 200 * (y - z)); + } + function d3_rgb_xyz(r) { + return (r /= 255) <= .04045 ? r / 12.92 : Math.pow((r + .055) / 1.055, 2.4); + } + function d3_rgb_parseNumber(c) { + var f = parseFloat(c); + return c.charAt(c.length - 1) === "%" ? Math.round(f * 2.55) : f; + } + var d3_rgb_names = d3.map({ + aliceblue: 15792383, + antiquewhite: 16444375, + aqua: 65535, + aquamarine: 8388564, + azure: 15794175, + beige: 16119260, + bisque: 16770244, + black: 0, + blanchedalmond: 16772045, + blue: 255, + blueviolet: 9055202, + brown: 10824234, + burlywood: 14596231, + cadetblue: 6266528, + chartreuse: 8388352, + chocolate: 13789470, + coral: 16744272, + cornflowerblue: 6591981, + cornsilk: 16775388, + crimson: 14423100, + cyan: 65535, + darkblue: 139, + darkcyan: 35723, + darkgoldenrod: 12092939, + darkgray: 11119017, + darkgreen: 25600, + darkgrey: 11119017, + darkkhaki: 12433259, + darkmagenta: 9109643, + darkolivegreen: 5597999, + darkorange: 16747520, + darkorchid: 10040012, + darkred: 9109504, + darksalmon: 15308410, + darkseagreen: 9419919, + darkslateblue: 4734347, + darkslategray: 3100495, + darkslategrey: 3100495, + darkturquoise: 52945, + darkviolet: 9699539, + deeppink: 16716947, + deepskyblue: 49151, + dimgray: 6908265, + dimgrey: 6908265, + dodgerblue: 2003199, + firebrick: 11674146, + floralwhite: 16775920, + forestgreen: 2263842, + fuchsia: 16711935, + gainsboro: 14474460, + ghostwhite: 16316671, + gold: 16766720, + goldenrod: 14329120, + gray: 8421504, + green: 32768, + greenyellow: 11403055, + grey: 8421504, + honeydew: 15794160, + hotpink: 16738740, + indianred: 13458524, + indigo: 4915330, + ivory: 16777200, + khaki: 15787660, + lavender: 15132410, + lavenderblush: 16773365, + lawngreen: 8190976, + lemonchiffon: 16775885, + lightblue: 11393254, + lightcoral: 15761536, + lightcyan: 14745599, + lightgoldenrodyellow: 16448210, + lightgray: 13882323, + lightgreen: 9498256, + lightgrey: 13882323, + lightpink: 16758465, + lightsalmon: 16752762, + lightseagreen: 2142890, + lightskyblue: 8900346, + lightslategray: 7833753, + lightslategrey: 7833753, + lightsteelblue: 11584734, + lightyellow: 16777184, + lime: 65280, + limegreen: 3329330, + linen: 16445670, + magenta: 16711935, + maroon: 8388608, + mediumaquamarine: 6737322, + mediumblue: 205, + mediumorchid: 12211667, + mediumpurple: 9662683, + mediumseagreen: 3978097, + mediumslateblue: 8087790, + mediumspringgreen: 64154, + mediumturquoise: 4772300, + mediumvioletred: 13047173, + midnightblue: 1644912, + mintcream: 16121850, + mistyrose: 16770273, + moccasin: 16770229, + navajowhite: 16768685, + navy: 128, + oldlace: 16643558, + olive: 8421376, + olivedrab: 7048739, + orange: 16753920, + orangered: 16729344, + orchid: 14315734, + palegoldenrod: 15657130, + palegreen: 10025880, + paleturquoise: 11529966, + palevioletred: 14381203, + papayawhip: 16773077, + peachpuff: 16767673, + peru: 13468991, + pink: 16761035, + plum: 14524637, + powderblue: 11591910, + purple: 8388736, + rebeccapurple: 6697881, + red: 16711680, + rosybrown: 12357519, + royalblue: 4286945, + saddlebrown: 9127187, + salmon: 16416882, + sandybrown: 16032864, + seagreen: 3050327, + seashell: 16774638, + sienna: 10506797, + silver: 12632256, + skyblue: 8900331, + slateblue: 6970061, + slategray: 7372944, + slategrey: 7372944, + snow: 16775930, + springgreen: 65407, + steelblue: 4620980, + tan: 13808780, + teal: 32896, + thistle: 14204888, + tomato: 16737095, + turquoise: 4251856, + violet: 15631086, + wheat: 16113331, + white: 16777215, + whitesmoke: 16119285, + yellow: 16776960, + yellowgreen: 10145074 + }); + d3_rgb_names.forEach(function(key, value) { + d3_rgb_names.set(key, d3_rgbNumber(value)); + }); + function d3_functor(v) { + return typeof v === "function" ? v : function() { + return v; + }; + } + d3.functor = d3_functor; + d3.xhr = d3_xhrType(d3_identity); + function d3_xhrType(response) { + return function(url, mimeType, callback) { + if (arguments.length === 2 && typeof mimeType === "function") callback = mimeType, + mimeType = null; + return d3_xhr(url, mimeType, response, callback); + }; + } + function d3_xhr(url, mimeType, response, callback) { + var xhr = {}, dispatch = d3.dispatch("beforesend", "progress", "load", "error"), headers = {}, request = new XMLHttpRequest(), responseType = null; + if (this.XDomainRequest && !("withCredentials" in request) && /^(http(s)?:)?\/\//.test(url)) request = new XDomainRequest(); + "onload" in request ? request.onload = request.onerror = respond : request.onreadystatechange = function() { + request.readyState > 3 && respond(); + }; + function respond() { + var status = request.status, result; + if (!status && d3_xhrHasResponse(request) || status >= 200 && status < 300 || status === 304) { + try { + result = response.call(xhr, request); + } catch (e) { + dispatch.error.call(xhr, e); + return; + } + dispatch.load.call(xhr, result); + } else { + dispatch.error.call(xhr, request); + } + } + request.onprogress = function(event) { + var o = d3.event; + d3.event = event; + try { + dispatch.progress.call(xhr, request); + } finally { + d3.event = o; + } + }; + xhr.header = function(name, value) { + name = (name + "").toLowerCase(); + if (arguments.length < 2) return headers[name]; + if (value == null) delete headers[name]; else headers[name] = value + ""; + return xhr; + }; + xhr.mimeType = function(value) { + if (!arguments.length) return mimeType; + mimeType = value == null ? null : value + ""; + return xhr; + }; + xhr.responseType = function(value) { + if (!arguments.length) return responseType; + responseType = value; + return xhr; + }; + xhr.response = function(value) { + response = value; + return xhr; + }; + [ "get", "post" ].forEach(function(method) { + xhr[method] = function() { + return xhr.send.apply(xhr, [ method ].concat(d3_array(arguments))); + }; + }); + xhr.send = function(method, data, callback) { + if (arguments.length === 2 && typeof data === "function") callback = data, data = null; + request.open(method, url, true); + if (mimeType != null && !("accept" in headers)) headers["accept"] = mimeType + ",*/*"; + if (request.setRequestHeader) for (var name in headers) request.setRequestHeader(name, headers[name]); + if (mimeType != null && request.overrideMimeType) request.overrideMimeType(mimeType); + if (responseType != null) request.responseType = responseType; + if (callback != null) xhr.on("error", callback).on("load", function(request) { + callback(null, request); + }); + dispatch.beforesend.call(xhr, request); + request.send(data == null ? null : data); + return xhr; + }; + xhr.abort = function() { + request.abort(); + return xhr; + }; + d3.rebind(xhr, dispatch, "on"); + return callback == null ? xhr : xhr.get(d3_xhr_fixCallback(callback)); + } + function d3_xhr_fixCallback(callback) { + return callback.length === 1 ? function(error, request) { + callback(error == null ? request : null); + } : callback; + } + function d3_xhrHasResponse(request) { + var type = request.responseType; + return type && type !== "text" ? request.response : request.responseText; + } + d3.dsv = function(delimiter, mimeType) { + var reFormat = new RegExp('["' + delimiter + "\n]"), delimiterCode = delimiter.charCodeAt(0); + function dsv(url, row, callback) { + if (arguments.length < 3) callback = row, row = null; + var xhr = d3_xhr(url, mimeType, row == null ? response : typedResponse(row), callback); + xhr.row = function(_) { + return arguments.length ? xhr.response((row = _) == null ? response : typedResponse(_)) : row; + }; + return xhr; + } + function response(request) { + return dsv.parse(request.responseText); + } + function typedResponse(f) { + return function(request) { + return dsv.parse(request.responseText, f); + }; + } + dsv.parse = function(text, f) { + var o; + return dsv.parseRows(text, function(row, i) { + if (o) return o(row, i - 1); + var a = new Function("d", "return {" + row.map(function(name, i) { + return JSON.stringify(name) + ": d[" + i + "]"; + }).join(",") + "}"); + o = f ? function(row, i) { + return f(a(row), i); + } : a; + }); + }; + dsv.parseRows = function(text, f) { + var EOL = {}, EOF = {}, rows = [], N = text.length, I = 0, n = 0, t, eol; + function token() { + if (I >= N) return EOF; + if (eol) return eol = false, EOL; + var j = I; + if (text.charCodeAt(j) === 34) { + var i = j; + while (i++ < N) { + if (text.charCodeAt(i) === 34) { + if (text.charCodeAt(i + 1) !== 34) break; + ++i; + } + } + I = i + 2; + var c = text.charCodeAt(i + 1); + if (c === 13) { + eol = true; + if (text.charCodeAt(i + 2) === 10) ++I; + } else if (c === 10) { + eol = true; + } + return text.slice(j + 1, i).replace(/""/g, '"'); + } + while (I < N) { + var c = text.charCodeAt(I++), k = 1; + if (c === 10) eol = true; else if (c === 13) { + eol = true; + if (text.charCodeAt(I) === 10) ++I, ++k; + } else if (c !== delimiterCode) continue; + return text.slice(j, I - k); + } + return text.slice(j); + } + while ((t = token()) !== EOF) { + var a = []; + while (t !== EOL && t !== EOF) { + a.push(t); + t = token(); + } + if (f && (a = f(a, n++)) == null) continue; + rows.push(a); + } + return rows; + }; + dsv.format = function(rows) { + if (Array.isArray(rows[0])) return dsv.formatRows(rows); + var fieldSet = new d3_Set(), fields = []; + rows.forEach(function(row) { + for (var field in row) { + if (!fieldSet.has(field)) { + fields.push(fieldSet.add(field)); + } + } + }); + return [ fields.map(formatValue).join(delimiter) ].concat(rows.map(function(row) { + return fields.map(function(field) { + return formatValue(row[field]); + }).join(delimiter); + })).join("\n"); + }; + dsv.formatRows = function(rows) { + return rows.map(formatRow).join("\n"); + }; + function formatRow(row) { + return row.map(formatValue).join(delimiter); + } + function formatValue(text) { + return reFormat.test(text) ? '"' + text.replace(/\"/g, '""') + '"' : text; + } + return dsv; + }; + d3.csv = d3.dsv(",", "text/csv"); + d3.tsv = d3.dsv(" ", "text/tab-separated-values"); + var d3_timer_queueHead, d3_timer_queueTail, d3_timer_interval, d3_timer_timeout, d3_timer_frame = this[d3_vendorSymbol(this, "requestAnimationFrame")] || function(callback) { + setTimeout(callback, 17); + }; + d3.timer = function() { + d3_timer.apply(this, arguments); + }; + function d3_timer(callback, delay, then) { + var n = arguments.length; + if (n < 2) delay = 0; + if (n < 3) then = Date.now(); + var time = then + delay, timer = { + c: callback, + t: time, + n: null + }; + if (d3_timer_queueTail) d3_timer_queueTail.n = timer; else d3_timer_queueHead = timer; + d3_timer_queueTail = timer; + if (!d3_timer_interval) { + d3_timer_timeout = clearTimeout(d3_timer_timeout); + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } + return timer; + } + function d3_timer_step() { + var now = d3_timer_mark(), delay = d3_timer_sweep() - now; + if (delay > 24) { + if (isFinite(delay)) { + clearTimeout(d3_timer_timeout); + d3_timer_timeout = setTimeout(d3_timer_step, delay); + } + d3_timer_interval = 0; + } else { + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } + } + d3.timer.flush = function() { + d3_timer_mark(); + d3_timer_sweep(); + }; + function d3_timer_mark() { + var now = Date.now(), timer = d3_timer_queueHead; + while (timer) { + if (now >= timer.t && timer.c(now - timer.t)) timer.c = null; + timer = timer.n; + } + return now; + } + function d3_timer_sweep() { + var t0, t1 = d3_timer_queueHead, time = Infinity; + while (t1) { + if (t1.c) { + if (t1.t < time) time = t1.t; + t1 = (t0 = t1).n; + } else { + t1 = t0 ? t0.n = t1.n : d3_timer_queueHead = t1.n; + } + } + d3_timer_queueTail = t0; + return time; + } + function d3_format_precision(x, p) { + return p - (x ? Math.ceil(Math.log(x) / Math.LN10) : 1); + } + d3.round = function(x, n) { + return n ? Math.round(x * (n = Math.pow(10, n))) / n : Math.round(x); + }; + var d3_formatPrefixes = [ "y", "z", "a", "f", "p", "n", "µ", "m", "", "k", "M", "G", "T", "P", "E", "Z", "Y" ].map(d3_formatPrefix); + d3.formatPrefix = function(value, precision) { + var i = 0; + if (value = +value) { + if (value < 0) value *= -1; + if (precision) value = d3.round(value, d3_format_precision(value, precision)); + i = 1 + Math.floor(1e-12 + Math.log(value) / Math.LN10); + i = Math.max(-24, Math.min(24, Math.floor((i - 1) / 3) * 3)); + } + return d3_formatPrefixes[8 + i / 3]; + }; + function d3_formatPrefix(d, i) { + var k = Math.pow(10, abs(8 - i) * 3); + return { + scale: i > 8 ? function(d) { + return d / k; + } : function(d) { + return d * k; + }, + symbol: d + }; + } + function d3_locale_numberFormat(locale) { + var locale_decimal = locale.decimal, locale_thousands = locale.thousands, locale_grouping = locale.grouping, locale_currency = locale.currency, formatGroup = locale_grouping && locale_thousands ? function(value, width) { + var i = value.length, t = [], j = 0, g = locale_grouping[0], length = 0; + while (i > 0 && g > 0) { + if (length + g + 1 > width) g = Math.max(1, width - length); + t.push(value.substring(i -= g, i + g)); + if ((length += g + 1) > width) break; + g = locale_grouping[j = (j + 1) % locale_grouping.length]; + } + return t.reverse().join(locale_thousands); + } : d3_identity; + return function(specifier) { + var match = d3_format_re.exec(specifier), fill = match[1] || " ", align = match[2] || ">", sign = match[3] || "-", symbol = match[4] || "", zfill = match[5], width = +match[6], comma = match[7], precision = match[8], type = match[9], scale = 1, prefix = "", suffix = "", integer = false, exponent = true; + if (precision) precision = +precision.substring(1); + if (zfill || fill === "0" && align === "=") { + zfill = fill = "0"; + align = "="; + } + switch (type) { + case "n": + comma = true; + type = "g"; + break; + + case "%": + scale = 100; + suffix = "%"; + type = "f"; + break; + + case "p": + scale = 100; + suffix = "%"; + type = "r"; + break; + + case "b": + case "o": + case "x": + case "X": + if (symbol === "#") prefix = "0" + type.toLowerCase(); + + case "c": + exponent = false; + + case "d": + integer = true; + precision = 0; + break; + + case "s": + scale = -1; + type = "r"; + break; + } + if (symbol === "$") prefix = locale_currency[0], suffix = locale_currency[1]; + if (type == "r" && !precision) type = "g"; + if (precision != null) { + if (type == "g") precision = Math.max(1, Math.min(21, precision)); else if (type == "e" || type == "f") precision = Math.max(0, Math.min(20, precision)); + } + type = d3_format_types.get(type) || d3_format_typeDefault; + var zcomma = zfill && comma; + return function(value) { + var fullSuffix = suffix; + if (integer && value % 1) return ""; + var negative = value < 0 || value === 0 && 1 / value < 0 ? (value = -value, "-") : sign === "-" ? "" : sign; + if (scale < 0) { + var unit = d3.formatPrefix(value, precision); + value = unit.scale(value); + fullSuffix = unit.symbol + suffix; + } else { + value *= scale; + } + value = type(value, precision); + var i = value.lastIndexOf("."), before, after; + if (i < 0) { + var j = exponent ? value.lastIndexOf("e") : -1; + if (j < 0) before = value, after = ""; else before = value.substring(0, j), after = value.substring(j); + } else { + before = value.substring(0, i); + after = locale_decimal + value.substring(i + 1); + } + if (!zfill && comma) before = formatGroup(before, Infinity); + var length = prefix.length + before.length + after.length + (zcomma ? 0 : negative.length), padding = length < width ? new Array(length = width - length + 1).join(fill) : ""; + if (zcomma) before = formatGroup(padding + before, padding.length ? width - after.length : Infinity); + negative += prefix; + value = before + after; + return (align === "<" ? negative + value + padding : align === ">" ? padding + negative + value : align === "^" ? padding.substring(0, length >>= 1) + negative + value + padding.substring(length) : negative + (zcomma ? value : padding + value)) + fullSuffix; + }; + }; + } + var d3_format_re = /(?:([^{])?([<>=^]))?([+\- ])?([$#])?(0)?(\d+)?(,)?(\.-?\d+)?([a-z%])?/i; + var d3_format_types = d3.map({ + b: function(x) { + return x.toString(2); + }, + c: function(x) { + return String.fromCharCode(x); + }, + o: function(x) { + return x.toString(8); + }, + x: function(x) { + return x.toString(16); + }, + X: function(x) { + return x.toString(16).toUpperCase(); + }, + g: function(x, p) { + return x.toPrecision(p); + }, + e: function(x, p) { + return x.toExponential(p); + }, + f: function(x, p) { + return x.toFixed(p); + }, + r: function(x, p) { + return (x = d3.round(x, d3_format_precision(x, p))).toFixed(Math.max(0, Math.min(20, d3_format_precision(x * (1 + 1e-15), p)))); + } + }); + function d3_format_typeDefault(x) { + return x + ""; + } + var d3_time = d3.time = {}, d3_date = Date; + function d3_date_utc() { + this._ = new Date(arguments.length > 1 ? Date.UTC.apply(this, arguments) : arguments[0]); + } + d3_date_utc.prototype = { + getDate: function() { + return this._.getUTCDate(); + }, + getDay: function() { + return this._.getUTCDay(); + }, + getFullYear: function() { + return this._.getUTCFullYear(); + }, + getHours: function() { + return this._.getUTCHours(); + }, + getMilliseconds: function() { + return this._.getUTCMilliseconds(); + }, + getMinutes: function() { + return this._.getUTCMinutes(); + }, + getMonth: function() { + return this._.getUTCMonth(); + }, + getSeconds: function() { + return this._.getUTCSeconds(); + }, + getTime: function() { + return this._.getTime(); + }, + getTimezoneOffset: function() { + return 0; + }, + valueOf: function() { + return this._.valueOf(); + }, + setDate: function() { + d3_time_prototype.setUTCDate.apply(this._, arguments); + }, + setDay: function() { + d3_time_prototype.setUTCDay.apply(this._, arguments); + }, + setFullYear: function() { + d3_time_prototype.setUTCFullYear.apply(this._, arguments); + }, + setHours: function() { + d3_time_prototype.setUTCHours.apply(this._, arguments); + }, + setMilliseconds: function() { + d3_time_prototype.setUTCMilliseconds.apply(this._, arguments); + }, + setMinutes: function() { + d3_time_prototype.setUTCMinutes.apply(this._, arguments); + }, + setMonth: function() { + d3_time_prototype.setUTCMonth.apply(this._, arguments); + }, + setSeconds: function() { + d3_time_prototype.setUTCSeconds.apply(this._, arguments); + }, + setTime: function() { + d3_time_prototype.setTime.apply(this._, arguments); + } + }; + var d3_time_prototype = Date.prototype; + function d3_time_interval(local, step, number) { + function round(date) { + var d0 = local(date), d1 = offset(d0, 1); + return date - d0 < d1 - date ? d0 : d1; + } + function ceil(date) { + step(date = local(new d3_date(date - 1)), 1); + return date; + } + function offset(date, k) { + step(date = new d3_date(+date), k); + return date; + } + function range(t0, t1, dt) { + var time = ceil(t0), times = []; + if (dt > 1) { + while (time < t1) { + if (!(number(time) % dt)) times.push(new Date(+time)); + step(time, 1); + } + } else { + while (time < t1) times.push(new Date(+time)), step(time, 1); + } + return times; + } + function range_utc(t0, t1, dt) { + try { + d3_date = d3_date_utc; + var utc = new d3_date_utc(); + utc._ = t0; + return range(utc, t1, dt); + } finally { + d3_date = Date; + } + } + local.floor = local; + local.round = round; + local.ceil = ceil; + local.offset = offset; + local.range = range; + var utc = local.utc = d3_time_interval_utc(local); + utc.floor = utc; + utc.round = d3_time_interval_utc(round); + utc.ceil = d3_time_interval_utc(ceil); + utc.offset = d3_time_interval_utc(offset); + utc.range = range_utc; + return local; + } + function d3_time_interval_utc(method) { + return function(date, k) { + try { + d3_date = d3_date_utc; + var utc = new d3_date_utc(); + utc._ = date; + return method(utc, k)._; + } finally { + d3_date = Date; + } + }; + } + d3_time.year = d3_time_interval(function(date) { + date = d3_time.day(date); + date.setMonth(0, 1); + return date; + }, function(date, offset) { + date.setFullYear(date.getFullYear() + offset); + }, function(date) { + return date.getFullYear(); + }); + d3_time.years = d3_time.year.range; + d3_time.years.utc = d3_time.year.utc.range; + d3_time.day = d3_time_interval(function(date) { + var day = new d3_date(2e3, 0); + day.setFullYear(date.getFullYear(), date.getMonth(), date.getDate()); + return day; + }, function(date, offset) { + date.setDate(date.getDate() + offset); + }, function(date) { + return date.getDate() - 1; + }); + d3_time.days = d3_time.day.range; + d3_time.days.utc = d3_time.day.utc.range; + d3_time.dayOfYear = function(date) { + var year = d3_time.year(date); + return Math.floor((date - year - (date.getTimezoneOffset() - year.getTimezoneOffset()) * 6e4) / 864e5); + }; + [ "sunday", "monday", "tuesday", "wednesday", "thursday", "friday", "saturday" ].forEach(function(day, i) { + i = 7 - i; + var interval = d3_time[day] = d3_time_interval(function(date) { + (date = d3_time.day(date)).setDate(date.getDate() - (date.getDay() + i) % 7); + return date; + }, function(date, offset) { + date.setDate(date.getDate() + Math.floor(offset) * 7); + }, function(date) { + var day = d3_time.year(date).getDay(); + return Math.floor((d3_time.dayOfYear(date) + (day + i) % 7) / 7) - (day !== i); + }); + d3_time[day + "s"] = interval.range; + d3_time[day + "s"].utc = interval.utc.range; + d3_time[day + "OfYear"] = function(date) { + var day = d3_time.year(date).getDay(); + return Math.floor((d3_time.dayOfYear(date) + (day + i) % 7) / 7); + }; + }); + d3_time.week = d3_time.sunday; + d3_time.weeks = d3_time.sunday.range; + d3_time.weeks.utc = d3_time.sunday.utc.range; + d3_time.weekOfYear = d3_time.sundayOfYear; + function d3_locale_timeFormat(locale) { + var locale_dateTime = locale.dateTime, locale_date = locale.date, locale_time = locale.time, locale_periods = locale.periods, locale_days = locale.days, locale_shortDays = locale.shortDays, locale_months = locale.months, locale_shortMonths = locale.shortMonths; + function d3_time_format(template) { + var n = template.length; + function format(date) { + var string = [], i = -1, j = 0, c, p, f; + while (++i < n) { + if (template.charCodeAt(i) === 37) { + string.push(template.slice(j, i)); + if ((p = d3_time_formatPads[c = template.charAt(++i)]) != null) c = template.charAt(++i); + if (f = d3_time_formats[c]) c = f(date, p == null ? c === "e" ? " " : "0" : p); + string.push(c); + j = i + 1; + } + } + string.push(template.slice(j, i)); + return string.join(""); + } + format.parse = function(string) { + var d = { + y: 1900, + m: 0, + d: 1, + H: 0, + M: 0, + S: 0, + L: 0, + Z: null + }, i = d3_time_parse(d, template, string, 0); + if (i != string.length) return null; + if ("p" in d) d.H = d.H % 12 + d.p * 12; + var localZ = d.Z != null && d3_date !== d3_date_utc, date = new (localZ ? d3_date_utc : d3_date)(); + if ("j" in d) date.setFullYear(d.y, 0, d.j); else if ("W" in d || "U" in d) { + if (!("w" in d)) d.w = "W" in d ? 1 : 0; + date.setFullYear(d.y, 0, 1); + date.setFullYear(d.y, 0, "W" in d ? (d.w + 6) % 7 + d.W * 7 - (date.getDay() + 5) % 7 : d.w + d.U * 7 - (date.getDay() + 6) % 7); + } else date.setFullYear(d.y, d.m, d.d); + date.setHours(d.H + (d.Z / 100 | 0), d.M + d.Z % 100, d.S, d.L); + return localZ ? date._ : date; + }; + format.toString = function() { + return template; + }; + return format; + } + function d3_time_parse(date, template, string, j) { + var c, p, t, i = 0, n = template.length, m = string.length; + while (i < n) { + if (j >= m) return -1; + c = template.charCodeAt(i++); + if (c === 37) { + t = template.charAt(i++); + p = d3_time_parsers[t in d3_time_formatPads ? template.charAt(i++) : t]; + if (!p || (j = p(date, string, j)) < 0) return -1; + } else if (c != string.charCodeAt(j++)) { + return -1; + } + } + return j; + } + d3_time_format.utc = function(template) { + var local = d3_time_format(template); + function format(date) { + try { + d3_date = d3_date_utc; + var utc = new d3_date(); + utc._ = date; + return local(utc); + } finally { + d3_date = Date; + } + } + format.parse = function(string) { + try { + d3_date = d3_date_utc; + var date = local.parse(string); + return date && date._; + } finally { + d3_date = Date; + } + }; + format.toString = local.toString; + return format; + }; + d3_time_format.multi = d3_time_format.utc.multi = d3_time_formatMulti; + var d3_time_periodLookup = d3.map(), d3_time_dayRe = d3_time_formatRe(locale_days), d3_time_dayLookup = d3_time_formatLookup(locale_days), d3_time_dayAbbrevRe = d3_time_formatRe(locale_shortDays), d3_time_dayAbbrevLookup = d3_time_formatLookup(locale_shortDays), d3_time_monthRe = d3_time_formatRe(locale_months), d3_time_monthLookup = d3_time_formatLookup(locale_months), d3_time_monthAbbrevRe = d3_time_formatRe(locale_shortMonths), d3_time_monthAbbrevLookup = d3_time_formatLookup(locale_shortMonths); + locale_periods.forEach(function(p, i) { + d3_time_periodLookup.set(p.toLowerCase(), i); + }); + var d3_time_formats = { + a: function(d) { + return locale_shortDays[d.getDay()]; + }, + A: function(d) { + return locale_days[d.getDay()]; + }, + b: function(d) { + return locale_shortMonths[d.getMonth()]; + }, + B: function(d) { + return locale_months[d.getMonth()]; + }, + c: d3_time_format(locale_dateTime), + d: function(d, p) { + return d3_time_formatPad(d.getDate(), p, 2); + }, + e: function(d, p) { + return d3_time_formatPad(d.getDate(), p, 2); + }, + H: function(d, p) { + return d3_time_formatPad(d.getHours(), p, 2); + }, + I: function(d, p) { + return d3_time_formatPad(d.getHours() % 12 || 12, p, 2); + }, + j: function(d, p) { + return d3_time_formatPad(1 + d3_time.dayOfYear(d), p, 3); + }, + L: function(d, p) { + return d3_time_formatPad(d.getMilliseconds(), p, 3); + }, + m: function(d, p) { + return d3_time_formatPad(d.getMonth() + 1, p, 2); + }, + M: function(d, p) { + return d3_time_formatPad(d.getMinutes(), p, 2); + }, + p: function(d) { + return locale_periods[+(d.getHours() >= 12)]; + }, + S: function(d, p) { + return d3_time_formatPad(d.getSeconds(), p, 2); + }, + U: function(d, p) { + return d3_time_formatPad(d3_time.sundayOfYear(d), p, 2); + }, + w: function(d) { + return d.getDay(); + }, + W: function(d, p) { + return d3_time_formatPad(d3_time.mondayOfYear(d), p, 2); + }, + x: d3_time_format(locale_date), + X: d3_time_format(locale_time), + y: function(d, p) { + return d3_time_formatPad(d.getFullYear() % 100, p, 2); + }, + Y: function(d, p) { + return d3_time_formatPad(d.getFullYear() % 1e4, p, 4); + }, + Z: d3_time_zone, + "%": function() { + return "%"; + } + }; + var d3_time_parsers = { + a: d3_time_parseWeekdayAbbrev, + A: d3_time_parseWeekday, + b: d3_time_parseMonthAbbrev, + B: d3_time_parseMonth, + c: d3_time_parseLocaleFull, + d: d3_time_parseDay, + e: d3_time_parseDay, + H: d3_time_parseHour24, + I: d3_time_parseHour24, + j: d3_time_parseDayOfYear, + L: d3_time_parseMilliseconds, + m: d3_time_parseMonthNumber, + M: d3_time_parseMinutes, + p: d3_time_parseAmPm, + S: d3_time_parseSeconds, + U: d3_time_parseWeekNumberSunday, + w: d3_time_parseWeekdayNumber, + W: d3_time_parseWeekNumberMonday, + x: d3_time_parseLocaleDate, + X: d3_time_parseLocaleTime, + y: d3_time_parseYear, + Y: d3_time_parseFullYear, + Z: d3_time_parseZone, + "%": d3_time_parseLiteralPercent + }; + function d3_time_parseWeekdayAbbrev(date, string, i) { + d3_time_dayAbbrevRe.lastIndex = 0; + var n = d3_time_dayAbbrevRe.exec(string.slice(i)); + return n ? (date.w = d3_time_dayAbbrevLookup.get(n[0].toLowerCase()), i + n[0].length) : -1; + } + function d3_time_parseWeekday(date, string, i) { + d3_time_dayRe.lastIndex = 0; + var n = d3_time_dayRe.exec(string.slice(i)); + return n ? (date.w = d3_time_dayLookup.get(n[0].toLowerCase()), i + n[0].length) : -1; + } + function d3_time_parseMonthAbbrev(date, string, i) { + d3_time_monthAbbrevRe.lastIndex = 0; + var n = d3_time_monthAbbrevRe.exec(string.slice(i)); + return n ? (date.m = d3_time_monthAbbrevLookup.get(n[0].toLowerCase()), i + n[0].length) : -1; + } + function d3_time_parseMonth(date, string, i) { + d3_time_monthRe.lastIndex = 0; + var n = d3_time_monthRe.exec(string.slice(i)); + return n ? (date.m = d3_time_monthLookup.get(n[0].toLowerCase()), i + n[0].length) : -1; + } + function d3_time_parseLocaleFull(date, string, i) { + return d3_time_parse(date, d3_time_formats.c.toString(), string, i); + } + function d3_time_parseLocaleDate(date, string, i) { + return d3_time_parse(date, d3_time_formats.x.toString(), string, i); + } + function d3_time_parseLocaleTime(date, string, i) { + return d3_time_parse(date, d3_time_formats.X.toString(), string, i); + } + function d3_time_parseAmPm(date, string, i) { + var n = d3_time_periodLookup.get(string.slice(i, i += 2).toLowerCase()); + return n == null ? -1 : (date.p = n, i); + } + return d3_time_format; + } + var d3_time_formatPads = { + "-": "", + _: " ", + "0": "0" + }, d3_time_numberRe = /^\s*\d+/, d3_time_percentRe = /^%/; + function d3_time_formatPad(value, fill, width) { + var sign = value < 0 ? "-" : "", string = (sign ? -value : value) + "", length = string.length; + return sign + (length < width ? new Array(width - length + 1).join(fill) + string : string); + } + function d3_time_formatRe(names) { + return new RegExp("^(?:" + names.map(d3.requote).join("|") + ")", "i"); + } + function d3_time_formatLookup(names) { + var map = new d3_Map(), i = -1, n = names.length; + while (++i < n) map.set(names[i].toLowerCase(), i); + return map; + } + function d3_time_parseWeekdayNumber(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 1)); + return n ? (date.w = +n[0], i + n[0].length) : -1; + } + function d3_time_parseWeekNumberSunday(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i)); + return n ? (date.U = +n[0], i + n[0].length) : -1; + } + function d3_time_parseWeekNumberMonday(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i)); + return n ? (date.W = +n[0], i + n[0].length) : -1; + } + function d3_time_parseFullYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 4)); + return n ? (date.y = +n[0], i + n[0].length) : -1; + } + function d3_time_parseYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 2)); + return n ? (date.y = d3_time_expandYear(+n[0]), i + n[0].length) : -1; + } + function d3_time_parseZone(date, string, i) { + return /^[+-]\d{4}$/.test(string = string.slice(i, i + 5)) ? (date.Z = -string, + i + 5) : -1; + } + function d3_time_expandYear(d) { + return d + (d > 68 ? 1900 : 2e3); + } + function d3_time_parseMonthNumber(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 2)); + return n ? (date.m = n[0] - 1, i + n[0].length) : -1; + } + function d3_time_parseDay(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 2)); + return n ? (date.d = +n[0], i + n[0].length) : -1; + } + function d3_time_parseDayOfYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 3)); + return n ? (date.j = +n[0], i + n[0].length) : -1; + } + function d3_time_parseHour24(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 2)); + return n ? (date.H = +n[0], i + n[0].length) : -1; + } + function d3_time_parseMinutes(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 2)); + return n ? (date.M = +n[0], i + n[0].length) : -1; + } + function d3_time_parseSeconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 2)); + return n ? (date.S = +n[0], i + n[0].length) : -1; + } + function d3_time_parseMilliseconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.slice(i, i + 3)); + return n ? (date.L = +n[0], i + n[0].length) : -1; + } + function d3_time_zone(d) { + var z = d.getTimezoneOffset(), zs = z > 0 ? "-" : "+", zh = abs(z) / 60 | 0, zm = abs(z) % 60; + return zs + d3_time_formatPad(zh, "0", 2) + d3_time_formatPad(zm, "0", 2); + } + function d3_time_parseLiteralPercent(date, string, i) { + d3_time_percentRe.lastIndex = 0; + var n = d3_time_percentRe.exec(string.slice(i, i + 1)); + return n ? i + n[0].length : -1; + } + function d3_time_formatMulti(formats) { + var n = formats.length, i = -1; + while (++i < n) formats[i][0] = this(formats[i][0]); + return function(date) { + var i = 0, f = formats[i]; + while (!f[1](date)) f = formats[++i]; + return f[0](date); + }; + } + d3.locale = function(locale) { + return { + numberFormat: d3_locale_numberFormat(locale), + timeFormat: d3_locale_timeFormat(locale) + }; + }; + var d3_locale_enUS = d3.locale({ + decimal: ".", + thousands: ",", + grouping: [ 3 ], + currency: [ "$", "" ], + dateTime: "%a %b %e %X %Y", + date: "%m/%d/%Y", + time: "%H:%M:%S", + periods: [ "AM", "PM" ], + days: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], + shortDays: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], + months: [ "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December" ], + shortMonths: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ] + }); + d3.format = d3_locale_enUS.numberFormat; + d3.geo = {}; + function d3_adder() {} + d3_adder.prototype = { + s: 0, + t: 0, + add: function(y) { + d3_adderSum(y, this.t, d3_adderTemp); + d3_adderSum(d3_adderTemp.s, this.s, this); + if (this.s) this.t += d3_adderTemp.t; else this.s = d3_adderTemp.t; + }, + reset: function() { + this.s = this.t = 0; + }, + valueOf: function() { + return this.s; + } + }; + var d3_adderTemp = new d3_adder(); + function d3_adderSum(a, b, o) { + var x = o.s = a + b, bv = x - a, av = x - bv; + o.t = a - av + (b - bv); + } + d3.geo.stream = function(object, listener) { + if (object && d3_geo_streamObjectType.hasOwnProperty(object.type)) { + d3_geo_streamObjectType[object.type](object, listener); + } else { + d3_geo_streamGeometry(object, listener); + } + }; + function d3_geo_streamGeometry(geometry, listener) { + if (geometry && d3_geo_streamGeometryType.hasOwnProperty(geometry.type)) { + d3_geo_streamGeometryType[geometry.type](geometry, listener); + } + } + var d3_geo_streamObjectType = { + Feature: function(feature, listener) { + d3_geo_streamGeometry(feature.geometry, listener); + }, + FeatureCollection: function(object, listener) { + var features = object.features, i = -1, n = features.length; + while (++i < n) d3_geo_streamGeometry(features[i].geometry, listener); + } + }; + var d3_geo_streamGeometryType = { + Sphere: function(object, listener) { + listener.sphere(); + }, + Point: function(object, listener) { + object = object.coordinates; + listener.point(object[0], object[1], object[2]); + }, + MultiPoint: function(object, listener) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) object = coordinates[i], listener.point(object[0], object[1], object[2]); + }, + LineString: function(object, listener) { + d3_geo_streamLine(object.coordinates, listener, 0); + }, + MultiLineString: function(object, listener) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) d3_geo_streamLine(coordinates[i], listener, 0); + }, + Polygon: function(object, listener) { + d3_geo_streamPolygon(object.coordinates, listener); + }, + MultiPolygon: function(object, listener) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) d3_geo_streamPolygon(coordinates[i], listener); + }, + GeometryCollection: function(object, listener) { + var geometries = object.geometries, i = -1, n = geometries.length; + while (++i < n) d3_geo_streamGeometry(geometries[i], listener); + } + }; + function d3_geo_streamLine(coordinates, listener, closed) { + var i = -1, n = coordinates.length - closed, coordinate; + listener.lineStart(); + while (++i < n) coordinate = coordinates[i], listener.point(coordinate[0], coordinate[1], coordinate[2]); + listener.lineEnd(); + } + function d3_geo_streamPolygon(coordinates, listener) { + var i = -1, n = coordinates.length; + listener.polygonStart(); + while (++i < n) d3_geo_streamLine(coordinates[i], listener, 1); + listener.polygonEnd(); + } + d3.geo.area = function(object) { + d3_geo_areaSum = 0; + d3.geo.stream(object, d3_geo_area); + return d3_geo_areaSum; + }; + var d3_geo_areaSum, d3_geo_areaRingSum = new d3_adder(); + var d3_geo_area = { + sphere: function() { + d3_geo_areaSum += 4 * π; + }, + point: d3_noop, + lineStart: d3_noop, + lineEnd: d3_noop, + polygonStart: function() { + d3_geo_areaRingSum.reset(); + d3_geo_area.lineStart = d3_geo_areaRingStart; + }, + polygonEnd: function() { + var area = 2 * d3_geo_areaRingSum; + d3_geo_areaSum += area < 0 ? 4 * π + area : area; + d3_geo_area.lineStart = d3_geo_area.lineEnd = d3_geo_area.point = d3_noop; + } + }; + function d3_geo_areaRingStart() { + var λ00, φ00, λ0, cosφ0, sinφ0; + d3_geo_area.point = function(λ, φ) { + d3_geo_area.point = nextPoint; + λ0 = (λ00 = λ) * d3_radians, cosφ0 = Math.cos(φ = (φ00 = φ) * d3_radians / 2 + π / 4), + sinφ0 = Math.sin(φ); + }; + function nextPoint(λ, φ) { + λ *= d3_radians; + φ = φ * d3_radians / 2 + π / 4; + var dλ = λ - λ0, sdλ = dλ >= 0 ? 1 : -1, adλ = sdλ * dλ, cosφ = Math.cos(φ), sinφ = Math.sin(φ), k = sinφ0 * sinφ, u = cosφ0 * cosφ + k * Math.cos(adλ), v = k * sdλ * Math.sin(adλ); + d3_geo_areaRingSum.add(Math.atan2(v, u)); + λ0 = λ, cosφ0 = cosφ, sinφ0 = sinφ; + } + d3_geo_area.lineEnd = function() { + nextPoint(λ00, φ00); + }; + } + function d3_geo_cartesian(spherical) { + var λ = spherical[0], φ = spherical[1], cosφ = Math.cos(φ); + return [ cosφ * Math.cos(λ), cosφ * Math.sin(λ), Math.sin(φ) ]; + } + function d3_geo_cartesianDot(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2]; + } + function d3_geo_cartesianCross(a, b) { + return [ a[1] * b[2] - a[2] * b[1], a[2] * b[0] - a[0] * b[2], a[0] * b[1] - a[1] * b[0] ]; + } + function d3_geo_cartesianAdd(a, b) { + a[0] += b[0]; + a[1] += b[1]; + a[2] += b[2]; + } + function d3_geo_cartesianScale(vector, k) { + return [ vector[0] * k, vector[1] * k, vector[2] * k ]; + } + function d3_geo_cartesianNormalize(d) { + var l = Math.sqrt(d[0] * d[0] + d[1] * d[1] + d[2] * d[2]); + d[0] /= l; + d[1] /= l; + d[2] /= l; + } + function d3_geo_spherical(cartesian) { + return [ Math.atan2(cartesian[1], cartesian[0]), d3_asin(cartesian[2]) ]; + } + function d3_geo_sphericalEqual(a, b) { + return abs(a[0] - b[0]) < ε && abs(a[1] - b[1]) < ε; + } + d3.geo.bounds = function() { + var λ0, φ0, λ1, φ1, λ_, λ__, φ__, p0, dλSum, ranges, range; + var bound = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { + bound.point = ringPoint; + bound.lineStart = ringStart; + bound.lineEnd = ringEnd; + dλSum = 0; + d3_geo_area.polygonStart(); + }, + polygonEnd: function() { + d3_geo_area.polygonEnd(); + bound.point = point; + bound.lineStart = lineStart; + bound.lineEnd = lineEnd; + if (d3_geo_areaRingSum < 0) λ0 = -(λ1 = 180), φ0 = -(φ1 = 90); else if (dλSum > ε) φ1 = 90; else if (dλSum < -ε) φ0 = -90; + range[0] = λ0, range[1] = λ1; + } + }; + function point(λ, φ) { + ranges.push(range = [ λ0 = λ, λ1 = λ ]); + if (φ < φ0) φ0 = φ; + if (φ > φ1) φ1 = φ; + } + function linePoint(λ, φ) { + var p = d3_geo_cartesian([ λ * d3_radians, φ * d3_radians ]); + if (p0) { + var normal = d3_geo_cartesianCross(p0, p), equatorial = [ normal[1], -normal[0], 0 ], inflection = d3_geo_cartesianCross(equatorial, normal); + d3_geo_cartesianNormalize(inflection); + inflection = d3_geo_spherical(inflection); + var dλ = λ - λ_, s = dλ > 0 ? 1 : -1, λi = inflection[0] * d3_degrees * s, antimeridian = abs(dλ) > 180; + if (antimeridian ^ (s * λ_ < λi && λi < s * λ)) { + var φi = inflection[1] * d3_degrees; + if (φi > φ1) φ1 = φi; + } else if (λi = (λi + 360) % 360 - 180, antimeridian ^ (s * λ_ < λi && λi < s * λ)) { + var φi = -inflection[1] * d3_degrees; + if (φi < φ0) φ0 = φi; + } else { + if (φ < φ0) φ0 = φ; + if (φ > φ1) φ1 = φ; + } + if (antimeridian) { + if (λ < λ_) { + if (angle(λ0, λ) > angle(λ0, λ1)) λ1 = λ; + } else { + if (angle(λ, λ1) > angle(λ0, λ1)) λ0 = λ; + } + } else { + if (λ1 >= λ0) { + if (λ < λ0) λ0 = λ; + if (λ > λ1) λ1 = λ; + } else { + if (λ > λ_) { + if (angle(λ0, λ) > angle(λ0, λ1)) λ1 = λ; + } else { + if (angle(λ, λ1) > angle(λ0, λ1)) λ0 = λ; + } + } + } + } else { + point(λ, φ); + } + p0 = p, λ_ = λ; + } + function lineStart() { + bound.point = linePoint; + } + function lineEnd() { + range[0] = λ0, range[1] = λ1; + bound.point = point; + p0 = null; + } + function ringPoint(λ, φ) { + if (p0) { + var dλ = λ - λ_; + dλSum += abs(dλ) > 180 ? dλ + (dλ > 0 ? 360 : -360) : dλ; + } else λ__ = λ, φ__ = φ; + d3_geo_area.point(λ, φ); + linePoint(λ, φ); + } + function ringStart() { + d3_geo_area.lineStart(); + } + function ringEnd() { + ringPoint(λ__, φ__); + d3_geo_area.lineEnd(); + if (abs(dλSum) > ε) λ0 = -(λ1 = 180); + range[0] = λ0, range[1] = λ1; + p0 = null; + } + function angle(λ0, λ1) { + return (λ1 -= λ0) < 0 ? λ1 + 360 : λ1; + } + function compareRanges(a, b) { + return a[0] - b[0]; + } + function withinRange(x, range) { + return range[0] <= range[1] ? range[0] <= x && x <= range[1] : x < range[0] || range[1] < x; + } + return function(feature) { + φ1 = λ1 = -(λ0 = φ0 = Infinity); + ranges = []; + d3.geo.stream(feature, bound); + var n = ranges.length; + if (n) { + ranges.sort(compareRanges); + for (var i = 1, a = ranges[0], b, merged = [ a ]; i < n; ++i) { + b = ranges[i]; + if (withinRange(b[0], a) || withinRange(b[1], a)) { + if (angle(a[0], b[1]) > angle(a[0], a[1])) a[1] = b[1]; + if (angle(b[0], a[1]) > angle(a[0], a[1])) a[0] = b[0]; + } else { + merged.push(a = b); + } + } + var best = -Infinity, dλ; + for (var n = merged.length - 1, i = 0, a = merged[n], b; i <= n; a = b, ++i) { + b = merged[i]; + if ((dλ = angle(a[1], b[0])) > best) best = dλ, λ0 = b[0], λ1 = a[1]; + } + } + ranges = range = null; + return λ0 === Infinity || φ0 === Infinity ? [ [ NaN, NaN ], [ NaN, NaN ] ] : [ [ λ0, φ0 ], [ λ1, φ1 ] ]; + }; + }(); + d3.geo.centroid = function(object) { + d3_geo_centroidW0 = d3_geo_centroidW1 = d3_geo_centroidX0 = d3_geo_centroidY0 = d3_geo_centroidZ0 = d3_geo_centroidX1 = d3_geo_centroidY1 = d3_geo_centroidZ1 = d3_geo_centroidX2 = d3_geo_centroidY2 = d3_geo_centroidZ2 = 0; + d3.geo.stream(object, d3_geo_centroid); + var x = d3_geo_centroidX2, y = d3_geo_centroidY2, z = d3_geo_centroidZ2, m = x * x + y * y + z * z; + if (m < ε2) { + x = d3_geo_centroidX1, y = d3_geo_centroidY1, z = d3_geo_centroidZ1; + if (d3_geo_centroidW1 < ε) x = d3_geo_centroidX0, y = d3_geo_centroidY0, z = d3_geo_centroidZ0; + m = x * x + y * y + z * z; + if (m < ε2) return [ NaN, NaN ]; + } + return [ Math.atan2(y, x) * d3_degrees, d3_asin(z / Math.sqrt(m)) * d3_degrees ]; + }; + var d3_geo_centroidW0, d3_geo_centroidW1, d3_geo_centroidX0, d3_geo_centroidY0, d3_geo_centroidZ0, d3_geo_centroidX1, d3_geo_centroidY1, d3_geo_centroidZ1, d3_geo_centroidX2, d3_geo_centroidY2, d3_geo_centroidZ2; + var d3_geo_centroid = { + sphere: d3_noop, + point: d3_geo_centroidPoint, + lineStart: d3_geo_centroidLineStart, + lineEnd: d3_geo_centroidLineEnd, + polygonStart: function() { + d3_geo_centroid.lineStart = d3_geo_centroidRingStart; + }, + polygonEnd: function() { + d3_geo_centroid.lineStart = d3_geo_centroidLineStart; + } + }; + function d3_geo_centroidPoint(λ, φ) { + λ *= d3_radians; + var cosφ = Math.cos(φ *= d3_radians); + d3_geo_centroidPointXYZ(cosφ * Math.cos(λ), cosφ * Math.sin(λ), Math.sin(φ)); + } + function d3_geo_centroidPointXYZ(x, y, z) { + ++d3_geo_centroidW0; + d3_geo_centroidX0 += (x - d3_geo_centroidX0) / d3_geo_centroidW0; + d3_geo_centroidY0 += (y - d3_geo_centroidY0) / d3_geo_centroidW0; + d3_geo_centroidZ0 += (z - d3_geo_centroidZ0) / d3_geo_centroidW0; + } + function d3_geo_centroidLineStart() { + var x0, y0, z0; + d3_geo_centroid.point = function(λ, φ) { + λ *= d3_radians; + var cosφ = Math.cos(φ *= d3_radians); + x0 = cosφ * Math.cos(λ); + y0 = cosφ * Math.sin(λ); + z0 = Math.sin(φ); + d3_geo_centroid.point = nextPoint; + d3_geo_centroidPointXYZ(x0, y0, z0); + }; + function nextPoint(λ, φ) { + λ *= d3_radians; + var cosφ = Math.cos(φ *= d3_radians), x = cosφ * Math.cos(λ), y = cosφ * Math.sin(λ), z = Math.sin(φ), w = Math.atan2(Math.sqrt((w = y0 * z - z0 * y) * w + (w = z0 * x - x0 * z) * w + (w = x0 * y - y0 * x) * w), x0 * x + y0 * y + z0 * z); + d3_geo_centroidW1 += w; + d3_geo_centroidX1 += w * (x0 + (x0 = x)); + d3_geo_centroidY1 += w * (y0 + (y0 = y)); + d3_geo_centroidZ1 += w * (z0 + (z0 = z)); + d3_geo_centroidPointXYZ(x0, y0, z0); + } + } + function d3_geo_centroidLineEnd() { + d3_geo_centroid.point = d3_geo_centroidPoint; + } + function d3_geo_centroidRingStart() { + var λ00, φ00, x0, y0, z0; + d3_geo_centroid.point = function(λ, φ) { + λ00 = λ, φ00 = φ; + d3_geo_centroid.point = nextPoint; + λ *= d3_radians; + var cosφ = Math.cos(φ *= d3_radians); + x0 = cosφ * Math.cos(λ); + y0 = cosφ * Math.sin(λ); + z0 = Math.sin(φ); + d3_geo_centroidPointXYZ(x0, y0, z0); + }; + d3_geo_centroid.lineEnd = function() { + nextPoint(λ00, φ00); + d3_geo_centroid.lineEnd = d3_geo_centroidLineEnd; + d3_geo_centroid.point = d3_geo_centroidPoint; + }; + function nextPoint(λ, φ) { + λ *= d3_radians; + var cosφ = Math.cos(φ *= d3_radians), x = cosφ * Math.cos(λ), y = cosφ * Math.sin(λ), z = Math.sin(φ), cx = y0 * z - z0 * y, cy = z0 * x - x0 * z, cz = x0 * y - y0 * x, m = Math.sqrt(cx * cx + cy * cy + cz * cz), u = x0 * x + y0 * y + z0 * z, v = m && -d3_acos(u) / m, w = Math.atan2(m, u); + d3_geo_centroidX2 += v * cx; + d3_geo_centroidY2 += v * cy; + d3_geo_centroidZ2 += v * cz; + d3_geo_centroidW1 += w; + d3_geo_centroidX1 += w * (x0 + (x0 = x)); + d3_geo_centroidY1 += w * (y0 + (y0 = y)); + d3_geo_centroidZ1 += w * (z0 + (z0 = z)); + d3_geo_centroidPointXYZ(x0, y0, z0); + } + } + function d3_geo_compose(a, b) { + function compose(x, y) { + return x = a(x, y), b(x[0], x[1]); + } + if (a.invert && b.invert) compose.invert = function(x, y) { + return x = b.invert(x, y), x && a.invert(x[0], x[1]); + }; + return compose; + } + function d3_true() { + return true; + } + function d3_geo_clipPolygon(segments, compare, clipStartInside, interpolate, listener) { + var subject = [], clip = []; + segments.forEach(function(segment) { + if ((n = segment.length - 1) <= 0) return; + var n, p0 = segment[0], p1 = segment[n]; + if (d3_geo_sphericalEqual(p0, p1)) { + listener.lineStart(); + for (var i = 0; i < n; ++i) listener.point((p0 = segment[i])[0], p0[1]); + listener.lineEnd(); + return; + } + var a = new d3_geo_clipPolygonIntersection(p0, segment, null, true), b = new d3_geo_clipPolygonIntersection(p0, null, a, false); + a.o = b; + subject.push(a); + clip.push(b); + a = new d3_geo_clipPolygonIntersection(p1, segment, null, false); + b = new d3_geo_clipPolygonIntersection(p1, null, a, true); + a.o = b; + subject.push(a); + clip.push(b); + }); + clip.sort(compare); + d3_geo_clipPolygonLinkCircular(subject); + d3_geo_clipPolygonLinkCircular(clip); + if (!subject.length) return; + for (var i = 0, entry = clipStartInside, n = clip.length; i < n; ++i) { + clip[i].e = entry = !entry; + } + var start = subject[0], points, point; + while (1) { + var current = start, isSubject = true; + while (current.v) if ((current = current.n) === start) return; + points = current.z; + listener.lineStart(); + do { + current.v = current.o.v = true; + if (current.e) { + if (isSubject) { + for (var i = 0, n = points.length; i < n; ++i) listener.point((point = points[i])[0], point[1]); + } else { + interpolate(current.x, current.n.x, 1, listener); + } + current = current.n; + } else { + if (isSubject) { + points = current.p.z; + for (var i = points.length - 1; i >= 0; --i) listener.point((point = points[i])[0], point[1]); + } else { + interpolate(current.x, current.p.x, -1, listener); + } + current = current.p; + } + current = current.o; + points = current.z; + isSubject = !isSubject; + } while (!current.v); + listener.lineEnd(); + } + } + function d3_geo_clipPolygonLinkCircular(array) { + if (!(n = array.length)) return; + var n, i = 0, a = array[0], b; + while (++i < n) { + a.n = b = array[i]; + b.p = a; + a = b; + } + a.n = b = array[0]; + b.p = a; + } + function d3_geo_clipPolygonIntersection(point, points, other, entry) { + this.x = point; + this.z = points; + this.o = other; + this.e = entry; + this.v = false; + this.n = this.p = null; + } + function d3_geo_clip(pointVisible, clipLine, interpolate, clipStart) { + return function(rotate, listener) { + var line = clipLine(listener), rotatedClipStart = rotate.invert(clipStart[0], clipStart[1]); + var clip = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { + clip.point = pointRing; + clip.lineStart = ringStart; + clip.lineEnd = ringEnd; + segments = []; + polygon = []; + }, + polygonEnd: function() { + clip.point = point; + clip.lineStart = lineStart; + clip.lineEnd = lineEnd; + segments = d3.merge(segments); + var clipStartInside = d3_geo_pointInPolygon(rotatedClipStart, polygon); + if (segments.length) { + if (!polygonStarted) listener.polygonStart(), polygonStarted = true; + d3_geo_clipPolygon(segments, d3_geo_clipSort, clipStartInside, interpolate, listener); + } else if (clipStartInside) { + if (!polygonStarted) listener.polygonStart(), polygonStarted = true; + listener.lineStart(); + interpolate(null, null, 1, listener); + listener.lineEnd(); + } + if (polygonStarted) listener.polygonEnd(), polygonStarted = false; + segments = polygon = null; + }, + sphere: function() { + listener.polygonStart(); + listener.lineStart(); + interpolate(null, null, 1, listener); + listener.lineEnd(); + listener.polygonEnd(); + } + }; + function point(λ, φ) { + var point = rotate(λ, φ); + if (pointVisible(λ = point[0], φ = point[1])) listener.point(λ, φ); + } + function pointLine(λ, φ) { + var point = rotate(λ, φ); + line.point(point[0], point[1]); + } + function lineStart() { + clip.point = pointLine; + line.lineStart(); + } + function lineEnd() { + clip.point = point; + line.lineEnd(); + } + var segments; + var buffer = d3_geo_clipBufferListener(), ringListener = clipLine(buffer), polygonStarted = false, polygon, ring; + function pointRing(λ, φ) { + ring.push([ λ, φ ]); + var point = rotate(λ, φ); + ringListener.point(point[0], point[1]); + } + function ringStart() { + ringListener.lineStart(); + ring = []; + } + function ringEnd() { + pointRing(ring[0][0], ring[0][1]); + ringListener.lineEnd(); + var clean = ringListener.clean(), ringSegments = buffer.buffer(), segment, n = ringSegments.length; + ring.pop(); + polygon.push(ring); + ring = null; + if (!n) return; + if (clean & 1) { + segment = ringSegments[0]; + var n = segment.length - 1, i = -1, point; + if (n > 0) { + if (!polygonStarted) listener.polygonStart(), polygonStarted = true; + listener.lineStart(); + while (++i < n) listener.point((point = segment[i])[0], point[1]); + listener.lineEnd(); + } + return; + } + if (n > 1 && clean & 2) ringSegments.push(ringSegments.pop().concat(ringSegments.shift())); + segments.push(ringSegments.filter(d3_geo_clipSegmentLength1)); + } + return clip; + }; + } + function d3_geo_clipSegmentLength1(segment) { + return segment.length > 1; + } + function d3_geo_clipBufferListener() { + var lines = [], line; + return { + lineStart: function() { + lines.push(line = []); + }, + point: function(λ, φ) { + line.push([ λ, φ ]); + }, + lineEnd: d3_noop, + buffer: function() { + var buffer = lines; + lines = []; + line = null; + return buffer; + }, + rejoin: function() { + if (lines.length > 1) lines.push(lines.pop().concat(lines.shift())); + } + }; + } + function d3_geo_clipSort(a, b) { + return ((a = a.x)[0] < 0 ? a[1] - halfπ - ε : halfπ - a[1]) - ((b = b.x)[0] < 0 ? b[1] - halfπ - ε : halfπ - b[1]); + } + var d3_geo_clipAntimeridian = d3_geo_clip(d3_true, d3_geo_clipAntimeridianLine, d3_geo_clipAntimeridianInterpolate, [ -π, -π / 2 ]); + function d3_geo_clipAntimeridianLine(listener) { + var λ0 = NaN, φ0 = NaN, sλ0 = NaN, clean; + return { + lineStart: function() { + listener.lineStart(); + clean = 1; + }, + point: function(λ1, φ1) { + var sλ1 = λ1 > 0 ? π : -π, dλ = abs(λ1 - λ0); + if (abs(dλ - π) < ε) { + listener.point(λ0, φ0 = (φ0 + φ1) / 2 > 0 ? halfπ : -halfπ); + listener.point(sλ0, φ0); + listener.lineEnd(); + listener.lineStart(); + listener.point(sλ1, φ0); + listener.point(λ1, φ0); + clean = 0; + } else if (sλ0 !== sλ1 && dλ >= π) { + if (abs(λ0 - sλ0) < ε) λ0 -= sλ0 * ε; + if (abs(λ1 - sλ1) < ε) λ1 -= sλ1 * ε; + φ0 = d3_geo_clipAntimeridianIntersect(λ0, φ0, λ1, φ1); + listener.point(sλ0, φ0); + listener.lineEnd(); + listener.lineStart(); + listener.point(sλ1, φ0); + clean = 0; + } + listener.point(λ0 = λ1, φ0 = φ1); + sλ0 = sλ1; + }, + lineEnd: function() { + listener.lineEnd(); + λ0 = φ0 = NaN; + }, + clean: function() { + return 2 - clean; + } + }; + } + function d3_geo_clipAntimeridianIntersect(λ0, φ0, λ1, φ1) { + var cosφ0, cosφ1, sinλ0_λ1 = Math.sin(λ0 - λ1); + return abs(sinλ0_λ1) > ε ? Math.atan((Math.sin(φ0) * (cosφ1 = Math.cos(φ1)) * Math.sin(λ1) - Math.sin(φ1) * (cosφ0 = Math.cos(φ0)) * Math.sin(λ0)) / (cosφ0 * cosφ1 * sinλ0_λ1)) : (φ0 + φ1) / 2; + } + function d3_geo_clipAntimeridianInterpolate(from, to, direction, listener) { + var φ; + if (from == null) { + φ = direction * halfπ; + listener.point(-π, φ); + listener.point(0, φ); + listener.point(π, φ); + listener.point(π, 0); + listener.point(π, -φ); + listener.point(0, -φ); + listener.point(-π, -φ); + listener.point(-π, 0); + listener.point(-π, φ); + } else if (abs(from[0] - to[0]) > ε) { + var s = from[0] < to[0] ? π : -π; + φ = direction * s / 2; + listener.point(-s, φ); + listener.point(0, φ); + listener.point(s, φ); + } else { + listener.point(to[0], to[1]); + } + } + function d3_geo_pointInPolygon(point, polygon) { + var meridian = point[0], parallel = point[1], meridianNormal = [ Math.sin(meridian), -Math.cos(meridian), 0 ], polarAngle = 0, winding = 0; + d3_geo_areaRingSum.reset(); + for (var i = 0, n = polygon.length; i < n; ++i) { + var ring = polygon[i], m = ring.length; + if (!m) continue; + var point0 = ring[0], λ0 = point0[0], φ0 = point0[1] / 2 + π / 4, sinφ0 = Math.sin(φ0), cosφ0 = Math.cos(φ0), j = 1; + while (true) { + if (j === m) j = 0; + point = ring[j]; + var λ = point[0], φ = point[1] / 2 + π / 4, sinφ = Math.sin(φ), cosφ = Math.cos(φ), dλ = λ - λ0, sdλ = dλ >= 0 ? 1 : -1, adλ = sdλ * dλ, antimeridian = adλ > π, k = sinφ0 * sinφ; + d3_geo_areaRingSum.add(Math.atan2(k * sdλ * Math.sin(adλ), cosφ0 * cosφ + k * Math.cos(adλ))); + polarAngle += antimeridian ? dλ + sdλ * τ : dλ; + if (antimeridian ^ λ0 >= meridian ^ λ >= meridian) { + var arc = d3_geo_cartesianCross(d3_geo_cartesian(point0), d3_geo_cartesian(point)); + d3_geo_cartesianNormalize(arc); + var intersection = d3_geo_cartesianCross(meridianNormal, arc); + d3_geo_cartesianNormalize(intersection); + var φarc = (antimeridian ^ dλ >= 0 ? -1 : 1) * d3_asin(intersection[2]); + if (parallel > φarc || parallel === φarc && (arc[0] || arc[1])) { + winding += antimeridian ^ dλ >= 0 ? 1 : -1; + } + } + if (!j++) break; + λ0 = λ, sinφ0 = sinφ, cosφ0 = cosφ, point0 = point; + } + } + return (polarAngle < -ε || polarAngle < ε && d3_geo_areaRingSum < -ε) ^ winding & 1; + } + function d3_geo_clipCircle(radius) { + var cr = Math.cos(radius), smallRadius = cr > 0, notHemisphere = abs(cr) > ε, interpolate = d3_geo_circleInterpolate(radius, 6 * d3_radians); + return d3_geo_clip(visible, clipLine, interpolate, smallRadius ? [ 0, -radius ] : [ -π, radius - π ]); + function visible(λ, φ) { + return Math.cos(λ) * Math.cos(φ) > cr; + } + function clipLine(listener) { + var point0, c0, v0, v00, clean; + return { + lineStart: function() { + v00 = v0 = false; + clean = 1; + }, + point: function(λ, φ) { + var point1 = [ λ, φ ], point2, v = visible(λ, φ), c = smallRadius ? v ? 0 : code(λ, φ) : v ? code(λ + (λ < 0 ? π : -π), φ) : 0; + if (!point0 && (v00 = v0 = v)) listener.lineStart(); + if (v !== v0) { + point2 = intersect(point0, point1); + if (d3_geo_sphericalEqual(point0, point2) || d3_geo_sphericalEqual(point1, point2)) { + point1[0] += ε; + point1[1] += ε; + v = visible(point1[0], point1[1]); + } + } + if (v !== v0) { + clean = 0; + if (v) { + listener.lineStart(); + point2 = intersect(point1, point0); + listener.point(point2[0], point2[1]); + } else { + point2 = intersect(point0, point1); + listener.point(point2[0], point2[1]); + listener.lineEnd(); + } + point0 = point2; + } else if (notHemisphere && point0 && smallRadius ^ v) { + var t; + if (!(c & c0) && (t = intersect(point1, point0, true))) { + clean = 0; + if (smallRadius) { + listener.lineStart(); + listener.point(t[0][0], t[0][1]); + listener.point(t[1][0], t[1][1]); + listener.lineEnd(); + } else { + listener.point(t[1][0], t[1][1]); + listener.lineEnd(); + listener.lineStart(); + listener.point(t[0][0], t[0][1]); + } + } + } + if (v && (!point0 || !d3_geo_sphericalEqual(point0, point1))) { + listener.point(point1[0], point1[1]); + } + point0 = point1, v0 = v, c0 = c; + }, + lineEnd: function() { + if (v0) listener.lineEnd(); + point0 = null; + }, + clean: function() { + return clean | (v00 && v0) << 1; + } + }; + } + function intersect(a, b, two) { + var pa = d3_geo_cartesian(a), pb = d3_geo_cartesian(b); + var n1 = [ 1, 0, 0 ], n2 = d3_geo_cartesianCross(pa, pb), n2n2 = d3_geo_cartesianDot(n2, n2), n1n2 = n2[0], determinant = n2n2 - n1n2 * n1n2; + if (!determinant) return !two && a; + var c1 = cr * n2n2 / determinant, c2 = -cr * n1n2 / determinant, n1xn2 = d3_geo_cartesianCross(n1, n2), A = d3_geo_cartesianScale(n1, c1), B = d3_geo_cartesianScale(n2, c2); + d3_geo_cartesianAdd(A, B); + var u = n1xn2, w = d3_geo_cartesianDot(A, u), uu = d3_geo_cartesianDot(u, u), t2 = w * w - uu * (d3_geo_cartesianDot(A, A) - 1); + if (t2 < 0) return; + var t = Math.sqrt(t2), q = d3_geo_cartesianScale(u, (-w - t) / uu); + d3_geo_cartesianAdd(q, A); + q = d3_geo_spherical(q); + if (!two) return q; + var λ0 = a[0], λ1 = b[0], φ0 = a[1], φ1 = b[1], z; + if (λ1 < λ0) z = λ0, λ0 = λ1, λ1 = z; + var δλ = λ1 - λ0, polar = abs(δλ - π) < ε, meridian = polar || δλ < ε; + if (!polar && φ1 < φ0) z = φ0, φ0 = φ1, φ1 = z; + if (meridian ? polar ? φ0 + φ1 > 0 ^ q[1] < (abs(q[0] - λ0) < ε ? φ0 : φ1) : φ0 <= q[1] && q[1] <= φ1 : δλ > π ^ (λ0 <= q[0] && q[0] <= λ1)) { + var q1 = d3_geo_cartesianScale(u, (-w + t) / uu); + d3_geo_cartesianAdd(q1, A); + return [ q, d3_geo_spherical(q1) ]; + } + } + function code(λ, φ) { + var r = smallRadius ? radius : π - radius, code = 0; + if (λ < -r) code |= 1; else if (λ > r) code |= 2; + if (φ < -r) code |= 4; else if (φ > r) code |= 8; + return code; + } + } + function d3_geom_clipLine(x0, y0, x1, y1) { + return function(line) { + var a = line.a, b = line.b, ax = a.x, ay = a.y, bx = b.x, by = b.y, t0 = 0, t1 = 1, dx = bx - ax, dy = by - ay, r; + r = x0 - ax; + if (!dx && r > 0) return; + r /= dx; + if (dx < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dx > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + r = x1 - ax; + if (!dx && r < 0) return; + r /= dx; + if (dx < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dx > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + r = y0 - ay; + if (!dy && r > 0) return; + r /= dy; + if (dy < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dy > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + r = y1 - ay; + if (!dy && r < 0) return; + r /= dy; + if (dy < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dy > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + if (t0 > 0) line.a = { + x: ax + t0 * dx, + y: ay + t0 * dy + }; + if (t1 < 1) line.b = { + x: ax + t1 * dx, + y: ay + t1 * dy + }; + return line; + }; + } + var d3_geo_clipExtentMAX = 1e9; + d3.geo.clipExtent = function() { + var x0, y0, x1, y1, stream, clip, clipExtent = { + stream: function(output) { + if (stream) stream.valid = false; + stream = clip(output); + stream.valid = true; + return stream; + }, + extent: function(_) { + if (!arguments.length) return [ [ x0, y0 ], [ x1, y1 ] ]; + clip = d3_geo_clipExtent(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]); + if (stream) stream.valid = false, stream = null; + return clipExtent; + } + }; + return clipExtent.extent([ [ 0, 0 ], [ 960, 500 ] ]); + }; + function d3_geo_clipExtent(x0, y0, x1, y1) { + return function(listener) { + var listener_ = listener, bufferListener = d3_geo_clipBufferListener(), clipLine = d3_geom_clipLine(x0, y0, x1, y1), segments, polygon, ring; + var clip = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { + listener = bufferListener; + segments = []; + polygon = []; + clean = true; + }, + polygonEnd: function() { + listener = listener_; + segments = d3.merge(segments); + var clipStartInside = insidePolygon([ x0, y1 ]), inside = clean && clipStartInside, visible = segments.length; + if (inside || visible) { + listener.polygonStart(); + if (inside) { + listener.lineStart(); + interpolate(null, null, 1, listener); + listener.lineEnd(); + } + if (visible) { + d3_geo_clipPolygon(segments, compare, clipStartInside, interpolate, listener); + } + listener.polygonEnd(); + } + segments = polygon = ring = null; + } + }; + function insidePolygon(p) { + var wn = 0, n = polygon.length, y = p[1]; + for (var i = 0; i < n; ++i) { + for (var j = 1, v = polygon[i], m = v.length, a = v[0], b; j < m; ++j) { + b = v[j]; + if (a[1] <= y) { + if (b[1] > y && d3_cross2d(a, b, p) > 0) ++wn; + } else { + if (b[1] <= y && d3_cross2d(a, b, p) < 0) --wn; + } + a = b; + } + } + return wn !== 0; + } + function interpolate(from, to, direction, listener) { + var a = 0, a1 = 0; + if (from == null || (a = corner(from, direction)) !== (a1 = corner(to, direction)) || comparePoints(from, to) < 0 ^ direction > 0) { + do { + listener.point(a === 0 || a === 3 ? x0 : x1, a > 1 ? y1 : y0); + } while ((a = (a + direction + 4) % 4) !== a1); + } else { + listener.point(to[0], to[1]); + } + } + function pointVisible(x, y) { + return x0 <= x && x <= x1 && y0 <= y && y <= y1; + } + function point(x, y) { + if (pointVisible(x, y)) listener.point(x, y); + } + var x__, y__, v__, x_, y_, v_, first, clean; + function lineStart() { + clip.point = linePoint; + if (polygon) polygon.push(ring = []); + first = true; + v_ = false; + x_ = y_ = NaN; + } + function lineEnd() { + if (segments) { + linePoint(x__, y__); + if (v__ && v_) bufferListener.rejoin(); + segments.push(bufferListener.buffer()); + } + clip.point = point; + if (v_) listener.lineEnd(); + } + function linePoint(x, y) { + x = Math.max(-d3_geo_clipExtentMAX, Math.min(d3_geo_clipExtentMAX, x)); + y = Math.max(-d3_geo_clipExtentMAX, Math.min(d3_geo_clipExtentMAX, y)); + var v = pointVisible(x, y); + if (polygon) ring.push([ x, y ]); + if (first) { + x__ = x, y__ = y, v__ = v; + first = false; + if (v) { + listener.lineStart(); + listener.point(x, y); + } + } else { + if (v && v_) listener.point(x, y); else { + var l = { + a: { + x: x_, + y: y_ + }, + b: { + x: x, + y: y + } + }; + if (clipLine(l)) { + if (!v_) { + listener.lineStart(); + listener.point(l.a.x, l.a.y); + } + listener.point(l.b.x, l.b.y); + if (!v) listener.lineEnd(); + clean = false; + } else if (v) { + listener.lineStart(); + listener.point(x, y); + clean = false; + } + } + } + x_ = x, y_ = y, v_ = v; + } + return clip; + }; + function corner(p, direction) { + return abs(p[0] - x0) < ε ? direction > 0 ? 0 : 3 : abs(p[0] - x1) < ε ? direction > 0 ? 2 : 1 : abs(p[1] - y0) < ε ? direction > 0 ? 1 : 0 : direction > 0 ? 3 : 2; + } + function compare(a, b) { + return comparePoints(a.x, b.x); + } + function comparePoints(a, b) { + var ca = corner(a, 1), cb = corner(b, 1); + return ca !== cb ? ca - cb : ca === 0 ? b[1] - a[1] : ca === 1 ? a[0] - b[0] : ca === 2 ? a[1] - b[1] : b[0] - a[0]; + } + } + function d3_geo_conic(projectAt) { + var φ0 = 0, φ1 = π / 3, m = d3_geo_projectionMutator(projectAt), p = m(φ0, φ1); + p.parallels = function(_) { + if (!arguments.length) return [ φ0 / π * 180, φ1 / π * 180 ]; + return m(φ0 = _[0] * π / 180, φ1 = _[1] * π / 180); + }; + return p; + } + function d3_geo_conicEqualArea(φ0, φ1) { + var sinφ0 = Math.sin(φ0), n = (sinφ0 + Math.sin(φ1)) / 2, C = 1 + sinφ0 * (2 * n - sinφ0), ρ0 = Math.sqrt(C) / n; + function forward(λ, φ) { + var ρ = Math.sqrt(C - 2 * n * Math.sin(φ)) / n; + return [ ρ * Math.sin(λ *= n), ρ0 - ρ * Math.cos(λ) ]; + } + forward.invert = function(x, y) { + var ρ0_y = ρ0 - y; + return [ Math.atan2(x, ρ0_y) / n, d3_asin((C - (x * x + ρ0_y * ρ0_y) * n * n) / (2 * n)) ]; + }; + return forward; + } + (d3.geo.conicEqualArea = function() { + return d3_geo_conic(d3_geo_conicEqualArea); + }).raw = d3_geo_conicEqualArea; + d3.geo.albers = function() { + return d3.geo.conicEqualArea().rotate([ 96, 0 ]).center([ -.6, 38.7 ]).parallels([ 29.5, 45.5 ]).scale(1070); + }; + d3.geo.albersUsa = function() { + var lower48 = d3.geo.albers(); + var alaska = d3.geo.conicEqualArea().rotate([ 154, 0 ]).center([ -2, 58.5 ]).parallels([ 55, 65 ]); + var hawaii = d3.geo.conicEqualArea().rotate([ 157, 0 ]).center([ -3, 19.9 ]).parallels([ 8, 18 ]); + var point, pointStream = { + point: function(x, y) { + point = [ x, y ]; + } + }, lower48Point, alaskaPoint, hawaiiPoint; + function albersUsa(coordinates) { + var x = coordinates[0], y = coordinates[1]; + point = null; + (lower48Point(x, y), point) || (alaskaPoint(x, y), point) || hawaiiPoint(x, y); + return point; + } + albersUsa.invert = function(coordinates) { + var k = lower48.scale(), t = lower48.translate(), x = (coordinates[0] - t[0]) / k, y = (coordinates[1] - t[1]) / k; + return (y >= .12 && y < .234 && x >= -.425 && x < -.214 ? alaska : y >= .166 && y < .234 && x >= -.214 && x < -.115 ? hawaii : lower48).invert(coordinates); + }; + albersUsa.stream = function(stream) { + var lower48Stream = lower48.stream(stream), alaskaStream = alaska.stream(stream), hawaiiStream = hawaii.stream(stream); + return { + point: function(x, y) { + lower48Stream.point(x, y); + alaskaStream.point(x, y); + hawaiiStream.point(x, y); + }, + sphere: function() { + lower48Stream.sphere(); + alaskaStream.sphere(); + hawaiiStream.sphere(); + }, + lineStart: function() { + lower48Stream.lineStart(); + alaskaStream.lineStart(); + hawaiiStream.lineStart(); + }, + lineEnd: function() { + lower48Stream.lineEnd(); + alaskaStream.lineEnd(); + hawaiiStream.lineEnd(); + }, + polygonStart: function() { + lower48Stream.polygonStart(); + alaskaStream.polygonStart(); + hawaiiStream.polygonStart(); + }, + polygonEnd: function() { + lower48Stream.polygonEnd(); + alaskaStream.polygonEnd(); + hawaiiStream.polygonEnd(); + } + }; + }; + albersUsa.precision = function(_) { + if (!arguments.length) return lower48.precision(); + lower48.precision(_); + alaska.precision(_); + hawaii.precision(_); + return albersUsa; + }; + albersUsa.scale = function(_) { + if (!arguments.length) return lower48.scale(); + lower48.scale(_); + alaska.scale(_ * .35); + hawaii.scale(_); + return albersUsa.translate(lower48.translate()); + }; + albersUsa.translate = function(_) { + if (!arguments.length) return lower48.translate(); + var k = lower48.scale(), x = +_[0], y = +_[1]; + lower48Point = lower48.translate(_).clipExtent([ [ x - .455 * k, y - .238 * k ], [ x + .455 * k, y + .238 * k ] ]).stream(pointStream).point; + alaskaPoint = alaska.translate([ x - .307 * k, y + .201 * k ]).clipExtent([ [ x - .425 * k + ε, y + .12 * k + ε ], [ x - .214 * k - ε, y + .234 * k - ε ] ]).stream(pointStream).point; + hawaiiPoint = hawaii.translate([ x - .205 * k, y + .212 * k ]).clipExtent([ [ x - .214 * k + ε, y + .166 * k + ε ], [ x - .115 * k - ε, y + .234 * k - ε ] ]).stream(pointStream).point; + return albersUsa; + }; + return albersUsa.scale(1070); + }; + var d3_geo_pathAreaSum, d3_geo_pathAreaPolygon, d3_geo_pathArea = { + point: d3_noop, + lineStart: d3_noop, + lineEnd: d3_noop, + polygonStart: function() { + d3_geo_pathAreaPolygon = 0; + d3_geo_pathArea.lineStart = d3_geo_pathAreaRingStart; + }, + polygonEnd: function() { + d3_geo_pathArea.lineStart = d3_geo_pathArea.lineEnd = d3_geo_pathArea.point = d3_noop; + d3_geo_pathAreaSum += abs(d3_geo_pathAreaPolygon / 2); + } + }; + function d3_geo_pathAreaRingStart() { + var x00, y00, x0, y0; + d3_geo_pathArea.point = function(x, y) { + d3_geo_pathArea.point = nextPoint; + x00 = x0 = x, y00 = y0 = y; + }; + function nextPoint(x, y) { + d3_geo_pathAreaPolygon += y0 * x - x0 * y; + x0 = x, y0 = y; + } + d3_geo_pathArea.lineEnd = function() { + nextPoint(x00, y00); + }; + } + var d3_geo_pathBoundsX0, d3_geo_pathBoundsY0, d3_geo_pathBoundsX1, d3_geo_pathBoundsY1; + var d3_geo_pathBounds = { + point: d3_geo_pathBoundsPoint, + lineStart: d3_noop, + lineEnd: d3_noop, + polygonStart: d3_noop, + polygonEnd: d3_noop + }; + function d3_geo_pathBoundsPoint(x, y) { + if (x < d3_geo_pathBoundsX0) d3_geo_pathBoundsX0 = x; + if (x > d3_geo_pathBoundsX1) d3_geo_pathBoundsX1 = x; + if (y < d3_geo_pathBoundsY0) d3_geo_pathBoundsY0 = y; + if (y > d3_geo_pathBoundsY1) d3_geo_pathBoundsY1 = y; + } + function d3_geo_pathBuffer() { + var pointCircle = d3_geo_pathBufferCircle(4.5), buffer = []; + var stream = { + point: point, + lineStart: function() { + stream.point = pointLineStart; + }, + lineEnd: lineEnd, + polygonStart: function() { + stream.lineEnd = lineEndPolygon; + }, + polygonEnd: function() { + stream.lineEnd = lineEnd; + stream.point = point; + }, + pointRadius: function(_) { + pointCircle = d3_geo_pathBufferCircle(_); + return stream; + }, + result: function() { + if (buffer.length) { + var result = buffer.join(""); + buffer = []; + return result; + } + } + }; + function point(x, y) { + buffer.push("M", x, ",", y, pointCircle); + } + function pointLineStart(x, y) { + buffer.push("M", x, ",", y); + stream.point = pointLine; + } + function pointLine(x, y) { + buffer.push("L", x, ",", y); + } + function lineEnd() { + stream.point = point; + } + function lineEndPolygon() { + buffer.push("Z"); + } + return stream; + } + function d3_geo_pathBufferCircle(radius) { + return "m0," + radius + "a" + radius + "," + radius + " 0 1,1 0," + -2 * radius + "a" + radius + "," + radius + " 0 1,1 0," + 2 * radius + "z"; + } + var d3_geo_pathCentroid = { + point: d3_geo_pathCentroidPoint, + lineStart: d3_geo_pathCentroidLineStart, + lineEnd: d3_geo_pathCentroidLineEnd, + polygonStart: function() { + d3_geo_pathCentroid.lineStart = d3_geo_pathCentroidRingStart; + }, + polygonEnd: function() { + d3_geo_pathCentroid.point = d3_geo_pathCentroidPoint; + d3_geo_pathCentroid.lineStart = d3_geo_pathCentroidLineStart; + d3_geo_pathCentroid.lineEnd = d3_geo_pathCentroidLineEnd; + } + }; + function d3_geo_pathCentroidPoint(x, y) { + d3_geo_centroidX0 += x; + d3_geo_centroidY0 += y; + ++d3_geo_centroidZ0; + } + function d3_geo_pathCentroidLineStart() { + var x0, y0; + d3_geo_pathCentroid.point = function(x, y) { + d3_geo_pathCentroid.point = nextPoint; + d3_geo_pathCentroidPoint(x0 = x, y0 = y); + }; + function nextPoint(x, y) { + var dx = x - x0, dy = y - y0, z = Math.sqrt(dx * dx + dy * dy); + d3_geo_centroidX1 += z * (x0 + x) / 2; + d3_geo_centroidY1 += z * (y0 + y) / 2; + d3_geo_centroidZ1 += z; + d3_geo_pathCentroidPoint(x0 = x, y0 = y); + } + } + function d3_geo_pathCentroidLineEnd() { + d3_geo_pathCentroid.point = d3_geo_pathCentroidPoint; + } + function d3_geo_pathCentroidRingStart() { + var x00, y00, x0, y0; + d3_geo_pathCentroid.point = function(x, y) { + d3_geo_pathCentroid.point = nextPoint; + d3_geo_pathCentroidPoint(x00 = x0 = x, y00 = y0 = y); + }; + function nextPoint(x, y) { + var dx = x - x0, dy = y - y0, z = Math.sqrt(dx * dx + dy * dy); + d3_geo_centroidX1 += z * (x0 + x) / 2; + d3_geo_centroidY1 += z * (y0 + y) / 2; + d3_geo_centroidZ1 += z; + z = y0 * x - x0 * y; + d3_geo_centroidX2 += z * (x0 + x); + d3_geo_centroidY2 += z * (y0 + y); + d3_geo_centroidZ2 += z * 3; + d3_geo_pathCentroidPoint(x0 = x, y0 = y); + } + d3_geo_pathCentroid.lineEnd = function() { + nextPoint(x00, y00); + }; + } + function d3_geo_pathContext(context) { + var pointRadius = 4.5; + var stream = { + point: point, + lineStart: function() { + stream.point = pointLineStart; + }, + lineEnd: lineEnd, + polygonStart: function() { + stream.lineEnd = lineEndPolygon; + }, + polygonEnd: function() { + stream.lineEnd = lineEnd; + stream.point = point; + }, + pointRadius: function(_) { + pointRadius = _; + return stream; + }, + result: d3_noop + }; + function point(x, y) { + context.moveTo(x + pointRadius, y); + context.arc(x, y, pointRadius, 0, τ); + } + function pointLineStart(x, y) { + context.moveTo(x, y); + stream.point = pointLine; + } + function pointLine(x, y) { + context.lineTo(x, y); + } + function lineEnd() { + stream.point = point; + } + function lineEndPolygon() { + context.closePath(); + } + return stream; + } + function d3_geo_resample(project) { + var δ2 = .5, cosMinDistance = Math.cos(30 * d3_radians), maxDepth = 16; + function resample(stream) { + return (maxDepth ? resampleRecursive : resampleNone)(stream); + } + function resampleNone(stream) { + return d3_geo_transformPoint(stream, function(x, y) { + x = project(x, y); + stream.point(x[0], x[1]); + }); + } + function resampleRecursive(stream) { + var λ00, φ00, x00, y00, a00, b00, c00, λ0, x0, y0, a0, b0, c0; + var resample = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { + stream.polygonStart(); + resample.lineStart = ringStart; + }, + polygonEnd: function() { + stream.polygonEnd(); + resample.lineStart = lineStart; + } + }; + function point(x, y) { + x = project(x, y); + stream.point(x[0], x[1]); + } + function lineStart() { + x0 = NaN; + resample.point = linePoint; + stream.lineStart(); + } + function linePoint(λ, φ) { + var c = d3_geo_cartesian([ λ, φ ]), p = project(λ, φ); + resampleLineTo(x0, y0, λ0, a0, b0, c0, x0 = p[0], y0 = p[1], λ0 = λ, a0 = c[0], b0 = c[1], c0 = c[2], maxDepth, stream); + stream.point(x0, y0); + } + function lineEnd() { + resample.point = point; + stream.lineEnd(); + } + function ringStart() { + lineStart(); + resample.point = ringPoint; + resample.lineEnd = ringEnd; + } + function ringPoint(λ, φ) { + linePoint(λ00 = λ, φ00 = φ), x00 = x0, y00 = y0, a00 = a0, b00 = b0, c00 = c0; + resample.point = linePoint; + } + function ringEnd() { + resampleLineTo(x0, y0, λ0, a0, b0, c0, x00, y00, λ00, a00, b00, c00, maxDepth, stream); + resample.lineEnd = lineEnd; + lineEnd(); + } + return resample; + } + function resampleLineTo(x0, y0, λ0, a0, b0, c0, x1, y1, λ1, a1, b1, c1, depth, stream) { + var dx = x1 - x0, dy = y1 - y0, d2 = dx * dx + dy * dy; + if (d2 > 4 * δ2 && depth--) { + var a = a0 + a1, b = b0 + b1, c = c0 + c1, m = Math.sqrt(a * a + b * b + c * c), φ2 = Math.asin(c /= m), λ2 = abs(abs(c) - 1) < ε || abs(λ0 - λ1) < ε ? (λ0 + λ1) / 2 : Math.atan2(b, a), p = project(λ2, φ2), x2 = p[0], y2 = p[1], dx2 = x2 - x0, dy2 = y2 - y0, dz = dy * dx2 - dx * dy2; + if (dz * dz / d2 > δ2 || abs((dx * dx2 + dy * dy2) / d2 - .5) > .3 || a0 * a1 + b0 * b1 + c0 * c1 < cosMinDistance) { + resampleLineTo(x0, y0, λ0, a0, b0, c0, x2, y2, λ2, a /= m, b /= m, c, depth, stream); + stream.point(x2, y2); + resampleLineTo(x2, y2, λ2, a, b, c, x1, y1, λ1, a1, b1, c1, depth, stream); + } + } + } + resample.precision = function(_) { + if (!arguments.length) return Math.sqrt(δ2); + maxDepth = (δ2 = _ * _) > 0 && 16; + return resample; + }; + return resample; + } + d3.geo.path = function() { + var pointRadius = 4.5, projection, context, projectStream, contextStream, cacheStream; + function path(object) { + if (object) { + if (typeof pointRadius === "function") contextStream.pointRadius(+pointRadius.apply(this, arguments)); + if (!cacheStream || !cacheStream.valid) cacheStream = projectStream(contextStream); + d3.geo.stream(object, cacheStream); + } + return contextStream.result(); + } + path.area = function(object) { + d3_geo_pathAreaSum = 0; + d3.geo.stream(object, projectStream(d3_geo_pathArea)); + return d3_geo_pathAreaSum; + }; + path.centroid = function(object) { + d3_geo_centroidX0 = d3_geo_centroidY0 = d3_geo_centroidZ0 = d3_geo_centroidX1 = d3_geo_centroidY1 = d3_geo_centroidZ1 = d3_geo_centroidX2 = d3_geo_centroidY2 = d3_geo_centroidZ2 = 0; + d3.geo.stream(object, projectStream(d3_geo_pathCentroid)); + return d3_geo_centroidZ2 ? [ d3_geo_centroidX2 / d3_geo_centroidZ2, d3_geo_centroidY2 / d3_geo_centroidZ2 ] : d3_geo_centroidZ1 ? [ d3_geo_centroidX1 / d3_geo_centroidZ1, d3_geo_centroidY1 / d3_geo_centroidZ1 ] : d3_geo_centroidZ0 ? [ d3_geo_centroidX0 / d3_geo_centroidZ0, d3_geo_centroidY0 / d3_geo_centroidZ0 ] : [ NaN, NaN ]; + }; + path.bounds = function(object) { + d3_geo_pathBoundsX1 = d3_geo_pathBoundsY1 = -(d3_geo_pathBoundsX0 = d3_geo_pathBoundsY0 = Infinity); + d3.geo.stream(object, projectStream(d3_geo_pathBounds)); + return [ [ d3_geo_pathBoundsX0, d3_geo_pathBoundsY0 ], [ d3_geo_pathBoundsX1, d3_geo_pathBoundsY1 ] ]; + }; + path.projection = function(_) { + if (!arguments.length) return projection; + projectStream = (projection = _) ? _.stream || d3_geo_pathProjectStream(_) : d3_identity; + return reset(); + }; + path.context = function(_) { + if (!arguments.length) return context; + contextStream = (context = _) == null ? new d3_geo_pathBuffer() : new d3_geo_pathContext(_); + if (typeof pointRadius !== "function") contextStream.pointRadius(pointRadius); + return reset(); + }; + path.pointRadius = function(_) { + if (!arguments.length) return pointRadius; + pointRadius = typeof _ === "function" ? _ : (contextStream.pointRadius(+_), +_); + return path; + }; + function reset() { + cacheStream = null; + return path; + } + return path.projection(d3.geo.albersUsa()).context(null); + }; + function d3_geo_pathProjectStream(project) { + var resample = d3_geo_resample(function(x, y) { + return project([ x * d3_degrees, y * d3_degrees ]); + }); + return function(stream) { + return d3_geo_projectionRadians(resample(stream)); + }; + } + d3.geo.transform = function(methods) { + return { + stream: function(stream) { + var transform = new d3_geo_transform(stream); + for (var k in methods) transform[k] = methods[k]; + return transform; + } + }; + }; + function d3_geo_transform(stream) { + this.stream = stream; + } + d3_geo_transform.prototype = { + point: function(x, y) { + this.stream.point(x, y); + }, + sphere: function() { + this.stream.sphere(); + }, + lineStart: function() { + this.stream.lineStart(); + }, + lineEnd: function() { + this.stream.lineEnd(); + }, + polygonStart: function() { + this.stream.polygonStart(); + }, + polygonEnd: function() { + this.stream.polygonEnd(); + } + }; + function d3_geo_transformPoint(stream, point) { + return { + point: point, + sphere: function() { + stream.sphere(); + }, + lineStart: function() { + stream.lineStart(); + }, + lineEnd: function() { + stream.lineEnd(); + }, + polygonStart: function() { + stream.polygonStart(); + }, + polygonEnd: function() { + stream.polygonEnd(); + } + }; + } + d3.geo.projection = d3_geo_projection; + d3.geo.projectionMutator = d3_geo_projectionMutator; + function d3_geo_projection(project) { + return d3_geo_projectionMutator(function() { + return project; + })(); + } + function d3_geo_projectionMutator(projectAt) { + var project, rotate, projectRotate, projectResample = d3_geo_resample(function(x, y) { + x = project(x, y); + return [ x[0] * k + δx, δy - x[1] * k ]; + }), k = 150, x = 480, y = 250, λ = 0, φ = 0, δλ = 0, δφ = 0, δγ = 0, δx, δy, preclip = d3_geo_clipAntimeridian, postclip = d3_identity, clipAngle = null, clipExtent = null, stream; + function projection(point) { + point = projectRotate(point[0] * d3_radians, point[1] * d3_radians); + return [ point[0] * k + δx, δy - point[1] * k ]; + } + function invert(point) { + point = projectRotate.invert((point[0] - δx) / k, (δy - point[1]) / k); + return point && [ point[0] * d3_degrees, point[1] * d3_degrees ]; + } + projection.stream = function(output) { + if (stream) stream.valid = false; + stream = d3_geo_projectionRadians(preclip(rotate, projectResample(postclip(output)))); + stream.valid = true; + return stream; + }; + projection.clipAngle = function(_) { + if (!arguments.length) return clipAngle; + preclip = _ == null ? (clipAngle = _, d3_geo_clipAntimeridian) : d3_geo_clipCircle((clipAngle = +_) * d3_radians); + return invalidate(); + }; + projection.clipExtent = function(_) { + if (!arguments.length) return clipExtent; + clipExtent = _; + postclip = _ ? d3_geo_clipExtent(_[0][0], _[0][1], _[1][0], _[1][1]) : d3_identity; + return invalidate(); + }; + projection.scale = function(_) { + if (!arguments.length) return k; + k = +_; + return reset(); + }; + projection.translate = function(_) { + if (!arguments.length) return [ x, y ]; + x = +_[0]; + y = +_[1]; + return reset(); + }; + projection.center = function(_) { + if (!arguments.length) return [ λ * d3_degrees, φ * d3_degrees ]; + λ = _[0] % 360 * d3_radians; + φ = _[1] % 360 * d3_radians; + return reset(); + }; + projection.rotate = function(_) { + if (!arguments.length) return [ δλ * d3_degrees, δφ * d3_degrees, δγ * d3_degrees ]; + δλ = _[0] % 360 * d3_radians; + δφ = _[1] % 360 * d3_radians; + δγ = _.length > 2 ? _[2] % 360 * d3_radians : 0; + return reset(); + }; + d3.rebind(projection, projectResample, "precision"); + function reset() { + projectRotate = d3_geo_compose(rotate = d3_geo_rotation(δλ, δφ, δγ), project); + var center = project(λ, φ); + δx = x - center[0] * k; + δy = y + center[1] * k; + return invalidate(); + } + function invalidate() { + if (stream) stream.valid = false, stream = null; + return projection; + } + return function() { + project = projectAt.apply(this, arguments); + projection.invert = project.invert && invert; + return reset(); + }; + } + function d3_geo_projectionRadians(stream) { + return d3_geo_transformPoint(stream, function(x, y) { + stream.point(x * d3_radians, y * d3_radians); + }); + } + function d3_geo_equirectangular(λ, φ) { + return [ λ, φ ]; + } + (d3.geo.equirectangular = function() { + return d3_geo_projection(d3_geo_equirectangular); + }).raw = d3_geo_equirectangular.invert = d3_geo_equirectangular; + d3.geo.rotation = function(rotate) { + rotate = d3_geo_rotation(rotate[0] % 360 * d3_radians, rotate[1] * d3_radians, rotate.length > 2 ? rotate[2] * d3_radians : 0); + function forward(coordinates) { + coordinates = rotate(coordinates[0] * d3_radians, coordinates[1] * d3_radians); + return coordinates[0] *= d3_degrees, coordinates[1] *= d3_degrees, coordinates; + } + forward.invert = function(coordinates) { + coordinates = rotate.invert(coordinates[0] * d3_radians, coordinates[1] * d3_radians); + return coordinates[0] *= d3_degrees, coordinates[1] *= d3_degrees, coordinates; + }; + return forward; + }; + function d3_geo_identityRotation(λ, φ) { + return [ λ > π ? λ - τ : λ < -π ? λ + τ : λ, φ ]; + } + d3_geo_identityRotation.invert = d3_geo_equirectangular; + function d3_geo_rotation(δλ, δφ, δγ) { + return δλ ? δφ || δγ ? d3_geo_compose(d3_geo_rotationλ(δλ), d3_geo_rotationφγ(δφ, δγ)) : d3_geo_rotationλ(δλ) : δφ || δγ ? d3_geo_rotationφγ(δφ, δγ) : d3_geo_identityRotation; + } + function d3_geo_forwardRotationλ(δλ) { + return function(λ, φ) { + return λ += δλ, [ λ > π ? λ - τ : λ < -π ? λ + τ : λ, φ ]; + }; + } + function d3_geo_rotationλ(δλ) { + var rotation = d3_geo_forwardRotationλ(δλ); + rotation.invert = d3_geo_forwardRotationλ(-δλ); + return rotation; + } + function d3_geo_rotationφγ(δφ, δγ) { + var cosδφ = Math.cos(δφ), sinδφ = Math.sin(δφ), cosδγ = Math.cos(δγ), sinδγ = Math.sin(δγ); + function rotation(λ, φ) { + var cosφ = Math.cos(φ), x = Math.cos(λ) * cosφ, y = Math.sin(λ) * cosφ, z = Math.sin(φ), k = z * cosδφ + x * sinδφ; + return [ Math.atan2(y * cosδγ - k * sinδγ, x * cosδφ - z * sinδφ), d3_asin(k * cosδγ + y * sinδγ) ]; + } + rotation.invert = function(λ, φ) { + var cosφ = Math.cos(φ), x = Math.cos(λ) * cosφ, y = Math.sin(λ) * cosφ, z = Math.sin(φ), k = z * cosδγ - y * sinδγ; + return [ Math.atan2(y * cosδγ + z * sinδγ, x * cosδφ + k * sinδφ), d3_asin(k * cosδφ - x * sinδφ) ]; + }; + return rotation; + } + d3.geo.circle = function() { + var origin = [ 0, 0 ], angle, precision = 6, interpolate; + function circle() { + var center = typeof origin === "function" ? origin.apply(this, arguments) : origin, rotate = d3_geo_rotation(-center[0] * d3_radians, -center[1] * d3_radians, 0).invert, ring = []; + interpolate(null, null, 1, { + point: function(x, y) { + ring.push(x = rotate(x, y)); + x[0] *= d3_degrees, x[1] *= d3_degrees; + } + }); + return { + type: "Polygon", + coordinates: [ ring ] + }; + } + circle.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + return circle; + }; + circle.angle = function(x) { + if (!arguments.length) return angle; + interpolate = d3_geo_circleInterpolate((angle = +x) * d3_radians, precision * d3_radians); + return circle; + }; + circle.precision = function(_) { + if (!arguments.length) return precision; + interpolate = d3_geo_circleInterpolate(angle * d3_radians, (precision = +_) * d3_radians); + return circle; + }; + return circle.angle(90); + }; + function d3_geo_circleInterpolate(radius, precision) { + var cr = Math.cos(radius), sr = Math.sin(radius); + return function(from, to, direction, listener) { + var step = direction * precision; + if (from != null) { + from = d3_geo_circleAngle(cr, from); + to = d3_geo_circleAngle(cr, to); + if (direction > 0 ? from < to : from > to) from += direction * τ; + } else { + from = radius + direction * τ; + to = radius - .5 * step; + } + for (var point, t = from; direction > 0 ? t > to : t < to; t -= step) { + listener.point((point = d3_geo_spherical([ cr, -sr * Math.cos(t), -sr * Math.sin(t) ]))[0], point[1]); + } + }; + } + function d3_geo_circleAngle(cr, point) { + var a = d3_geo_cartesian(point); + a[0] -= cr; + d3_geo_cartesianNormalize(a); + var angle = d3_acos(-a[1]); + return ((-a[2] < 0 ? -angle : angle) + 2 * Math.PI - ε) % (2 * Math.PI); + } + d3.geo.distance = function(a, b) { + var Δλ = (b[0] - a[0]) * d3_radians, φ0 = a[1] * d3_radians, φ1 = b[1] * d3_radians, sinΔλ = Math.sin(Δλ), cosΔλ = Math.cos(Δλ), sinφ0 = Math.sin(φ0), cosφ0 = Math.cos(φ0), sinφ1 = Math.sin(φ1), cosφ1 = Math.cos(φ1), t; + return Math.atan2(Math.sqrt((t = cosφ1 * sinΔλ) * t + (t = cosφ0 * sinφ1 - sinφ0 * cosφ1 * cosΔλ) * t), sinφ0 * sinφ1 + cosφ0 * cosφ1 * cosΔλ); + }; + d3.geo.graticule = function() { + var x1, x0, X1, X0, y1, y0, Y1, Y0, dx = 10, dy = dx, DX = 90, DY = 360, x, y, X, Y, precision = 2.5; + function graticule() { + return { + type: "MultiLineString", + coordinates: lines() + }; + } + function lines() { + return d3.range(Math.ceil(X0 / DX) * DX, X1, DX).map(X).concat(d3.range(Math.ceil(Y0 / DY) * DY, Y1, DY).map(Y)).concat(d3.range(Math.ceil(x0 / dx) * dx, x1, dx).filter(function(x) { + return abs(x % DX) > ε; + }).map(x)).concat(d3.range(Math.ceil(y0 / dy) * dy, y1, dy).filter(function(y) { + return abs(y % DY) > ε; + }).map(y)); + } + graticule.lines = function() { + return lines().map(function(coordinates) { + return { + type: "LineString", + coordinates: coordinates + }; + }); + }; + graticule.outline = function() { + return { + type: "Polygon", + coordinates: [ X(X0).concat(Y(Y1).slice(1), X(X1).reverse().slice(1), Y(Y0).reverse().slice(1)) ] + }; + }; + graticule.extent = function(_) { + if (!arguments.length) return graticule.minorExtent(); + return graticule.majorExtent(_).minorExtent(_); + }; + graticule.majorExtent = function(_) { + if (!arguments.length) return [ [ X0, Y0 ], [ X1, Y1 ] ]; + X0 = +_[0][0], X1 = +_[1][0]; + Y0 = +_[0][1], Y1 = +_[1][1]; + if (X0 > X1) _ = X0, X0 = X1, X1 = _; + if (Y0 > Y1) _ = Y0, Y0 = Y1, Y1 = _; + return graticule.precision(precision); + }; + graticule.minorExtent = function(_) { + if (!arguments.length) return [ [ x0, y0 ], [ x1, y1 ] ]; + x0 = +_[0][0], x1 = +_[1][0]; + y0 = +_[0][1], y1 = +_[1][1]; + if (x0 > x1) _ = x0, x0 = x1, x1 = _; + if (y0 > y1) _ = y0, y0 = y1, y1 = _; + return graticule.precision(precision); + }; + graticule.step = function(_) { + if (!arguments.length) return graticule.minorStep(); + return graticule.majorStep(_).minorStep(_); + }; + graticule.majorStep = function(_) { + if (!arguments.length) return [ DX, DY ]; + DX = +_[0], DY = +_[1]; + return graticule; + }; + graticule.minorStep = function(_) { + if (!arguments.length) return [ dx, dy ]; + dx = +_[0], dy = +_[1]; + return graticule; + }; + graticule.precision = function(_) { + if (!arguments.length) return precision; + precision = +_; + x = d3_geo_graticuleX(y0, y1, 90); + y = d3_geo_graticuleY(x0, x1, precision); + X = d3_geo_graticuleX(Y0, Y1, 90); + Y = d3_geo_graticuleY(X0, X1, precision); + return graticule; + }; + return graticule.majorExtent([ [ -180, -90 + ε ], [ 180, 90 - ε ] ]).minorExtent([ [ -180, -80 - ε ], [ 180, 80 + ε ] ]); + }; + function d3_geo_graticuleX(y0, y1, dy) { + var y = d3.range(y0, y1 - ε, dy).concat(y1); + return function(x) { + return y.map(function(y) { + return [ x, y ]; + }); + }; + } + function d3_geo_graticuleY(x0, x1, dx) { + var x = d3.range(x0, x1 - ε, dx).concat(x1); + return function(y) { + return x.map(function(x) { + return [ x, y ]; + }); + }; + } + function d3_source(d) { + return d.source; + } + function d3_target(d) { + return d.target; + } + d3.geo.greatArc = function() { + var source = d3_source, source_, target = d3_target, target_; + function greatArc() { + return { + type: "LineString", + coordinates: [ source_ || source.apply(this, arguments), target_ || target.apply(this, arguments) ] + }; + } + greatArc.distance = function() { + return d3.geo.distance(source_ || source.apply(this, arguments), target_ || target.apply(this, arguments)); + }; + greatArc.source = function(_) { + if (!arguments.length) return source; + source = _, source_ = typeof _ === "function" ? null : _; + return greatArc; + }; + greatArc.target = function(_) { + if (!arguments.length) return target; + target = _, target_ = typeof _ === "function" ? null : _; + return greatArc; + }; + greatArc.precision = function() { + return arguments.length ? greatArc : 0; + }; + return greatArc; + }; + d3.geo.interpolate = function(source, target) { + return d3_geo_interpolate(source[0] * d3_radians, source[1] * d3_radians, target[0] * d3_radians, target[1] * d3_radians); + }; + function d3_geo_interpolate(x0, y0, x1, y1) { + var cy0 = Math.cos(y0), sy0 = Math.sin(y0), cy1 = Math.cos(y1), sy1 = Math.sin(y1), kx0 = cy0 * Math.cos(x0), ky0 = cy0 * Math.sin(x0), kx1 = cy1 * Math.cos(x1), ky1 = cy1 * Math.sin(x1), d = 2 * Math.asin(Math.sqrt(d3_haversin(y1 - y0) + cy0 * cy1 * d3_haversin(x1 - x0))), k = 1 / Math.sin(d); + var interpolate = d ? function(t) { + var B = Math.sin(t *= d) * k, A = Math.sin(d - t) * k, x = A * kx0 + B * kx1, y = A * ky0 + B * ky1, z = A * sy0 + B * sy1; + return [ Math.atan2(y, x) * d3_degrees, Math.atan2(z, Math.sqrt(x * x + y * y)) * d3_degrees ]; + } : function() { + return [ x0 * d3_degrees, y0 * d3_degrees ]; + }; + interpolate.distance = d; + return interpolate; + } + d3.geo.length = function(object) { + d3_geo_lengthSum = 0; + d3.geo.stream(object, d3_geo_length); + return d3_geo_lengthSum; + }; + var d3_geo_lengthSum; + var d3_geo_length = { + sphere: d3_noop, + point: d3_noop, + lineStart: d3_geo_lengthLineStart, + lineEnd: d3_noop, + polygonStart: d3_noop, + polygonEnd: d3_noop + }; + function d3_geo_lengthLineStart() { + var λ0, sinφ0, cosφ0; + d3_geo_length.point = function(λ, φ) { + λ0 = λ * d3_radians, sinφ0 = Math.sin(φ *= d3_radians), cosφ0 = Math.cos(φ); + d3_geo_length.point = nextPoint; + }; + d3_geo_length.lineEnd = function() { + d3_geo_length.point = d3_geo_length.lineEnd = d3_noop; + }; + function nextPoint(λ, φ) { + var sinφ = Math.sin(φ *= d3_radians), cosφ = Math.cos(φ), t = abs((λ *= d3_radians) - λ0), cosΔλ = Math.cos(t); + d3_geo_lengthSum += Math.atan2(Math.sqrt((t = cosφ * Math.sin(t)) * t + (t = cosφ0 * sinφ - sinφ0 * cosφ * cosΔλ) * t), sinφ0 * sinφ + cosφ0 * cosφ * cosΔλ); + λ0 = λ, sinφ0 = sinφ, cosφ0 = cosφ; + } + } + function d3_geo_azimuthal(scale, angle) { + function azimuthal(λ, φ) { + var cosλ = Math.cos(λ), cosφ = Math.cos(φ), k = scale(cosλ * cosφ); + return [ k * cosφ * Math.sin(λ), k * Math.sin(φ) ]; + } + azimuthal.invert = function(x, y) { + var ρ = Math.sqrt(x * x + y * y), c = angle(ρ), sinc = Math.sin(c), cosc = Math.cos(c); + return [ Math.atan2(x * sinc, ρ * cosc), Math.asin(ρ && y * sinc / ρ) ]; + }; + return azimuthal; + } + var d3_geo_azimuthalEqualArea = d3_geo_azimuthal(function(cosλcosφ) { + return Math.sqrt(2 / (1 + cosλcosφ)); + }, function(ρ) { + return 2 * Math.asin(ρ / 2); + }); + (d3.geo.azimuthalEqualArea = function() { + return d3_geo_projection(d3_geo_azimuthalEqualArea); + }).raw = d3_geo_azimuthalEqualArea; + var d3_geo_azimuthalEquidistant = d3_geo_azimuthal(function(cosλcosφ) { + var c = Math.acos(cosλcosφ); + return c && c / Math.sin(c); + }, d3_identity); + (d3.geo.azimuthalEquidistant = function() { + return d3_geo_projection(d3_geo_azimuthalEquidistant); + }).raw = d3_geo_azimuthalEquidistant; + function d3_geo_conicConformal(φ0, φ1) { + var cosφ0 = Math.cos(φ0), t = function(φ) { + return Math.tan(π / 4 + φ / 2); + }, n = φ0 === φ1 ? Math.sin(φ0) : Math.log(cosφ0 / Math.cos(φ1)) / Math.log(t(φ1) / t(φ0)), F = cosφ0 * Math.pow(t(φ0), n) / n; + if (!n) return d3_geo_mercator; + function forward(λ, φ) { + if (F > 0) { + if (φ < -halfπ + ε) φ = -halfπ + ε; + } else { + if (φ > halfπ - ε) φ = halfπ - ε; + } + var ρ = F / Math.pow(t(φ), n); + return [ ρ * Math.sin(n * λ), F - ρ * Math.cos(n * λ) ]; + } + forward.invert = function(x, y) { + var ρ0_y = F - y, ρ = d3_sgn(n) * Math.sqrt(x * x + ρ0_y * ρ0_y); + return [ Math.atan2(x, ρ0_y) / n, 2 * Math.atan(Math.pow(F / ρ, 1 / n)) - halfπ ]; + }; + return forward; + } + (d3.geo.conicConformal = function() { + return d3_geo_conic(d3_geo_conicConformal); + }).raw = d3_geo_conicConformal; + function d3_geo_conicEquidistant(φ0, φ1) { + var cosφ0 = Math.cos(φ0), n = φ0 === φ1 ? Math.sin(φ0) : (cosφ0 - Math.cos(φ1)) / (φ1 - φ0), G = cosφ0 / n + φ0; + if (abs(n) < ε) return d3_geo_equirectangular; + function forward(λ, φ) { + var ρ = G - φ; + return [ ρ * Math.sin(n * λ), G - ρ * Math.cos(n * λ) ]; + } + forward.invert = function(x, y) { + var ρ0_y = G - y; + return [ Math.atan2(x, ρ0_y) / n, G - d3_sgn(n) * Math.sqrt(x * x + ρ0_y * ρ0_y) ]; + }; + return forward; + } + (d3.geo.conicEquidistant = function() { + return d3_geo_conic(d3_geo_conicEquidistant); + }).raw = d3_geo_conicEquidistant; + var d3_geo_gnomonic = d3_geo_azimuthal(function(cosλcosφ) { + return 1 / cosλcosφ; + }, Math.atan); + (d3.geo.gnomonic = function() { + return d3_geo_projection(d3_geo_gnomonic); + }).raw = d3_geo_gnomonic; + function d3_geo_mercator(λ, φ) { + return [ λ, Math.log(Math.tan(π / 4 + φ / 2)) ]; + } + d3_geo_mercator.invert = function(x, y) { + return [ x, 2 * Math.atan(Math.exp(y)) - halfπ ]; + }; + function d3_geo_mercatorProjection(project) { + var m = d3_geo_projection(project), scale = m.scale, translate = m.translate, clipExtent = m.clipExtent, clipAuto; + m.scale = function() { + var v = scale.apply(m, arguments); + return v === m ? clipAuto ? m.clipExtent(null) : m : v; + }; + m.translate = function() { + var v = translate.apply(m, arguments); + return v === m ? clipAuto ? m.clipExtent(null) : m : v; + }; + m.clipExtent = function(_) { + var v = clipExtent.apply(m, arguments); + if (v === m) { + if (clipAuto = _ == null) { + var k = π * scale(), t = translate(); + clipExtent([ [ t[0] - k, t[1] - k ], [ t[0] + k, t[1] + k ] ]); + } + } else if (clipAuto) { + v = null; + } + return v; + }; + return m.clipExtent(null); + } + (d3.geo.mercator = function() { + return d3_geo_mercatorProjection(d3_geo_mercator); + }).raw = d3_geo_mercator; + var d3_geo_orthographic = d3_geo_azimuthal(function() { + return 1; + }, Math.asin); + (d3.geo.orthographic = function() { + return d3_geo_projection(d3_geo_orthographic); + }).raw = d3_geo_orthographic; + var d3_geo_stereographic = d3_geo_azimuthal(function(cosλcosφ) { + return 1 / (1 + cosλcosφ); + }, function(ρ) { + return 2 * Math.atan(ρ); + }); + (d3.geo.stereographic = function() { + return d3_geo_projection(d3_geo_stereographic); + }).raw = d3_geo_stereographic; + function d3_geo_transverseMercator(λ, φ) { + return [ Math.log(Math.tan(π / 4 + φ / 2)), -λ ]; + } + d3_geo_transverseMercator.invert = function(x, y) { + return [ -y, 2 * Math.atan(Math.exp(x)) - halfπ ]; + }; + (d3.geo.transverseMercator = function() { + var projection = d3_geo_mercatorProjection(d3_geo_transverseMercator), center = projection.center, rotate = projection.rotate; + projection.center = function(_) { + return _ ? center([ -_[1], _[0] ]) : (_ = center(), [ _[1], -_[0] ]); + }; + projection.rotate = function(_) { + return _ ? rotate([ _[0], _[1], _.length > 2 ? _[2] + 90 : 90 ]) : (_ = rotate(), + [ _[0], _[1], _[2] - 90 ]); + }; + return rotate([ 0, 0, 90 ]); + }).raw = d3_geo_transverseMercator; + d3.geom = {}; + function d3_geom_pointX(d) { + return d[0]; + } + function d3_geom_pointY(d) { + return d[1]; + } + d3.geom.hull = function(vertices) { + var x = d3_geom_pointX, y = d3_geom_pointY; + if (arguments.length) return hull(vertices); + function hull(data) { + if (data.length < 3) return []; + var fx = d3_functor(x), fy = d3_functor(y), i, n = data.length, points = [], flippedPoints = []; + for (i = 0; i < n; i++) { + points.push([ +fx.call(this, data[i], i), +fy.call(this, data[i], i), i ]); + } + points.sort(d3_geom_hullOrder); + for (i = 0; i < n; i++) flippedPoints.push([ points[i][0], -points[i][1] ]); + var upper = d3_geom_hullUpper(points), lower = d3_geom_hullUpper(flippedPoints); + var skipLeft = lower[0] === upper[0], skipRight = lower[lower.length - 1] === upper[upper.length - 1], polygon = []; + for (i = upper.length - 1; i >= 0; --i) polygon.push(data[points[upper[i]][2]]); + for (i = +skipLeft; i < lower.length - skipRight; ++i) polygon.push(data[points[lower[i]][2]]); + return polygon; + } + hull.x = function(_) { + return arguments.length ? (x = _, hull) : x; + }; + hull.y = function(_) { + return arguments.length ? (y = _, hull) : y; + }; + return hull; + }; + function d3_geom_hullUpper(points) { + var n = points.length, hull = [ 0, 1 ], hs = 2; + for (var i = 2; i < n; i++) { + while (hs > 1 && d3_cross2d(points[hull[hs - 2]], points[hull[hs - 1]], points[i]) <= 0) --hs; + hull[hs++] = i; + } + return hull.slice(0, hs); + } + function d3_geom_hullOrder(a, b) { + return a[0] - b[0] || a[1] - b[1]; + } + d3.geom.polygon = function(coordinates) { + d3_subclass(coordinates, d3_geom_polygonPrototype); + return coordinates; + }; + var d3_geom_polygonPrototype = d3.geom.polygon.prototype = []; + d3_geom_polygonPrototype.area = function() { + var i = -1, n = this.length, a, b = this[n - 1], area = 0; + while (++i < n) { + a = b; + b = this[i]; + area += a[1] * b[0] - a[0] * b[1]; + } + return area * .5; + }; + d3_geom_polygonPrototype.centroid = function(k) { + var i = -1, n = this.length, x = 0, y = 0, a, b = this[n - 1], c; + if (!arguments.length) k = -1 / (6 * this.area()); + while (++i < n) { + a = b; + b = this[i]; + c = a[0] * b[1] - b[0] * a[1]; + x += (a[0] + b[0]) * c; + y += (a[1] + b[1]) * c; + } + return [ x * k, y * k ]; + }; + d3_geom_polygonPrototype.clip = function(subject) { + var input, closed = d3_geom_polygonClosed(subject), i = -1, n = this.length - d3_geom_polygonClosed(this), j, m, a = this[n - 1], b, c, d; + while (++i < n) { + input = subject.slice(); + subject.length = 0; + b = this[i]; + c = input[(m = input.length - closed) - 1]; + j = -1; + while (++j < m) { + d = input[j]; + if (d3_geom_polygonInside(d, a, b)) { + if (!d3_geom_polygonInside(c, a, b)) { + subject.push(d3_geom_polygonIntersect(c, d, a, b)); + } + subject.push(d); + } else if (d3_geom_polygonInside(c, a, b)) { + subject.push(d3_geom_polygonIntersect(c, d, a, b)); + } + c = d; + } + if (closed) subject.push(subject[0]); + a = b; + } + return subject; + }; + function d3_geom_polygonInside(p, a, b) { + return (b[0] - a[0]) * (p[1] - a[1]) < (b[1] - a[1]) * (p[0] - a[0]); + } + function d3_geom_polygonIntersect(c, d, a, b) { + var x1 = c[0], x3 = a[0], x21 = d[0] - x1, x43 = b[0] - x3, y1 = c[1], y3 = a[1], y21 = d[1] - y1, y43 = b[1] - y3, ua = (x43 * (y1 - y3) - y43 * (x1 - x3)) / (y43 * x21 - x43 * y21); + return [ x1 + ua * x21, y1 + ua * y21 ]; + } + function d3_geom_polygonClosed(coordinates) { + var a = coordinates[0], b = coordinates[coordinates.length - 1]; + return !(a[0] - b[0] || a[1] - b[1]); + } + var d3_geom_voronoiEdges, d3_geom_voronoiCells, d3_geom_voronoiBeaches, d3_geom_voronoiBeachPool = [], d3_geom_voronoiFirstCircle, d3_geom_voronoiCircles, d3_geom_voronoiCirclePool = []; + function d3_geom_voronoiBeach() { + d3_geom_voronoiRedBlackNode(this); + this.edge = this.site = this.circle = null; + } + function d3_geom_voronoiCreateBeach(site) { + var beach = d3_geom_voronoiBeachPool.pop() || new d3_geom_voronoiBeach(); + beach.site = site; + return beach; + } + function d3_geom_voronoiDetachBeach(beach) { + d3_geom_voronoiDetachCircle(beach); + d3_geom_voronoiBeaches.remove(beach); + d3_geom_voronoiBeachPool.push(beach); + d3_geom_voronoiRedBlackNode(beach); + } + function d3_geom_voronoiRemoveBeach(beach) { + var circle = beach.circle, x = circle.x, y = circle.cy, vertex = { + x: x, + y: y + }, previous = beach.P, next = beach.N, disappearing = [ beach ]; + d3_geom_voronoiDetachBeach(beach); + var lArc = previous; + while (lArc.circle && abs(x - lArc.circle.x) < ε && abs(y - lArc.circle.cy) < ε) { + previous = lArc.P; + disappearing.unshift(lArc); + d3_geom_voronoiDetachBeach(lArc); + lArc = previous; + } + disappearing.unshift(lArc); + d3_geom_voronoiDetachCircle(lArc); + var rArc = next; + while (rArc.circle && abs(x - rArc.circle.x) < ε && abs(y - rArc.circle.cy) < ε) { + next = rArc.N; + disappearing.push(rArc); + d3_geom_voronoiDetachBeach(rArc); + rArc = next; + } + disappearing.push(rArc); + d3_geom_voronoiDetachCircle(rArc); + var nArcs = disappearing.length, iArc; + for (iArc = 1; iArc < nArcs; ++iArc) { + rArc = disappearing[iArc]; + lArc = disappearing[iArc - 1]; + d3_geom_voronoiSetEdgeEnd(rArc.edge, lArc.site, rArc.site, vertex); + } + lArc = disappearing[0]; + rArc = disappearing[nArcs - 1]; + rArc.edge = d3_geom_voronoiCreateEdge(lArc.site, rArc.site, null, vertex); + d3_geom_voronoiAttachCircle(lArc); + d3_geom_voronoiAttachCircle(rArc); + } + function d3_geom_voronoiAddBeach(site) { + var x = site.x, directrix = site.y, lArc, rArc, dxl, dxr, node = d3_geom_voronoiBeaches._; + while (node) { + dxl = d3_geom_voronoiLeftBreakPoint(node, directrix) - x; + if (dxl > ε) node = node.L; else { + dxr = x - d3_geom_voronoiRightBreakPoint(node, directrix); + if (dxr > ε) { + if (!node.R) { + lArc = node; + break; + } + node = node.R; + } else { + if (dxl > -ε) { + lArc = node.P; + rArc = node; + } else if (dxr > -ε) { + lArc = node; + rArc = node.N; + } else { + lArc = rArc = node; + } + break; + } + } + } + var newArc = d3_geom_voronoiCreateBeach(site); + d3_geom_voronoiBeaches.insert(lArc, newArc); + if (!lArc && !rArc) return; + if (lArc === rArc) { + d3_geom_voronoiDetachCircle(lArc); + rArc = d3_geom_voronoiCreateBeach(lArc.site); + d3_geom_voronoiBeaches.insert(newArc, rArc); + newArc.edge = rArc.edge = d3_geom_voronoiCreateEdge(lArc.site, newArc.site); + d3_geom_voronoiAttachCircle(lArc); + d3_geom_voronoiAttachCircle(rArc); + return; + } + if (!rArc) { + newArc.edge = d3_geom_voronoiCreateEdge(lArc.site, newArc.site); + return; + } + d3_geom_voronoiDetachCircle(lArc); + d3_geom_voronoiDetachCircle(rArc); + var lSite = lArc.site, ax = lSite.x, ay = lSite.y, bx = site.x - ax, by = site.y - ay, rSite = rArc.site, cx = rSite.x - ax, cy = rSite.y - ay, d = 2 * (bx * cy - by * cx), hb = bx * bx + by * by, hc = cx * cx + cy * cy, vertex = { + x: (cy * hb - by * hc) / d + ax, + y: (bx * hc - cx * hb) / d + ay + }; + d3_geom_voronoiSetEdgeEnd(rArc.edge, lSite, rSite, vertex); + newArc.edge = d3_geom_voronoiCreateEdge(lSite, site, null, vertex); + rArc.edge = d3_geom_voronoiCreateEdge(site, rSite, null, vertex); + d3_geom_voronoiAttachCircle(lArc); + d3_geom_voronoiAttachCircle(rArc); + } + function d3_geom_voronoiLeftBreakPoint(arc, directrix) { + var site = arc.site, rfocx = site.x, rfocy = site.y, pby2 = rfocy - directrix; + if (!pby2) return rfocx; + var lArc = arc.P; + if (!lArc) return -Infinity; + site = lArc.site; + var lfocx = site.x, lfocy = site.y, plby2 = lfocy - directrix; + if (!plby2) return lfocx; + var hl = lfocx - rfocx, aby2 = 1 / pby2 - 1 / plby2, b = hl / plby2; + if (aby2) return (-b + Math.sqrt(b * b - 2 * aby2 * (hl * hl / (-2 * plby2) - lfocy + plby2 / 2 + rfocy - pby2 / 2))) / aby2 + rfocx; + return (rfocx + lfocx) / 2; + } + function d3_geom_voronoiRightBreakPoint(arc, directrix) { + var rArc = arc.N; + if (rArc) return d3_geom_voronoiLeftBreakPoint(rArc, directrix); + var site = arc.site; + return site.y === directrix ? site.x : Infinity; + } + function d3_geom_voronoiCell(site) { + this.site = site; + this.edges = []; + } + d3_geom_voronoiCell.prototype.prepare = function() { + var halfEdges = this.edges, iHalfEdge = halfEdges.length, edge; + while (iHalfEdge--) { + edge = halfEdges[iHalfEdge].edge; + if (!edge.b || !edge.a) halfEdges.splice(iHalfEdge, 1); + } + halfEdges.sort(d3_geom_voronoiHalfEdgeOrder); + return halfEdges.length; + }; + function d3_geom_voronoiCloseCells(extent) { + var x0 = extent[0][0], x1 = extent[1][0], y0 = extent[0][1], y1 = extent[1][1], x2, y2, x3, y3, cells = d3_geom_voronoiCells, iCell = cells.length, cell, iHalfEdge, halfEdges, nHalfEdges, start, end; + while (iCell--) { + cell = cells[iCell]; + if (!cell || !cell.prepare()) continue; + halfEdges = cell.edges; + nHalfEdges = halfEdges.length; + iHalfEdge = 0; + while (iHalfEdge < nHalfEdges) { + end = halfEdges[iHalfEdge].end(), x3 = end.x, y3 = end.y; + start = halfEdges[++iHalfEdge % nHalfEdges].start(), x2 = start.x, y2 = start.y; + if (abs(x3 - x2) > ε || abs(y3 - y2) > ε) { + halfEdges.splice(iHalfEdge, 0, new d3_geom_voronoiHalfEdge(d3_geom_voronoiCreateBorderEdge(cell.site, end, abs(x3 - x0) < ε && y1 - y3 > ε ? { + x: x0, + y: abs(x2 - x0) < ε ? y2 : y1 + } : abs(y3 - y1) < ε && x1 - x3 > ε ? { + x: abs(y2 - y1) < ε ? x2 : x1, + y: y1 + } : abs(x3 - x1) < ε && y3 - y0 > ε ? { + x: x1, + y: abs(x2 - x1) < ε ? y2 : y0 + } : abs(y3 - y0) < ε && x3 - x0 > ε ? { + x: abs(y2 - y0) < ε ? x2 : x0, + y: y0 + } : null), cell.site, null)); + ++nHalfEdges; + } + } + } + } + function d3_geom_voronoiHalfEdgeOrder(a, b) { + return b.angle - a.angle; + } + function d3_geom_voronoiCircle() { + d3_geom_voronoiRedBlackNode(this); + this.x = this.y = this.arc = this.site = this.cy = null; + } + function d3_geom_voronoiAttachCircle(arc) { + var lArc = arc.P, rArc = arc.N; + if (!lArc || !rArc) return; + var lSite = lArc.site, cSite = arc.site, rSite = rArc.site; + if (lSite === rSite) return; + var bx = cSite.x, by = cSite.y, ax = lSite.x - bx, ay = lSite.y - by, cx = rSite.x - bx, cy = rSite.y - by; + var d = 2 * (ax * cy - ay * cx); + if (d >= -ε2) return; + var ha = ax * ax + ay * ay, hc = cx * cx + cy * cy, x = (cy * ha - ay * hc) / d, y = (ax * hc - cx * ha) / d, cy = y + by; + var circle = d3_geom_voronoiCirclePool.pop() || new d3_geom_voronoiCircle(); + circle.arc = arc; + circle.site = cSite; + circle.x = x + bx; + circle.y = cy + Math.sqrt(x * x + y * y); + circle.cy = cy; + arc.circle = circle; + var before = null, node = d3_geom_voronoiCircles._; + while (node) { + if (circle.y < node.y || circle.y === node.y && circle.x <= node.x) { + if (node.L) node = node.L; else { + before = node.P; + break; + } + } else { + if (node.R) node = node.R; else { + before = node; + break; + } + } + } + d3_geom_voronoiCircles.insert(before, circle); + if (!before) d3_geom_voronoiFirstCircle = circle; + } + function d3_geom_voronoiDetachCircle(arc) { + var circle = arc.circle; + if (circle) { + if (!circle.P) d3_geom_voronoiFirstCircle = circle.N; + d3_geom_voronoiCircles.remove(circle); + d3_geom_voronoiCirclePool.push(circle); + d3_geom_voronoiRedBlackNode(circle); + arc.circle = null; + } + } + function d3_geom_voronoiClipEdges(extent) { + var edges = d3_geom_voronoiEdges, clip = d3_geom_clipLine(extent[0][0], extent[0][1], extent[1][0], extent[1][1]), i = edges.length, e; + while (i--) { + e = edges[i]; + if (!d3_geom_voronoiConnectEdge(e, extent) || !clip(e) || abs(e.a.x - e.b.x) < ε && abs(e.a.y - e.b.y) < ε) { + e.a = e.b = null; + edges.splice(i, 1); + } + } + } + function d3_geom_voronoiConnectEdge(edge, extent) { + var vb = edge.b; + if (vb) return true; + var va = edge.a, x0 = extent[0][0], x1 = extent[1][0], y0 = extent[0][1], y1 = extent[1][1], lSite = edge.l, rSite = edge.r, lx = lSite.x, ly = lSite.y, rx = rSite.x, ry = rSite.y, fx = (lx + rx) / 2, fy = (ly + ry) / 2, fm, fb; + if (ry === ly) { + if (fx < x0 || fx >= x1) return; + if (lx > rx) { + if (!va) va = { + x: fx, + y: y0 + }; else if (va.y >= y1) return; + vb = { + x: fx, + y: y1 + }; + } else { + if (!va) va = { + x: fx, + y: y1 + }; else if (va.y < y0) return; + vb = { + x: fx, + y: y0 + }; + } + } else { + fm = (lx - rx) / (ry - ly); + fb = fy - fm * fx; + if (fm < -1 || fm > 1) { + if (lx > rx) { + if (!va) va = { + x: (y0 - fb) / fm, + y: y0 + }; else if (va.y >= y1) return; + vb = { + x: (y1 - fb) / fm, + y: y1 + }; + } else { + if (!va) va = { + x: (y1 - fb) / fm, + y: y1 + }; else if (va.y < y0) return; + vb = { + x: (y0 - fb) / fm, + y: y0 + }; + } + } else { + if (ly < ry) { + if (!va) va = { + x: x0, + y: fm * x0 + fb + }; else if (va.x >= x1) return; + vb = { + x: x1, + y: fm * x1 + fb + }; + } else { + if (!va) va = { + x: x1, + y: fm * x1 + fb + }; else if (va.x < x0) return; + vb = { + x: x0, + y: fm * x0 + fb + }; + } + } + } + edge.a = va; + edge.b = vb; + return true; + } + function d3_geom_voronoiEdge(lSite, rSite) { + this.l = lSite; + this.r = rSite; + this.a = this.b = null; + } + function d3_geom_voronoiCreateEdge(lSite, rSite, va, vb) { + var edge = new d3_geom_voronoiEdge(lSite, rSite); + d3_geom_voronoiEdges.push(edge); + if (va) d3_geom_voronoiSetEdgeEnd(edge, lSite, rSite, va); + if (vb) d3_geom_voronoiSetEdgeEnd(edge, rSite, lSite, vb); + d3_geom_voronoiCells[lSite.i].edges.push(new d3_geom_voronoiHalfEdge(edge, lSite, rSite)); + d3_geom_voronoiCells[rSite.i].edges.push(new d3_geom_voronoiHalfEdge(edge, rSite, lSite)); + return edge; + } + function d3_geom_voronoiCreateBorderEdge(lSite, va, vb) { + var edge = new d3_geom_voronoiEdge(lSite, null); + edge.a = va; + edge.b = vb; + d3_geom_voronoiEdges.push(edge); + return edge; + } + function d3_geom_voronoiSetEdgeEnd(edge, lSite, rSite, vertex) { + if (!edge.a && !edge.b) { + edge.a = vertex; + edge.l = lSite; + edge.r = rSite; + } else if (edge.l === rSite) { + edge.b = vertex; + } else { + edge.a = vertex; + } + } + function d3_geom_voronoiHalfEdge(edge, lSite, rSite) { + var va = edge.a, vb = edge.b; + this.edge = edge; + this.site = lSite; + this.angle = rSite ? Math.atan2(rSite.y - lSite.y, rSite.x - lSite.x) : edge.l === lSite ? Math.atan2(vb.x - va.x, va.y - vb.y) : Math.atan2(va.x - vb.x, vb.y - va.y); + } + d3_geom_voronoiHalfEdge.prototype = { + start: function() { + return this.edge.l === this.site ? this.edge.a : this.edge.b; + }, + end: function() { + return this.edge.l === this.site ? this.edge.b : this.edge.a; + } + }; + function d3_geom_voronoiRedBlackTree() { + this._ = null; + } + function d3_geom_voronoiRedBlackNode(node) { + node.U = node.C = node.L = node.R = node.P = node.N = null; + } + d3_geom_voronoiRedBlackTree.prototype = { + insert: function(after, node) { + var parent, grandpa, uncle; + if (after) { + node.P = after; + node.N = after.N; + if (after.N) after.N.P = node; + after.N = node; + if (after.R) { + after = after.R; + while (after.L) after = after.L; + after.L = node; + } else { + after.R = node; + } + parent = after; + } else if (this._) { + after = d3_geom_voronoiRedBlackFirst(this._); + node.P = null; + node.N = after; + after.P = after.L = node; + parent = after; + } else { + node.P = node.N = null; + this._ = node; + parent = null; + } + node.L = node.R = null; + node.U = parent; + node.C = true; + after = node; + while (parent && parent.C) { + grandpa = parent.U; + if (parent === grandpa.L) { + uncle = grandpa.R; + if (uncle && uncle.C) { + parent.C = uncle.C = false; + grandpa.C = true; + after = grandpa; + } else { + if (after === parent.R) { + d3_geom_voronoiRedBlackRotateLeft(this, parent); + after = parent; + parent = after.U; + } + parent.C = false; + grandpa.C = true; + d3_geom_voronoiRedBlackRotateRight(this, grandpa); + } + } else { + uncle = grandpa.L; + if (uncle && uncle.C) { + parent.C = uncle.C = false; + grandpa.C = true; + after = grandpa; + } else { + if (after === parent.L) { + d3_geom_voronoiRedBlackRotateRight(this, parent); + after = parent; + parent = after.U; + } + parent.C = false; + grandpa.C = true; + d3_geom_voronoiRedBlackRotateLeft(this, grandpa); + } + } + parent = after.U; + } + this._.C = false; + }, + remove: function(node) { + if (node.N) node.N.P = node.P; + if (node.P) node.P.N = node.N; + node.N = node.P = null; + var parent = node.U, sibling, left = node.L, right = node.R, next, red; + if (!left) next = right; else if (!right) next = left; else next = d3_geom_voronoiRedBlackFirst(right); + if (parent) { + if (parent.L === node) parent.L = next; else parent.R = next; + } else { + this._ = next; + } + if (left && right) { + red = next.C; + next.C = node.C; + next.L = left; + left.U = next; + if (next !== right) { + parent = next.U; + next.U = node.U; + node = next.R; + parent.L = node; + next.R = right; + right.U = next; + } else { + next.U = parent; + parent = next; + node = next.R; + } + } else { + red = node.C; + node = next; + } + if (node) node.U = parent; + if (red) return; + if (node && node.C) { + node.C = false; + return; + } + do { + if (node === this._) break; + if (node === parent.L) { + sibling = parent.R; + if (sibling.C) { + sibling.C = false; + parent.C = true; + d3_geom_voronoiRedBlackRotateLeft(this, parent); + sibling = parent.R; + } + if (sibling.L && sibling.L.C || sibling.R && sibling.R.C) { + if (!sibling.R || !sibling.R.C) { + sibling.L.C = false; + sibling.C = true; + d3_geom_voronoiRedBlackRotateRight(this, sibling); + sibling = parent.R; + } + sibling.C = parent.C; + parent.C = sibling.R.C = false; + d3_geom_voronoiRedBlackRotateLeft(this, parent); + node = this._; + break; + } + } else { + sibling = parent.L; + if (sibling.C) { + sibling.C = false; + parent.C = true; + d3_geom_voronoiRedBlackRotateRight(this, parent); + sibling = parent.L; + } + if (sibling.L && sibling.L.C || sibling.R && sibling.R.C) { + if (!sibling.L || !sibling.L.C) { + sibling.R.C = false; + sibling.C = true; + d3_geom_voronoiRedBlackRotateLeft(this, sibling); + sibling = parent.L; + } + sibling.C = parent.C; + parent.C = sibling.L.C = false; + d3_geom_voronoiRedBlackRotateRight(this, parent); + node = this._; + break; + } + } + sibling.C = true; + node = parent; + parent = parent.U; + } while (!node.C); + if (node) node.C = false; + } + }; + function d3_geom_voronoiRedBlackRotateLeft(tree, node) { + var p = node, q = node.R, parent = p.U; + if (parent) { + if (parent.L === p) parent.L = q; else parent.R = q; + } else { + tree._ = q; + } + q.U = parent; + p.U = q; + p.R = q.L; + if (p.R) p.R.U = p; + q.L = p; + } + function d3_geom_voronoiRedBlackRotateRight(tree, node) { + var p = node, q = node.L, parent = p.U; + if (parent) { + if (parent.L === p) parent.L = q; else parent.R = q; + } else { + tree._ = q; + } + q.U = parent; + p.U = q; + p.L = q.R; + if (p.L) p.L.U = p; + q.R = p; + } + function d3_geom_voronoiRedBlackFirst(node) { + while (node.L) node = node.L; + return node; + } + function d3_geom_voronoi(sites, bbox) { + var site = sites.sort(d3_geom_voronoiVertexOrder).pop(), x0, y0, circle; + d3_geom_voronoiEdges = []; + d3_geom_voronoiCells = new Array(sites.length); + d3_geom_voronoiBeaches = new d3_geom_voronoiRedBlackTree(); + d3_geom_voronoiCircles = new d3_geom_voronoiRedBlackTree(); + while (true) { + circle = d3_geom_voronoiFirstCircle; + if (site && (!circle || site.y < circle.y || site.y === circle.y && site.x < circle.x)) { + if (site.x !== x0 || site.y !== y0) { + d3_geom_voronoiCells[site.i] = new d3_geom_voronoiCell(site); + d3_geom_voronoiAddBeach(site); + x0 = site.x, y0 = site.y; + } + site = sites.pop(); + } else if (circle) { + d3_geom_voronoiRemoveBeach(circle.arc); + } else { + break; + } + } + if (bbox) d3_geom_voronoiClipEdges(bbox), d3_geom_voronoiCloseCells(bbox); + var diagram = { + cells: d3_geom_voronoiCells, + edges: d3_geom_voronoiEdges + }; + d3_geom_voronoiBeaches = d3_geom_voronoiCircles = d3_geom_voronoiEdges = d3_geom_voronoiCells = null; + return diagram; + } + function d3_geom_voronoiVertexOrder(a, b) { + return b.y - a.y || b.x - a.x; + } + d3.geom.voronoi = function(points) { + var x = d3_geom_pointX, y = d3_geom_pointY, fx = x, fy = y, clipExtent = d3_geom_voronoiClipExtent; + if (points) return voronoi(points); + function voronoi(data) { + var polygons = new Array(data.length), x0 = clipExtent[0][0], y0 = clipExtent[0][1], x1 = clipExtent[1][0], y1 = clipExtent[1][1]; + d3_geom_voronoi(sites(data), clipExtent).cells.forEach(function(cell, i) { + var edges = cell.edges, site = cell.site, polygon = polygons[i] = edges.length ? edges.map(function(e) { + var s = e.start(); + return [ s.x, s.y ]; + }) : site.x >= x0 && site.x <= x1 && site.y >= y0 && site.y <= y1 ? [ [ x0, y1 ], [ x1, y1 ], [ x1, y0 ], [ x0, y0 ] ] : []; + polygon.point = data[i]; + }); + return polygons; + } + function sites(data) { + return data.map(function(d, i) { + return { + x: Math.round(fx(d, i) / ε) * ε, + y: Math.round(fy(d, i) / ε) * ε, + i: i + }; + }); + } + voronoi.links = function(data) { + return d3_geom_voronoi(sites(data)).edges.filter(function(edge) { + return edge.l && edge.r; + }).map(function(edge) { + return { + source: data[edge.l.i], + target: data[edge.r.i] + }; + }); + }; + voronoi.triangles = function(data) { + var triangles = []; + d3_geom_voronoi(sites(data)).cells.forEach(function(cell, i) { + var site = cell.site, edges = cell.edges.sort(d3_geom_voronoiHalfEdgeOrder), j = -1, m = edges.length, e0, s0, e1 = edges[m - 1].edge, s1 = e1.l === site ? e1.r : e1.l; + while (++j < m) { + e0 = e1; + s0 = s1; + e1 = edges[j].edge; + s1 = e1.l === site ? e1.r : e1.l; + if (i < s0.i && i < s1.i && d3_geom_voronoiTriangleArea(site, s0, s1) < 0) { + triangles.push([ data[i], data[s0.i], data[s1.i] ]); + } + } + }); + return triangles; + }; + voronoi.x = function(_) { + return arguments.length ? (fx = d3_functor(x = _), voronoi) : x; + }; + voronoi.y = function(_) { + return arguments.length ? (fy = d3_functor(y = _), voronoi) : y; + }; + voronoi.clipExtent = function(_) { + if (!arguments.length) return clipExtent === d3_geom_voronoiClipExtent ? null : clipExtent; + clipExtent = _ == null ? d3_geom_voronoiClipExtent : _; + return voronoi; + }; + voronoi.size = function(_) { + if (!arguments.length) return clipExtent === d3_geom_voronoiClipExtent ? null : clipExtent && clipExtent[1]; + return voronoi.clipExtent(_ && [ [ 0, 0 ], _ ]); + }; + return voronoi; + }; + var d3_geom_voronoiClipExtent = [ [ -1e6, -1e6 ], [ 1e6, 1e6 ] ]; + function d3_geom_voronoiTriangleArea(a, b, c) { + return (a.x - c.x) * (b.y - a.y) - (a.x - b.x) * (c.y - a.y); + } + d3.geom.delaunay = function(vertices) { + return d3.geom.voronoi().triangles(vertices); + }; + d3.geom.quadtree = function(points, x1, y1, x2, y2) { + var x = d3_geom_pointX, y = d3_geom_pointY, compat; + if (compat = arguments.length) { + x = d3_geom_quadtreeCompatX; + y = d3_geom_quadtreeCompatY; + if (compat === 3) { + y2 = y1; + x2 = x1; + y1 = x1 = 0; + } + return quadtree(points); + } + function quadtree(data) { + var d, fx = d3_functor(x), fy = d3_functor(y), xs, ys, i, n, x1_, y1_, x2_, y2_; + if (x1 != null) { + x1_ = x1, y1_ = y1, x2_ = x2, y2_ = y2; + } else { + x2_ = y2_ = -(x1_ = y1_ = Infinity); + xs = [], ys = []; + n = data.length; + if (compat) for (i = 0; i < n; ++i) { + d = data[i]; + if (d.x < x1_) x1_ = d.x; + if (d.y < y1_) y1_ = d.y; + if (d.x > x2_) x2_ = d.x; + if (d.y > y2_) y2_ = d.y; + xs.push(d.x); + ys.push(d.y); + } else for (i = 0; i < n; ++i) { + var x_ = +fx(d = data[i], i), y_ = +fy(d, i); + if (x_ < x1_) x1_ = x_; + if (y_ < y1_) y1_ = y_; + if (x_ > x2_) x2_ = x_; + if (y_ > y2_) y2_ = y_; + xs.push(x_); + ys.push(y_); + } + } + var dx = x2_ - x1_, dy = y2_ - y1_; + if (dx > dy) y2_ = y1_ + dx; else x2_ = x1_ + dy; + function insert(n, d, x, y, x1, y1, x2, y2) { + if (isNaN(x) || isNaN(y)) return; + if (n.leaf) { + var nx = n.x, ny = n.y; + if (nx != null) { + if (abs(nx - x) + abs(ny - y) < .01) { + insertChild(n, d, x, y, x1, y1, x2, y2); + } else { + var nPoint = n.point; + n.x = n.y = n.point = null; + insertChild(n, nPoint, nx, ny, x1, y1, x2, y2); + insertChild(n, d, x, y, x1, y1, x2, y2); + } + } else { + n.x = x, n.y = y, n.point = d; + } + } else { + insertChild(n, d, x, y, x1, y1, x2, y2); + } + } + function insertChild(n, d, x, y, x1, y1, x2, y2) { + var xm = (x1 + x2) * .5, ym = (y1 + y2) * .5, right = x >= xm, below = y >= ym, i = below << 1 | right; + n.leaf = false; + n = n.nodes[i] || (n.nodes[i] = d3_geom_quadtreeNode()); + if (right) x1 = xm; else x2 = xm; + if (below) y1 = ym; else y2 = ym; + insert(n, d, x, y, x1, y1, x2, y2); + } + var root = d3_geom_quadtreeNode(); + root.add = function(d) { + insert(root, d, +fx(d, ++i), +fy(d, i), x1_, y1_, x2_, y2_); + }; + root.visit = function(f) { + d3_geom_quadtreeVisit(f, root, x1_, y1_, x2_, y2_); + }; + root.find = function(point) { + return d3_geom_quadtreeFind(root, point[0], point[1], x1_, y1_, x2_, y2_); + }; + i = -1; + if (x1 == null) { + while (++i < n) { + insert(root, data[i], xs[i], ys[i], x1_, y1_, x2_, y2_); + } + --i; + } else data.forEach(root.add); + xs = ys = data = d = null; + return root; + } + quadtree.x = function(_) { + return arguments.length ? (x = _, quadtree) : x; + }; + quadtree.y = function(_) { + return arguments.length ? (y = _, quadtree) : y; + }; + quadtree.extent = function(_) { + if (!arguments.length) return x1 == null ? null : [ [ x1, y1 ], [ x2, y2 ] ]; + if (_ == null) x1 = y1 = x2 = y2 = null; else x1 = +_[0][0], y1 = +_[0][1], x2 = +_[1][0], + y2 = +_[1][1]; + return quadtree; + }; + quadtree.size = function(_) { + if (!arguments.length) return x1 == null ? null : [ x2 - x1, y2 - y1 ]; + if (_ == null) x1 = y1 = x2 = y2 = null; else x1 = y1 = 0, x2 = +_[0], y2 = +_[1]; + return quadtree; + }; + return quadtree; + }; + function d3_geom_quadtreeCompatX(d) { + return d.x; + } + function d3_geom_quadtreeCompatY(d) { + return d.y; + } + function d3_geom_quadtreeNode() { + return { + leaf: true, + nodes: [], + point: null, + x: null, + y: null + }; + } + function d3_geom_quadtreeVisit(f, node, x1, y1, x2, y2) { + if (!f(node, x1, y1, x2, y2)) { + var sx = (x1 + x2) * .5, sy = (y1 + y2) * .5, children = node.nodes; + if (children[0]) d3_geom_quadtreeVisit(f, children[0], x1, y1, sx, sy); + if (children[1]) d3_geom_quadtreeVisit(f, children[1], sx, y1, x2, sy); + if (children[2]) d3_geom_quadtreeVisit(f, children[2], x1, sy, sx, y2); + if (children[3]) d3_geom_quadtreeVisit(f, children[3], sx, sy, x2, y2); + } + } + function d3_geom_quadtreeFind(root, x, y, x0, y0, x3, y3) { + var minDistance2 = Infinity, closestPoint; + (function find(node, x1, y1, x2, y2) { + if (x1 > x3 || y1 > y3 || x2 < x0 || y2 < y0) return; + if (point = node.point) { + var point, dx = x - node.x, dy = y - node.y, distance2 = dx * dx + dy * dy; + if (distance2 < minDistance2) { + var distance = Math.sqrt(minDistance2 = distance2); + x0 = x - distance, y0 = y - distance; + x3 = x + distance, y3 = y + distance; + closestPoint = point; + } + } + var children = node.nodes, xm = (x1 + x2) * .5, ym = (y1 + y2) * .5, right = x >= xm, below = y >= ym; + for (var i = below << 1 | right, j = i + 4; i < j; ++i) { + if (node = children[i & 3]) switch (i & 3) { + case 0: + find(node, x1, y1, xm, ym); + break; + + case 1: + find(node, xm, y1, x2, ym); + break; + + case 2: + find(node, x1, ym, xm, y2); + break; + + case 3: + find(node, xm, ym, x2, y2); + break; + } + } + })(root, x0, y0, x3, y3); + return closestPoint; + } + d3.interpolateRgb = d3_interpolateRgb; + function d3_interpolateRgb(a, b) { + a = d3.rgb(a); + b = d3.rgb(b); + var ar = a.r, ag = a.g, ab = a.b, br = b.r - ar, bg = b.g - ag, bb = b.b - ab; + return function(t) { + return "#" + d3_rgb_hex(Math.round(ar + br * t)) + d3_rgb_hex(Math.round(ag + bg * t)) + d3_rgb_hex(Math.round(ab + bb * t)); + }; + } + d3.interpolateObject = d3_interpolateObject; + function d3_interpolateObject(a, b) { + var i = {}, c = {}, k; + for (k in a) { + if (k in b) { + i[k] = d3_interpolate(a[k], b[k]); + } else { + c[k] = a[k]; + } + } + for (k in b) { + if (!(k in a)) { + c[k] = b[k]; + } + } + return function(t) { + for (k in i) c[k] = i[k](t); + return c; + }; + } + d3.interpolateNumber = d3_interpolateNumber; + function d3_interpolateNumber(a, b) { + a = +a, b = +b; + return function(t) { + return a * (1 - t) + b * t; + }; + } + d3.interpolateString = d3_interpolateString; + function d3_interpolateString(a, b) { + var bi = d3_interpolate_numberA.lastIndex = d3_interpolate_numberB.lastIndex = 0, am, bm, bs, i = -1, s = [], q = []; + a = a + "", b = b + ""; + while ((am = d3_interpolate_numberA.exec(a)) && (bm = d3_interpolate_numberB.exec(b))) { + if ((bs = bm.index) > bi) { + bs = b.slice(bi, bs); + if (s[i]) s[i] += bs; else s[++i] = bs; + } + if ((am = am[0]) === (bm = bm[0])) { + if (s[i]) s[i] += bm; else s[++i] = bm; + } else { + s[++i] = null; + q.push({ + i: i, + x: d3_interpolateNumber(am, bm) + }); + } + bi = d3_interpolate_numberB.lastIndex; + } + if (bi < b.length) { + bs = b.slice(bi); + if (s[i]) s[i] += bs; else s[++i] = bs; + } + return s.length < 2 ? q[0] ? (b = q[0].x, function(t) { + return b(t) + ""; + }) : function() { + return b; + } : (b = q.length, function(t) { + for (var i = 0, o; i < b; ++i) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }); + } + var d3_interpolate_numberA = /[-+]?(?:\d+\.?\d*|\.?\d+)(?:[eE][-+]?\d+)?/g, d3_interpolate_numberB = new RegExp(d3_interpolate_numberA.source, "g"); + d3.interpolate = d3_interpolate; + function d3_interpolate(a, b) { + var i = d3.interpolators.length, f; + while (--i >= 0 && !(f = d3.interpolators[i](a, b))) ; + return f; + } + d3.interpolators = [ function(a, b) { + var t = typeof b; + return (t === "string" ? d3_rgb_names.has(b.toLowerCase()) || /^(#|rgb\(|hsl\()/i.test(b) ? d3_interpolateRgb : d3_interpolateString : b instanceof d3_color ? d3_interpolateRgb : Array.isArray(b) ? d3_interpolateArray : t === "object" && isNaN(b) ? d3_interpolateObject : d3_interpolateNumber)(a, b); + } ]; + d3.interpolateArray = d3_interpolateArray; + function d3_interpolateArray(a, b) { + var x = [], c = [], na = a.length, nb = b.length, n0 = Math.min(a.length, b.length), i; + for (i = 0; i < n0; ++i) x.push(d3_interpolate(a[i], b[i])); + for (;i < na; ++i) c[i] = a[i]; + for (;i < nb; ++i) c[i] = b[i]; + return function(t) { + for (i = 0; i < n0; ++i) c[i] = x[i](t); + return c; + }; + } + var d3_ease_default = function() { + return d3_identity; + }; + var d3_ease = d3.map({ + linear: d3_ease_default, + poly: d3_ease_poly, + quad: function() { + return d3_ease_quad; + }, + cubic: function() { + return d3_ease_cubic; + }, + sin: function() { + return d3_ease_sin; + }, + exp: function() { + return d3_ease_exp; + }, + circle: function() { + return d3_ease_circle; + }, + elastic: d3_ease_elastic, + back: d3_ease_back, + bounce: function() { + return d3_ease_bounce; + } + }); + var d3_ease_mode = d3.map({ + "in": d3_identity, + out: d3_ease_reverse, + "in-out": d3_ease_reflect, + "out-in": function(f) { + return d3_ease_reflect(d3_ease_reverse(f)); + } + }); + d3.ease = function(name) { + var i = name.indexOf("-"), t = i >= 0 ? name.slice(0, i) : name, m = i >= 0 ? name.slice(i + 1) : "in"; + t = d3_ease.get(t) || d3_ease_default; + m = d3_ease_mode.get(m) || d3_identity; + return d3_ease_clamp(m(t.apply(null, d3_arraySlice.call(arguments, 1)))); + }; + function d3_ease_clamp(f) { + return function(t) { + return t <= 0 ? 0 : t >= 1 ? 1 : f(t); + }; + } + function d3_ease_reverse(f) { + return function(t) { + return 1 - f(1 - t); + }; + } + function d3_ease_reflect(f) { + return function(t) { + return .5 * (t < .5 ? f(2 * t) : 2 - f(2 - 2 * t)); + }; + } + function d3_ease_quad(t) { + return t * t; + } + function d3_ease_cubic(t) { + return t * t * t; + } + function d3_ease_cubicInOut(t) { + if (t <= 0) return 0; + if (t >= 1) return 1; + var t2 = t * t, t3 = t2 * t; + return 4 * (t < .5 ? t3 : 3 * (t - t2) + t3 - .75); + } + function d3_ease_poly(e) { + return function(t) { + return Math.pow(t, e); + }; + } + function d3_ease_sin(t) { + return 1 - Math.cos(t * halfπ); + } + function d3_ease_exp(t) { + return Math.pow(2, 10 * (t - 1)); + } + function d3_ease_circle(t) { + return 1 - Math.sqrt(1 - t * t); + } + function d3_ease_elastic(a, p) { + var s; + if (arguments.length < 2) p = .45; + if (arguments.length) s = p / τ * Math.asin(1 / a); else a = 1, s = p / 4; + return function(t) { + return 1 + a * Math.pow(2, -10 * t) * Math.sin((t - s) * τ / p); + }; + } + function d3_ease_back(s) { + if (!s) s = 1.70158; + return function(t) { + return t * t * ((s + 1) * t - s); + }; + } + function d3_ease_bounce(t) { + return t < 1 / 2.75 ? 7.5625 * t * t : t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 : 7.5625 * (t -= 2.625 / 2.75) * t + .984375; + } + d3.interpolateHcl = d3_interpolateHcl; + function d3_interpolateHcl(a, b) { + a = d3.hcl(a); + b = d3.hcl(b); + var ah = a.h, ac = a.c, al = a.l, bh = b.h - ah, bc = b.c - ac, bl = b.l - al; + if (isNaN(bc)) bc = 0, ac = isNaN(ac) ? b.c : ac; + if (isNaN(bh)) bh = 0, ah = isNaN(ah) ? b.h : ah; else if (bh > 180) bh -= 360; else if (bh < -180) bh += 360; + return function(t) { + return d3_hcl_lab(ah + bh * t, ac + bc * t, al + bl * t) + ""; + }; + } + d3.interpolateHsl = d3_interpolateHsl; + function d3_interpolateHsl(a, b) { + a = d3.hsl(a); + b = d3.hsl(b); + var ah = a.h, as = a.s, al = a.l, bh = b.h - ah, bs = b.s - as, bl = b.l - al; + if (isNaN(bs)) bs = 0, as = isNaN(as) ? b.s : as; + if (isNaN(bh)) bh = 0, ah = isNaN(ah) ? b.h : ah; else if (bh > 180) bh -= 360; else if (bh < -180) bh += 360; + return function(t) { + return d3_hsl_rgb(ah + bh * t, as + bs * t, al + bl * t) + ""; + }; + } + d3.interpolateLab = d3_interpolateLab; + function d3_interpolateLab(a, b) { + a = d3.lab(a); + b = d3.lab(b); + var al = a.l, aa = a.a, ab = a.b, bl = b.l - al, ba = b.a - aa, bb = b.b - ab; + return function(t) { + return d3_lab_rgb(al + bl * t, aa + ba * t, ab + bb * t) + ""; + }; + } + d3.interpolateRound = d3_interpolateRound; + function d3_interpolateRound(a, b) { + b -= a; + return function(t) { + return Math.round(a + b * t); + }; + } + d3.transform = function(string) { + var g = d3_document.createElementNS(d3.ns.prefix.svg, "g"); + return (d3.transform = function(string) { + if (string != null) { + g.setAttribute("transform", string); + var t = g.transform.baseVal.consolidate(); + } + return new d3_transform(t ? t.matrix : d3_transformIdentity); + })(string); + }; + function d3_transform(m) { + var r0 = [ m.a, m.b ], r1 = [ m.c, m.d ], kx = d3_transformNormalize(r0), kz = d3_transformDot(r0, r1), ky = d3_transformNormalize(d3_transformCombine(r1, r0, -kz)) || 0; + if (r0[0] * r1[1] < r1[0] * r0[1]) { + r0[0] *= -1; + r0[1] *= -1; + kx *= -1; + kz *= -1; + } + this.rotate = (kx ? Math.atan2(r0[1], r0[0]) : Math.atan2(-r1[0], r1[1])) * d3_degrees; + this.translate = [ m.e, m.f ]; + this.scale = [ kx, ky ]; + this.skew = ky ? Math.atan2(kz, ky) * d3_degrees : 0; + } + d3_transform.prototype.toString = function() { + return "translate(" + this.translate + ")rotate(" + this.rotate + ")skewX(" + this.skew + ")scale(" + this.scale + ")"; + }; + function d3_transformDot(a, b) { + return a[0] * b[0] + a[1] * b[1]; + } + function d3_transformNormalize(a) { + var k = Math.sqrt(d3_transformDot(a, a)); + if (k) { + a[0] /= k; + a[1] /= k; + } + return k; + } + function d3_transformCombine(a, b, k) { + a[0] += k * b[0]; + a[1] += k * b[1]; + return a; + } + var d3_transformIdentity = { + a: 1, + b: 0, + c: 0, + d: 1, + e: 0, + f: 0 + }; + d3.interpolateTransform = d3_interpolateTransform; + function d3_interpolateTransformPop(s) { + return s.length ? s.pop() + "," : ""; + } + function d3_interpolateTranslate(ta, tb, s, q) { + if (ta[0] !== tb[0] || ta[1] !== tb[1]) { + var i = s.push("translate(", null, ",", null, ")"); + q.push({ + i: i - 4, + x: d3_interpolateNumber(ta[0], tb[0]) + }, { + i: i - 2, + x: d3_interpolateNumber(ta[1], tb[1]) + }); + } else if (tb[0] || tb[1]) { + s.push("translate(" + tb + ")"); + } + } + function d3_interpolateRotate(ra, rb, s, q) { + if (ra !== rb) { + if (ra - rb > 180) rb += 360; else if (rb - ra > 180) ra += 360; + q.push({ + i: s.push(d3_interpolateTransformPop(s) + "rotate(", null, ")") - 2, + x: d3_interpolateNumber(ra, rb) + }); + } else if (rb) { + s.push(d3_interpolateTransformPop(s) + "rotate(" + rb + ")"); + } + } + function d3_interpolateSkew(wa, wb, s, q) { + if (wa !== wb) { + q.push({ + i: s.push(d3_interpolateTransformPop(s) + "skewX(", null, ")") - 2, + x: d3_interpolateNumber(wa, wb) + }); + } else if (wb) { + s.push(d3_interpolateTransformPop(s) + "skewX(" + wb + ")"); + } + } + function d3_interpolateScale(ka, kb, s, q) { + if (ka[0] !== kb[0] || ka[1] !== kb[1]) { + var i = s.push(d3_interpolateTransformPop(s) + "scale(", null, ",", null, ")"); + q.push({ + i: i - 4, + x: d3_interpolateNumber(ka[0], kb[0]) + }, { + i: i - 2, + x: d3_interpolateNumber(ka[1], kb[1]) + }); + } else if (kb[0] !== 1 || kb[1] !== 1) { + s.push(d3_interpolateTransformPop(s) + "scale(" + kb + ")"); + } + } + function d3_interpolateTransform(a, b) { + var s = [], q = []; + a = d3.transform(a), b = d3.transform(b); + d3_interpolateTranslate(a.translate, b.translate, s, q); + d3_interpolateRotate(a.rotate, b.rotate, s, q); + d3_interpolateSkew(a.skew, b.skew, s, q); + d3_interpolateScale(a.scale, b.scale, s, q); + a = b = null; + return function(t) { + var i = -1, n = q.length, o; + while (++i < n) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; + } + function d3_uninterpolateNumber(a, b) { + b = (b -= a = +a) || 1 / b; + return function(x) { + return (x - a) / b; + }; + } + function d3_uninterpolateClamp(a, b) { + b = (b -= a = +a) || 1 / b; + return function(x) { + return Math.max(0, Math.min(1, (x - a) / b)); + }; + } + d3.layout = {}; + d3.layout.bundle = function() { + return function(links) { + var paths = [], i = -1, n = links.length; + while (++i < n) paths.push(d3_layout_bundlePath(links[i])); + return paths; + }; + }; + function d3_layout_bundlePath(link) { + var start = link.source, end = link.target, lca = d3_layout_bundleLeastCommonAncestor(start, end), points = [ start ]; + while (start !== lca) { + start = start.parent; + points.push(start); + } + var k = points.length; + while (end !== lca) { + points.splice(k, 0, end); + end = end.parent; + } + return points; + } + function d3_layout_bundleAncestors(node) { + var ancestors = [], parent = node.parent; + while (parent != null) { + ancestors.push(node); + node = parent; + parent = parent.parent; + } + ancestors.push(node); + return ancestors; + } + function d3_layout_bundleLeastCommonAncestor(a, b) { + if (a === b) return a; + var aNodes = d3_layout_bundleAncestors(a), bNodes = d3_layout_bundleAncestors(b), aNode = aNodes.pop(), bNode = bNodes.pop(), sharedNode = null; + while (aNode === bNode) { + sharedNode = aNode; + aNode = aNodes.pop(); + bNode = bNodes.pop(); + } + return sharedNode; + } + d3.layout.chord = function() { + var chord = {}, chords, groups, matrix, n, padding = 0, sortGroups, sortSubgroups, sortChords; + function relayout() { + var subgroups = {}, groupSums = [], groupIndex = d3.range(n), subgroupIndex = [], k, x, x0, i, j; + chords = []; + groups = []; + k = 0, i = -1; + while (++i < n) { + x = 0, j = -1; + while (++j < n) { + x += matrix[i][j]; + } + groupSums.push(x); + subgroupIndex.push(d3.range(n)); + k += x; + } + if (sortGroups) { + groupIndex.sort(function(a, b) { + return sortGroups(groupSums[a], groupSums[b]); + }); + } + if (sortSubgroups) { + subgroupIndex.forEach(function(d, i) { + d.sort(function(a, b) { + return sortSubgroups(matrix[i][a], matrix[i][b]); + }); + }); + } + k = (τ - padding * n) / k; + x = 0, i = -1; + while (++i < n) { + x0 = x, j = -1; + while (++j < n) { + var di = groupIndex[i], dj = subgroupIndex[di][j], v = matrix[di][dj], a0 = x, a1 = x += v * k; + subgroups[di + "-" + dj] = { + index: di, + subindex: dj, + startAngle: a0, + endAngle: a1, + value: v + }; + } + groups[di] = { + index: di, + startAngle: x0, + endAngle: x, + value: groupSums[di] + }; + x += padding; + } + i = -1; + while (++i < n) { + j = i - 1; + while (++j < n) { + var source = subgroups[i + "-" + j], target = subgroups[j + "-" + i]; + if (source.value || target.value) { + chords.push(source.value < target.value ? { + source: target, + target: source + } : { + source: source, + target: target + }); + } + } + } + if (sortChords) resort(); + } + function resort() { + chords.sort(function(a, b) { + return sortChords((a.source.value + a.target.value) / 2, (b.source.value + b.target.value) / 2); + }); + } + chord.matrix = function(x) { + if (!arguments.length) return matrix; + n = (matrix = x) && matrix.length; + chords = groups = null; + return chord; + }; + chord.padding = function(x) { + if (!arguments.length) return padding; + padding = x; + chords = groups = null; + return chord; + }; + chord.sortGroups = function(x) { + if (!arguments.length) return sortGroups; + sortGroups = x; + chords = groups = null; + return chord; + }; + chord.sortSubgroups = function(x) { + if (!arguments.length) return sortSubgroups; + sortSubgroups = x; + chords = null; + return chord; + }; + chord.sortChords = function(x) { + if (!arguments.length) return sortChords; + sortChords = x; + if (chords) resort(); + return chord; + }; + chord.chords = function() { + if (!chords) relayout(); + return chords; + }; + chord.groups = function() { + if (!groups) relayout(); + return groups; + }; + return chord; + }; + d3.layout.force = function() { + var force = {}, event = d3.dispatch("start", "tick", "end"), timer, size = [ 1, 1 ], drag, alpha, friction = .9, linkDistance = d3_layout_forceLinkDistance, linkStrength = d3_layout_forceLinkStrength, charge = -30, chargeDistance2 = d3_layout_forceChargeDistance2, gravity = .1, theta2 = .64, nodes = [], links = [], distances, strengths, charges; + function repulse(node) { + return function(quad, x1, _, x2) { + if (quad.point !== node) { + var dx = quad.cx - node.x, dy = quad.cy - node.y, dw = x2 - x1, dn = dx * dx + dy * dy; + if (dw * dw / theta2 < dn) { + if (dn < chargeDistance2) { + var k = quad.charge / dn; + node.px -= dx * k; + node.py -= dy * k; + } + return true; + } + if (quad.point && dn && dn < chargeDistance2) { + var k = quad.pointCharge / dn; + node.px -= dx * k; + node.py -= dy * k; + } + } + return !quad.charge; + }; + } + force.tick = function() { + if ((alpha *= .99) < .005) { + timer = null; + event.end({ + type: "end", + alpha: alpha = 0 + }); + return true; + } + var n = nodes.length, m = links.length, q, i, o, s, t, l, k, x, y; + for (i = 0; i < m; ++i) { + o = links[i]; + s = o.source; + t = o.target; + x = t.x - s.x; + y = t.y - s.y; + if (l = x * x + y * y) { + l = alpha * strengths[i] * ((l = Math.sqrt(l)) - distances[i]) / l; + x *= l; + y *= l; + t.x -= x * (k = s.weight + t.weight ? s.weight / (s.weight + t.weight) : .5); + t.y -= y * k; + s.x += x * (k = 1 - k); + s.y += y * k; + } + } + if (k = alpha * gravity) { + x = size[0] / 2; + y = size[1] / 2; + i = -1; + if (k) while (++i < n) { + o = nodes[i]; + o.x += (x - o.x) * k; + o.y += (y - o.y) * k; + } + } + if (charge) { + d3_layout_forceAccumulate(q = d3.geom.quadtree(nodes), alpha, charges); + i = -1; + while (++i < n) { + if (!(o = nodes[i]).fixed) { + q.visit(repulse(o)); + } + } + } + i = -1; + while (++i < n) { + o = nodes[i]; + if (o.fixed) { + o.x = o.px; + o.y = o.py; + } else { + o.x -= (o.px - (o.px = o.x)) * friction; + o.y -= (o.py - (o.py = o.y)) * friction; + } + } + event.tick({ + type: "tick", + alpha: alpha + }); + }; + force.nodes = function(x) { + if (!arguments.length) return nodes; + nodes = x; + return force; + }; + force.links = function(x) { + if (!arguments.length) return links; + links = x; + return force; + }; + force.size = function(x) { + if (!arguments.length) return size; + size = x; + return force; + }; + force.linkDistance = function(x) { + if (!arguments.length) return linkDistance; + linkDistance = typeof x === "function" ? x : +x; + return force; + }; + force.distance = force.linkDistance; + force.linkStrength = function(x) { + if (!arguments.length) return linkStrength; + linkStrength = typeof x === "function" ? x : +x; + return force; + }; + force.friction = function(x) { + if (!arguments.length) return friction; + friction = +x; + return force; + }; + force.charge = function(x) { + if (!arguments.length) return charge; + charge = typeof x === "function" ? x : +x; + return force; + }; + force.chargeDistance = function(x) { + if (!arguments.length) return Math.sqrt(chargeDistance2); + chargeDistance2 = x * x; + return force; + }; + force.gravity = function(x) { + if (!arguments.length) return gravity; + gravity = +x; + return force; + }; + force.theta = function(x) { + if (!arguments.length) return Math.sqrt(theta2); + theta2 = x * x; + return force; + }; + force.alpha = function(x) { + if (!arguments.length) return alpha; + x = +x; + if (alpha) { + if (x > 0) { + alpha = x; + } else { + timer.c = null, timer.t = NaN, timer = null; + event.end({ + type: "end", + alpha: alpha = 0 + }); + } + } else if (x > 0) { + event.start({ + type: "start", + alpha: alpha = x + }); + timer = d3_timer(force.tick); + } + return force; + }; + force.start = function() { + var i, n = nodes.length, m = links.length, w = size[0], h = size[1], neighbors, o; + for (i = 0; i < n; ++i) { + (o = nodes[i]).index = i; + o.weight = 0; + } + for (i = 0; i < m; ++i) { + o = links[i]; + if (typeof o.source == "number") o.source = nodes[o.source]; + if (typeof o.target == "number") o.target = nodes[o.target]; + ++o.source.weight; + ++o.target.weight; + } + for (i = 0; i < n; ++i) { + o = nodes[i]; + if (isNaN(o.x)) o.x = position("x", w); + if (isNaN(o.y)) o.y = position("y", h); + if (isNaN(o.px)) o.px = o.x; + if (isNaN(o.py)) o.py = o.y; + } + distances = []; + if (typeof linkDistance === "function") for (i = 0; i < m; ++i) distances[i] = +linkDistance.call(this, links[i], i); else for (i = 0; i < m; ++i) distances[i] = linkDistance; + strengths = []; + if (typeof linkStrength === "function") for (i = 0; i < m; ++i) strengths[i] = +linkStrength.call(this, links[i], i); else for (i = 0; i < m; ++i) strengths[i] = linkStrength; + charges = []; + if (typeof charge === "function") for (i = 0; i < n; ++i) charges[i] = +charge.call(this, nodes[i], i); else for (i = 0; i < n; ++i) charges[i] = charge; + function position(dimension, size) { + if (!neighbors) { + neighbors = new Array(n); + for (j = 0; j < n; ++j) { + neighbors[j] = []; + } + for (j = 0; j < m; ++j) { + var o = links[j]; + neighbors[o.source.index].push(o.target); + neighbors[o.target.index].push(o.source); + } + } + var candidates = neighbors[i], j = -1, l = candidates.length, x; + while (++j < l) if (!isNaN(x = candidates[j][dimension])) return x; + return Math.random() * size; + } + return force.resume(); + }; + force.resume = function() { + return force.alpha(.1); + }; + force.stop = function() { + return force.alpha(0); + }; + force.drag = function() { + if (!drag) drag = d3.behavior.drag().origin(d3_identity).on("dragstart.force", d3_layout_forceDragstart).on("drag.force", dragmove).on("dragend.force", d3_layout_forceDragend); + if (!arguments.length) return drag; + this.on("mouseover.force", d3_layout_forceMouseover).on("mouseout.force", d3_layout_forceMouseout).call(drag); + }; + function dragmove(d) { + d.px = d3.event.x, d.py = d3.event.y; + force.resume(); + } + return d3.rebind(force, event, "on"); + }; + function d3_layout_forceDragstart(d) { + d.fixed |= 2; + } + function d3_layout_forceDragend(d) { + d.fixed &= ~6; + } + function d3_layout_forceMouseover(d) { + d.fixed |= 4; + d.px = d.x, d.py = d.y; + } + function d3_layout_forceMouseout(d) { + d.fixed &= ~4; + } + function d3_layout_forceAccumulate(quad, alpha, charges) { + var cx = 0, cy = 0; + quad.charge = 0; + if (!quad.leaf) { + var nodes = quad.nodes, n = nodes.length, i = -1, c; + while (++i < n) { + c = nodes[i]; + if (c == null) continue; + d3_layout_forceAccumulate(c, alpha, charges); + quad.charge += c.charge; + cx += c.charge * c.cx; + cy += c.charge * c.cy; + } + } + if (quad.point) { + if (!quad.leaf) { + quad.point.x += Math.random() - .5; + quad.point.y += Math.random() - .5; + } + var k = alpha * charges[quad.point.index]; + quad.charge += quad.pointCharge = k; + cx += k * quad.point.x; + cy += k * quad.point.y; + } + quad.cx = cx / quad.charge; + quad.cy = cy / quad.charge; + } + var d3_layout_forceLinkDistance = 20, d3_layout_forceLinkStrength = 1, d3_layout_forceChargeDistance2 = Infinity; + d3.layout.hierarchy = function() { + var sort = d3_layout_hierarchySort, children = d3_layout_hierarchyChildren, value = d3_layout_hierarchyValue; + function hierarchy(root) { + var stack = [ root ], nodes = [], node; + root.depth = 0; + while ((node = stack.pop()) != null) { + nodes.push(node); + if ((childs = children.call(hierarchy, node, node.depth)) && (n = childs.length)) { + var n, childs, child; + while (--n >= 0) { + stack.push(child = childs[n]); + child.parent = node; + child.depth = node.depth + 1; + } + if (value) node.value = 0; + node.children = childs; + } else { + if (value) node.value = +value.call(hierarchy, node, node.depth) || 0; + delete node.children; + } + } + d3_layout_hierarchyVisitAfter(root, function(node) { + var childs, parent; + if (sort && (childs = node.children)) childs.sort(sort); + if (value && (parent = node.parent)) parent.value += node.value; + }); + return nodes; + } + hierarchy.sort = function(x) { + if (!arguments.length) return sort; + sort = x; + return hierarchy; + }; + hierarchy.children = function(x) { + if (!arguments.length) return children; + children = x; + return hierarchy; + }; + hierarchy.value = function(x) { + if (!arguments.length) return value; + value = x; + return hierarchy; + }; + hierarchy.revalue = function(root) { + if (value) { + d3_layout_hierarchyVisitBefore(root, function(node) { + if (node.children) node.value = 0; + }); + d3_layout_hierarchyVisitAfter(root, function(node) { + var parent; + if (!node.children) node.value = +value.call(hierarchy, node, node.depth) || 0; + if (parent = node.parent) parent.value += node.value; + }); + } + return root; + }; + return hierarchy; + }; + function d3_layout_hierarchyRebind(object, hierarchy) { + d3.rebind(object, hierarchy, "sort", "children", "value"); + object.nodes = object; + object.links = d3_layout_hierarchyLinks; + return object; + } + function d3_layout_hierarchyVisitBefore(node, callback) { + var nodes = [ node ]; + while ((node = nodes.pop()) != null) { + callback(node); + if ((children = node.children) && (n = children.length)) { + var n, children; + while (--n >= 0) nodes.push(children[n]); + } + } + } + function d3_layout_hierarchyVisitAfter(node, callback) { + var nodes = [ node ], nodes2 = []; + while ((node = nodes.pop()) != null) { + nodes2.push(node); + if ((children = node.children) && (n = children.length)) { + var i = -1, n, children; + while (++i < n) nodes.push(children[i]); + } + } + while ((node = nodes2.pop()) != null) { + callback(node); + } + } + function d3_layout_hierarchyChildren(d) { + return d.children; + } + function d3_layout_hierarchyValue(d) { + return d.value; + } + function d3_layout_hierarchySort(a, b) { + return b.value - a.value; + } + function d3_layout_hierarchyLinks(nodes) { + return d3.merge(nodes.map(function(parent) { + return (parent.children || []).map(function(child) { + return { + source: parent, + target: child + }; + }); + })); + } + d3.layout.partition = function() { + var hierarchy = d3.layout.hierarchy(), size = [ 1, 1 ]; + function position(node, x, dx, dy) { + var children = node.children; + node.x = x; + node.y = node.depth * dy; + node.dx = dx; + node.dy = dy; + if (children && (n = children.length)) { + var i = -1, n, c, d; + dx = node.value ? dx / node.value : 0; + while (++i < n) { + position(c = children[i], x, d = c.value * dx, dy); + x += d; + } + } + } + function depth(node) { + var children = node.children, d = 0; + if (children && (n = children.length)) { + var i = -1, n; + while (++i < n) d = Math.max(d, depth(children[i])); + } + return 1 + d; + } + function partition(d, i) { + var nodes = hierarchy.call(this, d, i); + position(nodes[0], 0, size[0], size[1] / depth(nodes[0])); + return nodes; + } + partition.size = function(x) { + if (!arguments.length) return size; + size = x; + return partition; + }; + return d3_layout_hierarchyRebind(partition, hierarchy); + }; + d3.layout.pie = function() { + var value = Number, sort = d3_layout_pieSortByValue, startAngle = 0, endAngle = τ, padAngle = 0; + function pie(data) { + var n = data.length, values = data.map(function(d, i) { + return +value.call(pie, d, i); + }), a = +(typeof startAngle === "function" ? startAngle.apply(this, arguments) : startAngle), da = (typeof endAngle === "function" ? endAngle.apply(this, arguments) : endAngle) - a, p = Math.min(Math.abs(da) / n, +(typeof padAngle === "function" ? padAngle.apply(this, arguments) : padAngle)), pa = p * (da < 0 ? -1 : 1), sum = d3.sum(values), k = sum ? (da - n * pa) / sum : 0, index = d3.range(n), arcs = [], v; + if (sort != null) index.sort(sort === d3_layout_pieSortByValue ? function(i, j) { + return values[j] - values[i]; + } : function(i, j) { + return sort(data[i], data[j]); + }); + index.forEach(function(i) { + arcs[i] = { + data: data[i], + value: v = values[i], + startAngle: a, + endAngle: a += v * k + pa, + padAngle: p + }; + }); + return arcs; + } + pie.value = function(_) { + if (!arguments.length) return value; + value = _; + return pie; + }; + pie.sort = function(_) { + if (!arguments.length) return sort; + sort = _; + return pie; + }; + pie.startAngle = function(_) { + if (!arguments.length) return startAngle; + startAngle = _; + return pie; + }; + pie.endAngle = function(_) { + if (!arguments.length) return endAngle; + endAngle = _; + return pie; + }; + pie.padAngle = function(_) { + if (!arguments.length) return padAngle; + padAngle = _; + return pie; + }; + return pie; + }; + var d3_layout_pieSortByValue = {}; + d3.layout.stack = function() { + var values = d3_identity, order = d3_layout_stackOrderDefault, offset = d3_layout_stackOffsetZero, out = d3_layout_stackOut, x = d3_layout_stackX, y = d3_layout_stackY; + function stack(data, index) { + if (!(n = data.length)) return data; + var series = data.map(function(d, i) { + return values.call(stack, d, i); + }); + var points = series.map(function(d) { + return d.map(function(v, i) { + return [ x.call(stack, v, i), y.call(stack, v, i) ]; + }); + }); + var orders = order.call(stack, points, index); + series = d3.permute(series, orders); + points = d3.permute(points, orders); + var offsets = offset.call(stack, points, index); + var m = series[0].length, n, i, j, o; + for (j = 0; j < m; ++j) { + out.call(stack, series[0][j], o = offsets[j], points[0][j][1]); + for (i = 1; i < n; ++i) { + out.call(stack, series[i][j], o += points[i - 1][j][1], points[i][j][1]); + } + } + return data; + } + stack.values = function(x) { + if (!arguments.length) return values; + values = x; + return stack; + }; + stack.order = function(x) { + if (!arguments.length) return order; + order = typeof x === "function" ? x : d3_layout_stackOrders.get(x) || d3_layout_stackOrderDefault; + return stack; + }; + stack.offset = function(x) { + if (!arguments.length) return offset; + offset = typeof x === "function" ? x : d3_layout_stackOffsets.get(x) || d3_layout_stackOffsetZero; + return stack; + }; + stack.x = function(z) { + if (!arguments.length) return x; + x = z; + return stack; + }; + stack.y = function(z) { + if (!arguments.length) return y; + y = z; + return stack; + }; + stack.out = function(z) { + if (!arguments.length) return out; + out = z; + return stack; + }; + return stack; + }; + function d3_layout_stackX(d) { + return d.x; + } + function d3_layout_stackY(d) { + return d.y; + } + function d3_layout_stackOut(d, y0, y) { + d.y0 = y0; + d.y = y; + } + var d3_layout_stackOrders = d3.map({ + "inside-out": function(data) { + var n = data.length, i, j, max = data.map(d3_layout_stackMaxIndex), sums = data.map(d3_layout_stackReduceSum), index = d3.range(n).sort(function(a, b) { + return max[a] - max[b]; + }), top = 0, bottom = 0, tops = [], bottoms = []; + for (i = 0; i < n; ++i) { + j = index[i]; + if (top < bottom) { + top += sums[j]; + tops.push(j); + } else { + bottom += sums[j]; + bottoms.push(j); + } + } + return bottoms.reverse().concat(tops); + }, + reverse: function(data) { + return d3.range(data.length).reverse(); + }, + "default": d3_layout_stackOrderDefault + }); + var d3_layout_stackOffsets = d3.map({ + silhouette: function(data) { + var n = data.length, m = data[0].length, sums = [], max = 0, i, j, o, y0 = []; + for (j = 0; j < m; ++j) { + for (i = 0, o = 0; i < n; i++) o += data[i][j][1]; + if (o > max) max = o; + sums.push(o); + } + for (j = 0; j < m; ++j) { + y0[j] = (max - sums[j]) / 2; + } + return y0; + }, + wiggle: function(data) { + var n = data.length, x = data[0], m = x.length, i, j, k, s1, s2, s3, dx, o, o0, y0 = []; + y0[0] = o = o0 = 0; + for (j = 1; j < m; ++j) { + for (i = 0, s1 = 0; i < n; ++i) s1 += data[i][j][1]; + for (i = 0, s2 = 0, dx = x[j][0] - x[j - 1][0]; i < n; ++i) { + for (k = 0, s3 = (data[i][j][1] - data[i][j - 1][1]) / (2 * dx); k < i; ++k) { + s3 += (data[k][j][1] - data[k][j - 1][1]) / dx; + } + s2 += s3 * data[i][j][1]; + } + y0[j] = o -= s1 ? s2 / s1 * dx : 0; + if (o < o0) o0 = o; + } + for (j = 0; j < m; ++j) y0[j] -= o0; + return y0; + }, + expand: function(data) { + var n = data.length, m = data[0].length, k = 1 / n, i, j, o, y0 = []; + for (j = 0; j < m; ++j) { + for (i = 0, o = 0; i < n; i++) o += data[i][j][1]; + if (o) for (i = 0; i < n; i++) data[i][j][1] /= o; else for (i = 0; i < n; i++) data[i][j][1] = k; + } + for (j = 0; j < m; ++j) y0[j] = 0; + return y0; + }, + zero: d3_layout_stackOffsetZero + }); + function d3_layout_stackOrderDefault(data) { + return d3.range(data.length); + } + function d3_layout_stackOffsetZero(data) { + var j = -1, m = data[0].length, y0 = []; + while (++j < m) y0[j] = 0; + return y0; + } + function d3_layout_stackMaxIndex(array) { + var i = 1, j = 0, v = array[0][1], k, n = array.length; + for (;i < n; ++i) { + if ((k = array[i][1]) > v) { + j = i; + v = k; + } + } + return j; + } + function d3_layout_stackReduceSum(d) { + return d.reduce(d3_layout_stackSum, 0); + } + function d3_layout_stackSum(p, d) { + return p + d[1]; + } + d3.layout.histogram = function() { + var frequency = true, valuer = Number, ranger = d3_layout_histogramRange, binner = d3_layout_histogramBinSturges; + function histogram(data, i) { + var bins = [], values = data.map(valuer, this), range = ranger.call(this, values, i), thresholds = binner.call(this, range, values, i), bin, i = -1, n = values.length, m = thresholds.length - 1, k = frequency ? 1 : 1 / n, x; + while (++i < m) { + bin = bins[i] = []; + bin.dx = thresholds[i + 1] - (bin.x = thresholds[i]); + bin.y = 0; + } + if (m > 0) { + i = -1; + while (++i < n) { + x = values[i]; + if (x >= range[0] && x <= range[1]) { + bin = bins[d3.bisect(thresholds, x, 1, m) - 1]; + bin.y += k; + bin.push(data[i]); + } + } + } + return bins; + } + histogram.value = function(x) { + if (!arguments.length) return valuer; + valuer = x; + return histogram; + }; + histogram.range = function(x) { + if (!arguments.length) return ranger; + ranger = d3_functor(x); + return histogram; + }; + histogram.bins = function(x) { + if (!arguments.length) return binner; + binner = typeof x === "number" ? function(range) { + return d3_layout_histogramBinFixed(range, x); + } : d3_functor(x); + return histogram; + }; + histogram.frequency = function(x) { + if (!arguments.length) return frequency; + frequency = !!x; + return histogram; + }; + return histogram; + }; + function d3_layout_histogramBinSturges(range, values) { + return d3_layout_histogramBinFixed(range, Math.ceil(Math.log(values.length) / Math.LN2 + 1)); + } + function d3_layout_histogramBinFixed(range, n) { + var x = -1, b = +range[0], m = (range[1] - b) / n, f = []; + while (++x <= n) f[x] = m * x + b; + return f; + } + function d3_layout_histogramRange(values) { + return [ d3.min(values), d3.max(values) ]; + } + d3.layout.pack = function() { + var hierarchy = d3.layout.hierarchy().sort(d3_layout_packSort), padding = 0, size = [ 1, 1 ], radius; + function pack(d, i) { + var nodes = hierarchy.call(this, d, i), root = nodes[0], w = size[0], h = size[1], r = radius == null ? Math.sqrt : typeof radius === "function" ? radius : function() { + return radius; + }; + root.x = root.y = 0; + d3_layout_hierarchyVisitAfter(root, function(d) { + d.r = +r(d.value); + }); + d3_layout_hierarchyVisitAfter(root, d3_layout_packSiblings); + if (padding) { + var dr = padding * (radius ? 1 : Math.max(2 * root.r / w, 2 * root.r / h)) / 2; + d3_layout_hierarchyVisitAfter(root, function(d) { + d.r += dr; + }); + d3_layout_hierarchyVisitAfter(root, d3_layout_packSiblings); + d3_layout_hierarchyVisitAfter(root, function(d) { + d.r -= dr; + }); + } + d3_layout_packTransform(root, w / 2, h / 2, radius ? 1 : 1 / Math.max(2 * root.r / w, 2 * root.r / h)); + return nodes; + } + pack.size = function(_) { + if (!arguments.length) return size; + size = _; + return pack; + }; + pack.radius = function(_) { + if (!arguments.length) return radius; + radius = _ == null || typeof _ === "function" ? _ : +_; + return pack; + }; + pack.padding = function(_) { + if (!arguments.length) return padding; + padding = +_; + return pack; + }; + return d3_layout_hierarchyRebind(pack, hierarchy); + }; + function d3_layout_packSort(a, b) { + return a.value - b.value; + } + function d3_layout_packInsert(a, b) { + var c = a._pack_next; + a._pack_next = b; + b._pack_prev = a; + b._pack_next = c; + c._pack_prev = b; + } + function d3_layout_packSplice(a, b) { + a._pack_next = b; + b._pack_prev = a; + } + function d3_layout_packIntersects(a, b) { + var dx = b.x - a.x, dy = b.y - a.y, dr = a.r + b.r; + return .999 * dr * dr > dx * dx + dy * dy; + } + function d3_layout_packSiblings(node) { + if (!(nodes = node.children) || !(n = nodes.length)) return; + var nodes, xMin = Infinity, xMax = -Infinity, yMin = Infinity, yMax = -Infinity, a, b, c, i, j, k, n; + function bound(node) { + xMin = Math.min(node.x - node.r, xMin); + xMax = Math.max(node.x + node.r, xMax); + yMin = Math.min(node.y - node.r, yMin); + yMax = Math.max(node.y + node.r, yMax); + } + nodes.forEach(d3_layout_packLink); + a = nodes[0]; + a.x = -a.r; + a.y = 0; + bound(a); + if (n > 1) { + b = nodes[1]; + b.x = b.r; + b.y = 0; + bound(b); + if (n > 2) { + c = nodes[2]; + d3_layout_packPlace(a, b, c); + bound(c); + d3_layout_packInsert(a, c); + a._pack_prev = c; + d3_layout_packInsert(c, b); + b = a._pack_next; + for (i = 3; i < n; i++) { + d3_layout_packPlace(a, b, c = nodes[i]); + var isect = 0, s1 = 1, s2 = 1; + for (j = b._pack_next; j !== b; j = j._pack_next, s1++) { + if (d3_layout_packIntersects(j, c)) { + isect = 1; + break; + } + } + if (isect == 1) { + for (k = a._pack_prev; k !== j._pack_prev; k = k._pack_prev, s2++) { + if (d3_layout_packIntersects(k, c)) { + break; + } + } + } + if (isect) { + if (s1 < s2 || s1 == s2 && b.r < a.r) d3_layout_packSplice(a, b = j); else d3_layout_packSplice(a = k, b); + i--; + } else { + d3_layout_packInsert(a, c); + b = c; + bound(c); + } + } + } + } + var cx = (xMin + xMax) / 2, cy = (yMin + yMax) / 2, cr = 0; + for (i = 0; i < n; i++) { + c = nodes[i]; + c.x -= cx; + c.y -= cy; + cr = Math.max(cr, c.r + Math.sqrt(c.x * c.x + c.y * c.y)); + } + node.r = cr; + nodes.forEach(d3_layout_packUnlink); + } + function d3_layout_packLink(node) { + node._pack_next = node._pack_prev = node; + } + function d3_layout_packUnlink(node) { + delete node._pack_next; + delete node._pack_prev; + } + function d3_layout_packTransform(node, x, y, k) { + var children = node.children; + node.x = x += k * node.x; + node.y = y += k * node.y; + node.r *= k; + if (children) { + var i = -1, n = children.length; + while (++i < n) d3_layout_packTransform(children[i], x, y, k); + } + } + function d3_layout_packPlace(a, b, c) { + var db = a.r + c.r, dx = b.x - a.x, dy = b.y - a.y; + if (db && (dx || dy)) { + var da = b.r + c.r, dc = dx * dx + dy * dy; + da *= da; + db *= db; + var x = .5 + (db - da) / (2 * dc), y = Math.sqrt(Math.max(0, 2 * da * (db + dc) - (db -= dc) * db - da * da)) / (2 * dc); + c.x = a.x + x * dx + y * dy; + c.y = a.y + x * dy - y * dx; + } else { + c.x = a.x + db; + c.y = a.y; + } + } + d3.layout.tree = function() { + var hierarchy = d3.layout.hierarchy().sort(null).value(null), separation = d3_layout_treeSeparation, size = [ 1, 1 ], nodeSize = null; + function tree(d, i) { + var nodes = hierarchy.call(this, d, i), root0 = nodes[0], root1 = wrapTree(root0); + d3_layout_hierarchyVisitAfter(root1, firstWalk), root1.parent.m = -root1.z; + d3_layout_hierarchyVisitBefore(root1, secondWalk); + if (nodeSize) d3_layout_hierarchyVisitBefore(root0, sizeNode); else { + var left = root0, right = root0, bottom = root0; + d3_layout_hierarchyVisitBefore(root0, function(node) { + if (node.x < left.x) left = node; + if (node.x > right.x) right = node; + if (node.depth > bottom.depth) bottom = node; + }); + var tx = separation(left, right) / 2 - left.x, kx = size[0] / (right.x + separation(right, left) / 2 + tx), ky = size[1] / (bottom.depth || 1); + d3_layout_hierarchyVisitBefore(root0, function(node) { + node.x = (node.x + tx) * kx; + node.y = node.depth * ky; + }); + } + return nodes; + } + function wrapTree(root0) { + var root1 = { + A: null, + children: [ root0 ] + }, queue = [ root1 ], node1; + while ((node1 = queue.pop()) != null) { + for (var children = node1.children, child, i = 0, n = children.length; i < n; ++i) { + queue.push((children[i] = child = { + _: children[i], + parent: node1, + children: (child = children[i].children) && child.slice() || [], + A: null, + a: null, + z: 0, + m: 0, + c: 0, + s: 0, + t: null, + i: i + }).a = child); + } + } + return root1.children[0]; + } + function firstWalk(v) { + var children = v.children, siblings = v.parent.children, w = v.i ? siblings[v.i - 1] : null; + if (children.length) { + d3_layout_treeShift(v); + var midpoint = (children[0].z + children[children.length - 1].z) / 2; + if (w) { + v.z = w.z + separation(v._, w._); + v.m = v.z - midpoint; + } else { + v.z = midpoint; + } + } else if (w) { + v.z = w.z + separation(v._, w._); + } + v.parent.A = apportion(v, w, v.parent.A || siblings[0]); + } + function secondWalk(v) { + v._.x = v.z + v.parent.m; + v.m += v.parent.m; + } + function apportion(v, w, ancestor) { + if (w) { + var vip = v, vop = v, vim = w, vom = vip.parent.children[0], sip = vip.m, sop = vop.m, sim = vim.m, som = vom.m, shift; + while (vim = d3_layout_treeRight(vim), vip = d3_layout_treeLeft(vip), vim && vip) { + vom = d3_layout_treeLeft(vom); + vop = d3_layout_treeRight(vop); + vop.a = v; + shift = vim.z + sim - vip.z - sip + separation(vim._, vip._); + if (shift > 0) { + d3_layout_treeMove(d3_layout_treeAncestor(vim, v, ancestor), v, shift); + sip += shift; + sop += shift; + } + sim += vim.m; + sip += vip.m; + som += vom.m; + sop += vop.m; + } + if (vim && !d3_layout_treeRight(vop)) { + vop.t = vim; + vop.m += sim - sop; + } + if (vip && !d3_layout_treeLeft(vom)) { + vom.t = vip; + vom.m += sip - som; + ancestor = v; + } + } + return ancestor; + } + function sizeNode(node) { + node.x *= size[0]; + node.y = node.depth * size[1]; + } + tree.separation = function(x) { + if (!arguments.length) return separation; + separation = x; + return tree; + }; + tree.size = function(x) { + if (!arguments.length) return nodeSize ? null : size; + nodeSize = (size = x) == null ? sizeNode : null; + return tree; + }; + tree.nodeSize = function(x) { + if (!arguments.length) return nodeSize ? size : null; + nodeSize = (size = x) == null ? null : sizeNode; + return tree; + }; + return d3_layout_hierarchyRebind(tree, hierarchy); + }; + function d3_layout_treeSeparation(a, b) { + return a.parent == b.parent ? 1 : 2; + } + function d3_layout_treeLeft(v) { + var children = v.children; + return children.length ? children[0] : v.t; + } + function d3_layout_treeRight(v) { + var children = v.children, n; + return (n = children.length) ? children[n - 1] : v.t; + } + function d3_layout_treeMove(wm, wp, shift) { + var change = shift / (wp.i - wm.i); + wp.c -= change; + wp.s += shift; + wm.c += change; + wp.z += shift; + wp.m += shift; + } + function d3_layout_treeShift(v) { + var shift = 0, change = 0, children = v.children, i = children.length, w; + while (--i >= 0) { + w = children[i]; + w.z += shift; + w.m += shift; + shift += w.s + (change += w.c); + } + } + function d3_layout_treeAncestor(vim, v, ancestor) { + return vim.a.parent === v.parent ? vim.a : ancestor; + } + d3.layout.cluster = function() { + var hierarchy = d3.layout.hierarchy().sort(null).value(null), separation = d3_layout_treeSeparation, size = [ 1, 1 ], nodeSize = false; + function cluster(d, i) { + var nodes = hierarchy.call(this, d, i), root = nodes[0], previousNode, x = 0; + d3_layout_hierarchyVisitAfter(root, function(node) { + var children = node.children; + if (children && children.length) { + node.x = d3_layout_clusterX(children); + node.y = d3_layout_clusterY(children); + } else { + node.x = previousNode ? x += separation(node, previousNode) : 0; + node.y = 0; + previousNode = node; + } + }); + var left = d3_layout_clusterLeft(root), right = d3_layout_clusterRight(root), x0 = left.x - separation(left, right) / 2, x1 = right.x + separation(right, left) / 2; + d3_layout_hierarchyVisitAfter(root, nodeSize ? function(node) { + node.x = (node.x - root.x) * size[0]; + node.y = (root.y - node.y) * size[1]; + } : function(node) { + node.x = (node.x - x0) / (x1 - x0) * size[0]; + node.y = (1 - (root.y ? node.y / root.y : 1)) * size[1]; + }); + return nodes; + } + cluster.separation = function(x) { + if (!arguments.length) return separation; + separation = x; + return cluster; + }; + cluster.size = function(x) { + if (!arguments.length) return nodeSize ? null : size; + nodeSize = (size = x) == null; + return cluster; + }; + cluster.nodeSize = function(x) { + if (!arguments.length) return nodeSize ? size : null; + nodeSize = (size = x) != null; + return cluster; + }; + return d3_layout_hierarchyRebind(cluster, hierarchy); + }; + function d3_layout_clusterY(children) { + return 1 + d3.max(children, function(child) { + return child.y; + }); + } + function d3_layout_clusterX(children) { + return children.reduce(function(x, child) { + return x + child.x; + }, 0) / children.length; + } + function d3_layout_clusterLeft(node) { + var children = node.children; + return children && children.length ? d3_layout_clusterLeft(children[0]) : node; + } + function d3_layout_clusterRight(node) { + var children = node.children, n; + return children && (n = children.length) ? d3_layout_clusterRight(children[n - 1]) : node; + } + d3.layout.treemap = function() { + var hierarchy = d3.layout.hierarchy(), round = Math.round, size = [ 1, 1 ], padding = null, pad = d3_layout_treemapPadNull, sticky = false, stickies, mode = "squarify", ratio = .5 * (1 + Math.sqrt(5)); + function scale(children, k) { + var i = -1, n = children.length, child, area; + while (++i < n) { + area = (child = children[i]).value * (k < 0 ? 0 : k); + child.area = isNaN(area) || area <= 0 ? 0 : area; + } + } + function squarify(node) { + var children = node.children; + if (children && children.length) { + var rect = pad(node), row = [], remaining = children.slice(), child, best = Infinity, score, u = mode === "slice" ? rect.dx : mode === "dice" ? rect.dy : mode === "slice-dice" ? node.depth & 1 ? rect.dy : rect.dx : Math.min(rect.dx, rect.dy), n; + scale(remaining, rect.dx * rect.dy / node.value); + row.area = 0; + while ((n = remaining.length) > 0) { + row.push(child = remaining[n - 1]); + row.area += child.area; + if (mode !== "squarify" || (score = worst(row, u)) <= best) { + remaining.pop(); + best = score; + } else { + row.area -= row.pop().area; + position(row, u, rect, false); + u = Math.min(rect.dx, rect.dy); + row.length = row.area = 0; + best = Infinity; + } + } + if (row.length) { + position(row, u, rect, true); + row.length = row.area = 0; + } + children.forEach(squarify); + } + } + function stickify(node) { + var children = node.children; + if (children && children.length) { + var rect = pad(node), remaining = children.slice(), child, row = []; + scale(remaining, rect.dx * rect.dy / node.value); + row.area = 0; + while (child = remaining.pop()) { + row.push(child); + row.area += child.area; + if (child.z != null) { + position(row, child.z ? rect.dx : rect.dy, rect, !remaining.length); + row.length = row.area = 0; + } + } + children.forEach(stickify); + } + } + function worst(row, u) { + var s = row.area, r, rmax = 0, rmin = Infinity, i = -1, n = row.length; + while (++i < n) { + if (!(r = row[i].area)) continue; + if (r < rmin) rmin = r; + if (r > rmax) rmax = r; + } + s *= s; + u *= u; + return s ? Math.max(u * rmax * ratio / s, s / (u * rmin * ratio)) : Infinity; + } + function position(row, u, rect, flush) { + var i = -1, n = row.length, x = rect.x, y = rect.y, v = u ? round(row.area / u) : 0, o; + if (u == rect.dx) { + if (flush || v > rect.dy) v = rect.dy; + while (++i < n) { + o = row[i]; + o.x = x; + o.y = y; + o.dy = v; + x += o.dx = Math.min(rect.x + rect.dx - x, v ? round(o.area / v) : 0); + } + o.z = true; + o.dx += rect.x + rect.dx - x; + rect.y += v; + rect.dy -= v; + } else { + if (flush || v > rect.dx) v = rect.dx; + while (++i < n) { + o = row[i]; + o.x = x; + o.y = y; + o.dx = v; + y += o.dy = Math.min(rect.y + rect.dy - y, v ? round(o.area / v) : 0); + } + o.z = false; + o.dy += rect.y + rect.dy - y; + rect.x += v; + rect.dx -= v; + } + } + function treemap(d) { + var nodes = stickies || hierarchy(d), root = nodes[0]; + root.x = root.y = 0; + if (root.value) root.dx = size[0], root.dy = size[1]; else root.dx = root.dy = 0; + if (stickies) hierarchy.revalue(root); + scale([ root ], root.dx * root.dy / root.value); + (stickies ? stickify : squarify)(root); + if (sticky) stickies = nodes; + return nodes; + } + treemap.size = function(x) { + if (!arguments.length) return size; + size = x; + return treemap; + }; + treemap.padding = function(x) { + if (!arguments.length) return padding; + function padFunction(node) { + var p = x.call(treemap, node, node.depth); + return p == null ? d3_layout_treemapPadNull(node) : d3_layout_treemapPad(node, typeof p === "number" ? [ p, p, p, p ] : p); + } + function padConstant(node) { + return d3_layout_treemapPad(node, x); + } + var type; + pad = (padding = x) == null ? d3_layout_treemapPadNull : (type = typeof x) === "function" ? padFunction : type === "number" ? (x = [ x, x, x, x ], + padConstant) : padConstant; + return treemap; + }; + treemap.round = function(x) { + if (!arguments.length) return round != Number; + round = x ? Math.round : Number; + return treemap; + }; + treemap.sticky = function(x) { + if (!arguments.length) return sticky; + sticky = x; + stickies = null; + return treemap; + }; + treemap.ratio = function(x) { + if (!arguments.length) return ratio; + ratio = x; + return treemap; + }; + treemap.mode = function(x) { + if (!arguments.length) return mode; + mode = x + ""; + return treemap; + }; + return d3_layout_hierarchyRebind(treemap, hierarchy); + }; + function d3_layout_treemapPadNull(node) { + return { + x: node.x, + y: node.y, + dx: node.dx, + dy: node.dy + }; + } + function d3_layout_treemapPad(node, padding) { + var x = node.x + padding[3], y = node.y + padding[0], dx = node.dx - padding[1] - padding[3], dy = node.dy - padding[0] - padding[2]; + if (dx < 0) { + x += dx / 2; + dx = 0; + } + if (dy < 0) { + y += dy / 2; + dy = 0; + } + return { + x: x, + y: y, + dx: dx, + dy: dy + }; + } + d3.random = { + normal: function(µ, σ) { + var n = arguments.length; + if (n < 2) σ = 1; + if (n < 1) µ = 0; + return function() { + var x, y, r; + do { + x = Math.random() * 2 - 1; + y = Math.random() * 2 - 1; + r = x * x + y * y; + } while (!r || r > 1); + return µ + σ * x * Math.sqrt(-2 * Math.log(r) / r); + }; + }, + logNormal: function() { + var random = d3.random.normal.apply(d3, arguments); + return function() { + return Math.exp(random()); + }; + }, + bates: function(m) { + var random = d3.random.irwinHall(m); + return function() { + return random() / m; + }; + }, + irwinHall: function(m) { + return function() { + for (var s = 0, j = 0; j < m; j++) s += Math.random(); + return s; + }; + } + }; + d3.scale = {}; + function d3_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [ start, stop ] : [ stop, start ]; + } + function d3_scaleRange(scale) { + return scale.rangeExtent ? scale.rangeExtent() : d3_scaleExtent(scale.range()); + } + function d3_scale_bilinear(domain, range, uninterpolate, interpolate) { + var u = uninterpolate(domain[0], domain[1]), i = interpolate(range[0], range[1]); + return function(x) { + return i(u(x)); + }; + } + function d3_scale_nice(domain, nice) { + var i0 = 0, i1 = domain.length - 1, x0 = domain[i0], x1 = domain[i1], dx; + if (x1 < x0) { + dx = i0, i0 = i1, i1 = dx; + dx = x0, x0 = x1, x1 = dx; + } + domain[i0] = nice.floor(x0); + domain[i1] = nice.ceil(x1); + return domain; + } + function d3_scale_niceStep(step) { + return step ? { + floor: function(x) { + return Math.floor(x / step) * step; + }, + ceil: function(x) { + return Math.ceil(x / step) * step; + } + } : d3_scale_niceIdentity; + } + var d3_scale_niceIdentity = { + floor: d3_identity, + ceil: d3_identity + }; + function d3_scale_polylinear(domain, range, uninterpolate, interpolate) { + var u = [], i = [], j = 0, k = Math.min(domain.length, range.length) - 1; + if (domain[k] < domain[0]) { + domain = domain.slice().reverse(); + range = range.slice().reverse(); + } + while (++j <= k) { + u.push(uninterpolate(domain[j - 1], domain[j])); + i.push(interpolate(range[j - 1], range[j])); + } + return function(x) { + var j = d3.bisect(domain, x, 1, k) - 1; + return i[j](u[j](x)); + }; + } + d3.scale.linear = function() { + return d3_scale_linear([ 0, 1 ], [ 0, 1 ], d3_interpolate, false); + }; + function d3_scale_linear(domain, range, interpolate, clamp) { + var output, input; + function rescale() { + var linear = Math.min(domain.length, range.length) > 2 ? d3_scale_polylinear : d3_scale_bilinear, uninterpolate = clamp ? d3_uninterpolateClamp : d3_uninterpolateNumber; + output = linear(domain, range, uninterpolate, interpolate); + input = linear(range, domain, uninterpolate, d3_interpolate); + return scale; + } + function scale(x) { + return output(x); + } + scale.invert = function(y) { + return input(y); + }; + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.map(Number); + return rescale(); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + scale.rangeRound = function(x) { + return scale.range(x).interpolate(d3_interpolateRound); + }; + scale.clamp = function(x) { + if (!arguments.length) return clamp; + clamp = x; + return rescale(); + }; + scale.interpolate = function(x) { + if (!arguments.length) return interpolate; + interpolate = x; + return rescale(); + }; + scale.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + scale.tickFormat = function(m, format) { + return d3_scale_linearTickFormat(domain, m, format); + }; + scale.nice = function(m) { + d3_scale_linearNice(domain, m); + return rescale(); + }; + scale.copy = function() { + return d3_scale_linear(domain, range, interpolate, clamp); + }; + return rescale(); + } + function d3_scale_linearRebind(scale, linear) { + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); + } + function d3_scale_linearNice(domain, m) { + d3_scale_nice(domain, d3_scale_niceStep(d3_scale_linearTickRange(domain, m)[2])); + d3_scale_nice(domain, d3_scale_niceStep(d3_scale_linearTickRange(domain, m)[2])); + return domain; + } + function d3_scale_linearTickRange(domain, m) { + if (m == null) m = 10; + var extent = d3_scaleExtent(domain), span = extent[1] - extent[0], step = Math.pow(10, Math.floor(Math.log(span / m) / Math.LN10)), err = m / span * step; + if (err <= .15) step *= 10; else if (err <= .35) step *= 5; else if (err <= .75) step *= 2; + extent[0] = Math.ceil(extent[0] / step) * step; + extent[1] = Math.floor(extent[1] / step) * step + step * .5; + extent[2] = step; + return extent; + } + function d3_scale_linearTicks(domain, m) { + return d3.range.apply(d3, d3_scale_linearTickRange(domain, m)); + } + function d3_scale_linearTickFormat(domain, m, format) { + var range = d3_scale_linearTickRange(domain, m); + if (format) { + var match = d3_format_re.exec(format); + match.shift(); + if (match[8] === "s") { + var prefix = d3.formatPrefix(Math.max(abs(range[0]), abs(range[1]))); + if (!match[7]) match[7] = "." + d3_scale_linearPrecision(prefix.scale(range[2])); + match[8] = "f"; + format = d3.format(match.join("")); + return function(d) { + return format(prefix.scale(d)) + prefix.symbol; + }; + } + if (!match[7]) match[7] = "." + d3_scale_linearFormatPrecision(match[8], range); + format = match.join(""); + } else { + format = ",." + d3_scale_linearPrecision(range[2]) + "f"; + } + return d3.format(format); + } + var d3_scale_linearFormatSignificant = { + s: 1, + g: 1, + p: 1, + r: 1, + e: 1 + }; + function d3_scale_linearPrecision(value) { + return -Math.floor(Math.log(value) / Math.LN10 + .01); + } + function d3_scale_linearFormatPrecision(type, range) { + var p = d3_scale_linearPrecision(range[2]); + return type in d3_scale_linearFormatSignificant ? Math.abs(p - d3_scale_linearPrecision(Math.max(abs(range[0]), abs(range[1])))) + +(type !== "e") : p - (type === "%") * 2; + } + d3.scale.log = function() { + return d3_scale_log(d3.scale.linear().domain([ 0, 1 ]), 10, true, [ 1, 10 ]); + }; + function d3_scale_log(linear, base, positive, domain) { + function log(x) { + return (positive ? Math.log(x < 0 ? 0 : x) : -Math.log(x > 0 ? 0 : -x)) / Math.log(base); + } + function pow(x) { + return positive ? Math.pow(base, x) : -Math.pow(base, -x); + } + function scale(x) { + return linear(log(x)); + } + scale.invert = function(x) { + return pow(linear.invert(x)); + }; + scale.domain = function(x) { + if (!arguments.length) return domain; + positive = x[0] >= 0; + linear.domain((domain = x.map(Number)).map(log)); + return scale; + }; + scale.base = function(_) { + if (!arguments.length) return base; + base = +_; + linear.domain(domain.map(log)); + return scale; + }; + scale.nice = function() { + var niced = d3_scale_nice(domain.map(log), positive ? Math : d3_scale_logNiceNegative); + linear.domain(niced); + domain = niced.map(pow); + return scale; + }; + scale.ticks = function() { + var extent = d3_scaleExtent(domain), ticks = [], u = extent[0], v = extent[1], i = Math.floor(log(u)), j = Math.ceil(log(v)), n = base % 1 ? 2 : base; + if (isFinite(j - i)) { + if (positive) { + for (;i < j; i++) for (var k = 1; k < n; k++) ticks.push(pow(i) * k); + ticks.push(pow(i)); + } else { + ticks.push(pow(i)); + for (;i++ < j; ) for (var k = n - 1; k > 0; k--) ticks.push(pow(i) * k); + } + for (i = 0; ticks[i] < u; i++) {} + for (j = ticks.length; ticks[j - 1] > v; j--) {} + ticks = ticks.slice(i, j); + } + return ticks; + }; + scale.tickFormat = function(n, format) { + if (!arguments.length) return d3_scale_logFormat; + if (arguments.length < 2) format = d3_scale_logFormat; else if (typeof format !== "function") format = d3.format(format); + var k = Math.max(1, base * n / scale.ticks().length); + return function(d) { + var i = d / pow(Math.round(log(d))); + if (i * base < base - .5) i *= base; + return i <= k ? format(d) : ""; + }; + }; + scale.copy = function() { + return d3_scale_log(linear.copy(), base, positive, domain); + }; + return d3_scale_linearRebind(scale, linear); + } + var d3_scale_logFormat = d3.format(".0e"), d3_scale_logNiceNegative = { + floor: function(x) { + return -Math.ceil(-x); + }, + ceil: function(x) { + return -Math.floor(-x); + } + }; + d3.scale.pow = function() { + return d3_scale_pow(d3.scale.linear(), 1, [ 0, 1 ]); + }; + function d3_scale_pow(linear, exponent, domain) { + var powp = d3_scale_powPow(exponent), powb = d3_scale_powPow(1 / exponent); + function scale(x) { + return linear(powp(x)); + } + scale.invert = function(x) { + return powb(linear.invert(x)); + }; + scale.domain = function(x) { + if (!arguments.length) return domain; + linear.domain((domain = x.map(Number)).map(powp)); + return scale; + }; + scale.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + scale.tickFormat = function(m, format) { + return d3_scale_linearTickFormat(domain, m, format); + }; + scale.nice = function(m) { + return scale.domain(d3_scale_linearNice(domain, m)); + }; + scale.exponent = function(x) { + if (!arguments.length) return exponent; + powp = d3_scale_powPow(exponent = x); + powb = d3_scale_powPow(1 / exponent); + linear.domain(domain.map(powp)); + return scale; + }; + scale.copy = function() { + return d3_scale_pow(linear.copy(), exponent, domain); + }; + return d3_scale_linearRebind(scale, linear); + } + function d3_scale_powPow(e) { + return function(x) { + return x < 0 ? -Math.pow(-x, e) : Math.pow(x, e); + }; + } + d3.scale.sqrt = function() { + return d3.scale.pow().exponent(.5); + }; + d3.scale.ordinal = function() { + return d3_scale_ordinal([], { + t: "range", + a: [ [] ] + }); + }; + function d3_scale_ordinal(domain, ranger) { + var index, range, rangeBand; + function scale(x) { + return range[((index.get(x) || (ranger.t === "range" ? index.set(x, domain.push(x)) : NaN)) - 1) % range.length]; + } + function steps(start, step) { + return d3.range(domain.length).map(function(i) { + return start + step * i; + }); + } + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = []; + index = new d3_Map(); + var i = -1, n = x.length, xi; + while (++i < n) if (!index.has(xi = x[i])) index.set(xi, domain.push(xi)); + return scale[ranger.t].apply(scale, ranger.a); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + rangeBand = 0; + ranger = { + t: "range", + a: arguments + }; + return scale; + }; + scale.rangePoints = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], stop = x[1], step = domain.length < 2 ? (start = (start + stop) / 2, + 0) : (stop - start) / (domain.length - 1 + padding); + range = steps(start + step * padding / 2, step); + rangeBand = 0; + ranger = { + t: "rangePoints", + a: arguments + }; + return scale; + }; + scale.rangeRoundPoints = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], stop = x[1], step = domain.length < 2 ? (start = stop = Math.round((start + stop) / 2), + 0) : (stop - start) / (domain.length - 1 + padding) | 0; + range = steps(start + Math.round(step * padding / 2 + (stop - start - (domain.length - 1 + padding) * step) / 2), step); + rangeBand = 0; + ranger = { + t: "rangeRoundPoints", + a: arguments + }; + return scale; + }; + scale.rangeBands = function(x, padding, outerPadding) { + if (arguments.length < 2) padding = 0; + if (arguments.length < 3) outerPadding = padding; + var reverse = x[1] < x[0], start = x[reverse - 0], stop = x[1 - reverse], step = (stop - start) / (domain.length - padding + 2 * outerPadding); + range = steps(start + step * outerPadding, step); + if (reverse) range.reverse(); + rangeBand = step * (1 - padding); + ranger = { + t: "rangeBands", + a: arguments + }; + return scale; + }; + scale.rangeRoundBands = function(x, padding, outerPadding) { + if (arguments.length < 2) padding = 0; + if (arguments.length < 3) outerPadding = padding; + var reverse = x[1] < x[0], start = x[reverse - 0], stop = x[1 - reverse], step = Math.floor((stop - start) / (domain.length - padding + 2 * outerPadding)); + range = steps(start + Math.round((stop - start - (domain.length - padding) * step) / 2), step); + if (reverse) range.reverse(); + rangeBand = Math.round(step * (1 - padding)); + ranger = { + t: "rangeRoundBands", + a: arguments + }; + return scale; + }; + scale.rangeBand = function() { + return rangeBand; + }; + scale.rangeExtent = function() { + return d3_scaleExtent(ranger.a[0]); + }; + scale.copy = function() { + return d3_scale_ordinal(domain, ranger); + }; + return scale.domain(domain); + } + d3.scale.category10 = function() { + return d3.scale.ordinal().range(d3_category10); + }; + d3.scale.category20 = function() { + return d3.scale.ordinal().range(d3_category20); + }; + d3.scale.category20b = function() { + return d3.scale.ordinal().range(d3_category20b); + }; + d3.scale.category20c = function() { + return d3.scale.ordinal().range(d3_category20c); + }; + var d3_category10 = [ 2062260, 16744206, 2924588, 14034728, 9725885, 9197131, 14907330, 8355711, 12369186, 1556175 ].map(d3_rgbString); + var d3_category20 = [ 2062260, 11454440, 16744206, 16759672, 2924588, 10018698, 14034728, 16750742, 9725885, 12955861, 9197131, 12885140, 14907330, 16234194, 8355711, 13092807, 12369186, 14408589, 1556175, 10410725 ].map(d3_rgbString); + var d3_category20b = [ 3750777, 5395619, 7040719, 10264286, 6519097, 9216594, 11915115, 13556636, 9202993, 12426809, 15186514, 15190932, 8666169, 11356490, 14049643, 15177372, 8077683, 10834324, 13528509, 14589654 ].map(d3_rgbString); + var d3_category20c = [ 3244733, 7057110, 10406625, 13032431, 15095053, 16616764, 16625259, 16634018, 3253076, 7652470, 10607003, 13101504, 7695281, 10394312, 12369372, 14342891, 6513507, 9868950, 12434877, 14277081 ].map(d3_rgbString); + d3.scale.quantile = function() { + return d3_scale_quantile([], []); + }; + function d3_scale_quantile(domain, range) { + var thresholds; + function rescale() { + var k = 0, q = range.length; + thresholds = []; + while (++k < q) thresholds[k - 1] = d3.quantile(domain, k / q); + return scale; + } + function scale(x) { + if (!isNaN(x = +x)) return range[d3.bisect(thresholds, x)]; + } + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.map(d3_number).filter(d3_numeric).sort(d3_ascending); + return rescale(); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + scale.quantiles = function() { + return thresholds; + }; + scale.invertExtent = function(y) { + y = range.indexOf(y); + return y < 0 ? [ NaN, NaN ] : [ y > 0 ? thresholds[y - 1] : domain[0], y < thresholds.length ? thresholds[y] : domain[domain.length - 1] ]; + }; + scale.copy = function() { + return d3_scale_quantile(domain, range); + }; + return rescale(); + } + d3.scale.quantize = function() { + return d3_scale_quantize(0, 1, [ 0, 1 ]); + }; + function d3_scale_quantize(x0, x1, range) { + var kx, i; + function scale(x) { + return range[Math.max(0, Math.min(i, Math.floor(kx * (x - x0))))]; + } + function rescale() { + kx = range.length / (x1 - x0); + i = range.length - 1; + return scale; + } + scale.domain = function(x) { + if (!arguments.length) return [ x0, x1 ]; + x0 = +x[0]; + x1 = +x[x.length - 1]; + return rescale(); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + scale.invertExtent = function(y) { + y = range.indexOf(y); + y = y < 0 ? NaN : y / kx + x0; + return [ y, y + 1 / kx ]; + }; + scale.copy = function() { + return d3_scale_quantize(x0, x1, range); + }; + return rescale(); + } + d3.scale.threshold = function() { + return d3_scale_threshold([ .5 ], [ 0, 1 ]); + }; + function d3_scale_threshold(domain, range) { + function scale(x) { + if (x <= x) return range[d3.bisect(domain, x)]; + } + scale.domain = function(_) { + if (!arguments.length) return domain; + domain = _; + return scale; + }; + scale.range = function(_) { + if (!arguments.length) return range; + range = _; + return scale; + }; + scale.invertExtent = function(y) { + y = range.indexOf(y); + return [ domain[y - 1], domain[y] ]; + }; + scale.copy = function() { + return d3_scale_threshold(domain, range); + }; + return scale; + } + d3.scale.identity = function() { + return d3_scale_identity([ 0, 1 ]); + }; + function d3_scale_identity(domain) { + function identity(x) { + return +x; + } + identity.invert = identity; + identity.domain = identity.range = function(x) { + if (!arguments.length) return domain; + domain = x.map(identity); + return identity; + }; + identity.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + identity.tickFormat = function(m, format) { + return d3_scale_linearTickFormat(domain, m, format); + }; + identity.copy = function() { + return d3_scale_identity(domain); + }; + return identity; + } + d3.svg = {}; + function d3_zero() { + return 0; + } + d3.svg.arc = function() { + var innerRadius = d3_svg_arcInnerRadius, outerRadius = d3_svg_arcOuterRadius, cornerRadius = d3_zero, padRadius = d3_svg_arcAuto, startAngle = d3_svg_arcStartAngle, endAngle = d3_svg_arcEndAngle, padAngle = d3_svg_arcPadAngle; + function arc() { + var r0 = Math.max(0, +innerRadius.apply(this, arguments)), r1 = Math.max(0, +outerRadius.apply(this, arguments)), a0 = startAngle.apply(this, arguments) - halfπ, a1 = endAngle.apply(this, arguments) - halfπ, da = Math.abs(a1 - a0), cw = a0 > a1 ? 0 : 1; + if (r1 < r0) rc = r1, r1 = r0, r0 = rc; + if (da >= τε) return circleSegment(r1, cw) + (r0 ? circleSegment(r0, 1 - cw) : "") + "Z"; + var rc, cr, rp, ap, p0 = 0, p1 = 0, x0, y0, x1, y1, x2, y2, x3, y3, path = []; + if (ap = (+padAngle.apply(this, arguments) || 0) / 2) { + rp = padRadius === d3_svg_arcAuto ? Math.sqrt(r0 * r0 + r1 * r1) : +padRadius.apply(this, arguments); + if (!cw) p1 *= -1; + if (r1) p1 = d3_asin(rp / r1 * Math.sin(ap)); + if (r0) p0 = d3_asin(rp / r0 * Math.sin(ap)); + } + if (r1) { + x0 = r1 * Math.cos(a0 + p1); + y0 = r1 * Math.sin(a0 + p1); + x1 = r1 * Math.cos(a1 - p1); + y1 = r1 * Math.sin(a1 - p1); + var l1 = Math.abs(a1 - a0 - 2 * p1) <= π ? 0 : 1; + if (p1 && d3_svg_arcSweep(x0, y0, x1, y1) === cw ^ l1) { + var h1 = (a0 + a1) / 2; + x0 = r1 * Math.cos(h1); + y0 = r1 * Math.sin(h1); + x1 = y1 = null; + } + } else { + x0 = y0 = 0; + } + if (r0) { + x2 = r0 * Math.cos(a1 - p0); + y2 = r0 * Math.sin(a1 - p0); + x3 = r0 * Math.cos(a0 + p0); + y3 = r0 * Math.sin(a0 + p0); + var l0 = Math.abs(a0 - a1 + 2 * p0) <= π ? 0 : 1; + if (p0 && d3_svg_arcSweep(x2, y2, x3, y3) === 1 - cw ^ l0) { + var h0 = (a0 + a1) / 2; + x2 = r0 * Math.cos(h0); + y2 = r0 * Math.sin(h0); + x3 = y3 = null; + } + } else { + x2 = y2 = 0; + } + if (da > ε && (rc = Math.min(Math.abs(r1 - r0) / 2, +cornerRadius.apply(this, arguments))) > .001) { + cr = r0 < r1 ^ cw ? 0 : 1; + var rc1 = rc, rc0 = rc; + if (da < π) { + var oc = x3 == null ? [ x2, y2 ] : x1 == null ? [ x0, y0 ] : d3_geom_polygonIntersect([ x0, y0 ], [ x3, y3 ], [ x1, y1 ], [ x2, y2 ]), ax = x0 - oc[0], ay = y0 - oc[1], bx = x1 - oc[0], by = y1 - oc[1], kc = 1 / Math.sin(Math.acos((ax * bx + ay * by) / (Math.sqrt(ax * ax + ay * ay) * Math.sqrt(bx * bx + by * by))) / 2), lc = Math.sqrt(oc[0] * oc[0] + oc[1] * oc[1]); + rc0 = Math.min(rc, (r0 - lc) / (kc - 1)); + rc1 = Math.min(rc, (r1 - lc) / (kc + 1)); + } + if (x1 != null) { + var t30 = d3_svg_arcCornerTangents(x3 == null ? [ x2, y2 ] : [ x3, y3 ], [ x0, y0 ], r1, rc1, cw), t12 = d3_svg_arcCornerTangents([ x1, y1 ], [ x2, y2 ], r1, rc1, cw); + if (rc === rc1) { + path.push("M", t30[0], "A", rc1, ",", rc1, " 0 0,", cr, " ", t30[1], "A", r1, ",", r1, " 0 ", 1 - cw ^ d3_svg_arcSweep(t30[1][0], t30[1][1], t12[1][0], t12[1][1]), ",", cw, " ", t12[1], "A", rc1, ",", rc1, " 0 0,", cr, " ", t12[0]); + } else { + path.push("M", t30[0], "A", rc1, ",", rc1, " 0 1,", cr, " ", t12[0]); + } + } else { + path.push("M", x0, ",", y0); + } + if (x3 != null) { + var t03 = d3_svg_arcCornerTangents([ x0, y0 ], [ x3, y3 ], r0, -rc0, cw), t21 = d3_svg_arcCornerTangents([ x2, y2 ], x1 == null ? [ x0, y0 ] : [ x1, y1 ], r0, -rc0, cw); + if (rc === rc0) { + path.push("L", t21[0], "A", rc0, ",", rc0, " 0 0,", cr, " ", t21[1], "A", r0, ",", r0, " 0 ", cw ^ d3_svg_arcSweep(t21[1][0], t21[1][1], t03[1][0], t03[1][1]), ",", 1 - cw, " ", t03[1], "A", rc0, ",", rc0, " 0 0,", cr, " ", t03[0]); + } else { + path.push("L", t21[0], "A", rc0, ",", rc0, " 0 0,", cr, " ", t03[0]); + } + } else { + path.push("L", x2, ",", y2); + } + } else { + path.push("M", x0, ",", y0); + if (x1 != null) path.push("A", r1, ",", r1, " 0 ", l1, ",", cw, " ", x1, ",", y1); + path.push("L", x2, ",", y2); + if (x3 != null) path.push("A", r0, ",", r0, " 0 ", l0, ",", 1 - cw, " ", x3, ",", y3); + } + path.push("Z"); + return path.join(""); + } + function circleSegment(r1, cw) { + return "M0," + r1 + "A" + r1 + "," + r1 + " 0 1," + cw + " 0," + -r1 + "A" + r1 + "," + r1 + " 0 1," + cw + " 0," + r1; + } + arc.innerRadius = function(v) { + if (!arguments.length) return innerRadius; + innerRadius = d3_functor(v); + return arc; + }; + arc.outerRadius = function(v) { + if (!arguments.length) return outerRadius; + outerRadius = d3_functor(v); + return arc; + }; + arc.cornerRadius = function(v) { + if (!arguments.length) return cornerRadius; + cornerRadius = d3_functor(v); + return arc; + }; + arc.padRadius = function(v) { + if (!arguments.length) return padRadius; + padRadius = v == d3_svg_arcAuto ? d3_svg_arcAuto : d3_functor(v); + return arc; + }; + arc.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3_functor(v); + return arc; + }; + arc.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3_functor(v); + return arc; + }; + arc.padAngle = function(v) { + if (!arguments.length) return padAngle; + padAngle = d3_functor(v); + return arc; + }; + arc.centroid = function() { + var r = (+innerRadius.apply(this, arguments) + +outerRadius.apply(this, arguments)) / 2, a = (+startAngle.apply(this, arguments) + +endAngle.apply(this, arguments)) / 2 - halfπ; + return [ Math.cos(a) * r, Math.sin(a) * r ]; + }; + return arc; + }; + var d3_svg_arcAuto = "auto"; + function d3_svg_arcInnerRadius(d) { + return d.innerRadius; + } + function d3_svg_arcOuterRadius(d) { + return d.outerRadius; + } + function d3_svg_arcStartAngle(d) { + return d.startAngle; + } + function d3_svg_arcEndAngle(d) { + return d.endAngle; + } + function d3_svg_arcPadAngle(d) { + return d && d.padAngle; + } + function d3_svg_arcSweep(x0, y0, x1, y1) { + return (x0 - x1) * y0 - (y0 - y1) * x0 > 0 ? 0 : 1; + } + function d3_svg_arcCornerTangents(p0, p1, r1, rc, cw) { + var x01 = p0[0] - p1[0], y01 = p0[1] - p1[1], lo = (cw ? rc : -rc) / Math.sqrt(x01 * x01 + y01 * y01), ox = lo * y01, oy = -lo * x01, x1 = p0[0] + ox, y1 = p0[1] + oy, x2 = p1[0] + ox, y2 = p1[1] + oy, x3 = (x1 + x2) / 2, y3 = (y1 + y2) / 2, dx = x2 - x1, dy = y2 - y1, d2 = dx * dx + dy * dy, r = r1 - rc, D = x1 * y2 - x2 * y1, d = (dy < 0 ? -1 : 1) * Math.sqrt(Math.max(0, r * r * d2 - D * D)), cx0 = (D * dy - dx * d) / d2, cy0 = (-D * dx - dy * d) / d2, cx1 = (D * dy + dx * d) / d2, cy1 = (-D * dx + dy * d) / d2, dx0 = cx0 - x3, dy0 = cy0 - y3, dx1 = cx1 - x3, dy1 = cy1 - y3; + if (dx0 * dx0 + dy0 * dy0 > dx1 * dx1 + dy1 * dy1) cx0 = cx1, cy0 = cy1; + return [ [ cx0 - ox, cy0 - oy ], [ cx0 * r1 / r, cy0 * r1 / r ] ]; + } + function d3_svg_line(projection) { + var x = d3_geom_pointX, y = d3_geom_pointY, defined = d3_true, interpolate = d3_svg_lineLinear, interpolateKey = interpolate.key, tension = .7; + function line(data) { + var segments = [], points = [], i = -1, n = data.length, d, fx = d3_functor(x), fy = d3_functor(y); + function segment() { + segments.push("M", interpolate(projection(points), tension)); + } + while (++i < n) { + if (defined.call(this, d = data[i], i)) { + points.push([ +fx.call(this, d, i), +fy.call(this, d, i) ]); + } else if (points.length) { + segment(); + points = []; + } + } + if (points.length) segment(); + return segments.length ? segments.join("") : null; + } + line.x = function(_) { + if (!arguments.length) return x; + x = _; + return line; + }; + line.y = function(_) { + if (!arguments.length) return y; + y = _; + return line; + }; + line.defined = function(_) { + if (!arguments.length) return defined; + defined = _; + return line; + }; + line.interpolate = function(_) { + if (!arguments.length) return interpolateKey; + if (typeof _ === "function") interpolateKey = interpolate = _; else interpolateKey = (interpolate = d3_svg_lineInterpolators.get(_) || d3_svg_lineLinear).key; + return line; + }; + line.tension = function(_) { + if (!arguments.length) return tension; + tension = _; + return line; + }; + return line; + } + d3.svg.line = function() { + return d3_svg_line(d3_identity); + }; + var d3_svg_lineInterpolators = d3.map({ + linear: d3_svg_lineLinear, + "linear-closed": d3_svg_lineLinearClosed, + step: d3_svg_lineStep, + "step-before": d3_svg_lineStepBefore, + "step-after": d3_svg_lineStepAfter, + basis: d3_svg_lineBasis, + "basis-open": d3_svg_lineBasisOpen, + "basis-closed": d3_svg_lineBasisClosed, + bundle: d3_svg_lineBundle, + cardinal: d3_svg_lineCardinal, + "cardinal-open": d3_svg_lineCardinalOpen, + "cardinal-closed": d3_svg_lineCardinalClosed, + monotone: d3_svg_lineMonotone + }); + d3_svg_lineInterpolators.forEach(function(key, value) { + value.key = key; + value.closed = /-closed$/.test(key); + }); + function d3_svg_lineLinear(points) { + return points.length > 1 ? points.join("L") : points + "Z"; + } + function d3_svg_lineLinearClosed(points) { + return points.join("L") + "Z"; + } + function d3_svg_lineStep(points) { + var i = 0, n = points.length, p = points[0], path = [ p[0], ",", p[1] ]; + while (++i < n) path.push("H", (p[0] + (p = points[i])[0]) / 2, "V", p[1]); + if (n > 1) path.push("H", p[0]); + return path.join(""); + } + function d3_svg_lineStepBefore(points) { + var i = 0, n = points.length, p = points[0], path = [ p[0], ",", p[1] ]; + while (++i < n) path.push("V", (p = points[i])[1], "H", p[0]); + return path.join(""); + } + function d3_svg_lineStepAfter(points) { + var i = 0, n = points.length, p = points[0], path = [ p[0], ",", p[1] ]; + while (++i < n) path.push("H", (p = points[i])[0], "V", p[1]); + return path.join(""); + } + function d3_svg_lineCardinalOpen(points, tension) { + return points.length < 4 ? d3_svg_lineLinear(points) : points[1] + d3_svg_lineHermite(points.slice(1, -1), d3_svg_lineCardinalTangents(points, tension)); + } + function d3_svg_lineCardinalClosed(points, tension) { + return points.length < 3 ? d3_svg_lineLinearClosed(points) : points[0] + d3_svg_lineHermite((points.push(points[0]), + points), d3_svg_lineCardinalTangents([ points[points.length - 2] ].concat(points, [ points[1] ]), tension)); + } + function d3_svg_lineCardinal(points, tension) { + return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite(points, d3_svg_lineCardinalTangents(points, tension)); + } + function d3_svg_lineHermite(points, tangents) { + if (tangents.length < 1 || points.length != tangents.length && points.length != tangents.length + 2) { + return d3_svg_lineLinear(points); + } + var quad = points.length != tangents.length, path = "", p0 = points[0], p = points[1], t0 = tangents[0], t = t0, pi = 1; + if (quad) { + path += "Q" + (p[0] - t0[0] * 2 / 3) + "," + (p[1] - t0[1] * 2 / 3) + "," + p[0] + "," + p[1]; + p0 = points[1]; + pi = 2; + } + if (tangents.length > 1) { + t = tangents[1]; + p = points[pi]; + pi++; + path += "C" + (p0[0] + t0[0]) + "," + (p0[1] + t0[1]) + "," + (p[0] - t[0]) + "," + (p[1] - t[1]) + "," + p[0] + "," + p[1]; + for (var i = 2; i < tangents.length; i++, pi++) { + p = points[pi]; + t = tangents[i]; + path += "S" + (p[0] - t[0]) + "," + (p[1] - t[1]) + "," + p[0] + "," + p[1]; + } + } + if (quad) { + var lp = points[pi]; + path += "Q" + (p[0] + t[0] * 2 / 3) + "," + (p[1] + t[1] * 2 / 3) + "," + lp[0] + "," + lp[1]; + } + return path; + } + function d3_svg_lineCardinalTangents(points, tension) { + var tangents = [], a = (1 - tension) / 2, p0, p1 = points[0], p2 = points[1], i = 1, n = points.length; + while (++i < n) { + p0 = p1; + p1 = p2; + p2 = points[i]; + tangents.push([ a * (p2[0] - p0[0]), a * (p2[1] - p0[1]) ]); + } + return tangents; + } + function d3_svg_lineBasis(points) { + if (points.length < 3) return d3_svg_lineLinear(points); + var i = 1, n = points.length, pi = points[0], x0 = pi[0], y0 = pi[1], px = [ x0, x0, x0, (pi = points[1])[0] ], py = [ y0, y0, y0, pi[1] ], path = [ x0, ",", y0, "L", d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) ]; + points.push(points[n - 1]); + while (++i <= n) { + pi = points[i]; + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + points.pop(); + path.push("L", pi); + return path.join(""); + } + function d3_svg_lineBasisOpen(points) { + if (points.length < 4) return d3_svg_lineLinear(points); + var path = [], i = -1, n = points.length, pi, px = [ 0 ], py = [ 0 ]; + while (++i < 3) { + pi = points[i]; + px.push(pi[0]); + py.push(pi[1]); + } + path.push(d3_svg_lineDot4(d3_svg_lineBasisBezier3, px) + "," + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py)); + --i; + while (++i < n) { + pi = points[i]; + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); + } + function d3_svg_lineBasisClosed(points) { + var path, i = -1, n = points.length, m = n + 4, pi, px = [], py = []; + while (++i < 4) { + pi = points[i % n]; + px.push(pi[0]); + py.push(pi[1]); + } + path = [ d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) ]; + --i; + while (++i < m) { + pi = points[i % n]; + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); + } + function d3_svg_lineBundle(points, tension) { + var n = points.length - 1; + if (n) { + var x0 = points[0][0], y0 = points[0][1], dx = points[n][0] - x0, dy = points[n][1] - y0, i = -1, p, t; + while (++i <= n) { + p = points[i]; + t = i / n; + p[0] = tension * p[0] + (1 - tension) * (x0 + t * dx); + p[1] = tension * p[1] + (1 - tension) * (y0 + t * dy); + } + } + return d3_svg_lineBasis(points); + } + function d3_svg_lineDot4(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2] + a[3] * b[3]; + } + var d3_svg_lineBasisBezier1 = [ 0, 2 / 3, 1 / 3, 0 ], d3_svg_lineBasisBezier2 = [ 0, 1 / 3, 2 / 3, 0 ], d3_svg_lineBasisBezier3 = [ 0, 1 / 6, 2 / 3, 1 / 6 ]; + function d3_svg_lineBasisBezier(path, x, y) { + path.push("C", d3_svg_lineDot4(d3_svg_lineBasisBezier1, x), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier1, y), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, x), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, y), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, x), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, y)); + } + function d3_svg_lineSlope(p0, p1) { + return (p1[1] - p0[1]) / (p1[0] - p0[0]); + } + function d3_svg_lineFiniteDifferences(points) { + var i = 0, j = points.length - 1, m = [], p0 = points[0], p1 = points[1], d = m[0] = d3_svg_lineSlope(p0, p1); + while (++i < j) { + m[i] = (d + (d = d3_svg_lineSlope(p0 = p1, p1 = points[i + 1]))) / 2; + } + m[i] = d; + return m; + } + function d3_svg_lineMonotoneTangents(points) { + var tangents = [], d, a, b, s, m = d3_svg_lineFiniteDifferences(points), i = -1, j = points.length - 1; + while (++i < j) { + d = d3_svg_lineSlope(points[i], points[i + 1]); + if (abs(d) < ε) { + m[i] = m[i + 1] = 0; + } else { + a = m[i] / d; + b = m[i + 1] / d; + s = a * a + b * b; + if (s > 9) { + s = d * 3 / Math.sqrt(s); + m[i] = s * a; + m[i + 1] = s * b; + } + } + } + i = -1; + while (++i <= j) { + s = (points[Math.min(j, i + 1)][0] - points[Math.max(0, i - 1)][0]) / (6 * (1 + m[i] * m[i])); + tangents.push([ s || 0, m[i] * s || 0 ]); + } + return tangents; + } + function d3_svg_lineMonotone(points) { + return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite(points, d3_svg_lineMonotoneTangents(points)); + } + d3.svg.line.radial = function() { + var line = d3_svg_line(d3_svg_lineRadial); + line.radius = line.x, delete line.x; + line.angle = line.y, delete line.y; + return line; + }; + function d3_svg_lineRadial(points) { + var point, i = -1, n = points.length, r, a; + while (++i < n) { + point = points[i]; + r = point[0]; + a = point[1] - halfπ; + point[0] = r * Math.cos(a); + point[1] = r * Math.sin(a); + } + return points; + } + function d3_svg_area(projection) { + var x0 = d3_geom_pointX, x1 = d3_geom_pointX, y0 = 0, y1 = d3_geom_pointY, defined = d3_true, interpolate = d3_svg_lineLinear, interpolateKey = interpolate.key, interpolateReverse = interpolate, L = "L", tension = .7; + function area(data) { + var segments = [], points0 = [], points1 = [], i = -1, n = data.length, d, fx0 = d3_functor(x0), fy0 = d3_functor(y0), fx1 = x0 === x1 ? function() { + return x; + } : d3_functor(x1), fy1 = y0 === y1 ? function() { + return y; + } : d3_functor(y1), x, y; + function segment() { + segments.push("M", interpolate(projection(points1), tension), L, interpolateReverse(projection(points0.reverse()), tension), "Z"); + } + while (++i < n) { + if (defined.call(this, d = data[i], i)) { + points0.push([ x = +fx0.call(this, d, i), y = +fy0.call(this, d, i) ]); + points1.push([ +fx1.call(this, d, i), +fy1.call(this, d, i) ]); + } else if (points0.length) { + segment(); + points0 = []; + points1 = []; + } + } + if (points0.length) segment(); + return segments.length ? segments.join("") : null; + } + area.x = function(_) { + if (!arguments.length) return x1; + x0 = x1 = _; + return area; + }; + area.x0 = function(_) { + if (!arguments.length) return x0; + x0 = _; + return area; + }; + area.x1 = function(_) { + if (!arguments.length) return x1; + x1 = _; + return area; + }; + area.y = function(_) { + if (!arguments.length) return y1; + y0 = y1 = _; + return area; + }; + area.y0 = function(_) { + if (!arguments.length) return y0; + y0 = _; + return area; + }; + area.y1 = function(_) { + if (!arguments.length) return y1; + y1 = _; + return area; + }; + area.defined = function(_) { + if (!arguments.length) return defined; + defined = _; + return area; + }; + area.interpolate = function(_) { + if (!arguments.length) return interpolateKey; + if (typeof _ === "function") interpolateKey = interpolate = _; else interpolateKey = (interpolate = d3_svg_lineInterpolators.get(_) || d3_svg_lineLinear).key; + interpolateReverse = interpolate.reverse || interpolate; + L = interpolate.closed ? "M" : "L"; + return area; + }; + area.tension = function(_) { + if (!arguments.length) return tension; + tension = _; + return area; + }; + return area; + } + d3_svg_lineStepBefore.reverse = d3_svg_lineStepAfter; + d3_svg_lineStepAfter.reverse = d3_svg_lineStepBefore; + d3.svg.area = function() { + return d3_svg_area(d3_identity); + }; + d3.svg.area.radial = function() { + var area = d3_svg_area(d3_svg_lineRadial); + area.radius = area.x, delete area.x; + area.innerRadius = area.x0, delete area.x0; + area.outerRadius = area.x1, delete area.x1; + area.angle = area.y, delete area.y; + area.startAngle = area.y0, delete area.y0; + area.endAngle = area.y1, delete area.y1; + return area; + }; + d3.svg.chord = function() { + var source = d3_source, target = d3_target, radius = d3_svg_chordRadius, startAngle = d3_svg_arcStartAngle, endAngle = d3_svg_arcEndAngle; + function chord(d, i) { + var s = subgroup(this, source, d, i), t = subgroup(this, target, d, i); + return "M" + s.p0 + arc(s.r, s.p1, s.a1 - s.a0) + (equals(s, t) ? curve(s.r, s.p1, s.r, s.p0) : curve(s.r, s.p1, t.r, t.p0) + arc(t.r, t.p1, t.a1 - t.a0) + curve(t.r, t.p1, s.r, s.p0)) + "Z"; + } + function subgroup(self, f, d, i) { + var subgroup = f.call(self, d, i), r = radius.call(self, subgroup, i), a0 = startAngle.call(self, subgroup, i) - halfπ, a1 = endAngle.call(self, subgroup, i) - halfπ; + return { + r: r, + a0: a0, + a1: a1, + p0: [ r * Math.cos(a0), r * Math.sin(a0) ], + p1: [ r * Math.cos(a1), r * Math.sin(a1) ] + }; + } + function equals(a, b) { + return a.a0 == b.a0 && a.a1 == b.a1; + } + function arc(r, p, a) { + return "A" + r + "," + r + " 0 " + +(a > π) + ",1 " + p; + } + function curve(r0, p0, r1, p1) { + return "Q 0,0 " + p1; + } + chord.radius = function(v) { + if (!arguments.length) return radius; + radius = d3_functor(v); + return chord; + }; + chord.source = function(v) { + if (!arguments.length) return source; + source = d3_functor(v); + return chord; + }; + chord.target = function(v) { + if (!arguments.length) return target; + target = d3_functor(v); + return chord; + }; + chord.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3_functor(v); + return chord; + }; + chord.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3_functor(v); + return chord; + }; + return chord; + }; + function d3_svg_chordRadius(d) { + return d.radius; + } + d3.svg.diagonal = function() { + var source = d3_source, target = d3_target, projection = d3_svg_diagonalProjection; + function diagonal(d, i) { + var p0 = source.call(this, d, i), p3 = target.call(this, d, i), m = (p0.y + p3.y) / 2, p = [ p0, { + x: p0.x, + y: m + }, { + x: p3.x, + y: m + }, p3 ]; + p = p.map(projection); + return "M" + p[0] + "C" + p[1] + " " + p[2] + " " + p[3]; + } + diagonal.source = function(x) { + if (!arguments.length) return source; + source = d3_functor(x); + return diagonal; + }; + diagonal.target = function(x) { + if (!arguments.length) return target; + target = d3_functor(x); + return diagonal; + }; + diagonal.projection = function(x) { + if (!arguments.length) return projection; + projection = x; + return diagonal; + }; + return diagonal; + }; + function d3_svg_diagonalProjection(d) { + return [ d.x, d.y ]; + } + d3.svg.diagonal.radial = function() { + var diagonal = d3.svg.diagonal(), projection = d3_svg_diagonalProjection, projection_ = diagonal.projection; + diagonal.projection = function(x) { + return arguments.length ? projection_(d3_svg_diagonalRadialProjection(projection = x)) : projection; + }; + return diagonal; + }; + function d3_svg_diagonalRadialProjection(projection) { + return function() { + var d = projection.apply(this, arguments), r = d[0], a = d[1] - halfπ; + return [ r * Math.cos(a), r * Math.sin(a) ]; + }; + } + d3.svg.symbol = function() { + var type = d3_svg_symbolType, size = d3_svg_symbolSize; + function symbol(d, i) { + return (d3_svg_symbols.get(type.call(this, d, i)) || d3_svg_symbolCircle)(size.call(this, d, i)); + } + symbol.type = function(x) { + if (!arguments.length) return type; + type = d3_functor(x); + return symbol; + }; + symbol.size = function(x) { + if (!arguments.length) return size; + size = d3_functor(x); + return symbol; + }; + return symbol; + }; + function d3_svg_symbolSize() { + return 64; + } + function d3_svg_symbolType() { + return "circle"; + } + function d3_svg_symbolCircle(size) { + var r = Math.sqrt(size / π); + return "M0," + r + "A" + r + "," + r + " 0 1,1 0," + -r + "A" + r + "," + r + " 0 1,1 0," + r + "Z"; + } + var d3_svg_symbols = d3.map({ + circle: d3_svg_symbolCircle, + cross: function(size) { + var r = Math.sqrt(size / 5) / 2; + return "M" + -3 * r + "," + -r + "H" + -r + "V" + -3 * r + "H" + r + "V" + -r + "H" + 3 * r + "V" + r + "H" + r + "V" + 3 * r + "H" + -r + "V" + r + "H" + -3 * r + "Z"; + }, + diamond: function(size) { + var ry = Math.sqrt(size / (2 * d3_svg_symbolTan30)), rx = ry * d3_svg_symbolTan30; + return "M0," + -ry + "L" + rx + ",0" + " 0," + ry + " " + -rx + ",0" + "Z"; + }, + square: function(size) { + var r = Math.sqrt(size) / 2; + return "M" + -r + "," + -r + "L" + r + "," + -r + " " + r + "," + r + " " + -r + "," + r + "Z"; + }, + "triangle-down": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + ry + "L" + rx + "," + -ry + " " + -rx + "," + -ry + "Z"; + }, + "triangle-up": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + -ry + "L" + rx + "," + ry + " " + -rx + "," + ry + "Z"; + } + }); + d3.svg.symbolTypes = d3_svg_symbols.keys(); + var d3_svg_symbolSqrt3 = Math.sqrt(3), d3_svg_symbolTan30 = Math.tan(30 * d3_radians); + d3_selectionPrototype.transition = function(name) { + var id = d3_transitionInheritId || ++d3_transitionId, ns = d3_transitionNamespace(name), subgroups = [], subgroup, node, transition = d3_transitionInherit || { + time: Date.now(), + ease: d3_ease_cubicInOut, + delay: 0, + duration: 250 + }; + for (var j = -1, m = this.length; ++j < m; ) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) d3_transitionNode(node, i, ns, id, transition); + subgroup.push(node); + } + } + return d3_transition(subgroups, ns, id); + }; + d3_selectionPrototype.interrupt = function(name) { + return this.each(name == null ? d3_selection_interrupt : d3_selection_interruptNS(d3_transitionNamespace(name))); + }; + var d3_selection_interrupt = d3_selection_interruptNS(d3_transitionNamespace()); + function d3_selection_interruptNS(ns) { + return function() { + var lock, activeId, active; + if ((lock = this[ns]) && (active = lock[activeId = lock.active])) { + active.timer.c = null; + active.timer.t = NaN; + if (--lock.count) delete lock[activeId]; else delete this[ns]; + lock.active += .5; + active.event && active.event.interrupt.call(this, this.__data__, active.index); + } + }; + } + function d3_transition(groups, ns, id) { + d3_subclass(groups, d3_transitionPrototype); + groups.namespace = ns; + groups.id = id; + return groups; + } + var d3_transitionPrototype = [], d3_transitionId = 0, d3_transitionInheritId, d3_transitionInherit; + d3_transitionPrototype.call = d3_selectionPrototype.call; + d3_transitionPrototype.empty = d3_selectionPrototype.empty; + d3_transitionPrototype.node = d3_selectionPrototype.node; + d3_transitionPrototype.size = d3_selectionPrototype.size; + d3.transition = function(selection, name) { + return selection && selection.transition ? d3_transitionInheritId ? selection.transition(name) : selection : d3.selection().transition(selection); + }; + d3.transition.prototype = d3_transitionPrototype; + d3_transitionPrototype.select = function(selector) { + var id = this.id, ns = this.namespace, subgroups = [], subgroup, subnode, node; + selector = d3_selection_selector(selector); + for (var j = -1, m = this.length; ++j < m; ) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if ((node = group[i]) && (subnode = selector.call(node, node.__data__, i, j))) { + if ("__data__" in node) subnode.__data__ = node.__data__; + d3_transitionNode(subnode, i, ns, id, node[ns][id]); + subgroup.push(subnode); + } else { + subgroup.push(null); + } + } + } + return d3_transition(subgroups, ns, id); + }; + d3_transitionPrototype.selectAll = function(selector) { + var id = this.id, ns = this.namespace, subgroups = [], subgroup, subnodes, node, subnode, transition; + selector = d3_selection_selectorAll(selector); + for (var j = -1, m = this.length; ++j < m; ) { + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + transition = node[ns][id]; + subnodes = selector.call(node, node.__data__, i, j); + subgroups.push(subgroup = []); + for (var k = -1, o = subnodes.length; ++k < o; ) { + if (subnode = subnodes[k]) d3_transitionNode(subnode, k, ns, id, transition); + subgroup.push(subnode); + } + } + } + } + return d3_transition(subgroups, ns, id); + }; + d3_transitionPrototype.filter = function(filter) { + var subgroups = [], subgroup, group, node; + if (typeof filter !== "function") filter = d3_selection_filter(filter); + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + if ((node = group[i]) && filter.call(node, node.__data__, i, j)) { + subgroup.push(node); + } + } + } + return d3_transition(subgroups, this.namespace, this.id); + }; + d3_transitionPrototype.tween = function(name, tween) { + var id = this.id, ns = this.namespace; + if (arguments.length < 2) return this.node()[ns][id].tween.get(name); + return d3_selection_each(this, tween == null ? function(node) { + node[ns][id].tween.remove(name); + } : function(node) { + node[ns][id].tween.set(name, tween); + }); + }; + function d3_transition_tween(groups, name, value, tween) { + var id = groups.id, ns = groups.namespace; + return d3_selection_each(groups, typeof value === "function" ? function(node, i, j) { + node[ns][id].tween.set(name, tween(value.call(node, node.__data__, i, j))); + } : (value = tween(value), function(node) { + node[ns][id].tween.set(name, value); + })); + } + d3_transitionPrototype.attr = function(nameNS, value) { + if (arguments.length < 2) { + for (value in nameNS) this.attr(value, nameNS[value]); + return this; + } + var interpolate = nameNS == "transform" ? d3_interpolateTransform : d3_interpolate, name = d3.ns.qualify(nameNS); + function attrNull() { + this.removeAttribute(name); + } + function attrNullNS() { + this.removeAttributeNS(name.space, name.local); + } + function attrTween(b) { + return b == null ? attrNull : (b += "", function() { + var a = this.getAttribute(name), i; + return a !== b && (i = interpolate(a, b), function(t) { + this.setAttribute(name, i(t)); + }); + }); + } + function attrTweenNS(b) { + return b == null ? attrNullNS : (b += "", function() { + var a = this.getAttributeNS(name.space, name.local), i; + return a !== b && (i = interpolate(a, b), function(t) { + this.setAttributeNS(name.space, name.local, i(t)); + }); + }); + } + return d3_transition_tween(this, "attr." + nameNS, value, name.local ? attrTweenNS : attrTween); + }; + d3_transitionPrototype.attrTween = function(nameNS, tween) { + var name = d3.ns.qualify(nameNS); + function attrTween(d, i) { + var f = tween.call(this, d, i, this.getAttribute(name)); + return f && function(t) { + this.setAttribute(name, f(t)); + }; + } + function attrTweenNS(d, i) { + var f = tween.call(this, d, i, this.getAttributeNS(name.space, name.local)); + return f && function(t) { + this.setAttributeNS(name.space, name.local, f(t)); + }; + } + return this.tween("attr." + nameNS, name.local ? attrTweenNS : attrTween); + }; + d3_transitionPrototype.style = function(name, value, priority) { + var n = arguments.length; + if (n < 3) { + if (typeof name !== "string") { + if (n < 2) value = ""; + for (priority in name) this.style(priority, name[priority], value); + return this; + } + priority = ""; + } + function styleNull() { + this.style.removeProperty(name); + } + function styleString(b) { + return b == null ? styleNull : (b += "", function() { + var a = d3_window(this).getComputedStyle(this, null).getPropertyValue(name), i; + return a !== b && (i = d3_interpolate(a, b), function(t) { + this.style.setProperty(name, i(t), priority); + }); + }); + } + return d3_transition_tween(this, "style." + name, value, styleString); + }; + d3_transitionPrototype.styleTween = function(name, tween, priority) { + if (arguments.length < 3) priority = ""; + function styleTween(d, i) { + var f = tween.call(this, d, i, d3_window(this).getComputedStyle(this, null).getPropertyValue(name)); + return f && function(t) { + this.style.setProperty(name, f(t), priority); + }; + } + return this.tween("style." + name, styleTween); + }; + d3_transitionPrototype.text = function(value) { + return d3_transition_tween(this, "text", value, d3_transition_text); + }; + function d3_transition_text(b) { + if (b == null) b = ""; + return function() { + this.textContent = b; + }; + } + d3_transitionPrototype.remove = function() { + var ns = this.namespace; + return this.each("end.transition", function() { + var p; + if (this[ns].count < 2 && (p = this.parentNode)) p.removeChild(this); + }); + }; + d3_transitionPrototype.ease = function(value) { + var id = this.id, ns = this.namespace; + if (arguments.length < 1) return this.node()[ns][id].ease; + if (typeof value !== "function") value = d3.ease.apply(d3, arguments); + return d3_selection_each(this, function(node) { + node[ns][id].ease = value; + }); + }; + d3_transitionPrototype.delay = function(value) { + var id = this.id, ns = this.namespace; + if (arguments.length < 1) return this.node()[ns][id].delay; + return d3_selection_each(this, typeof value === "function" ? function(node, i, j) { + node[ns][id].delay = +value.call(node, node.__data__, i, j); + } : (value = +value, function(node) { + node[ns][id].delay = value; + })); + }; + d3_transitionPrototype.duration = function(value) { + var id = this.id, ns = this.namespace; + if (arguments.length < 1) return this.node()[ns][id].duration; + return d3_selection_each(this, typeof value === "function" ? function(node, i, j) { + node[ns][id].duration = Math.max(1, value.call(node, node.__data__, i, j)); + } : (value = Math.max(1, value), function(node) { + node[ns][id].duration = value; + })); + }; + d3_transitionPrototype.each = function(type, listener) { + var id = this.id, ns = this.namespace; + if (arguments.length < 2) { + var inherit = d3_transitionInherit, inheritId = d3_transitionInheritId; + try { + d3_transitionInheritId = id; + d3_selection_each(this, function(node, i, j) { + d3_transitionInherit = node[ns][id]; + type.call(node, node.__data__, i, j); + }); + } finally { + d3_transitionInherit = inherit; + d3_transitionInheritId = inheritId; + } + } else { + d3_selection_each(this, function(node) { + var transition = node[ns][id]; + (transition.event || (transition.event = d3.dispatch("start", "end", "interrupt"))).on(type, listener); + }); + } + return this; + }; + d3_transitionPrototype.transition = function() { + var id0 = this.id, id1 = ++d3_transitionId, ns = this.namespace, subgroups = [], subgroup, group, node, transition; + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + if (node = group[i]) { + transition = node[ns][id0]; + d3_transitionNode(node, i, ns, id1, { + time: transition.time, + ease: transition.ease, + delay: transition.delay + transition.duration, + duration: transition.duration + }); + } + subgroup.push(node); + } + } + return d3_transition(subgroups, ns, id1); + }; + function d3_transitionNamespace(name) { + return name == null ? "__transition__" : "__transition_" + name + "__"; + } + function d3_transitionNode(node, i, ns, id, inherit) { + var lock = node[ns] || (node[ns] = { + active: 0, + count: 0 + }), transition = lock[id], time, timer, duration, ease, tweens; + function schedule(elapsed) { + var delay = transition.delay; + timer.t = delay + time; + if (delay <= elapsed) return start(elapsed - delay); + timer.c = start; + } + function start(elapsed) { + var activeId = lock.active, active = lock[activeId]; + if (active) { + active.timer.c = null; + active.timer.t = NaN; + --lock.count; + delete lock[activeId]; + active.event && active.event.interrupt.call(node, node.__data__, active.index); + } + for (var cancelId in lock) { + if (+cancelId < id) { + var cancel = lock[cancelId]; + cancel.timer.c = null; + cancel.timer.t = NaN; + --lock.count; + delete lock[cancelId]; + } + } + timer.c = tick; + d3_timer(function() { + if (timer.c && tick(elapsed || 1)) { + timer.c = null; + timer.t = NaN; + } + return 1; + }, 0, time); + lock.active = id; + transition.event && transition.event.start.call(node, node.__data__, i); + tweens = []; + transition.tween.forEach(function(key, value) { + if (value = value.call(node, node.__data__, i)) { + tweens.push(value); + } + }); + ease = transition.ease; + duration = transition.duration; + } + function tick(elapsed) { + var t = elapsed / duration, e = ease(t), n = tweens.length; + while (n > 0) { + tweens[--n].call(node, e); + } + if (t >= 1) { + transition.event && transition.event.end.call(node, node.__data__, i); + if (--lock.count) delete lock[id]; else delete node[ns]; + return 1; + } + } + if (!transition) { + time = inherit.time; + timer = d3_timer(schedule, 0, time); + transition = lock[id] = { + tween: new d3_Map(), + time: time, + timer: timer, + delay: inherit.delay, + duration: inherit.duration, + ease: inherit.ease, + index: i + }; + inherit = null; + ++lock.count; + } + } + d3.svg.axis = function() { + var scale = d3.scale.linear(), orient = d3_svg_axisDefaultOrient, innerTickSize = 6, outerTickSize = 6, tickPadding = 3, tickArguments_ = [ 10 ], tickValues = null, tickFormat_; + function axis(g) { + g.each(function() { + var g = d3.select(this); + var scale0 = this.__chart__ || scale, scale1 = this.__chart__ = scale.copy(); + var ticks = tickValues == null ? scale1.ticks ? scale1.ticks.apply(scale1, tickArguments_) : scale1.domain() : tickValues, tickFormat = tickFormat_ == null ? scale1.tickFormat ? scale1.tickFormat.apply(scale1, tickArguments_) : d3_identity : tickFormat_, tick = g.selectAll(".tick").data(ticks, scale1), tickEnter = tick.enter().insert("g", ".domain").attr("class", "tick").style("opacity", ε), tickExit = d3.transition(tick.exit()).style("opacity", ε).remove(), tickUpdate = d3.transition(tick.order()).style("opacity", 1), tickSpacing = Math.max(innerTickSize, 0) + tickPadding, tickTransform; + var range = d3_scaleRange(scale1), path = g.selectAll(".domain").data([ 0 ]), pathUpdate = (path.enter().append("path").attr("class", "domain"), + d3.transition(path)); + tickEnter.append("line"); + tickEnter.append("text"); + var lineEnter = tickEnter.select("line"), lineUpdate = tickUpdate.select("line"), text = tick.select("text").text(tickFormat), textEnter = tickEnter.select("text"), textUpdate = tickUpdate.select("text"), sign = orient === "top" || orient === "left" ? -1 : 1, x1, x2, y1, y2; + if (orient === "bottom" || orient === "top") { + tickTransform = d3_svg_axisX, x1 = "x", y1 = "y", x2 = "x2", y2 = "y2"; + text.attr("dy", sign < 0 ? "0em" : ".71em").style("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + sign * outerTickSize + "V0H" + range[1] + "V" + sign * outerTickSize); + } else { + tickTransform = d3_svg_axisY, x1 = "y", y1 = "x", x2 = "y2", y2 = "x2"; + text.attr("dy", ".32em").style("text-anchor", sign < 0 ? "end" : "start"); + pathUpdate.attr("d", "M" + sign * outerTickSize + "," + range[0] + "H0V" + range[1] + "H" + sign * outerTickSize); + } + lineEnter.attr(y2, sign * innerTickSize); + textEnter.attr(y1, sign * tickSpacing); + lineUpdate.attr(x2, 0).attr(y2, sign * innerTickSize); + textUpdate.attr(x1, 0).attr(y1, sign * tickSpacing); + if (scale1.rangeBand) { + var x = scale1, dx = x.rangeBand() / 2; + scale0 = scale1 = function(d) { + return x(d) + dx; + }; + } else if (scale0.rangeBand) { + scale0 = scale1; + } else { + tickExit.call(tickTransform, scale1, scale0); + } + tickEnter.call(tickTransform, scale0, scale1); + tickUpdate.call(tickTransform, scale1, scale1); + }); + } + axis.scale = function(x) { + if (!arguments.length) return scale; + scale = x; + return axis; + }; + axis.orient = function(x) { + if (!arguments.length) return orient; + orient = x in d3_svg_axisOrients ? x + "" : d3_svg_axisDefaultOrient; + return axis; + }; + axis.ticks = function() { + if (!arguments.length) return tickArguments_; + tickArguments_ = d3_array(arguments); + return axis; + }; + axis.tickValues = function(x) { + if (!arguments.length) return tickValues; + tickValues = x; + return axis; + }; + axis.tickFormat = function(x) { + if (!arguments.length) return tickFormat_; + tickFormat_ = x; + return axis; + }; + axis.tickSize = function(x) { + var n = arguments.length; + if (!n) return innerTickSize; + innerTickSize = +x; + outerTickSize = +arguments[n - 1]; + return axis; + }; + axis.innerTickSize = function(x) { + if (!arguments.length) return innerTickSize; + innerTickSize = +x; + return axis; + }; + axis.outerTickSize = function(x) { + if (!arguments.length) return outerTickSize; + outerTickSize = +x; + return axis; + }; + axis.tickPadding = function(x) { + if (!arguments.length) return tickPadding; + tickPadding = +x; + return axis; + }; + axis.tickSubdivide = function() { + return arguments.length && axis; + }; + return axis; + }; + var d3_svg_axisDefaultOrient = "bottom", d3_svg_axisOrients = { + top: 1, + right: 1, + bottom: 1, + left: 1 + }; + function d3_svg_axisX(selection, x0, x1) { + selection.attr("transform", function(d) { + var v0 = x0(d); + return "translate(" + (isFinite(v0) ? v0 : x1(d)) + ",0)"; + }); + } + function d3_svg_axisY(selection, y0, y1) { + selection.attr("transform", function(d) { + var v0 = y0(d); + return "translate(0," + (isFinite(v0) ? v0 : y1(d)) + ")"; + }); + } + d3.svg.brush = function() { + var event = d3_eventDispatch(brush, "brushstart", "brush", "brushend"), x = null, y = null, xExtent = [ 0, 0 ], yExtent = [ 0, 0 ], xExtentDomain, yExtentDomain, xClamp = true, yClamp = true, resizes = d3_svg_brushResizes[0]; + function brush(g) { + g.each(function() { + var g = d3.select(this).style("pointer-events", "all").style("-webkit-tap-highlight-color", "rgba(0,0,0,0)").on("mousedown.brush", brushstart).on("touchstart.brush", brushstart); + var background = g.selectAll(".background").data([ 0 ]); + background.enter().append("rect").attr("class", "background").style("visibility", "hidden").style("cursor", "crosshair"); + g.selectAll(".extent").data([ 0 ]).enter().append("rect").attr("class", "extent").style("cursor", "move"); + var resize = g.selectAll(".resize").data(resizes, d3_identity); + resize.exit().remove(); + resize.enter().append("g").attr("class", function(d) { + return "resize " + d; + }).style("cursor", function(d) { + return d3_svg_brushCursor[d]; + }).append("rect").attr("x", function(d) { + return /[ew]$/.test(d) ? -3 : null; + }).attr("y", function(d) { + return /^[ns]/.test(d) ? -3 : null; + }).attr("width", 6).attr("height", 6).style("visibility", "hidden"); + resize.style("display", brush.empty() ? "none" : null); + var gUpdate = d3.transition(g), backgroundUpdate = d3.transition(background), range; + if (x) { + range = d3_scaleRange(x); + backgroundUpdate.attr("x", range[0]).attr("width", range[1] - range[0]); + redrawX(gUpdate); + } + if (y) { + range = d3_scaleRange(y); + backgroundUpdate.attr("y", range[0]).attr("height", range[1] - range[0]); + redrawY(gUpdate); + } + redraw(gUpdate); + }); + } + brush.event = function(g) { + g.each(function() { + var event_ = event.of(this, arguments), extent1 = { + x: xExtent, + y: yExtent, + i: xExtentDomain, + j: yExtentDomain + }, extent0 = this.__chart__ || extent1; + this.__chart__ = extent1; + if (d3_transitionInheritId) { + d3.select(this).transition().each("start.brush", function() { + xExtentDomain = extent0.i; + yExtentDomain = extent0.j; + xExtent = extent0.x; + yExtent = extent0.y; + event_({ + type: "brushstart" + }); + }).tween("brush:brush", function() { + var xi = d3_interpolateArray(xExtent, extent1.x), yi = d3_interpolateArray(yExtent, extent1.y); + xExtentDomain = yExtentDomain = null; + return function(t) { + xExtent = extent1.x = xi(t); + yExtent = extent1.y = yi(t); + event_({ + type: "brush", + mode: "resize" + }); + }; + }).each("end.brush", function() { + xExtentDomain = extent1.i; + yExtentDomain = extent1.j; + event_({ + type: "brush", + mode: "resize" + }); + event_({ + type: "brushend" + }); + }); + } else { + event_({ + type: "brushstart" + }); + event_({ + type: "brush", + mode: "resize" + }); + event_({ + type: "brushend" + }); + } + }); + }; + function redraw(g) { + g.selectAll(".resize").attr("transform", function(d) { + return "translate(" + xExtent[+/e$/.test(d)] + "," + yExtent[+/^s/.test(d)] + ")"; + }); + } + function redrawX(g) { + g.select(".extent").attr("x", xExtent[0]); + g.selectAll(".extent,.n>rect,.s>rect").attr("width", xExtent[1] - xExtent[0]); + } + function redrawY(g) { + g.select(".extent").attr("y", yExtent[0]); + g.selectAll(".extent,.e>rect,.w>rect").attr("height", yExtent[1] - yExtent[0]); + } + function brushstart() { + var target = this, eventTarget = d3.select(d3.event.target), event_ = event.of(target, arguments), g = d3.select(target), resizing = eventTarget.datum(), resizingX = !/^(n|s)$/.test(resizing) && x, resizingY = !/^(e|w)$/.test(resizing) && y, dragging = eventTarget.classed("extent"), dragRestore = d3_event_dragSuppress(target), center, origin = d3.mouse(target), offset; + var w = d3.select(d3_window(target)).on("keydown.brush", keydown).on("keyup.brush", keyup); + if (d3.event.changedTouches) { + w.on("touchmove.brush", brushmove).on("touchend.brush", brushend); + } else { + w.on("mousemove.brush", brushmove).on("mouseup.brush", brushend); + } + g.interrupt().selectAll("*").interrupt(); + if (dragging) { + origin[0] = xExtent[0] - origin[0]; + origin[1] = yExtent[0] - origin[1]; + } else if (resizing) { + var ex = +/w$/.test(resizing), ey = +/^n/.test(resizing); + offset = [ xExtent[1 - ex] - origin[0], yExtent[1 - ey] - origin[1] ]; + origin[0] = xExtent[ex]; + origin[1] = yExtent[ey]; + } else if (d3.event.altKey) center = origin.slice(); + g.style("pointer-events", "none").selectAll(".resize").style("display", null); + d3.select("body").style("cursor", eventTarget.style("cursor")); + event_({ + type: "brushstart" + }); + brushmove(); + function keydown() { + if (d3.event.keyCode == 32) { + if (!dragging) { + center = null; + origin[0] -= xExtent[1]; + origin[1] -= yExtent[1]; + dragging = 2; + } + d3_eventPreventDefault(); + } + } + function keyup() { + if (d3.event.keyCode == 32 && dragging == 2) { + origin[0] += xExtent[1]; + origin[1] += yExtent[1]; + dragging = 0; + d3_eventPreventDefault(); + } + } + function brushmove() { + var point = d3.mouse(target), moved = false; + if (offset) { + point[0] += offset[0]; + point[1] += offset[1]; + } + if (!dragging) { + if (d3.event.altKey) { + if (!center) center = [ (xExtent[0] + xExtent[1]) / 2, (yExtent[0] + yExtent[1]) / 2 ]; + origin[0] = xExtent[+(point[0] < center[0])]; + origin[1] = yExtent[+(point[1] < center[1])]; + } else center = null; + } + if (resizingX && move1(point, x, 0)) { + redrawX(g); + moved = true; + } + if (resizingY && move1(point, y, 1)) { + redrawY(g); + moved = true; + } + if (moved) { + redraw(g); + event_({ + type: "brush", + mode: dragging ? "move" : "resize" + }); + } + } + function move1(point, scale, i) { + var range = d3_scaleRange(scale), r0 = range[0], r1 = range[1], position = origin[i], extent = i ? yExtent : xExtent, size = extent[1] - extent[0], min, max; + if (dragging) { + r0 -= position; + r1 -= size + position; + } + min = (i ? yClamp : xClamp) ? Math.max(r0, Math.min(r1, point[i])) : point[i]; + if (dragging) { + max = (min += position) + size; + } else { + if (center) position = Math.max(r0, Math.min(r1, 2 * center[i] - min)); + if (position < min) { + max = min; + min = position; + } else { + max = position; + } + } + if (extent[0] != min || extent[1] != max) { + if (i) yExtentDomain = null; else xExtentDomain = null; + extent[0] = min; + extent[1] = max; + return true; + } + } + function brushend() { + brushmove(); + g.style("pointer-events", "all").selectAll(".resize").style("display", brush.empty() ? "none" : null); + d3.select("body").style("cursor", null); + w.on("mousemove.brush", null).on("mouseup.brush", null).on("touchmove.brush", null).on("touchend.brush", null).on("keydown.brush", null).on("keyup.brush", null); + dragRestore(); + event_({ + type: "brushend" + }); + } + } + brush.x = function(z) { + if (!arguments.length) return x; + x = z; + resizes = d3_svg_brushResizes[!x << 1 | !y]; + return brush; + }; + brush.y = function(z) { + if (!arguments.length) return y; + y = z; + resizes = d3_svg_brushResizes[!x << 1 | !y]; + return brush; + }; + brush.clamp = function(z) { + if (!arguments.length) return x && y ? [ xClamp, yClamp ] : x ? xClamp : y ? yClamp : null; + if (x && y) xClamp = !!z[0], yClamp = !!z[1]; else if (x) xClamp = !!z; else if (y) yClamp = !!z; + return brush; + }; + brush.extent = function(z) { + var x0, x1, y0, y1, t; + if (!arguments.length) { + if (x) { + if (xExtentDomain) { + x0 = xExtentDomain[0], x1 = xExtentDomain[1]; + } else { + x0 = xExtent[0], x1 = xExtent[1]; + if (x.invert) x0 = x.invert(x0), x1 = x.invert(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + } + } + if (y) { + if (yExtentDomain) { + y0 = yExtentDomain[0], y1 = yExtentDomain[1]; + } else { + y0 = yExtent[0], y1 = yExtent[1]; + if (y.invert) y0 = y.invert(y0), y1 = y.invert(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + } + } + return x && y ? [ [ x0, y0 ], [ x1, y1 ] ] : x ? [ x0, x1 ] : y && [ y0, y1 ]; + } + if (x) { + x0 = z[0], x1 = z[1]; + if (y) x0 = x0[0], x1 = x1[0]; + xExtentDomain = [ x0, x1 ]; + if (x.invert) x0 = x(x0), x1 = x(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + if (x0 != xExtent[0] || x1 != xExtent[1]) xExtent = [ x0, x1 ]; + } + if (y) { + y0 = z[0], y1 = z[1]; + if (x) y0 = y0[1], y1 = y1[1]; + yExtentDomain = [ y0, y1 ]; + if (y.invert) y0 = y(y0), y1 = y(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + if (y0 != yExtent[0] || y1 != yExtent[1]) yExtent = [ y0, y1 ]; + } + return brush; + }; + brush.clear = function() { + if (!brush.empty()) { + xExtent = [ 0, 0 ], yExtent = [ 0, 0 ]; + xExtentDomain = yExtentDomain = null; + } + return brush; + }; + brush.empty = function() { + return !!x && xExtent[0] == xExtent[1] || !!y && yExtent[0] == yExtent[1]; + }; + return d3.rebind(brush, event, "on"); + }; + var d3_svg_brushCursor = { + n: "ns-resize", + e: "ew-resize", + s: "ns-resize", + w: "ew-resize", + nw: "nwse-resize", + ne: "nesw-resize", + se: "nwse-resize", + sw: "nesw-resize" + }; + var d3_svg_brushResizes = [ [ "n", "e", "s", "w", "nw", "ne", "se", "sw" ], [ "e", "w" ], [ "n", "s" ], [] ]; + var d3_time_format = d3_time.format = d3_locale_enUS.timeFormat; + var d3_time_formatUtc = d3_time_format.utc; + var d3_time_formatIso = d3_time_formatUtc("%Y-%m-%dT%H:%M:%S.%LZ"); + d3_time_format.iso = Date.prototype.toISOString && +new Date("2000-01-01T00:00:00.000Z") ? d3_time_formatIsoNative : d3_time_formatIso; + function d3_time_formatIsoNative(date) { + return date.toISOString(); + } + d3_time_formatIsoNative.parse = function(string) { + var date = new Date(string); + return isNaN(date) ? null : date; + }; + d3_time_formatIsoNative.toString = d3_time_formatIso.toString; + d3_time.second = d3_time_interval(function(date) { + return new d3_date(Math.floor(date / 1e3) * 1e3); + }, function(date, offset) { + date.setTime(date.getTime() + Math.floor(offset) * 1e3); + }, function(date) { + return date.getSeconds(); + }); + d3_time.seconds = d3_time.second.range; + d3_time.seconds.utc = d3_time.second.utc.range; + d3_time.minute = d3_time_interval(function(date) { + return new d3_date(Math.floor(date / 6e4) * 6e4); + }, function(date, offset) { + date.setTime(date.getTime() + Math.floor(offset) * 6e4); + }, function(date) { + return date.getMinutes(); + }); + d3_time.minutes = d3_time.minute.range; + d3_time.minutes.utc = d3_time.minute.utc.range; + d3_time.hour = d3_time_interval(function(date) { + var timezone = date.getTimezoneOffset() / 60; + return new d3_date((Math.floor(date / 36e5 - timezone) + timezone) * 36e5); + }, function(date, offset) { + date.setTime(date.getTime() + Math.floor(offset) * 36e5); + }, function(date) { + return date.getHours(); + }); + d3_time.hours = d3_time.hour.range; + d3_time.hours.utc = d3_time.hour.utc.range; + d3_time.month = d3_time_interval(function(date) { + date = d3_time.day(date); + date.setDate(1); + return date; + }, function(date, offset) { + date.setMonth(date.getMonth() + offset); + }, function(date) { + return date.getMonth(); + }); + d3_time.months = d3_time.month.range; + d3_time.months.utc = d3_time.month.utc.range; + function d3_time_scale(linear, methods, format) { + function scale(x) { + return linear(x); + } + scale.invert = function(x) { + return d3_time_scaleDate(linear.invert(x)); + }; + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(d3_time_scaleDate); + linear.domain(x); + return scale; + }; + function tickMethod(extent, count) { + var span = extent[1] - extent[0], target = span / count, i = d3.bisect(d3_time_scaleSteps, target); + return i == d3_time_scaleSteps.length ? [ methods.year, d3_scale_linearTickRange(extent.map(function(d) { + return d / 31536e6; + }), count)[2] ] : !i ? [ d3_time_scaleMilliseconds, d3_scale_linearTickRange(extent, count)[2] ] : methods[target / d3_time_scaleSteps[i - 1] < d3_time_scaleSteps[i] / target ? i - 1 : i]; + } + scale.nice = function(interval, skip) { + var domain = scale.domain(), extent = d3_scaleExtent(domain), method = interval == null ? tickMethod(extent, 10) : typeof interval === "number" && tickMethod(extent, interval); + if (method) interval = method[0], skip = method[1]; + function skipped(date) { + return !isNaN(date) && !interval.range(date, d3_time_scaleDate(+date + 1), skip).length; + } + return scale.domain(d3_scale_nice(domain, skip > 1 ? { + floor: function(date) { + while (skipped(date = interval.floor(date))) date = d3_time_scaleDate(date - 1); + return date; + }, + ceil: function(date) { + while (skipped(date = interval.ceil(date))) date = d3_time_scaleDate(+date + 1); + return date; + } + } : interval)); + }; + scale.ticks = function(interval, skip) { + var extent = d3_scaleExtent(scale.domain()), method = interval == null ? tickMethod(extent, 10) : typeof interval === "number" ? tickMethod(extent, interval) : !interval.range && [ { + range: interval + }, skip ]; + if (method) interval = method[0], skip = method[1]; + return interval.range(extent[0], d3_time_scaleDate(+extent[1] + 1), skip < 1 ? 1 : skip); + }; + scale.tickFormat = function() { + return format; + }; + scale.copy = function() { + return d3_time_scale(linear.copy(), methods, format); + }; + return d3_scale_linearRebind(scale, linear); + } + function d3_time_scaleDate(t) { + return new Date(t); + } + var d3_time_scaleSteps = [ 1e3, 5e3, 15e3, 3e4, 6e4, 3e5, 9e5, 18e5, 36e5, 108e5, 216e5, 432e5, 864e5, 1728e5, 6048e5, 2592e6, 7776e6, 31536e6 ]; + var d3_time_scaleLocalMethods = [ [ d3_time.second, 1 ], [ d3_time.second, 5 ], [ d3_time.second, 15 ], [ d3_time.second, 30 ], [ d3_time.minute, 1 ], [ d3_time.minute, 5 ], [ d3_time.minute, 15 ], [ d3_time.minute, 30 ], [ d3_time.hour, 1 ], [ d3_time.hour, 3 ], [ d3_time.hour, 6 ], [ d3_time.hour, 12 ], [ d3_time.day, 1 ], [ d3_time.day, 2 ], [ d3_time.week, 1 ], [ d3_time.month, 1 ], [ d3_time.month, 3 ], [ d3_time.year, 1 ] ]; + var d3_time_scaleLocalFormat = d3_time_format.multi([ [ ".%L", function(d) { + return d.getMilliseconds(); + } ], [ ":%S", function(d) { + return d.getSeconds(); + } ], [ "%I:%M", function(d) { + return d.getMinutes(); + } ], [ "%I %p", function(d) { + return d.getHours(); + } ], [ "%a %d", function(d) { + return d.getDay() && d.getDate() != 1; + } ], [ "%b %d", function(d) { + return d.getDate() != 1; + } ], [ "%B", function(d) { + return d.getMonth(); + } ], [ "%Y", d3_true ] ]); + var d3_time_scaleMilliseconds = { + range: function(start, stop, step) { + return d3.range(Math.ceil(start / step) * step, +stop, step).map(d3_time_scaleDate); + }, + floor: d3_identity, + ceil: d3_identity + }; + d3_time_scaleLocalMethods.year = d3_time.year; + d3_time.scale = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleLocalMethods, d3_time_scaleLocalFormat); + }; + var d3_time_scaleUtcMethods = d3_time_scaleLocalMethods.map(function(m) { + return [ m[0].utc, m[1] ]; + }); + var d3_time_scaleUtcFormat = d3_time_formatUtc.multi([ [ ".%L", function(d) { + return d.getUTCMilliseconds(); + } ], [ ":%S", function(d) { + return d.getUTCSeconds(); + } ], [ "%I:%M", function(d) { + return d.getUTCMinutes(); + } ], [ "%I %p", function(d) { + return d.getUTCHours(); + } ], [ "%a %d", function(d) { + return d.getUTCDay() && d.getUTCDate() != 1; + } ], [ "%b %d", function(d) { + return d.getUTCDate() != 1; + } ], [ "%B", function(d) { + return d.getUTCMonth(); + } ], [ "%Y", d3_true ] ]); + d3_time_scaleUtcMethods.year = d3_time.year.utc; + d3_time.scale.utc = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleUtcMethods, d3_time_scaleUtcFormat); + }; + d3.text = d3_xhrType(function(request) { + return request.responseText; + }); + d3.json = function(url, callback) { + return d3_xhr(url, "application/json", d3_json, callback); + }; + function d3_json(request) { + return JSON.parse(request.responseText); + } + d3.html = function(url, callback) { + return d3_xhr(url, "text/html", d3_html, callback); + }; + function d3_html(request) { + var range = d3_document.createRange(); + range.selectNode(d3_document.body); + return range.createContextualFragment(request.responseText); + } + d3.xml = d3_xhrType(function(request) { + return request.responseXML; + }); + if (typeof define === "function" && define.amd) this.d3 = d3, define(d3); else if (typeof module === "object" && module.exports) module.exports = d3; else this.d3 = d3; + }(); \ No newline at end of file diff --git a/intropage/JSfiles/d3.v4.js b/intropage/JSfiles/d3.v4.js new file mode 100644 index 000000000..73e5c4fd5 --- /dev/null +++ b/intropage/JSfiles/d3.v4.js @@ -0,0 +1,17178 @@ +// https://d3js.org Version 4.13.0. Copyright 2018 Mike Bostock. +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) : + typeof define === 'function' && define.amd ? define(['exports'], factory) : + (factory((global.d3 = global.d3 || {}))); +}(this, (function (exports) { 'use strict'; + +var version = "4.13.0"; + +function ascending(a, b) { + return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN; +} + +function bisector(compare) { + if (compare.length === 1) compare = ascendingComparator(compare); + return { + left: function(a, x, lo, hi) { + if (lo == null) lo = 0; + if (hi == null) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (compare(a[mid], x) < 0) lo = mid + 1; + else hi = mid; + } + return lo; + }, + right: function(a, x, lo, hi) { + if (lo == null) lo = 0; + if (hi == null) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (compare(a[mid], x) > 0) hi = mid; + else lo = mid + 1; + } + return lo; + } + }; +} + +function ascendingComparator(f) { + return function(d, x) { + return ascending(f(d), x); + }; +} + +var ascendingBisect = bisector(ascending); +var bisectRight = ascendingBisect.right; +var bisectLeft = ascendingBisect.left; + +function pairs(array, f) { + if (f == null) f = pair; + var i = 0, n = array.length - 1, p = array[0], pairs = new Array(n < 0 ? 0 : n); + while (i < n) pairs[i] = f(p, p = array[++i]); + return pairs; +} + +function pair(a, b) { + return [a, b]; +} + +function cross(values0, values1, reduce) { + var n0 = values0.length, + n1 = values1.length, + values = new Array(n0 * n1), + i0, + i1, + i, + value0; + + if (reduce == null) reduce = pair; + + for (i0 = i = 0; i0 < n0; ++i0) { + for (value0 = values0[i0], i1 = 0; i1 < n1; ++i1, ++i) { + values[i] = reduce(value0, values1[i1]); + } + } + + return values; +} + +function descending(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; +} + +function number(x) { + return x === null ? NaN : +x; +} + +function variance(values, valueof) { + var n = values.length, + m = 0, + i = -1, + mean = 0, + value, + delta, + sum = 0; + + if (valueof == null) { + while (++i < n) { + if (!isNaN(value = number(values[i]))) { + delta = value - mean; + mean += delta / ++m; + sum += delta * (value - mean); + } + } + } + + else { + while (++i < n) { + if (!isNaN(value = number(valueof(values[i], i, values)))) { + delta = value - mean; + mean += delta / ++m; + sum += delta * (value - mean); + } + } + } + + if (m > 1) return sum / (m - 1); +} + +function deviation(array, f) { + var v = variance(array, f); + return v ? Math.sqrt(v) : v; +} + +function extent(values, valueof) { + var n = values.length, + i = -1, + value, + min, + max; + + if (valueof == null) { + while (++i < n) { // Find the first comparable value. + if ((value = values[i]) != null && value >= value) { + min = max = value; + while (++i < n) { // Compare the remaining values. + if ((value = values[i]) != null) { + if (min > value) min = value; + if (max < value) max = value; + } + } + } + } + } + + else { + while (++i < n) { // Find the first comparable value. + if ((value = valueof(values[i], i, values)) != null && value >= value) { + min = max = value; + while (++i < n) { // Compare the remaining values. + if ((value = valueof(values[i], i, values)) != null) { + if (min > value) min = value; + if (max < value) max = value; + } + } + } + } + } + + return [min, max]; +} + +var array = Array.prototype; + +var slice = array.slice; +var map = array.map; + +function constant(x) { + return function() { + return x; + }; +} + +function identity(x) { + return x; +} + +function sequence(start, stop, step) { + start = +start, stop = +stop, step = (n = arguments.length) < 2 ? (stop = start, start = 0, 1) : n < 3 ? 1 : +step; + + var i = -1, + n = Math.max(0, Math.ceil((stop - start) / step)) | 0, + range = new Array(n); + + while (++i < n) { + range[i] = start + i * step; + } + + return range; +} + +var e10 = Math.sqrt(50); +var e5 = Math.sqrt(10); +var e2 = Math.sqrt(2); + +function ticks(start, stop, count) { + var reverse, + i = -1, + n, + ticks, + step; + + stop = +stop, start = +start, count = +count; + if (start === stop && count > 0) return [start]; + if (reverse = stop < start) n = start, start = stop, stop = n; + if ((step = tickIncrement(start, stop, count)) === 0 || !isFinite(step)) return []; + + if (step > 0) { + start = Math.ceil(start / step); + stop = Math.floor(stop / step); + ticks = new Array(n = Math.ceil(stop - start + 1)); + while (++i < n) ticks[i] = (start + i) * step; + } else { + start = Math.floor(start * step); + stop = Math.ceil(stop * step); + ticks = new Array(n = Math.ceil(start - stop + 1)); + while (++i < n) ticks[i] = (start - i) / step; + } + + if (reverse) ticks.reverse(); + + return ticks; +} + +function tickIncrement(start, stop, count) { + var step = (stop - start) / Math.max(0, count), + power = Math.floor(Math.log(step) / Math.LN10), + error = step / Math.pow(10, power); + return power >= 0 + ? (error >= e10 ? 10 : error >= e5 ? 5 : error >= e2 ? 2 : 1) * Math.pow(10, power) + : -Math.pow(10, -power) / (error >= e10 ? 10 : error >= e5 ? 5 : error >= e2 ? 2 : 1); +} + +function tickStep(start, stop, count) { + var step0 = Math.abs(stop - start) / Math.max(0, count), + step1 = Math.pow(10, Math.floor(Math.log(step0) / Math.LN10)), + error = step0 / step1; + if (error >= e10) step1 *= 10; + else if (error >= e5) step1 *= 5; + else if (error >= e2) step1 *= 2; + return stop < start ? -step1 : step1; +} + +function sturges(values) { + return Math.ceil(Math.log(values.length) / Math.LN2) + 1; +} + +function histogram() { + var value = identity, + domain = extent, + threshold = sturges; + + function histogram(data) { + var i, + n = data.length, + x, + values = new Array(n); + + for (i = 0; i < n; ++i) { + values[i] = value(data[i], i, data); + } + + var xz = domain(values), + x0 = xz[0], + x1 = xz[1], + tz = threshold(values, x0, x1); + + // Convert number of thresholds into uniform thresholds. + if (!Array.isArray(tz)) { + tz = tickStep(x0, x1, tz); + tz = sequence(Math.ceil(x0 / tz) * tz, Math.floor(x1 / tz) * tz, tz); // exclusive + } + + // Remove any thresholds outside the domain. + var m = tz.length; + while (tz[0] <= x0) tz.shift(), --m; + while (tz[m - 1] > x1) tz.pop(), --m; + + var bins = new Array(m + 1), + bin; + + // Initialize bins. + for (i = 0; i <= m; ++i) { + bin = bins[i] = []; + bin.x0 = i > 0 ? tz[i - 1] : x0; + bin.x1 = i < m ? tz[i] : x1; + } + + // Assign data to bins by value, ignoring any outside the domain. + for (i = 0; i < n; ++i) { + x = values[i]; + if (x0 <= x && x <= x1) { + bins[bisectRight(tz, x, 0, m)].push(data[i]); + } + } + + return bins; + } + + histogram.value = function(_) { + return arguments.length ? (value = typeof _ === "function" ? _ : constant(_), histogram) : value; + }; + + histogram.domain = function(_) { + return arguments.length ? (domain = typeof _ === "function" ? _ : constant([_[0], _[1]]), histogram) : domain; + }; + + histogram.thresholds = function(_) { + return arguments.length ? (threshold = typeof _ === "function" ? _ : Array.isArray(_) ? constant(slice.call(_)) : constant(_), histogram) : threshold; + }; + + return histogram; +} + +function threshold(values, p, valueof) { + if (valueof == null) valueof = number; + if (!(n = values.length)) return; + if ((p = +p) <= 0 || n < 2) return +valueof(values[0], 0, values); + if (p >= 1) return +valueof(values[n - 1], n - 1, values); + var n, + i = (n - 1) * p, + i0 = Math.floor(i), + value0 = +valueof(values[i0], i0, values), + value1 = +valueof(values[i0 + 1], i0 + 1, values); + return value0 + (value1 - value0) * (i - i0); +} + +function freedmanDiaconis(values, min, max) { + values = map.call(values, number).sort(ascending); + return Math.ceil((max - min) / (2 * (threshold(values, 0.75) - threshold(values, 0.25)) * Math.pow(values.length, -1 / 3))); +} + +function scott(values, min, max) { + return Math.ceil((max - min) / (3.5 * deviation(values) * Math.pow(values.length, -1 / 3))); +} + +function max(values, valueof) { + var n = values.length, + i = -1, + value, + max; + + if (valueof == null) { + while (++i < n) { // Find the first comparable value. + if ((value = values[i]) != null && value >= value) { + max = value; + while (++i < n) { // Compare the remaining values. + if ((value = values[i]) != null && value > max) { + max = value; + } + } + } + } + } + + else { + while (++i < n) { // Find the first comparable value. + if ((value = valueof(values[i], i, values)) != null && value >= value) { + max = value; + while (++i < n) { // Compare the remaining values. + if ((value = valueof(values[i], i, values)) != null && value > max) { + max = value; + } + } + } + } + } + + return max; +} + +function mean(values, valueof) { + var n = values.length, + m = n, + i = -1, + value, + sum = 0; + + if (valueof == null) { + while (++i < n) { + if (!isNaN(value = number(values[i]))) sum += value; + else --m; + } + } + + else { + while (++i < n) { + if (!isNaN(value = number(valueof(values[i], i, values)))) sum += value; + else --m; + } + } + + if (m) return sum / m; +} + +function median(values, valueof) { + var n = values.length, + i = -1, + value, + numbers = []; + + if (valueof == null) { + while (++i < n) { + if (!isNaN(value = number(values[i]))) { + numbers.push(value); + } + } + } + + else { + while (++i < n) { + if (!isNaN(value = number(valueof(values[i], i, values)))) { + numbers.push(value); + } + } + } + + return threshold(numbers.sort(ascending), 0.5); +} + +function merge(arrays) { + var n = arrays.length, + m, + i = -1, + j = 0, + merged, + array; + + while (++i < n) j += arrays[i].length; + merged = new Array(j); + + while (--n >= 0) { + array = arrays[n]; + m = array.length; + while (--m >= 0) { + merged[--j] = array[m]; + } + } + + return merged; +} + +function min(values, valueof) { + var n = values.length, + i = -1, + value, + min; + + if (valueof == null) { + while (++i < n) { // Find the first comparable value. + if ((value = values[i]) != null && value >= value) { + min = value; + while (++i < n) { // Compare the remaining values. + if ((value = values[i]) != null && min > value) { + min = value; + } + } + } + } + } + + else { + while (++i < n) { // Find the first comparable value. + if ((value = valueof(values[i], i, values)) != null && value >= value) { + min = value; + while (++i < n) { // Compare the remaining values. + if ((value = valueof(values[i], i, values)) != null && min > value) { + min = value; + } + } + } + } + } + + return min; +} + +function permute(array, indexes) { + var i = indexes.length, permutes = new Array(i); + while (i--) permutes[i] = array[indexes[i]]; + return permutes; +} + +function scan(values, compare) { + if (!(n = values.length)) return; + var n, + i = 0, + j = 0, + xi, + xj = values[j]; + + if (compare == null) compare = ascending; + + while (++i < n) { + if (compare(xi = values[i], xj) < 0 || compare(xj, xj) !== 0) { + xj = xi, j = i; + } + } + + if (compare(xj, xj) === 0) return j; +} + +function shuffle(array, i0, i1) { + var m = (i1 == null ? array.length : i1) - (i0 = i0 == null ? 0 : +i0), + t, + i; + + while (m) { + i = Math.random() * m-- | 0; + t = array[m + i0]; + array[m + i0] = array[i + i0]; + array[i + i0] = t; + } + + return array; +} + +function sum(values, valueof) { + var n = values.length, + i = -1, + value, + sum = 0; + + if (valueof == null) { + while (++i < n) { + if (value = +values[i]) sum += value; // Note: zero and null are equivalent. + } + } + + else { + while (++i < n) { + if (value = +valueof(values[i], i, values)) sum += value; + } + } + + return sum; +} + +function transpose(matrix) { + if (!(n = matrix.length)) return []; + for (var i = -1, m = min(matrix, length), transpose = new Array(m); ++i < m;) { + for (var j = -1, n, row = transpose[i] = new Array(n); ++j < n;) { + row[j] = matrix[j][i]; + } + } + return transpose; +} + +function length(d) { + return d.length; +} + +function zip() { + return transpose(arguments); +} + +var slice$1 = Array.prototype.slice; + +function identity$1(x) { + return x; +} + +var top = 1; +var right = 2; +var bottom = 3; +var left = 4; +var epsilon = 1e-6; + +function translateX(x) { + return "translate(" + (x + 0.5) + ",0)"; +} + +function translateY(y) { + return "translate(0," + (y + 0.5) + ")"; +} + +function number$1(scale) { + return function(d) { + return +scale(d); + }; +} + +function center(scale) { + var offset = Math.max(0, scale.bandwidth() - 1) / 2; // Adjust for 0.5px offset. + if (scale.round()) offset = Math.round(offset); + return function(d) { + return +scale(d) + offset; + }; +} + +function entering() { + return !this.__axis; +} + +function axis(orient, scale) { + var tickArguments = [], + tickValues = null, + tickFormat = null, + tickSizeInner = 6, + tickSizeOuter = 6, + tickPadding = 3, + k = orient === top || orient === left ? -1 : 1, + x = orient === left || orient === right ? "x" : "y", + transform = orient === top || orient === bottom ? translateX : translateY; + + function axis(context) { + var values = tickValues == null ? (scale.ticks ? scale.ticks.apply(scale, tickArguments) : scale.domain()) : tickValues, + format = tickFormat == null ? (scale.tickFormat ? scale.tickFormat.apply(scale, tickArguments) : identity$1) : tickFormat, + spacing = Math.max(tickSizeInner, 0) + tickPadding, + range = scale.range(), + range0 = +range[0] + 0.5, + range1 = +range[range.length - 1] + 0.5, + position = (scale.bandwidth ? center : number$1)(scale.copy()), + selection = context.selection ? context.selection() : context, + path = selection.selectAll(".domain").data([null]), + tick = selection.selectAll(".tick").data(values, scale).order(), + tickExit = tick.exit(), + tickEnter = tick.enter().append("g").attr("class", "tick"), + line = tick.select("line"), + text = tick.select("text"); + + path = path.merge(path.enter().insert("path", ".tick") + .attr("class", "domain") + .attr("stroke", "#000")); + + tick = tick.merge(tickEnter); + + line = line.merge(tickEnter.append("line") + .attr("stroke", "#000") + .attr(x + "2", k * tickSizeInner)); + + text = text.merge(tickEnter.append("text") + .attr("fill", "#000") + .attr(x, k * spacing) + .attr("dy", orient === top ? "0em" : orient === bottom ? "0.71em" : "0.32em")); + + if (context !== selection) { + path = path.transition(context); + tick = tick.transition(context); + line = line.transition(context); + text = text.transition(context); + + tickExit = tickExit.transition(context) + .attr("opacity", epsilon) + .attr("transform", function(d) { return isFinite(d = position(d)) ? transform(d) : this.getAttribute("transform"); }); + + tickEnter + .attr("opacity", epsilon) + .attr("transform", function(d) { var p = this.parentNode.__axis; return transform(p && isFinite(p = p(d)) ? p : position(d)); }); + } + + tickExit.remove(); + + path + .attr("d", orient === left || orient == right + ? "M" + k * tickSizeOuter + "," + range0 + "H0.5V" + range1 + "H" + k * tickSizeOuter + : "M" + range0 + "," + k * tickSizeOuter + "V0.5H" + range1 + "V" + k * tickSizeOuter); + + tick + .attr("opacity", 1) + .attr("transform", function(d) { return transform(position(d)); }); + + line + .attr(x + "2", k * tickSizeInner); + + text + .attr(x, k * spacing) + .text(format); + + selection.filter(entering) + .attr("fill", "none") + .attr("font-size", 10) + .attr("font-family", "sans-serif") + .attr("text-anchor", orient === right ? "start" : orient === left ? "end" : "middle"); + + selection + .each(function() { this.__axis = position; }); + } + + axis.scale = function(_) { + return arguments.length ? (scale = _, axis) : scale; + }; + + axis.ticks = function() { + return tickArguments = slice$1.call(arguments), axis; + }; + + axis.tickArguments = function(_) { + return arguments.length ? (tickArguments = _ == null ? [] : slice$1.call(_), axis) : tickArguments.slice(); + }; + + axis.tickValues = function(_) { + return arguments.length ? (tickValues = _ == null ? null : slice$1.call(_), axis) : tickValues && tickValues.slice(); + }; + + axis.tickFormat = function(_) { + return arguments.length ? (tickFormat = _, axis) : tickFormat; + }; + + axis.tickSize = function(_) { + return arguments.length ? (tickSizeInner = tickSizeOuter = +_, axis) : tickSizeInner; + }; + + axis.tickSizeInner = function(_) { + return arguments.length ? (tickSizeInner = +_, axis) : tickSizeInner; + }; + + axis.tickSizeOuter = function(_) { + return arguments.length ? (tickSizeOuter = +_, axis) : tickSizeOuter; + }; + + axis.tickPadding = function(_) { + return arguments.length ? (tickPadding = +_, axis) : tickPadding; + }; + + return axis; +} + +function axisTop(scale) { + return axis(top, scale); +} + +function axisRight(scale) { + return axis(right, scale); +} + +function axisBottom(scale) { + return axis(bottom, scale); +} + +function axisLeft(scale) { + return axis(left, scale); +} + +var noop = {value: function() {}}; + +function dispatch() { + for (var i = 0, n = arguments.length, _ = {}, t; i < n; ++i) { + if (!(t = arguments[i] + "") || (t in _)) throw new Error("illegal type: " + t); + _[t] = []; + } + return new Dispatch(_); +} + +function Dispatch(_) { + this._ = _; +} + +function parseTypenames(typenames, types) { + return typenames.trim().split(/^|\s+/).map(function(t) { + var name = "", i = t.indexOf("."); + if (i >= 0) name = t.slice(i + 1), t = t.slice(0, i); + if (t && !types.hasOwnProperty(t)) throw new Error("unknown type: " + t); + return {type: t, name: name}; + }); +} + +Dispatch.prototype = dispatch.prototype = { + constructor: Dispatch, + on: function(typename, callback) { + var _ = this._, + T = parseTypenames(typename + "", _), + t, + i = -1, + n = T.length; + + // If no callback was specified, return the callback of the given type and name. + if (arguments.length < 2) { + while (++i < n) if ((t = (typename = T[i]).type) && (t = get(_[t], typename.name))) return t; + return; + } + + // If a type was specified, set the callback for the given type and name. + // Otherwise, if a null callback was specified, remove callbacks of the given name. + if (callback != null && typeof callback !== "function") throw new Error("invalid callback: " + callback); + while (++i < n) { + if (t = (typename = T[i]).type) _[t] = set(_[t], typename.name, callback); + else if (callback == null) for (t in _) _[t] = set(_[t], typename.name, null); + } + + return this; + }, + copy: function() { + var copy = {}, _ = this._; + for (var t in _) copy[t] = _[t].slice(); + return new Dispatch(copy); + }, + call: function(type, that) { + if ((n = arguments.length - 2) > 0) for (var args = new Array(n), i = 0, n, t; i < n; ++i) args[i] = arguments[i + 2]; + if (!this._.hasOwnProperty(type)) throw new Error("unknown type: " + type); + for (t = this._[type], i = 0, n = t.length; i < n; ++i) t[i].value.apply(that, args); + }, + apply: function(type, that, args) { + if (!this._.hasOwnProperty(type)) throw new Error("unknown type: " + type); + for (var t = this._[type], i = 0, n = t.length; i < n; ++i) t[i].value.apply(that, args); + } +}; + +function get(type, name) { + for (var i = 0, n = type.length, c; i < n; ++i) { + if ((c = type[i]).name === name) { + return c.value; + } + } +} + +function set(type, name, callback) { + for (var i = 0, n = type.length; i < n; ++i) { + if (type[i].name === name) { + type[i] = noop, type = type.slice(0, i).concat(type.slice(i + 1)); + break; + } + } + if (callback != null) type.push({name: name, value: callback}); + return type; +} + +var xhtml = "http://www.w3.org/1999/xhtml"; + +var namespaces = { + svg: "http://www.w3.org/2000/svg", + xhtml: xhtml, + xlink: "http://www.w3.org/1999/xlink", + xml: "http://www.w3.org/XML/1998/namespace", + xmlns: "http://www.w3.org/2000/xmlns/" +}; + +function namespace(name) { + var prefix = name += "", i = prefix.indexOf(":"); + if (i >= 0 && (prefix = name.slice(0, i)) !== "xmlns") name = name.slice(i + 1); + return namespaces.hasOwnProperty(prefix) ? {space: namespaces[prefix], local: name} : name; +} + +function creatorInherit(name) { + return function() { + var document = this.ownerDocument, + uri = this.namespaceURI; + return uri === xhtml && document.documentElement.namespaceURI === xhtml + ? document.createElement(name) + : document.createElementNS(uri, name); + }; +} + +function creatorFixed(fullname) { + return function() { + return this.ownerDocument.createElementNS(fullname.space, fullname.local); + }; +} + +function creator(name) { + var fullname = namespace(name); + return (fullname.local + ? creatorFixed + : creatorInherit)(fullname); +} + +function none() {} + +function selector(selector) { + return selector == null ? none : function() { + return this.querySelector(selector); + }; +} + +function selection_select(select) { + if (typeof select !== "function") select = selector(select); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = new Array(n), node, subnode, i = 0; i < n; ++i) { + if ((node = group[i]) && (subnode = select.call(node, node.__data__, i, group))) { + if ("__data__" in node) subnode.__data__ = node.__data__; + subgroup[i] = subnode; + } + } + } + + return new Selection(subgroups, this._parents); +} + +function empty$1() { + return []; +} + +function selectorAll(selector) { + return selector == null ? empty$1 : function() { + return this.querySelectorAll(selector); + }; +} + +function selection_selectAll(select) { + if (typeof select !== "function") select = selectorAll(select); + + for (var groups = this._groups, m = groups.length, subgroups = [], parents = [], j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + subgroups.push(select.call(node, node.__data__, i, group)); + parents.push(node); + } + } + } + + return new Selection(subgroups, parents); +} + +var matcher = function(selector) { + return function() { + return this.matches(selector); + }; +}; + +if (typeof document !== "undefined") { + var element = document.documentElement; + if (!element.matches) { + var vendorMatches = element.webkitMatchesSelector + || element.msMatchesSelector + || element.mozMatchesSelector + || element.oMatchesSelector; + matcher = function(selector) { + return function() { + return vendorMatches.call(this, selector); + }; + }; + } +} + +var matcher$1 = matcher; + +function selection_filter(match) { + if (typeof match !== "function") match = matcher$1(match); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = [], node, i = 0; i < n; ++i) { + if ((node = group[i]) && match.call(node, node.__data__, i, group)) { + subgroup.push(node); + } + } + } + + return new Selection(subgroups, this._parents); +} + +function sparse(update) { + return new Array(update.length); +} + +function selection_enter() { + return new Selection(this._enter || this._groups.map(sparse), this._parents); +} + +function EnterNode(parent, datum) { + this.ownerDocument = parent.ownerDocument; + this.namespaceURI = parent.namespaceURI; + this._next = null; + this._parent = parent; + this.__data__ = datum; +} + +EnterNode.prototype = { + constructor: EnterNode, + appendChild: function(child) { return this._parent.insertBefore(child, this._next); }, + insertBefore: function(child, next) { return this._parent.insertBefore(child, next); }, + querySelector: function(selector) { return this._parent.querySelector(selector); }, + querySelectorAll: function(selector) { return this._parent.querySelectorAll(selector); } +}; + +function constant$1(x) { + return function() { + return x; + }; +} + +var keyPrefix = "$"; // Protect against keys like “__proto__”. + +function bindIndex(parent, group, enter, update, exit, data) { + var i = 0, + node, + groupLength = group.length, + dataLength = data.length; + + // Put any non-null nodes that fit into update. + // Put any null nodes into enter. + // Put any remaining data into enter. + for (; i < dataLength; ++i) { + if (node = group[i]) { + node.__data__ = data[i]; + update[i] = node; + } else { + enter[i] = new EnterNode(parent, data[i]); + } + } + + // Put any non-null nodes that don’t fit into exit. + for (; i < groupLength; ++i) { + if (node = group[i]) { + exit[i] = node; + } + } +} + +function bindKey(parent, group, enter, update, exit, data, key) { + var i, + node, + nodeByKeyValue = {}, + groupLength = group.length, + dataLength = data.length, + keyValues = new Array(groupLength), + keyValue; + + // Compute the key for each node. + // If multiple nodes have the same key, the duplicates are added to exit. + for (i = 0; i < groupLength; ++i) { + if (node = group[i]) { + keyValues[i] = keyValue = keyPrefix + key.call(node, node.__data__, i, group); + if (keyValue in nodeByKeyValue) { + exit[i] = node; + } else { + nodeByKeyValue[keyValue] = node; + } + } + } + + // Compute the key for each datum. + // If there a node associated with this key, join and add it to update. + // If there is not (or the key is a duplicate), add it to enter. + for (i = 0; i < dataLength; ++i) { + keyValue = keyPrefix + key.call(parent, data[i], i, data); + if (node = nodeByKeyValue[keyValue]) { + update[i] = node; + node.__data__ = data[i]; + nodeByKeyValue[keyValue] = null; + } else { + enter[i] = new EnterNode(parent, data[i]); + } + } + + // Add any remaining nodes that were not bound to data to exit. + for (i = 0; i < groupLength; ++i) { + if ((node = group[i]) && (nodeByKeyValue[keyValues[i]] === node)) { + exit[i] = node; + } + } +} + +function selection_data(value, key) { + if (!value) { + data = new Array(this.size()), j = -1; + this.each(function(d) { data[++j] = d; }); + return data; + } + + var bind = key ? bindKey : bindIndex, + parents = this._parents, + groups = this._groups; + + if (typeof value !== "function") value = constant$1(value); + + for (var m = groups.length, update = new Array(m), enter = new Array(m), exit = new Array(m), j = 0; j < m; ++j) { + var parent = parents[j], + group = groups[j], + groupLength = group.length, + data = value.call(parent, parent && parent.__data__, j, parents), + dataLength = data.length, + enterGroup = enter[j] = new Array(dataLength), + updateGroup = update[j] = new Array(dataLength), + exitGroup = exit[j] = new Array(groupLength); + + bind(parent, group, enterGroup, updateGroup, exitGroup, data, key); + + // Now connect the enter nodes to their following update node, such that + // appendChild can insert the materialized enter node before this node, + // rather than at the end of the parent node. + for (var i0 = 0, i1 = 0, previous, next; i0 < dataLength; ++i0) { + if (previous = enterGroup[i0]) { + if (i0 >= i1) i1 = i0 + 1; + while (!(next = updateGroup[i1]) && ++i1 < dataLength); + previous._next = next || null; + } + } + } + + update = new Selection(update, parents); + update._enter = enter; + update._exit = exit; + return update; +} + +function selection_exit() { + return new Selection(this._exit || this._groups.map(sparse), this._parents); +} + +function selection_merge(selection$$1) { + + for (var groups0 = this._groups, groups1 = selection$$1._groups, m0 = groups0.length, m1 = groups1.length, m = Math.min(m0, m1), merges = new Array(m0), j = 0; j < m; ++j) { + for (var group0 = groups0[j], group1 = groups1[j], n = group0.length, merge = merges[j] = new Array(n), node, i = 0; i < n; ++i) { + if (node = group0[i] || group1[i]) { + merge[i] = node; + } + } + } + + for (; j < m0; ++j) { + merges[j] = groups0[j]; + } + + return new Selection(merges, this._parents); +} + +function selection_order() { + + for (var groups = this._groups, j = -1, m = groups.length; ++j < m;) { + for (var group = groups[j], i = group.length - 1, next = group[i], node; --i >= 0;) { + if (node = group[i]) { + if (next && next !== node.nextSibling) next.parentNode.insertBefore(node, next); + next = node; + } + } + } + + return this; +} + +function selection_sort(compare) { + if (!compare) compare = ascending$1; + + function compareNode(a, b) { + return a && b ? compare(a.__data__, b.__data__) : !a - !b; + } + + for (var groups = this._groups, m = groups.length, sortgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, sortgroup = sortgroups[j] = new Array(n), node, i = 0; i < n; ++i) { + if (node = group[i]) { + sortgroup[i] = node; + } + } + sortgroup.sort(compareNode); + } + + return new Selection(sortgroups, this._parents).order(); +} + +function ascending$1(a, b) { + return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN; +} + +function selection_call() { + var callback = arguments[0]; + arguments[0] = this; + callback.apply(null, arguments); + return this; +} + +function selection_nodes() { + var nodes = new Array(this.size()), i = -1; + this.each(function() { nodes[++i] = this; }); + return nodes; +} + +function selection_node() { + + for (var groups = this._groups, j = 0, m = groups.length; j < m; ++j) { + for (var group = groups[j], i = 0, n = group.length; i < n; ++i) { + var node = group[i]; + if (node) return node; + } + } + + return null; +} + +function selection_size() { + var size = 0; + this.each(function() { ++size; }); + return size; +} + +function selection_empty() { + return !this.node(); +} + +function selection_each(callback) { + + for (var groups = this._groups, j = 0, m = groups.length; j < m; ++j) { + for (var group = groups[j], i = 0, n = group.length, node; i < n; ++i) { + if (node = group[i]) callback.call(node, node.__data__, i, group); + } + } + + return this; +} + +function attrRemove(name) { + return function() { + this.removeAttribute(name); + }; +} + +function attrRemoveNS(fullname) { + return function() { + this.removeAttributeNS(fullname.space, fullname.local); + }; +} + +function attrConstant(name, value) { + return function() { + this.setAttribute(name, value); + }; +} + +function attrConstantNS(fullname, value) { + return function() { + this.setAttributeNS(fullname.space, fullname.local, value); + }; +} + +function attrFunction(name, value) { + return function() { + var v = value.apply(this, arguments); + if (v == null) this.removeAttribute(name); + else this.setAttribute(name, v); + }; +} + +function attrFunctionNS(fullname, value) { + return function() { + var v = value.apply(this, arguments); + if (v == null) this.removeAttributeNS(fullname.space, fullname.local); + else this.setAttributeNS(fullname.space, fullname.local, v); + }; +} + +function selection_attr(name, value) { + var fullname = namespace(name); + + if (arguments.length < 2) { + var node = this.node(); + return fullname.local + ? node.getAttributeNS(fullname.space, fullname.local) + : node.getAttribute(fullname); + } + + return this.each((value == null + ? (fullname.local ? attrRemoveNS : attrRemove) : (typeof value === "function" + ? (fullname.local ? attrFunctionNS : attrFunction) + : (fullname.local ? attrConstantNS : attrConstant)))(fullname, value)); +} + +function defaultView(node) { + return (node.ownerDocument && node.ownerDocument.defaultView) // node is a Node + || (node.document && node) // node is a Window + || node.defaultView; // node is a Document +} + +function styleRemove(name) { + return function() { + this.style.removeProperty(name); + }; +} + +function styleConstant(name, value, priority) { + return function() { + this.style.setProperty(name, value, priority); + }; +} + +function styleFunction(name, value, priority) { + return function() { + var v = value.apply(this, arguments); + if (v == null) this.style.removeProperty(name); + else this.style.setProperty(name, v, priority); + }; +} + +function selection_style(name, value, priority) { + return arguments.length > 1 + ? this.each((value == null + ? styleRemove : typeof value === "function" + ? styleFunction + : styleConstant)(name, value, priority == null ? "" : priority)) + : styleValue(this.node(), name); +} + +function styleValue(node, name) { + return node.style.getPropertyValue(name) + || defaultView(node).getComputedStyle(node, null).getPropertyValue(name); +} + +function propertyRemove(name) { + return function() { + delete this[name]; + }; +} + +function propertyConstant(name, value) { + return function() { + this[name] = value; + }; +} + +function propertyFunction(name, value) { + return function() { + var v = value.apply(this, arguments); + if (v == null) delete this[name]; + else this[name] = v; + }; +} + +function selection_property(name, value) { + return arguments.length > 1 + ? this.each((value == null + ? propertyRemove : typeof value === "function" + ? propertyFunction + : propertyConstant)(name, value)) + : this.node()[name]; +} + +function classArray(string) { + return string.trim().split(/^|\s+/); +} + +function classList(node) { + return node.classList || new ClassList(node); +} + +function ClassList(node) { + this._node = node; + this._names = classArray(node.getAttribute("class") || ""); +} + +ClassList.prototype = { + add: function(name) { + var i = this._names.indexOf(name); + if (i < 0) { + this._names.push(name); + this._node.setAttribute("class", this._names.join(" ")); + } + }, + remove: function(name) { + var i = this._names.indexOf(name); + if (i >= 0) { + this._names.splice(i, 1); + this._node.setAttribute("class", this._names.join(" ")); + } + }, + contains: function(name) { + return this._names.indexOf(name) >= 0; + } +}; + +function classedAdd(node, names) { + var list = classList(node), i = -1, n = names.length; + while (++i < n) list.add(names[i]); +} + +function classedRemove(node, names) { + var list = classList(node), i = -1, n = names.length; + while (++i < n) list.remove(names[i]); +} + +function classedTrue(names) { + return function() { + classedAdd(this, names); + }; +} + +function classedFalse(names) { + return function() { + classedRemove(this, names); + }; +} + +function classedFunction(names, value) { + return function() { + (value.apply(this, arguments) ? classedAdd : classedRemove)(this, names); + }; +} + +function selection_classed(name, value) { + var names = classArray(name + ""); + + if (arguments.length < 2) { + var list = classList(this.node()), i = -1, n = names.length; + while (++i < n) if (!list.contains(names[i])) return false; + return true; + } + + return this.each((typeof value === "function" + ? classedFunction : value + ? classedTrue + : classedFalse)(names, value)); +} + +function textRemove() { + this.textContent = ""; +} + +function textConstant(value) { + return function() { + this.textContent = value; + }; +} + +function textFunction(value) { + return function() { + var v = value.apply(this, arguments); + this.textContent = v == null ? "" : v; + }; +} + +function selection_text(value) { + return arguments.length + ? this.each(value == null + ? textRemove : (typeof value === "function" + ? textFunction + : textConstant)(value)) + : this.node().textContent; +} + +function htmlRemove() { + this.innerHTML = ""; +} + +function htmlConstant(value) { + return function() { + this.innerHTML = value; + }; +} + +function htmlFunction(value) { + return function() { + var v = value.apply(this, arguments); + this.innerHTML = v == null ? "" : v; + }; +} + +function selection_html(value) { + return arguments.length + ? this.each(value == null + ? htmlRemove : (typeof value === "function" + ? htmlFunction + : htmlConstant)(value)) + : this.node().innerHTML; +} + +function raise() { + if (this.nextSibling) this.parentNode.appendChild(this); +} + +function selection_raise() { + return this.each(raise); +} + +function lower() { + if (this.previousSibling) this.parentNode.insertBefore(this, this.parentNode.firstChild); +} + +function selection_lower() { + return this.each(lower); +} + +function selection_append(name) { + var create = typeof name === "function" ? name : creator(name); + return this.select(function() { + return this.appendChild(create.apply(this, arguments)); + }); +} + +function constantNull() { + return null; +} + +function selection_insert(name, before) { + var create = typeof name === "function" ? name : creator(name), + select = before == null ? constantNull : typeof before === "function" ? before : selector(before); + return this.select(function() { + return this.insertBefore(create.apply(this, arguments), select.apply(this, arguments) || null); + }); +} + +function remove() { + var parent = this.parentNode; + if (parent) parent.removeChild(this); +} + +function selection_remove() { + return this.each(remove); +} + +function selection_cloneShallow() { + return this.parentNode.insertBefore(this.cloneNode(false), this.nextSibling); +} + +function selection_cloneDeep() { + return this.parentNode.insertBefore(this.cloneNode(true), this.nextSibling); +} + +function selection_clone(deep) { + return this.select(deep ? selection_cloneDeep : selection_cloneShallow); +} + +function selection_datum(value) { + return arguments.length + ? this.property("__data__", value) + : this.node().__data__; +} + +var filterEvents = {}; + +exports.event = null; + +if (typeof document !== "undefined") { + var element$1 = document.documentElement; + if (!("onmouseenter" in element$1)) { + filterEvents = {mouseenter: "mouseover", mouseleave: "mouseout"}; + } +} + +function filterContextListener(listener, index, group) { + listener = contextListener(listener, index, group); + return function(event) { + var related = event.relatedTarget; + if (!related || (related !== this && !(related.compareDocumentPosition(this) & 8))) { + listener.call(this, event); + } + }; +} + +function contextListener(listener, index, group) { + return function(event1) { + var event0 = exports.event; // Events can be reentrant (e.g., focus). + exports.event = event1; + try { + listener.call(this, this.__data__, index, group); + } finally { + exports.event = event0; + } + }; +} + +function parseTypenames$1(typenames) { + return typenames.trim().split(/^|\s+/).map(function(t) { + var name = "", i = t.indexOf("."); + if (i >= 0) name = t.slice(i + 1), t = t.slice(0, i); + return {type: t, name: name}; + }); +} + +function onRemove(typename) { + return function() { + var on = this.__on; + if (!on) return; + for (var j = 0, i = -1, m = on.length, o; j < m; ++j) { + if (o = on[j], (!typename.type || o.type === typename.type) && o.name === typename.name) { + this.removeEventListener(o.type, o.listener, o.capture); + } else { + on[++i] = o; + } + } + if (++i) on.length = i; + else delete this.__on; + }; +} + +function onAdd(typename, value, capture) { + var wrap = filterEvents.hasOwnProperty(typename.type) ? filterContextListener : contextListener; + return function(d, i, group) { + var on = this.__on, o, listener = wrap(value, i, group); + if (on) for (var j = 0, m = on.length; j < m; ++j) { + if ((o = on[j]).type === typename.type && o.name === typename.name) { + this.removeEventListener(o.type, o.listener, o.capture); + this.addEventListener(o.type, o.listener = listener, o.capture = capture); + o.value = value; + return; + } + } + this.addEventListener(typename.type, listener, capture); + o = {type: typename.type, name: typename.name, value: value, listener: listener, capture: capture}; + if (!on) this.__on = [o]; + else on.push(o); + }; +} + +function selection_on(typename, value, capture) { + var typenames = parseTypenames$1(typename + ""), i, n = typenames.length, t; + + if (arguments.length < 2) { + var on = this.node().__on; + if (on) for (var j = 0, m = on.length, o; j < m; ++j) { + for (i = 0, o = on[j]; i < n; ++i) { + if ((t = typenames[i]).type === o.type && t.name === o.name) { + return o.value; + } + } + } + return; + } + + on = value ? onAdd : onRemove; + if (capture == null) capture = false; + for (i = 0; i < n; ++i) this.each(on(typenames[i], value, capture)); + return this; +} + +function customEvent(event1, listener, that, args) { + var event0 = exports.event; + event1.sourceEvent = exports.event; + exports.event = event1; + try { + return listener.apply(that, args); + } finally { + exports.event = event0; + } +} + +function dispatchEvent(node, type, params) { + var window = defaultView(node), + event = window.CustomEvent; + + if (typeof event === "function") { + event = new event(type, params); + } else { + event = window.document.createEvent("Event"); + if (params) event.initEvent(type, params.bubbles, params.cancelable), event.detail = params.detail; + else event.initEvent(type, false, false); + } + + node.dispatchEvent(event); +} + +function dispatchConstant(type, params) { + return function() { + return dispatchEvent(this, type, params); + }; +} + +function dispatchFunction(type, params) { + return function() { + return dispatchEvent(this, type, params.apply(this, arguments)); + }; +} + +function selection_dispatch(type, params) { + return this.each((typeof params === "function" + ? dispatchFunction + : dispatchConstant)(type, params)); +} + +var root = [null]; + +function Selection(groups, parents) { + this._groups = groups; + this._parents = parents; +} + +function selection() { + return new Selection([[document.documentElement]], root); +} + +Selection.prototype = selection.prototype = { + constructor: Selection, + select: selection_select, + selectAll: selection_selectAll, + filter: selection_filter, + data: selection_data, + enter: selection_enter, + exit: selection_exit, + merge: selection_merge, + order: selection_order, + sort: selection_sort, + call: selection_call, + nodes: selection_nodes, + node: selection_node, + size: selection_size, + empty: selection_empty, + each: selection_each, + attr: selection_attr, + style: selection_style, + property: selection_property, + classed: selection_classed, + text: selection_text, + html: selection_html, + raise: selection_raise, + lower: selection_lower, + append: selection_append, + insert: selection_insert, + remove: selection_remove, + clone: selection_clone, + datum: selection_datum, + on: selection_on, + dispatch: selection_dispatch +}; + +function select(selector) { + return typeof selector === "string" + ? new Selection([[document.querySelector(selector)]], [document.documentElement]) + : new Selection([[selector]], root); +} + +function create(name) { + return select(creator(name).call(document.documentElement)); +} + +var nextId = 0; + +function local$1() { + return new Local; +} + +function Local() { + this._ = "@" + (++nextId).toString(36); +} + +Local.prototype = local$1.prototype = { + constructor: Local, + get: function(node) { + var id = this._; + while (!(id in node)) if (!(node = node.parentNode)) return; + return node[id]; + }, + set: function(node, value) { + return node[this._] = value; + }, + remove: function(node) { + return this._ in node && delete node[this._]; + }, + toString: function() { + return this._; + } +}; + +function sourceEvent() { + var current = exports.event, source; + while (source = current.sourceEvent) current = source; + return current; +} + +function point(node, event) { + var svg = node.ownerSVGElement || node; + + if (svg.createSVGPoint) { + var point = svg.createSVGPoint(); + point.x = event.clientX, point.y = event.clientY; + point = point.matrixTransform(node.getScreenCTM().inverse()); + return [point.x, point.y]; + } + + var rect = node.getBoundingClientRect(); + return [event.clientX - rect.left - node.clientLeft, event.clientY - rect.top - node.clientTop]; +} + +function mouse(node) { + var event = sourceEvent(); + if (event.changedTouches) event = event.changedTouches[0]; + return point(node, event); +} + +function selectAll(selector) { + return typeof selector === "string" + ? new Selection([document.querySelectorAll(selector)], [document.documentElement]) + : new Selection([selector == null ? [] : selector], root); +} + +function touch(node, touches, identifier) { + if (arguments.length < 3) identifier = touches, touches = sourceEvent().changedTouches; + + for (var i = 0, n = touches ? touches.length : 0, touch; i < n; ++i) { + if ((touch = touches[i]).identifier === identifier) { + return point(node, touch); + } + } + + return null; +} + +function touches(node, touches) { + if (touches == null) touches = sourceEvent().touches; + + for (var i = 0, n = touches ? touches.length : 0, points = new Array(n); i < n; ++i) { + points[i] = point(node, touches[i]); + } + + return points; +} + +function nopropagation() { + exports.event.stopImmediatePropagation(); +} + +function noevent() { + exports.event.preventDefault(); + exports.event.stopImmediatePropagation(); +} + +function dragDisable(view) { + var root = view.document.documentElement, + selection = select(view).on("dragstart.drag", noevent, true); + if ("onselectstart" in root) { + selection.on("selectstart.drag", noevent, true); + } else { + root.__noselect = root.style.MozUserSelect; + root.style.MozUserSelect = "none"; + } +} + +function yesdrag(view, noclick) { + var root = view.document.documentElement, + selection = select(view).on("dragstart.drag", null); + if (noclick) { + selection.on("click.drag", noevent, true); + setTimeout(function() { selection.on("click.drag", null); }, 0); + } + if ("onselectstart" in root) { + selection.on("selectstart.drag", null); + } else { + root.style.MozUserSelect = root.__noselect; + delete root.__noselect; + } +} + +function constant$2(x) { + return function() { + return x; + }; +} + +function DragEvent(target, type, subject, id, active, x, y, dx, dy, dispatch) { + this.target = target; + this.type = type; + this.subject = subject; + this.identifier = id; + this.active = active; + this.x = x; + this.y = y; + this.dx = dx; + this.dy = dy; + this._ = dispatch; +} + +DragEvent.prototype.on = function() { + var value = this._.on.apply(this._, arguments); + return value === this._ ? this : value; +}; + +// Ignore right-click, since that should open the context menu. +function defaultFilter$1() { + return !exports.event.button; +} + +function defaultContainer() { + return this.parentNode; +} + +function defaultSubject(d) { + return d == null ? {x: exports.event.x, y: exports.event.y} : d; +} + +function defaultTouchable() { + return "ontouchstart" in this; +} + +function drag() { + var filter = defaultFilter$1, + container = defaultContainer, + subject = defaultSubject, + touchable = defaultTouchable, + gestures = {}, + listeners = dispatch("start", "drag", "end"), + active = 0, + mousedownx, + mousedowny, + mousemoving, + touchending, + clickDistance2 = 0; + + function drag(selection) { + selection + .on("mousedown.drag", mousedowned) + .filter(touchable) + .on("touchstart.drag", touchstarted) + .on("touchmove.drag", touchmoved) + .on("touchend.drag touchcancel.drag", touchended) + .style("touch-action", "none") + .style("-webkit-tap-highlight-color", "rgba(0,0,0,0)"); + } + + function mousedowned() { + if (touchending || !filter.apply(this, arguments)) return; + var gesture = beforestart("mouse", container.apply(this, arguments), mouse, this, arguments); + if (!gesture) return; + select(exports.event.view).on("mousemove.drag", mousemoved, true).on("mouseup.drag", mouseupped, true); + dragDisable(exports.event.view); + nopropagation(); + mousemoving = false; + mousedownx = exports.event.clientX; + mousedowny = exports.event.clientY; + gesture("start"); + } + + function mousemoved() { + noevent(); + if (!mousemoving) { + var dx = exports.event.clientX - mousedownx, dy = exports.event.clientY - mousedowny; + mousemoving = dx * dx + dy * dy > clickDistance2; + } + gestures.mouse("drag"); + } + + function mouseupped() { + select(exports.event.view).on("mousemove.drag mouseup.drag", null); + yesdrag(exports.event.view, mousemoving); + noevent(); + gestures.mouse("end"); + } + + function touchstarted() { + if (!filter.apply(this, arguments)) return; + var touches = exports.event.changedTouches, + c = container.apply(this, arguments), + n = touches.length, i, gesture; + + for (i = 0; i < n; ++i) { + if (gesture = beforestart(touches[i].identifier, c, touch, this, arguments)) { + nopropagation(); + gesture("start"); + } + } + } + + function touchmoved() { + var touches = exports.event.changedTouches, + n = touches.length, i, gesture; + + for (i = 0; i < n; ++i) { + if (gesture = gestures[touches[i].identifier]) { + noevent(); + gesture("drag"); + } + } + } + + function touchended() { + var touches = exports.event.changedTouches, + n = touches.length, i, gesture; + + if (touchending) clearTimeout(touchending); + touchending = setTimeout(function() { touchending = null; }, 500); // Ghost clicks are delayed! + for (i = 0; i < n; ++i) { + if (gesture = gestures[touches[i].identifier]) { + nopropagation(); + gesture("end"); + } + } + } + + function beforestart(id, container, point, that, args) { + var p = point(container, id), s, dx, dy, + sublisteners = listeners.copy(); + + if (!customEvent(new DragEvent(drag, "beforestart", s, id, active, p[0], p[1], 0, 0, sublisteners), function() { + if ((exports.event.subject = s = subject.apply(that, args)) == null) return false; + dx = s.x - p[0] || 0; + dy = s.y - p[1] || 0; + return true; + })) return; + + return function gesture(type) { + var p0 = p, n; + switch (type) { + case "start": gestures[id] = gesture, n = active++; break; + case "end": delete gestures[id], --active; // nobreak + case "drag": p = point(container, id), n = active; break; + } + customEvent(new DragEvent(drag, type, s, id, n, p[0] + dx, p[1] + dy, p[0] - p0[0], p[1] - p0[1], sublisteners), sublisteners.apply, sublisteners, [type, that, args]); + }; + } + + drag.filter = function(_) { + return arguments.length ? (filter = typeof _ === "function" ? _ : constant$2(!!_), drag) : filter; + }; + + drag.container = function(_) { + return arguments.length ? (container = typeof _ === "function" ? _ : constant$2(_), drag) : container; + }; + + drag.subject = function(_) { + return arguments.length ? (subject = typeof _ === "function" ? _ : constant$2(_), drag) : subject; + }; + + drag.touchable = function(_) { + return arguments.length ? (touchable = typeof _ === "function" ? _ : constant$2(!!_), drag) : touchable; + }; + + drag.on = function() { + var value = listeners.on.apply(listeners, arguments); + return value === listeners ? drag : value; + }; + + drag.clickDistance = function(_) { + return arguments.length ? (clickDistance2 = (_ = +_) * _, drag) : Math.sqrt(clickDistance2); + }; + + return drag; +} + +function define(constructor, factory, prototype) { + constructor.prototype = factory.prototype = prototype; + prototype.constructor = constructor; +} + +function extend(parent, definition) { + var prototype = Object.create(parent.prototype); + for (var key in definition) prototype[key] = definition[key]; + return prototype; +} + +function Color() {} + +var darker = 0.7; +var brighter = 1 / darker; + +var reI = "\\s*([+-]?\\d+)\\s*"; +var reN = "\\s*([+-]?\\d*\\.?\\d+(?:[eE][+-]?\\d+)?)\\s*"; +var reP = "\\s*([+-]?\\d*\\.?\\d+(?:[eE][+-]?\\d+)?)%\\s*"; +var reHex3 = /^#([0-9a-f]{3})$/; +var reHex6 = /^#([0-9a-f]{6})$/; +var reRgbInteger = new RegExp("^rgb\\(" + [reI, reI, reI] + "\\)$"); +var reRgbPercent = new RegExp("^rgb\\(" + [reP, reP, reP] + "\\)$"); +var reRgbaInteger = new RegExp("^rgba\\(" + [reI, reI, reI, reN] + "\\)$"); +var reRgbaPercent = new RegExp("^rgba\\(" + [reP, reP, reP, reN] + "\\)$"); +var reHslPercent = new RegExp("^hsl\\(" + [reN, reP, reP] + "\\)$"); +var reHslaPercent = new RegExp("^hsla\\(" + [reN, reP, reP, reN] + "\\)$"); + +var named = { + aliceblue: 0xf0f8ff, + antiquewhite: 0xfaebd7, + aqua: 0x00ffff, + aquamarine: 0x7fffd4, + azure: 0xf0ffff, + beige: 0xf5f5dc, + bisque: 0xffe4c4, + black: 0x000000, + blanchedalmond: 0xffebcd, + blue: 0x0000ff, + blueviolet: 0x8a2be2, + brown: 0xa52a2a, + burlywood: 0xdeb887, + cadetblue: 0x5f9ea0, + chartreuse: 0x7fff00, + chocolate: 0xd2691e, + coral: 0xff7f50, + cornflowerblue: 0x6495ed, + cornsilk: 0xfff8dc, + crimson: 0xdc143c, + cyan: 0x00ffff, + darkblue: 0x00008b, + darkcyan: 0x008b8b, + darkgoldenrod: 0xb8860b, + darkgray: 0xa9a9a9, + darkgreen: 0x006400, + darkgrey: 0xa9a9a9, + darkkhaki: 0xbdb76b, + darkmagenta: 0x8b008b, + darkolivegreen: 0x556b2f, + darkorange: 0xff8c00, + darkorchid: 0x9932cc, + darkred: 0x8b0000, + darksalmon: 0xe9967a, + darkseagreen: 0x8fbc8f, + darkslateblue: 0x483d8b, + darkslategray: 0x2f4f4f, + darkslategrey: 0x2f4f4f, + darkturquoise: 0x00ced1, + darkviolet: 0x9400d3, + deeppink: 0xff1493, + deepskyblue: 0x00bfff, + dimgray: 0x696969, + dimgrey: 0x696969, + dodgerblue: 0x1e90ff, + firebrick: 0xb22222, + floralwhite: 0xfffaf0, + forestgreen: 0x228b22, + fuchsia: 0xff00ff, + gainsboro: 0xdcdcdc, + ghostwhite: 0xf8f8ff, + gold: 0xffd700, + goldenrod: 0xdaa520, + gray: 0x808080, + green: 0x008000, + greenyellow: 0xadff2f, + grey: 0x808080, + honeydew: 0xf0fff0, + hotpink: 0xff69b4, + indianred: 0xcd5c5c, + indigo: 0x4b0082, + ivory: 0xfffff0, + khaki: 0xf0e68c, + lavender: 0xe6e6fa, + lavenderblush: 0xfff0f5, + lawngreen: 0x7cfc00, + lemonchiffon: 0xfffacd, + lightblue: 0xadd8e6, + lightcoral: 0xf08080, + lightcyan: 0xe0ffff, + lightgoldenrodyellow: 0xfafad2, + lightgray: 0xd3d3d3, + lightgreen: 0x90ee90, + lightgrey: 0xd3d3d3, + lightpink: 0xffb6c1, + lightsalmon: 0xffa07a, + lightseagreen: 0x20b2aa, + lightskyblue: 0x87cefa, + lightslategray: 0x778899, + lightslategrey: 0x778899, + lightsteelblue: 0xb0c4de, + lightyellow: 0xffffe0, + lime: 0x00ff00, + limegreen: 0x32cd32, + linen: 0xfaf0e6, + magenta: 0xff00ff, + maroon: 0x800000, + mediumaquamarine: 0x66cdaa, + mediumblue: 0x0000cd, + mediumorchid: 0xba55d3, + mediumpurple: 0x9370db, + mediumseagreen: 0x3cb371, + mediumslateblue: 0x7b68ee, + mediumspringgreen: 0x00fa9a, + mediumturquoise: 0x48d1cc, + mediumvioletred: 0xc71585, + midnightblue: 0x191970, + mintcream: 0xf5fffa, + mistyrose: 0xffe4e1, + moccasin: 0xffe4b5, + navajowhite: 0xffdead, + navy: 0x000080, + oldlace: 0xfdf5e6, + olive: 0x808000, + olivedrab: 0x6b8e23, + orange: 0xffa500, + orangered: 0xff4500, + orchid: 0xda70d6, + palegoldenrod: 0xeee8aa, + palegreen: 0x98fb98, + paleturquoise: 0xafeeee, + palevioletred: 0xdb7093, + papayawhip: 0xffefd5, + peachpuff: 0xffdab9, + peru: 0xcd853f, + pink: 0xffc0cb, + plum: 0xdda0dd, + powderblue: 0xb0e0e6, + purple: 0x800080, + rebeccapurple: 0x663399, + red: 0xff0000, + rosybrown: 0xbc8f8f, + royalblue: 0x4169e1, + saddlebrown: 0x8b4513, + salmon: 0xfa8072, + sandybrown: 0xf4a460, + seagreen: 0x2e8b57, + seashell: 0xfff5ee, + sienna: 0xa0522d, + silver: 0xc0c0c0, + skyblue: 0x87ceeb, + slateblue: 0x6a5acd, + slategray: 0x708090, + slategrey: 0x708090, + snow: 0xfffafa, + springgreen: 0x00ff7f, + steelblue: 0x4682b4, + tan: 0xd2b48c, + teal: 0x008080, + thistle: 0xd8bfd8, + tomato: 0xff6347, + turquoise: 0x40e0d0, + violet: 0xee82ee, + wheat: 0xf5deb3, + white: 0xffffff, + whitesmoke: 0xf5f5f5, + yellow: 0xffff00, + yellowgreen: 0x9acd32 +}; + +define(Color, color, { + displayable: function() { + return this.rgb().displayable(); + }, + toString: function() { + return this.rgb() + ""; + } +}); + +function color(format) { + var m; + format = (format + "").trim().toLowerCase(); + return (m = reHex3.exec(format)) ? (m = parseInt(m[1], 16), new Rgb((m >> 8 & 0xf) | (m >> 4 & 0x0f0), (m >> 4 & 0xf) | (m & 0xf0), ((m & 0xf) << 4) | (m & 0xf), 1)) // #f00 + : (m = reHex6.exec(format)) ? rgbn(parseInt(m[1], 16)) // #ff0000 + : (m = reRgbInteger.exec(format)) ? new Rgb(m[1], m[2], m[3], 1) // rgb(255, 0, 0) + : (m = reRgbPercent.exec(format)) ? new Rgb(m[1] * 255 / 100, m[2] * 255 / 100, m[3] * 255 / 100, 1) // rgb(100%, 0%, 0%) + : (m = reRgbaInteger.exec(format)) ? rgba(m[1], m[2], m[3], m[4]) // rgba(255, 0, 0, 1) + : (m = reRgbaPercent.exec(format)) ? rgba(m[1] * 255 / 100, m[2] * 255 / 100, m[3] * 255 / 100, m[4]) // rgb(100%, 0%, 0%, 1) + : (m = reHslPercent.exec(format)) ? hsla(m[1], m[2] / 100, m[3] / 100, 1) // hsl(120, 50%, 50%) + : (m = reHslaPercent.exec(format)) ? hsla(m[1], m[2] / 100, m[3] / 100, m[4]) // hsla(120, 50%, 50%, 1) + : named.hasOwnProperty(format) ? rgbn(named[format]) + : format === "transparent" ? new Rgb(NaN, NaN, NaN, 0) + : null; +} + +function rgbn(n) { + return new Rgb(n >> 16 & 0xff, n >> 8 & 0xff, n & 0xff, 1); +} + +function rgba(r, g, b, a) { + if (a <= 0) r = g = b = NaN; + return new Rgb(r, g, b, a); +} + +function rgbConvert(o) { + if (!(o instanceof Color)) o = color(o); + if (!o) return new Rgb; + o = o.rgb(); + return new Rgb(o.r, o.g, o.b, o.opacity); +} + +function rgb(r, g, b, opacity) { + return arguments.length === 1 ? rgbConvert(r) : new Rgb(r, g, b, opacity == null ? 1 : opacity); +} + +function Rgb(r, g, b, opacity) { + this.r = +r; + this.g = +g; + this.b = +b; + this.opacity = +opacity; +} + +define(Rgb, rgb, extend(Color, { + brighter: function(k) { + k = k == null ? brighter : Math.pow(brighter, k); + return new Rgb(this.r * k, this.g * k, this.b * k, this.opacity); + }, + darker: function(k) { + k = k == null ? darker : Math.pow(darker, k); + return new Rgb(this.r * k, this.g * k, this.b * k, this.opacity); + }, + rgb: function() { + return this; + }, + displayable: function() { + return (0 <= this.r && this.r <= 255) + && (0 <= this.g && this.g <= 255) + && (0 <= this.b && this.b <= 255) + && (0 <= this.opacity && this.opacity <= 1); + }, + toString: function() { + var a = this.opacity; a = isNaN(a) ? 1 : Math.max(0, Math.min(1, a)); + return (a === 1 ? "rgb(" : "rgba(") + + Math.max(0, Math.min(255, Math.round(this.r) || 0)) + ", " + + Math.max(0, Math.min(255, Math.round(this.g) || 0)) + ", " + + Math.max(0, Math.min(255, Math.round(this.b) || 0)) + + (a === 1 ? ")" : ", " + a + ")"); + } +})); + +function hsla(h, s, l, a) { + if (a <= 0) h = s = l = NaN; + else if (l <= 0 || l >= 1) h = s = NaN; + else if (s <= 0) h = NaN; + return new Hsl(h, s, l, a); +} + +function hslConvert(o) { + if (o instanceof Hsl) return new Hsl(o.h, o.s, o.l, o.opacity); + if (!(o instanceof Color)) o = color(o); + if (!o) return new Hsl; + if (o instanceof Hsl) return o; + o = o.rgb(); + var r = o.r / 255, + g = o.g / 255, + b = o.b / 255, + min = Math.min(r, g, b), + max = Math.max(r, g, b), + h = NaN, + s = max - min, + l = (max + min) / 2; + if (s) { + if (r === max) h = (g - b) / s + (g < b) * 6; + else if (g === max) h = (b - r) / s + 2; + else h = (r - g) / s + 4; + s /= l < 0.5 ? max + min : 2 - max - min; + h *= 60; + } else { + s = l > 0 && l < 1 ? 0 : h; + } + return new Hsl(h, s, l, o.opacity); +} + +function hsl(h, s, l, opacity) { + return arguments.length === 1 ? hslConvert(h) : new Hsl(h, s, l, opacity == null ? 1 : opacity); +} + +function Hsl(h, s, l, opacity) { + this.h = +h; + this.s = +s; + this.l = +l; + this.opacity = +opacity; +} + +define(Hsl, hsl, extend(Color, { + brighter: function(k) { + k = k == null ? brighter : Math.pow(brighter, k); + return new Hsl(this.h, this.s, this.l * k, this.opacity); + }, + darker: function(k) { + k = k == null ? darker : Math.pow(darker, k); + return new Hsl(this.h, this.s, this.l * k, this.opacity); + }, + rgb: function() { + var h = this.h % 360 + (this.h < 0) * 360, + s = isNaN(h) || isNaN(this.s) ? 0 : this.s, + l = this.l, + m2 = l + (l < 0.5 ? l : 1 - l) * s, + m1 = 2 * l - m2; + return new Rgb( + hsl2rgb(h >= 240 ? h - 240 : h + 120, m1, m2), + hsl2rgb(h, m1, m2), + hsl2rgb(h < 120 ? h + 240 : h - 120, m1, m2), + this.opacity + ); + }, + displayable: function() { + return (0 <= this.s && this.s <= 1 || isNaN(this.s)) + && (0 <= this.l && this.l <= 1) + && (0 <= this.opacity && this.opacity <= 1); + } +})); + +/* From FvD 13.37, CSS Color Module Level 3 */ +function hsl2rgb(h, m1, m2) { + return (h < 60 ? m1 + (m2 - m1) * h / 60 + : h < 180 ? m2 + : h < 240 ? m1 + (m2 - m1) * (240 - h) / 60 + : m1) * 255; +} + +var deg2rad = Math.PI / 180; +var rad2deg = 180 / Math.PI; + +var Kn = 18; +var Xn = 0.950470; +var Yn = 1; +var Zn = 1.088830; +var t0 = 4 / 29; +var t1 = 6 / 29; +var t2 = 3 * t1 * t1; +var t3 = t1 * t1 * t1; + +function labConvert(o) { + if (o instanceof Lab) return new Lab(o.l, o.a, o.b, o.opacity); + if (o instanceof Hcl) { + var h = o.h * deg2rad; + return new Lab(o.l, Math.cos(h) * o.c, Math.sin(h) * o.c, o.opacity); + } + if (!(o instanceof Rgb)) o = rgbConvert(o); + var b = rgb2xyz(o.r), + a = rgb2xyz(o.g), + l = rgb2xyz(o.b), + x = xyz2lab((0.4124564 * b + 0.3575761 * a + 0.1804375 * l) / Xn), + y = xyz2lab((0.2126729 * b + 0.7151522 * a + 0.0721750 * l) / Yn), + z = xyz2lab((0.0193339 * b + 0.1191920 * a + 0.9503041 * l) / Zn); + return new Lab(116 * y - 16, 500 * (x - y), 200 * (y - z), o.opacity); +} + +function lab(l, a, b, opacity) { + return arguments.length === 1 ? labConvert(l) : new Lab(l, a, b, opacity == null ? 1 : opacity); +} + +function Lab(l, a, b, opacity) { + this.l = +l; + this.a = +a; + this.b = +b; + this.opacity = +opacity; +} + +define(Lab, lab, extend(Color, { + brighter: function(k) { + return new Lab(this.l + Kn * (k == null ? 1 : k), this.a, this.b, this.opacity); + }, + darker: function(k) { + return new Lab(this.l - Kn * (k == null ? 1 : k), this.a, this.b, this.opacity); + }, + rgb: function() { + var y = (this.l + 16) / 116, + x = isNaN(this.a) ? y : y + this.a / 500, + z = isNaN(this.b) ? y : y - this.b / 200; + y = Yn * lab2xyz(y); + x = Xn * lab2xyz(x); + z = Zn * lab2xyz(z); + return new Rgb( + xyz2rgb( 3.2404542 * x - 1.5371385 * y - 0.4985314 * z), // D65 -> sRGB + xyz2rgb(-0.9692660 * x + 1.8760108 * y + 0.0415560 * z), + xyz2rgb( 0.0556434 * x - 0.2040259 * y + 1.0572252 * z), + this.opacity + ); + } +})); + +function xyz2lab(t) { + return t > t3 ? Math.pow(t, 1 / 3) : t / t2 + t0; +} + +function lab2xyz(t) { + return t > t1 ? t * t * t : t2 * (t - t0); +} + +function xyz2rgb(x) { + return 255 * (x <= 0.0031308 ? 12.92 * x : 1.055 * Math.pow(x, 1 / 2.4) - 0.055); +} + +function rgb2xyz(x) { + return (x /= 255) <= 0.04045 ? x / 12.92 : Math.pow((x + 0.055) / 1.055, 2.4); +} + +function hclConvert(o) { + if (o instanceof Hcl) return new Hcl(o.h, o.c, o.l, o.opacity); + if (!(o instanceof Lab)) o = labConvert(o); + var h = Math.atan2(o.b, o.a) * rad2deg; + return new Hcl(h < 0 ? h + 360 : h, Math.sqrt(o.a * o.a + o.b * o.b), o.l, o.opacity); +} + +function hcl(h, c, l, opacity) { + return arguments.length === 1 ? hclConvert(h) : new Hcl(h, c, l, opacity == null ? 1 : opacity); +} + +function Hcl(h, c, l, opacity) { + this.h = +h; + this.c = +c; + this.l = +l; + this.opacity = +opacity; +} + +define(Hcl, hcl, extend(Color, { + brighter: function(k) { + return new Hcl(this.h, this.c, this.l + Kn * (k == null ? 1 : k), this.opacity); + }, + darker: function(k) { + return new Hcl(this.h, this.c, this.l - Kn * (k == null ? 1 : k), this.opacity); + }, + rgb: function() { + return labConvert(this).rgb(); + } +})); + +var A = -0.14861; +var B = +1.78277; +var C = -0.29227; +var D = -0.90649; +var E = +1.97294; +var ED = E * D; +var EB = E * B; +var BC_DA = B * C - D * A; + +function cubehelixConvert(o) { + if (o instanceof Cubehelix) return new Cubehelix(o.h, o.s, o.l, o.opacity); + if (!(o instanceof Rgb)) o = rgbConvert(o); + var r = o.r / 255, + g = o.g / 255, + b = o.b / 255, + l = (BC_DA * b + ED * r - EB * g) / (BC_DA + ED - EB), + bl = b - l, + k = (E * (g - l) - C * bl) / D, + s = Math.sqrt(k * k + bl * bl) / (E * l * (1 - l)), // NaN if l=0 or l=1 + h = s ? Math.atan2(k, bl) * rad2deg - 120 : NaN; + return new Cubehelix(h < 0 ? h + 360 : h, s, l, o.opacity); +} + +function cubehelix(h, s, l, opacity) { + return arguments.length === 1 ? cubehelixConvert(h) : new Cubehelix(h, s, l, opacity == null ? 1 : opacity); +} + +function Cubehelix(h, s, l, opacity) { + this.h = +h; + this.s = +s; + this.l = +l; + this.opacity = +opacity; +} + +define(Cubehelix, cubehelix, extend(Color, { + brighter: function(k) { + k = k == null ? brighter : Math.pow(brighter, k); + return new Cubehelix(this.h, this.s, this.l * k, this.opacity); + }, + darker: function(k) { + k = k == null ? darker : Math.pow(darker, k); + return new Cubehelix(this.h, this.s, this.l * k, this.opacity); + }, + rgb: function() { + var h = isNaN(this.h) ? 0 : (this.h + 120) * deg2rad, + l = +this.l, + a = isNaN(this.s) ? 0 : this.s * l * (1 - l), + cosh = Math.cos(h), + sinh = Math.sin(h); + return new Rgb( + 255 * (l + a * (A * cosh + B * sinh)), + 255 * (l + a * (C * cosh + D * sinh)), + 255 * (l + a * (E * cosh)), + this.opacity + ); + } +})); + +function basis(t1, v0, v1, v2, v3) { + var t2 = t1 * t1, t3 = t2 * t1; + return ((1 - 3 * t1 + 3 * t2 - t3) * v0 + + (4 - 6 * t2 + 3 * t3) * v1 + + (1 + 3 * t1 + 3 * t2 - 3 * t3) * v2 + + t3 * v3) / 6; +} + +function basis$1(values) { + var n = values.length - 1; + return function(t) { + var i = t <= 0 ? (t = 0) : t >= 1 ? (t = 1, n - 1) : Math.floor(t * n), + v1 = values[i], + v2 = values[i + 1], + v0 = i > 0 ? values[i - 1] : 2 * v1 - v2, + v3 = i < n - 1 ? values[i + 2] : 2 * v2 - v1; + return basis((t - i / n) * n, v0, v1, v2, v3); + }; +} + +function basisClosed(values) { + var n = values.length; + return function(t) { + var i = Math.floor(((t %= 1) < 0 ? ++t : t) * n), + v0 = values[(i + n - 1) % n], + v1 = values[i % n], + v2 = values[(i + 1) % n], + v3 = values[(i + 2) % n]; + return basis((t - i / n) * n, v0, v1, v2, v3); + }; +} + +function constant$3(x) { + return function() { + return x; + }; +} + +function linear(a, d) { + return function(t) { + return a + t * d; + }; +} + +function exponential(a, b, y) { + return a = Math.pow(a, y), b = Math.pow(b, y) - a, y = 1 / y, function(t) { + return Math.pow(a + t * b, y); + }; +} + +function hue(a, b) { + var d = b - a; + return d ? linear(a, d > 180 || d < -180 ? d - 360 * Math.round(d / 360) : d) : constant$3(isNaN(a) ? b : a); +} + +function gamma(y) { + return (y = +y) === 1 ? nogamma : function(a, b) { + return b - a ? exponential(a, b, y) : constant$3(isNaN(a) ? b : a); + }; +} + +function nogamma(a, b) { + var d = b - a; + return d ? linear(a, d) : constant$3(isNaN(a) ? b : a); +} + +var interpolateRgb = (function rgbGamma(y) { + var color$$1 = gamma(y); + + function rgb$$1(start, end) { + var r = color$$1((start = rgb(start)).r, (end = rgb(end)).r), + g = color$$1(start.g, end.g), + b = color$$1(start.b, end.b), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.r = r(t); + start.g = g(t); + start.b = b(t); + start.opacity = opacity(t); + return start + ""; + }; + } + + rgb$$1.gamma = rgbGamma; + + return rgb$$1; +})(1); + +function rgbSpline(spline) { + return function(colors) { + var n = colors.length, + r = new Array(n), + g = new Array(n), + b = new Array(n), + i, color$$1; + for (i = 0; i < n; ++i) { + color$$1 = rgb(colors[i]); + r[i] = color$$1.r || 0; + g[i] = color$$1.g || 0; + b[i] = color$$1.b || 0; + } + r = spline(r); + g = spline(g); + b = spline(b); + color$$1.opacity = 1; + return function(t) { + color$$1.r = r(t); + color$$1.g = g(t); + color$$1.b = b(t); + return color$$1 + ""; + }; + }; +} + +var rgbBasis = rgbSpline(basis$1); +var rgbBasisClosed = rgbSpline(basisClosed); + +function array$1(a, b) { + var nb = b ? b.length : 0, + na = a ? Math.min(nb, a.length) : 0, + x = new Array(na), + c = new Array(nb), + i; + + for (i = 0; i < na; ++i) x[i] = interpolateValue(a[i], b[i]); + for (; i < nb; ++i) c[i] = b[i]; + + return function(t) { + for (i = 0; i < na; ++i) c[i] = x[i](t); + return c; + }; +} + +function date(a, b) { + var d = new Date; + return a = +a, b -= a, function(t) { + return d.setTime(a + b * t), d; + }; +} + +function reinterpolate(a, b) { + return a = +a, b -= a, function(t) { + return a + b * t; + }; +} + +function object(a, b) { + var i = {}, + c = {}, + k; + + if (a === null || typeof a !== "object") a = {}; + if (b === null || typeof b !== "object") b = {}; + + for (k in b) { + if (k in a) { + i[k] = interpolateValue(a[k], b[k]); + } else { + c[k] = b[k]; + } + } + + return function(t) { + for (k in i) c[k] = i[k](t); + return c; + }; +} + +var reA = /[-+]?(?:\d+\.?\d*|\.?\d+)(?:[eE][-+]?\d+)?/g; +var reB = new RegExp(reA.source, "g"); + +function zero(b) { + return function() { + return b; + }; +} + +function one(b) { + return function(t) { + return b(t) + ""; + }; +} + +function interpolateString(a, b) { + var bi = reA.lastIndex = reB.lastIndex = 0, // scan index for next number in b + am, // current match in a + bm, // current match in b + bs, // string preceding current number in b, if any + i = -1, // index in s + s = [], // string constants and placeholders + q = []; // number interpolators + + // Coerce inputs to strings. + a = a + "", b = b + ""; + + // Interpolate pairs of numbers in a & b. + while ((am = reA.exec(a)) + && (bm = reB.exec(b))) { + if ((bs = bm.index) > bi) { // a string precedes the next number in b + bs = b.slice(bi, bs); + if (s[i]) s[i] += bs; // coalesce with previous string + else s[++i] = bs; + } + if ((am = am[0]) === (bm = bm[0])) { // numbers in a & b match + if (s[i]) s[i] += bm; // coalesce with previous string + else s[++i] = bm; + } else { // interpolate non-matching numbers + s[++i] = null; + q.push({i: i, x: reinterpolate(am, bm)}); + } + bi = reB.lastIndex; + } + + // Add remains of b. + if (bi < b.length) { + bs = b.slice(bi); + if (s[i]) s[i] += bs; // coalesce with previous string + else s[++i] = bs; + } + + // Special optimization for only a single match. + // Otherwise, interpolate each of the numbers and rejoin the string. + return s.length < 2 ? (q[0] + ? one(q[0].x) + : zero(b)) + : (b = q.length, function(t) { + for (var i = 0, o; i < b; ++i) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }); +} + +function interpolateValue(a, b) { + var t = typeof b, c; + return b == null || t === "boolean" ? constant$3(b) + : (t === "number" ? reinterpolate + : t === "string" ? ((c = color(b)) ? (b = c, interpolateRgb) : interpolateString) + : b instanceof color ? interpolateRgb + : b instanceof Date ? date + : Array.isArray(b) ? array$1 + : typeof b.valueOf !== "function" && typeof b.toString !== "function" || isNaN(b) ? object + : reinterpolate)(a, b); +} + +function interpolateRound(a, b) { + return a = +a, b -= a, function(t) { + return Math.round(a + b * t); + }; +} + +var degrees = 180 / Math.PI; + +var identity$2 = { + translateX: 0, + translateY: 0, + rotate: 0, + skewX: 0, + scaleX: 1, + scaleY: 1 +}; + +function decompose(a, b, c, d, e, f) { + var scaleX, scaleY, skewX; + if (scaleX = Math.sqrt(a * a + b * b)) a /= scaleX, b /= scaleX; + if (skewX = a * c + b * d) c -= a * skewX, d -= b * skewX; + if (scaleY = Math.sqrt(c * c + d * d)) c /= scaleY, d /= scaleY, skewX /= scaleY; + if (a * d < b * c) a = -a, b = -b, skewX = -skewX, scaleX = -scaleX; + return { + translateX: e, + translateY: f, + rotate: Math.atan2(b, a) * degrees, + skewX: Math.atan(skewX) * degrees, + scaleX: scaleX, + scaleY: scaleY + }; +} + +var cssNode; +var cssRoot; +var cssView; +var svgNode; + +function parseCss(value) { + if (value === "none") return identity$2; + if (!cssNode) cssNode = document.createElement("DIV"), cssRoot = document.documentElement, cssView = document.defaultView; + cssNode.style.transform = value; + value = cssView.getComputedStyle(cssRoot.appendChild(cssNode), null).getPropertyValue("transform"); + cssRoot.removeChild(cssNode); + value = value.slice(7, -1).split(","); + return decompose(+value[0], +value[1], +value[2], +value[3], +value[4], +value[5]); +} + +function parseSvg(value) { + if (value == null) return identity$2; + if (!svgNode) svgNode = document.createElementNS("http://www.w3.org/2000/svg", "g"); + svgNode.setAttribute("transform", value); + if (!(value = svgNode.transform.baseVal.consolidate())) return identity$2; + value = value.matrix; + return decompose(value.a, value.b, value.c, value.d, value.e, value.f); +} + +function interpolateTransform(parse, pxComma, pxParen, degParen) { + + function pop(s) { + return s.length ? s.pop() + " " : ""; + } + + function translate(xa, ya, xb, yb, s, q) { + if (xa !== xb || ya !== yb) { + var i = s.push("translate(", null, pxComma, null, pxParen); + q.push({i: i - 4, x: reinterpolate(xa, xb)}, {i: i - 2, x: reinterpolate(ya, yb)}); + } else if (xb || yb) { + s.push("translate(" + xb + pxComma + yb + pxParen); + } + } + + function rotate(a, b, s, q) { + if (a !== b) { + if (a - b > 180) b += 360; else if (b - a > 180) a += 360; // shortest path + q.push({i: s.push(pop(s) + "rotate(", null, degParen) - 2, x: reinterpolate(a, b)}); + } else if (b) { + s.push(pop(s) + "rotate(" + b + degParen); + } + } + + function skewX(a, b, s, q) { + if (a !== b) { + q.push({i: s.push(pop(s) + "skewX(", null, degParen) - 2, x: reinterpolate(a, b)}); + } else if (b) { + s.push(pop(s) + "skewX(" + b + degParen); + } + } + + function scale(xa, ya, xb, yb, s, q) { + if (xa !== xb || ya !== yb) { + var i = s.push(pop(s) + "scale(", null, ",", null, ")"); + q.push({i: i - 4, x: reinterpolate(xa, xb)}, {i: i - 2, x: reinterpolate(ya, yb)}); + } else if (xb !== 1 || yb !== 1) { + s.push(pop(s) + "scale(" + xb + "," + yb + ")"); + } + } + + return function(a, b) { + var s = [], // string constants and placeholders + q = []; // number interpolators + a = parse(a), b = parse(b); + translate(a.translateX, a.translateY, b.translateX, b.translateY, s, q); + rotate(a.rotate, b.rotate, s, q); + skewX(a.skewX, b.skewX, s, q); + scale(a.scaleX, a.scaleY, b.scaleX, b.scaleY, s, q); + a = b = null; // gc + return function(t) { + var i = -1, n = q.length, o; + while (++i < n) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; + }; +} + +var interpolateTransformCss = interpolateTransform(parseCss, "px, ", "px)", "deg)"); +var interpolateTransformSvg = interpolateTransform(parseSvg, ", ", ")", ")"); + +var rho = Math.SQRT2; +var rho2 = 2; +var rho4 = 4; +var epsilon2 = 1e-12; + +function cosh(x) { + return ((x = Math.exp(x)) + 1 / x) / 2; +} + +function sinh(x) { + return ((x = Math.exp(x)) - 1 / x) / 2; +} + +function tanh(x) { + return ((x = Math.exp(2 * x)) - 1) / (x + 1); +} + +// p0 = [ux0, uy0, w0] +// p1 = [ux1, uy1, w1] +function interpolateZoom(p0, p1) { + var ux0 = p0[0], uy0 = p0[1], w0 = p0[2], + ux1 = p1[0], uy1 = p1[1], w1 = p1[2], + dx = ux1 - ux0, + dy = uy1 - uy0, + d2 = dx * dx + dy * dy, + i, + S; + + // Special case for u0 ≅ u1. + if (d2 < epsilon2) { + S = Math.log(w1 / w0) / rho; + i = function(t) { + return [ + ux0 + t * dx, + uy0 + t * dy, + w0 * Math.exp(rho * t * S) + ]; + }; + } + + // General case. + else { + var d1 = Math.sqrt(d2), + b0 = (w1 * w1 - w0 * w0 + rho4 * d2) / (2 * w0 * rho2 * d1), + b1 = (w1 * w1 - w0 * w0 - rho4 * d2) / (2 * w1 * rho2 * d1), + r0 = Math.log(Math.sqrt(b0 * b0 + 1) - b0), + r1 = Math.log(Math.sqrt(b1 * b1 + 1) - b1); + S = (r1 - r0) / rho; + i = function(t) { + var s = t * S, + coshr0 = cosh(r0), + u = w0 / (rho2 * d1) * (coshr0 * tanh(rho * s + r0) - sinh(r0)); + return [ + ux0 + u * dx, + uy0 + u * dy, + w0 * coshr0 / cosh(rho * s + r0) + ]; + }; + } + + i.duration = S * 1000; + + return i; +} + +function hsl$1(hue$$1) { + return function(start, end) { + var h = hue$$1((start = hsl(start)).h, (end = hsl(end)).h), + s = nogamma(start.s, end.s), + l = nogamma(start.l, end.l), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.h = h(t); + start.s = s(t); + start.l = l(t); + start.opacity = opacity(t); + return start + ""; + }; + } +} + +var hsl$2 = hsl$1(hue); +var hslLong = hsl$1(nogamma); + +function lab$1(start, end) { + var l = nogamma((start = lab(start)).l, (end = lab(end)).l), + a = nogamma(start.a, end.a), + b = nogamma(start.b, end.b), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.l = l(t); + start.a = a(t); + start.b = b(t); + start.opacity = opacity(t); + return start + ""; + }; +} + +function hcl$1(hue$$1) { + return function(start, end) { + var h = hue$$1((start = hcl(start)).h, (end = hcl(end)).h), + c = nogamma(start.c, end.c), + l = nogamma(start.l, end.l), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.h = h(t); + start.c = c(t); + start.l = l(t); + start.opacity = opacity(t); + return start + ""; + }; + } +} + +var hcl$2 = hcl$1(hue); +var hclLong = hcl$1(nogamma); + +function cubehelix$1(hue$$1) { + return (function cubehelixGamma(y) { + y = +y; + + function cubehelix$$1(start, end) { + var h = hue$$1((start = cubehelix(start)).h, (end = cubehelix(end)).h), + s = nogamma(start.s, end.s), + l = nogamma(start.l, end.l), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.h = h(t); + start.s = s(t); + start.l = l(Math.pow(t, y)); + start.opacity = opacity(t); + return start + ""; + }; + } + + cubehelix$$1.gamma = cubehelixGamma; + + return cubehelix$$1; + })(1); +} + +var cubehelix$2 = cubehelix$1(hue); +var cubehelixLong = cubehelix$1(nogamma); + +function quantize(interpolator, n) { + var samples = new Array(n); + for (var i = 0; i < n; ++i) samples[i] = interpolator(i / (n - 1)); + return samples; +} + +var frame = 0; +var timeout = 0; +var interval = 0; +var pokeDelay = 1000; +var taskHead; +var taskTail; +var clockLast = 0; +var clockNow = 0; +var clockSkew = 0; +var clock = typeof performance === "object" && performance.now ? performance : Date; +var setFrame = typeof window === "object" && window.requestAnimationFrame ? window.requestAnimationFrame.bind(window) : function(f) { setTimeout(f, 17); }; + +function now() { + return clockNow || (setFrame(clearNow), clockNow = clock.now() + clockSkew); +} + +function clearNow() { + clockNow = 0; +} + +function Timer() { + this._call = + this._time = + this._next = null; +} + +Timer.prototype = timer.prototype = { + constructor: Timer, + restart: function(callback, delay, time) { + if (typeof callback !== "function") throw new TypeError("callback is not a function"); + time = (time == null ? now() : +time) + (delay == null ? 0 : +delay); + if (!this._next && taskTail !== this) { + if (taskTail) taskTail._next = this; + else taskHead = this; + taskTail = this; + } + this._call = callback; + this._time = time; + sleep(); + }, + stop: function() { + if (this._call) { + this._call = null; + this._time = Infinity; + sleep(); + } + } +}; + +function timer(callback, delay, time) { + var t = new Timer; + t.restart(callback, delay, time); + return t; +} + +function timerFlush() { + now(); // Get the current time, if not already set. + ++frame; // Pretend we’ve set an alarm, if we haven’t already. + var t = taskHead, e; + while (t) { + if ((e = clockNow - t._time) >= 0) t._call.call(null, e); + t = t._next; + } + --frame; +} + +function wake() { + clockNow = (clockLast = clock.now()) + clockSkew; + frame = timeout = 0; + try { + timerFlush(); + } finally { + frame = 0; + nap(); + clockNow = 0; + } +} + +function poke() { + var now = clock.now(), delay = now - clockLast; + if (delay > pokeDelay) clockSkew -= delay, clockLast = now; +} + +function nap() { + var t0, t1 = taskHead, t2, time = Infinity; + while (t1) { + if (t1._call) { + if (time > t1._time) time = t1._time; + t0 = t1, t1 = t1._next; + } else { + t2 = t1._next, t1._next = null; + t1 = t0 ? t0._next = t2 : taskHead = t2; + } + } + taskTail = t0; + sleep(time); +} + +function sleep(time) { + if (frame) return; // Soonest alarm already set, or will be. + if (timeout) timeout = clearTimeout(timeout); + var delay = time - clockNow; // Strictly less than if we recomputed clockNow. + if (delay > 24) { + if (time < Infinity) timeout = setTimeout(wake, time - clock.now() - clockSkew); + if (interval) interval = clearInterval(interval); + } else { + if (!interval) clockLast = clock.now(), interval = setInterval(poke, pokeDelay); + frame = 1, setFrame(wake); + } +} + +function timeout$1(callback, delay, time) { + var t = new Timer; + delay = delay == null ? 0 : +delay; + t.restart(function(elapsed) { + t.stop(); + callback(elapsed + delay); + }, delay, time); + return t; +} + +function interval$1(callback, delay, time) { + var t = new Timer, total = delay; + if (delay == null) return t.restart(callback, delay, time), t; + delay = +delay, time = time == null ? now() : +time; + t.restart(function tick(elapsed) { + elapsed += total; + t.restart(tick, total += delay, time); + callback(elapsed); + }, delay, time); + return t; +} + +var emptyOn = dispatch("start", "end", "interrupt"); +var emptyTween = []; + +var CREATED = 0; +var SCHEDULED = 1; +var STARTING = 2; +var STARTED = 3; +var RUNNING = 4; +var ENDING = 5; +var ENDED = 6; + +function schedule(node, name, id, index, group, timing) { + var schedules = node.__transition; + if (!schedules) node.__transition = {}; + else if (id in schedules) return; + create$1(node, id, { + name: name, + index: index, // For context during callback. + group: group, // For context during callback. + on: emptyOn, + tween: emptyTween, + time: timing.time, + delay: timing.delay, + duration: timing.duration, + ease: timing.ease, + timer: null, + state: CREATED + }); +} + +function init(node, id) { + var schedule = get$1(node, id); + if (schedule.state > CREATED) throw new Error("too late; already scheduled"); + return schedule; +} + +function set$1(node, id) { + var schedule = get$1(node, id); + if (schedule.state > STARTING) throw new Error("too late; already started"); + return schedule; +} + +function get$1(node, id) { + var schedule = node.__transition; + if (!schedule || !(schedule = schedule[id])) throw new Error("transition not found"); + return schedule; +} + +function create$1(node, id, self) { + var schedules = node.__transition, + tween; + + // Initialize the self timer when the transition is created. + // Note the actual delay is not known until the first callback! + schedules[id] = self; + self.timer = timer(schedule, 0, self.time); + + function schedule(elapsed) { + self.state = SCHEDULED; + self.timer.restart(start, self.delay, self.time); + + // If the elapsed delay is less than our first sleep, start immediately. + if (self.delay <= elapsed) start(elapsed - self.delay); + } + + function start(elapsed) { + var i, j, n, o; + + // If the state is not SCHEDULED, then we previously errored on start. + if (self.state !== SCHEDULED) return stop(); + + for (i in schedules) { + o = schedules[i]; + if (o.name !== self.name) continue; + + // While this element already has a starting transition during this frame, + // defer starting an interrupting transition until that transition has a + // chance to tick (and possibly end); see d3/d3-transition#54! + if (o.state === STARTED) return timeout$1(start); + + // Interrupt the active transition, if any. + // Dispatch the interrupt event. + if (o.state === RUNNING) { + o.state = ENDED; + o.timer.stop(); + o.on.call("interrupt", node, node.__data__, o.index, o.group); + delete schedules[i]; + } + + // Cancel any pre-empted transitions. No interrupt event is dispatched + // because the cancelled transitions never started. Note that this also + // removes this transition from the pending list! + else if (+i < id) { + o.state = ENDED; + o.timer.stop(); + delete schedules[i]; + } + } + + // Defer the first tick to end of the current frame; see d3/d3#1576. + // Note the transition may be canceled after start and before the first tick! + // Note this must be scheduled before the start event; see d3/d3-transition#16! + // Assuming this is successful, subsequent callbacks go straight to tick. + timeout$1(function() { + if (self.state === STARTED) { + self.state = RUNNING; + self.timer.restart(tick, self.delay, self.time); + tick(elapsed); + } + }); + + // Dispatch the start event. + // Note this must be done before the tween are initialized. + self.state = STARTING; + self.on.call("start", node, node.__data__, self.index, self.group); + if (self.state !== STARTING) return; // interrupted + self.state = STARTED; + + // Initialize the tween, deleting null tween. + tween = new Array(n = self.tween.length); + for (i = 0, j = -1; i < n; ++i) { + if (o = self.tween[i].value.call(node, node.__data__, self.index, self.group)) { + tween[++j] = o; + } + } + tween.length = j + 1; + } + + function tick(elapsed) { + var t = elapsed < self.duration ? self.ease.call(null, elapsed / self.duration) : (self.timer.restart(stop), self.state = ENDING, 1), + i = -1, + n = tween.length; + + while (++i < n) { + tween[i].call(null, t); + } + + // Dispatch the end event. + if (self.state === ENDING) { + self.on.call("end", node, node.__data__, self.index, self.group); + stop(); + } + } + + function stop() { + self.state = ENDED; + self.timer.stop(); + delete schedules[id]; + for (var i in schedules) return; // eslint-disable-line no-unused-vars + delete node.__transition; + } +} + +function interrupt(node, name) { + var schedules = node.__transition, + schedule$$1, + active, + empty = true, + i; + + if (!schedules) return; + + name = name == null ? null : name + ""; + + for (i in schedules) { + if ((schedule$$1 = schedules[i]).name !== name) { empty = false; continue; } + active = schedule$$1.state > STARTING && schedule$$1.state < ENDING; + schedule$$1.state = ENDED; + schedule$$1.timer.stop(); + if (active) schedule$$1.on.call("interrupt", node, node.__data__, schedule$$1.index, schedule$$1.group); + delete schedules[i]; + } + + if (empty) delete node.__transition; +} + +function selection_interrupt(name) { + return this.each(function() { + interrupt(this, name); + }); +} + +function tweenRemove(id, name) { + var tween0, tween1; + return function() { + var schedule$$1 = set$1(this, id), + tween = schedule$$1.tween; + + // If this node shared tween with the previous node, + // just assign the updated shared tween and we’re done! + // Otherwise, copy-on-write. + if (tween !== tween0) { + tween1 = tween0 = tween; + for (var i = 0, n = tween1.length; i < n; ++i) { + if (tween1[i].name === name) { + tween1 = tween1.slice(); + tween1.splice(i, 1); + break; + } + } + } + + schedule$$1.tween = tween1; + }; +} + +function tweenFunction(id, name, value) { + var tween0, tween1; + if (typeof value !== "function") throw new Error; + return function() { + var schedule$$1 = set$1(this, id), + tween = schedule$$1.tween; + + // If this node shared tween with the previous node, + // just assign the updated shared tween and we’re done! + // Otherwise, copy-on-write. + if (tween !== tween0) { + tween1 = (tween0 = tween).slice(); + for (var t = {name: name, value: value}, i = 0, n = tween1.length; i < n; ++i) { + if (tween1[i].name === name) { + tween1[i] = t; + break; + } + } + if (i === n) tween1.push(t); + } + + schedule$$1.tween = tween1; + }; +} + +function transition_tween(name, value) { + var id = this._id; + + name += ""; + + if (arguments.length < 2) { + var tween = get$1(this.node(), id).tween; + for (var i = 0, n = tween.length, t; i < n; ++i) { + if ((t = tween[i]).name === name) { + return t.value; + } + } + return null; + } + + return this.each((value == null ? tweenRemove : tweenFunction)(id, name, value)); +} + +function tweenValue(transition, name, value) { + var id = transition._id; + + transition.each(function() { + var schedule$$1 = set$1(this, id); + (schedule$$1.value || (schedule$$1.value = {}))[name] = value.apply(this, arguments); + }); + + return function(node) { + return get$1(node, id).value[name]; + }; +} + +function interpolate(a, b) { + var c; + return (typeof b === "number" ? reinterpolate + : b instanceof color ? interpolateRgb + : (c = color(b)) ? (b = c, interpolateRgb) + : interpolateString)(a, b); +} + +function attrRemove$1(name) { + return function() { + this.removeAttribute(name); + }; +} + +function attrRemoveNS$1(fullname) { + return function() { + this.removeAttributeNS(fullname.space, fullname.local); + }; +} + +function attrConstant$1(name, interpolate$$1, value1) { + var value00, + interpolate0; + return function() { + var value0 = this.getAttribute(name); + return value0 === value1 ? null + : value0 === value00 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value1); + }; +} + +function attrConstantNS$1(fullname, interpolate$$1, value1) { + var value00, + interpolate0; + return function() { + var value0 = this.getAttributeNS(fullname.space, fullname.local); + return value0 === value1 ? null + : value0 === value00 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value1); + }; +} + +function attrFunction$1(name, interpolate$$1, value) { + var value00, + value10, + interpolate0; + return function() { + var value0, value1 = value(this); + if (value1 == null) return void this.removeAttribute(name); + value0 = this.getAttribute(name); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function attrFunctionNS$1(fullname, interpolate$$1, value) { + var value00, + value10, + interpolate0; + return function() { + var value0, value1 = value(this); + if (value1 == null) return void this.removeAttributeNS(fullname.space, fullname.local); + value0 = this.getAttributeNS(fullname.space, fullname.local); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function transition_attr(name, value) { + var fullname = namespace(name), i = fullname === "transform" ? interpolateTransformSvg : interpolate; + return this.attrTween(name, typeof value === "function" + ? (fullname.local ? attrFunctionNS$1 : attrFunction$1)(fullname, i, tweenValue(this, "attr." + name, value)) + : value == null ? (fullname.local ? attrRemoveNS$1 : attrRemove$1)(fullname) + : (fullname.local ? attrConstantNS$1 : attrConstant$1)(fullname, i, value + "")); +} + +function attrTweenNS(fullname, value) { + function tween() { + var node = this, i = value.apply(node, arguments); + return i && function(t) { + node.setAttributeNS(fullname.space, fullname.local, i(t)); + }; + } + tween._value = value; + return tween; +} + +function attrTween(name, value) { + function tween() { + var node = this, i = value.apply(node, arguments); + return i && function(t) { + node.setAttribute(name, i(t)); + }; + } + tween._value = value; + return tween; +} + +function transition_attrTween(name, value) { + var key = "attr." + name; + if (arguments.length < 2) return (key = this.tween(key)) && key._value; + if (value == null) return this.tween(key, null); + if (typeof value !== "function") throw new Error; + var fullname = namespace(name); + return this.tween(key, (fullname.local ? attrTweenNS : attrTween)(fullname, value)); +} + +function delayFunction(id, value) { + return function() { + init(this, id).delay = +value.apply(this, arguments); + }; +} + +function delayConstant(id, value) { + return value = +value, function() { + init(this, id).delay = value; + }; +} + +function transition_delay(value) { + var id = this._id; + + return arguments.length + ? this.each((typeof value === "function" + ? delayFunction + : delayConstant)(id, value)) + : get$1(this.node(), id).delay; +} + +function durationFunction(id, value) { + return function() { + set$1(this, id).duration = +value.apply(this, arguments); + }; +} + +function durationConstant(id, value) { + return value = +value, function() { + set$1(this, id).duration = value; + }; +} + +function transition_duration(value) { + var id = this._id; + + return arguments.length + ? this.each((typeof value === "function" + ? durationFunction + : durationConstant)(id, value)) + : get$1(this.node(), id).duration; +} + +function easeConstant(id, value) { + if (typeof value !== "function") throw new Error; + return function() { + set$1(this, id).ease = value; + }; +} + +function transition_ease(value) { + var id = this._id; + + return arguments.length + ? this.each(easeConstant(id, value)) + : get$1(this.node(), id).ease; +} + +function transition_filter(match) { + if (typeof match !== "function") match = matcher$1(match); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = [], node, i = 0; i < n; ++i) { + if ((node = group[i]) && match.call(node, node.__data__, i, group)) { + subgroup.push(node); + } + } + } + + return new Transition(subgroups, this._parents, this._name, this._id); +} + +function transition_merge(transition$$1) { + if (transition$$1._id !== this._id) throw new Error; + + for (var groups0 = this._groups, groups1 = transition$$1._groups, m0 = groups0.length, m1 = groups1.length, m = Math.min(m0, m1), merges = new Array(m0), j = 0; j < m; ++j) { + for (var group0 = groups0[j], group1 = groups1[j], n = group0.length, merge = merges[j] = new Array(n), node, i = 0; i < n; ++i) { + if (node = group0[i] || group1[i]) { + merge[i] = node; + } + } + } + + for (; j < m0; ++j) { + merges[j] = groups0[j]; + } + + return new Transition(merges, this._parents, this._name, this._id); +} + +function start(name) { + return (name + "").trim().split(/^|\s+/).every(function(t) { + var i = t.indexOf("."); + if (i >= 0) t = t.slice(0, i); + return !t || t === "start"; + }); +} + +function onFunction(id, name, listener) { + var on0, on1, sit = start(name) ? init : set$1; + return function() { + var schedule$$1 = sit(this, id), + on = schedule$$1.on; + + // If this node shared a dispatch with the previous node, + // just assign the updated shared dispatch and we’re done! + // Otherwise, copy-on-write. + if (on !== on0) (on1 = (on0 = on).copy()).on(name, listener); + + schedule$$1.on = on1; + }; +} + +function transition_on(name, listener) { + var id = this._id; + + return arguments.length < 2 + ? get$1(this.node(), id).on.on(name) + : this.each(onFunction(id, name, listener)); +} + +function removeFunction(id) { + return function() { + var parent = this.parentNode; + for (var i in this.__transition) if (+i !== id) return; + if (parent) parent.removeChild(this); + }; +} + +function transition_remove() { + return this.on("end.remove", removeFunction(this._id)); +} + +function transition_select(select) { + var name = this._name, + id = this._id; + + if (typeof select !== "function") select = selector(select); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = new Array(n), node, subnode, i = 0; i < n; ++i) { + if ((node = group[i]) && (subnode = select.call(node, node.__data__, i, group))) { + if ("__data__" in node) subnode.__data__ = node.__data__; + subgroup[i] = subnode; + schedule(subgroup[i], name, id, i, subgroup, get$1(node, id)); + } + } + } + + return new Transition(subgroups, this._parents, name, id); +} + +function transition_selectAll(select) { + var name = this._name, + id = this._id; + + if (typeof select !== "function") select = selectorAll(select); + + for (var groups = this._groups, m = groups.length, subgroups = [], parents = [], j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + for (var children = select.call(node, node.__data__, i, group), child, inherit = get$1(node, id), k = 0, l = children.length; k < l; ++k) { + if (child = children[k]) { + schedule(child, name, id, k, children, inherit); + } + } + subgroups.push(children); + parents.push(node); + } + } + } + + return new Transition(subgroups, parents, name, id); +} + +var Selection$1 = selection.prototype.constructor; + +function transition_selection() { + return new Selection$1(this._groups, this._parents); +} + +function styleRemove$1(name, interpolate$$1) { + var value00, + value10, + interpolate0; + return function() { + var value0 = styleValue(this, name), + value1 = (this.style.removeProperty(name), styleValue(this, name)); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function styleRemoveEnd(name) { + return function() { + this.style.removeProperty(name); + }; +} + +function styleConstant$1(name, interpolate$$1, value1) { + var value00, + interpolate0; + return function() { + var value0 = styleValue(this, name); + return value0 === value1 ? null + : value0 === value00 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value1); + }; +} + +function styleFunction$1(name, interpolate$$1, value) { + var value00, + value10, + interpolate0; + return function() { + var value0 = styleValue(this, name), + value1 = value(this); + if (value1 == null) value1 = (this.style.removeProperty(name), styleValue(this, name)); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function transition_style(name, value, priority) { + var i = (name += "") === "transform" ? interpolateTransformCss : interpolate; + return value == null ? this + .styleTween(name, styleRemove$1(name, i)) + .on("end.style." + name, styleRemoveEnd(name)) + : this.styleTween(name, typeof value === "function" + ? styleFunction$1(name, i, tweenValue(this, "style." + name, value)) + : styleConstant$1(name, i, value + ""), priority); +} + +function styleTween(name, value, priority) { + function tween() { + var node = this, i = value.apply(node, arguments); + return i && function(t) { + node.style.setProperty(name, i(t), priority); + }; + } + tween._value = value; + return tween; +} + +function transition_styleTween(name, value, priority) { + var key = "style." + (name += ""); + if (arguments.length < 2) return (key = this.tween(key)) && key._value; + if (value == null) return this.tween(key, null); + if (typeof value !== "function") throw new Error; + return this.tween(key, styleTween(name, value, priority == null ? "" : priority)); +} + +function textConstant$1(value) { + return function() { + this.textContent = value; + }; +} + +function textFunction$1(value) { + return function() { + var value1 = value(this); + this.textContent = value1 == null ? "" : value1; + }; +} + +function transition_text(value) { + return this.tween("text", typeof value === "function" + ? textFunction$1(tweenValue(this, "text", value)) + : textConstant$1(value == null ? "" : value + "")); +} + +function transition_transition() { + var name = this._name, + id0 = this._id, + id1 = newId(); + + for (var groups = this._groups, m = groups.length, j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + var inherit = get$1(node, id0); + schedule(node, name, id1, i, group, { + time: inherit.time + inherit.delay + inherit.duration, + delay: 0, + duration: inherit.duration, + ease: inherit.ease + }); + } + } + } + + return new Transition(groups, this._parents, name, id1); +} + +var id = 0; + +function Transition(groups, parents, name, id) { + this._groups = groups; + this._parents = parents; + this._name = name; + this._id = id; +} + +function transition(name) { + return selection().transition(name); +} + +function newId() { + return ++id; +} + +var selection_prototype = selection.prototype; + +Transition.prototype = transition.prototype = { + constructor: Transition, + select: transition_select, + selectAll: transition_selectAll, + filter: transition_filter, + merge: transition_merge, + selection: transition_selection, + transition: transition_transition, + call: selection_prototype.call, + nodes: selection_prototype.nodes, + node: selection_prototype.node, + size: selection_prototype.size, + empty: selection_prototype.empty, + each: selection_prototype.each, + on: transition_on, + attr: transition_attr, + attrTween: transition_attrTween, + style: transition_style, + styleTween: transition_styleTween, + text: transition_text, + remove: transition_remove, + tween: transition_tween, + delay: transition_delay, + duration: transition_duration, + ease: transition_ease +}; + +function linear$1(t) { + return +t; +} + +function quadIn(t) { + return t * t; +} + +function quadOut(t) { + return t * (2 - t); +} + +function quadInOut(t) { + return ((t *= 2) <= 1 ? t * t : --t * (2 - t) + 1) / 2; +} + +function cubicIn(t) { + return t * t * t; +} + +function cubicOut(t) { + return --t * t * t + 1; +} + +function cubicInOut(t) { + return ((t *= 2) <= 1 ? t * t * t : (t -= 2) * t * t + 2) / 2; +} + +var exponent = 3; + +var polyIn = (function custom(e) { + e = +e; + + function polyIn(t) { + return Math.pow(t, e); + } + + polyIn.exponent = custom; + + return polyIn; +})(exponent); + +var polyOut = (function custom(e) { + e = +e; + + function polyOut(t) { + return 1 - Math.pow(1 - t, e); + } + + polyOut.exponent = custom; + + return polyOut; +})(exponent); + +var polyInOut = (function custom(e) { + e = +e; + + function polyInOut(t) { + return ((t *= 2) <= 1 ? Math.pow(t, e) : 2 - Math.pow(2 - t, e)) / 2; + } + + polyInOut.exponent = custom; + + return polyInOut; +})(exponent); + +var pi = Math.PI; +var halfPi = pi / 2; + +function sinIn(t) { + return 1 - Math.cos(t * halfPi); +} + +function sinOut(t) { + return Math.sin(t * halfPi); +} + +function sinInOut(t) { + return (1 - Math.cos(pi * t)) / 2; +} + +function expIn(t) { + return Math.pow(2, 10 * t - 10); +} + +function expOut(t) { + return 1 - Math.pow(2, -10 * t); +} + +function expInOut(t) { + return ((t *= 2) <= 1 ? Math.pow(2, 10 * t - 10) : 2 - Math.pow(2, 10 - 10 * t)) / 2; +} + +function circleIn(t) { + return 1 - Math.sqrt(1 - t * t); +} + +function circleOut(t) { + return Math.sqrt(1 - --t * t); +} + +function circleInOut(t) { + return ((t *= 2) <= 1 ? 1 - Math.sqrt(1 - t * t) : Math.sqrt(1 - (t -= 2) * t) + 1) / 2; +} + +var b1 = 4 / 11; +var b2 = 6 / 11; +var b3 = 8 / 11; +var b4 = 3 / 4; +var b5 = 9 / 11; +var b6 = 10 / 11; +var b7 = 15 / 16; +var b8 = 21 / 22; +var b9 = 63 / 64; +var b0 = 1 / b1 / b1; + +function bounceIn(t) { + return 1 - bounceOut(1 - t); +} + +function bounceOut(t) { + return (t = +t) < b1 ? b0 * t * t : t < b3 ? b0 * (t -= b2) * t + b4 : t < b6 ? b0 * (t -= b5) * t + b7 : b0 * (t -= b8) * t + b9; +} + +function bounceInOut(t) { + return ((t *= 2) <= 1 ? 1 - bounceOut(1 - t) : bounceOut(t - 1) + 1) / 2; +} + +var overshoot = 1.70158; + +var backIn = (function custom(s) { + s = +s; + + function backIn(t) { + return t * t * ((s + 1) * t - s); + } + + backIn.overshoot = custom; + + return backIn; +})(overshoot); + +var backOut = (function custom(s) { + s = +s; + + function backOut(t) { + return --t * t * ((s + 1) * t + s) + 1; + } + + backOut.overshoot = custom; + + return backOut; +})(overshoot); + +var backInOut = (function custom(s) { + s = +s; + + function backInOut(t) { + return ((t *= 2) < 1 ? t * t * ((s + 1) * t - s) : (t -= 2) * t * ((s + 1) * t + s) + 2) / 2; + } + + backInOut.overshoot = custom; + + return backInOut; +})(overshoot); + +var tau = 2 * Math.PI; +var amplitude = 1; +var period = 0.3; + +var elasticIn = (function custom(a, p) { + var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau); + + function elasticIn(t) { + return a * Math.pow(2, 10 * --t) * Math.sin((s - t) / p); + } + + elasticIn.amplitude = function(a) { return custom(a, p * tau); }; + elasticIn.period = function(p) { return custom(a, p); }; + + return elasticIn; +})(amplitude, period); + +var elasticOut = (function custom(a, p) { + var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau); + + function elasticOut(t) { + return 1 - a * Math.pow(2, -10 * (t = +t)) * Math.sin((t + s) / p); + } + + elasticOut.amplitude = function(a) { return custom(a, p * tau); }; + elasticOut.period = function(p) { return custom(a, p); }; + + return elasticOut; +})(amplitude, period); + +var elasticInOut = (function custom(a, p) { + var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau); + + function elasticInOut(t) { + return ((t = t * 2 - 1) < 0 + ? a * Math.pow(2, 10 * t) * Math.sin((s - t) / p) + : 2 - a * Math.pow(2, -10 * t) * Math.sin((s + t) / p)) / 2; + } + + elasticInOut.amplitude = function(a) { return custom(a, p * tau); }; + elasticInOut.period = function(p) { return custom(a, p); }; + + return elasticInOut; +})(amplitude, period); + +var defaultTiming = { + time: null, // Set on use. + delay: 0, + duration: 250, + ease: cubicInOut +}; + +function inherit(node, id) { + var timing; + while (!(timing = node.__transition) || !(timing = timing[id])) { + if (!(node = node.parentNode)) { + return defaultTiming.time = now(), defaultTiming; + } + } + return timing; +} + +function selection_transition(name) { + var id, + timing; + + if (name instanceof Transition) { + id = name._id, name = name._name; + } else { + id = newId(), (timing = defaultTiming).time = now(), name = name == null ? null : name + ""; + } + + for (var groups = this._groups, m = groups.length, j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + schedule(node, name, id, i, group, timing || inherit(node, id)); + } + } + } + + return new Transition(groups, this._parents, name, id); +} + +selection.prototype.interrupt = selection_interrupt; +selection.prototype.transition = selection_transition; + +var root$1 = [null]; + +function active(node, name) { + var schedules = node.__transition, + schedule$$1, + i; + + if (schedules) { + name = name == null ? null : name + ""; + for (i in schedules) { + if ((schedule$$1 = schedules[i]).state > SCHEDULED && schedule$$1.name === name) { + return new Transition([[node]], root$1, name, +i); + } + } + } + + return null; +} + +function constant$4(x) { + return function() { + return x; + }; +} + +function BrushEvent(target, type, selection) { + this.target = target; + this.type = type; + this.selection = selection; +} + +function nopropagation$1() { + exports.event.stopImmediatePropagation(); +} + +function noevent$1() { + exports.event.preventDefault(); + exports.event.stopImmediatePropagation(); +} + +var MODE_DRAG = {name: "drag"}; +var MODE_SPACE = {name: "space"}; +var MODE_HANDLE = {name: "handle"}; +var MODE_CENTER = {name: "center"}; + +var X = { + name: "x", + handles: ["e", "w"].map(type), + input: function(x, e) { return x && [[x[0], e[0][1]], [x[1], e[1][1]]]; }, + output: function(xy) { return xy && [xy[0][0], xy[1][0]]; } +}; + +var Y = { + name: "y", + handles: ["n", "s"].map(type), + input: function(y, e) { return y && [[e[0][0], y[0]], [e[1][0], y[1]]]; }, + output: function(xy) { return xy && [xy[0][1], xy[1][1]]; } +}; + +var XY = { + name: "xy", + handles: ["n", "e", "s", "w", "nw", "ne", "se", "sw"].map(type), + input: function(xy) { return xy; }, + output: function(xy) { return xy; } +}; + +var cursors = { + overlay: "crosshair", + selection: "move", + n: "ns-resize", + e: "ew-resize", + s: "ns-resize", + w: "ew-resize", + nw: "nwse-resize", + ne: "nesw-resize", + se: "nwse-resize", + sw: "nesw-resize" +}; + +var flipX = { + e: "w", + w: "e", + nw: "ne", + ne: "nw", + se: "sw", + sw: "se" +}; + +var flipY = { + n: "s", + s: "n", + nw: "sw", + ne: "se", + se: "ne", + sw: "nw" +}; + +var signsX = { + overlay: +1, + selection: +1, + n: null, + e: +1, + s: null, + w: -1, + nw: -1, + ne: +1, + se: +1, + sw: -1 +}; + +var signsY = { + overlay: +1, + selection: +1, + n: -1, + e: null, + s: +1, + w: null, + nw: -1, + ne: -1, + se: +1, + sw: +1 +}; + +function type(t) { + return {type: t}; +} + +// Ignore right-click, since that should open the context menu. +function defaultFilter() { + return !exports.event.button; +} + +function defaultExtent() { + var svg = this.ownerSVGElement || this; + return [[0, 0], [svg.width.baseVal.value, svg.height.baseVal.value]]; +} + +// Like d3.local, but with the name “__brush” rather than auto-generated. +function local(node) { + while (!node.__brush) if (!(node = node.parentNode)) return; + return node.__brush; +} + +function empty(extent) { + return extent[0][0] === extent[1][0] + || extent[0][1] === extent[1][1]; +} + +function brushSelection(node) { + var state = node.__brush; + return state ? state.dim.output(state.selection) : null; +} + +function brushX() { + return brush$1(X); +} + +function brushY() { + return brush$1(Y); +} + +function brush() { + return brush$1(XY); +} + +function brush$1(dim) { + var extent = defaultExtent, + filter = defaultFilter, + listeners = dispatch(brush, "start", "brush", "end"), + handleSize = 6, + touchending; + + function brush(group) { + var overlay = group + .property("__brush", initialize) + .selectAll(".overlay") + .data([type("overlay")]); + + overlay.enter().append("rect") + .attr("class", "overlay") + .attr("pointer-events", "all") + .attr("cursor", cursors.overlay) + .merge(overlay) + .each(function() { + var extent = local(this).extent; + select(this) + .attr("x", extent[0][0]) + .attr("y", extent[0][1]) + .attr("width", extent[1][0] - extent[0][0]) + .attr("height", extent[1][1] - extent[0][1]); + }); + + group.selectAll(".selection") + .data([type("selection")]) + .enter().append("rect") + .attr("class", "selection") + .attr("cursor", cursors.selection) + .attr("fill", "#777") + .attr("fill-opacity", 0.3) + .attr("stroke", "#fff") + .attr("shape-rendering", "crispEdges"); + + var handle = group.selectAll(".handle") + .data(dim.handles, function(d) { return d.type; }); + + handle.exit().remove(); + + handle.enter().append("rect") + .attr("class", function(d) { return "handle handle--" + d.type; }) + .attr("cursor", function(d) { return cursors[d.type]; }); + + group + .each(redraw) + .attr("fill", "none") + .attr("pointer-events", "all") + .style("-webkit-tap-highlight-color", "rgba(0,0,0,0)") + .on("mousedown.brush touchstart.brush", started); + } + + brush.move = function(group, selection) { + if (group.selection) { + group + .on("start.brush", function() { emitter(this, arguments).beforestart().start(); }) + .on("interrupt.brush end.brush", function() { emitter(this, arguments).end(); }) + .tween("brush", function() { + var that = this, + state = that.__brush, + emit = emitter(that, arguments), + selection0 = state.selection, + selection1 = dim.input(typeof selection === "function" ? selection.apply(this, arguments) : selection, state.extent), + i = interpolateValue(selection0, selection1); + + function tween(t) { + state.selection = t === 1 && empty(selection1) ? null : i(t); + redraw.call(that); + emit.brush(); + } + + return selection0 && selection1 ? tween : tween(1); + }); + } else { + group + .each(function() { + var that = this, + args = arguments, + state = that.__brush, + selection1 = dim.input(typeof selection === "function" ? selection.apply(that, args) : selection, state.extent), + emit = emitter(that, args).beforestart(); + + interrupt(that); + state.selection = selection1 == null || empty(selection1) ? null : selection1; + redraw.call(that); + emit.start().brush().end(); + }); + } + }; + + function redraw() { + var group = select(this), + selection = local(this).selection; + + if (selection) { + group.selectAll(".selection") + .style("display", null) + .attr("x", selection[0][0]) + .attr("y", selection[0][1]) + .attr("width", selection[1][0] - selection[0][0]) + .attr("height", selection[1][1] - selection[0][1]); + + group.selectAll(".handle") + .style("display", null) + .attr("x", function(d) { return d.type[d.type.length - 1] === "e" ? selection[1][0] - handleSize / 2 : selection[0][0] - handleSize / 2; }) + .attr("y", function(d) { return d.type[0] === "s" ? selection[1][1] - handleSize / 2 : selection[0][1] - handleSize / 2; }) + .attr("width", function(d) { return d.type === "n" || d.type === "s" ? selection[1][0] - selection[0][0] + handleSize : handleSize; }) + .attr("height", function(d) { return d.type === "e" || d.type === "w" ? selection[1][1] - selection[0][1] + handleSize : handleSize; }); + } + + else { + group.selectAll(".selection,.handle") + .style("display", "none") + .attr("x", null) + .attr("y", null) + .attr("width", null) + .attr("height", null); + } + } + + function emitter(that, args) { + return that.__brush.emitter || new Emitter(that, args); + } + + function Emitter(that, args) { + this.that = that; + this.args = args; + this.state = that.__brush; + this.active = 0; + } + + Emitter.prototype = { + beforestart: function() { + if (++this.active === 1) this.state.emitter = this, this.starting = true; + return this; + }, + start: function() { + if (this.starting) this.starting = false, this.emit("start"); + return this; + }, + brush: function() { + this.emit("brush"); + return this; + }, + end: function() { + if (--this.active === 0) delete this.state.emitter, this.emit("end"); + return this; + }, + emit: function(type) { + customEvent(new BrushEvent(brush, type, dim.output(this.state.selection)), listeners.apply, listeners, [type, this.that, this.args]); + } + }; + + function started() { + if (exports.event.touches) { if (exports.event.changedTouches.length < exports.event.touches.length) return noevent$1(); } + else if (touchending) return; + if (!filter.apply(this, arguments)) return; + + var that = this, + type = exports.event.target.__data__.type, + mode = (exports.event.metaKey ? type = "overlay" : type) === "selection" ? MODE_DRAG : (exports.event.altKey ? MODE_CENTER : MODE_HANDLE), + signX = dim === Y ? null : signsX[type], + signY = dim === X ? null : signsY[type], + state = local(that), + extent = state.extent, + selection = state.selection, + W = extent[0][0], w0, w1, + N = extent[0][1], n0, n1, + E = extent[1][0], e0, e1, + S = extent[1][1], s0, s1, + dx, + dy, + moving, + shifting = signX && signY && exports.event.shiftKey, + lockX, + lockY, + point0 = mouse(that), + point = point0, + emit = emitter(that, arguments).beforestart(); + + if (type === "overlay") { + state.selection = selection = [ + [w0 = dim === Y ? W : point0[0], n0 = dim === X ? N : point0[1]], + [e0 = dim === Y ? E : w0, s0 = dim === X ? S : n0] + ]; + } else { + w0 = selection[0][0]; + n0 = selection[0][1]; + e0 = selection[1][0]; + s0 = selection[1][1]; + } + + w1 = w0; + n1 = n0; + e1 = e0; + s1 = s0; + + var group = select(that) + .attr("pointer-events", "none"); + + var overlay = group.selectAll(".overlay") + .attr("cursor", cursors[type]); + + if (exports.event.touches) { + group + .on("touchmove.brush", moved, true) + .on("touchend.brush touchcancel.brush", ended, true); + } else { + var view = select(exports.event.view) + .on("keydown.brush", keydowned, true) + .on("keyup.brush", keyupped, true) + .on("mousemove.brush", moved, true) + .on("mouseup.brush", ended, true); + + dragDisable(exports.event.view); + } + + nopropagation$1(); + interrupt(that); + redraw.call(that); + emit.start(); + + function moved() { + var point1 = mouse(that); + if (shifting && !lockX && !lockY) { + if (Math.abs(point1[0] - point[0]) > Math.abs(point1[1] - point[1])) lockY = true; + else lockX = true; + } + point = point1; + moving = true; + noevent$1(); + move(); + } + + function move() { + var t; + + dx = point[0] - point0[0]; + dy = point[1] - point0[1]; + + switch (mode) { + case MODE_SPACE: + case MODE_DRAG: { + if (signX) dx = Math.max(W - w0, Math.min(E - e0, dx)), w1 = w0 + dx, e1 = e0 + dx; + if (signY) dy = Math.max(N - n0, Math.min(S - s0, dy)), n1 = n0 + dy, s1 = s0 + dy; + break; + } + case MODE_HANDLE: { + if (signX < 0) dx = Math.max(W - w0, Math.min(E - w0, dx)), w1 = w0 + dx, e1 = e0; + else if (signX > 0) dx = Math.max(W - e0, Math.min(E - e0, dx)), w1 = w0, e1 = e0 + dx; + if (signY < 0) dy = Math.max(N - n0, Math.min(S - n0, dy)), n1 = n0 + dy, s1 = s0; + else if (signY > 0) dy = Math.max(N - s0, Math.min(S - s0, dy)), n1 = n0, s1 = s0 + dy; + break; + } + case MODE_CENTER: { + if (signX) w1 = Math.max(W, Math.min(E, w0 - dx * signX)), e1 = Math.max(W, Math.min(E, e0 + dx * signX)); + if (signY) n1 = Math.max(N, Math.min(S, n0 - dy * signY)), s1 = Math.max(N, Math.min(S, s0 + dy * signY)); + break; + } + } + + if (e1 < w1) { + signX *= -1; + t = w0, w0 = e0, e0 = t; + t = w1, w1 = e1, e1 = t; + if (type in flipX) overlay.attr("cursor", cursors[type = flipX[type]]); + } + + if (s1 < n1) { + signY *= -1; + t = n0, n0 = s0, s0 = t; + t = n1, n1 = s1, s1 = t; + if (type in flipY) overlay.attr("cursor", cursors[type = flipY[type]]); + } + + if (state.selection) selection = state.selection; // May be set by brush.move! + if (lockX) w1 = selection[0][0], e1 = selection[1][0]; + if (lockY) n1 = selection[0][1], s1 = selection[1][1]; + + if (selection[0][0] !== w1 + || selection[0][1] !== n1 + || selection[1][0] !== e1 + || selection[1][1] !== s1) { + state.selection = [[w1, n1], [e1, s1]]; + redraw.call(that); + emit.brush(); + } + } + + function ended() { + nopropagation$1(); + if (exports.event.touches) { + if (exports.event.touches.length) return; + if (touchending) clearTimeout(touchending); + touchending = setTimeout(function() { touchending = null; }, 500); // Ghost clicks are delayed! + group.on("touchmove.brush touchend.brush touchcancel.brush", null); + } else { + yesdrag(exports.event.view, moving); + view.on("keydown.brush keyup.brush mousemove.brush mouseup.brush", null); + } + group.attr("pointer-events", "all"); + overlay.attr("cursor", cursors.overlay); + if (state.selection) selection = state.selection; // May be set by brush.move (on start)! + if (empty(selection)) state.selection = null, redraw.call(that); + emit.end(); + } + + function keydowned() { + switch (exports.event.keyCode) { + case 16: { // SHIFT + shifting = signX && signY; + break; + } + case 18: { // ALT + if (mode === MODE_HANDLE) { + if (signX) e0 = e1 - dx * signX, w0 = w1 + dx * signX; + if (signY) s0 = s1 - dy * signY, n0 = n1 + dy * signY; + mode = MODE_CENTER; + move(); + } + break; + } + case 32: { // SPACE; takes priority over ALT + if (mode === MODE_HANDLE || mode === MODE_CENTER) { + if (signX < 0) e0 = e1 - dx; else if (signX > 0) w0 = w1 - dx; + if (signY < 0) s0 = s1 - dy; else if (signY > 0) n0 = n1 - dy; + mode = MODE_SPACE; + overlay.attr("cursor", cursors.selection); + move(); + } + break; + } + default: return; + } + noevent$1(); + } + + function keyupped() { + switch (exports.event.keyCode) { + case 16: { // SHIFT + if (shifting) { + lockX = lockY = shifting = false; + move(); + } + break; + } + case 18: { // ALT + if (mode === MODE_CENTER) { + if (signX < 0) e0 = e1; else if (signX > 0) w0 = w1; + if (signY < 0) s0 = s1; else if (signY > 0) n0 = n1; + mode = MODE_HANDLE; + move(); + } + break; + } + case 32: { // SPACE + if (mode === MODE_SPACE) { + if (exports.event.altKey) { + if (signX) e0 = e1 - dx * signX, w0 = w1 + dx * signX; + if (signY) s0 = s1 - dy * signY, n0 = n1 + dy * signY; + mode = MODE_CENTER; + } else { + if (signX < 0) e0 = e1; else if (signX > 0) w0 = w1; + if (signY < 0) s0 = s1; else if (signY > 0) n0 = n1; + mode = MODE_HANDLE; + } + overlay.attr("cursor", cursors[type]); + move(); + } + break; + } + default: return; + } + noevent$1(); + } + } + + function initialize() { + var state = this.__brush || {selection: null}; + state.extent = extent.apply(this, arguments); + state.dim = dim; + return state; + } + + brush.extent = function(_) { + return arguments.length ? (extent = typeof _ === "function" ? _ : constant$4([[+_[0][0], +_[0][1]], [+_[1][0], +_[1][1]]]), brush) : extent; + }; + + brush.filter = function(_) { + return arguments.length ? (filter = typeof _ === "function" ? _ : constant$4(!!_), brush) : filter; + }; + + brush.handleSize = function(_) { + return arguments.length ? (handleSize = +_, brush) : handleSize; + }; + + brush.on = function() { + var value = listeners.on.apply(listeners, arguments); + return value === listeners ? brush : value; + }; + + return brush; +} + +var cos = Math.cos; +var sin = Math.sin; +var pi$1 = Math.PI; +var halfPi$1 = pi$1 / 2; +var tau$1 = pi$1 * 2; +var max$1 = Math.max; + +function compareValue(compare) { + return function(a, b) { + return compare( + a.source.value + a.target.value, + b.source.value + b.target.value + ); + }; +} + +function chord() { + var padAngle = 0, + sortGroups = null, + sortSubgroups = null, + sortChords = null; + + function chord(matrix) { + var n = matrix.length, + groupSums = [], + groupIndex = sequence(n), + subgroupIndex = [], + chords = [], + groups = chords.groups = new Array(n), + subgroups = new Array(n * n), + k, + x, + x0, + dx, + i, + j; + + // Compute the sum. + k = 0, i = -1; while (++i < n) { + x = 0, j = -1; while (++j < n) { + x += matrix[i][j]; + } + groupSums.push(x); + subgroupIndex.push(sequence(n)); + k += x; + } + + // Sort groups… + if (sortGroups) groupIndex.sort(function(a, b) { + return sortGroups(groupSums[a], groupSums[b]); + }); + + // Sort subgroups… + if (sortSubgroups) subgroupIndex.forEach(function(d, i) { + d.sort(function(a, b) { + return sortSubgroups(matrix[i][a], matrix[i][b]); + }); + }); + + // Convert the sum to scaling factor for [0, 2pi]. + // TODO Allow start and end angle to be specified? + // TODO Allow padding to be specified as percentage? + k = max$1(0, tau$1 - padAngle * n) / k; + dx = k ? padAngle : tau$1 / n; + + // Compute the start and end angle for each group and subgroup. + // Note: Opera has a bug reordering object literal properties! + x = 0, i = -1; while (++i < n) { + x0 = x, j = -1; while (++j < n) { + var di = groupIndex[i], + dj = subgroupIndex[di][j], + v = matrix[di][dj], + a0 = x, + a1 = x += v * k; + subgroups[dj * n + di] = { + index: di, + subindex: dj, + startAngle: a0, + endAngle: a1, + value: v + }; + } + groups[di] = { + index: di, + startAngle: x0, + endAngle: x, + value: groupSums[di] + }; + x += dx; + } + + // Generate chords for each (non-empty) subgroup-subgroup link. + i = -1; while (++i < n) { + j = i - 1; while (++j < n) { + var source = subgroups[j * n + i], + target = subgroups[i * n + j]; + if (source.value || target.value) { + chords.push(source.value < target.value + ? {source: target, target: source} + : {source: source, target: target}); + } + } + } + + return sortChords ? chords.sort(sortChords) : chords; + } + + chord.padAngle = function(_) { + return arguments.length ? (padAngle = max$1(0, _), chord) : padAngle; + }; + + chord.sortGroups = function(_) { + return arguments.length ? (sortGroups = _, chord) : sortGroups; + }; + + chord.sortSubgroups = function(_) { + return arguments.length ? (sortSubgroups = _, chord) : sortSubgroups; + }; + + chord.sortChords = function(_) { + return arguments.length ? (_ == null ? sortChords = null : (sortChords = compareValue(_))._ = _, chord) : sortChords && sortChords._; + }; + + return chord; +} + +var slice$2 = Array.prototype.slice; + +function constant$5(x) { + return function() { + return x; + }; +} + +var pi$2 = Math.PI; +var tau$2 = 2 * pi$2; +var epsilon$1 = 1e-6; +var tauEpsilon = tau$2 - epsilon$1; + +function Path() { + this._x0 = this._y0 = // start of current subpath + this._x1 = this._y1 = null; // end of current subpath + this._ = ""; +} + +function path() { + return new Path; +} + +Path.prototype = path.prototype = { + constructor: Path, + moveTo: function(x, y) { + this._ += "M" + (this._x0 = this._x1 = +x) + "," + (this._y0 = this._y1 = +y); + }, + closePath: function() { + if (this._x1 !== null) { + this._x1 = this._x0, this._y1 = this._y0; + this._ += "Z"; + } + }, + lineTo: function(x, y) { + this._ += "L" + (this._x1 = +x) + "," + (this._y1 = +y); + }, + quadraticCurveTo: function(x1, y1, x, y) { + this._ += "Q" + (+x1) + "," + (+y1) + "," + (this._x1 = +x) + "," + (this._y1 = +y); + }, + bezierCurveTo: function(x1, y1, x2, y2, x, y) { + this._ += "C" + (+x1) + "," + (+y1) + "," + (+x2) + "," + (+y2) + "," + (this._x1 = +x) + "," + (this._y1 = +y); + }, + arcTo: function(x1, y1, x2, y2, r) { + x1 = +x1, y1 = +y1, x2 = +x2, y2 = +y2, r = +r; + var x0 = this._x1, + y0 = this._y1, + x21 = x2 - x1, + y21 = y2 - y1, + x01 = x0 - x1, + y01 = y0 - y1, + l01_2 = x01 * x01 + y01 * y01; + + // Is the radius negative? Error. + if (r < 0) throw new Error("negative radius: " + r); + + // Is this path empty? Move to (x1,y1). + if (this._x1 === null) { + this._ += "M" + (this._x1 = x1) + "," + (this._y1 = y1); + } + + // Or, is (x1,y1) coincident with (x0,y0)? Do nothing. + else if (!(l01_2 > epsilon$1)) {} + + // Or, are (x0,y0), (x1,y1) and (x2,y2) collinear? + // Equivalently, is (x1,y1) coincident with (x2,y2)? + // Or, is the radius zero? Line to (x1,y1). + else if (!(Math.abs(y01 * x21 - y21 * x01) > epsilon$1) || !r) { + this._ += "L" + (this._x1 = x1) + "," + (this._y1 = y1); + } + + // Otherwise, draw an arc! + else { + var x20 = x2 - x0, + y20 = y2 - y0, + l21_2 = x21 * x21 + y21 * y21, + l20_2 = x20 * x20 + y20 * y20, + l21 = Math.sqrt(l21_2), + l01 = Math.sqrt(l01_2), + l = r * Math.tan((pi$2 - Math.acos((l21_2 + l01_2 - l20_2) / (2 * l21 * l01))) / 2), + t01 = l / l01, + t21 = l / l21; + + // If the start tangent is not coincident with (x0,y0), line to. + if (Math.abs(t01 - 1) > epsilon$1) { + this._ += "L" + (x1 + t01 * x01) + "," + (y1 + t01 * y01); + } + + this._ += "A" + r + "," + r + ",0,0," + (+(y01 * x20 > x01 * y20)) + "," + (this._x1 = x1 + t21 * x21) + "," + (this._y1 = y1 + t21 * y21); + } + }, + arc: function(x, y, r, a0, a1, ccw) { + x = +x, y = +y, r = +r; + var dx = r * Math.cos(a0), + dy = r * Math.sin(a0), + x0 = x + dx, + y0 = y + dy, + cw = 1 ^ ccw, + da = ccw ? a0 - a1 : a1 - a0; + + // Is the radius negative? Error. + if (r < 0) throw new Error("negative radius: " + r); + + // Is this path empty? Move to (x0,y0). + if (this._x1 === null) { + this._ += "M" + x0 + "," + y0; + } + + // Or, is (x0,y0) not coincident with the previous point? Line to (x0,y0). + else if (Math.abs(this._x1 - x0) > epsilon$1 || Math.abs(this._y1 - y0) > epsilon$1) { + this._ += "L" + x0 + "," + y0; + } + + // Is this arc empty? We’re done. + if (!r) return; + + // Does the angle go the wrong way? Flip the direction. + if (da < 0) da = da % tau$2 + tau$2; + + // Is this a complete circle? Draw two arcs to complete the circle. + if (da > tauEpsilon) { + this._ += "A" + r + "," + r + ",0,1," + cw + "," + (x - dx) + "," + (y - dy) + "A" + r + "," + r + ",0,1," + cw + "," + (this._x1 = x0) + "," + (this._y1 = y0); + } + + // Is this arc non-empty? Draw an arc! + else if (da > epsilon$1) { + this._ += "A" + r + "," + r + ",0," + (+(da >= pi$2)) + "," + cw + "," + (this._x1 = x + r * Math.cos(a1)) + "," + (this._y1 = y + r * Math.sin(a1)); + } + }, + rect: function(x, y, w, h) { + this._ += "M" + (this._x0 = this._x1 = +x) + "," + (this._y0 = this._y1 = +y) + "h" + (+w) + "v" + (+h) + "h" + (-w) + "Z"; + }, + toString: function() { + return this._; + } +}; + +function defaultSource(d) { + return d.source; +} + +function defaultTarget(d) { + return d.target; +} + +function defaultRadius(d) { + return d.radius; +} + +function defaultStartAngle(d) { + return d.startAngle; +} + +function defaultEndAngle(d) { + return d.endAngle; +} + +function ribbon() { + var source = defaultSource, + target = defaultTarget, + radius = defaultRadius, + startAngle = defaultStartAngle, + endAngle = defaultEndAngle, + context = null; + + function ribbon() { + var buffer, + argv = slice$2.call(arguments), + s = source.apply(this, argv), + t = target.apply(this, argv), + sr = +radius.apply(this, (argv[0] = s, argv)), + sa0 = startAngle.apply(this, argv) - halfPi$1, + sa1 = endAngle.apply(this, argv) - halfPi$1, + sx0 = sr * cos(sa0), + sy0 = sr * sin(sa0), + tr = +radius.apply(this, (argv[0] = t, argv)), + ta0 = startAngle.apply(this, argv) - halfPi$1, + ta1 = endAngle.apply(this, argv) - halfPi$1; + + if (!context) context = buffer = path(); + + context.moveTo(sx0, sy0); + context.arc(0, 0, sr, sa0, sa1); + if (sa0 !== ta0 || sa1 !== ta1) { // TODO sr !== tr? + context.quadraticCurveTo(0, 0, tr * cos(ta0), tr * sin(ta0)); + context.arc(0, 0, tr, ta0, ta1); + } + context.quadraticCurveTo(0, 0, sx0, sy0); + context.closePath(); + + if (buffer) return context = null, buffer + "" || null; + } + + ribbon.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$5(+_), ribbon) : radius; + }; + + ribbon.startAngle = function(_) { + return arguments.length ? (startAngle = typeof _ === "function" ? _ : constant$5(+_), ribbon) : startAngle; + }; + + ribbon.endAngle = function(_) { + return arguments.length ? (endAngle = typeof _ === "function" ? _ : constant$5(+_), ribbon) : endAngle; + }; + + ribbon.source = function(_) { + return arguments.length ? (source = _, ribbon) : source; + }; + + ribbon.target = function(_) { + return arguments.length ? (target = _, ribbon) : target; + }; + + ribbon.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, ribbon) : context; + }; + + return ribbon; +} + +var prefix = "$"; + +function Map() {} + +Map.prototype = map$1.prototype = { + constructor: Map, + has: function(key) { + return (prefix + key) in this; + }, + get: function(key) { + return this[prefix + key]; + }, + set: function(key, value) { + this[prefix + key] = value; + return this; + }, + remove: function(key) { + var property = prefix + key; + return property in this && delete this[property]; + }, + clear: function() { + for (var property in this) if (property[0] === prefix) delete this[property]; + }, + keys: function() { + var keys = []; + for (var property in this) if (property[0] === prefix) keys.push(property.slice(1)); + return keys; + }, + values: function() { + var values = []; + for (var property in this) if (property[0] === prefix) values.push(this[property]); + return values; + }, + entries: function() { + var entries = []; + for (var property in this) if (property[0] === prefix) entries.push({key: property.slice(1), value: this[property]}); + return entries; + }, + size: function() { + var size = 0; + for (var property in this) if (property[0] === prefix) ++size; + return size; + }, + empty: function() { + for (var property in this) if (property[0] === prefix) return false; + return true; + }, + each: function(f) { + for (var property in this) if (property[0] === prefix) f(this[property], property.slice(1), this); + } +}; + +function map$1(object, f) { + var map = new Map; + + // Copy constructor. + if (object instanceof Map) object.each(function(value, key) { map.set(key, value); }); + + // Index array by numeric index or specified key function. + else if (Array.isArray(object)) { + var i = -1, + n = object.length, + o; + + if (f == null) while (++i < n) map.set(i, object[i]); + else while (++i < n) map.set(f(o = object[i], i, object), o); + } + + // Convert object to map. + else if (object) for (var key in object) map.set(key, object[key]); + + return map; +} + +function nest() { + var keys = [], + sortKeys = [], + sortValues, + rollup, + nest; + + function apply(array, depth, createResult, setResult) { + if (depth >= keys.length) { + if (sortValues != null) array.sort(sortValues); + return rollup != null ? rollup(array) : array; + } + + var i = -1, + n = array.length, + key = keys[depth++], + keyValue, + value, + valuesByKey = map$1(), + values, + result = createResult(); + + while (++i < n) { + if (values = valuesByKey.get(keyValue = key(value = array[i]) + "")) { + values.push(value); + } else { + valuesByKey.set(keyValue, [value]); + } + } + + valuesByKey.each(function(values, key) { + setResult(result, key, apply(values, depth, createResult, setResult)); + }); + + return result; + } + + function entries(map, depth) { + if (++depth > keys.length) return map; + var array, sortKey = sortKeys[depth - 1]; + if (rollup != null && depth >= keys.length) array = map.entries(); + else array = [], map.each(function(v, k) { array.push({key: k, values: entries(v, depth)}); }); + return sortKey != null ? array.sort(function(a, b) { return sortKey(a.key, b.key); }) : array; + } + + return nest = { + object: function(array) { return apply(array, 0, createObject, setObject); }, + map: function(array) { return apply(array, 0, createMap, setMap); }, + entries: function(array) { return entries(apply(array, 0, createMap, setMap), 0); }, + key: function(d) { keys.push(d); return nest; }, + sortKeys: function(order) { sortKeys[keys.length - 1] = order; return nest; }, + sortValues: function(order) { sortValues = order; return nest; }, + rollup: function(f) { rollup = f; return nest; } + }; +} + +function createObject() { + return {}; +} + +function setObject(object, key, value) { + object[key] = value; +} + +function createMap() { + return map$1(); +} + +function setMap(map, key, value) { + map.set(key, value); +} + +function Set() {} + +var proto = map$1.prototype; + +Set.prototype = set$2.prototype = { + constructor: Set, + has: proto.has, + add: function(value) { + value += ""; + this[prefix + value] = value; + return this; + }, + remove: proto.remove, + clear: proto.clear, + values: proto.keys, + size: proto.size, + empty: proto.empty, + each: proto.each +}; + +function set$2(object, f) { + var set = new Set; + + // Copy constructor. + if (object instanceof Set) object.each(function(value) { set.add(value); }); + + // Otherwise, assume it’s an array. + else if (object) { + var i = -1, n = object.length; + if (f == null) while (++i < n) set.add(object[i]); + else while (++i < n) set.add(f(object[i], i, object)); + } + + return set; +} + +function keys(map) { + var keys = []; + for (var key in map) keys.push(key); + return keys; +} + +function values(map) { + var values = []; + for (var key in map) values.push(map[key]); + return values; +} + +function entries(map) { + var entries = []; + for (var key in map) entries.push({key: key, value: map[key]}); + return entries; +} + +var EOL = {}; +var EOF = {}; +var QUOTE = 34; +var NEWLINE = 10; +var RETURN = 13; + +function objectConverter(columns) { + return new Function("d", "return {" + columns.map(function(name, i) { + return JSON.stringify(name) + ": d[" + i + "]"; + }).join(",") + "}"); +} + +function customConverter(columns, f) { + var object = objectConverter(columns); + return function(row, i) { + return f(object(row), i, columns); + }; +} + +// Compute unique columns in order of discovery. +function inferColumns(rows) { + var columnSet = Object.create(null), + columns = []; + + rows.forEach(function(row) { + for (var column in row) { + if (!(column in columnSet)) { + columns.push(columnSet[column] = column); + } + } + }); + + return columns; +} + +function dsv(delimiter) { + var reFormat = new RegExp("[\"" + delimiter + "\n\r]"), + DELIMITER = delimiter.charCodeAt(0); + + function parse(text, f) { + var convert, columns, rows = parseRows(text, function(row, i) { + if (convert) return convert(row, i - 1); + columns = row, convert = f ? customConverter(row, f) : objectConverter(row); + }); + rows.columns = columns || []; + return rows; + } + + function parseRows(text, f) { + var rows = [], // output rows + N = text.length, + I = 0, // current character index + n = 0, // current line number + t, // current token + eof = N <= 0, // current token followed by EOF? + eol = false; // current token followed by EOL? + + // Strip the trailing newline. + if (text.charCodeAt(N - 1) === NEWLINE) --N; + if (text.charCodeAt(N - 1) === RETURN) --N; + + function token() { + if (eof) return EOF; + if (eol) return eol = false, EOL; + + // Unescape quotes. + var i, j = I, c; + if (text.charCodeAt(j) === QUOTE) { + while (I++ < N && text.charCodeAt(I) !== QUOTE || text.charCodeAt(++I) === QUOTE); + if ((i = I) >= N) eof = true; + else if ((c = text.charCodeAt(I++)) === NEWLINE) eol = true; + else if (c === RETURN) { eol = true; if (text.charCodeAt(I) === NEWLINE) ++I; } + return text.slice(j + 1, i - 1).replace(/""/g, "\""); + } + + // Find next delimiter or newline. + while (I < N) { + if ((c = text.charCodeAt(i = I++)) === NEWLINE) eol = true; + else if (c === RETURN) { eol = true; if (text.charCodeAt(I) === NEWLINE) ++I; } + else if (c !== DELIMITER) continue; + return text.slice(j, i); + } + + // Return last token before EOF. + return eof = true, text.slice(j, N); + } + + while ((t = token()) !== EOF) { + var row = []; + while (t !== EOL && t !== EOF) row.push(t), t = token(); + if (f && (row = f(row, n++)) == null) continue; + rows.push(row); + } + + return rows; + } + + function format(rows, columns) { + if (columns == null) columns = inferColumns(rows); + return [columns.map(formatValue).join(delimiter)].concat(rows.map(function(row) { + return columns.map(function(column) { + return formatValue(row[column]); + }).join(delimiter); + })).join("\n"); + } + + function formatRows(rows) { + return rows.map(formatRow).join("\n"); + } + + function formatRow(row) { + return row.map(formatValue).join(delimiter); + } + + function formatValue(text) { + return text == null ? "" + : reFormat.test(text += "") ? "\"" + text.replace(/"/g, "\"\"") + "\"" + : text; + } + + return { + parse: parse, + parseRows: parseRows, + format: format, + formatRows: formatRows + }; +} + +var csv = dsv(","); + +var csvParse = csv.parse; +var csvParseRows = csv.parseRows; +var csvFormat = csv.format; +var csvFormatRows = csv.formatRows; + +var tsv = dsv("\t"); + +var tsvParse = tsv.parse; +var tsvParseRows = tsv.parseRows; +var tsvFormat = tsv.format; +var tsvFormatRows = tsv.formatRows; + +function center$1(x, y) { + var nodes; + + if (x == null) x = 0; + if (y == null) y = 0; + + function force() { + var i, + n = nodes.length, + node, + sx = 0, + sy = 0; + + for (i = 0; i < n; ++i) { + node = nodes[i], sx += node.x, sy += node.y; + } + + for (sx = sx / n - x, sy = sy / n - y, i = 0; i < n; ++i) { + node = nodes[i], node.x -= sx, node.y -= sy; + } + } + + force.initialize = function(_) { + nodes = _; + }; + + force.x = function(_) { + return arguments.length ? (x = +_, force) : x; + }; + + force.y = function(_) { + return arguments.length ? (y = +_, force) : y; + }; + + return force; +} + +function constant$6(x) { + return function() { + return x; + }; +} + +function jiggle() { + return (Math.random() - 0.5) * 1e-6; +} + +function tree_add(d) { + var x = +this._x.call(null, d), + y = +this._y.call(null, d); + return add(this.cover(x, y), x, y, d); +} + +function add(tree, x, y, d) { + if (isNaN(x) || isNaN(y)) return tree; // ignore invalid points + + var parent, + node = tree._root, + leaf = {data: d}, + x0 = tree._x0, + y0 = tree._y0, + x1 = tree._x1, + y1 = tree._y1, + xm, + ym, + xp, + yp, + right, + bottom, + i, + j; + + // If the tree is empty, initialize the root as a leaf. + if (!node) return tree._root = leaf, tree; + + // Find the existing leaf for the new point, or add it. + while (node.length) { + if (right = x >= (xm = (x0 + x1) / 2)) x0 = xm; else x1 = xm; + if (bottom = y >= (ym = (y0 + y1) / 2)) y0 = ym; else y1 = ym; + if (parent = node, !(node = node[i = bottom << 1 | right])) return parent[i] = leaf, tree; + } + + // Is the new point is exactly coincident with the existing point? + xp = +tree._x.call(null, node.data); + yp = +tree._y.call(null, node.data); + if (x === xp && y === yp) return leaf.next = node, parent ? parent[i] = leaf : tree._root = leaf, tree; + + // Otherwise, split the leaf node until the old and new point are separated. + do { + parent = parent ? parent[i] = new Array(4) : tree._root = new Array(4); + if (right = x >= (xm = (x0 + x1) / 2)) x0 = xm; else x1 = xm; + if (bottom = y >= (ym = (y0 + y1) / 2)) y0 = ym; else y1 = ym; + } while ((i = bottom << 1 | right) === (j = (yp >= ym) << 1 | (xp >= xm))); + return parent[j] = node, parent[i] = leaf, tree; +} + +function addAll(data) { + var d, i, n = data.length, + x, + y, + xz = new Array(n), + yz = new Array(n), + x0 = Infinity, + y0 = Infinity, + x1 = -Infinity, + y1 = -Infinity; + + // Compute the points and their extent. + for (i = 0; i < n; ++i) { + if (isNaN(x = +this._x.call(null, d = data[i])) || isNaN(y = +this._y.call(null, d))) continue; + xz[i] = x; + yz[i] = y; + if (x < x0) x0 = x; + if (x > x1) x1 = x; + if (y < y0) y0 = y; + if (y > y1) y1 = y; + } + + // If there were no (valid) points, inherit the existing extent. + if (x1 < x0) x0 = this._x0, x1 = this._x1; + if (y1 < y0) y0 = this._y0, y1 = this._y1; + + // Expand the tree to cover the new points. + this.cover(x0, y0).cover(x1, y1); + + // Add the new points. + for (i = 0; i < n; ++i) { + add(this, xz[i], yz[i], data[i]); + } + + return this; +} + +function tree_cover(x, y) { + if (isNaN(x = +x) || isNaN(y = +y)) return this; // ignore invalid points + + var x0 = this._x0, + y0 = this._y0, + x1 = this._x1, + y1 = this._y1; + + // If the quadtree has no extent, initialize them. + // Integer extent are necessary so that if we later double the extent, + // the existing quadrant boundaries don’t change due to floating point error! + if (isNaN(x0)) { + x1 = (x0 = Math.floor(x)) + 1; + y1 = (y0 = Math.floor(y)) + 1; + } + + // Otherwise, double repeatedly to cover. + else if (x0 > x || x > x1 || y0 > y || y > y1) { + var z = x1 - x0, + node = this._root, + parent, + i; + + switch (i = (y < (y0 + y1) / 2) << 1 | (x < (x0 + x1) / 2)) { + case 0: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x1 = x0 + z, y1 = y0 + z, x > x1 || y > y1); + break; + } + case 1: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x0 = x1 - z, y1 = y0 + z, x0 > x || y > y1); + break; + } + case 2: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x1 = x0 + z, y0 = y1 - z, x > x1 || y0 > y); + break; + } + case 3: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x0 = x1 - z, y0 = y1 - z, x0 > x || y0 > y); + break; + } + } + + if (this._root && this._root.length) this._root = node; + } + + // If the quadtree covers the point already, just return. + else return this; + + this._x0 = x0; + this._y0 = y0; + this._x1 = x1; + this._y1 = y1; + return this; +} + +function tree_data() { + var data = []; + this.visit(function(node) { + if (!node.length) do data.push(node.data); while (node = node.next) + }); + return data; +} + +function tree_extent(_) { + return arguments.length + ? this.cover(+_[0][0], +_[0][1]).cover(+_[1][0], +_[1][1]) + : isNaN(this._x0) ? undefined : [[this._x0, this._y0], [this._x1, this._y1]]; +} + +function Quad(node, x0, y0, x1, y1) { + this.node = node; + this.x0 = x0; + this.y0 = y0; + this.x1 = x1; + this.y1 = y1; +} + +function tree_find(x, y, radius) { + var data, + x0 = this._x0, + y0 = this._y0, + x1, + y1, + x2, + y2, + x3 = this._x1, + y3 = this._y1, + quads = [], + node = this._root, + q, + i; + + if (node) quads.push(new Quad(node, x0, y0, x3, y3)); + if (radius == null) radius = Infinity; + else { + x0 = x - radius, y0 = y - radius; + x3 = x + radius, y3 = y + radius; + radius *= radius; + } + + while (q = quads.pop()) { + + // Stop searching if this quadrant can’t contain a closer node. + if (!(node = q.node) + || (x1 = q.x0) > x3 + || (y1 = q.y0) > y3 + || (x2 = q.x1) < x0 + || (y2 = q.y1) < y0) continue; + + // Bisect the current quadrant. + if (node.length) { + var xm = (x1 + x2) / 2, + ym = (y1 + y2) / 2; + + quads.push( + new Quad(node[3], xm, ym, x2, y2), + new Quad(node[2], x1, ym, xm, y2), + new Quad(node[1], xm, y1, x2, ym), + new Quad(node[0], x1, y1, xm, ym) + ); + + // Visit the closest quadrant first. + if (i = (y >= ym) << 1 | (x >= xm)) { + q = quads[quads.length - 1]; + quads[quads.length - 1] = quads[quads.length - 1 - i]; + quads[quads.length - 1 - i] = q; + } + } + + // Visit this point. (Visiting coincident points isn’t necessary!) + else { + var dx = x - +this._x.call(null, node.data), + dy = y - +this._y.call(null, node.data), + d2 = dx * dx + dy * dy; + if (d2 < radius) { + var d = Math.sqrt(radius = d2); + x0 = x - d, y0 = y - d; + x3 = x + d, y3 = y + d; + data = node.data; + } + } + } + + return data; +} + +function tree_remove(d) { + if (isNaN(x = +this._x.call(null, d)) || isNaN(y = +this._y.call(null, d))) return this; // ignore invalid points + + var parent, + node = this._root, + retainer, + previous, + next, + x0 = this._x0, + y0 = this._y0, + x1 = this._x1, + y1 = this._y1, + x, + y, + xm, + ym, + right, + bottom, + i, + j; + + // If the tree is empty, initialize the root as a leaf. + if (!node) return this; + + // Find the leaf node for the point. + // While descending, also retain the deepest parent with a non-removed sibling. + if (node.length) while (true) { + if (right = x >= (xm = (x0 + x1) / 2)) x0 = xm; else x1 = xm; + if (bottom = y >= (ym = (y0 + y1) / 2)) y0 = ym; else y1 = ym; + if (!(parent = node, node = node[i = bottom << 1 | right])) return this; + if (!node.length) break; + if (parent[(i + 1) & 3] || parent[(i + 2) & 3] || parent[(i + 3) & 3]) retainer = parent, j = i; + } + + // Find the point to remove. + while (node.data !== d) if (!(previous = node, node = node.next)) return this; + if (next = node.next) delete node.next; + + // If there are multiple coincident points, remove just the point. + if (previous) return next ? previous.next = next : delete previous.next, this; + + // If this is the root point, remove it. + if (!parent) return this._root = next, this; + + // Remove this leaf. + next ? parent[i] = next : delete parent[i]; + + // If the parent now contains exactly one leaf, collapse superfluous parents. + if ((node = parent[0] || parent[1] || parent[2] || parent[3]) + && node === (parent[3] || parent[2] || parent[1] || parent[0]) + && !node.length) { + if (retainer) retainer[j] = node; + else this._root = node; + } + + return this; +} + +function removeAll(data) { + for (var i = 0, n = data.length; i < n; ++i) this.remove(data[i]); + return this; +} + +function tree_root() { + return this._root; +} + +function tree_size() { + var size = 0; + this.visit(function(node) { + if (!node.length) do ++size; while (node = node.next) + }); + return size; +} + +function tree_visit(callback) { + var quads = [], q, node = this._root, child, x0, y0, x1, y1; + if (node) quads.push(new Quad(node, this._x0, this._y0, this._x1, this._y1)); + while (q = quads.pop()) { + if (!callback(node = q.node, x0 = q.x0, y0 = q.y0, x1 = q.x1, y1 = q.y1) && node.length) { + var xm = (x0 + x1) / 2, ym = (y0 + y1) / 2; + if (child = node[3]) quads.push(new Quad(child, xm, ym, x1, y1)); + if (child = node[2]) quads.push(new Quad(child, x0, ym, xm, y1)); + if (child = node[1]) quads.push(new Quad(child, xm, y0, x1, ym)); + if (child = node[0]) quads.push(new Quad(child, x0, y0, xm, ym)); + } + } + return this; +} + +function tree_visitAfter(callback) { + var quads = [], next = [], q; + if (this._root) quads.push(new Quad(this._root, this._x0, this._y0, this._x1, this._y1)); + while (q = quads.pop()) { + var node = q.node; + if (node.length) { + var child, x0 = q.x0, y0 = q.y0, x1 = q.x1, y1 = q.y1, xm = (x0 + x1) / 2, ym = (y0 + y1) / 2; + if (child = node[0]) quads.push(new Quad(child, x0, y0, xm, ym)); + if (child = node[1]) quads.push(new Quad(child, xm, y0, x1, ym)); + if (child = node[2]) quads.push(new Quad(child, x0, ym, xm, y1)); + if (child = node[3]) quads.push(new Quad(child, xm, ym, x1, y1)); + } + next.push(q); + } + while (q = next.pop()) { + callback(q.node, q.x0, q.y0, q.x1, q.y1); + } + return this; +} + +function defaultX(d) { + return d[0]; +} + +function tree_x(_) { + return arguments.length ? (this._x = _, this) : this._x; +} + +function defaultY(d) { + return d[1]; +} + +function tree_y(_) { + return arguments.length ? (this._y = _, this) : this._y; +} + +function quadtree(nodes, x, y) { + var tree = new Quadtree(x == null ? defaultX : x, y == null ? defaultY : y, NaN, NaN, NaN, NaN); + return nodes == null ? tree : tree.addAll(nodes); +} + +function Quadtree(x, y, x0, y0, x1, y1) { + this._x = x; + this._y = y; + this._x0 = x0; + this._y0 = y0; + this._x1 = x1; + this._y1 = y1; + this._root = undefined; +} + +function leaf_copy(leaf) { + var copy = {data: leaf.data}, next = copy; + while (leaf = leaf.next) next = next.next = {data: leaf.data}; + return copy; +} + +var treeProto = quadtree.prototype = Quadtree.prototype; + +treeProto.copy = function() { + var copy = new Quadtree(this._x, this._y, this._x0, this._y0, this._x1, this._y1), + node = this._root, + nodes, + child; + + if (!node) return copy; + + if (!node.length) return copy._root = leaf_copy(node), copy; + + nodes = [{source: node, target: copy._root = new Array(4)}]; + while (node = nodes.pop()) { + for (var i = 0; i < 4; ++i) { + if (child = node.source[i]) { + if (child.length) nodes.push({source: child, target: node.target[i] = new Array(4)}); + else node.target[i] = leaf_copy(child); + } + } + } + + return copy; +}; + +treeProto.add = tree_add; +treeProto.addAll = addAll; +treeProto.cover = tree_cover; +treeProto.data = tree_data; +treeProto.extent = tree_extent; +treeProto.find = tree_find; +treeProto.remove = tree_remove; +treeProto.removeAll = removeAll; +treeProto.root = tree_root; +treeProto.size = tree_size; +treeProto.visit = tree_visit; +treeProto.visitAfter = tree_visitAfter; +treeProto.x = tree_x; +treeProto.y = tree_y; + +function x(d) { + return d.x + d.vx; +} + +function y(d) { + return d.y + d.vy; +} + +function collide(radius) { + var nodes, + radii, + strength = 1, + iterations = 1; + + if (typeof radius !== "function") radius = constant$6(radius == null ? 1 : +radius); + + function force() { + var i, n = nodes.length, + tree, + node, + xi, + yi, + ri, + ri2; + + for (var k = 0; k < iterations; ++k) { + tree = quadtree(nodes, x, y).visitAfter(prepare); + for (i = 0; i < n; ++i) { + node = nodes[i]; + ri = radii[node.index], ri2 = ri * ri; + xi = node.x + node.vx; + yi = node.y + node.vy; + tree.visit(apply); + } + } + + function apply(quad, x0, y0, x1, y1) { + var data = quad.data, rj = quad.r, r = ri + rj; + if (data) { + if (data.index > node.index) { + var x = xi - data.x - data.vx, + y = yi - data.y - data.vy, + l = x * x + y * y; + if (l < r * r) { + if (x === 0) x = jiggle(), l += x * x; + if (y === 0) y = jiggle(), l += y * y; + l = (r - (l = Math.sqrt(l))) / l * strength; + node.vx += (x *= l) * (r = (rj *= rj) / (ri2 + rj)); + node.vy += (y *= l) * r; + data.vx -= x * (r = 1 - r); + data.vy -= y * r; + } + } + return; + } + return x0 > xi + r || x1 < xi - r || y0 > yi + r || y1 < yi - r; + } + } + + function prepare(quad) { + if (quad.data) return quad.r = radii[quad.data.index]; + for (var i = quad.r = 0; i < 4; ++i) { + if (quad[i] && quad[i].r > quad.r) { + quad.r = quad[i].r; + } + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length, node; + radii = new Array(n); + for (i = 0; i < n; ++i) node = nodes[i], radii[node.index] = +radius(node, i, nodes); + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.iterations = function(_) { + return arguments.length ? (iterations = +_, force) : iterations; + }; + + force.strength = function(_) { + return arguments.length ? (strength = +_, force) : strength; + }; + + force.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : radius; + }; + + return force; +} + +function index(d) { + return d.index; +} + +function find(nodeById, nodeId) { + var node = nodeById.get(nodeId); + if (!node) throw new Error("missing: " + nodeId); + return node; +} + +function link(links) { + var id = index, + strength = defaultStrength, + strengths, + distance = constant$6(30), + distances, + nodes, + count, + bias, + iterations = 1; + + if (links == null) links = []; + + function defaultStrength(link) { + return 1 / Math.min(count[link.source.index], count[link.target.index]); + } + + function force(alpha) { + for (var k = 0, n = links.length; k < iterations; ++k) { + for (var i = 0, link, source, target, x, y, l, b; i < n; ++i) { + link = links[i], source = link.source, target = link.target; + x = target.x + target.vx - source.x - source.vx || jiggle(); + y = target.y + target.vy - source.y - source.vy || jiggle(); + l = Math.sqrt(x * x + y * y); + l = (l - distances[i]) / l * alpha * strengths[i]; + x *= l, y *= l; + target.vx -= x * (b = bias[i]); + target.vy -= y * b; + source.vx += x * (b = 1 - b); + source.vy += y * b; + } + } + } + + function initialize() { + if (!nodes) return; + + var i, + n = nodes.length, + m = links.length, + nodeById = map$1(nodes, id), + link; + + for (i = 0, count = new Array(n); i < m; ++i) { + link = links[i], link.index = i; + if (typeof link.source !== "object") link.source = find(nodeById, link.source); + if (typeof link.target !== "object") link.target = find(nodeById, link.target); + count[link.source.index] = (count[link.source.index] || 0) + 1; + count[link.target.index] = (count[link.target.index] || 0) + 1; + } + + for (i = 0, bias = new Array(m); i < m; ++i) { + link = links[i], bias[i] = count[link.source.index] / (count[link.source.index] + count[link.target.index]); + } + + strengths = new Array(m), initializeStrength(); + distances = new Array(m), initializeDistance(); + } + + function initializeStrength() { + if (!nodes) return; + + for (var i = 0, n = links.length; i < n; ++i) { + strengths[i] = +strength(links[i], i, links); + } + } + + function initializeDistance() { + if (!nodes) return; + + for (var i = 0, n = links.length; i < n; ++i) { + distances[i] = +distance(links[i], i, links); + } + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.links = function(_) { + return arguments.length ? (links = _, initialize(), force) : links; + }; + + force.id = function(_) { + return arguments.length ? (id = _, force) : id; + }; + + force.iterations = function(_) { + return arguments.length ? (iterations = +_, force) : iterations; + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initializeStrength(), force) : strength; + }; + + force.distance = function(_) { + return arguments.length ? (distance = typeof _ === "function" ? _ : constant$6(+_), initializeDistance(), force) : distance; + }; + + return force; +} + +function x$1(d) { + return d.x; +} + +function y$1(d) { + return d.y; +} + +var initialRadius = 10; +var initialAngle = Math.PI * (3 - Math.sqrt(5)); + +function simulation(nodes) { + var simulation, + alpha = 1, + alphaMin = 0.001, + alphaDecay = 1 - Math.pow(alphaMin, 1 / 300), + alphaTarget = 0, + velocityDecay = 0.6, + forces = map$1(), + stepper = timer(step), + event = dispatch("tick", "end"); + + if (nodes == null) nodes = []; + + function step() { + tick(); + event.call("tick", simulation); + if (alpha < alphaMin) { + stepper.stop(); + event.call("end", simulation); + } + } + + function tick() { + var i, n = nodes.length, node; + + alpha += (alphaTarget - alpha) * alphaDecay; + + forces.each(function(force) { + force(alpha); + }); + + for (i = 0; i < n; ++i) { + node = nodes[i]; + if (node.fx == null) node.x += node.vx *= velocityDecay; + else node.x = node.fx, node.vx = 0; + if (node.fy == null) node.y += node.vy *= velocityDecay; + else node.y = node.fy, node.vy = 0; + } + } + + function initializeNodes() { + for (var i = 0, n = nodes.length, node; i < n; ++i) { + node = nodes[i], node.index = i; + if (isNaN(node.x) || isNaN(node.y)) { + var radius = initialRadius * Math.sqrt(i), angle = i * initialAngle; + node.x = radius * Math.cos(angle); + node.y = radius * Math.sin(angle); + } + if (isNaN(node.vx) || isNaN(node.vy)) { + node.vx = node.vy = 0; + } + } + } + + function initializeForce(force) { + if (force.initialize) force.initialize(nodes); + return force; + } + + initializeNodes(); + + return simulation = { + tick: tick, + + restart: function() { + return stepper.restart(step), simulation; + }, + + stop: function() { + return stepper.stop(), simulation; + }, + + nodes: function(_) { + return arguments.length ? (nodes = _, initializeNodes(), forces.each(initializeForce), simulation) : nodes; + }, + + alpha: function(_) { + return arguments.length ? (alpha = +_, simulation) : alpha; + }, + + alphaMin: function(_) { + return arguments.length ? (alphaMin = +_, simulation) : alphaMin; + }, + + alphaDecay: function(_) { + return arguments.length ? (alphaDecay = +_, simulation) : +alphaDecay; + }, + + alphaTarget: function(_) { + return arguments.length ? (alphaTarget = +_, simulation) : alphaTarget; + }, + + velocityDecay: function(_) { + return arguments.length ? (velocityDecay = 1 - _, simulation) : 1 - velocityDecay; + }, + + force: function(name, _) { + return arguments.length > 1 ? (_ == null ? forces.remove(name) : forces.set(name, initializeForce(_)), simulation) : forces.get(name); + }, + + find: function(x, y, radius) { + var i = 0, + n = nodes.length, + dx, + dy, + d2, + node, + closest; + + if (radius == null) radius = Infinity; + else radius *= radius; + + for (i = 0; i < n; ++i) { + node = nodes[i]; + dx = x - node.x; + dy = y - node.y; + d2 = dx * dx + dy * dy; + if (d2 < radius) closest = node, radius = d2; + } + + return closest; + }, + + on: function(name, _) { + return arguments.length > 1 ? (event.on(name, _), simulation) : event.on(name); + } + }; +} + +function manyBody() { + var nodes, + node, + alpha, + strength = constant$6(-30), + strengths, + distanceMin2 = 1, + distanceMax2 = Infinity, + theta2 = 0.81; + + function force(_) { + var i, n = nodes.length, tree = quadtree(nodes, x$1, y$1).visitAfter(accumulate); + for (alpha = _, i = 0; i < n; ++i) node = nodes[i], tree.visit(apply); + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length, node; + strengths = new Array(n); + for (i = 0; i < n; ++i) node = nodes[i], strengths[node.index] = +strength(node, i, nodes); + } + + function accumulate(quad) { + var strength = 0, q, c, weight = 0, x, y, i; + + // For internal nodes, accumulate forces from child quadrants. + if (quad.length) { + for (x = y = i = 0; i < 4; ++i) { + if ((q = quad[i]) && (c = Math.abs(q.value))) { + strength += q.value, weight += c, x += c * q.x, y += c * q.y; + } + } + quad.x = x / weight; + quad.y = y / weight; + } + + // For leaf nodes, accumulate forces from coincident quadrants. + else { + q = quad; + q.x = q.data.x; + q.y = q.data.y; + do strength += strengths[q.data.index]; + while (q = q.next); + } + + quad.value = strength; + } + + function apply(quad, x1, _, x2) { + if (!quad.value) return true; + + var x = quad.x - node.x, + y = quad.y - node.y, + w = x2 - x1, + l = x * x + y * y; + + // Apply the Barnes-Hut approximation if possible. + // Limit forces for very close nodes; randomize direction if coincident. + if (w * w / theta2 < l) { + if (l < distanceMax2) { + if (x === 0) x = jiggle(), l += x * x; + if (y === 0) y = jiggle(), l += y * y; + if (l < distanceMin2) l = Math.sqrt(distanceMin2 * l); + node.vx += x * quad.value * alpha / l; + node.vy += y * quad.value * alpha / l; + } + return true; + } + + // Otherwise, process points directly. + else if (quad.length || l >= distanceMax2) return; + + // Limit forces for very close nodes; randomize direction if coincident. + if (quad.data !== node || quad.next) { + if (x === 0) x = jiggle(), l += x * x; + if (y === 0) y = jiggle(), l += y * y; + if (l < distanceMin2) l = Math.sqrt(distanceMin2 * l); + } + + do if (quad.data !== node) { + w = strengths[quad.data.index] * alpha / l; + node.vx += x * w; + node.vy += y * w; + } while (quad = quad.next); + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.distanceMin = function(_) { + return arguments.length ? (distanceMin2 = _ * _, force) : Math.sqrt(distanceMin2); + }; + + force.distanceMax = function(_) { + return arguments.length ? (distanceMax2 = _ * _, force) : Math.sqrt(distanceMax2); + }; + + force.theta = function(_) { + return arguments.length ? (theta2 = _ * _, force) : Math.sqrt(theta2); + }; + + return force; +} + +function radial(radius, x, y) { + var nodes, + strength = constant$6(0.1), + strengths, + radiuses; + + if (typeof radius !== "function") radius = constant$6(+radius); + if (x == null) x = 0; + if (y == null) y = 0; + + function force(alpha) { + for (var i = 0, n = nodes.length; i < n; ++i) { + var node = nodes[i], + dx = node.x - x || 1e-6, + dy = node.y - y || 1e-6, + r = Math.sqrt(dx * dx + dy * dy), + k = (radiuses[i] - r) * strengths[i] * alpha / r; + node.vx += dx * k; + node.vy += dy * k; + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length; + strengths = new Array(n); + radiuses = new Array(n); + for (i = 0; i < n; ++i) { + radiuses[i] = +radius(nodes[i], i, nodes); + strengths[i] = isNaN(radiuses[i]) ? 0 : +strength(nodes[i], i, nodes); + } + } + + force.initialize = function(_) { + nodes = _, initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : radius; + }; + + force.x = function(_) { + return arguments.length ? (x = +_, force) : x; + }; + + force.y = function(_) { + return arguments.length ? (y = +_, force) : y; + }; + + return force; +} + +function x$2(x) { + var strength = constant$6(0.1), + nodes, + strengths, + xz; + + if (typeof x !== "function") x = constant$6(x == null ? 0 : +x); + + function force(alpha) { + for (var i = 0, n = nodes.length, node; i < n; ++i) { + node = nodes[i], node.vx += (xz[i] - node.x) * strengths[i] * alpha; + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length; + strengths = new Array(n); + xz = new Array(n); + for (i = 0; i < n; ++i) { + strengths[i] = isNaN(xz[i] = +x(nodes[i], i, nodes)) ? 0 : +strength(nodes[i], i, nodes); + } + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.x = function(_) { + return arguments.length ? (x = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : x; + }; + + return force; +} + +function y$2(y) { + var strength = constant$6(0.1), + nodes, + strengths, + yz; + + if (typeof y !== "function") y = constant$6(y == null ? 0 : +y); + + function force(alpha) { + for (var i = 0, n = nodes.length, node; i < n; ++i) { + node = nodes[i], node.vy += (yz[i] - node.y) * strengths[i] * alpha; + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length; + strengths = new Array(n); + yz = new Array(n); + for (i = 0; i < n; ++i) { + strengths[i] = isNaN(yz[i] = +y(nodes[i], i, nodes)) ? 0 : +strength(nodes[i], i, nodes); + } + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.y = function(_) { + return arguments.length ? (y = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : y; + }; + + return force; +} + +// Computes the decimal coefficient and exponent of the specified number x with +// significant digits p, where x is positive and p is in [1, 21] or undefined. +// For example, formatDecimal(1.23) returns ["123", 0]. +function formatDecimal(x, p) { + if ((i = (x = p ? x.toExponential(p - 1) : x.toExponential()).indexOf("e")) < 0) return null; // NaN, ±Infinity + var i, coefficient = x.slice(0, i); + + // The string returned by toExponential either has the form \d\.\d+e[-+]\d+ + // (e.g., 1.2e+3) or the form \de[-+]\d+ (e.g., 1e+3). + return [ + coefficient.length > 1 ? coefficient[0] + coefficient.slice(2) : coefficient, + +x.slice(i + 1) + ]; +} + +function exponent$1(x) { + return x = formatDecimal(Math.abs(x)), x ? x[1] : NaN; +} + +function formatGroup(grouping, thousands) { + return function(value, width) { + var i = value.length, + t = [], + j = 0, + g = grouping[0], + length = 0; + + while (i > 0 && g > 0) { + if (length + g + 1 > width) g = Math.max(1, width - length); + t.push(value.substring(i -= g, i + g)); + if ((length += g + 1) > width) break; + g = grouping[j = (j + 1) % grouping.length]; + } + + return t.reverse().join(thousands); + }; +} + +function formatNumerals(numerals) { + return function(value) { + return value.replace(/[0-9]/g, function(i) { + return numerals[+i]; + }); + }; +} + +function formatDefault(x, p) { + x = x.toPrecision(p); + + out: for (var n = x.length, i = 1, i0 = -1, i1; i < n; ++i) { + switch (x[i]) { + case ".": i0 = i1 = i; break; + case "0": if (i0 === 0) i0 = i; i1 = i; break; + case "e": break out; + default: if (i0 > 0) i0 = 0; break; + } + } + + return i0 > 0 ? x.slice(0, i0) + x.slice(i1 + 1) : x; +} + +var prefixExponent; + +function formatPrefixAuto(x, p) { + var d = formatDecimal(x, p); + if (!d) return x + ""; + var coefficient = d[0], + exponent = d[1], + i = exponent - (prefixExponent = Math.max(-8, Math.min(8, Math.floor(exponent / 3))) * 3) + 1, + n = coefficient.length; + return i === n ? coefficient + : i > n ? coefficient + new Array(i - n + 1).join("0") + : i > 0 ? coefficient.slice(0, i) + "." + coefficient.slice(i) + : "0." + new Array(1 - i).join("0") + formatDecimal(x, Math.max(0, p + i - 1))[0]; // less than 1y! +} + +function formatRounded(x, p) { + var d = formatDecimal(x, p); + if (!d) return x + ""; + var coefficient = d[0], + exponent = d[1]; + return exponent < 0 ? "0." + new Array(-exponent).join("0") + coefficient + : coefficient.length > exponent + 1 ? coefficient.slice(0, exponent + 1) + "." + coefficient.slice(exponent + 1) + : coefficient + new Array(exponent - coefficient.length + 2).join("0"); +} + +var formatTypes = { + "": formatDefault, + "%": function(x, p) { return (x * 100).toFixed(p); }, + "b": function(x) { return Math.round(x).toString(2); }, + "c": function(x) { return x + ""; }, + "d": function(x) { return Math.round(x).toString(10); }, + "e": function(x, p) { return x.toExponential(p); }, + "f": function(x, p) { return x.toFixed(p); }, + "g": function(x, p) { return x.toPrecision(p); }, + "o": function(x) { return Math.round(x).toString(8); }, + "p": function(x, p) { return formatRounded(x * 100, p); }, + "r": formatRounded, + "s": formatPrefixAuto, + "X": function(x) { return Math.round(x).toString(16).toUpperCase(); }, + "x": function(x) { return Math.round(x).toString(16); } +}; + +// [[fill]align][sign][symbol][0][width][,][.precision][type] +var re = /^(?:(.)?([<>=^]))?([+\-\( ])?([$#])?(0)?(\d+)?(,)?(\.\d+)?([a-z%])?$/i; + +function formatSpecifier(specifier) { + return new FormatSpecifier(specifier); +} + +formatSpecifier.prototype = FormatSpecifier.prototype; // instanceof + +function FormatSpecifier(specifier) { + if (!(match = re.exec(specifier))) throw new Error("invalid format: " + specifier); + + var match, + fill = match[1] || " ", + align = match[2] || ">", + sign = match[3] || "-", + symbol = match[4] || "", + zero = !!match[5], + width = match[6] && +match[6], + comma = !!match[7], + precision = match[8] && +match[8].slice(1), + type = match[9] || ""; + + // The "n" type is an alias for ",g". + if (type === "n") comma = true, type = "g"; + + // Map invalid types to the default format. + else if (!formatTypes[type]) type = ""; + + // If zero fill is specified, padding goes after sign and before digits. + if (zero || (fill === "0" && align === "=")) zero = true, fill = "0", align = "="; + + this.fill = fill; + this.align = align; + this.sign = sign; + this.symbol = symbol; + this.zero = zero; + this.width = width; + this.comma = comma; + this.precision = precision; + this.type = type; +} + +FormatSpecifier.prototype.toString = function() { + return this.fill + + this.align + + this.sign + + this.symbol + + (this.zero ? "0" : "") + + (this.width == null ? "" : Math.max(1, this.width | 0)) + + (this.comma ? "," : "") + + (this.precision == null ? "" : "." + Math.max(0, this.precision | 0)) + + this.type; +}; + +function identity$3(x) { + return x; +} + +var prefixes = ["y","z","a","f","p","n","\xB5","m","","k","M","G","T","P","E","Z","Y"]; + +function formatLocale(locale) { + var group = locale.grouping && locale.thousands ? formatGroup(locale.grouping, locale.thousands) : identity$3, + currency = locale.currency, + decimal = locale.decimal, + numerals = locale.numerals ? formatNumerals(locale.numerals) : identity$3, + percent = locale.percent || "%"; + + function newFormat(specifier) { + specifier = formatSpecifier(specifier); + + var fill = specifier.fill, + align = specifier.align, + sign = specifier.sign, + symbol = specifier.symbol, + zero = specifier.zero, + width = specifier.width, + comma = specifier.comma, + precision = specifier.precision, + type = specifier.type; + + // Compute the prefix and suffix. + // For SI-prefix, the suffix is lazily computed. + var prefix = symbol === "$" ? currency[0] : symbol === "#" && /[boxX]/.test(type) ? "0" + type.toLowerCase() : "", + suffix = symbol === "$" ? currency[1] : /[%p]/.test(type) ? percent : ""; + + // What format function should we use? + // Is this an integer type? + // Can this type generate exponential notation? + var formatType = formatTypes[type], + maybeSuffix = !type || /[defgprs%]/.test(type); + + // Set the default precision if not specified, + // or clamp the specified precision to the supported range. + // For significant precision, it must be in [1, 21]. + // For fixed precision, it must be in [0, 20]. + precision = precision == null ? (type ? 6 : 12) + : /[gprs]/.test(type) ? Math.max(1, Math.min(21, precision)) + : Math.max(0, Math.min(20, precision)); + + function format(value) { + var valuePrefix = prefix, + valueSuffix = suffix, + i, n, c; + + if (type === "c") { + valueSuffix = formatType(value) + valueSuffix; + value = ""; + } else { + value = +value; + + // Perform the initial formatting. + var valueNegative = value < 0; + value = formatType(Math.abs(value), precision); + + // If a negative value rounds to zero during formatting, treat as positive. + if (valueNegative && +value === 0) valueNegative = false; + + // Compute the prefix and suffix. + valuePrefix = (valueNegative ? (sign === "(" ? sign : "-") : sign === "-" || sign === "(" ? "" : sign) + valuePrefix; + valueSuffix = (type === "s" ? prefixes[8 + prefixExponent / 3] : "") + valueSuffix + (valueNegative && sign === "(" ? ")" : ""); + + // Break the formatted value into the integer “value” part that can be + // grouped, and fractional or exponential “suffix” part that is not. + if (maybeSuffix) { + i = -1, n = value.length; + while (++i < n) { + if (c = value.charCodeAt(i), 48 > c || c > 57) { + valueSuffix = (c === 46 ? decimal + value.slice(i + 1) : value.slice(i)) + valueSuffix; + value = value.slice(0, i); + break; + } + } + } + } + + // If the fill character is not "0", grouping is applied before padding. + if (comma && !zero) value = group(value, Infinity); + + // Compute the padding. + var length = valuePrefix.length + value.length + valueSuffix.length, + padding = length < width ? new Array(width - length + 1).join(fill) : ""; + + // If the fill character is "0", grouping is applied after padding. + if (comma && zero) value = group(padding + value, padding.length ? width - valueSuffix.length : Infinity), padding = ""; + + // Reconstruct the final output based on the desired alignment. + switch (align) { + case "<": value = valuePrefix + value + valueSuffix + padding; break; + case "=": value = valuePrefix + padding + value + valueSuffix; break; + case "^": value = padding.slice(0, length = padding.length >> 1) + valuePrefix + value + valueSuffix + padding.slice(length); break; + default: value = padding + valuePrefix + value + valueSuffix; break; + } + + return numerals(value); + } + + format.toString = function() { + return specifier + ""; + }; + + return format; + } + + function formatPrefix(specifier, value) { + var f = newFormat((specifier = formatSpecifier(specifier), specifier.type = "f", specifier)), + e = Math.max(-8, Math.min(8, Math.floor(exponent$1(value) / 3))) * 3, + k = Math.pow(10, -e), + prefix = prefixes[8 + e / 3]; + return function(value) { + return f(k * value) + prefix; + }; + } + + return { + format: newFormat, + formatPrefix: formatPrefix + }; +} + +var locale; + + + +defaultLocale({ + decimal: ".", + thousands: ",", + grouping: [3], + currency: ["$", ""] +}); + +function defaultLocale(definition) { + locale = formatLocale(definition); + exports.format = locale.format; + exports.formatPrefix = locale.formatPrefix; + return locale; +} + +function precisionFixed(step) { + return Math.max(0, -exponent$1(Math.abs(step))); +} + +function precisionPrefix(step, value) { + return Math.max(0, Math.max(-8, Math.min(8, Math.floor(exponent$1(value) / 3))) * 3 - exponent$1(Math.abs(step))); +} + +function precisionRound(step, max) { + step = Math.abs(step), max = Math.abs(max) - step; + return Math.max(0, exponent$1(max) - exponent$1(step)) + 1; +} + +// Adds floating point numbers with twice the normal precision. +// Reference: J. R. Shewchuk, Adaptive Precision Floating-Point Arithmetic and +// Fast Robust Geometric Predicates, Discrete & Computational Geometry 18(3) +// 305–363 (1997). +// Code adapted from GeographicLib by Charles F. F. Karney, +// http://geographiclib.sourceforge.net/ + +function adder() { + return new Adder; +} + +function Adder() { + this.reset(); +} + +Adder.prototype = { + constructor: Adder, + reset: function() { + this.s = // rounded value + this.t = 0; // exact error + }, + add: function(y) { + add$1(temp, y, this.t); + add$1(this, temp.s, this.s); + if (this.s) this.t += temp.t; + else this.s = temp.t; + }, + valueOf: function() { + return this.s; + } +}; + +var temp = new Adder; + +function add$1(adder, a, b) { + var x = adder.s = a + b, + bv = x - a, + av = x - bv; + adder.t = (a - av) + (b - bv); +} + +var epsilon$2 = 1e-6; +var epsilon2$1 = 1e-12; +var pi$3 = Math.PI; +var halfPi$2 = pi$3 / 2; +var quarterPi = pi$3 / 4; +var tau$3 = pi$3 * 2; + +var degrees$1 = 180 / pi$3; +var radians = pi$3 / 180; + +var abs = Math.abs; +var atan = Math.atan; +var atan2 = Math.atan2; +var cos$1 = Math.cos; +var ceil = Math.ceil; +var exp = Math.exp; + +var log = Math.log; +var pow = Math.pow; +var sin$1 = Math.sin; +var sign = Math.sign || function(x) { return x > 0 ? 1 : x < 0 ? -1 : 0; }; +var sqrt = Math.sqrt; +var tan = Math.tan; + +function acos(x) { + return x > 1 ? 0 : x < -1 ? pi$3 : Math.acos(x); +} + +function asin(x) { + return x > 1 ? halfPi$2 : x < -1 ? -halfPi$2 : Math.asin(x); +} + +function haversin(x) { + return (x = sin$1(x / 2)) * x; +} + +function noop$1() {} + +function streamGeometry(geometry, stream) { + if (geometry && streamGeometryType.hasOwnProperty(geometry.type)) { + streamGeometryType[geometry.type](geometry, stream); + } +} + +var streamObjectType = { + Feature: function(object, stream) { + streamGeometry(object.geometry, stream); + }, + FeatureCollection: function(object, stream) { + var features = object.features, i = -1, n = features.length; + while (++i < n) streamGeometry(features[i].geometry, stream); + } +}; + +var streamGeometryType = { + Sphere: function(object, stream) { + stream.sphere(); + }, + Point: function(object, stream) { + object = object.coordinates; + stream.point(object[0], object[1], object[2]); + }, + MultiPoint: function(object, stream) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) object = coordinates[i], stream.point(object[0], object[1], object[2]); + }, + LineString: function(object, stream) { + streamLine(object.coordinates, stream, 0); + }, + MultiLineString: function(object, stream) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) streamLine(coordinates[i], stream, 0); + }, + Polygon: function(object, stream) { + streamPolygon(object.coordinates, stream); + }, + MultiPolygon: function(object, stream) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) streamPolygon(coordinates[i], stream); + }, + GeometryCollection: function(object, stream) { + var geometries = object.geometries, i = -1, n = geometries.length; + while (++i < n) streamGeometry(geometries[i], stream); + } +}; + +function streamLine(coordinates, stream, closed) { + var i = -1, n = coordinates.length - closed, coordinate; + stream.lineStart(); + while (++i < n) coordinate = coordinates[i], stream.point(coordinate[0], coordinate[1], coordinate[2]); + stream.lineEnd(); +} + +function streamPolygon(coordinates, stream) { + var i = -1, n = coordinates.length; + stream.polygonStart(); + while (++i < n) streamLine(coordinates[i], stream, 1); + stream.polygonEnd(); +} + +function geoStream(object, stream) { + if (object && streamObjectType.hasOwnProperty(object.type)) { + streamObjectType[object.type](object, stream); + } else { + streamGeometry(object, stream); + } +} + +var areaRingSum = adder(); + +var areaSum = adder(); +var lambda00; +var phi00; +var lambda0; +var cosPhi0; +var sinPhi0; + +var areaStream = { + point: noop$1, + lineStart: noop$1, + lineEnd: noop$1, + polygonStart: function() { + areaRingSum.reset(); + areaStream.lineStart = areaRingStart; + areaStream.lineEnd = areaRingEnd; + }, + polygonEnd: function() { + var areaRing = +areaRingSum; + areaSum.add(areaRing < 0 ? tau$3 + areaRing : areaRing); + this.lineStart = this.lineEnd = this.point = noop$1; + }, + sphere: function() { + areaSum.add(tau$3); + } +}; + +function areaRingStart() { + areaStream.point = areaPointFirst; +} + +function areaRingEnd() { + areaPoint(lambda00, phi00); +} + +function areaPointFirst(lambda, phi) { + areaStream.point = areaPoint; + lambda00 = lambda, phi00 = phi; + lambda *= radians, phi *= radians; + lambda0 = lambda, cosPhi0 = cos$1(phi = phi / 2 + quarterPi), sinPhi0 = sin$1(phi); +} + +function areaPoint(lambda, phi) { + lambda *= radians, phi *= radians; + phi = phi / 2 + quarterPi; // half the angular distance from south pole + + // Spherical excess E for a spherical triangle with vertices: south pole, + // previous point, current point. Uses a formula derived from Cagnoli’s + // theorem. See Todhunter, Spherical Trig. (1871), Sec. 103, Eq. (2). + var dLambda = lambda - lambda0, + sdLambda = dLambda >= 0 ? 1 : -1, + adLambda = sdLambda * dLambda, + cosPhi = cos$1(phi), + sinPhi = sin$1(phi), + k = sinPhi0 * sinPhi, + u = cosPhi0 * cosPhi + k * cos$1(adLambda), + v = k * sdLambda * sin$1(adLambda); + areaRingSum.add(atan2(v, u)); + + // Advance the previous points. + lambda0 = lambda, cosPhi0 = cosPhi, sinPhi0 = sinPhi; +} + +function area(object) { + areaSum.reset(); + geoStream(object, areaStream); + return areaSum * 2; +} + +function spherical(cartesian) { + return [atan2(cartesian[1], cartesian[0]), asin(cartesian[2])]; +} + +function cartesian(spherical) { + var lambda = spherical[0], phi = spherical[1], cosPhi = cos$1(phi); + return [cosPhi * cos$1(lambda), cosPhi * sin$1(lambda), sin$1(phi)]; +} + +function cartesianDot(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2]; +} + +function cartesianCross(a, b) { + return [a[1] * b[2] - a[2] * b[1], a[2] * b[0] - a[0] * b[2], a[0] * b[1] - a[1] * b[0]]; +} + +// TODO return a +function cartesianAddInPlace(a, b) { + a[0] += b[0], a[1] += b[1], a[2] += b[2]; +} + +function cartesianScale(vector, k) { + return [vector[0] * k, vector[1] * k, vector[2] * k]; +} + +// TODO return d +function cartesianNormalizeInPlace(d) { + var l = sqrt(d[0] * d[0] + d[1] * d[1] + d[2] * d[2]); + d[0] /= l, d[1] /= l, d[2] /= l; +} + +var lambda0$1; +var phi0; +var lambda1; +var phi1; +var lambda2; +var lambda00$1; +var phi00$1; +var p0; +var deltaSum = adder(); +var ranges; +var range; + +var boundsStream = { + point: boundsPoint, + lineStart: boundsLineStart, + lineEnd: boundsLineEnd, + polygonStart: function() { + boundsStream.point = boundsRingPoint; + boundsStream.lineStart = boundsRingStart; + boundsStream.lineEnd = boundsRingEnd; + deltaSum.reset(); + areaStream.polygonStart(); + }, + polygonEnd: function() { + areaStream.polygonEnd(); + boundsStream.point = boundsPoint; + boundsStream.lineStart = boundsLineStart; + boundsStream.lineEnd = boundsLineEnd; + if (areaRingSum < 0) lambda0$1 = -(lambda1 = 180), phi0 = -(phi1 = 90); + else if (deltaSum > epsilon$2) phi1 = 90; + else if (deltaSum < -epsilon$2) phi0 = -90; + range[0] = lambda0$1, range[1] = lambda1; + } +}; + +function boundsPoint(lambda, phi) { + ranges.push(range = [lambda0$1 = lambda, lambda1 = lambda]); + if (phi < phi0) phi0 = phi; + if (phi > phi1) phi1 = phi; +} + +function linePoint(lambda, phi) { + var p = cartesian([lambda * radians, phi * radians]); + if (p0) { + var normal = cartesianCross(p0, p), + equatorial = [normal[1], -normal[0], 0], + inflection = cartesianCross(equatorial, normal); + cartesianNormalizeInPlace(inflection); + inflection = spherical(inflection); + var delta = lambda - lambda2, + sign$$1 = delta > 0 ? 1 : -1, + lambdai = inflection[0] * degrees$1 * sign$$1, + phii, + antimeridian = abs(delta) > 180; + if (antimeridian ^ (sign$$1 * lambda2 < lambdai && lambdai < sign$$1 * lambda)) { + phii = inflection[1] * degrees$1; + if (phii > phi1) phi1 = phii; + } else if (lambdai = (lambdai + 360) % 360 - 180, antimeridian ^ (sign$$1 * lambda2 < lambdai && lambdai < sign$$1 * lambda)) { + phii = -inflection[1] * degrees$1; + if (phii < phi0) phi0 = phii; + } else { + if (phi < phi0) phi0 = phi; + if (phi > phi1) phi1 = phi; + } + if (antimeridian) { + if (lambda < lambda2) { + if (angle(lambda0$1, lambda) > angle(lambda0$1, lambda1)) lambda1 = lambda; + } else { + if (angle(lambda, lambda1) > angle(lambda0$1, lambda1)) lambda0$1 = lambda; + } + } else { + if (lambda1 >= lambda0$1) { + if (lambda < lambda0$1) lambda0$1 = lambda; + if (lambda > lambda1) lambda1 = lambda; + } else { + if (lambda > lambda2) { + if (angle(lambda0$1, lambda) > angle(lambda0$1, lambda1)) lambda1 = lambda; + } else { + if (angle(lambda, lambda1) > angle(lambda0$1, lambda1)) lambda0$1 = lambda; + } + } + } + } else { + ranges.push(range = [lambda0$1 = lambda, lambda1 = lambda]); + } + if (phi < phi0) phi0 = phi; + if (phi > phi1) phi1 = phi; + p0 = p, lambda2 = lambda; +} + +function boundsLineStart() { + boundsStream.point = linePoint; +} + +function boundsLineEnd() { + range[0] = lambda0$1, range[1] = lambda1; + boundsStream.point = boundsPoint; + p0 = null; +} + +function boundsRingPoint(lambda, phi) { + if (p0) { + var delta = lambda - lambda2; + deltaSum.add(abs(delta) > 180 ? delta + (delta > 0 ? 360 : -360) : delta); + } else { + lambda00$1 = lambda, phi00$1 = phi; + } + areaStream.point(lambda, phi); + linePoint(lambda, phi); +} + +function boundsRingStart() { + areaStream.lineStart(); +} + +function boundsRingEnd() { + boundsRingPoint(lambda00$1, phi00$1); + areaStream.lineEnd(); + if (abs(deltaSum) > epsilon$2) lambda0$1 = -(lambda1 = 180); + range[0] = lambda0$1, range[1] = lambda1; + p0 = null; +} + +// Finds the left-right distance between two longitudes. +// This is almost the same as (lambda1 - lambda0 + 360°) % 360°, except that we want +// the distance between ±180° to be 360°. +function angle(lambda0, lambda1) { + return (lambda1 -= lambda0) < 0 ? lambda1 + 360 : lambda1; +} + +function rangeCompare(a, b) { + return a[0] - b[0]; +} + +function rangeContains(range, x) { + return range[0] <= range[1] ? range[0] <= x && x <= range[1] : x < range[0] || range[1] < x; +} + +function bounds(feature) { + var i, n, a, b, merged, deltaMax, delta; + + phi1 = lambda1 = -(lambda0$1 = phi0 = Infinity); + ranges = []; + geoStream(feature, boundsStream); + + // First, sort ranges by their minimum longitudes. + if (n = ranges.length) { + ranges.sort(rangeCompare); + + // Then, merge any ranges that overlap. + for (i = 1, a = ranges[0], merged = [a]; i < n; ++i) { + b = ranges[i]; + if (rangeContains(a, b[0]) || rangeContains(a, b[1])) { + if (angle(a[0], b[1]) > angle(a[0], a[1])) a[1] = b[1]; + if (angle(b[0], a[1]) > angle(a[0], a[1])) a[0] = b[0]; + } else { + merged.push(a = b); + } + } + + // Finally, find the largest gap between the merged ranges. + // The final bounding box will be the inverse of this gap. + for (deltaMax = -Infinity, n = merged.length - 1, i = 0, a = merged[n]; i <= n; a = b, ++i) { + b = merged[i]; + if ((delta = angle(a[1], b[0])) > deltaMax) deltaMax = delta, lambda0$1 = b[0], lambda1 = a[1]; + } + } + + ranges = range = null; + + return lambda0$1 === Infinity || phi0 === Infinity + ? [[NaN, NaN], [NaN, NaN]] + : [[lambda0$1, phi0], [lambda1, phi1]]; +} + +var W0; +var W1; +var X0; +var Y0; +var Z0; +var X1; +var Y1; +var Z1; +var X2; +var Y2; +var Z2; +var lambda00$2; +var phi00$2; +var x0; +var y0; +var z0; // previous point + +var centroidStream = { + sphere: noop$1, + point: centroidPoint, + lineStart: centroidLineStart, + lineEnd: centroidLineEnd, + polygonStart: function() { + centroidStream.lineStart = centroidRingStart; + centroidStream.lineEnd = centroidRingEnd; + }, + polygonEnd: function() { + centroidStream.lineStart = centroidLineStart; + centroidStream.lineEnd = centroidLineEnd; + } +}; + +// Arithmetic mean of Cartesian vectors. +function centroidPoint(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi); + centroidPointCartesian(cosPhi * cos$1(lambda), cosPhi * sin$1(lambda), sin$1(phi)); +} + +function centroidPointCartesian(x, y, z) { + ++W0; + X0 += (x - X0) / W0; + Y0 += (y - Y0) / W0; + Z0 += (z - Z0) / W0; +} + +function centroidLineStart() { + centroidStream.point = centroidLinePointFirst; +} + +function centroidLinePointFirst(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi); + x0 = cosPhi * cos$1(lambda); + y0 = cosPhi * sin$1(lambda); + z0 = sin$1(phi); + centroidStream.point = centroidLinePoint; + centroidPointCartesian(x0, y0, z0); +} + +function centroidLinePoint(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi), + x = cosPhi * cos$1(lambda), + y = cosPhi * sin$1(lambda), + z = sin$1(phi), + w = atan2(sqrt((w = y0 * z - z0 * y) * w + (w = z0 * x - x0 * z) * w + (w = x0 * y - y0 * x) * w), x0 * x + y0 * y + z0 * z); + W1 += w; + X1 += w * (x0 + (x0 = x)); + Y1 += w * (y0 + (y0 = y)); + Z1 += w * (z0 + (z0 = z)); + centroidPointCartesian(x0, y0, z0); +} + +function centroidLineEnd() { + centroidStream.point = centroidPoint; +} + +// See J. E. Brock, The Inertia Tensor for a Spherical Triangle, +// J. Applied Mechanics 42, 239 (1975). +function centroidRingStart() { + centroidStream.point = centroidRingPointFirst; +} + +function centroidRingEnd() { + centroidRingPoint(lambda00$2, phi00$2); + centroidStream.point = centroidPoint; +} + +function centroidRingPointFirst(lambda, phi) { + lambda00$2 = lambda, phi00$2 = phi; + lambda *= radians, phi *= radians; + centroidStream.point = centroidRingPoint; + var cosPhi = cos$1(phi); + x0 = cosPhi * cos$1(lambda); + y0 = cosPhi * sin$1(lambda); + z0 = sin$1(phi); + centroidPointCartesian(x0, y0, z0); +} + +function centroidRingPoint(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi), + x = cosPhi * cos$1(lambda), + y = cosPhi * sin$1(lambda), + z = sin$1(phi), + cx = y0 * z - z0 * y, + cy = z0 * x - x0 * z, + cz = x0 * y - y0 * x, + m = sqrt(cx * cx + cy * cy + cz * cz), + w = asin(m), // line weight = angle + v = m && -w / m; // area weight multiplier + X2 += v * cx; + Y2 += v * cy; + Z2 += v * cz; + W1 += w; + X1 += w * (x0 + (x0 = x)); + Y1 += w * (y0 + (y0 = y)); + Z1 += w * (z0 + (z0 = z)); + centroidPointCartesian(x0, y0, z0); +} + +function centroid(object) { + W0 = W1 = + X0 = Y0 = Z0 = + X1 = Y1 = Z1 = + X2 = Y2 = Z2 = 0; + geoStream(object, centroidStream); + + var x = X2, + y = Y2, + z = Z2, + m = x * x + y * y + z * z; + + // If the area-weighted ccentroid is undefined, fall back to length-weighted ccentroid. + if (m < epsilon2$1) { + x = X1, y = Y1, z = Z1; + // If the feature has zero length, fall back to arithmetic mean of point vectors. + if (W1 < epsilon$2) x = X0, y = Y0, z = Z0; + m = x * x + y * y + z * z; + // If the feature still has an undefined ccentroid, then return. + if (m < epsilon2$1) return [NaN, NaN]; + } + + return [atan2(y, x) * degrees$1, asin(z / sqrt(m)) * degrees$1]; +} + +function constant$7(x) { + return function() { + return x; + }; +} + +function compose(a, b) { + + function compose(x, y) { + return x = a(x, y), b(x[0], x[1]); + } + + if (a.invert && b.invert) compose.invert = function(x, y) { + return x = b.invert(x, y), x && a.invert(x[0], x[1]); + }; + + return compose; +} + +function rotationIdentity(lambda, phi) { + return [lambda > pi$3 ? lambda - tau$3 : lambda < -pi$3 ? lambda + tau$3 : lambda, phi]; +} + +rotationIdentity.invert = rotationIdentity; + +function rotateRadians(deltaLambda, deltaPhi, deltaGamma) { + return (deltaLambda %= tau$3) ? (deltaPhi || deltaGamma ? compose(rotationLambda(deltaLambda), rotationPhiGamma(deltaPhi, deltaGamma)) + : rotationLambda(deltaLambda)) + : (deltaPhi || deltaGamma ? rotationPhiGamma(deltaPhi, deltaGamma) + : rotationIdentity); +} + +function forwardRotationLambda(deltaLambda) { + return function(lambda, phi) { + return lambda += deltaLambda, [lambda > pi$3 ? lambda - tau$3 : lambda < -pi$3 ? lambda + tau$3 : lambda, phi]; + }; +} + +function rotationLambda(deltaLambda) { + var rotation = forwardRotationLambda(deltaLambda); + rotation.invert = forwardRotationLambda(-deltaLambda); + return rotation; +} + +function rotationPhiGamma(deltaPhi, deltaGamma) { + var cosDeltaPhi = cos$1(deltaPhi), + sinDeltaPhi = sin$1(deltaPhi), + cosDeltaGamma = cos$1(deltaGamma), + sinDeltaGamma = sin$1(deltaGamma); + + function rotation(lambda, phi) { + var cosPhi = cos$1(phi), + x = cos$1(lambda) * cosPhi, + y = sin$1(lambda) * cosPhi, + z = sin$1(phi), + k = z * cosDeltaPhi + x * sinDeltaPhi; + return [ + atan2(y * cosDeltaGamma - k * sinDeltaGamma, x * cosDeltaPhi - z * sinDeltaPhi), + asin(k * cosDeltaGamma + y * sinDeltaGamma) + ]; + } + + rotation.invert = function(lambda, phi) { + var cosPhi = cos$1(phi), + x = cos$1(lambda) * cosPhi, + y = sin$1(lambda) * cosPhi, + z = sin$1(phi), + k = z * cosDeltaGamma - y * sinDeltaGamma; + return [ + atan2(y * cosDeltaGamma + z * sinDeltaGamma, x * cosDeltaPhi + k * sinDeltaPhi), + asin(k * cosDeltaPhi - x * sinDeltaPhi) + ]; + }; + + return rotation; +} + +function rotation(rotate) { + rotate = rotateRadians(rotate[0] * radians, rotate[1] * radians, rotate.length > 2 ? rotate[2] * radians : 0); + + function forward(coordinates) { + coordinates = rotate(coordinates[0] * radians, coordinates[1] * radians); + return coordinates[0] *= degrees$1, coordinates[1] *= degrees$1, coordinates; + } + + forward.invert = function(coordinates) { + coordinates = rotate.invert(coordinates[0] * radians, coordinates[1] * radians); + return coordinates[0] *= degrees$1, coordinates[1] *= degrees$1, coordinates; + }; + + return forward; +} + +// Generates a circle centered at [0°, 0°], with a given radius and precision. +function circleStream(stream, radius, delta, direction, t0, t1) { + if (!delta) return; + var cosRadius = cos$1(radius), + sinRadius = sin$1(radius), + step = direction * delta; + if (t0 == null) { + t0 = radius + direction * tau$3; + t1 = radius - step / 2; + } else { + t0 = circleRadius(cosRadius, t0); + t1 = circleRadius(cosRadius, t1); + if (direction > 0 ? t0 < t1 : t0 > t1) t0 += direction * tau$3; + } + for (var point, t = t0; direction > 0 ? t > t1 : t < t1; t -= step) { + point = spherical([cosRadius, -sinRadius * cos$1(t), -sinRadius * sin$1(t)]); + stream.point(point[0], point[1]); + } +} + +// Returns the signed angle of a cartesian point relative to [cosRadius, 0, 0]. +function circleRadius(cosRadius, point) { + point = cartesian(point), point[0] -= cosRadius; + cartesianNormalizeInPlace(point); + var radius = acos(-point[1]); + return ((-point[2] < 0 ? -radius : radius) + tau$3 - epsilon$2) % tau$3; +} + +function circle() { + var center = constant$7([0, 0]), + radius = constant$7(90), + precision = constant$7(6), + ring, + rotate, + stream = {point: point}; + + function point(x, y) { + ring.push(x = rotate(x, y)); + x[0] *= degrees$1, x[1] *= degrees$1; + } + + function circle() { + var c = center.apply(this, arguments), + r = radius.apply(this, arguments) * radians, + p = precision.apply(this, arguments) * radians; + ring = []; + rotate = rotateRadians(-c[0] * radians, -c[1] * radians, 0).invert; + circleStream(stream, r, p, 1); + c = {type: "Polygon", coordinates: [ring]}; + ring = rotate = null; + return c; + } + + circle.center = function(_) { + return arguments.length ? (center = typeof _ === "function" ? _ : constant$7([+_[0], +_[1]]), circle) : center; + }; + + circle.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$7(+_), circle) : radius; + }; + + circle.precision = function(_) { + return arguments.length ? (precision = typeof _ === "function" ? _ : constant$7(+_), circle) : precision; + }; + + return circle; +} + +function clipBuffer() { + var lines = [], + line; + return { + point: function(x, y) { + line.push([x, y]); + }, + lineStart: function() { + lines.push(line = []); + }, + lineEnd: noop$1, + rejoin: function() { + if (lines.length > 1) lines.push(lines.pop().concat(lines.shift())); + }, + result: function() { + var result = lines; + lines = []; + line = null; + return result; + } + }; +} + +function pointEqual(a, b) { + return abs(a[0] - b[0]) < epsilon$2 && abs(a[1] - b[1]) < epsilon$2; +} + +function Intersection(point, points, other, entry) { + this.x = point; + this.z = points; + this.o = other; // another intersection + this.e = entry; // is an entry? + this.v = false; // visited + this.n = this.p = null; // next & previous +} + +// A generalized polygon clipping algorithm: given a polygon that has been cut +// into its visible line segments, and rejoins the segments by interpolating +// along the clip edge. +function clipRejoin(segments, compareIntersection, startInside, interpolate, stream) { + var subject = [], + clip = [], + i, + n; + + segments.forEach(function(segment) { + if ((n = segment.length - 1) <= 0) return; + var n, p0 = segment[0], p1 = segment[n], x; + + // If the first and last points of a segment are coincident, then treat as a + // closed ring. TODO if all rings are closed, then the winding order of the + // exterior ring should be checked. + if (pointEqual(p0, p1)) { + stream.lineStart(); + for (i = 0; i < n; ++i) stream.point((p0 = segment[i])[0], p0[1]); + stream.lineEnd(); + return; + } + + subject.push(x = new Intersection(p0, segment, null, true)); + clip.push(x.o = new Intersection(p0, null, x, false)); + subject.push(x = new Intersection(p1, segment, null, false)); + clip.push(x.o = new Intersection(p1, null, x, true)); + }); + + if (!subject.length) return; + + clip.sort(compareIntersection); + link$1(subject); + link$1(clip); + + for (i = 0, n = clip.length; i < n; ++i) { + clip[i].e = startInside = !startInside; + } + + var start = subject[0], + points, + point; + + while (1) { + // Find first unvisited intersection. + var current = start, + isSubject = true; + while (current.v) if ((current = current.n) === start) return; + points = current.z; + stream.lineStart(); + do { + current.v = current.o.v = true; + if (current.e) { + if (isSubject) { + for (i = 0, n = points.length; i < n; ++i) stream.point((point = points[i])[0], point[1]); + } else { + interpolate(current.x, current.n.x, 1, stream); + } + current = current.n; + } else { + if (isSubject) { + points = current.p.z; + for (i = points.length - 1; i >= 0; --i) stream.point((point = points[i])[0], point[1]); + } else { + interpolate(current.x, current.p.x, -1, stream); + } + current = current.p; + } + current = current.o; + points = current.z; + isSubject = !isSubject; + } while (!current.v); + stream.lineEnd(); + } +} + +function link$1(array) { + if (!(n = array.length)) return; + var n, + i = 0, + a = array[0], + b; + while (++i < n) { + a.n = b = array[i]; + b.p = a; + a = b; + } + a.n = b = array[0]; + b.p = a; +} + +var sum$1 = adder(); + +function polygonContains(polygon, point) { + var lambda = point[0], + phi = point[1], + normal = [sin$1(lambda), -cos$1(lambda), 0], + angle = 0, + winding = 0; + + sum$1.reset(); + + for (var i = 0, n = polygon.length; i < n; ++i) { + if (!(m = (ring = polygon[i]).length)) continue; + var ring, + m, + point0 = ring[m - 1], + lambda0 = point0[0], + phi0 = point0[1] / 2 + quarterPi, + sinPhi0 = sin$1(phi0), + cosPhi0 = cos$1(phi0); + + for (var j = 0; j < m; ++j, lambda0 = lambda1, sinPhi0 = sinPhi1, cosPhi0 = cosPhi1, point0 = point1) { + var point1 = ring[j], + lambda1 = point1[0], + phi1 = point1[1] / 2 + quarterPi, + sinPhi1 = sin$1(phi1), + cosPhi1 = cos$1(phi1), + delta = lambda1 - lambda0, + sign$$1 = delta >= 0 ? 1 : -1, + absDelta = sign$$1 * delta, + antimeridian = absDelta > pi$3, + k = sinPhi0 * sinPhi1; + + sum$1.add(atan2(k * sign$$1 * sin$1(absDelta), cosPhi0 * cosPhi1 + k * cos$1(absDelta))); + angle += antimeridian ? delta + sign$$1 * tau$3 : delta; + + // Are the longitudes either side of the point’s meridian (lambda), + // and are the latitudes smaller than the parallel (phi)? + if (antimeridian ^ lambda0 >= lambda ^ lambda1 >= lambda) { + var arc = cartesianCross(cartesian(point0), cartesian(point1)); + cartesianNormalizeInPlace(arc); + var intersection = cartesianCross(normal, arc); + cartesianNormalizeInPlace(intersection); + var phiArc = (antimeridian ^ delta >= 0 ? -1 : 1) * asin(intersection[2]); + if (phi > phiArc || phi === phiArc && (arc[0] || arc[1])) { + winding += antimeridian ^ delta >= 0 ? 1 : -1; + } + } + } + } + + // First, determine whether the South pole is inside or outside: + // + // It is inside if: + // * the polygon winds around it in a clockwise direction. + // * the polygon does not (cumulatively) wind around it, but has a negative + // (counter-clockwise) area. + // + // Second, count the (signed) number of times a segment crosses a lambda + // from the point to the South pole. If it is zero, then the point is the + // same side as the South pole. + + return (angle < -epsilon$2 || angle < epsilon$2 && sum$1 < -epsilon$2) ^ (winding & 1); +} + +function clip(pointVisible, clipLine, interpolate, start) { + return function(sink) { + var line = clipLine(sink), + ringBuffer = clipBuffer(), + ringSink = clipLine(ringBuffer), + polygonStarted = false, + polygon, + segments, + ring; + + var clip = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { + clip.point = pointRing; + clip.lineStart = ringStart; + clip.lineEnd = ringEnd; + segments = []; + polygon = []; + }, + polygonEnd: function() { + clip.point = point; + clip.lineStart = lineStart; + clip.lineEnd = lineEnd; + segments = merge(segments); + var startInside = polygonContains(polygon, start); + if (segments.length) { + if (!polygonStarted) sink.polygonStart(), polygonStarted = true; + clipRejoin(segments, compareIntersection, startInside, interpolate, sink); + } else if (startInside) { + if (!polygonStarted) sink.polygonStart(), polygonStarted = true; + sink.lineStart(); + interpolate(null, null, 1, sink); + sink.lineEnd(); + } + if (polygonStarted) sink.polygonEnd(), polygonStarted = false; + segments = polygon = null; + }, + sphere: function() { + sink.polygonStart(); + sink.lineStart(); + interpolate(null, null, 1, sink); + sink.lineEnd(); + sink.polygonEnd(); + } + }; + + function point(lambda, phi) { + if (pointVisible(lambda, phi)) sink.point(lambda, phi); + } + + function pointLine(lambda, phi) { + line.point(lambda, phi); + } + + function lineStart() { + clip.point = pointLine; + line.lineStart(); + } + + function lineEnd() { + clip.point = point; + line.lineEnd(); + } + + function pointRing(lambda, phi) { + ring.push([lambda, phi]); + ringSink.point(lambda, phi); + } + + function ringStart() { + ringSink.lineStart(); + ring = []; + } + + function ringEnd() { + pointRing(ring[0][0], ring[0][1]); + ringSink.lineEnd(); + + var clean = ringSink.clean(), + ringSegments = ringBuffer.result(), + i, n = ringSegments.length, m, + segment, + point; + + ring.pop(); + polygon.push(ring); + ring = null; + + if (!n) return; + + // No intersections. + if (clean & 1) { + segment = ringSegments[0]; + if ((m = segment.length - 1) > 0) { + if (!polygonStarted) sink.polygonStart(), polygonStarted = true; + sink.lineStart(); + for (i = 0; i < m; ++i) sink.point((point = segment[i])[0], point[1]); + sink.lineEnd(); + } + return; + } + + // Rejoin connected segments. + // TODO reuse ringBuffer.rejoin()? + if (n > 1 && clean & 2) ringSegments.push(ringSegments.pop().concat(ringSegments.shift())); + + segments.push(ringSegments.filter(validSegment)); + } + + return clip; + }; +} + +function validSegment(segment) { + return segment.length > 1; +} + +// Intersections are sorted along the clip edge. For both antimeridian cutting +// and circle clipping, the same comparison is used. +function compareIntersection(a, b) { + return ((a = a.x)[0] < 0 ? a[1] - halfPi$2 - epsilon$2 : halfPi$2 - a[1]) + - ((b = b.x)[0] < 0 ? b[1] - halfPi$2 - epsilon$2 : halfPi$2 - b[1]); +} + +var clipAntimeridian = clip( + function() { return true; }, + clipAntimeridianLine, + clipAntimeridianInterpolate, + [-pi$3, -halfPi$2] +); + +// Takes a line and cuts into visible segments. Return values: 0 - there were +// intersections or the line was empty; 1 - no intersections; 2 - there were +// intersections, and the first and last segments should be rejoined. +function clipAntimeridianLine(stream) { + var lambda0 = NaN, + phi0 = NaN, + sign0 = NaN, + clean; // no intersections + + return { + lineStart: function() { + stream.lineStart(); + clean = 1; + }, + point: function(lambda1, phi1) { + var sign1 = lambda1 > 0 ? pi$3 : -pi$3, + delta = abs(lambda1 - lambda0); + if (abs(delta - pi$3) < epsilon$2) { // line crosses a pole + stream.point(lambda0, phi0 = (phi0 + phi1) / 2 > 0 ? halfPi$2 : -halfPi$2); + stream.point(sign0, phi0); + stream.lineEnd(); + stream.lineStart(); + stream.point(sign1, phi0); + stream.point(lambda1, phi0); + clean = 0; + } else if (sign0 !== sign1 && delta >= pi$3) { // line crosses antimeridian + if (abs(lambda0 - sign0) < epsilon$2) lambda0 -= sign0 * epsilon$2; // handle degeneracies + if (abs(lambda1 - sign1) < epsilon$2) lambda1 -= sign1 * epsilon$2; + phi0 = clipAntimeridianIntersect(lambda0, phi0, lambda1, phi1); + stream.point(sign0, phi0); + stream.lineEnd(); + stream.lineStart(); + stream.point(sign1, phi0); + clean = 0; + } + stream.point(lambda0 = lambda1, phi0 = phi1); + sign0 = sign1; + }, + lineEnd: function() { + stream.lineEnd(); + lambda0 = phi0 = NaN; + }, + clean: function() { + return 2 - clean; // if intersections, rejoin first and last segments + } + }; +} + +function clipAntimeridianIntersect(lambda0, phi0, lambda1, phi1) { + var cosPhi0, + cosPhi1, + sinLambda0Lambda1 = sin$1(lambda0 - lambda1); + return abs(sinLambda0Lambda1) > epsilon$2 + ? atan((sin$1(phi0) * (cosPhi1 = cos$1(phi1)) * sin$1(lambda1) + - sin$1(phi1) * (cosPhi0 = cos$1(phi0)) * sin$1(lambda0)) + / (cosPhi0 * cosPhi1 * sinLambda0Lambda1)) + : (phi0 + phi1) / 2; +} + +function clipAntimeridianInterpolate(from, to, direction, stream) { + var phi; + if (from == null) { + phi = direction * halfPi$2; + stream.point(-pi$3, phi); + stream.point(0, phi); + stream.point(pi$3, phi); + stream.point(pi$3, 0); + stream.point(pi$3, -phi); + stream.point(0, -phi); + stream.point(-pi$3, -phi); + stream.point(-pi$3, 0); + stream.point(-pi$3, phi); + } else if (abs(from[0] - to[0]) > epsilon$2) { + var lambda = from[0] < to[0] ? pi$3 : -pi$3; + phi = direction * lambda / 2; + stream.point(-lambda, phi); + stream.point(0, phi); + stream.point(lambda, phi); + } else { + stream.point(to[0], to[1]); + } +} + +function clipCircle(radius) { + var cr = cos$1(radius), + delta = 6 * radians, + smallRadius = cr > 0, + notHemisphere = abs(cr) > epsilon$2; // TODO optimise for this common case + + function interpolate(from, to, direction, stream) { + circleStream(stream, radius, delta, direction, from, to); + } + + function visible(lambda, phi) { + return cos$1(lambda) * cos$1(phi) > cr; + } + + // Takes a line and cuts into visible segments. Return values used for polygon + // clipping: 0 - there were intersections or the line was empty; 1 - no + // intersections 2 - there were intersections, and the first and last segments + // should be rejoined. + function clipLine(stream) { + var point0, // previous point + c0, // code for previous point + v0, // visibility of previous point + v00, // visibility of first point + clean; // no intersections + return { + lineStart: function() { + v00 = v0 = false; + clean = 1; + }, + point: function(lambda, phi) { + var point1 = [lambda, phi], + point2, + v = visible(lambda, phi), + c = smallRadius + ? v ? 0 : code(lambda, phi) + : v ? code(lambda + (lambda < 0 ? pi$3 : -pi$3), phi) : 0; + if (!point0 && (v00 = v0 = v)) stream.lineStart(); + // Handle degeneracies. + // TODO ignore if not clipping polygons. + if (v !== v0) { + point2 = intersect(point0, point1); + if (!point2 || pointEqual(point0, point2) || pointEqual(point1, point2)) { + point1[0] += epsilon$2; + point1[1] += epsilon$2; + v = visible(point1[0], point1[1]); + } + } + if (v !== v0) { + clean = 0; + if (v) { + // outside going in + stream.lineStart(); + point2 = intersect(point1, point0); + stream.point(point2[0], point2[1]); + } else { + // inside going out + point2 = intersect(point0, point1); + stream.point(point2[0], point2[1]); + stream.lineEnd(); + } + point0 = point2; + } else if (notHemisphere && point0 && smallRadius ^ v) { + var t; + // If the codes for two points are different, or are both zero, + // and there this segment intersects with the small circle. + if (!(c & c0) && (t = intersect(point1, point0, true))) { + clean = 0; + if (smallRadius) { + stream.lineStart(); + stream.point(t[0][0], t[0][1]); + stream.point(t[1][0], t[1][1]); + stream.lineEnd(); + } else { + stream.point(t[1][0], t[1][1]); + stream.lineEnd(); + stream.lineStart(); + stream.point(t[0][0], t[0][1]); + } + } + } + if (v && (!point0 || !pointEqual(point0, point1))) { + stream.point(point1[0], point1[1]); + } + point0 = point1, v0 = v, c0 = c; + }, + lineEnd: function() { + if (v0) stream.lineEnd(); + point0 = null; + }, + // Rejoin first and last segments if there were intersections and the first + // and last points were visible. + clean: function() { + return clean | ((v00 && v0) << 1); + } + }; + } + + // Intersects the great circle between a and b with the clip circle. + function intersect(a, b, two) { + var pa = cartesian(a), + pb = cartesian(b); + + // We have two planes, n1.p = d1 and n2.p = d2. + // Find intersection line p(t) = c1 n1 + c2 n2 + t (n1 ⨯ n2). + var n1 = [1, 0, 0], // normal + n2 = cartesianCross(pa, pb), + n2n2 = cartesianDot(n2, n2), + n1n2 = n2[0], // cartesianDot(n1, n2), + determinant = n2n2 - n1n2 * n1n2; + + // Two polar points. + if (!determinant) return !two && a; + + var c1 = cr * n2n2 / determinant, + c2 = -cr * n1n2 / determinant, + n1xn2 = cartesianCross(n1, n2), + A = cartesianScale(n1, c1), + B = cartesianScale(n2, c2); + cartesianAddInPlace(A, B); + + // Solve |p(t)|^2 = 1. + var u = n1xn2, + w = cartesianDot(A, u), + uu = cartesianDot(u, u), + t2 = w * w - uu * (cartesianDot(A, A) - 1); + + if (t2 < 0) return; + + var t = sqrt(t2), + q = cartesianScale(u, (-w - t) / uu); + cartesianAddInPlace(q, A); + q = spherical(q); + + if (!two) return q; + + // Two intersection points. + var lambda0 = a[0], + lambda1 = b[0], + phi0 = a[1], + phi1 = b[1], + z; + + if (lambda1 < lambda0) z = lambda0, lambda0 = lambda1, lambda1 = z; + + var delta = lambda1 - lambda0, + polar = abs(delta - pi$3) < epsilon$2, + meridian = polar || delta < epsilon$2; + + if (!polar && phi1 < phi0) z = phi0, phi0 = phi1, phi1 = z; + + // Check that the first point is between a and b. + if (meridian + ? polar + ? phi0 + phi1 > 0 ^ q[1] < (abs(q[0] - lambda0) < epsilon$2 ? phi0 : phi1) + : phi0 <= q[1] && q[1] <= phi1 + : delta > pi$3 ^ (lambda0 <= q[0] && q[0] <= lambda1)) { + var q1 = cartesianScale(u, (-w + t) / uu); + cartesianAddInPlace(q1, A); + return [q, spherical(q1)]; + } + } + + // Generates a 4-bit vector representing the location of a point relative to + // the small circle's bounding box. + function code(lambda, phi) { + var r = smallRadius ? radius : pi$3 - radius, + code = 0; + if (lambda < -r) code |= 1; // left + else if (lambda > r) code |= 2; // right + if (phi < -r) code |= 4; // below + else if (phi > r) code |= 8; // above + return code; + } + + return clip(visible, clipLine, interpolate, smallRadius ? [0, -radius] : [-pi$3, radius - pi$3]); +} + +function clipLine(a, b, x0, y0, x1, y1) { + var ax = a[0], + ay = a[1], + bx = b[0], + by = b[1], + t0 = 0, + t1 = 1, + dx = bx - ax, + dy = by - ay, + r; + + r = x0 - ax; + if (!dx && r > 0) return; + r /= dx; + if (dx < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dx > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = x1 - ax; + if (!dx && r < 0) return; + r /= dx; + if (dx < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dx > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + r = y0 - ay; + if (!dy && r > 0) return; + r /= dy; + if (dy < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dy > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = y1 - ay; + if (!dy && r < 0) return; + r /= dy; + if (dy < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dy > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + if (t0 > 0) a[0] = ax + t0 * dx, a[1] = ay + t0 * dy; + if (t1 < 1) b[0] = ax + t1 * dx, b[1] = ay + t1 * dy; + return true; +} + +var clipMax = 1e9; +var clipMin = -clipMax; + +// TODO Use d3-polygon’s polygonContains here for the ring check? +// TODO Eliminate duplicate buffering in clipBuffer and polygon.push? + +function clipRectangle(x0, y0, x1, y1) { + + function visible(x, y) { + return x0 <= x && x <= x1 && y0 <= y && y <= y1; + } + + function interpolate(from, to, direction, stream) { + var a = 0, a1 = 0; + if (from == null + || (a = corner(from, direction)) !== (a1 = corner(to, direction)) + || comparePoint(from, to) < 0 ^ direction > 0) { + do stream.point(a === 0 || a === 3 ? x0 : x1, a > 1 ? y1 : y0); + while ((a = (a + direction + 4) % 4) !== a1); + } else { + stream.point(to[0], to[1]); + } + } + + function corner(p, direction) { + return abs(p[0] - x0) < epsilon$2 ? direction > 0 ? 0 : 3 + : abs(p[0] - x1) < epsilon$2 ? direction > 0 ? 2 : 1 + : abs(p[1] - y0) < epsilon$2 ? direction > 0 ? 1 : 0 + : direction > 0 ? 3 : 2; // abs(p[1] - y1) < epsilon + } + + function compareIntersection(a, b) { + return comparePoint(a.x, b.x); + } + + function comparePoint(a, b) { + var ca = corner(a, 1), + cb = corner(b, 1); + return ca !== cb ? ca - cb + : ca === 0 ? b[1] - a[1] + : ca === 1 ? a[0] - b[0] + : ca === 2 ? a[1] - b[1] + : b[0] - a[0]; + } + + return function(stream) { + var activeStream = stream, + bufferStream = clipBuffer(), + segments, + polygon, + ring, + x__, y__, v__, // first point + x_, y_, v_, // previous point + first, + clean; + + var clipStream = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: polygonStart, + polygonEnd: polygonEnd + }; + + function point(x, y) { + if (visible(x, y)) activeStream.point(x, y); + } + + function polygonInside() { + var winding = 0; + + for (var i = 0, n = polygon.length; i < n; ++i) { + for (var ring = polygon[i], j = 1, m = ring.length, point = ring[0], a0, a1, b0 = point[0], b1 = point[1]; j < m; ++j) { + a0 = b0, a1 = b1, point = ring[j], b0 = point[0], b1 = point[1]; + if (a1 <= y1) { if (b1 > y1 && (b0 - a0) * (y1 - a1) > (b1 - a1) * (x0 - a0)) ++winding; } + else { if (b1 <= y1 && (b0 - a0) * (y1 - a1) < (b1 - a1) * (x0 - a0)) --winding; } + } + } + + return winding; + } + + // Buffer geometry within a polygon and then clip it en masse. + function polygonStart() { + activeStream = bufferStream, segments = [], polygon = [], clean = true; + } + + function polygonEnd() { + var startInside = polygonInside(), + cleanInside = clean && startInside, + visible = (segments = merge(segments)).length; + if (cleanInside || visible) { + stream.polygonStart(); + if (cleanInside) { + stream.lineStart(); + interpolate(null, null, 1, stream); + stream.lineEnd(); + } + if (visible) { + clipRejoin(segments, compareIntersection, startInside, interpolate, stream); + } + stream.polygonEnd(); + } + activeStream = stream, segments = polygon = ring = null; + } + + function lineStart() { + clipStream.point = linePoint; + if (polygon) polygon.push(ring = []); + first = true; + v_ = false; + x_ = y_ = NaN; + } + + // TODO rather than special-case polygons, simply handle them separately. + // Ideally, coincident intersection points should be jittered to avoid + // clipping issues. + function lineEnd() { + if (segments) { + linePoint(x__, y__); + if (v__ && v_) bufferStream.rejoin(); + segments.push(bufferStream.result()); + } + clipStream.point = point; + if (v_) activeStream.lineEnd(); + } + + function linePoint(x, y) { + var v = visible(x, y); + if (polygon) ring.push([x, y]); + if (first) { + x__ = x, y__ = y, v__ = v; + first = false; + if (v) { + activeStream.lineStart(); + activeStream.point(x, y); + } + } else { + if (v && v_) activeStream.point(x, y); + else { + var a = [x_ = Math.max(clipMin, Math.min(clipMax, x_)), y_ = Math.max(clipMin, Math.min(clipMax, y_))], + b = [x = Math.max(clipMin, Math.min(clipMax, x)), y = Math.max(clipMin, Math.min(clipMax, y))]; + if (clipLine(a, b, x0, y0, x1, y1)) { + if (!v_) { + activeStream.lineStart(); + activeStream.point(a[0], a[1]); + } + activeStream.point(b[0], b[1]); + if (!v) activeStream.lineEnd(); + clean = false; + } else if (v) { + activeStream.lineStart(); + activeStream.point(x, y); + clean = false; + } + } + } + x_ = x, y_ = y, v_ = v; + } + + return clipStream; + }; +} + +function extent$1() { + var x0 = 0, + y0 = 0, + x1 = 960, + y1 = 500, + cache, + cacheStream, + clip; + + return clip = { + stream: function(stream) { + return cache && cacheStream === stream ? cache : cache = clipRectangle(x0, y0, x1, y1)(cacheStream = stream); + }, + extent: function(_) { + return arguments.length ? (x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1], cache = cacheStream = null, clip) : [[x0, y0], [x1, y1]]; + } + }; +} + +var lengthSum = adder(); +var lambda0$2; +var sinPhi0$1; +var cosPhi0$1; + +var lengthStream = { + sphere: noop$1, + point: noop$1, + lineStart: lengthLineStart, + lineEnd: noop$1, + polygonStart: noop$1, + polygonEnd: noop$1 +}; + +function lengthLineStart() { + lengthStream.point = lengthPointFirst; + lengthStream.lineEnd = lengthLineEnd; +} + +function lengthLineEnd() { + lengthStream.point = lengthStream.lineEnd = noop$1; +} + +function lengthPointFirst(lambda, phi) { + lambda *= radians, phi *= radians; + lambda0$2 = lambda, sinPhi0$1 = sin$1(phi), cosPhi0$1 = cos$1(phi); + lengthStream.point = lengthPoint; +} + +function lengthPoint(lambda, phi) { + lambda *= radians, phi *= radians; + var sinPhi = sin$1(phi), + cosPhi = cos$1(phi), + delta = abs(lambda - lambda0$2), + cosDelta = cos$1(delta), + sinDelta = sin$1(delta), + x = cosPhi * sinDelta, + y = cosPhi0$1 * sinPhi - sinPhi0$1 * cosPhi * cosDelta, + z = sinPhi0$1 * sinPhi + cosPhi0$1 * cosPhi * cosDelta; + lengthSum.add(atan2(sqrt(x * x + y * y), z)); + lambda0$2 = lambda, sinPhi0$1 = sinPhi, cosPhi0$1 = cosPhi; +} + +function length$1(object) { + lengthSum.reset(); + geoStream(object, lengthStream); + return +lengthSum; +} + +var coordinates = [null, null]; +var object$1 = {type: "LineString", coordinates: coordinates}; + +function distance(a, b) { + coordinates[0] = a; + coordinates[1] = b; + return length$1(object$1); +} + +var containsObjectType = { + Feature: function(object, point) { + return containsGeometry(object.geometry, point); + }, + FeatureCollection: function(object, point) { + var features = object.features, i = -1, n = features.length; + while (++i < n) if (containsGeometry(features[i].geometry, point)) return true; + return false; + } +}; + +var containsGeometryType = { + Sphere: function() { + return true; + }, + Point: function(object, point) { + return containsPoint(object.coordinates, point); + }, + MultiPoint: function(object, point) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) if (containsPoint(coordinates[i], point)) return true; + return false; + }, + LineString: function(object, point) { + return containsLine(object.coordinates, point); + }, + MultiLineString: function(object, point) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) if (containsLine(coordinates[i], point)) return true; + return false; + }, + Polygon: function(object, point) { + return containsPolygon(object.coordinates, point); + }, + MultiPolygon: function(object, point) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) if (containsPolygon(coordinates[i], point)) return true; + return false; + }, + GeometryCollection: function(object, point) { + var geometries = object.geometries, i = -1, n = geometries.length; + while (++i < n) if (containsGeometry(geometries[i], point)) return true; + return false; + } +}; + +function containsGeometry(geometry, point) { + return geometry && containsGeometryType.hasOwnProperty(geometry.type) + ? containsGeometryType[geometry.type](geometry, point) + : false; +} + +function containsPoint(coordinates, point) { + return distance(coordinates, point) === 0; +} + +function containsLine(coordinates, point) { + var ab = distance(coordinates[0], coordinates[1]), + ao = distance(coordinates[0], point), + ob = distance(point, coordinates[1]); + return ao + ob <= ab + epsilon$2; +} + +function containsPolygon(coordinates, point) { + return !!polygonContains(coordinates.map(ringRadians), pointRadians(point)); +} + +function ringRadians(ring) { + return ring = ring.map(pointRadians), ring.pop(), ring; +} + +function pointRadians(point) { + return [point[0] * radians, point[1] * radians]; +} + +function contains(object, point) { + return (object && containsObjectType.hasOwnProperty(object.type) + ? containsObjectType[object.type] + : containsGeometry)(object, point); +} + +function graticuleX(y0, y1, dy) { + var y = sequence(y0, y1 - epsilon$2, dy).concat(y1); + return function(x) { return y.map(function(y) { return [x, y]; }); }; +} + +function graticuleY(x0, x1, dx) { + var x = sequence(x0, x1 - epsilon$2, dx).concat(x1); + return function(y) { return x.map(function(x) { return [x, y]; }); }; +} + +function graticule() { + var x1, x0, X1, X0, + y1, y0, Y1, Y0, + dx = 10, dy = dx, DX = 90, DY = 360, + x, y, X, Y, + precision = 2.5; + + function graticule() { + return {type: "MultiLineString", coordinates: lines()}; + } + + function lines() { + return sequence(ceil(X0 / DX) * DX, X1, DX).map(X) + .concat(sequence(ceil(Y0 / DY) * DY, Y1, DY).map(Y)) + .concat(sequence(ceil(x0 / dx) * dx, x1, dx).filter(function(x) { return abs(x % DX) > epsilon$2; }).map(x)) + .concat(sequence(ceil(y0 / dy) * dy, y1, dy).filter(function(y) { return abs(y % DY) > epsilon$2; }).map(y)); + } + + graticule.lines = function() { + return lines().map(function(coordinates) { return {type: "LineString", coordinates: coordinates}; }); + }; + + graticule.outline = function() { + return { + type: "Polygon", + coordinates: [ + X(X0).concat( + Y(Y1).slice(1), + X(X1).reverse().slice(1), + Y(Y0).reverse().slice(1)) + ] + }; + }; + + graticule.extent = function(_) { + if (!arguments.length) return graticule.extentMinor(); + return graticule.extentMajor(_).extentMinor(_); + }; + + graticule.extentMajor = function(_) { + if (!arguments.length) return [[X0, Y0], [X1, Y1]]; + X0 = +_[0][0], X1 = +_[1][0]; + Y0 = +_[0][1], Y1 = +_[1][1]; + if (X0 > X1) _ = X0, X0 = X1, X1 = _; + if (Y0 > Y1) _ = Y0, Y0 = Y1, Y1 = _; + return graticule.precision(precision); + }; + + graticule.extentMinor = function(_) { + if (!arguments.length) return [[x0, y0], [x1, y1]]; + x0 = +_[0][0], x1 = +_[1][0]; + y0 = +_[0][1], y1 = +_[1][1]; + if (x0 > x1) _ = x0, x0 = x1, x1 = _; + if (y0 > y1) _ = y0, y0 = y1, y1 = _; + return graticule.precision(precision); + }; + + graticule.step = function(_) { + if (!arguments.length) return graticule.stepMinor(); + return graticule.stepMajor(_).stepMinor(_); + }; + + graticule.stepMajor = function(_) { + if (!arguments.length) return [DX, DY]; + DX = +_[0], DY = +_[1]; + return graticule; + }; + + graticule.stepMinor = function(_) { + if (!arguments.length) return [dx, dy]; + dx = +_[0], dy = +_[1]; + return graticule; + }; + + graticule.precision = function(_) { + if (!arguments.length) return precision; + precision = +_; + x = graticuleX(y0, y1, 90); + y = graticuleY(x0, x1, precision); + X = graticuleX(Y0, Y1, 90); + Y = graticuleY(X0, X1, precision); + return graticule; + }; + + return graticule + .extentMajor([[-180, -90 + epsilon$2], [180, 90 - epsilon$2]]) + .extentMinor([[-180, -80 - epsilon$2], [180, 80 + epsilon$2]]); +} + +function graticule10() { + return graticule()(); +} + +function interpolate$1(a, b) { + var x0 = a[0] * radians, + y0 = a[1] * radians, + x1 = b[0] * radians, + y1 = b[1] * radians, + cy0 = cos$1(y0), + sy0 = sin$1(y0), + cy1 = cos$1(y1), + sy1 = sin$1(y1), + kx0 = cy0 * cos$1(x0), + ky0 = cy0 * sin$1(x0), + kx1 = cy1 * cos$1(x1), + ky1 = cy1 * sin$1(x1), + d = 2 * asin(sqrt(haversin(y1 - y0) + cy0 * cy1 * haversin(x1 - x0))), + k = sin$1(d); + + var interpolate = d ? function(t) { + var B = sin$1(t *= d) / k, + A = sin$1(d - t) / k, + x = A * kx0 + B * kx1, + y = A * ky0 + B * ky1, + z = A * sy0 + B * sy1; + return [ + atan2(y, x) * degrees$1, + atan2(z, sqrt(x * x + y * y)) * degrees$1 + ]; + } : function() { + return [x0 * degrees$1, y0 * degrees$1]; + }; + + interpolate.distance = d; + + return interpolate; +} + +function identity$4(x) { + return x; +} + +var areaSum$1 = adder(); +var areaRingSum$1 = adder(); +var x00; +var y00; +var x0$1; +var y0$1; + +var areaStream$1 = { + point: noop$1, + lineStart: noop$1, + lineEnd: noop$1, + polygonStart: function() { + areaStream$1.lineStart = areaRingStart$1; + areaStream$1.lineEnd = areaRingEnd$1; + }, + polygonEnd: function() { + areaStream$1.lineStart = areaStream$1.lineEnd = areaStream$1.point = noop$1; + areaSum$1.add(abs(areaRingSum$1)); + areaRingSum$1.reset(); + }, + result: function() { + var area = areaSum$1 / 2; + areaSum$1.reset(); + return area; + } +}; + +function areaRingStart$1() { + areaStream$1.point = areaPointFirst$1; +} + +function areaPointFirst$1(x, y) { + areaStream$1.point = areaPoint$1; + x00 = x0$1 = x, y00 = y0$1 = y; +} + +function areaPoint$1(x, y) { + areaRingSum$1.add(y0$1 * x - x0$1 * y); + x0$1 = x, y0$1 = y; +} + +function areaRingEnd$1() { + areaPoint$1(x00, y00); +} + +var x0$2 = Infinity; +var y0$2 = x0$2; +var x1 = -x0$2; +var y1 = x1; + +var boundsStream$1 = { + point: boundsPoint$1, + lineStart: noop$1, + lineEnd: noop$1, + polygonStart: noop$1, + polygonEnd: noop$1, + result: function() { + var bounds = [[x0$2, y0$2], [x1, y1]]; + x1 = y1 = -(y0$2 = x0$2 = Infinity); + return bounds; + } +}; + +function boundsPoint$1(x, y) { + if (x < x0$2) x0$2 = x; + if (x > x1) x1 = x; + if (y < y0$2) y0$2 = y; + if (y > y1) y1 = y; +} + +// TODO Enforce positive area for exterior, negative area for interior? + +var X0$1 = 0; +var Y0$1 = 0; +var Z0$1 = 0; +var X1$1 = 0; +var Y1$1 = 0; +var Z1$1 = 0; +var X2$1 = 0; +var Y2$1 = 0; +var Z2$1 = 0; +var x00$1; +var y00$1; +var x0$3; +var y0$3; + +var centroidStream$1 = { + point: centroidPoint$1, + lineStart: centroidLineStart$1, + lineEnd: centroidLineEnd$1, + polygonStart: function() { + centroidStream$1.lineStart = centroidRingStart$1; + centroidStream$1.lineEnd = centroidRingEnd$1; + }, + polygonEnd: function() { + centroidStream$1.point = centroidPoint$1; + centroidStream$1.lineStart = centroidLineStart$1; + centroidStream$1.lineEnd = centroidLineEnd$1; + }, + result: function() { + var centroid = Z2$1 ? [X2$1 / Z2$1, Y2$1 / Z2$1] + : Z1$1 ? [X1$1 / Z1$1, Y1$1 / Z1$1] + : Z0$1 ? [X0$1 / Z0$1, Y0$1 / Z0$1] + : [NaN, NaN]; + X0$1 = Y0$1 = Z0$1 = + X1$1 = Y1$1 = Z1$1 = + X2$1 = Y2$1 = Z2$1 = 0; + return centroid; + } +}; + +function centroidPoint$1(x, y) { + X0$1 += x; + Y0$1 += y; + ++Z0$1; +} + +function centroidLineStart$1() { + centroidStream$1.point = centroidPointFirstLine; +} + +function centroidPointFirstLine(x, y) { + centroidStream$1.point = centroidPointLine; + centroidPoint$1(x0$3 = x, y0$3 = y); +} + +function centroidPointLine(x, y) { + var dx = x - x0$3, dy = y - y0$3, z = sqrt(dx * dx + dy * dy); + X1$1 += z * (x0$3 + x) / 2; + Y1$1 += z * (y0$3 + y) / 2; + Z1$1 += z; + centroidPoint$1(x0$3 = x, y0$3 = y); +} + +function centroidLineEnd$1() { + centroidStream$1.point = centroidPoint$1; +} + +function centroidRingStart$1() { + centroidStream$1.point = centroidPointFirstRing; +} + +function centroidRingEnd$1() { + centroidPointRing(x00$1, y00$1); +} + +function centroidPointFirstRing(x, y) { + centroidStream$1.point = centroidPointRing; + centroidPoint$1(x00$1 = x0$3 = x, y00$1 = y0$3 = y); +} + +function centroidPointRing(x, y) { + var dx = x - x0$3, + dy = y - y0$3, + z = sqrt(dx * dx + dy * dy); + + X1$1 += z * (x0$3 + x) / 2; + Y1$1 += z * (y0$3 + y) / 2; + Z1$1 += z; + + z = y0$3 * x - x0$3 * y; + X2$1 += z * (x0$3 + x); + Y2$1 += z * (y0$3 + y); + Z2$1 += z * 3; + centroidPoint$1(x0$3 = x, y0$3 = y); +} + +function PathContext(context) { + this._context = context; +} + +PathContext.prototype = { + _radius: 4.5, + pointRadius: function(_) { + return this._radius = _, this; + }, + polygonStart: function() { + this._line = 0; + }, + polygonEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._line === 0) this._context.closePath(); + this._point = NaN; + }, + point: function(x, y) { + switch (this._point) { + case 0: { + this._context.moveTo(x, y); + this._point = 1; + break; + } + case 1: { + this._context.lineTo(x, y); + break; + } + default: { + this._context.moveTo(x + this._radius, y); + this._context.arc(x, y, this._radius, 0, tau$3); + break; + } + } + }, + result: noop$1 +}; + +var lengthSum$1 = adder(); +var lengthRing; +var x00$2; +var y00$2; +var x0$4; +var y0$4; + +var lengthStream$1 = { + point: noop$1, + lineStart: function() { + lengthStream$1.point = lengthPointFirst$1; + }, + lineEnd: function() { + if (lengthRing) lengthPoint$1(x00$2, y00$2); + lengthStream$1.point = noop$1; + }, + polygonStart: function() { + lengthRing = true; + }, + polygonEnd: function() { + lengthRing = null; + }, + result: function() { + var length = +lengthSum$1; + lengthSum$1.reset(); + return length; + } +}; + +function lengthPointFirst$1(x, y) { + lengthStream$1.point = lengthPoint$1; + x00$2 = x0$4 = x, y00$2 = y0$4 = y; +} + +function lengthPoint$1(x, y) { + x0$4 -= x, y0$4 -= y; + lengthSum$1.add(sqrt(x0$4 * x0$4 + y0$4 * y0$4)); + x0$4 = x, y0$4 = y; +} + +function PathString() { + this._string = []; +} + +PathString.prototype = { + _radius: 4.5, + _circle: circle$1(4.5), + pointRadius: function(_) { + if ((_ = +_) !== this._radius) this._radius = _, this._circle = null; + return this; + }, + polygonStart: function() { + this._line = 0; + }, + polygonEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._line === 0) this._string.push("Z"); + this._point = NaN; + }, + point: function(x, y) { + switch (this._point) { + case 0: { + this._string.push("M", x, ",", y); + this._point = 1; + break; + } + case 1: { + this._string.push("L", x, ",", y); + break; + } + default: { + if (this._circle == null) this._circle = circle$1(this._radius); + this._string.push("M", x, ",", y, this._circle); + break; + } + } + }, + result: function() { + if (this._string.length) { + var result = this._string.join(""); + this._string = []; + return result; + } else { + return null; + } + } +}; + +function circle$1(radius) { + return "m0," + radius + + "a" + radius + "," + radius + " 0 1,1 0," + -2 * radius + + "a" + radius + "," + radius + " 0 1,1 0," + 2 * radius + + "z"; +} + +function index$1(projection, context) { + var pointRadius = 4.5, + projectionStream, + contextStream; + + function path(object) { + if (object) { + if (typeof pointRadius === "function") contextStream.pointRadius(+pointRadius.apply(this, arguments)); + geoStream(object, projectionStream(contextStream)); + } + return contextStream.result(); + } + + path.area = function(object) { + geoStream(object, projectionStream(areaStream$1)); + return areaStream$1.result(); + }; + + path.measure = function(object) { + geoStream(object, projectionStream(lengthStream$1)); + return lengthStream$1.result(); + }; + + path.bounds = function(object) { + geoStream(object, projectionStream(boundsStream$1)); + return boundsStream$1.result(); + }; + + path.centroid = function(object) { + geoStream(object, projectionStream(centroidStream$1)); + return centroidStream$1.result(); + }; + + path.projection = function(_) { + return arguments.length ? (projectionStream = _ == null ? (projection = null, identity$4) : (projection = _).stream, path) : projection; + }; + + path.context = function(_) { + if (!arguments.length) return context; + contextStream = _ == null ? (context = null, new PathString) : new PathContext(context = _); + if (typeof pointRadius !== "function") contextStream.pointRadius(pointRadius); + return path; + }; + + path.pointRadius = function(_) { + if (!arguments.length) return pointRadius; + pointRadius = typeof _ === "function" ? _ : (contextStream.pointRadius(+_), +_); + return path; + }; + + return path.projection(projection).context(context); +} + +function transform(methods) { + return { + stream: transformer(methods) + }; +} + +function transformer(methods) { + return function(stream) { + var s = new TransformStream; + for (var key in methods) s[key] = methods[key]; + s.stream = stream; + return s; + }; +} + +function TransformStream() {} + +TransformStream.prototype = { + constructor: TransformStream, + point: function(x, y) { this.stream.point(x, y); }, + sphere: function() { this.stream.sphere(); }, + lineStart: function() { this.stream.lineStart(); }, + lineEnd: function() { this.stream.lineEnd(); }, + polygonStart: function() { this.stream.polygonStart(); }, + polygonEnd: function() { this.stream.polygonEnd(); } +}; + +function fit(projection, fitBounds, object) { + var clip = projection.clipExtent && projection.clipExtent(); + projection.scale(150).translate([0, 0]); + if (clip != null) projection.clipExtent(null); + geoStream(object, projection.stream(boundsStream$1)); + fitBounds(boundsStream$1.result()); + if (clip != null) projection.clipExtent(clip); + return projection; +} + +function fitExtent(projection, extent, object) { + return fit(projection, function(b) { + var w = extent[1][0] - extent[0][0], + h = extent[1][1] - extent[0][1], + k = Math.min(w / (b[1][0] - b[0][0]), h / (b[1][1] - b[0][1])), + x = +extent[0][0] + (w - k * (b[1][0] + b[0][0])) / 2, + y = +extent[0][1] + (h - k * (b[1][1] + b[0][1])) / 2; + projection.scale(150 * k).translate([x, y]); + }, object); +} + +function fitSize(projection, size, object) { + return fitExtent(projection, [[0, 0], size], object); +} + +function fitWidth(projection, width, object) { + return fit(projection, function(b) { + var w = +width, + k = w / (b[1][0] - b[0][0]), + x = (w - k * (b[1][0] + b[0][0])) / 2, + y = -k * b[0][1]; + projection.scale(150 * k).translate([x, y]); + }, object); +} + +function fitHeight(projection, height, object) { + return fit(projection, function(b) { + var h = +height, + k = h / (b[1][1] - b[0][1]), + x = -k * b[0][0], + y = (h - k * (b[1][1] + b[0][1])) / 2; + projection.scale(150 * k).translate([x, y]); + }, object); +} + +var maxDepth = 16; +var cosMinDistance = cos$1(30 * radians); // cos(minimum angular distance) + +function resample(project, delta2) { + return +delta2 ? resample$1(project, delta2) : resampleNone(project); +} + +function resampleNone(project) { + return transformer({ + point: function(x, y) { + x = project(x, y); + this.stream.point(x[0], x[1]); + } + }); +} + +function resample$1(project, delta2) { + + function resampleLineTo(x0, y0, lambda0, a0, b0, c0, x1, y1, lambda1, a1, b1, c1, depth, stream) { + var dx = x1 - x0, + dy = y1 - y0, + d2 = dx * dx + dy * dy; + if (d2 > 4 * delta2 && depth--) { + var a = a0 + a1, + b = b0 + b1, + c = c0 + c1, + m = sqrt(a * a + b * b + c * c), + phi2 = asin(c /= m), + lambda2 = abs(abs(c) - 1) < epsilon$2 || abs(lambda0 - lambda1) < epsilon$2 ? (lambda0 + lambda1) / 2 : atan2(b, a), + p = project(lambda2, phi2), + x2 = p[0], + y2 = p[1], + dx2 = x2 - x0, + dy2 = y2 - y0, + dz = dy * dx2 - dx * dy2; + if (dz * dz / d2 > delta2 // perpendicular projected distance + || abs((dx * dx2 + dy * dy2) / d2 - 0.5) > 0.3 // midpoint close to an end + || a0 * a1 + b0 * b1 + c0 * c1 < cosMinDistance) { // angular distance + resampleLineTo(x0, y0, lambda0, a0, b0, c0, x2, y2, lambda2, a /= m, b /= m, c, depth, stream); + stream.point(x2, y2); + resampleLineTo(x2, y2, lambda2, a, b, c, x1, y1, lambda1, a1, b1, c1, depth, stream); + } + } + } + return function(stream) { + var lambda00, x00, y00, a00, b00, c00, // first point + lambda0, x0, y0, a0, b0, c0; // previous point + + var resampleStream = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { stream.polygonStart(); resampleStream.lineStart = ringStart; }, + polygonEnd: function() { stream.polygonEnd(); resampleStream.lineStart = lineStart; } + }; + + function point(x, y) { + x = project(x, y); + stream.point(x[0], x[1]); + } + + function lineStart() { + x0 = NaN; + resampleStream.point = linePoint; + stream.lineStart(); + } + + function linePoint(lambda, phi) { + var c = cartesian([lambda, phi]), p = project(lambda, phi); + resampleLineTo(x0, y0, lambda0, a0, b0, c0, x0 = p[0], y0 = p[1], lambda0 = lambda, a0 = c[0], b0 = c[1], c0 = c[2], maxDepth, stream); + stream.point(x0, y0); + } + + function lineEnd() { + resampleStream.point = point; + stream.lineEnd(); + } + + function ringStart() { + lineStart(); + resampleStream.point = ringPoint; + resampleStream.lineEnd = ringEnd; + } + + function ringPoint(lambda, phi) { + linePoint(lambda00 = lambda, phi), x00 = x0, y00 = y0, a00 = a0, b00 = b0, c00 = c0; + resampleStream.point = linePoint; + } + + function ringEnd() { + resampleLineTo(x0, y0, lambda0, a0, b0, c0, x00, y00, lambda00, a00, b00, c00, maxDepth, stream); + resampleStream.lineEnd = lineEnd; + lineEnd(); + } + + return resampleStream; + }; +} + +var transformRadians = transformer({ + point: function(x, y) { + this.stream.point(x * radians, y * radians); + } +}); + +function transformRotate(rotate) { + return transformer({ + point: function(x, y) { + var r = rotate(x, y); + return this.stream.point(r[0], r[1]); + } + }); +} + +function projection(project) { + return projectionMutator(function() { return project; })(); +} + +function projectionMutator(projectAt) { + var project, + k = 150, // scale + x = 480, y = 250, // translate + dx, dy, lambda = 0, phi = 0, // center + deltaLambda = 0, deltaPhi = 0, deltaGamma = 0, rotate, projectRotate, // rotate + theta = null, preclip = clipAntimeridian, // clip angle + x0 = null, y0, x1, y1, postclip = identity$4, // clip extent + delta2 = 0.5, projectResample = resample(projectTransform, delta2), // precision + cache, + cacheStream; + + function projection(point) { + point = projectRotate(point[0] * radians, point[1] * radians); + return [point[0] * k + dx, dy - point[1] * k]; + } + + function invert(point) { + point = projectRotate.invert((point[0] - dx) / k, (dy - point[1]) / k); + return point && [point[0] * degrees$1, point[1] * degrees$1]; + } + + function projectTransform(x, y) { + return x = project(x, y), [x[0] * k + dx, dy - x[1] * k]; + } + + projection.stream = function(stream) { + return cache && cacheStream === stream ? cache : cache = transformRadians(transformRotate(rotate)(preclip(projectResample(postclip(cacheStream = stream))))); + }; + + projection.preclip = function(_) { + return arguments.length ? (preclip = _, theta = undefined, reset()) : preclip; + }; + + projection.postclip = function(_) { + return arguments.length ? (postclip = _, x0 = y0 = x1 = y1 = null, reset()) : postclip; + }; + + projection.clipAngle = function(_) { + return arguments.length ? (preclip = +_ ? clipCircle(theta = _ * radians) : (theta = null, clipAntimeridian), reset()) : theta * degrees$1; + }; + + projection.clipExtent = function(_) { + return arguments.length ? (postclip = _ == null ? (x0 = y0 = x1 = y1 = null, identity$4) : clipRectangle(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reset()) : x0 == null ? null : [[x0, y0], [x1, y1]]; + }; + + projection.scale = function(_) { + return arguments.length ? (k = +_, recenter()) : k; + }; + + projection.translate = function(_) { + return arguments.length ? (x = +_[0], y = +_[1], recenter()) : [x, y]; + }; + + projection.center = function(_) { + return arguments.length ? (lambda = _[0] % 360 * radians, phi = _[1] % 360 * radians, recenter()) : [lambda * degrees$1, phi * degrees$1]; + }; + + projection.rotate = function(_) { + return arguments.length ? (deltaLambda = _[0] % 360 * radians, deltaPhi = _[1] % 360 * radians, deltaGamma = _.length > 2 ? _[2] % 360 * radians : 0, recenter()) : [deltaLambda * degrees$1, deltaPhi * degrees$1, deltaGamma * degrees$1]; + }; + + projection.precision = function(_) { + return arguments.length ? (projectResample = resample(projectTransform, delta2 = _ * _), reset()) : sqrt(delta2); + }; + + projection.fitExtent = function(extent, object) { + return fitExtent(projection, extent, object); + }; + + projection.fitSize = function(size, object) { + return fitSize(projection, size, object); + }; + + projection.fitWidth = function(width, object) { + return fitWidth(projection, width, object); + }; + + projection.fitHeight = function(height, object) { + return fitHeight(projection, height, object); + }; + + function recenter() { + projectRotate = compose(rotate = rotateRadians(deltaLambda, deltaPhi, deltaGamma), project); + var center = project(lambda, phi); + dx = x - center[0] * k; + dy = y + center[1] * k; + return reset(); + } + + function reset() { + cache = cacheStream = null; + return projection; + } + + return function() { + project = projectAt.apply(this, arguments); + projection.invert = project.invert && invert; + return recenter(); + }; +} + +function conicProjection(projectAt) { + var phi0 = 0, + phi1 = pi$3 / 3, + m = projectionMutator(projectAt), + p = m(phi0, phi1); + + p.parallels = function(_) { + return arguments.length ? m(phi0 = _[0] * radians, phi1 = _[1] * radians) : [phi0 * degrees$1, phi1 * degrees$1]; + }; + + return p; +} + +function cylindricalEqualAreaRaw(phi0) { + var cosPhi0 = cos$1(phi0); + + function forward(lambda, phi) { + return [lambda * cosPhi0, sin$1(phi) / cosPhi0]; + } + + forward.invert = function(x, y) { + return [x / cosPhi0, asin(y * cosPhi0)]; + }; + + return forward; +} + +function conicEqualAreaRaw(y0, y1) { + var sy0 = sin$1(y0), n = (sy0 + sin$1(y1)) / 2; + + // Are the parallels symmetrical around the Equator? + if (abs(n) < epsilon$2) return cylindricalEqualAreaRaw(y0); + + var c = 1 + sy0 * (2 * n - sy0), r0 = sqrt(c) / n; + + function project(x, y) { + var r = sqrt(c - 2 * n * sin$1(y)) / n; + return [r * sin$1(x *= n), r0 - r * cos$1(x)]; + } + + project.invert = function(x, y) { + var r0y = r0 - y; + return [atan2(x, abs(r0y)) / n * sign(r0y), asin((c - (x * x + r0y * r0y) * n * n) / (2 * n))]; + }; + + return project; +} + +function conicEqualArea() { + return conicProjection(conicEqualAreaRaw) + .scale(155.424) + .center([0, 33.6442]); +} + +function albers() { + return conicEqualArea() + .parallels([29.5, 45.5]) + .scale(1070) + .translate([480, 250]) + .rotate([96, 0]) + .center([-0.6, 38.7]); +} + +// The projections must have mutually exclusive clip regions on the sphere, +// as this will avoid emitting interleaving lines and polygons. +function multiplex(streams) { + var n = streams.length; + return { + point: function(x, y) { var i = -1; while (++i < n) streams[i].point(x, y); }, + sphere: function() { var i = -1; while (++i < n) streams[i].sphere(); }, + lineStart: function() { var i = -1; while (++i < n) streams[i].lineStart(); }, + lineEnd: function() { var i = -1; while (++i < n) streams[i].lineEnd(); }, + polygonStart: function() { var i = -1; while (++i < n) streams[i].polygonStart(); }, + polygonEnd: function() { var i = -1; while (++i < n) streams[i].polygonEnd(); } + }; +} + +// A composite projection for the United States, configured by default for +// 960×500. The projection also works quite well at 960×600 if you change the +// scale to 1285 and adjust the translate accordingly. The set of standard +// parallels for each region comes from USGS, which is published here: +// http://egsc.usgs.gov/isb/pubs/MapProjections/projections.html#albers +function albersUsa() { + var cache, + cacheStream, + lower48 = albers(), lower48Point, + alaska = conicEqualArea().rotate([154, 0]).center([-2, 58.5]).parallels([55, 65]), alaskaPoint, // EPSG:3338 + hawaii = conicEqualArea().rotate([157, 0]).center([-3, 19.9]).parallels([8, 18]), hawaiiPoint, // ESRI:102007 + point, pointStream = {point: function(x, y) { point = [x, y]; }}; + + function albersUsa(coordinates) { + var x = coordinates[0], y = coordinates[1]; + return point = null, (lower48Point.point(x, y), point) + || (alaskaPoint.point(x, y), point) + || (hawaiiPoint.point(x, y), point); + } + + albersUsa.invert = function(coordinates) { + var k = lower48.scale(), + t = lower48.translate(), + x = (coordinates[0] - t[0]) / k, + y = (coordinates[1] - t[1]) / k; + return (y >= 0.120 && y < 0.234 && x >= -0.425 && x < -0.214 ? alaska + : y >= 0.166 && y < 0.234 && x >= -0.214 && x < -0.115 ? hawaii + : lower48).invert(coordinates); + }; + + albersUsa.stream = function(stream) { + return cache && cacheStream === stream ? cache : cache = multiplex([lower48.stream(cacheStream = stream), alaska.stream(stream), hawaii.stream(stream)]); + }; + + albersUsa.precision = function(_) { + if (!arguments.length) return lower48.precision(); + lower48.precision(_), alaska.precision(_), hawaii.precision(_); + return reset(); + }; + + albersUsa.scale = function(_) { + if (!arguments.length) return lower48.scale(); + lower48.scale(_), alaska.scale(_ * 0.35), hawaii.scale(_); + return albersUsa.translate(lower48.translate()); + }; + + albersUsa.translate = function(_) { + if (!arguments.length) return lower48.translate(); + var k = lower48.scale(), x = +_[0], y = +_[1]; + + lower48Point = lower48 + .translate(_) + .clipExtent([[x - 0.455 * k, y - 0.238 * k], [x + 0.455 * k, y + 0.238 * k]]) + .stream(pointStream); + + alaskaPoint = alaska + .translate([x - 0.307 * k, y + 0.201 * k]) + .clipExtent([[x - 0.425 * k + epsilon$2, y + 0.120 * k + epsilon$2], [x - 0.214 * k - epsilon$2, y + 0.234 * k - epsilon$2]]) + .stream(pointStream); + + hawaiiPoint = hawaii + .translate([x - 0.205 * k, y + 0.212 * k]) + .clipExtent([[x - 0.214 * k + epsilon$2, y + 0.166 * k + epsilon$2], [x - 0.115 * k - epsilon$2, y + 0.234 * k - epsilon$2]]) + .stream(pointStream); + + return reset(); + }; + + albersUsa.fitExtent = function(extent, object) { + return fitExtent(albersUsa, extent, object); + }; + + albersUsa.fitSize = function(size, object) { + return fitSize(albersUsa, size, object); + }; + + albersUsa.fitWidth = function(width, object) { + return fitWidth(albersUsa, width, object); + }; + + albersUsa.fitHeight = function(height, object) { + return fitHeight(albersUsa, height, object); + }; + + function reset() { + cache = cacheStream = null; + return albersUsa; + } + + return albersUsa.scale(1070); +} + +function azimuthalRaw(scale) { + return function(x, y) { + var cx = cos$1(x), + cy = cos$1(y), + k = scale(cx * cy); + return [ + k * cy * sin$1(x), + k * sin$1(y) + ]; + } +} + +function azimuthalInvert(angle) { + return function(x, y) { + var z = sqrt(x * x + y * y), + c = angle(z), + sc = sin$1(c), + cc = cos$1(c); + return [ + atan2(x * sc, z * cc), + asin(z && y * sc / z) + ]; + } +} + +var azimuthalEqualAreaRaw = azimuthalRaw(function(cxcy) { + return sqrt(2 / (1 + cxcy)); +}); + +azimuthalEqualAreaRaw.invert = azimuthalInvert(function(z) { + return 2 * asin(z / 2); +}); + +function azimuthalEqualArea() { + return projection(azimuthalEqualAreaRaw) + .scale(124.75) + .clipAngle(180 - 1e-3); +} + +var azimuthalEquidistantRaw = azimuthalRaw(function(c) { + return (c = acos(c)) && c / sin$1(c); +}); + +azimuthalEquidistantRaw.invert = azimuthalInvert(function(z) { + return z; +}); + +function azimuthalEquidistant() { + return projection(azimuthalEquidistantRaw) + .scale(79.4188) + .clipAngle(180 - 1e-3); +} + +function mercatorRaw(lambda, phi) { + return [lambda, log(tan((halfPi$2 + phi) / 2))]; +} + +mercatorRaw.invert = function(x, y) { + return [x, 2 * atan(exp(y)) - halfPi$2]; +}; + +function mercator() { + return mercatorProjection(mercatorRaw) + .scale(961 / tau$3); +} + +function mercatorProjection(project) { + var m = projection(project), + center = m.center, + scale = m.scale, + translate = m.translate, + clipExtent = m.clipExtent, + x0 = null, y0, x1, y1; // clip extent + + m.scale = function(_) { + return arguments.length ? (scale(_), reclip()) : scale(); + }; + + m.translate = function(_) { + return arguments.length ? (translate(_), reclip()) : translate(); + }; + + m.center = function(_) { + return arguments.length ? (center(_), reclip()) : center(); + }; + + m.clipExtent = function(_) { + return arguments.length ? (_ == null ? x0 = y0 = x1 = y1 = null : (x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reclip()) : x0 == null ? null : [[x0, y0], [x1, y1]]; + }; + + function reclip() { + var k = pi$3 * scale(), + t = m(rotation(m.rotate()).invert([0, 0])); + return clipExtent(x0 == null + ? [[t[0] - k, t[1] - k], [t[0] + k, t[1] + k]] : project === mercatorRaw + ? [[Math.max(t[0] - k, x0), y0], [Math.min(t[0] + k, x1), y1]] + : [[x0, Math.max(t[1] - k, y0)], [x1, Math.min(t[1] + k, y1)]]); + } + + return reclip(); +} + +function tany(y) { + return tan((halfPi$2 + y) / 2); +} + +function conicConformalRaw(y0, y1) { + var cy0 = cos$1(y0), + n = y0 === y1 ? sin$1(y0) : log(cy0 / cos$1(y1)) / log(tany(y1) / tany(y0)), + f = cy0 * pow(tany(y0), n) / n; + + if (!n) return mercatorRaw; + + function project(x, y) { + if (f > 0) { if (y < -halfPi$2 + epsilon$2) y = -halfPi$2 + epsilon$2; } + else { if (y > halfPi$2 - epsilon$2) y = halfPi$2 - epsilon$2; } + var r = f / pow(tany(y), n); + return [r * sin$1(n * x), f - r * cos$1(n * x)]; + } + + project.invert = function(x, y) { + var fy = f - y, r = sign(n) * sqrt(x * x + fy * fy); + return [atan2(x, abs(fy)) / n * sign(fy), 2 * atan(pow(f / r, 1 / n)) - halfPi$2]; + }; + + return project; +} + +function conicConformal() { + return conicProjection(conicConformalRaw) + .scale(109.5) + .parallels([30, 30]); +} + +function equirectangularRaw(lambda, phi) { + return [lambda, phi]; +} + +equirectangularRaw.invert = equirectangularRaw; + +function equirectangular() { + return projection(equirectangularRaw) + .scale(152.63); +} + +function conicEquidistantRaw(y0, y1) { + var cy0 = cos$1(y0), + n = y0 === y1 ? sin$1(y0) : (cy0 - cos$1(y1)) / (y1 - y0), + g = cy0 / n + y0; + + if (abs(n) < epsilon$2) return equirectangularRaw; + + function project(x, y) { + var gy = g - y, nx = n * x; + return [gy * sin$1(nx), g - gy * cos$1(nx)]; + } + + project.invert = function(x, y) { + var gy = g - y; + return [atan2(x, abs(gy)) / n * sign(gy), g - sign(n) * sqrt(x * x + gy * gy)]; + }; + + return project; +} + +function conicEquidistant() { + return conicProjection(conicEquidistantRaw) + .scale(131.154) + .center([0, 13.9389]); +} + +function gnomonicRaw(x, y) { + var cy = cos$1(y), k = cos$1(x) * cy; + return [cy * sin$1(x) / k, sin$1(y) / k]; +} + +gnomonicRaw.invert = azimuthalInvert(atan); + +function gnomonic() { + return projection(gnomonicRaw) + .scale(144.049) + .clipAngle(60); +} + +function scaleTranslate(kx, ky, tx, ty) { + return kx === 1 && ky === 1 && tx === 0 && ty === 0 ? identity$4 : transformer({ + point: function(x, y) { + this.stream.point(x * kx + tx, y * ky + ty); + } + }); +} + +function identity$5() { + var k = 1, tx = 0, ty = 0, sx = 1, sy = 1, transform$$1 = identity$4, // scale, translate and reflect + x0 = null, y0, x1, y1, // clip extent + postclip = identity$4, + cache, + cacheStream, + projection; + + function reset() { + cache = cacheStream = null; + return projection; + } + + return projection = { + stream: function(stream) { + return cache && cacheStream === stream ? cache : cache = transform$$1(postclip(cacheStream = stream)); + }, + postclip: function(_) { + return arguments.length ? (postclip = _, x0 = y0 = x1 = y1 = null, reset()) : postclip; + }, + clipExtent: function(_) { + return arguments.length ? (postclip = _ == null ? (x0 = y0 = x1 = y1 = null, identity$4) : clipRectangle(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reset()) : x0 == null ? null : [[x0, y0], [x1, y1]]; + }, + scale: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate((k = +_) * sx, k * sy, tx, ty), reset()) : k; + }, + translate: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate(k * sx, k * sy, tx = +_[0], ty = +_[1]), reset()) : [tx, ty]; + }, + reflectX: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate(k * (sx = _ ? -1 : 1), k * sy, tx, ty), reset()) : sx < 0; + }, + reflectY: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate(k * sx, k * (sy = _ ? -1 : 1), tx, ty), reset()) : sy < 0; + }, + fitExtent: function(extent, object) { + return fitExtent(projection, extent, object); + }, + fitSize: function(size, object) { + return fitSize(projection, size, object); + }, + fitWidth: function(width, object) { + return fitWidth(projection, width, object); + }, + fitHeight: function(height, object) { + return fitHeight(projection, height, object); + } + }; +} + +function naturalEarth1Raw(lambda, phi) { + var phi2 = phi * phi, phi4 = phi2 * phi2; + return [ + lambda * (0.8707 - 0.131979 * phi2 + phi4 * (-0.013791 + phi4 * (0.003971 * phi2 - 0.001529 * phi4))), + phi * (1.007226 + phi2 * (0.015085 + phi4 * (-0.044475 + 0.028874 * phi2 - 0.005916 * phi4))) + ]; +} + +naturalEarth1Raw.invert = function(x, y) { + var phi = y, i = 25, delta; + do { + var phi2 = phi * phi, phi4 = phi2 * phi2; + phi -= delta = (phi * (1.007226 + phi2 * (0.015085 + phi4 * (-0.044475 + 0.028874 * phi2 - 0.005916 * phi4))) - y) / + (1.007226 + phi2 * (0.015085 * 3 + phi4 * (-0.044475 * 7 + 0.028874 * 9 * phi2 - 0.005916 * 11 * phi4))); + } while (abs(delta) > epsilon$2 && --i > 0); + return [ + x / (0.8707 + (phi2 = phi * phi) * (-0.131979 + phi2 * (-0.013791 + phi2 * phi2 * phi2 * (0.003971 - 0.001529 * phi2)))), + phi + ]; +}; + +function naturalEarth1() { + return projection(naturalEarth1Raw) + .scale(175.295); +} + +function orthographicRaw(x, y) { + return [cos$1(y) * sin$1(x), sin$1(y)]; +} + +orthographicRaw.invert = azimuthalInvert(asin); + +function orthographic() { + return projection(orthographicRaw) + .scale(249.5) + .clipAngle(90 + epsilon$2); +} + +function stereographicRaw(x, y) { + var cy = cos$1(y), k = 1 + cos$1(x) * cy; + return [cy * sin$1(x) / k, sin$1(y) / k]; +} + +stereographicRaw.invert = azimuthalInvert(function(z) { + return 2 * atan(z); +}); + +function stereographic() { + return projection(stereographicRaw) + .scale(250) + .clipAngle(142); +} + +function transverseMercatorRaw(lambda, phi) { + return [log(tan((halfPi$2 + phi) / 2)), -lambda]; +} + +transverseMercatorRaw.invert = function(x, y) { + return [-y, 2 * atan(exp(x)) - halfPi$2]; +}; + +function transverseMercator() { + var m = mercatorProjection(transverseMercatorRaw), + center = m.center, + rotate = m.rotate; + + m.center = function(_) { + return arguments.length ? center([-_[1], _[0]]) : (_ = center(), [_[1], -_[0]]); + }; + + m.rotate = function(_) { + return arguments.length ? rotate([_[0], _[1], _.length > 2 ? _[2] + 90 : 90]) : (_ = rotate(), [_[0], _[1], _[2] - 90]); + }; + + return rotate([0, 0, 90]) + .scale(159.155); +} + +function defaultSeparation(a, b) { + return a.parent === b.parent ? 1 : 2; +} + +function meanX(children) { + return children.reduce(meanXReduce, 0) / children.length; +} + +function meanXReduce(x, c) { + return x + c.x; +} + +function maxY(children) { + return 1 + children.reduce(maxYReduce, 0); +} + +function maxYReduce(y, c) { + return Math.max(y, c.y); +} + +function leafLeft(node) { + var children; + while (children = node.children) node = children[0]; + return node; +} + +function leafRight(node) { + var children; + while (children = node.children) node = children[children.length - 1]; + return node; +} + +function cluster() { + var separation = defaultSeparation, + dx = 1, + dy = 1, + nodeSize = false; + + function cluster(root) { + var previousNode, + x = 0; + + // First walk, computing the initial x & y values. + root.eachAfter(function(node) { + var children = node.children; + if (children) { + node.x = meanX(children); + node.y = maxY(children); + } else { + node.x = previousNode ? x += separation(node, previousNode) : 0; + node.y = 0; + previousNode = node; + } + }); + + var left = leafLeft(root), + right = leafRight(root), + x0 = left.x - separation(left, right) / 2, + x1 = right.x + separation(right, left) / 2; + + // Second walk, normalizing x & y to the desired size. + return root.eachAfter(nodeSize ? function(node) { + node.x = (node.x - root.x) * dx; + node.y = (root.y - node.y) * dy; + } : function(node) { + node.x = (node.x - x0) / (x1 - x0) * dx; + node.y = (1 - (root.y ? node.y / root.y : 1)) * dy; + }); + } + + cluster.separation = function(x) { + return arguments.length ? (separation = x, cluster) : separation; + }; + + cluster.size = function(x) { + return arguments.length ? (nodeSize = false, dx = +x[0], dy = +x[1], cluster) : (nodeSize ? null : [dx, dy]); + }; + + cluster.nodeSize = function(x) { + return arguments.length ? (nodeSize = true, dx = +x[0], dy = +x[1], cluster) : (nodeSize ? [dx, dy] : null); + }; + + return cluster; +} + +function count(node) { + var sum = 0, + children = node.children, + i = children && children.length; + if (!i) sum = 1; + else while (--i >= 0) sum += children[i].value; + node.value = sum; +} + +function node_count() { + return this.eachAfter(count); +} + +function node_each(callback) { + var node = this, current, next = [node], children, i, n; + do { + current = next.reverse(), next = []; + while (node = current.pop()) { + callback(node), children = node.children; + if (children) for (i = 0, n = children.length; i < n; ++i) { + next.push(children[i]); + } + } + } while (next.length); + return this; +} + +function node_eachBefore(callback) { + var node = this, nodes = [node], children, i; + while (node = nodes.pop()) { + callback(node), children = node.children; + if (children) for (i = children.length - 1; i >= 0; --i) { + nodes.push(children[i]); + } + } + return this; +} + +function node_eachAfter(callback) { + var node = this, nodes = [node], next = [], children, i, n; + while (node = nodes.pop()) { + next.push(node), children = node.children; + if (children) for (i = 0, n = children.length; i < n; ++i) { + nodes.push(children[i]); + } + } + while (node = next.pop()) { + callback(node); + } + return this; +} + +function node_sum(value) { + return this.eachAfter(function(node) { + var sum = +value(node.data) || 0, + children = node.children, + i = children && children.length; + while (--i >= 0) sum += children[i].value; + node.value = sum; + }); +} + +function node_sort(compare) { + return this.eachBefore(function(node) { + if (node.children) { + node.children.sort(compare); + } + }); +} + +function node_path(end) { + var start = this, + ancestor = leastCommonAncestor(start, end), + nodes = [start]; + while (start !== ancestor) { + start = start.parent; + nodes.push(start); + } + var k = nodes.length; + while (end !== ancestor) { + nodes.splice(k, 0, end); + end = end.parent; + } + return nodes; +} + +function leastCommonAncestor(a, b) { + if (a === b) return a; + var aNodes = a.ancestors(), + bNodes = b.ancestors(), + c = null; + a = aNodes.pop(); + b = bNodes.pop(); + while (a === b) { + c = a; + a = aNodes.pop(); + b = bNodes.pop(); + } + return c; +} + +function node_ancestors() { + var node = this, nodes = [node]; + while (node = node.parent) { + nodes.push(node); + } + return nodes; +} + +function node_descendants() { + var nodes = []; + this.each(function(node) { + nodes.push(node); + }); + return nodes; +} + +function node_leaves() { + var leaves = []; + this.eachBefore(function(node) { + if (!node.children) { + leaves.push(node); + } + }); + return leaves; +} + +function node_links() { + var root = this, links = []; + root.each(function(node) { + if (node !== root) { // Don’t include the root’s parent, if any. + links.push({source: node.parent, target: node}); + } + }); + return links; +} + +function hierarchy(data, children) { + var root = new Node(data), + valued = +data.value && (root.value = data.value), + node, + nodes = [root], + child, + childs, + i, + n; + + if (children == null) children = defaultChildren; + + while (node = nodes.pop()) { + if (valued) node.value = +node.data.value; + if ((childs = children(node.data)) && (n = childs.length)) { + node.children = new Array(n); + for (i = n - 1; i >= 0; --i) { + nodes.push(child = node.children[i] = new Node(childs[i])); + child.parent = node; + child.depth = node.depth + 1; + } + } + } + + return root.eachBefore(computeHeight); +} + +function node_copy() { + return hierarchy(this).eachBefore(copyData); +} + +function defaultChildren(d) { + return d.children; +} + +function copyData(node) { + node.data = node.data.data; +} + +function computeHeight(node) { + var height = 0; + do node.height = height; + while ((node = node.parent) && (node.height < ++height)); +} + +function Node(data) { + this.data = data; + this.depth = + this.height = 0; + this.parent = null; +} + +Node.prototype = hierarchy.prototype = { + constructor: Node, + count: node_count, + each: node_each, + eachAfter: node_eachAfter, + eachBefore: node_eachBefore, + sum: node_sum, + sort: node_sort, + path: node_path, + ancestors: node_ancestors, + descendants: node_descendants, + leaves: node_leaves, + links: node_links, + copy: node_copy +}; + +var slice$3 = Array.prototype.slice; + +function shuffle$1(array) { + var m = array.length, + t, + i; + + while (m) { + i = Math.random() * m-- | 0; + t = array[m]; + array[m] = array[i]; + array[i] = t; + } + + return array; +} + +function enclose(circles) { + var i = 0, n = (circles = shuffle$1(slice$3.call(circles))).length, B = [], p, e; + + while (i < n) { + p = circles[i]; + if (e && enclosesWeak(e, p)) ++i; + else e = encloseBasis(B = extendBasis(B, p)), i = 0; + } + + return e; +} + +function extendBasis(B, p) { + var i, j; + + if (enclosesWeakAll(p, B)) return [p]; + + // If we get here then B must have at least one element. + for (i = 0; i < B.length; ++i) { + if (enclosesNot(p, B[i]) + && enclosesWeakAll(encloseBasis2(B[i], p), B)) { + return [B[i], p]; + } + } + + // If we get here then B must have at least two elements. + for (i = 0; i < B.length - 1; ++i) { + for (j = i + 1; j < B.length; ++j) { + if (enclosesNot(encloseBasis2(B[i], B[j]), p) + && enclosesNot(encloseBasis2(B[i], p), B[j]) + && enclosesNot(encloseBasis2(B[j], p), B[i]) + && enclosesWeakAll(encloseBasis3(B[i], B[j], p), B)) { + return [B[i], B[j], p]; + } + } + } + + // If we get here then something is very wrong. + throw new Error; +} + +function enclosesNot(a, b) { + var dr = a.r - b.r, dx = b.x - a.x, dy = b.y - a.y; + return dr < 0 || dr * dr < dx * dx + dy * dy; +} + +function enclosesWeak(a, b) { + var dr = a.r - b.r + 1e-6, dx = b.x - a.x, dy = b.y - a.y; + return dr > 0 && dr * dr > dx * dx + dy * dy; +} + +function enclosesWeakAll(a, B) { + for (var i = 0; i < B.length; ++i) { + if (!enclosesWeak(a, B[i])) { + return false; + } + } + return true; +} + +function encloseBasis(B) { + switch (B.length) { + case 1: return encloseBasis1(B[0]); + case 2: return encloseBasis2(B[0], B[1]); + case 3: return encloseBasis3(B[0], B[1], B[2]); + } +} + +function encloseBasis1(a) { + return { + x: a.x, + y: a.y, + r: a.r + }; +} + +function encloseBasis2(a, b) { + var x1 = a.x, y1 = a.y, r1 = a.r, + x2 = b.x, y2 = b.y, r2 = b.r, + x21 = x2 - x1, y21 = y2 - y1, r21 = r2 - r1, + l = Math.sqrt(x21 * x21 + y21 * y21); + return { + x: (x1 + x2 + x21 / l * r21) / 2, + y: (y1 + y2 + y21 / l * r21) / 2, + r: (l + r1 + r2) / 2 + }; +} + +function encloseBasis3(a, b, c) { + var x1 = a.x, y1 = a.y, r1 = a.r, + x2 = b.x, y2 = b.y, r2 = b.r, + x3 = c.x, y3 = c.y, r3 = c.r, + a2 = x1 - x2, + a3 = x1 - x3, + b2 = y1 - y2, + b3 = y1 - y3, + c2 = r2 - r1, + c3 = r3 - r1, + d1 = x1 * x1 + y1 * y1 - r1 * r1, + d2 = d1 - x2 * x2 - y2 * y2 + r2 * r2, + d3 = d1 - x3 * x3 - y3 * y3 + r3 * r3, + ab = a3 * b2 - a2 * b3, + xa = (b2 * d3 - b3 * d2) / (ab * 2) - x1, + xb = (b3 * c2 - b2 * c3) / ab, + ya = (a3 * d2 - a2 * d3) / (ab * 2) - y1, + yb = (a2 * c3 - a3 * c2) / ab, + A = xb * xb + yb * yb - 1, + B = 2 * (r1 + xa * xb + ya * yb), + C = xa * xa + ya * ya - r1 * r1, + r = -(A ? (B + Math.sqrt(B * B - 4 * A * C)) / (2 * A) : C / B); + return { + x: x1 + xa + xb * r, + y: y1 + ya + yb * r, + r: r + }; +} + +function place(a, b, c) { + var ax = a.x, + ay = a.y, + da = b.r + c.r, + db = a.r + c.r, + dx = b.x - ax, + dy = b.y - ay, + dc = dx * dx + dy * dy; + if (dc) { + var x = 0.5 + ((db *= db) - (da *= da)) / (2 * dc), + y = Math.sqrt(Math.max(0, 2 * da * (db + dc) - (db -= dc) * db - da * da)) / (2 * dc); + c.x = ax + x * dx + y * dy; + c.y = ay + x * dy - y * dx; + } else { + c.x = ax + db; + c.y = ay; + } +} + +function intersects(a, b) { + var dx = b.x - a.x, + dy = b.y - a.y, + dr = a.r + b.r; + return dr * dr - 1e-6 > dx * dx + dy * dy; +} + +function score(node) { + var a = node._, + b = node.next._, + ab = a.r + b.r, + dx = (a.x * b.r + b.x * a.r) / ab, + dy = (a.y * b.r + b.y * a.r) / ab; + return dx * dx + dy * dy; +} + +function Node$1(circle) { + this._ = circle; + this.next = null; + this.previous = null; +} + +function packEnclose(circles) { + if (!(n = circles.length)) return 0; + + var a, b, c, n, aa, ca, i, j, k, sj, sk; + + // Place the first circle. + a = circles[0], a.x = 0, a.y = 0; + if (!(n > 1)) return a.r; + + // Place the second circle. + b = circles[1], a.x = -b.r, b.x = a.r, b.y = 0; + if (!(n > 2)) return a.r + b.r; + + // Place the third circle. + place(b, a, c = circles[2]); + + // Initialize the front-chain using the first three circles a, b and c. + a = new Node$1(a), b = new Node$1(b), c = new Node$1(c); + a.next = c.previous = b; + b.next = a.previous = c; + c.next = b.previous = a; + + // Attempt to place each remaining circle… + pack: for (i = 3; i < n; ++i) { + place(a._, b._, c = circles[i]), c = new Node$1(c); + + // Find the closest intersecting circle on the front-chain, if any. + // “Closeness” is determined by linear distance along the front-chain. + // “Ahead” or “behind” is likewise determined by linear distance. + j = b.next, k = a.previous, sj = b._.r, sk = a._.r; + do { + if (sj <= sk) { + if (intersects(j._, c._)) { + b = j, a.next = b, b.previous = a, --i; + continue pack; + } + sj += j._.r, j = j.next; + } else { + if (intersects(k._, c._)) { + a = k, a.next = b, b.previous = a, --i; + continue pack; + } + sk += k._.r, k = k.previous; + } + } while (j !== k.next); + + // Success! Insert the new circle c between a and b. + c.previous = a, c.next = b, a.next = b.previous = b = c; + + // Compute the new closest circle pair to the centroid. + aa = score(a); + while ((c = c.next) !== b) { + if ((ca = score(c)) < aa) { + a = c, aa = ca; + } + } + b = a.next; + } + + // Compute the enclosing circle of the front chain. + a = [b._], c = b; while ((c = c.next) !== b) a.push(c._); c = enclose(a); + + // Translate the circles to put the enclosing circle around the origin. + for (i = 0; i < n; ++i) a = circles[i], a.x -= c.x, a.y -= c.y; + + return c.r; +} + +function siblings(circles) { + packEnclose(circles); + return circles; +} + +function optional(f) { + return f == null ? null : required(f); +} + +function required(f) { + if (typeof f !== "function") throw new Error; + return f; +} + +function constantZero() { + return 0; +} + +function constant$8(x) { + return function() { + return x; + }; +} + +function defaultRadius$1(d) { + return Math.sqrt(d.value); +} + +function index$2() { + var radius = null, + dx = 1, + dy = 1, + padding = constantZero; + + function pack(root) { + root.x = dx / 2, root.y = dy / 2; + if (radius) { + root.eachBefore(radiusLeaf(radius)) + .eachAfter(packChildren(padding, 0.5)) + .eachBefore(translateChild(1)); + } else { + root.eachBefore(radiusLeaf(defaultRadius$1)) + .eachAfter(packChildren(constantZero, 1)) + .eachAfter(packChildren(padding, root.r / Math.min(dx, dy))) + .eachBefore(translateChild(Math.min(dx, dy) / (2 * root.r))); + } + return root; + } + + pack.radius = function(x) { + return arguments.length ? (radius = optional(x), pack) : radius; + }; + + pack.size = function(x) { + return arguments.length ? (dx = +x[0], dy = +x[1], pack) : [dx, dy]; + }; + + pack.padding = function(x) { + return arguments.length ? (padding = typeof x === "function" ? x : constant$8(+x), pack) : padding; + }; + + return pack; +} + +function radiusLeaf(radius) { + return function(node) { + if (!node.children) { + node.r = Math.max(0, +radius(node) || 0); + } + }; +} + +function packChildren(padding, k) { + return function(node) { + if (children = node.children) { + var children, + i, + n = children.length, + r = padding(node) * k || 0, + e; + + if (r) for (i = 0; i < n; ++i) children[i].r += r; + e = packEnclose(children); + if (r) for (i = 0; i < n; ++i) children[i].r -= r; + node.r = e + r; + } + }; +} + +function translateChild(k) { + return function(node) { + var parent = node.parent; + node.r *= k; + if (parent) { + node.x = parent.x + k * node.x; + node.y = parent.y + k * node.y; + } + }; +} + +function roundNode(node) { + node.x0 = Math.round(node.x0); + node.y0 = Math.round(node.y0); + node.x1 = Math.round(node.x1); + node.y1 = Math.round(node.y1); +} + +function treemapDice(parent, x0, y0, x1, y1) { + var nodes = parent.children, + node, + i = -1, + n = nodes.length, + k = parent.value && (x1 - x0) / parent.value; + + while (++i < n) { + node = nodes[i], node.y0 = y0, node.y1 = y1; + node.x0 = x0, node.x1 = x0 += node.value * k; + } +} + +function partition() { + var dx = 1, + dy = 1, + padding = 0, + round = false; + + function partition(root) { + var n = root.height + 1; + root.x0 = + root.y0 = padding; + root.x1 = dx; + root.y1 = dy / n; + root.eachBefore(positionNode(dy, n)); + if (round) root.eachBefore(roundNode); + return root; + } + + function positionNode(dy, n) { + return function(node) { + if (node.children) { + treemapDice(node, node.x0, dy * (node.depth + 1) / n, node.x1, dy * (node.depth + 2) / n); + } + var x0 = node.x0, + y0 = node.y0, + x1 = node.x1 - padding, + y1 = node.y1 - padding; + if (x1 < x0) x0 = x1 = (x0 + x1) / 2; + if (y1 < y0) y0 = y1 = (y0 + y1) / 2; + node.x0 = x0; + node.y0 = y0; + node.x1 = x1; + node.y1 = y1; + }; + } + + partition.round = function(x) { + return arguments.length ? (round = !!x, partition) : round; + }; + + partition.size = function(x) { + return arguments.length ? (dx = +x[0], dy = +x[1], partition) : [dx, dy]; + }; + + partition.padding = function(x) { + return arguments.length ? (padding = +x, partition) : padding; + }; + + return partition; +} + +var keyPrefix$1 = "$"; +var preroot = {depth: -1}; +var ambiguous = {}; + +function defaultId(d) { + return d.id; +} + +function defaultParentId(d) { + return d.parentId; +} + +function stratify() { + var id = defaultId, + parentId = defaultParentId; + + function stratify(data) { + var d, + i, + n = data.length, + root, + parent, + node, + nodes = new Array(n), + nodeId, + nodeKey, + nodeByKey = {}; + + for (i = 0; i < n; ++i) { + d = data[i], node = nodes[i] = new Node(d); + if ((nodeId = id(d, i, data)) != null && (nodeId += "")) { + nodeKey = keyPrefix$1 + (node.id = nodeId); + nodeByKey[nodeKey] = nodeKey in nodeByKey ? ambiguous : node; + } + } + + for (i = 0; i < n; ++i) { + node = nodes[i], nodeId = parentId(data[i], i, data); + if (nodeId == null || !(nodeId += "")) { + if (root) throw new Error("multiple roots"); + root = node; + } else { + parent = nodeByKey[keyPrefix$1 + nodeId]; + if (!parent) throw new Error("missing: " + nodeId); + if (parent === ambiguous) throw new Error("ambiguous: " + nodeId); + if (parent.children) parent.children.push(node); + else parent.children = [node]; + node.parent = parent; + } + } + + if (!root) throw new Error("no root"); + root.parent = preroot; + root.eachBefore(function(node) { node.depth = node.parent.depth + 1; --n; }).eachBefore(computeHeight); + root.parent = null; + if (n > 0) throw new Error("cycle"); + + return root; + } + + stratify.id = function(x) { + return arguments.length ? (id = required(x), stratify) : id; + }; + + stratify.parentId = function(x) { + return arguments.length ? (parentId = required(x), stratify) : parentId; + }; + + return stratify; +} + +function defaultSeparation$1(a, b) { + return a.parent === b.parent ? 1 : 2; +} + +// function radialSeparation(a, b) { +// return (a.parent === b.parent ? 1 : 2) / a.depth; +// } + +// This function is used to traverse the left contour of a subtree (or +// subforest). It returns the successor of v on this contour. This successor is +// either given by the leftmost child of v or by the thread of v. The function +// returns null if and only if v is on the highest level of its subtree. +function nextLeft(v) { + var children = v.children; + return children ? children[0] : v.t; +} + +// This function works analogously to nextLeft. +function nextRight(v) { + var children = v.children; + return children ? children[children.length - 1] : v.t; +} + +// Shifts the current subtree rooted at w+. This is done by increasing +// prelim(w+) and mod(w+) by shift. +function moveSubtree(wm, wp, shift) { + var change = shift / (wp.i - wm.i); + wp.c -= change; + wp.s += shift; + wm.c += change; + wp.z += shift; + wp.m += shift; +} + +// All other shifts, applied to the smaller subtrees between w- and w+, are +// performed by this function. To prepare the shifts, we have to adjust +// change(w+), shift(w+), and change(w-). +function executeShifts(v) { + var shift = 0, + change = 0, + children = v.children, + i = children.length, + w; + while (--i >= 0) { + w = children[i]; + w.z += shift; + w.m += shift; + shift += w.s + (change += w.c); + } +} + +// If vi-’s ancestor is a sibling of v, returns vi-’s ancestor. Otherwise, +// returns the specified (default) ancestor. +function nextAncestor(vim, v, ancestor) { + return vim.a.parent === v.parent ? vim.a : ancestor; +} + +function TreeNode(node, i) { + this._ = node; + this.parent = null; + this.children = null; + this.A = null; // default ancestor + this.a = this; // ancestor + this.z = 0; // prelim + this.m = 0; // mod + this.c = 0; // change + this.s = 0; // shift + this.t = null; // thread + this.i = i; // number +} + +TreeNode.prototype = Object.create(Node.prototype); + +function treeRoot(root) { + var tree = new TreeNode(root, 0), + node, + nodes = [tree], + child, + children, + i, + n; + + while (node = nodes.pop()) { + if (children = node._.children) { + node.children = new Array(n = children.length); + for (i = n - 1; i >= 0; --i) { + nodes.push(child = node.children[i] = new TreeNode(children[i], i)); + child.parent = node; + } + } + } + + (tree.parent = new TreeNode(null, 0)).children = [tree]; + return tree; +} + +// Node-link tree diagram using the Reingold-Tilford "tidy" algorithm +function tree() { + var separation = defaultSeparation$1, + dx = 1, + dy = 1, + nodeSize = null; + + function tree(root) { + var t = treeRoot(root); + + // Compute the layout using Buchheim et al.’s algorithm. + t.eachAfter(firstWalk), t.parent.m = -t.z; + t.eachBefore(secondWalk); + + // If a fixed node size is specified, scale x and y. + if (nodeSize) root.eachBefore(sizeNode); + + // If a fixed tree size is specified, scale x and y based on the extent. + // Compute the left-most, right-most, and depth-most nodes for extents. + else { + var left = root, + right = root, + bottom = root; + root.eachBefore(function(node) { + if (node.x < left.x) left = node; + if (node.x > right.x) right = node; + if (node.depth > bottom.depth) bottom = node; + }); + var s = left === right ? 1 : separation(left, right) / 2, + tx = s - left.x, + kx = dx / (right.x + s + tx), + ky = dy / (bottom.depth || 1); + root.eachBefore(function(node) { + node.x = (node.x + tx) * kx; + node.y = node.depth * ky; + }); + } + + return root; + } + + // Computes a preliminary x-coordinate for v. Before that, FIRST WALK is + // applied recursively to the children of v, as well as the function + // APPORTION. After spacing out the children by calling EXECUTE SHIFTS, the + // node v is placed to the midpoint of its outermost children. + function firstWalk(v) { + var children = v.children, + siblings = v.parent.children, + w = v.i ? siblings[v.i - 1] : null; + if (children) { + executeShifts(v); + var midpoint = (children[0].z + children[children.length - 1].z) / 2; + if (w) { + v.z = w.z + separation(v._, w._); + v.m = v.z - midpoint; + } else { + v.z = midpoint; + } + } else if (w) { + v.z = w.z + separation(v._, w._); + } + v.parent.A = apportion(v, w, v.parent.A || siblings[0]); + } + + // Computes all real x-coordinates by summing up the modifiers recursively. + function secondWalk(v) { + v._.x = v.z + v.parent.m; + v.m += v.parent.m; + } + + // The core of the algorithm. Here, a new subtree is combined with the + // previous subtrees. Threads are used to traverse the inside and outside + // contours of the left and right subtree up to the highest common level. The + // vertices used for the traversals are vi+, vi-, vo-, and vo+, where the + // superscript o means outside and i means inside, the subscript - means left + // subtree and + means right subtree. For summing up the modifiers along the + // contour, we use respective variables si+, si-, so-, and so+. Whenever two + // nodes of the inside contours conflict, we compute the left one of the + // greatest uncommon ancestors using the function ANCESTOR and call MOVE + // SUBTREE to shift the subtree and prepare the shifts of smaller subtrees. + // Finally, we add a new thread (if necessary). + function apportion(v, w, ancestor) { + if (w) { + var vip = v, + vop = v, + vim = w, + vom = vip.parent.children[0], + sip = vip.m, + sop = vop.m, + sim = vim.m, + som = vom.m, + shift; + while (vim = nextRight(vim), vip = nextLeft(vip), vim && vip) { + vom = nextLeft(vom); + vop = nextRight(vop); + vop.a = v; + shift = vim.z + sim - vip.z - sip + separation(vim._, vip._); + if (shift > 0) { + moveSubtree(nextAncestor(vim, v, ancestor), v, shift); + sip += shift; + sop += shift; + } + sim += vim.m; + sip += vip.m; + som += vom.m; + sop += vop.m; + } + if (vim && !nextRight(vop)) { + vop.t = vim; + vop.m += sim - sop; + } + if (vip && !nextLeft(vom)) { + vom.t = vip; + vom.m += sip - som; + ancestor = v; + } + } + return ancestor; + } + + function sizeNode(node) { + node.x *= dx; + node.y = node.depth * dy; + } + + tree.separation = function(x) { + return arguments.length ? (separation = x, tree) : separation; + }; + + tree.size = function(x) { + return arguments.length ? (nodeSize = false, dx = +x[0], dy = +x[1], tree) : (nodeSize ? null : [dx, dy]); + }; + + tree.nodeSize = function(x) { + return arguments.length ? (nodeSize = true, dx = +x[0], dy = +x[1], tree) : (nodeSize ? [dx, dy] : null); + }; + + return tree; +} + +function treemapSlice(parent, x0, y0, x1, y1) { + var nodes = parent.children, + node, + i = -1, + n = nodes.length, + k = parent.value && (y1 - y0) / parent.value; + + while (++i < n) { + node = nodes[i], node.x0 = x0, node.x1 = x1; + node.y0 = y0, node.y1 = y0 += node.value * k; + } +} + +var phi = (1 + Math.sqrt(5)) / 2; + +function squarifyRatio(ratio, parent, x0, y0, x1, y1) { + var rows = [], + nodes = parent.children, + row, + nodeValue, + i0 = 0, + i1 = 0, + n = nodes.length, + dx, dy, + value = parent.value, + sumValue, + minValue, + maxValue, + newRatio, + minRatio, + alpha, + beta; + + while (i0 < n) { + dx = x1 - x0, dy = y1 - y0; + + // Find the next non-empty node. + do sumValue = nodes[i1++].value; while (!sumValue && i1 < n); + minValue = maxValue = sumValue; + alpha = Math.max(dy / dx, dx / dy) / (value * ratio); + beta = sumValue * sumValue * alpha; + minRatio = Math.max(maxValue / beta, beta / minValue); + + // Keep adding nodes while the aspect ratio maintains or improves. + for (; i1 < n; ++i1) { + sumValue += nodeValue = nodes[i1].value; + if (nodeValue < minValue) minValue = nodeValue; + if (nodeValue > maxValue) maxValue = nodeValue; + beta = sumValue * sumValue * alpha; + newRatio = Math.max(maxValue / beta, beta / minValue); + if (newRatio > minRatio) { sumValue -= nodeValue; break; } + minRatio = newRatio; + } + + // Position and record the row orientation. + rows.push(row = {value: sumValue, dice: dx < dy, children: nodes.slice(i0, i1)}); + if (row.dice) treemapDice(row, x0, y0, x1, value ? y0 += dy * sumValue / value : y1); + else treemapSlice(row, x0, y0, value ? x0 += dx * sumValue / value : x1, y1); + value -= sumValue, i0 = i1; + } + + return rows; +} + +var squarify = (function custom(ratio) { + + function squarify(parent, x0, y0, x1, y1) { + squarifyRatio(ratio, parent, x0, y0, x1, y1); + } + + squarify.ratio = function(x) { + return custom((x = +x) > 1 ? x : 1); + }; + + return squarify; +})(phi); + +function index$3() { + var tile = squarify, + round = false, + dx = 1, + dy = 1, + paddingStack = [0], + paddingInner = constantZero, + paddingTop = constantZero, + paddingRight = constantZero, + paddingBottom = constantZero, + paddingLeft = constantZero; + + function treemap(root) { + root.x0 = + root.y0 = 0; + root.x1 = dx; + root.y1 = dy; + root.eachBefore(positionNode); + paddingStack = [0]; + if (round) root.eachBefore(roundNode); + return root; + } + + function positionNode(node) { + var p = paddingStack[node.depth], + x0 = node.x0 + p, + y0 = node.y0 + p, + x1 = node.x1 - p, + y1 = node.y1 - p; + if (x1 < x0) x0 = x1 = (x0 + x1) / 2; + if (y1 < y0) y0 = y1 = (y0 + y1) / 2; + node.x0 = x0; + node.y0 = y0; + node.x1 = x1; + node.y1 = y1; + if (node.children) { + p = paddingStack[node.depth + 1] = paddingInner(node) / 2; + x0 += paddingLeft(node) - p; + y0 += paddingTop(node) - p; + x1 -= paddingRight(node) - p; + y1 -= paddingBottom(node) - p; + if (x1 < x0) x0 = x1 = (x0 + x1) / 2; + if (y1 < y0) y0 = y1 = (y0 + y1) / 2; + tile(node, x0, y0, x1, y1); + } + } + + treemap.round = function(x) { + return arguments.length ? (round = !!x, treemap) : round; + }; + + treemap.size = function(x) { + return arguments.length ? (dx = +x[0], dy = +x[1], treemap) : [dx, dy]; + }; + + treemap.tile = function(x) { + return arguments.length ? (tile = required(x), treemap) : tile; + }; + + treemap.padding = function(x) { + return arguments.length ? treemap.paddingInner(x).paddingOuter(x) : treemap.paddingInner(); + }; + + treemap.paddingInner = function(x) { + return arguments.length ? (paddingInner = typeof x === "function" ? x : constant$8(+x), treemap) : paddingInner; + }; + + treemap.paddingOuter = function(x) { + return arguments.length ? treemap.paddingTop(x).paddingRight(x).paddingBottom(x).paddingLeft(x) : treemap.paddingTop(); + }; + + treemap.paddingTop = function(x) { + return arguments.length ? (paddingTop = typeof x === "function" ? x : constant$8(+x), treemap) : paddingTop; + }; + + treemap.paddingRight = function(x) { + return arguments.length ? (paddingRight = typeof x === "function" ? x : constant$8(+x), treemap) : paddingRight; + }; + + treemap.paddingBottom = function(x) { + return arguments.length ? (paddingBottom = typeof x === "function" ? x : constant$8(+x), treemap) : paddingBottom; + }; + + treemap.paddingLeft = function(x) { + return arguments.length ? (paddingLeft = typeof x === "function" ? x : constant$8(+x), treemap) : paddingLeft; + }; + + return treemap; +} + +function binary(parent, x0, y0, x1, y1) { + var nodes = parent.children, + i, n = nodes.length, + sum, sums = new Array(n + 1); + + for (sums[0] = sum = i = 0; i < n; ++i) { + sums[i + 1] = sum += nodes[i].value; + } + + partition(0, n, parent.value, x0, y0, x1, y1); + + function partition(i, j, value, x0, y0, x1, y1) { + if (i >= j - 1) { + var node = nodes[i]; + node.x0 = x0, node.y0 = y0; + node.x1 = x1, node.y1 = y1; + return; + } + + var valueOffset = sums[i], + valueTarget = (value / 2) + valueOffset, + k = i + 1, + hi = j - 1; + + while (k < hi) { + var mid = k + hi >>> 1; + if (sums[mid] < valueTarget) k = mid + 1; + else hi = mid; + } + + if ((valueTarget - sums[k - 1]) < (sums[k] - valueTarget) && i + 1 < k) --k; + + var valueLeft = sums[k] - valueOffset, + valueRight = value - valueLeft; + + if ((x1 - x0) > (y1 - y0)) { + var xk = (x0 * valueRight + x1 * valueLeft) / value; + partition(i, k, valueLeft, x0, y0, xk, y1); + partition(k, j, valueRight, xk, y0, x1, y1); + } else { + var yk = (y0 * valueRight + y1 * valueLeft) / value; + partition(i, k, valueLeft, x0, y0, x1, yk); + partition(k, j, valueRight, x0, yk, x1, y1); + } + } +} + +function sliceDice(parent, x0, y0, x1, y1) { + (parent.depth & 1 ? treemapSlice : treemapDice)(parent, x0, y0, x1, y1); +} + +var resquarify = (function custom(ratio) { + + function resquarify(parent, x0, y0, x1, y1) { + if ((rows = parent._squarify) && (rows.ratio === ratio)) { + var rows, + row, + nodes, + i, + j = -1, + n, + m = rows.length, + value = parent.value; + + while (++j < m) { + row = rows[j], nodes = row.children; + for (i = row.value = 0, n = nodes.length; i < n; ++i) row.value += nodes[i].value; + if (row.dice) treemapDice(row, x0, y0, x1, y0 += (y1 - y0) * row.value / value); + else treemapSlice(row, x0, y0, x0 += (x1 - x0) * row.value / value, y1); + value -= row.value; + } + } else { + parent._squarify = rows = squarifyRatio(ratio, parent, x0, y0, x1, y1); + rows.ratio = ratio; + } + } + + resquarify.ratio = function(x) { + return custom((x = +x) > 1 ? x : 1); + }; + + return resquarify; +})(phi); + +function area$1(polygon) { + var i = -1, + n = polygon.length, + a, + b = polygon[n - 1], + area = 0; + + while (++i < n) { + a = b; + b = polygon[i]; + area += a[1] * b[0] - a[0] * b[1]; + } + + return area / 2; +} + +function centroid$1(polygon) { + var i = -1, + n = polygon.length, + x = 0, + y = 0, + a, + b = polygon[n - 1], + c, + k = 0; + + while (++i < n) { + a = b; + b = polygon[i]; + k += c = a[0] * b[1] - b[0] * a[1]; + x += (a[0] + b[0]) * c; + y += (a[1] + b[1]) * c; + } + + return k *= 3, [x / k, y / k]; +} + +// Returns the 2D cross product of AB and AC vectors, i.e., the z-component of +// the 3D cross product in a quadrant I Cartesian coordinate system (+x is +// right, +y is up). Returns a positive value if ABC is counter-clockwise, +// negative if clockwise, and zero if the points are collinear. +function cross$1(a, b, c) { + return (b[0] - a[0]) * (c[1] - a[1]) - (b[1] - a[1]) * (c[0] - a[0]); +} + +function lexicographicOrder(a, b) { + return a[0] - b[0] || a[1] - b[1]; +} + +// Computes the upper convex hull per the monotone chain algorithm. +// Assumes points.length >= 3, is sorted by x, unique in y. +// Returns an array of indices into points in left-to-right order. +function computeUpperHullIndexes(points) { + var n = points.length, + indexes = [0, 1], + size = 2; + + for (var i = 2; i < n; ++i) { + while (size > 1 && cross$1(points[indexes[size - 2]], points[indexes[size - 1]], points[i]) <= 0) --size; + indexes[size++] = i; + } + + return indexes.slice(0, size); // remove popped points +} + +function hull(points) { + if ((n = points.length) < 3) return null; + + var i, + n, + sortedPoints = new Array(n), + flippedPoints = new Array(n); + + for (i = 0; i < n; ++i) sortedPoints[i] = [+points[i][0], +points[i][1], i]; + sortedPoints.sort(lexicographicOrder); + for (i = 0; i < n; ++i) flippedPoints[i] = [sortedPoints[i][0], -sortedPoints[i][1]]; + + var upperIndexes = computeUpperHullIndexes(sortedPoints), + lowerIndexes = computeUpperHullIndexes(flippedPoints); + + // Construct the hull polygon, removing possible duplicate endpoints. + var skipLeft = lowerIndexes[0] === upperIndexes[0], + skipRight = lowerIndexes[lowerIndexes.length - 1] === upperIndexes[upperIndexes.length - 1], + hull = []; + + // Add upper hull in right-to-l order. + // Then add lower hull in left-to-right order. + for (i = upperIndexes.length - 1; i >= 0; --i) hull.push(points[sortedPoints[upperIndexes[i]][2]]); + for (i = +skipLeft; i < lowerIndexes.length - skipRight; ++i) hull.push(points[sortedPoints[lowerIndexes[i]][2]]); + + return hull; +} + +function contains$1(polygon, point) { + var n = polygon.length, + p = polygon[n - 1], + x = point[0], y = point[1], + x0 = p[0], y0 = p[1], + x1, y1, + inside = false; + + for (var i = 0; i < n; ++i) { + p = polygon[i], x1 = p[0], y1 = p[1]; + if (((y1 > y) !== (y0 > y)) && (x < (x0 - x1) * (y - y1) / (y0 - y1) + x1)) inside = !inside; + x0 = x1, y0 = y1; + } + + return inside; +} + +function length$2(polygon) { + var i = -1, + n = polygon.length, + b = polygon[n - 1], + xa, + ya, + xb = b[0], + yb = b[1], + perimeter = 0; + + while (++i < n) { + xa = xb; + ya = yb; + b = polygon[i]; + xb = b[0]; + yb = b[1]; + xa -= xb; + ya -= yb; + perimeter += Math.sqrt(xa * xa + ya * ya); + } + + return perimeter; +} + +var slice$4 = [].slice; + +var noabort = {}; + +function Queue(size) { + this._size = size; + this._call = + this._error = null; + this._tasks = []; + this._data = []; + this._waiting = + this._active = + this._ended = + this._start = 0; // inside a synchronous task callback? +} + +Queue.prototype = queue.prototype = { + constructor: Queue, + defer: function(callback) { + if (typeof callback !== "function") throw new Error("invalid callback"); + if (this._call) throw new Error("defer after await"); + if (this._error != null) return this; + var t = slice$4.call(arguments, 1); + t.push(callback); + ++this._waiting, this._tasks.push(t); + poke$1(this); + return this; + }, + abort: function() { + if (this._error == null) abort(this, new Error("abort")); + return this; + }, + await: function(callback) { + if (typeof callback !== "function") throw new Error("invalid callback"); + if (this._call) throw new Error("multiple await"); + this._call = function(error, results) { callback.apply(null, [error].concat(results)); }; + maybeNotify(this); + return this; + }, + awaitAll: function(callback) { + if (typeof callback !== "function") throw new Error("invalid callback"); + if (this._call) throw new Error("multiple await"); + this._call = callback; + maybeNotify(this); + return this; + } +}; + +function poke$1(q) { + if (!q._start) { + try { start$1(q); } // let the current task complete + catch (e) { + if (q._tasks[q._ended + q._active - 1]) abort(q, e); // task errored synchronously + else if (!q._data) throw e; // await callback errored synchronously + } + } +} + +function start$1(q) { + while (q._start = q._waiting && q._active < q._size) { + var i = q._ended + q._active, + t = q._tasks[i], + j = t.length - 1, + c = t[j]; + t[j] = end(q, i); + --q._waiting, ++q._active; + t = c.apply(null, t); + if (!q._tasks[i]) continue; // task finished synchronously + q._tasks[i] = t || noabort; + } +} + +function end(q, i) { + return function(e, r) { + if (!q._tasks[i]) return; // ignore multiple callbacks + --q._active, ++q._ended; + q._tasks[i] = null; + if (q._error != null) return; // ignore secondary errors + if (e != null) { + abort(q, e); + } else { + q._data[i] = r; + if (q._waiting) poke$1(q); + else maybeNotify(q); + } + }; +} + +function abort(q, e) { + var i = q._tasks.length, t; + q._error = e; // ignore active callbacks + q._data = undefined; // allow gc + q._waiting = NaN; // prevent starting + + while (--i >= 0) { + if (t = q._tasks[i]) { + q._tasks[i] = null; + if (t.abort) { + try { t.abort(); } + catch (e) { /* ignore */ } + } + } + } + + q._active = NaN; // allow notification + maybeNotify(q); +} + +function maybeNotify(q) { + if (!q._active && q._call) { + var d = q._data; + q._data = undefined; // allow gc + q._call(q._error, d); + } +} + +function queue(concurrency) { + if (concurrency == null) concurrency = Infinity; + else if (!((concurrency = +concurrency) >= 1)) throw new Error("invalid concurrency"); + return new Queue(concurrency); +} + +function defaultSource$1() { + return Math.random(); +} + +var uniform = (function sourceRandomUniform(source) { + function randomUniform(min, max) { + min = min == null ? 0 : +min; + max = max == null ? 1 : +max; + if (arguments.length === 1) max = min, min = 0; + else max -= min; + return function() { + return source() * max + min; + }; + } + + randomUniform.source = sourceRandomUniform; + + return randomUniform; +})(defaultSource$1); + +var normal = (function sourceRandomNormal(source) { + function randomNormal(mu, sigma) { + var x, r; + mu = mu == null ? 0 : +mu; + sigma = sigma == null ? 1 : +sigma; + return function() { + var y; + + // If available, use the second previously-generated uniform random. + if (x != null) y = x, x = null; + + // Otherwise, generate a new x and y. + else do { + x = source() * 2 - 1; + y = source() * 2 - 1; + r = x * x + y * y; + } while (!r || r > 1); + + return mu + sigma * y * Math.sqrt(-2 * Math.log(r) / r); + }; + } + + randomNormal.source = sourceRandomNormal; + + return randomNormal; +})(defaultSource$1); + +var logNormal = (function sourceRandomLogNormal(source) { + function randomLogNormal() { + var randomNormal = normal.source(source).apply(this, arguments); + return function() { + return Math.exp(randomNormal()); + }; + } + + randomLogNormal.source = sourceRandomLogNormal; + + return randomLogNormal; +})(defaultSource$1); + +var irwinHall = (function sourceRandomIrwinHall(source) { + function randomIrwinHall(n) { + return function() { + for (var sum = 0, i = 0; i < n; ++i) sum += source(); + return sum; + }; + } + + randomIrwinHall.source = sourceRandomIrwinHall; + + return randomIrwinHall; +})(defaultSource$1); + +var bates = (function sourceRandomBates(source) { + function randomBates(n) { + var randomIrwinHall = irwinHall.source(source)(n); + return function() { + return randomIrwinHall() / n; + }; + } + + randomBates.source = sourceRandomBates; + + return randomBates; +})(defaultSource$1); + +var exponential$1 = (function sourceRandomExponential(source) { + function randomExponential(lambda) { + return function() { + return -Math.log(1 - source()) / lambda; + }; + } + + randomExponential.source = sourceRandomExponential; + + return randomExponential; +})(defaultSource$1); + +function request(url, callback) { + var request, + event = dispatch("beforesend", "progress", "load", "error"), + mimeType, + headers = map$1(), + xhr = new XMLHttpRequest, + user = null, + password = null, + response, + responseType, + timeout = 0; + + // If IE does not support CORS, use XDomainRequest. + if (typeof XDomainRequest !== "undefined" + && !("withCredentials" in xhr) + && /^(http(s)?:)?\/\//.test(url)) xhr = new XDomainRequest; + + "onload" in xhr + ? xhr.onload = xhr.onerror = xhr.ontimeout = respond + : xhr.onreadystatechange = function(o) { xhr.readyState > 3 && respond(o); }; + + function respond(o) { + var status = xhr.status, result; + if (!status && hasResponse(xhr) + || status >= 200 && status < 300 + || status === 304) { + if (response) { + try { + result = response.call(request, xhr); + } catch (e) { + event.call("error", request, e); + return; + } + } else { + result = xhr; + } + event.call("load", request, result); + } else { + event.call("error", request, o); + } + } + + xhr.onprogress = function(e) { + event.call("progress", request, e); + }; + + request = { + header: function(name, value) { + name = (name + "").toLowerCase(); + if (arguments.length < 2) return headers.get(name); + if (value == null) headers.remove(name); + else headers.set(name, value + ""); + return request; + }, + + // If mimeType is non-null and no Accept header is set, a default is used. + mimeType: function(value) { + if (!arguments.length) return mimeType; + mimeType = value == null ? null : value + ""; + return request; + }, + + // Specifies what type the response value should take; + // for instance, arraybuffer, blob, document, or text. + responseType: function(value) { + if (!arguments.length) return responseType; + responseType = value; + return request; + }, + + timeout: function(value) { + if (!arguments.length) return timeout; + timeout = +value; + return request; + }, + + user: function(value) { + return arguments.length < 1 ? user : (user = value == null ? null : value + "", request); + }, + + password: function(value) { + return arguments.length < 1 ? password : (password = value == null ? null : value + "", request); + }, + + // Specify how to convert the response content to a specific type; + // changes the callback value on "load" events. + response: function(value) { + response = value; + return request; + }, + + // Alias for send("GET", …). + get: function(data, callback) { + return request.send("GET", data, callback); + }, + + // Alias for send("POST", …). + post: function(data, callback) { + return request.send("POST", data, callback); + }, + + // If callback is non-null, it will be used for error and load events. + send: function(method, data, callback) { + xhr.open(method, url, true, user, password); + if (mimeType != null && !headers.has("accept")) headers.set("accept", mimeType + ",*/*"); + if (xhr.setRequestHeader) headers.each(function(value, name) { xhr.setRequestHeader(name, value); }); + if (mimeType != null && xhr.overrideMimeType) xhr.overrideMimeType(mimeType); + if (responseType != null) xhr.responseType = responseType; + if (timeout > 0) xhr.timeout = timeout; + if (callback == null && typeof data === "function") callback = data, data = null; + if (callback != null && callback.length === 1) callback = fixCallback(callback); + if (callback != null) request.on("error", callback).on("load", function(xhr) { callback(null, xhr); }); + event.call("beforesend", request, xhr); + xhr.send(data == null ? null : data); + return request; + }, + + abort: function() { + xhr.abort(); + return request; + }, + + on: function() { + var value = event.on.apply(event, arguments); + return value === event ? request : value; + } + }; + + if (callback != null) { + if (typeof callback !== "function") throw new Error("invalid callback: " + callback); + return request.get(callback); + } + + return request; +} + +function fixCallback(callback) { + return function(error, xhr) { + callback(error == null ? xhr : null); + }; +} + +function hasResponse(xhr) { + var type = xhr.responseType; + return type && type !== "text" + ? xhr.response // null on error + : xhr.responseText; // "" on error +} + +function type$1(defaultMimeType, response) { + return function(url, callback) { + var r = request(url).mimeType(defaultMimeType).response(response); + if (callback != null) { + if (typeof callback !== "function") throw new Error("invalid callback: " + callback); + return r.get(callback); + } + return r; + }; +} + +var html = type$1("text/html", function(xhr) { + return document.createRange().createContextualFragment(xhr.responseText); +}); + +var json = type$1("application/json", function(xhr) { + return JSON.parse(xhr.responseText); +}); + +var text = type$1("text/plain", function(xhr) { + return xhr.responseText; +}); + +var xml = type$1("application/xml", function(xhr) { + var xml = xhr.responseXML; + if (!xml) throw new Error("parse error"); + return xml; +}); + +function dsv$1(defaultMimeType, parse) { + return function(url, row, callback) { + if (arguments.length < 3) callback = row, row = null; + var r = request(url).mimeType(defaultMimeType); + r.row = function(_) { return arguments.length ? r.response(responseOf(parse, row = _)) : row; }; + r.row(row); + return callback ? r.get(callback) : r; + }; +} + +function responseOf(parse, row) { + return function(request$$1) { + return parse(request$$1.responseText, row); + }; +} + +var csv$1 = dsv$1("text/csv", csvParse); + +var tsv$1 = dsv$1("text/tab-separated-values", tsvParse); + +var array$2 = Array.prototype; + +var map$3 = array$2.map; +var slice$5 = array$2.slice; + +var implicit = {name: "implicit"}; + +function ordinal(range) { + var index = map$1(), + domain = [], + unknown = implicit; + + range = range == null ? [] : slice$5.call(range); + + function scale(d) { + var key = d + "", i = index.get(key); + if (!i) { + if (unknown !== implicit) return unknown; + index.set(key, i = domain.push(d)); + } + return range[(i - 1) % range.length]; + } + + scale.domain = function(_) { + if (!arguments.length) return domain.slice(); + domain = [], index = map$1(); + var i = -1, n = _.length, d, key; + while (++i < n) if (!index.has(key = (d = _[i]) + "")) index.set(key, domain.push(d)); + return scale; + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), scale) : range.slice(); + }; + + scale.unknown = function(_) { + return arguments.length ? (unknown = _, scale) : unknown; + }; + + scale.copy = function() { + return ordinal() + .domain(domain) + .range(range) + .unknown(unknown); + }; + + return scale; +} + +function band() { + var scale = ordinal().unknown(undefined), + domain = scale.domain, + ordinalRange = scale.range, + range$$1 = [0, 1], + step, + bandwidth, + round = false, + paddingInner = 0, + paddingOuter = 0, + align = 0.5; + + delete scale.unknown; + + function rescale() { + var n = domain().length, + reverse = range$$1[1] < range$$1[0], + start = range$$1[reverse - 0], + stop = range$$1[1 - reverse]; + step = (stop - start) / Math.max(1, n - paddingInner + paddingOuter * 2); + if (round) step = Math.floor(step); + start += (stop - start - step * (n - paddingInner)) * align; + bandwidth = step * (1 - paddingInner); + if (round) start = Math.round(start), bandwidth = Math.round(bandwidth); + var values = sequence(n).map(function(i) { return start + step * i; }); + return ordinalRange(reverse ? values.reverse() : values); + } + + scale.domain = function(_) { + return arguments.length ? (domain(_), rescale()) : domain(); + }; + + scale.range = function(_) { + return arguments.length ? (range$$1 = [+_[0], +_[1]], rescale()) : range$$1.slice(); + }; + + scale.rangeRound = function(_) { + return range$$1 = [+_[0], +_[1]], round = true, rescale(); + }; + + scale.bandwidth = function() { + return bandwidth; + }; + + scale.step = function() { + return step; + }; + + scale.round = function(_) { + return arguments.length ? (round = !!_, rescale()) : round; + }; + + scale.padding = function(_) { + return arguments.length ? (paddingInner = paddingOuter = Math.max(0, Math.min(1, _)), rescale()) : paddingInner; + }; + + scale.paddingInner = function(_) { + return arguments.length ? (paddingInner = Math.max(0, Math.min(1, _)), rescale()) : paddingInner; + }; + + scale.paddingOuter = function(_) { + return arguments.length ? (paddingOuter = Math.max(0, Math.min(1, _)), rescale()) : paddingOuter; + }; + + scale.align = function(_) { + return arguments.length ? (align = Math.max(0, Math.min(1, _)), rescale()) : align; + }; + + scale.copy = function() { + return band() + .domain(domain()) + .range(range$$1) + .round(round) + .paddingInner(paddingInner) + .paddingOuter(paddingOuter) + .align(align); + }; + + return rescale(); +} + +function pointish(scale) { + var copy = scale.copy; + + scale.padding = scale.paddingOuter; + delete scale.paddingInner; + delete scale.paddingOuter; + + scale.copy = function() { + return pointish(copy()); + }; + + return scale; +} + +function point$1() { + return pointish(band().paddingInner(1)); +} + +function constant$9(x) { + return function() { + return x; + }; +} + +function number$2(x) { + return +x; +} + +var unit = [0, 1]; + +function deinterpolateLinear(a, b) { + return (b -= (a = +a)) + ? function(x) { return (x - a) / b; } + : constant$9(b); +} + +function deinterpolateClamp(deinterpolate) { + return function(a, b) { + var d = deinterpolate(a = +a, b = +b); + return function(x) { return x <= a ? 0 : x >= b ? 1 : d(x); }; + }; +} + +function reinterpolateClamp(reinterpolate) { + return function(a, b) { + var r = reinterpolate(a = +a, b = +b); + return function(t) { return t <= 0 ? a : t >= 1 ? b : r(t); }; + }; +} + +function bimap(domain, range, deinterpolate, reinterpolate) { + var d0 = domain[0], d1 = domain[1], r0 = range[0], r1 = range[1]; + if (d1 < d0) d0 = deinterpolate(d1, d0), r0 = reinterpolate(r1, r0); + else d0 = deinterpolate(d0, d1), r0 = reinterpolate(r0, r1); + return function(x) { return r0(d0(x)); }; +} + +function polymap(domain, range, deinterpolate, reinterpolate) { + var j = Math.min(domain.length, range.length) - 1, + d = new Array(j), + r = new Array(j), + i = -1; + + // Reverse descending domains. + if (domain[j] < domain[0]) { + domain = domain.slice().reverse(); + range = range.slice().reverse(); + } + + while (++i < j) { + d[i] = deinterpolate(domain[i], domain[i + 1]); + r[i] = reinterpolate(range[i], range[i + 1]); + } + + return function(x) { + var i = bisectRight(domain, x, 1, j) - 1; + return r[i](d[i](x)); + }; +} + +function copy(source, target) { + return target + .domain(source.domain()) + .range(source.range()) + .interpolate(source.interpolate()) + .clamp(source.clamp()); +} + +// deinterpolate(a, b)(x) takes a domain value x in [a,b] and returns the corresponding parameter t in [0,1]. +// reinterpolate(a, b)(t) takes a parameter t in [0,1] and returns the corresponding domain value x in [a,b]. +function continuous(deinterpolate, reinterpolate) { + var domain = unit, + range = unit, + interpolate$$1 = interpolateValue, + clamp = false, + piecewise, + output, + input; + + function rescale() { + piecewise = Math.min(domain.length, range.length) > 2 ? polymap : bimap; + output = input = null; + return scale; + } + + function scale(x) { + return (output || (output = piecewise(domain, range, clamp ? deinterpolateClamp(deinterpolate) : deinterpolate, interpolate$$1)))(+x); + } + + scale.invert = function(y) { + return (input || (input = piecewise(range, domain, deinterpolateLinear, clamp ? reinterpolateClamp(reinterpolate) : reinterpolate)))(+y); + }; + + scale.domain = function(_) { + return arguments.length ? (domain = map$3.call(_, number$2), rescale()) : domain.slice(); + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), rescale()) : range.slice(); + }; + + scale.rangeRound = function(_) { + return range = slice$5.call(_), interpolate$$1 = interpolateRound, rescale(); + }; + + scale.clamp = function(_) { + return arguments.length ? (clamp = !!_, rescale()) : clamp; + }; + + scale.interpolate = function(_) { + return arguments.length ? (interpolate$$1 = _, rescale()) : interpolate$$1; + }; + + return rescale(); +} + +function tickFormat(domain, count, specifier) { + var start = domain[0], + stop = domain[domain.length - 1], + step = tickStep(start, stop, count == null ? 10 : count), + precision; + specifier = formatSpecifier(specifier == null ? ",f" : specifier); + switch (specifier.type) { + case "s": { + var value = Math.max(Math.abs(start), Math.abs(stop)); + if (specifier.precision == null && !isNaN(precision = precisionPrefix(step, value))) specifier.precision = precision; + return exports.formatPrefix(specifier, value); + } + case "": + case "e": + case "g": + case "p": + case "r": { + if (specifier.precision == null && !isNaN(precision = precisionRound(step, Math.max(Math.abs(start), Math.abs(stop))))) specifier.precision = precision - (specifier.type === "e"); + break; + } + case "f": + case "%": { + if (specifier.precision == null && !isNaN(precision = precisionFixed(step))) specifier.precision = precision - (specifier.type === "%") * 2; + break; + } + } + return exports.format(specifier); +} + +function linearish(scale) { + var domain = scale.domain; + + scale.ticks = function(count) { + var d = domain(); + return ticks(d[0], d[d.length - 1], count == null ? 10 : count); + }; + + scale.tickFormat = function(count, specifier) { + return tickFormat(domain(), count, specifier); + }; + + scale.nice = function(count) { + if (count == null) count = 10; + + var d = domain(), + i0 = 0, + i1 = d.length - 1, + start = d[i0], + stop = d[i1], + step; + + if (stop < start) { + step = start, start = stop, stop = step; + step = i0, i0 = i1, i1 = step; + } + + step = tickIncrement(start, stop, count); + + if (step > 0) { + start = Math.floor(start / step) * step; + stop = Math.ceil(stop / step) * step; + step = tickIncrement(start, stop, count); + } else if (step < 0) { + start = Math.ceil(start * step) / step; + stop = Math.floor(stop * step) / step; + step = tickIncrement(start, stop, count); + } + + if (step > 0) { + d[i0] = Math.floor(start / step) * step; + d[i1] = Math.ceil(stop / step) * step; + domain(d); + } else if (step < 0) { + d[i0] = Math.ceil(start * step) / step; + d[i1] = Math.floor(stop * step) / step; + domain(d); + } + + return scale; + }; + + return scale; +} + +function linear$2() { + var scale = continuous(deinterpolateLinear, reinterpolate); + + scale.copy = function() { + return copy(scale, linear$2()); + }; + + return linearish(scale); +} + +function identity$6() { + var domain = [0, 1]; + + function scale(x) { + return +x; + } + + scale.invert = scale; + + scale.domain = scale.range = function(_) { + return arguments.length ? (domain = map$3.call(_, number$2), scale) : domain.slice(); + }; + + scale.copy = function() { + return identity$6().domain(domain); + }; + + return linearish(scale); +} + +function nice(domain, interval) { + domain = domain.slice(); + + var i0 = 0, + i1 = domain.length - 1, + x0 = domain[i0], + x1 = domain[i1], + t; + + if (x1 < x0) { + t = i0, i0 = i1, i1 = t; + t = x0, x0 = x1, x1 = t; + } + + domain[i0] = interval.floor(x0); + domain[i1] = interval.ceil(x1); + return domain; +} + +function deinterpolate(a, b) { + return (b = Math.log(b / a)) + ? function(x) { return Math.log(x / a) / b; } + : constant$9(b); +} + +function reinterpolate$1(a, b) { + return a < 0 + ? function(t) { return -Math.pow(-b, t) * Math.pow(-a, 1 - t); } + : function(t) { return Math.pow(b, t) * Math.pow(a, 1 - t); }; +} + +function pow10(x) { + return isFinite(x) ? +("1e" + x) : x < 0 ? 0 : x; +} + +function powp(base) { + return base === 10 ? pow10 + : base === Math.E ? Math.exp + : function(x) { return Math.pow(base, x); }; +} + +function logp(base) { + return base === Math.E ? Math.log + : base === 10 && Math.log10 + || base === 2 && Math.log2 + || (base = Math.log(base), function(x) { return Math.log(x) / base; }); +} + +function reflect(f) { + return function(x) { + return -f(-x); + }; +} + +function log$1() { + var scale = continuous(deinterpolate, reinterpolate$1).domain([1, 10]), + domain = scale.domain, + base = 10, + logs = logp(10), + pows = powp(10); + + function rescale() { + logs = logp(base), pows = powp(base); + if (domain()[0] < 0) logs = reflect(logs), pows = reflect(pows); + return scale; + } + + scale.base = function(_) { + return arguments.length ? (base = +_, rescale()) : base; + }; + + scale.domain = function(_) { + return arguments.length ? (domain(_), rescale()) : domain(); + }; + + scale.ticks = function(count) { + var d = domain(), + u = d[0], + v = d[d.length - 1], + r; + + if (r = v < u) i = u, u = v, v = i; + + var i = logs(u), + j = logs(v), + p, + k, + t, + n = count == null ? 10 : +count, + z = []; + + if (!(base % 1) && j - i < n) { + i = Math.round(i) - 1, j = Math.round(j) + 1; + if (u > 0) for (; i < j; ++i) { + for (k = 1, p = pows(i); k < base; ++k) { + t = p * k; + if (t < u) continue; + if (t > v) break; + z.push(t); + } + } else for (; i < j; ++i) { + for (k = base - 1, p = pows(i); k >= 1; --k) { + t = p * k; + if (t < u) continue; + if (t > v) break; + z.push(t); + } + } + } else { + z = ticks(i, j, Math.min(j - i, n)).map(pows); + } + + return r ? z.reverse() : z; + }; + + scale.tickFormat = function(count, specifier) { + if (specifier == null) specifier = base === 10 ? ".0e" : ","; + if (typeof specifier !== "function") specifier = exports.format(specifier); + if (count === Infinity) return specifier; + if (count == null) count = 10; + var k = Math.max(1, base * count / scale.ticks().length); // TODO fast estimate? + return function(d) { + var i = d / pows(Math.round(logs(d))); + if (i * base < base - 0.5) i *= base; + return i <= k ? specifier(d) : ""; + }; + }; + + scale.nice = function() { + return domain(nice(domain(), { + floor: function(x) { return pows(Math.floor(logs(x))); }, + ceil: function(x) { return pows(Math.ceil(logs(x))); } + })); + }; + + scale.copy = function() { + return copy(scale, log$1().base(base)); + }; + + return scale; +} + +function raise$1(x, exponent) { + return x < 0 ? -Math.pow(-x, exponent) : Math.pow(x, exponent); +} + +function pow$1() { + var exponent = 1, + scale = continuous(deinterpolate, reinterpolate), + domain = scale.domain; + + function deinterpolate(a, b) { + return (b = raise$1(b, exponent) - (a = raise$1(a, exponent))) + ? function(x) { return (raise$1(x, exponent) - a) / b; } + : constant$9(b); + } + + function reinterpolate(a, b) { + b = raise$1(b, exponent) - (a = raise$1(a, exponent)); + return function(t) { return raise$1(a + b * t, 1 / exponent); }; + } + + scale.exponent = function(_) { + return arguments.length ? (exponent = +_, domain(domain())) : exponent; + }; + + scale.copy = function() { + return copy(scale, pow$1().exponent(exponent)); + }; + + return linearish(scale); +} + +function sqrt$1() { + return pow$1().exponent(0.5); +} + +function quantile$$1() { + var domain = [], + range = [], + thresholds = []; + + function rescale() { + var i = 0, n = Math.max(1, range.length); + thresholds = new Array(n - 1); + while (++i < n) thresholds[i - 1] = threshold(domain, i / n); + return scale; + } + + function scale(x) { + if (!isNaN(x = +x)) return range[bisectRight(thresholds, x)]; + } + + scale.invertExtent = function(y) { + var i = range.indexOf(y); + return i < 0 ? [NaN, NaN] : [ + i > 0 ? thresholds[i - 1] : domain[0], + i < thresholds.length ? thresholds[i] : domain[domain.length - 1] + ]; + }; + + scale.domain = function(_) { + if (!arguments.length) return domain.slice(); + domain = []; + for (var i = 0, n = _.length, d; i < n; ++i) if (d = _[i], d != null && !isNaN(d = +d)) domain.push(d); + domain.sort(ascending); + return rescale(); + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), rescale()) : range.slice(); + }; + + scale.quantiles = function() { + return thresholds.slice(); + }; + + scale.copy = function() { + return quantile$$1() + .domain(domain) + .range(range); + }; + + return scale; +} + +function quantize$1() { + var x0 = 0, + x1 = 1, + n = 1, + domain = [0.5], + range = [0, 1]; + + function scale(x) { + if (x <= x) return range[bisectRight(domain, x, 0, n)]; + } + + function rescale() { + var i = -1; + domain = new Array(n); + while (++i < n) domain[i] = ((i + 1) * x1 - (i - n) * x0) / (n + 1); + return scale; + } + + scale.domain = function(_) { + return arguments.length ? (x0 = +_[0], x1 = +_[1], rescale()) : [x0, x1]; + }; + + scale.range = function(_) { + return arguments.length ? (n = (range = slice$5.call(_)).length - 1, rescale()) : range.slice(); + }; + + scale.invertExtent = function(y) { + var i = range.indexOf(y); + return i < 0 ? [NaN, NaN] + : i < 1 ? [x0, domain[0]] + : i >= n ? [domain[n - 1], x1] + : [domain[i - 1], domain[i]]; + }; + + scale.copy = function() { + return quantize$1() + .domain([x0, x1]) + .range(range); + }; + + return linearish(scale); +} + +function threshold$1() { + var domain = [0.5], + range = [0, 1], + n = 1; + + function scale(x) { + if (x <= x) return range[bisectRight(domain, x, 0, n)]; + } + + scale.domain = function(_) { + return arguments.length ? (domain = slice$5.call(_), n = Math.min(domain.length, range.length - 1), scale) : domain.slice(); + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), n = Math.min(domain.length, range.length - 1), scale) : range.slice(); + }; + + scale.invertExtent = function(y) { + var i = range.indexOf(y); + return [domain[i - 1], domain[i]]; + }; + + scale.copy = function() { + return threshold$1() + .domain(domain) + .range(range); + }; + + return scale; +} + +var t0$1 = new Date; +var t1$1 = new Date; + +function newInterval(floori, offseti, count, field) { + + function interval(date) { + return floori(date = new Date(+date)), date; + } + + interval.floor = interval; + + interval.ceil = function(date) { + return floori(date = new Date(date - 1)), offseti(date, 1), floori(date), date; + }; + + interval.round = function(date) { + var d0 = interval(date), + d1 = interval.ceil(date); + return date - d0 < d1 - date ? d0 : d1; + }; + + interval.offset = function(date, step) { + return offseti(date = new Date(+date), step == null ? 1 : Math.floor(step)), date; + }; + + interval.range = function(start, stop, step) { + var range = [], previous; + start = interval.ceil(start); + step = step == null ? 1 : Math.floor(step); + if (!(start < stop) || !(step > 0)) return range; // also handles Invalid Date + do range.push(previous = new Date(+start)), offseti(start, step), floori(start); + while (previous < start && start < stop); + return range; + }; + + interval.filter = function(test) { + return newInterval(function(date) { + if (date >= date) while (floori(date), !test(date)) date.setTime(date - 1); + }, function(date, step) { + if (date >= date) { + if (step < 0) while (++step <= 0) { + while (offseti(date, -1), !test(date)) {} // eslint-disable-line no-empty + } else while (--step >= 0) { + while (offseti(date, +1), !test(date)) {} // eslint-disable-line no-empty + } + } + }); + }; + + if (count) { + interval.count = function(start, end) { + t0$1.setTime(+start), t1$1.setTime(+end); + floori(t0$1), floori(t1$1); + return Math.floor(count(t0$1, t1$1)); + }; + + interval.every = function(step) { + step = Math.floor(step); + return !isFinite(step) || !(step > 0) ? null + : !(step > 1) ? interval + : interval.filter(field + ? function(d) { return field(d) % step === 0; } + : function(d) { return interval.count(0, d) % step === 0; }); + }; + } + + return interval; +} + +var millisecond = newInterval(function() { + // noop +}, function(date, step) { + date.setTime(+date + step); +}, function(start, end) { + return end - start; +}); + +// An optimized implementation for this simple case. +millisecond.every = function(k) { + k = Math.floor(k); + if (!isFinite(k) || !(k > 0)) return null; + if (!(k > 1)) return millisecond; + return newInterval(function(date) { + date.setTime(Math.floor(date / k) * k); + }, function(date, step) { + date.setTime(+date + step * k); + }, function(start, end) { + return (end - start) / k; + }); +}; + +var milliseconds = millisecond.range; + +var durationSecond$1 = 1e3; +var durationMinute$1 = 6e4; +var durationHour$1 = 36e5; +var durationDay$1 = 864e5; +var durationWeek$1 = 6048e5; + +var second = newInterval(function(date) { + date.setTime(Math.floor(date / durationSecond$1) * durationSecond$1); +}, function(date, step) { + date.setTime(+date + step * durationSecond$1); +}, function(start, end) { + return (end - start) / durationSecond$1; +}, function(date) { + return date.getUTCSeconds(); +}); + +var seconds = second.range; + +var minute = newInterval(function(date) { + date.setTime(Math.floor(date / durationMinute$1) * durationMinute$1); +}, function(date, step) { + date.setTime(+date + step * durationMinute$1); +}, function(start, end) { + return (end - start) / durationMinute$1; +}, function(date) { + return date.getMinutes(); +}); + +var minutes = minute.range; + +var hour = newInterval(function(date) { + var offset = date.getTimezoneOffset() * durationMinute$1 % durationHour$1; + if (offset < 0) offset += durationHour$1; + date.setTime(Math.floor((+date - offset) / durationHour$1) * durationHour$1 + offset); +}, function(date, step) { + date.setTime(+date + step * durationHour$1); +}, function(start, end) { + return (end - start) / durationHour$1; +}, function(date) { + return date.getHours(); +}); + +var hours = hour.range; + +var day = newInterval(function(date) { + date.setHours(0, 0, 0, 0); +}, function(date, step) { + date.setDate(date.getDate() + step); +}, function(start, end) { + return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute$1) / durationDay$1; +}, function(date) { + return date.getDate() - 1; +}); + +var days = day.range; + +function weekday(i) { + return newInterval(function(date) { + date.setDate(date.getDate() - (date.getDay() + 7 - i) % 7); + date.setHours(0, 0, 0, 0); + }, function(date, step) { + date.setDate(date.getDate() + step * 7); + }, function(start, end) { + return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute$1) / durationWeek$1; + }); +} + +var sunday = weekday(0); +var monday = weekday(1); +var tuesday = weekday(2); +var wednesday = weekday(3); +var thursday = weekday(4); +var friday = weekday(5); +var saturday = weekday(6); + +var sundays = sunday.range; +var mondays = monday.range; +var tuesdays = tuesday.range; +var wednesdays = wednesday.range; +var thursdays = thursday.range; +var fridays = friday.range; +var saturdays = saturday.range; + +var month = newInterval(function(date) { + date.setDate(1); + date.setHours(0, 0, 0, 0); +}, function(date, step) { + date.setMonth(date.getMonth() + step); +}, function(start, end) { + return end.getMonth() - start.getMonth() + (end.getFullYear() - start.getFullYear()) * 12; +}, function(date) { + return date.getMonth(); +}); + +var months = month.range; + +var year = newInterval(function(date) { + date.setMonth(0, 1); + date.setHours(0, 0, 0, 0); +}, function(date, step) { + date.setFullYear(date.getFullYear() + step); +}, function(start, end) { + return end.getFullYear() - start.getFullYear(); +}, function(date) { + return date.getFullYear(); +}); + +// An optimized implementation for this simple case. +year.every = function(k) { + return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : newInterval(function(date) { + date.setFullYear(Math.floor(date.getFullYear() / k) * k); + date.setMonth(0, 1); + date.setHours(0, 0, 0, 0); + }, function(date, step) { + date.setFullYear(date.getFullYear() + step * k); + }); +}; + +var years = year.range; + +var utcMinute = newInterval(function(date) { + date.setUTCSeconds(0, 0); +}, function(date, step) { + date.setTime(+date + step * durationMinute$1); +}, function(start, end) { + return (end - start) / durationMinute$1; +}, function(date) { + return date.getUTCMinutes(); +}); + +var utcMinutes = utcMinute.range; + +var utcHour = newInterval(function(date) { + date.setUTCMinutes(0, 0, 0); +}, function(date, step) { + date.setTime(+date + step * durationHour$1); +}, function(start, end) { + return (end - start) / durationHour$1; +}, function(date) { + return date.getUTCHours(); +}); + +var utcHours = utcHour.range; + +var utcDay = newInterval(function(date) { + date.setUTCHours(0, 0, 0, 0); +}, function(date, step) { + date.setUTCDate(date.getUTCDate() + step); +}, function(start, end) { + return (end - start) / durationDay$1; +}, function(date) { + return date.getUTCDate() - 1; +}); + +var utcDays = utcDay.range; + +function utcWeekday(i) { + return newInterval(function(date) { + date.setUTCDate(date.getUTCDate() - (date.getUTCDay() + 7 - i) % 7); + date.setUTCHours(0, 0, 0, 0); + }, function(date, step) { + date.setUTCDate(date.getUTCDate() + step * 7); + }, function(start, end) { + return (end - start) / durationWeek$1; + }); +} + +var utcSunday = utcWeekday(0); +var utcMonday = utcWeekday(1); +var utcTuesday = utcWeekday(2); +var utcWednesday = utcWeekday(3); +var utcThursday = utcWeekday(4); +var utcFriday = utcWeekday(5); +var utcSaturday = utcWeekday(6); + +var utcSundays = utcSunday.range; +var utcMondays = utcMonday.range; +var utcTuesdays = utcTuesday.range; +var utcWednesdays = utcWednesday.range; +var utcThursdays = utcThursday.range; +var utcFridays = utcFriday.range; +var utcSaturdays = utcSaturday.range; + +var utcMonth = newInterval(function(date) { + date.setUTCDate(1); + date.setUTCHours(0, 0, 0, 0); +}, function(date, step) { + date.setUTCMonth(date.getUTCMonth() + step); +}, function(start, end) { + return end.getUTCMonth() - start.getUTCMonth() + (end.getUTCFullYear() - start.getUTCFullYear()) * 12; +}, function(date) { + return date.getUTCMonth(); +}); + +var utcMonths = utcMonth.range; + +var utcYear = newInterval(function(date) { + date.setUTCMonth(0, 1); + date.setUTCHours(0, 0, 0, 0); +}, function(date, step) { + date.setUTCFullYear(date.getUTCFullYear() + step); +}, function(start, end) { + return end.getUTCFullYear() - start.getUTCFullYear(); +}, function(date) { + return date.getUTCFullYear(); +}); + +// An optimized implementation for this simple case. +utcYear.every = function(k) { + return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : newInterval(function(date) { + date.setUTCFullYear(Math.floor(date.getUTCFullYear() / k) * k); + date.setUTCMonth(0, 1); + date.setUTCHours(0, 0, 0, 0); + }, function(date, step) { + date.setUTCFullYear(date.getUTCFullYear() + step * k); + }); +}; + +var utcYears = utcYear.range; + +function localDate(d) { + if (0 <= d.y && d.y < 100) { + var date = new Date(-1, d.m, d.d, d.H, d.M, d.S, d.L); + date.setFullYear(d.y); + return date; + } + return new Date(d.y, d.m, d.d, d.H, d.M, d.S, d.L); +} + +function utcDate(d) { + if (0 <= d.y && d.y < 100) { + var date = new Date(Date.UTC(-1, d.m, d.d, d.H, d.M, d.S, d.L)); + date.setUTCFullYear(d.y); + return date; + } + return new Date(Date.UTC(d.y, d.m, d.d, d.H, d.M, d.S, d.L)); +} + +function newYear(y) { + return {y: y, m: 0, d: 1, H: 0, M: 0, S: 0, L: 0}; +} + +function formatLocale$1(locale) { + var locale_dateTime = locale.dateTime, + locale_date = locale.date, + locale_time = locale.time, + locale_periods = locale.periods, + locale_weekdays = locale.days, + locale_shortWeekdays = locale.shortDays, + locale_months = locale.months, + locale_shortMonths = locale.shortMonths; + + var periodRe = formatRe(locale_periods), + periodLookup = formatLookup(locale_periods), + weekdayRe = formatRe(locale_weekdays), + weekdayLookup = formatLookup(locale_weekdays), + shortWeekdayRe = formatRe(locale_shortWeekdays), + shortWeekdayLookup = formatLookup(locale_shortWeekdays), + monthRe = formatRe(locale_months), + monthLookup = formatLookup(locale_months), + shortMonthRe = formatRe(locale_shortMonths), + shortMonthLookup = formatLookup(locale_shortMonths); + + var formats = { + "a": formatShortWeekday, + "A": formatWeekday, + "b": formatShortMonth, + "B": formatMonth, + "c": null, + "d": formatDayOfMonth, + "e": formatDayOfMonth, + "f": formatMicroseconds, + "H": formatHour24, + "I": formatHour12, + "j": formatDayOfYear, + "L": formatMilliseconds, + "m": formatMonthNumber, + "M": formatMinutes, + "p": formatPeriod, + "Q": formatUnixTimestamp, + "s": formatUnixTimestampSeconds, + "S": formatSeconds, + "u": formatWeekdayNumberMonday, + "U": formatWeekNumberSunday, + "V": formatWeekNumberISO, + "w": formatWeekdayNumberSunday, + "W": formatWeekNumberMonday, + "x": null, + "X": null, + "y": formatYear, + "Y": formatFullYear, + "Z": formatZone, + "%": formatLiteralPercent + }; + + var utcFormats = { + "a": formatUTCShortWeekday, + "A": formatUTCWeekday, + "b": formatUTCShortMonth, + "B": formatUTCMonth, + "c": null, + "d": formatUTCDayOfMonth, + "e": formatUTCDayOfMonth, + "f": formatUTCMicroseconds, + "H": formatUTCHour24, + "I": formatUTCHour12, + "j": formatUTCDayOfYear, + "L": formatUTCMilliseconds, + "m": formatUTCMonthNumber, + "M": formatUTCMinutes, + "p": formatUTCPeriod, + "Q": formatUnixTimestamp, + "s": formatUnixTimestampSeconds, + "S": formatUTCSeconds, + "u": formatUTCWeekdayNumberMonday, + "U": formatUTCWeekNumberSunday, + "V": formatUTCWeekNumberISO, + "w": formatUTCWeekdayNumberSunday, + "W": formatUTCWeekNumberMonday, + "x": null, + "X": null, + "y": formatUTCYear, + "Y": formatUTCFullYear, + "Z": formatUTCZone, + "%": formatLiteralPercent + }; + + var parses = { + "a": parseShortWeekday, + "A": parseWeekday, + "b": parseShortMonth, + "B": parseMonth, + "c": parseLocaleDateTime, + "d": parseDayOfMonth, + "e": parseDayOfMonth, + "f": parseMicroseconds, + "H": parseHour24, + "I": parseHour24, + "j": parseDayOfYear, + "L": parseMilliseconds, + "m": parseMonthNumber, + "M": parseMinutes, + "p": parsePeriod, + "Q": parseUnixTimestamp, + "s": parseUnixTimestampSeconds, + "S": parseSeconds, + "u": parseWeekdayNumberMonday, + "U": parseWeekNumberSunday, + "V": parseWeekNumberISO, + "w": parseWeekdayNumberSunday, + "W": parseWeekNumberMonday, + "x": parseLocaleDate, + "X": parseLocaleTime, + "y": parseYear, + "Y": parseFullYear, + "Z": parseZone, + "%": parseLiteralPercent + }; + + // These recursive directive definitions must be deferred. + formats.x = newFormat(locale_date, formats); + formats.X = newFormat(locale_time, formats); + formats.c = newFormat(locale_dateTime, formats); + utcFormats.x = newFormat(locale_date, utcFormats); + utcFormats.X = newFormat(locale_time, utcFormats); + utcFormats.c = newFormat(locale_dateTime, utcFormats); + + function newFormat(specifier, formats) { + return function(date) { + var string = [], + i = -1, + j = 0, + n = specifier.length, + c, + pad, + format; + + if (!(date instanceof Date)) date = new Date(+date); + + while (++i < n) { + if (specifier.charCodeAt(i) === 37) { + string.push(specifier.slice(j, i)); + if ((pad = pads[c = specifier.charAt(++i)]) != null) c = specifier.charAt(++i); + else pad = c === "e" ? " " : "0"; + if (format = formats[c]) c = format(date, pad); + string.push(c); + j = i + 1; + } + } + + string.push(specifier.slice(j, i)); + return string.join(""); + }; + } + + function newParse(specifier, newDate) { + return function(string) { + var d = newYear(1900), + i = parseSpecifier(d, specifier, string += "", 0), + week, day$$1; + if (i != string.length) return null; + + // If a UNIX timestamp is specified, return it. + if ("Q" in d) return new Date(d.Q); + + // The am-pm flag is 0 for AM, and 1 for PM. + if ("p" in d) d.H = d.H % 12 + d.p * 12; + + // Convert day-of-week and week-of-year to day-of-year. + if ("V" in d) { + if (d.V < 1 || d.V > 53) return null; + if (!("w" in d)) d.w = 1; + if ("Z" in d) { + week = utcDate(newYear(d.y)), day$$1 = week.getUTCDay(); + week = day$$1 > 4 || day$$1 === 0 ? utcMonday.ceil(week) : utcMonday(week); + week = utcDay.offset(week, (d.V - 1) * 7); + d.y = week.getUTCFullYear(); + d.m = week.getUTCMonth(); + d.d = week.getUTCDate() + (d.w + 6) % 7; + } else { + week = newDate(newYear(d.y)), day$$1 = week.getDay(); + week = day$$1 > 4 || day$$1 === 0 ? monday.ceil(week) : monday(week); + week = day.offset(week, (d.V - 1) * 7); + d.y = week.getFullYear(); + d.m = week.getMonth(); + d.d = week.getDate() + (d.w + 6) % 7; + } + } else if ("W" in d || "U" in d) { + if (!("w" in d)) d.w = "u" in d ? d.u % 7 : "W" in d ? 1 : 0; + day$$1 = "Z" in d ? utcDate(newYear(d.y)).getUTCDay() : newDate(newYear(d.y)).getDay(); + d.m = 0; + d.d = "W" in d ? (d.w + 6) % 7 + d.W * 7 - (day$$1 + 5) % 7 : d.w + d.U * 7 - (day$$1 + 6) % 7; + } + + // If a time zone is specified, all fields are interpreted as UTC and then + // offset according to the specified time zone. + if ("Z" in d) { + d.H += d.Z / 100 | 0; + d.M += d.Z % 100; + return utcDate(d); + } + + // Otherwise, all fields are in local time. + return newDate(d); + }; + } + + function parseSpecifier(d, specifier, string, j) { + var i = 0, + n = specifier.length, + m = string.length, + c, + parse; + + while (i < n) { + if (j >= m) return -1; + c = specifier.charCodeAt(i++); + if (c === 37) { + c = specifier.charAt(i++); + parse = parses[c in pads ? specifier.charAt(i++) : c]; + if (!parse || ((j = parse(d, string, j)) < 0)) return -1; + } else if (c != string.charCodeAt(j++)) { + return -1; + } + } + + return j; + } + + function parsePeriod(d, string, i) { + var n = periodRe.exec(string.slice(i)); + return n ? (d.p = periodLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseShortWeekday(d, string, i) { + var n = shortWeekdayRe.exec(string.slice(i)); + return n ? (d.w = shortWeekdayLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseWeekday(d, string, i) { + var n = weekdayRe.exec(string.slice(i)); + return n ? (d.w = weekdayLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseShortMonth(d, string, i) { + var n = shortMonthRe.exec(string.slice(i)); + return n ? (d.m = shortMonthLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseMonth(d, string, i) { + var n = monthRe.exec(string.slice(i)); + return n ? (d.m = monthLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseLocaleDateTime(d, string, i) { + return parseSpecifier(d, locale_dateTime, string, i); + } + + function parseLocaleDate(d, string, i) { + return parseSpecifier(d, locale_date, string, i); + } + + function parseLocaleTime(d, string, i) { + return parseSpecifier(d, locale_time, string, i); + } + + function formatShortWeekday(d) { + return locale_shortWeekdays[d.getDay()]; + } + + function formatWeekday(d) { + return locale_weekdays[d.getDay()]; + } + + function formatShortMonth(d) { + return locale_shortMonths[d.getMonth()]; + } + + function formatMonth(d) { + return locale_months[d.getMonth()]; + } + + function formatPeriod(d) { + return locale_periods[+(d.getHours() >= 12)]; + } + + function formatUTCShortWeekday(d) { + return locale_shortWeekdays[d.getUTCDay()]; + } + + function formatUTCWeekday(d) { + return locale_weekdays[d.getUTCDay()]; + } + + function formatUTCShortMonth(d) { + return locale_shortMonths[d.getUTCMonth()]; + } + + function formatUTCMonth(d) { + return locale_months[d.getUTCMonth()]; + } + + function formatUTCPeriod(d) { + return locale_periods[+(d.getUTCHours() >= 12)]; + } + + return { + format: function(specifier) { + var f = newFormat(specifier += "", formats); + f.toString = function() { return specifier; }; + return f; + }, + parse: function(specifier) { + var p = newParse(specifier += "", localDate); + p.toString = function() { return specifier; }; + return p; + }, + utcFormat: function(specifier) { + var f = newFormat(specifier += "", utcFormats); + f.toString = function() { return specifier; }; + return f; + }, + utcParse: function(specifier) { + var p = newParse(specifier, utcDate); + p.toString = function() { return specifier; }; + return p; + } + }; +} + +var pads = {"-": "", "_": " ", "0": "0"}; +var numberRe = /^\s*\d+/; +var percentRe = /^%/; +var requoteRe = /[\\^$*+?|[\]().{}]/g; + +function pad(value, fill, width) { + var sign = value < 0 ? "-" : "", + string = (sign ? -value : value) + "", + length = string.length; + return sign + (length < width ? new Array(width - length + 1).join(fill) + string : string); +} + +function requote(s) { + return s.replace(requoteRe, "\\$&"); +} + +function formatRe(names) { + return new RegExp("^(?:" + names.map(requote).join("|") + ")", "i"); +} + +function formatLookup(names) { + var map = {}, i = -1, n = names.length; + while (++i < n) map[names[i].toLowerCase()] = i; + return map; +} + +function parseWeekdayNumberSunday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 1)); + return n ? (d.w = +n[0], i + n[0].length) : -1; +} + +function parseWeekdayNumberMonday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 1)); + return n ? (d.u = +n[0], i + n[0].length) : -1; +} + +function parseWeekNumberSunday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.U = +n[0], i + n[0].length) : -1; +} + +function parseWeekNumberISO(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.V = +n[0], i + n[0].length) : -1; +} + +function parseWeekNumberMonday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.W = +n[0], i + n[0].length) : -1; +} + +function parseFullYear(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 4)); + return n ? (d.y = +n[0], i + n[0].length) : -1; +} + +function parseYear(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.y = +n[0] + (+n[0] > 68 ? 1900 : 2000), i + n[0].length) : -1; +} + +function parseZone(d, string, i) { + var n = /^(Z)|([+-]\d\d)(?::?(\d\d))?/.exec(string.slice(i, i + 6)); + return n ? (d.Z = n[1] ? 0 : -(n[2] + (n[3] || "00")), i + n[0].length) : -1; +} + +function parseMonthNumber(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.m = n[0] - 1, i + n[0].length) : -1; +} + +function parseDayOfMonth(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.d = +n[0], i + n[0].length) : -1; +} + +function parseDayOfYear(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 3)); + return n ? (d.m = 0, d.d = +n[0], i + n[0].length) : -1; +} + +function parseHour24(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.H = +n[0], i + n[0].length) : -1; +} + +function parseMinutes(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.M = +n[0], i + n[0].length) : -1; +} + +function parseSeconds(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.S = +n[0], i + n[0].length) : -1; +} + +function parseMilliseconds(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 3)); + return n ? (d.L = +n[0], i + n[0].length) : -1; +} + +function parseMicroseconds(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 6)); + return n ? (d.L = Math.floor(n[0] / 1000), i + n[0].length) : -1; +} + +function parseLiteralPercent(d, string, i) { + var n = percentRe.exec(string.slice(i, i + 1)); + return n ? i + n[0].length : -1; +} + +function parseUnixTimestamp(d, string, i) { + var n = numberRe.exec(string.slice(i)); + return n ? (d.Q = +n[0], i + n[0].length) : -1; +} + +function parseUnixTimestampSeconds(d, string, i) { + var n = numberRe.exec(string.slice(i)); + return n ? (d.Q = (+n[0]) * 1000, i + n[0].length) : -1; +} + +function formatDayOfMonth(d, p) { + return pad(d.getDate(), p, 2); +} + +function formatHour24(d, p) { + return pad(d.getHours(), p, 2); +} + +function formatHour12(d, p) { + return pad(d.getHours() % 12 || 12, p, 2); +} + +function formatDayOfYear(d, p) { + return pad(1 + day.count(year(d), d), p, 3); +} + +function formatMilliseconds(d, p) { + return pad(d.getMilliseconds(), p, 3); +} + +function formatMicroseconds(d, p) { + return formatMilliseconds(d, p) + "000"; +} + +function formatMonthNumber(d, p) { + return pad(d.getMonth() + 1, p, 2); +} + +function formatMinutes(d, p) { + return pad(d.getMinutes(), p, 2); +} + +function formatSeconds(d, p) { + return pad(d.getSeconds(), p, 2); +} + +function formatWeekdayNumberMonday(d) { + var day$$1 = d.getDay(); + return day$$1 === 0 ? 7 : day$$1; +} + +function formatWeekNumberSunday(d, p) { + return pad(sunday.count(year(d), d), p, 2); +} + +function formatWeekNumberISO(d, p) { + var day$$1 = d.getDay(); + d = (day$$1 >= 4 || day$$1 === 0) ? thursday(d) : thursday.ceil(d); + return pad(thursday.count(year(d), d) + (year(d).getDay() === 4), p, 2); +} + +function formatWeekdayNumberSunday(d) { + return d.getDay(); +} + +function formatWeekNumberMonday(d, p) { + return pad(monday.count(year(d), d), p, 2); +} + +function formatYear(d, p) { + return pad(d.getFullYear() % 100, p, 2); +} + +function formatFullYear(d, p) { + return pad(d.getFullYear() % 10000, p, 4); +} + +function formatZone(d) { + var z = d.getTimezoneOffset(); + return (z > 0 ? "-" : (z *= -1, "+")) + + pad(z / 60 | 0, "0", 2) + + pad(z % 60, "0", 2); +} + +function formatUTCDayOfMonth(d, p) { + return pad(d.getUTCDate(), p, 2); +} + +function formatUTCHour24(d, p) { + return pad(d.getUTCHours(), p, 2); +} + +function formatUTCHour12(d, p) { + return pad(d.getUTCHours() % 12 || 12, p, 2); +} + +function formatUTCDayOfYear(d, p) { + return pad(1 + utcDay.count(utcYear(d), d), p, 3); +} + +function formatUTCMilliseconds(d, p) { + return pad(d.getUTCMilliseconds(), p, 3); +} + +function formatUTCMicroseconds(d, p) { + return formatUTCMilliseconds(d, p) + "000"; +} + +function formatUTCMonthNumber(d, p) { + return pad(d.getUTCMonth() + 1, p, 2); +} + +function formatUTCMinutes(d, p) { + return pad(d.getUTCMinutes(), p, 2); +} + +function formatUTCSeconds(d, p) { + return pad(d.getUTCSeconds(), p, 2); +} + +function formatUTCWeekdayNumberMonday(d) { + var dow = d.getUTCDay(); + return dow === 0 ? 7 : dow; +} + +function formatUTCWeekNumberSunday(d, p) { + return pad(utcSunday.count(utcYear(d), d), p, 2); +} + +function formatUTCWeekNumberISO(d, p) { + var day$$1 = d.getUTCDay(); + d = (day$$1 >= 4 || day$$1 === 0) ? utcThursday(d) : utcThursday.ceil(d); + return pad(utcThursday.count(utcYear(d), d) + (utcYear(d).getUTCDay() === 4), p, 2); +} + +function formatUTCWeekdayNumberSunday(d) { + return d.getUTCDay(); +} + +function formatUTCWeekNumberMonday(d, p) { + return pad(utcMonday.count(utcYear(d), d), p, 2); +} + +function formatUTCYear(d, p) { + return pad(d.getUTCFullYear() % 100, p, 2); +} + +function formatUTCFullYear(d, p) { + return pad(d.getUTCFullYear() % 10000, p, 4); +} + +function formatUTCZone() { + return "+0000"; +} + +function formatLiteralPercent() { + return "%"; +} + +function formatUnixTimestamp(d) { + return +d; +} + +function formatUnixTimestampSeconds(d) { + return Math.floor(+d / 1000); +} + +var locale$1; + + + + + +defaultLocale$1({ + dateTime: "%x, %X", + date: "%-m/%-d/%Y", + time: "%-I:%M:%S %p", + periods: ["AM", "PM"], + days: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], + shortDays: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], + months: ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"], + shortMonths: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"] +}); + +function defaultLocale$1(definition) { + locale$1 = formatLocale$1(definition); + exports.timeFormat = locale$1.format; + exports.timeParse = locale$1.parse; + exports.utcFormat = locale$1.utcFormat; + exports.utcParse = locale$1.utcParse; + return locale$1; +} + +var isoSpecifier = "%Y-%m-%dT%H:%M:%S.%LZ"; + +function formatIsoNative(date) { + return date.toISOString(); +} + +var formatIso = Date.prototype.toISOString + ? formatIsoNative + : exports.utcFormat(isoSpecifier); + +function parseIsoNative(string) { + var date = new Date(string); + return isNaN(date) ? null : date; +} + +var parseIso = +new Date("2000-01-01T00:00:00.000Z") + ? parseIsoNative + : exports.utcParse(isoSpecifier); + +var durationSecond = 1000; +var durationMinute = durationSecond * 60; +var durationHour = durationMinute * 60; +var durationDay = durationHour * 24; +var durationWeek = durationDay * 7; +var durationMonth = durationDay * 30; +var durationYear = durationDay * 365; + +function date$1(t) { + return new Date(t); +} + +function number$3(t) { + return t instanceof Date ? +t : +new Date(+t); +} + +function calendar(year$$1, month$$1, week, day$$1, hour$$1, minute$$1, second$$1, millisecond$$1, format) { + var scale = continuous(deinterpolateLinear, reinterpolate), + invert = scale.invert, + domain = scale.domain; + + var formatMillisecond = format(".%L"), + formatSecond = format(":%S"), + formatMinute = format("%I:%M"), + formatHour = format("%I %p"), + formatDay = format("%a %d"), + formatWeek = format("%b %d"), + formatMonth = format("%B"), + formatYear = format("%Y"); + + var tickIntervals = [ + [second$$1, 1, durationSecond], + [second$$1, 5, 5 * durationSecond], + [second$$1, 15, 15 * durationSecond], + [second$$1, 30, 30 * durationSecond], + [minute$$1, 1, durationMinute], + [minute$$1, 5, 5 * durationMinute], + [minute$$1, 15, 15 * durationMinute], + [minute$$1, 30, 30 * durationMinute], + [ hour$$1, 1, durationHour ], + [ hour$$1, 3, 3 * durationHour ], + [ hour$$1, 6, 6 * durationHour ], + [ hour$$1, 12, 12 * durationHour ], + [ day$$1, 1, durationDay ], + [ day$$1, 2, 2 * durationDay ], + [ week, 1, durationWeek ], + [ month$$1, 1, durationMonth ], + [ month$$1, 3, 3 * durationMonth ], + [ year$$1, 1, durationYear ] + ]; + + function tickFormat(date) { + return (second$$1(date) < date ? formatMillisecond + : minute$$1(date) < date ? formatSecond + : hour$$1(date) < date ? formatMinute + : day$$1(date) < date ? formatHour + : month$$1(date) < date ? (week(date) < date ? formatDay : formatWeek) + : year$$1(date) < date ? formatMonth + : formatYear)(date); + } + + function tickInterval(interval, start, stop, step) { + if (interval == null) interval = 10; + + // If a desired tick count is specified, pick a reasonable tick interval + // based on the extent of the domain and a rough estimate of tick size. + // Otherwise, assume interval is already a time interval and use it. + if (typeof interval === "number") { + var target = Math.abs(stop - start) / interval, + i = bisector(function(i) { return i[2]; }).right(tickIntervals, target); + if (i === tickIntervals.length) { + step = tickStep(start / durationYear, stop / durationYear, interval); + interval = year$$1; + } else if (i) { + i = tickIntervals[target / tickIntervals[i - 1][2] < tickIntervals[i][2] / target ? i - 1 : i]; + step = i[1]; + interval = i[0]; + } else { + step = Math.max(tickStep(start, stop, interval), 1); + interval = millisecond$$1; + } + } + + return step == null ? interval : interval.every(step); + } + + scale.invert = function(y) { + return new Date(invert(y)); + }; + + scale.domain = function(_) { + return arguments.length ? domain(map$3.call(_, number$3)) : domain().map(date$1); + }; + + scale.ticks = function(interval, step) { + var d = domain(), + t0 = d[0], + t1 = d[d.length - 1], + r = t1 < t0, + t; + if (r) t = t0, t0 = t1, t1 = t; + t = tickInterval(interval, t0, t1, step); + t = t ? t.range(t0, t1 + 1) : []; // inclusive stop + return r ? t.reverse() : t; + }; + + scale.tickFormat = function(count, specifier) { + return specifier == null ? tickFormat : format(specifier); + }; + + scale.nice = function(interval, step) { + var d = domain(); + return (interval = tickInterval(interval, d[0], d[d.length - 1], step)) + ? domain(nice(d, interval)) + : scale; + }; + + scale.copy = function() { + return copy(scale, calendar(year$$1, month$$1, week, day$$1, hour$$1, minute$$1, second$$1, millisecond$$1, format)); + }; + + return scale; +} + +function time() { + return calendar(year, month, sunday, day, hour, minute, second, millisecond, exports.timeFormat).domain([new Date(2000, 0, 1), new Date(2000, 0, 2)]); +} + +function utcTime() { + return calendar(utcYear, utcMonth, utcSunday, utcDay, utcHour, utcMinute, second, millisecond, exports.utcFormat).domain([Date.UTC(2000, 0, 1), Date.UTC(2000, 0, 2)]); +} + +function colors(s) { + return s.match(/.{6}/g).map(function(x) { + return "#" + x; + }); +} + +var category10 = colors("1f77b4ff7f0e2ca02cd627289467bd8c564be377c27f7f7fbcbd2217becf"); + +var category20b = colors("393b795254a36b6ecf9c9ede6379398ca252b5cf6bcedb9c8c6d31bd9e39e7ba52e7cb94843c39ad494ad6616be7969c7b4173a55194ce6dbdde9ed6"); + +var category20c = colors("3182bd6baed69ecae1c6dbefe6550dfd8d3cfdae6bfdd0a231a35474c476a1d99bc7e9c0756bb19e9ac8bcbddcdadaeb636363969696bdbdbdd9d9d9"); + +var category20 = colors("1f77b4aec7e8ff7f0effbb782ca02c98df8ad62728ff98969467bdc5b0d58c564bc49c94e377c2f7b6d27f7f7fc7c7c7bcbd22dbdb8d17becf9edae5"); + +var cubehelix$3 = cubehelixLong(cubehelix(300, 0.5, 0.0), cubehelix(-240, 0.5, 1.0)); + +var warm = cubehelixLong(cubehelix(-100, 0.75, 0.35), cubehelix(80, 1.50, 0.8)); + +var cool = cubehelixLong(cubehelix(260, 0.75, 0.35), cubehelix(80, 1.50, 0.8)); + +var rainbow = cubehelix(); + +function rainbow$1(t) { + if (t < 0 || t > 1) t -= Math.floor(t); + var ts = Math.abs(t - 0.5); + rainbow.h = 360 * t - 100; + rainbow.s = 1.5 - 1.5 * ts; + rainbow.l = 0.8 - 0.9 * ts; + return rainbow + ""; +} + +function ramp(range) { + var n = range.length; + return function(t) { + return range[Math.max(0, Math.min(n - 1, Math.floor(t * n)))]; + }; +} + +var viridis = ramp(colors("44015444025645045745055946075a46085c460a5d460b5e470d60470e6147106347116447136548146748166848176948186a481a6c481b6d481c6e481d6f481f70482071482173482374482475482576482677482878482979472a7a472c7a472d7b472e7c472f7d46307e46327e46337f463480453581453781453882443983443a83443b84433d84433e85423f854240864241864142874144874045884046883f47883f48893e49893e4a893e4c8a3d4d8a3d4e8a3c4f8a3c508b3b518b3b528b3a538b3a548c39558c39568c38588c38598c375a8c375b8d365c8d365d8d355e8d355f8d34608d34618d33628d33638d32648e32658e31668e31678e31688e30698e306a8e2f6b8e2f6c8e2e6d8e2e6e8e2e6f8e2d708e2d718e2c718e2c728e2c738e2b748e2b758e2a768e2a778e2a788e29798e297a8e297b8e287c8e287d8e277e8e277f8e27808e26818e26828e26828e25838e25848e25858e24868e24878e23888e23898e238a8d228b8d228c8d228d8d218e8d218f8d21908d21918c20928c20928c20938c1f948c1f958b1f968b1f978b1f988b1f998a1f9a8a1e9b8a1e9c891e9d891f9e891f9f881fa0881fa1881fa1871fa28720a38620a48621a58521a68522a78522a88423a98324aa8325ab8225ac8226ad8127ad8128ae8029af7f2ab07f2cb17e2db27d2eb37c2fb47c31b57b32b67a34b67935b77937b87838b9773aba763bbb753dbc743fbc7340bd7242be7144bf7046c06f48c16e4ac16d4cc26c4ec36b50c46a52c56954c56856c66758c7655ac8645cc8635ec96260ca6063cb5f65cb5e67cc5c69cd5b6ccd5a6ece5870cf5773d05675d05477d1537ad1517cd2507fd34e81d34d84d44b86d54989d5488bd6468ed64590d74393d74195d84098d83e9bd93c9dd93ba0da39a2da37a5db36a8db34aadc32addc30b0dd2fb2dd2db5de2bb8de29bade28bddf26c0df25c2df23c5e021c8e020cae11fcde11dd0e11cd2e21bd5e21ad8e219dae319dde318dfe318e2e418e5e419e7e419eae51aece51befe51cf1e51df4e61ef6e620f8e621fbe723fde725")); + +var magma = ramp(colors("00000401000501010601010802010902020b02020d03030f03031204041405041606051806051a07061c08071e0907200a08220b09240c09260d0a290e0b2b100b2d110c2f120d31130d34140e36150e38160f3b180f3d19103f1a10421c10441d11471e114920114b21114e22115024125325125527125829115a2a115c2c115f2d11612f116331116533106734106936106b38106c390f6e3b0f703d0f713f0f72400f74420f75440f764510774710784910784a10794c117a4e117b4f127b51127c52137c54137d56147d57157e59157e5a167e5c167f5d177f5f187f601880621980641a80651a80671b80681c816a1c816b1d816d1d816e1e81701f81721f817320817521817621817822817922827b23827c23827e24828025828125818326818426818627818827818928818b29818c29818e2a81902a81912b81932b80942c80962c80982d80992d809b2e7f9c2e7f9e2f7fa02f7fa1307ea3307ea5317ea6317da8327daa337dab337cad347cae347bb0357bb2357bb3367ab5367ab73779b83779ba3878bc3978bd3977bf3a77c03a76c23b75c43c75c53c74c73d73c83e73ca3e72cc3f71cd4071cf4070d0416fd2426fd3436ed5446dd6456cd8456cd9466bdb476adc4869de4968df4a68e04c67e24d66e34e65e44f64e55064e75263e85362e95462ea5661eb5760ec5860ed5a5fee5b5eef5d5ef05f5ef1605df2625df2645cf3655cf4675cf4695cf56b5cf66c5cf66e5cf7705cf7725cf8745cf8765cf9785df9795df97b5dfa7d5efa7f5efa815ffb835ffb8560fb8761fc8961fc8a62fc8c63fc8e64fc9065fd9266fd9467fd9668fd9869fd9a6afd9b6bfe9d6cfe9f6dfea16efea36ffea571fea772fea973feaa74feac76feae77feb078feb27afeb47bfeb67cfeb77efeb97ffebb81febd82febf84fec185fec287fec488fec68afec88cfeca8dfecc8ffecd90fecf92fed194fed395fed597fed799fed89afdda9cfddc9efddea0fde0a1fde2a3fde3a5fde5a7fde7a9fde9aafdebacfcecaefceeb0fcf0b2fcf2b4fcf4b6fcf6b8fcf7b9fcf9bbfcfbbdfcfdbf")); + +var inferno = ramp(colors("00000401000501010601010802010a02020c02020e03021004031204031405041706041907051b08051d09061f0a07220b07240c08260d08290e092b10092d110a30120a32140b34150b37160b39180c3c190c3e1b0c411c0c431e0c451f0c48210c4a230c4c240c4f260c51280b53290b552b0b572d0b592f0a5b310a5c320a5e340a5f3609613809623909633b09643d09653e0966400a67420a68440a68450a69470b6a490b6a4a0c6b4c0c6b4d0d6c4f0d6c510e6c520e6d540f6d550f6d57106e59106e5a116e5c126e5d126e5f136e61136e62146e64156e65156e67166e69166e6a176e6c186e6d186e6f196e71196e721a6e741a6e751b6e771c6d781c6d7a1d6d7c1d6d7d1e6d7f1e6c801f6c82206c84206b85216b87216b88226a8a226a8c23698d23698f24699025689225689326679526679727669827669a28659b29649d29649f2a63a02a63a22b62a32c61a52c60a62d60a82e5fa92e5eab2f5ead305dae305cb0315bb1325ab3325ab43359b63458b73557b93556ba3655bc3754bd3853bf3952c03a51c13a50c33b4fc43c4ec63d4dc73e4cc83f4bca404acb4149cc4248ce4347cf4446d04545d24644d34743d44842d54a41d74b3fd84c3ed94d3dda4e3cdb503bdd513ade5238df5337e05536e15635e25734e35933e45a31e55c30e65d2fe75e2ee8602de9612bea632aeb6429eb6628ec6726ed6925ee6a24ef6c23ef6e21f06f20f1711ff1731df2741cf3761bf37819f47918f57b17f57d15f67e14f68013f78212f78410f8850ff8870ef8890cf98b0bf98c0af98e09fa9008fa9207fa9407fb9606fb9706fb9906fb9b06fb9d07fc9f07fca108fca309fca50afca60cfca80dfcaa0ffcac11fcae12fcb014fcb216fcb418fbb61afbb81dfbba1ffbbc21fbbe23fac026fac228fac42afac62df9c72ff9c932f9cb35f8cd37f8cf3af7d13df7d340f6d543f6d746f5d949f5db4cf4dd4ff4df53f4e156f3e35af3e55df2e661f2e865f2ea69f1ec6df1ed71f1ef75f1f179f2f27df2f482f3f586f3f68af4f88ef5f992f6fa96f8fb9af9fc9dfafda1fcffa4")); + +var plasma = ramp(colors("0d088710078813078916078a19068c1b068d1d068e20068f2206902406912605912805922a05932c05942e05952f059631059733059735049837049938049a3a049a3c049b3e049c3f049c41049d43039e44039e46039f48039f4903a04b03a14c02a14e02a25002a25102a35302a35502a45601a45801a45901a55b01a55c01a65e01a66001a66100a76300a76400a76600a76700a86900a86a00a86c00a86e00a86f00a87100a87201a87401a87501a87701a87801a87a02a87b02a87d03a87e03a88004a88104a78305a78405a78606a68707a68808a68a09a58b0aa58d0ba58e0ca48f0da4910ea3920fa39410a29511a19613a19814a099159f9a169f9c179e9d189d9e199da01a9ca11b9ba21d9aa31e9aa51f99a62098a72197a82296aa2395ab2494ac2694ad2793ae2892b02991b12a90b22b8fb32c8eb42e8db52f8cb6308bb7318ab83289ba3388bb3488bc3587bd3786be3885bf3984c03a83c13b82c23c81c33d80c43e7fc5407ec6417dc7427cc8437bc9447aca457acb4679cc4778cc4977cd4a76ce4b75cf4c74d04d73d14e72d24f71d35171d45270d5536fd5546ed6556dd7566cd8576bd9586ada5a6ada5b69db5c68dc5d67dd5e66de5f65de6164df6263e06363e16462e26561e26660e3685fe4695ee56a5de56b5de66c5ce76e5be76f5ae87059e97158e97257ea7457eb7556eb7655ec7754ed7953ed7a52ee7b51ef7c51ef7e50f07f4ff0804ef1814df1834cf2844bf3854bf3874af48849f48948f58b47f58c46f68d45f68f44f79044f79143f79342f89441f89540f9973ff9983ef99a3efa9b3dfa9c3cfa9e3bfb9f3afba139fba238fca338fca537fca636fca835fca934fdab33fdac33fdae32fdaf31fdb130fdb22ffdb42ffdb52efeb72dfeb82cfeba2cfebb2bfebd2afebe2afec029fdc229fdc328fdc527fdc627fdc827fdca26fdcb26fccd25fcce25fcd025fcd225fbd324fbd524fbd724fad824fada24f9dc24f9dd25f8df25f8e125f7e225f7e425f6e626f6e826f5e926f5eb27f4ed27f3ee27f3f027f2f227f1f426f1f525f0f724f0f921")); + +function sequential(interpolator) { + var x0 = 0, + x1 = 1, + clamp = false; + + function scale(x) { + var t = (x - x0) / (x1 - x0); + return interpolator(clamp ? Math.max(0, Math.min(1, t)) : t); + } + + scale.domain = function(_) { + return arguments.length ? (x0 = +_[0], x1 = +_[1], scale) : [x0, x1]; + }; + + scale.clamp = function(_) { + return arguments.length ? (clamp = !!_, scale) : clamp; + }; + + scale.interpolator = function(_) { + return arguments.length ? (interpolator = _, scale) : interpolator; + }; + + scale.copy = function() { + return sequential(interpolator).domain([x0, x1]).clamp(clamp); + }; + + return linearish(scale); +} + +function constant$10(x) { + return function constant() { + return x; + }; +} + +var abs$1 = Math.abs; +var atan2$1 = Math.atan2; +var cos$2 = Math.cos; +var max$2 = Math.max; +var min$1 = Math.min; +var sin$2 = Math.sin; +var sqrt$2 = Math.sqrt; + +var epsilon$3 = 1e-12; +var pi$4 = Math.PI; +var halfPi$3 = pi$4 / 2; +var tau$4 = 2 * pi$4; + +function acos$1(x) { + return x > 1 ? 0 : x < -1 ? pi$4 : Math.acos(x); +} + +function asin$1(x) { + return x >= 1 ? halfPi$3 : x <= -1 ? -halfPi$3 : Math.asin(x); +} + +function arcInnerRadius(d) { + return d.innerRadius; +} + +function arcOuterRadius(d) { + return d.outerRadius; +} + +function arcStartAngle(d) { + return d.startAngle; +} + +function arcEndAngle(d) { + return d.endAngle; +} + +function arcPadAngle(d) { + return d && d.padAngle; // Note: optional! +} + +function intersect(x0, y0, x1, y1, x2, y2, x3, y3) { + var x10 = x1 - x0, y10 = y1 - y0, + x32 = x3 - x2, y32 = y3 - y2, + t = (x32 * (y0 - y2) - y32 * (x0 - x2)) / (y32 * x10 - x32 * y10); + return [x0 + t * x10, y0 + t * y10]; +} + +// Compute perpendicular offset line of length rc. +// http://mathworld.wolfram.com/Circle-LineIntersection.html +function cornerTangents(x0, y0, x1, y1, r1, rc, cw) { + var x01 = x0 - x1, + y01 = y0 - y1, + lo = (cw ? rc : -rc) / sqrt$2(x01 * x01 + y01 * y01), + ox = lo * y01, + oy = -lo * x01, + x11 = x0 + ox, + y11 = y0 + oy, + x10 = x1 + ox, + y10 = y1 + oy, + x00 = (x11 + x10) / 2, + y00 = (y11 + y10) / 2, + dx = x10 - x11, + dy = y10 - y11, + d2 = dx * dx + dy * dy, + r = r1 - rc, + D = x11 * y10 - x10 * y11, + d = (dy < 0 ? -1 : 1) * sqrt$2(max$2(0, r * r * d2 - D * D)), + cx0 = (D * dy - dx * d) / d2, + cy0 = (-D * dx - dy * d) / d2, + cx1 = (D * dy + dx * d) / d2, + cy1 = (-D * dx + dy * d) / d2, + dx0 = cx0 - x00, + dy0 = cy0 - y00, + dx1 = cx1 - x00, + dy1 = cy1 - y00; + + // Pick the closer of the two intersection points. + // TODO Is there a faster way to determine which intersection to use? + if (dx0 * dx0 + dy0 * dy0 > dx1 * dx1 + dy1 * dy1) cx0 = cx1, cy0 = cy1; + + return { + cx: cx0, + cy: cy0, + x01: -ox, + y01: -oy, + x11: cx0 * (r1 / r - 1), + y11: cy0 * (r1 / r - 1) + }; +} + +function arc() { + var innerRadius = arcInnerRadius, + outerRadius = arcOuterRadius, + cornerRadius = constant$10(0), + padRadius = null, + startAngle = arcStartAngle, + endAngle = arcEndAngle, + padAngle = arcPadAngle, + context = null; + + function arc() { + var buffer, + r, + r0 = +innerRadius.apply(this, arguments), + r1 = +outerRadius.apply(this, arguments), + a0 = startAngle.apply(this, arguments) - halfPi$3, + a1 = endAngle.apply(this, arguments) - halfPi$3, + da = abs$1(a1 - a0), + cw = a1 > a0; + + if (!context) context = buffer = path(); + + // Ensure that the outer radius is always larger than the inner radius. + if (r1 < r0) r = r1, r1 = r0, r0 = r; + + // Is it a point? + if (!(r1 > epsilon$3)) context.moveTo(0, 0); + + // Or is it a circle or annulus? + else if (da > tau$4 - epsilon$3) { + context.moveTo(r1 * cos$2(a0), r1 * sin$2(a0)); + context.arc(0, 0, r1, a0, a1, !cw); + if (r0 > epsilon$3) { + context.moveTo(r0 * cos$2(a1), r0 * sin$2(a1)); + context.arc(0, 0, r0, a1, a0, cw); + } + } + + // Or is it a circular or annular sector? + else { + var a01 = a0, + a11 = a1, + a00 = a0, + a10 = a1, + da0 = da, + da1 = da, + ap = padAngle.apply(this, arguments) / 2, + rp = (ap > epsilon$3) && (padRadius ? +padRadius.apply(this, arguments) : sqrt$2(r0 * r0 + r1 * r1)), + rc = min$1(abs$1(r1 - r0) / 2, +cornerRadius.apply(this, arguments)), + rc0 = rc, + rc1 = rc, + t0, + t1; + + // Apply padding? Note that since r1 ≥ r0, da1 ≥ da0. + if (rp > epsilon$3) { + var p0 = asin$1(rp / r0 * sin$2(ap)), + p1 = asin$1(rp / r1 * sin$2(ap)); + if ((da0 -= p0 * 2) > epsilon$3) p0 *= (cw ? 1 : -1), a00 += p0, a10 -= p0; + else da0 = 0, a00 = a10 = (a0 + a1) / 2; + if ((da1 -= p1 * 2) > epsilon$3) p1 *= (cw ? 1 : -1), a01 += p1, a11 -= p1; + else da1 = 0, a01 = a11 = (a0 + a1) / 2; + } + + var x01 = r1 * cos$2(a01), + y01 = r1 * sin$2(a01), + x10 = r0 * cos$2(a10), + y10 = r0 * sin$2(a10); + + // Apply rounded corners? + if (rc > epsilon$3) { + var x11 = r1 * cos$2(a11), + y11 = r1 * sin$2(a11), + x00 = r0 * cos$2(a00), + y00 = r0 * sin$2(a00); + + // Restrict the corner radius according to the sector angle. + if (da < pi$4) { + var oc = da0 > epsilon$3 ? intersect(x01, y01, x00, y00, x11, y11, x10, y10) : [x10, y10], + ax = x01 - oc[0], + ay = y01 - oc[1], + bx = x11 - oc[0], + by = y11 - oc[1], + kc = 1 / sin$2(acos$1((ax * bx + ay * by) / (sqrt$2(ax * ax + ay * ay) * sqrt$2(bx * bx + by * by))) / 2), + lc = sqrt$2(oc[0] * oc[0] + oc[1] * oc[1]); + rc0 = min$1(rc, (r0 - lc) / (kc - 1)); + rc1 = min$1(rc, (r1 - lc) / (kc + 1)); + } + } + + // Is the sector collapsed to a line? + if (!(da1 > epsilon$3)) context.moveTo(x01, y01); + + // Does the sector’s outer ring have rounded corners? + else if (rc1 > epsilon$3) { + t0 = cornerTangents(x00, y00, x01, y01, r1, rc1, cw); + t1 = cornerTangents(x11, y11, x10, y10, r1, rc1, cw); + + context.moveTo(t0.cx + t0.x01, t0.cy + t0.y01); + + // Have the corners merged? + if (rc1 < rc) context.arc(t0.cx, t0.cy, rc1, atan2$1(t0.y01, t0.x01), atan2$1(t1.y01, t1.x01), !cw); + + // Otherwise, draw the two corners and the ring. + else { + context.arc(t0.cx, t0.cy, rc1, atan2$1(t0.y01, t0.x01), atan2$1(t0.y11, t0.x11), !cw); + context.arc(0, 0, r1, atan2$1(t0.cy + t0.y11, t0.cx + t0.x11), atan2$1(t1.cy + t1.y11, t1.cx + t1.x11), !cw); + context.arc(t1.cx, t1.cy, rc1, atan2$1(t1.y11, t1.x11), atan2$1(t1.y01, t1.x01), !cw); + } + } + + // Or is the outer ring just a circular arc? + else context.moveTo(x01, y01), context.arc(0, 0, r1, a01, a11, !cw); + + // Is there no inner ring, and it’s a circular sector? + // Or perhaps it’s an annular sector collapsed due to padding? + if (!(r0 > epsilon$3) || !(da0 > epsilon$3)) context.lineTo(x10, y10); + + // Does the sector’s inner ring (or point) have rounded corners? + else if (rc0 > epsilon$3) { + t0 = cornerTangents(x10, y10, x11, y11, r0, -rc0, cw); + t1 = cornerTangents(x01, y01, x00, y00, r0, -rc0, cw); + + context.lineTo(t0.cx + t0.x01, t0.cy + t0.y01); + + // Have the corners merged? + if (rc0 < rc) context.arc(t0.cx, t0.cy, rc0, atan2$1(t0.y01, t0.x01), atan2$1(t1.y01, t1.x01), !cw); + + // Otherwise, draw the two corners and the ring. + else { + context.arc(t0.cx, t0.cy, rc0, atan2$1(t0.y01, t0.x01), atan2$1(t0.y11, t0.x11), !cw); + context.arc(0, 0, r0, atan2$1(t0.cy + t0.y11, t0.cx + t0.x11), atan2$1(t1.cy + t1.y11, t1.cx + t1.x11), cw); + context.arc(t1.cx, t1.cy, rc0, atan2$1(t1.y11, t1.x11), atan2$1(t1.y01, t1.x01), !cw); + } + } + + // Or is the inner ring just a circular arc? + else context.arc(0, 0, r0, a10, a00, cw); + } + + context.closePath(); + + if (buffer) return context = null, buffer + "" || null; + } + + arc.centroid = function() { + var r = (+innerRadius.apply(this, arguments) + +outerRadius.apply(this, arguments)) / 2, + a = (+startAngle.apply(this, arguments) + +endAngle.apply(this, arguments)) / 2 - pi$4 / 2; + return [cos$2(a) * r, sin$2(a) * r]; + }; + + arc.innerRadius = function(_) { + return arguments.length ? (innerRadius = typeof _ === "function" ? _ : constant$10(+_), arc) : innerRadius; + }; + + arc.outerRadius = function(_) { + return arguments.length ? (outerRadius = typeof _ === "function" ? _ : constant$10(+_), arc) : outerRadius; + }; + + arc.cornerRadius = function(_) { + return arguments.length ? (cornerRadius = typeof _ === "function" ? _ : constant$10(+_), arc) : cornerRadius; + }; + + arc.padRadius = function(_) { + return arguments.length ? (padRadius = _ == null ? null : typeof _ === "function" ? _ : constant$10(+_), arc) : padRadius; + }; + + arc.startAngle = function(_) { + return arguments.length ? (startAngle = typeof _ === "function" ? _ : constant$10(+_), arc) : startAngle; + }; + + arc.endAngle = function(_) { + return arguments.length ? (endAngle = typeof _ === "function" ? _ : constant$10(+_), arc) : endAngle; + }; + + arc.padAngle = function(_) { + return arguments.length ? (padAngle = typeof _ === "function" ? _ : constant$10(+_), arc) : padAngle; + }; + + arc.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, arc) : context; + }; + + return arc; +} + +function Linear(context) { + this._context = context; +} + +Linear.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; // proceed + default: this._context.lineTo(x, y); break; + } + } +}; + +function curveLinear(context) { + return new Linear(context); +} + +function x$3(p) { + return p[0]; +} + +function y$3(p) { + return p[1]; +} + +function line() { + var x$$1 = x$3, + y$$1 = y$3, + defined = constant$10(true), + context = null, + curve = curveLinear, + output = null; + + function line(data) { + var i, + n = data.length, + d, + defined0 = false, + buffer; + + if (context == null) output = curve(buffer = path()); + + for (i = 0; i <= n; ++i) { + if (!(i < n && defined(d = data[i], i, data)) === defined0) { + if (defined0 = !defined0) output.lineStart(); + else output.lineEnd(); + } + if (defined0) output.point(+x$$1(d, i, data), +y$$1(d, i, data)); + } + + if (buffer) return output = null, buffer + "" || null; + } + + line.x = function(_) { + return arguments.length ? (x$$1 = typeof _ === "function" ? _ : constant$10(+_), line) : x$$1; + }; + + line.y = function(_) { + return arguments.length ? (y$$1 = typeof _ === "function" ? _ : constant$10(+_), line) : y$$1; + }; + + line.defined = function(_) { + return arguments.length ? (defined = typeof _ === "function" ? _ : constant$10(!!_), line) : defined; + }; + + line.curve = function(_) { + return arguments.length ? (curve = _, context != null && (output = curve(context)), line) : curve; + }; + + line.context = function(_) { + return arguments.length ? (_ == null ? context = output = null : output = curve(context = _), line) : context; + }; + + return line; +} + +function area$2() { + var x0 = x$3, + x1 = null, + y0 = constant$10(0), + y1 = y$3, + defined = constant$10(true), + context = null, + curve = curveLinear, + output = null; + + function area(data) { + var i, + j, + k, + n = data.length, + d, + defined0 = false, + buffer, + x0z = new Array(n), + y0z = new Array(n); + + if (context == null) output = curve(buffer = path()); + + for (i = 0; i <= n; ++i) { + if (!(i < n && defined(d = data[i], i, data)) === defined0) { + if (defined0 = !defined0) { + j = i; + output.areaStart(); + output.lineStart(); + } else { + output.lineEnd(); + output.lineStart(); + for (k = i - 1; k >= j; --k) { + output.point(x0z[k], y0z[k]); + } + output.lineEnd(); + output.areaEnd(); + } + } + if (defined0) { + x0z[i] = +x0(d, i, data), y0z[i] = +y0(d, i, data); + output.point(x1 ? +x1(d, i, data) : x0z[i], y1 ? +y1(d, i, data) : y0z[i]); + } + } + + if (buffer) return output = null, buffer + "" || null; + } + + function arealine() { + return line().defined(defined).curve(curve).context(context); + } + + area.x = function(_) { + return arguments.length ? (x0 = typeof _ === "function" ? _ : constant$10(+_), x1 = null, area) : x0; + }; + + area.x0 = function(_) { + return arguments.length ? (x0 = typeof _ === "function" ? _ : constant$10(+_), area) : x0; + }; + + area.x1 = function(_) { + return arguments.length ? (x1 = _ == null ? null : typeof _ === "function" ? _ : constant$10(+_), area) : x1; + }; + + area.y = function(_) { + return arguments.length ? (y0 = typeof _ === "function" ? _ : constant$10(+_), y1 = null, area) : y0; + }; + + area.y0 = function(_) { + return arguments.length ? (y0 = typeof _ === "function" ? _ : constant$10(+_), area) : y0; + }; + + area.y1 = function(_) { + return arguments.length ? (y1 = _ == null ? null : typeof _ === "function" ? _ : constant$10(+_), area) : y1; + }; + + area.lineX0 = + area.lineY0 = function() { + return arealine().x(x0).y(y0); + }; + + area.lineY1 = function() { + return arealine().x(x0).y(y1); + }; + + area.lineX1 = function() { + return arealine().x(x1).y(y0); + }; + + area.defined = function(_) { + return arguments.length ? (defined = typeof _ === "function" ? _ : constant$10(!!_), area) : defined; + }; + + area.curve = function(_) { + return arguments.length ? (curve = _, context != null && (output = curve(context)), area) : curve; + }; + + area.context = function(_) { + return arguments.length ? (_ == null ? context = output = null : output = curve(context = _), area) : context; + }; + + return area; +} + +function descending$1(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; +} + +function identity$7(d) { + return d; +} + +function pie() { + var value = identity$7, + sortValues = descending$1, + sort = null, + startAngle = constant$10(0), + endAngle = constant$10(tau$4), + padAngle = constant$10(0); + + function pie(data) { + var i, + n = data.length, + j, + k, + sum = 0, + index = new Array(n), + arcs = new Array(n), + a0 = +startAngle.apply(this, arguments), + da = Math.min(tau$4, Math.max(-tau$4, endAngle.apply(this, arguments) - a0)), + a1, + p = Math.min(Math.abs(da) / n, padAngle.apply(this, arguments)), + pa = p * (da < 0 ? -1 : 1), + v; + + for (i = 0; i < n; ++i) { + if ((v = arcs[index[i] = i] = +value(data[i], i, data)) > 0) { + sum += v; + } + } + + // Optionally sort the arcs by previously-computed values or by data. + if (sortValues != null) index.sort(function(i, j) { return sortValues(arcs[i], arcs[j]); }); + else if (sort != null) index.sort(function(i, j) { return sort(data[i], data[j]); }); + + // Compute the arcs! They are stored in the original data's order. + for (i = 0, k = sum ? (da - n * pa) / sum : 0; i < n; ++i, a0 = a1) { + j = index[i], v = arcs[j], a1 = a0 + (v > 0 ? v * k : 0) + pa, arcs[j] = { + data: data[j], + index: i, + value: v, + startAngle: a0, + endAngle: a1, + padAngle: p + }; + } + + return arcs; + } + + pie.value = function(_) { + return arguments.length ? (value = typeof _ === "function" ? _ : constant$10(+_), pie) : value; + }; + + pie.sortValues = function(_) { + return arguments.length ? (sortValues = _, sort = null, pie) : sortValues; + }; + + pie.sort = function(_) { + return arguments.length ? (sort = _, sortValues = null, pie) : sort; + }; + + pie.startAngle = function(_) { + return arguments.length ? (startAngle = typeof _ === "function" ? _ : constant$10(+_), pie) : startAngle; + }; + + pie.endAngle = function(_) { + return arguments.length ? (endAngle = typeof _ === "function" ? _ : constant$10(+_), pie) : endAngle; + }; + + pie.padAngle = function(_) { + return arguments.length ? (padAngle = typeof _ === "function" ? _ : constant$10(+_), pie) : padAngle; + }; + + return pie; +} + +var curveRadialLinear = curveRadial(curveLinear); + +function Radial(curve) { + this._curve = curve; +} + +Radial.prototype = { + areaStart: function() { + this._curve.areaStart(); + }, + areaEnd: function() { + this._curve.areaEnd(); + }, + lineStart: function() { + this._curve.lineStart(); + }, + lineEnd: function() { + this._curve.lineEnd(); + }, + point: function(a, r) { + this._curve.point(r * Math.sin(a), r * -Math.cos(a)); + } +}; + +function curveRadial(curve) { + + function radial(context) { + return new Radial(curve(context)); + } + + radial._curve = curve; + + return radial; +} + +function lineRadial(l) { + var c = l.curve; + + l.angle = l.x, delete l.x; + l.radius = l.y, delete l.y; + + l.curve = function(_) { + return arguments.length ? c(curveRadial(_)) : c()._curve; + }; + + return l; +} + +function lineRadial$1() { + return lineRadial(line().curve(curveRadialLinear)); +} + +function areaRadial() { + var a = area$2().curve(curveRadialLinear), + c = a.curve, + x0 = a.lineX0, + x1 = a.lineX1, + y0 = a.lineY0, + y1 = a.lineY1; + + a.angle = a.x, delete a.x; + a.startAngle = a.x0, delete a.x0; + a.endAngle = a.x1, delete a.x1; + a.radius = a.y, delete a.y; + a.innerRadius = a.y0, delete a.y0; + a.outerRadius = a.y1, delete a.y1; + a.lineStartAngle = function() { return lineRadial(x0()); }, delete a.lineX0; + a.lineEndAngle = function() { return lineRadial(x1()); }, delete a.lineX1; + a.lineInnerRadius = function() { return lineRadial(y0()); }, delete a.lineY0; + a.lineOuterRadius = function() { return lineRadial(y1()); }, delete a.lineY1; + + a.curve = function(_) { + return arguments.length ? c(curveRadial(_)) : c()._curve; + }; + + return a; +} + +function pointRadial(x, y) { + return [(y = +y) * Math.cos(x -= Math.PI / 2), y * Math.sin(x)]; +} + +var slice$6 = Array.prototype.slice; + +function linkSource(d) { + return d.source; +} + +function linkTarget(d) { + return d.target; +} + +function link$2(curve) { + var source = linkSource, + target = linkTarget, + x$$1 = x$3, + y$$1 = y$3, + context = null; + + function link() { + var buffer, argv = slice$6.call(arguments), s = source.apply(this, argv), t = target.apply(this, argv); + if (!context) context = buffer = path(); + curve(context, +x$$1.apply(this, (argv[0] = s, argv)), +y$$1.apply(this, argv), +x$$1.apply(this, (argv[0] = t, argv)), +y$$1.apply(this, argv)); + if (buffer) return context = null, buffer + "" || null; + } + + link.source = function(_) { + return arguments.length ? (source = _, link) : source; + }; + + link.target = function(_) { + return arguments.length ? (target = _, link) : target; + }; + + link.x = function(_) { + return arguments.length ? (x$$1 = typeof _ === "function" ? _ : constant$10(+_), link) : x$$1; + }; + + link.y = function(_) { + return arguments.length ? (y$$1 = typeof _ === "function" ? _ : constant$10(+_), link) : y$$1; + }; + + link.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, link) : context; + }; + + return link; +} + +function curveHorizontal(context, x0, y0, x1, y1) { + context.moveTo(x0, y0); + context.bezierCurveTo(x0 = (x0 + x1) / 2, y0, x0, y1, x1, y1); +} + +function curveVertical(context, x0, y0, x1, y1) { + context.moveTo(x0, y0); + context.bezierCurveTo(x0, y0 = (y0 + y1) / 2, x1, y0, x1, y1); +} + +function curveRadial$1(context, x0, y0, x1, y1) { + var p0 = pointRadial(x0, y0), + p1 = pointRadial(x0, y0 = (y0 + y1) / 2), + p2 = pointRadial(x1, y0), + p3 = pointRadial(x1, y1); + context.moveTo(p0[0], p0[1]); + context.bezierCurveTo(p1[0], p1[1], p2[0], p2[1], p3[0], p3[1]); +} + +function linkHorizontal() { + return link$2(curveHorizontal); +} + +function linkVertical() { + return link$2(curveVertical); +} + +function linkRadial() { + var l = link$2(curveRadial$1); + l.angle = l.x, delete l.x; + l.radius = l.y, delete l.y; + return l; +} + +var circle$2 = { + draw: function(context, size) { + var r = Math.sqrt(size / pi$4); + context.moveTo(r, 0); + context.arc(0, 0, r, 0, tau$4); + } +}; + +var cross$2 = { + draw: function(context, size) { + var r = Math.sqrt(size / 5) / 2; + context.moveTo(-3 * r, -r); + context.lineTo(-r, -r); + context.lineTo(-r, -3 * r); + context.lineTo(r, -3 * r); + context.lineTo(r, -r); + context.lineTo(3 * r, -r); + context.lineTo(3 * r, r); + context.lineTo(r, r); + context.lineTo(r, 3 * r); + context.lineTo(-r, 3 * r); + context.lineTo(-r, r); + context.lineTo(-3 * r, r); + context.closePath(); + } +}; + +var tan30 = Math.sqrt(1 / 3); +var tan30_2 = tan30 * 2; + +var diamond = { + draw: function(context, size) { + var y = Math.sqrt(size / tan30_2), + x = y * tan30; + context.moveTo(0, -y); + context.lineTo(x, 0); + context.lineTo(0, y); + context.lineTo(-x, 0); + context.closePath(); + } +}; + +var ka = 0.89081309152928522810; +var kr = Math.sin(pi$4 / 10) / Math.sin(7 * pi$4 / 10); +var kx = Math.sin(tau$4 / 10) * kr; +var ky = -Math.cos(tau$4 / 10) * kr; + +var star = { + draw: function(context, size) { + var r = Math.sqrt(size * ka), + x = kx * r, + y = ky * r; + context.moveTo(0, -r); + context.lineTo(x, y); + for (var i = 1; i < 5; ++i) { + var a = tau$4 * i / 5, + c = Math.cos(a), + s = Math.sin(a); + context.lineTo(s * r, -c * r); + context.lineTo(c * x - s * y, s * x + c * y); + } + context.closePath(); + } +}; + +var square = { + draw: function(context, size) { + var w = Math.sqrt(size), + x = -w / 2; + context.rect(x, x, w, w); + } +}; + +var sqrt3 = Math.sqrt(3); + +var triangle = { + draw: function(context, size) { + var y = -Math.sqrt(size / (sqrt3 * 3)); + context.moveTo(0, y * 2); + context.lineTo(-sqrt3 * y, -y); + context.lineTo(sqrt3 * y, -y); + context.closePath(); + } +}; + +var c = -0.5; +var s = Math.sqrt(3) / 2; +var k = 1 / Math.sqrt(12); +var a = (k / 2 + 1) * 3; + +var wye = { + draw: function(context, size) { + var r = Math.sqrt(size / a), + x0 = r / 2, + y0 = r * k, + x1 = x0, + y1 = r * k + r, + x2 = -x1, + y2 = y1; + context.moveTo(x0, y0); + context.lineTo(x1, y1); + context.lineTo(x2, y2); + context.lineTo(c * x0 - s * y0, s * x0 + c * y0); + context.lineTo(c * x1 - s * y1, s * x1 + c * y1); + context.lineTo(c * x2 - s * y2, s * x2 + c * y2); + context.lineTo(c * x0 + s * y0, c * y0 - s * x0); + context.lineTo(c * x1 + s * y1, c * y1 - s * x1); + context.lineTo(c * x2 + s * y2, c * y2 - s * x2); + context.closePath(); + } +}; + +var symbols = [ + circle$2, + cross$2, + diamond, + square, + star, + triangle, + wye +]; + +function symbol() { + var type = constant$10(circle$2), + size = constant$10(64), + context = null; + + function symbol() { + var buffer; + if (!context) context = buffer = path(); + type.apply(this, arguments).draw(context, +size.apply(this, arguments)); + if (buffer) return context = null, buffer + "" || null; + } + + symbol.type = function(_) { + return arguments.length ? (type = typeof _ === "function" ? _ : constant$10(_), symbol) : type; + }; + + symbol.size = function(_) { + return arguments.length ? (size = typeof _ === "function" ? _ : constant$10(+_), symbol) : size; + }; + + symbol.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, symbol) : context; + }; + + return symbol; +} + +function noop$2() {} + +function point$2(that, x, y) { + that._context.bezierCurveTo( + (2 * that._x0 + that._x1) / 3, + (2 * that._y0 + that._y1) / 3, + (that._x0 + 2 * that._x1) / 3, + (that._y0 + 2 * that._y1) / 3, + (that._x0 + 4 * that._x1 + x) / 6, + (that._y0 + 4 * that._y1 + y) / 6 + ); +} + +function Basis(context) { + this._context = context; +} + +Basis.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = + this._y0 = this._y1 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 3: point$2(this, this._x1, this._y1); // proceed + case 2: this._context.lineTo(this._x1, this._y1); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; break; + case 2: this._point = 3; this._context.lineTo((5 * this._x0 + this._x1) / 6, (5 * this._y0 + this._y1) / 6); // proceed + default: point$2(this, x, y); break; + } + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + } +}; + +function basis$2(context) { + return new Basis(context); +} + +function BasisClosed(context) { + this._context = context; +} + +BasisClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._x0 = this._x1 = this._x2 = this._x3 = this._x4 = + this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 1: { + this._context.moveTo(this._x2, this._y2); + this._context.closePath(); + break; + } + case 2: { + this._context.moveTo((this._x2 + 2 * this._x3) / 3, (this._y2 + 2 * this._y3) / 3); + this._context.lineTo((this._x3 + 2 * this._x2) / 3, (this._y3 + 2 * this._y2) / 3); + this._context.closePath(); + break; + } + case 3: { + this.point(this._x2, this._y2); + this.point(this._x3, this._y3); + this.point(this._x4, this._y4); + break; + } + } + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._x2 = x, this._y2 = y; break; + case 1: this._point = 2; this._x3 = x, this._y3 = y; break; + case 2: this._point = 3; this._x4 = x, this._y4 = y; this._context.moveTo((this._x0 + 4 * this._x1 + x) / 6, (this._y0 + 4 * this._y1 + y) / 6); break; + default: point$2(this, x, y); break; + } + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + } +}; + +function basisClosed$1(context) { + return new BasisClosed(context); +} + +function BasisOpen(context) { + this._context = context; +} + +BasisOpen.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = + this._y0 = this._y1 = NaN; + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; break; + case 1: this._point = 2; break; + case 2: this._point = 3; var x0 = (this._x0 + 4 * this._x1 + x) / 6, y0 = (this._y0 + 4 * this._y1 + y) / 6; this._line ? this._context.lineTo(x0, y0) : this._context.moveTo(x0, y0); break; + case 3: this._point = 4; // proceed + default: point$2(this, x, y); break; + } + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + } +}; + +function basisOpen(context) { + return new BasisOpen(context); +} + +function Bundle(context, beta) { + this._basis = new Basis(context); + this._beta = beta; +} + +Bundle.prototype = { + lineStart: function() { + this._x = []; + this._y = []; + this._basis.lineStart(); + }, + lineEnd: function() { + var x = this._x, + y = this._y, + j = x.length - 1; + + if (j > 0) { + var x0 = x[0], + y0 = y[0], + dx = x[j] - x0, + dy = y[j] - y0, + i = -1, + t; + + while (++i <= j) { + t = i / j; + this._basis.point( + this._beta * x[i] + (1 - this._beta) * (x0 + t * dx), + this._beta * y[i] + (1 - this._beta) * (y0 + t * dy) + ); + } + } + + this._x = this._y = null; + this._basis.lineEnd(); + }, + point: function(x, y) { + this._x.push(+x); + this._y.push(+y); + } +}; + +var bundle = (function custom(beta) { + + function bundle(context) { + return beta === 1 ? new Basis(context) : new Bundle(context, beta); + } + + bundle.beta = function(beta) { + return custom(+beta); + }; + + return bundle; +})(0.85); + +function point$3(that, x, y) { + that._context.bezierCurveTo( + that._x1 + that._k * (that._x2 - that._x0), + that._y1 + that._k * (that._y2 - that._y0), + that._x2 + that._k * (that._x1 - x), + that._y2 + that._k * (that._y1 - y), + that._x2, + that._y2 + ); +} + +function Cardinal(context, tension) { + this._context = context; + this._k = (1 - tension) / 6; +} + +Cardinal.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 2: this._context.lineTo(this._x2, this._y2); break; + case 3: point$3(this, this._x1, this._y1); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; this._x1 = x, this._y1 = y; break; + case 2: this._point = 3; // proceed + default: point$3(this, x, y); break; + } + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var cardinal = (function custom(tension) { + + function cardinal(context) { + return new Cardinal(context, tension); + } + + cardinal.tension = function(tension) { + return custom(+tension); + }; + + return cardinal; +})(0); + +function CardinalClosed(context, tension) { + this._context = context; + this._k = (1 - tension) / 6; +} + +CardinalClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._x0 = this._x1 = this._x2 = this._x3 = this._x4 = this._x5 = + this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = this._y5 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 1: { + this._context.moveTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 2: { + this._context.lineTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 3: { + this.point(this._x3, this._y3); + this.point(this._x4, this._y4); + this.point(this._x5, this._y5); + break; + } + } + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._x3 = x, this._y3 = y; break; + case 1: this._point = 2; this._context.moveTo(this._x4 = x, this._y4 = y); break; + case 2: this._point = 3; this._x5 = x, this._y5 = y; break; + default: point$3(this, x, y); break; + } + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var cardinalClosed = (function custom(tension) { + + function cardinal$$1(context) { + return new CardinalClosed(context, tension); + } + + cardinal$$1.tension = function(tension) { + return custom(+tension); + }; + + return cardinal$$1; +})(0); + +function CardinalOpen(context, tension) { + this._context = context; + this._k = (1 - tension) / 6; +} + +CardinalOpen.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; break; + case 1: this._point = 2; break; + case 2: this._point = 3; this._line ? this._context.lineTo(this._x2, this._y2) : this._context.moveTo(this._x2, this._y2); break; + case 3: this._point = 4; // proceed + default: point$3(this, x, y); break; + } + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var cardinalOpen = (function custom(tension) { + + function cardinal$$1(context) { + return new CardinalOpen(context, tension); + } + + cardinal$$1.tension = function(tension) { + return custom(+tension); + }; + + return cardinal$$1; +})(0); + +function point$4(that, x, y) { + var x1 = that._x1, + y1 = that._y1, + x2 = that._x2, + y2 = that._y2; + + if (that._l01_a > epsilon$3) { + var a = 2 * that._l01_2a + 3 * that._l01_a * that._l12_a + that._l12_2a, + n = 3 * that._l01_a * (that._l01_a + that._l12_a); + x1 = (x1 * a - that._x0 * that._l12_2a + that._x2 * that._l01_2a) / n; + y1 = (y1 * a - that._y0 * that._l12_2a + that._y2 * that._l01_2a) / n; + } + + if (that._l23_a > epsilon$3) { + var b = 2 * that._l23_2a + 3 * that._l23_a * that._l12_a + that._l12_2a, + m = 3 * that._l23_a * (that._l23_a + that._l12_a); + x2 = (x2 * b + that._x1 * that._l23_2a - x * that._l12_2a) / m; + y2 = (y2 * b + that._y1 * that._l23_2a - y * that._l12_2a) / m; + } + + that._context.bezierCurveTo(x1, y1, x2, y2, that._x2, that._y2); +} + +function CatmullRom(context, alpha) { + this._context = context; + this._alpha = alpha; +} + +CatmullRom.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._l01_a = this._l12_a = this._l23_a = + this._l01_2a = this._l12_2a = this._l23_2a = + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 2: this._context.lineTo(this._x2, this._y2); break; + case 3: this.point(this._x2, this._y2); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + + if (this._point) { + var x23 = this._x2 - x, + y23 = this._y2 - y; + this._l23_a = Math.sqrt(this._l23_2a = Math.pow(x23 * x23 + y23 * y23, this._alpha)); + } + + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; break; + case 2: this._point = 3; // proceed + default: point$4(this, x, y); break; + } + + this._l01_a = this._l12_a, this._l12_a = this._l23_a; + this._l01_2a = this._l12_2a, this._l12_2a = this._l23_2a; + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var catmullRom = (function custom(alpha) { + + function catmullRom(context) { + return alpha ? new CatmullRom(context, alpha) : new Cardinal(context, 0); + } + + catmullRom.alpha = function(alpha) { + return custom(+alpha); + }; + + return catmullRom; +})(0.5); + +function CatmullRomClosed(context, alpha) { + this._context = context; + this._alpha = alpha; +} + +CatmullRomClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._x0 = this._x1 = this._x2 = this._x3 = this._x4 = this._x5 = + this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = this._y5 = NaN; + this._l01_a = this._l12_a = this._l23_a = + this._l01_2a = this._l12_2a = this._l23_2a = + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 1: { + this._context.moveTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 2: { + this._context.lineTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 3: { + this.point(this._x3, this._y3); + this.point(this._x4, this._y4); + this.point(this._x5, this._y5); + break; + } + } + }, + point: function(x, y) { + x = +x, y = +y; + + if (this._point) { + var x23 = this._x2 - x, + y23 = this._y2 - y; + this._l23_a = Math.sqrt(this._l23_2a = Math.pow(x23 * x23 + y23 * y23, this._alpha)); + } + + switch (this._point) { + case 0: this._point = 1; this._x3 = x, this._y3 = y; break; + case 1: this._point = 2; this._context.moveTo(this._x4 = x, this._y4 = y); break; + case 2: this._point = 3; this._x5 = x, this._y5 = y; break; + default: point$4(this, x, y); break; + } + + this._l01_a = this._l12_a, this._l12_a = this._l23_a; + this._l01_2a = this._l12_2a, this._l12_2a = this._l23_2a; + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var catmullRomClosed = (function custom(alpha) { + + function catmullRom$$1(context) { + return alpha ? new CatmullRomClosed(context, alpha) : new CardinalClosed(context, 0); + } + + catmullRom$$1.alpha = function(alpha) { + return custom(+alpha); + }; + + return catmullRom$$1; +})(0.5); + +function CatmullRomOpen(context, alpha) { + this._context = context; + this._alpha = alpha; +} + +CatmullRomOpen.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._l01_a = this._l12_a = this._l23_a = + this._l01_2a = this._l12_2a = this._l23_2a = + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + + if (this._point) { + var x23 = this._x2 - x, + y23 = this._y2 - y; + this._l23_a = Math.sqrt(this._l23_2a = Math.pow(x23 * x23 + y23 * y23, this._alpha)); + } + + switch (this._point) { + case 0: this._point = 1; break; + case 1: this._point = 2; break; + case 2: this._point = 3; this._line ? this._context.lineTo(this._x2, this._y2) : this._context.moveTo(this._x2, this._y2); break; + case 3: this._point = 4; // proceed + default: point$4(this, x, y); break; + } + + this._l01_a = this._l12_a, this._l12_a = this._l23_a; + this._l01_2a = this._l12_2a, this._l12_2a = this._l23_2a; + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var catmullRomOpen = (function custom(alpha) { + + function catmullRom$$1(context) { + return alpha ? new CatmullRomOpen(context, alpha) : new CardinalOpen(context, 0); + } + + catmullRom$$1.alpha = function(alpha) { + return custom(+alpha); + }; + + return catmullRom$$1; +})(0.5); + +function LinearClosed(context) { + this._context = context; +} + +LinearClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._point) this._context.closePath(); + }, + point: function(x, y) { + x = +x, y = +y; + if (this._point) this._context.lineTo(x, y); + else this._point = 1, this._context.moveTo(x, y); + } +}; + +function linearClosed(context) { + return new LinearClosed(context); +} + +function sign$1(x) { + return x < 0 ? -1 : 1; +} + +// Calculate the slopes of the tangents (Hermite-type interpolation) based on +// the following paper: Steffen, M. 1990. A Simple Method for Monotonic +// Interpolation in One Dimension. Astronomy and Astrophysics, Vol. 239, NO. +// NOV(II), P. 443, 1990. +function slope3(that, x2, y2) { + var h0 = that._x1 - that._x0, + h1 = x2 - that._x1, + s0 = (that._y1 - that._y0) / (h0 || h1 < 0 && -0), + s1 = (y2 - that._y1) / (h1 || h0 < 0 && -0), + p = (s0 * h1 + s1 * h0) / (h0 + h1); + return (sign$1(s0) + sign$1(s1)) * Math.min(Math.abs(s0), Math.abs(s1), 0.5 * Math.abs(p)) || 0; +} + +// Calculate a one-sided slope. +function slope2(that, t) { + var h = that._x1 - that._x0; + return h ? (3 * (that._y1 - that._y0) / h - t) / 2 : t; +} + +// According to https://en.wikipedia.org/wiki/Cubic_Hermite_spline#Representations +// "you can express cubic Hermite interpolation in terms of cubic Bézier curves +// with respect to the four values p0, p0 + m0 / 3, p1 - m1 / 3, p1". +function point$5(that, t0, t1) { + var x0 = that._x0, + y0 = that._y0, + x1 = that._x1, + y1 = that._y1, + dx = (x1 - x0) / 3; + that._context.bezierCurveTo(x0 + dx, y0 + dx * t0, x1 - dx, y1 - dx * t1, x1, y1); +} + +function MonotoneX(context) { + this._context = context; +} + +MonotoneX.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = + this._y0 = this._y1 = + this._t0 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 2: this._context.lineTo(this._x1, this._y1); break; + case 3: point$5(this, this._t0, slope2(this, this._t0)); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + var t1 = NaN; + + x = +x, y = +y; + if (x === this._x1 && y === this._y1) return; // Ignore coincident points. + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; break; + case 2: this._point = 3; point$5(this, slope2(this, t1 = slope3(this, x, y)), t1); break; + default: point$5(this, this._t0, t1 = slope3(this, x, y)); break; + } + + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + this._t0 = t1; + } +}; + +function MonotoneY(context) { + this._context = new ReflectContext(context); +} + +(MonotoneY.prototype = Object.create(MonotoneX.prototype)).point = function(x, y) { + MonotoneX.prototype.point.call(this, y, x); +}; + +function ReflectContext(context) { + this._context = context; +} + +ReflectContext.prototype = { + moveTo: function(x, y) { this._context.moveTo(y, x); }, + closePath: function() { this._context.closePath(); }, + lineTo: function(x, y) { this._context.lineTo(y, x); }, + bezierCurveTo: function(x1, y1, x2, y2, x, y) { this._context.bezierCurveTo(y1, x1, y2, x2, y, x); } +}; + +function monotoneX(context) { + return new MonotoneX(context); +} + +function monotoneY(context) { + return new MonotoneY(context); +} + +function Natural(context) { + this._context = context; +} + +Natural.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x = []; + this._y = []; + }, + lineEnd: function() { + var x = this._x, + y = this._y, + n = x.length; + + if (n) { + this._line ? this._context.lineTo(x[0], y[0]) : this._context.moveTo(x[0], y[0]); + if (n === 2) { + this._context.lineTo(x[1], y[1]); + } else { + var px = controlPoints(x), + py = controlPoints(y); + for (var i0 = 0, i1 = 1; i1 < n; ++i0, ++i1) { + this._context.bezierCurveTo(px[0][i0], py[0][i0], px[1][i0], py[1][i0], x[i1], y[i1]); + } + } + } + + if (this._line || (this._line !== 0 && n === 1)) this._context.closePath(); + this._line = 1 - this._line; + this._x = this._y = null; + }, + point: function(x, y) { + this._x.push(+x); + this._y.push(+y); + } +}; + +// See https://www.particleincell.com/2012/bezier-splines/ for derivation. +function controlPoints(x) { + var i, + n = x.length - 1, + m, + a = new Array(n), + b = new Array(n), + r = new Array(n); + a[0] = 0, b[0] = 2, r[0] = x[0] + 2 * x[1]; + for (i = 1; i < n - 1; ++i) a[i] = 1, b[i] = 4, r[i] = 4 * x[i] + 2 * x[i + 1]; + a[n - 1] = 2, b[n - 1] = 7, r[n - 1] = 8 * x[n - 1] + x[n]; + for (i = 1; i < n; ++i) m = a[i] / b[i - 1], b[i] -= m, r[i] -= m * r[i - 1]; + a[n - 1] = r[n - 1] / b[n - 1]; + for (i = n - 2; i >= 0; --i) a[i] = (r[i] - a[i + 1]) / b[i]; + b[n - 1] = (x[n] + a[n - 1]) / 2; + for (i = 0; i < n - 1; ++i) b[i] = 2 * x[i + 1] - a[i + 1]; + return [a, b]; +} + +function natural(context) { + return new Natural(context); +} + +function Step(context, t) { + this._context = context; + this._t = t; +} + +Step.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x = this._y = NaN; + this._point = 0; + }, + lineEnd: function() { + if (0 < this._t && this._t < 1 && this._point === 2) this._context.lineTo(this._x, this._y); + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + if (this._line >= 0) this._t = 1 - this._t, this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; // proceed + default: { + if (this._t <= 0) { + this._context.lineTo(this._x, y); + this._context.lineTo(x, y); + } else { + var x1 = this._x * (1 - this._t) + x * this._t; + this._context.lineTo(x1, this._y); + this._context.lineTo(x1, y); + } + break; + } + } + this._x = x, this._y = y; + } +}; + +function step(context) { + return new Step(context, 0.5); +} + +function stepBefore(context) { + return new Step(context, 0); +} + +function stepAfter(context) { + return new Step(context, 1); +} + +function none$1(series, order) { + if (!((n = series.length) > 1)) return; + for (var i = 1, j, s0, s1 = series[order[0]], n, m = s1.length; i < n; ++i) { + s0 = s1, s1 = series[order[i]]; + for (j = 0; j < m; ++j) { + s1[j][1] += s1[j][0] = isNaN(s0[j][1]) ? s0[j][0] : s0[j][1]; + } + } +} + +function none$2(series) { + var n = series.length, o = new Array(n); + while (--n >= 0) o[n] = n; + return o; +} + +function stackValue(d, key) { + return d[key]; +} + +function stack() { + var keys = constant$10([]), + order = none$2, + offset = none$1, + value = stackValue; + + function stack(data) { + var kz = keys.apply(this, arguments), + i, + m = data.length, + n = kz.length, + sz = new Array(n), + oz; + + for (i = 0; i < n; ++i) { + for (var ki = kz[i], si = sz[i] = new Array(m), j = 0, sij; j < m; ++j) { + si[j] = sij = [0, +value(data[j], ki, j, data)]; + sij.data = data[j]; + } + si.key = ki; + } + + for (i = 0, oz = order(sz); i < n; ++i) { + sz[oz[i]].index = i; + } + + offset(sz, oz); + return sz; + } + + stack.keys = function(_) { + return arguments.length ? (keys = typeof _ === "function" ? _ : constant$10(slice$6.call(_)), stack) : keys; + }; + + stack.value = function(_) { + return arguments.length ? (value = typeof _ === "function" ? _ : constant$10(+_), stack) : value; + }; + + stack.order = function(_) { + return arguments.length ? (order = _ == null ? none$2 : typeof _ === "function" ? _ : constant$10(slice$6.call(_)), stack) : order; + }; + + stack.offset = function(_) { + return arguments.length ? (offset = _ == null ? none$1 : _, stack) : offset; + }; + + return stack; +} + +function expand(series, order) { + if (!((n = series.length) > 0)) return; + for (var i, n, j = 0, m = series[0].length, y; j < m; ++j) { + for (y = i = 0; i < n; ++i) y += series[i][j][1] || 0; + if (y) for (i = 0; i < n; ++i) series[i][j][1] /= y; + } + none$1(series, order); +} + +function diverging(series, order) { + if (!((n = series.length) > 1)) return; + for (var i, j = 0, d, dy, yp, yn, n, m = series[order[0]].length; j < m; ++j) { + for (yp = yn = 0, i = 0; i < n; ++i) { + if ((dy = (d = series[order[i]][j])[1] - d[0]) >= 0) { + d[0] = yp, d[1] = yp += dy; + } else if (dy < 0) { + d[1] = yn, d[0] = yn += dy; + } else { + d[0] = yp; + } + } + } +} + +function silhouette(series, order) { + if (!((n = series.length) > 0)) return; + for (var j = 0, s0 = series[order[0]], n, m = s0.length; j < m; ++j) { + for (var i = 0, y = 0; i < n; ++i) y += series[i][j][1] || 0; + s0[j][1] += s0[j][0] = -y / 2; + } + none$1(series, order); +} + +function wiggle(series, order) { + if (!((n = series.length) > 0) || !((m = (s0 = series[order[0]]).length) > 0)) return; + for (var y = 0, j = 1, s0, m, n; j < m; ++j) { + for (var i = 0, s1 = 0, s2 = 0; i < n; ++i) { + var si = series[order[i]], + sij0 = si[j][1] || 0, + sij1 = si[j - 1][1] || 0, + s3 = (sij0 - sij1) / 2; + for (var k = 0; k < i; ++k) { + var sk = series[order[k]], + skj0 = sk[j][1] || 0, + skj1 = sk[j - 1][1] || 0; + s3 += skj0 - skj1; + } + s1 += sij0, s2 += s3 * sij0; + } + s0[j - 1][1] += s0[j - 1][0] = y; + if (s1) y -= s2 / s1; + } + s0[j - 1][1] += s0[j - 1][0] = y; + none$1(series, order); +} + +function ascending$2(series) { + var sums = series.map(sum$2); + return none$2(series).sort(function(a, b) { return sums[a] - sums[b]; }); +} + +function sum$2(series) { + var s = 0, i = -1, n = series.length, v; + while (++i < n) if (v = +series[i][1]) s += v; + return s; +} + +function descending$2(series) { + return ascending$2(series).reverse(); +} + +function insideOut(series) { + var n = series.length, + i, + j, + sums = series.map(sum$2), + order = none$2(series).sort(function(a, b) { return sums[b] - sums[a]; }), + top = 0, + bottom = 0, + tops = [], + bottoms = []; + + for (i = 0; i < n; ++i) { + j = order[i]; + if (top < bottom) { + top += sums[j]; + tops.push(j); + } else { + bottom += sums[j]; + bottoms.push(j); + } + } + + return bottoms.reverse().concat(tops); +} + +function reverse(series) { + return none$2(series).reverse(); +} + +function constant$11(x) { + return function() { + return x; + }; +} + +function x$4(d) { + return d[0]; +} + +function y$4(d) { + return d[1]; +} + +function RedBlackTree() { + this._ = null; // root node +} + +function RedBlackNode(node) { + node.U = // parent node + node.C = // color - true for red, false for black + node.L = // left node + node.R = // right node + node.P = // previous node + node.N = null; // next node +} + +RedBlackTree.prototype = { + constructor: RedBlackTree, + + insert: function(after, node) { + var parent, grandpa, uncle; + + if (after) { + node.P = after; + node.N = after.N; + if (after.N) after.N.P = node; + after.N = node; + if (after.R) { + after = after.R; + while (after.L) after = after.L; + after.L = node; + } else { + after.R = node; + } + parent = after; + } else if (this._) { + after = RedBlackFirst(this._); + node.P = null; + node.N = after; + after.P = after.L = node; + parent = after; + } else { + node.P = node.N = null; + this._ = node; + parent = null; + } + node.L = node.R = null; + node.U = parent; + node.C = true; + + after = node; + while (parent && parent.C) { + grandpa = parent.U; + if (parent === grandpa.L) { + uncle = grandpa.R; + if (uncle && uncle.C) { + parent.C = uncle.C = false; + grandpa.C = true; + after = grandpa; + } else { + if (after === parent.R) { + RedBlackRotateLeft(this, parent); + after = parent; + parent = after.U; + } + parent.C = false; + grandpa.C = true; + RedBlackRotateRight(this, grandpa); + } + } else { + uncle = grandpa.L; + if (uncle && uncle.C) { + parent.C = uncle.C = false; + grandpa.C = true; + after = grandpa; + } else { + if (after === parent.L) { + RedBlackRotateRight(this, parent); + after = parent; + parent = after.U; + } + parent.C = false; + grandpa.C = true; + RedBlackRotateLeft(this, grandpa); + } + } + parent = after.U; + } + this._.C = false; + }, + + remove: function(node) { + if (node.N) node.N.P = node.P; + if (node.P) node.P.N = node.N; + node.N = node.P = null; + + var parent = node.U, + sibling, + left = node.L, + right = node.R, + next, + red; + + if (!left) next = right; + else if (!right) next = left; + else next = RedBlackFirst(right); + + if (parent) { + if (parent.L === node) parent.L = next; + else parent.R = next; + } else { + this._ = next; + } + + if (left && right) { + red = next.C; + next.C = node.C; + next.L = left; + left.U = next; + if (next !== right) { + parent = next.U; + next.U = node.U; + node = next.R; + parent.L = node; + next.R = right; + right.U = next; + } else { + next.U = parent; + parent = next; + node = next.R; + } + } else { + red = node.C; + node = next; + } + + if (node) node.U = parent; + if (red) return; + if (node && node.C) { node.C = false; return; } + + do { + if (node === this._) break; + if (node === parent.L) { + sibling = parent.R; + if (sibling.C) { + sibling.C = false; + parent.C = true; + RedBlackRotateLeft(this, parent); + sibling = parent.R; + } + if ((sibling.L && sibling.L.C) + || (sibling.R && sibling.R.C)) { + if (!sibling.R || !sibling.R.C) { + sibling.L.C = false; + sibling.C = true; + RedBlackRotateRight(this, sibling); + sibling = parent.R; + } + sibling.C = parent.C; + parent.C = sibling.R.C = false; + RedBlackRotateLeft(this, parent); + node = this._; + break; + } + } else { + sibling = parent.L; + if (sibling.C) { + sibling.C = false; + parent.C = true; + RedBlackRotateRight(this, parent); + sibling = parent.L; + } + if ((sibling.L && sibling.L.C) + || (sibling.R && sibling.R.C)) { + if (!sibling.L || !sibling.L.C) { + sibling.R.C = false; + sibling.C = true; + RedBlackRotateLeft(this, sibling); + sibling = parent.L; + } + sibling.C = parent.C; + parent.C = sibling.L.C = false; + RedBlackRotateRight(this, parent); + node = this._; + break; + } + } + sibling.C = true; + node = parent; + parent = parent.U; + } while (!node.C); + + if (node) node.C = false; + } +}; + +function RedBlackRotateLeft(tree, node) { + var p = node, + q = node.R, + parent = p.U; + + if (parent) { + if (parent.L === p) parent.L = q; + else parent.R = q; + } else { + tree._ = q; + } + + q.U = parent; + p.U = q; + p.R = q.L; + if (p.R) p.R.U = p; + q.L = p; +} + +function RedBlackRotateRight(tree, node) { + var p = node, + q = node.L, + parent = p.U; + + if (parent) { + if (parent.L === p) parent.L = q; + else parent.R = q; + } else { + tree._ = q; + } + + q.U = parent; + p.U = q; + p.L = q.R; + if (p.L) p.L.U = p; + q.R = p; +} + +function RedBlackFirst(node) { + while (node.L) node = node.L; + return node; +} + +function createEdge(left, right, v0, v1) { + var edge = [null, null], + index = edges.push(edge) - 1; + edge.left = left; + edge.right = right; + if (v0) setEdgeEnd(edge, left, right, v0); + if (v1) setEdgeEnd(edge, right, left, v1); + cells[left.index].halfedges.push(index); + cells[right.index].halfedges.push(index); + return edge; +} + +function createBorderEdge(left, v0, v1) { + var edge = [v0, v1]; + edge.left = left; + return edge; +} + +function setEdgeEnd(edge, left, right, vertex) { + if (!edge[0] && !edge[1]) { + edge[0] = vertex; + edge.left = left; + edge.right = right; + } else if (edge.left === right) { + edge[1] = vertex; + } else { + edge[0] = vertex; + } +} + +// Liang–Barsky line clipping. +function clipEdge(edge, x0, y0, x1, y1) { + var a = edge[0], + b = edge[1], + ax = a[0], + ay = a[1], + bx = b[0], + by = b[1], + t0 = 0, + t1 = 1, + dx = bx - ax, + dy = by - ay, + r; + + r = x0 - ax; + if (!dx && r > 0) return; + r /= dx; + if (dx < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dx > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = x1 - ax; + if (!dx && r < 0) return; + r /= dx; + if (dx < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dx > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + r = y0 - ay; + if (!dy && r > 0) return; + r /= dy; + if (dy < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dy > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = y1 - ay; + if (!dy && r < 0) return; + r /= dy; + if (dy < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dy > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + if (!(t0 > 0) && !(t1 < 1)) return true; // TODO Better check? + + if (t0 > 0) edge[0] = [ax + t0 * dx, ay + t0 * dy]; + if (t1 < 1) edge[1] = [ax + t1 * dx, ay + t1 * dy]; + return true; +} + +function connectEdge(edge, x0, y0, x1, y1) { + var v1 = edge[1]; + if (v1) return true; + + var v0 = edge[0], + left = edge.left, + right = edge.right, + lx = left[0], + ly = left[1], + rx = right[0], + ry = right[1], + fx = (lx + rx) / 2, + fy = (ly + ry) / 2, + fm, + fb; + + if (ry === ly) { + if (fx < x0 || fx >= x1) return; + if (lx > rx) { + if (!v0) v0 = [fx, y0]; + else if (v0[1] >= y1) return; + v1 = [fx, y1]; + } else { + if (!v0) v0 = [fx, y1]; + else if (v0[1] < y0) return; + v1 = [fx, y0]; + } + } else { + fm = (lx - rx) / (ry - ly); + fb = fy - fm * fx; + if (fm < -1 || fm > 1) { + if (lx > rx) { + if (!v0) v0 = [(y0 - fb) / fm, y0]; + else if (v0[1] >= y1) return; + v1 = [(y1 - fb) / fm, y1]; + } else { + if (!v0) v0 = [(y1 - fb) / fm, y1]; + else if (v0[1] < y0) return; + v1 = [(y0 - fb) / fm, y0]; + } + } else { + if (ly < ry) { + if (!v0) v0 = [x0, fm * x0 + fb]; + else if (v0[0] >= x1) return; + v1 = [x1, fm * x1 + fb]; + } else { + if (!v0) v0 = [x1, fm * x1 + fb]; + else if (v0[0] < x0) return; + v1 = [x0, fm * x0 + fb]; + } + } + } + + edge[0] = v0; + edge[1] = v1; + return true; +} + +function clipEdges(x0, y0, x1, y1) { + var i = edges.length, + edge; + + while (i--) { + if (!connectEdge(edge = edges[i], x0, y0, x1, y1) + || !clipEdge(edge, x0, y0, x1, y1) + || !(Math.abs(edge[0][0] - edge[1][0]) > epsilon$4 + || Math.abs(edge[0][1] - edge[1][1]) > epsilon$4)) { + delete edges[i]; + } + } +} + +function createCell(site) { + return cells[site.index] = { + site: site, + halfedges: [] + }; +} + +function cellHalfedgeAngle(cell, edge) { + var site = cell.site, + va = edge.left, + vb = edge.right; + if (site === vb) vb = va, va = site; + if (vb) return Math.atan2(vb[1] - va[1], vb[0] - va[0]); + if (site === va) va = edge[1], vb = edge[0]; + else va = edge[0], vb = edge[1]; + return Math.atan2(va[0] - vb[0], vb[1] - va[1]); +} + +function cellHalfedgeStart(cell, edge) { + return edge[+(edge.left !== cell.site)]; +} + +function cellHalfedgeEnd(cell, edge) { + return edge[+(edge.left === cell.site)]; +} + +function sortCellHalfedges() { + for (var i = 0, n = cells.length, cell, halfedges, j, m; i < n; ++i) { + if ((cell = cells[i]) && (m = (halfedges = cell.halfedges).length)) { + var index = new Array(m), + array = new Array(m); + for (j = 0; j < m; ++j) index[j] = j, array[j] = cellHalfedgeAngle(cell, edges[halfedges[j]]); + index.sort(function(i, j) { return array[j] - array[i]; }); + for (j = 0; j < m; ++j) array[j] = halfedges[index[j]]; + for (j = 0; j < m; ++j) halfedges[j] = array[j]; + } + } +} + +function clipCells(x0, y0, x1, y1) { + var nCells = cells.length, + iCell, + cell, + site, + iHalfedge, + halfedges, + nHalfedges, + start, + startX, + startY, + end, + endX, + endY, + cover = true; + + for (iCell = 0; iCell < nCells; ++iCell) { + if (cell = cells[iCell]) { + site = cell.site; + halfedges = cell.halfedges; + iHalfedge = halfedges.length; + + // Remove any dangling clipped edges. + while (iHalfedge--) { + if (!edges[halfedges[iHalfedge]]) { + halfedges.splice(iHalfedge, 1); + } + } + + // Insert any border edges as necessary. + iHalfedge = 0, nHalfedges = halfedges.length; + while (iHalfedge < nHalfedges) { + end = cellHalfedgeEnd(cell, edges[halfedges[iHalfedge]]), endX = end[0], endY = end[1]; + start = cellHalfedgeStart(cell, edges[halfedges[++iHalfedge % nHalfedges]]), startX = start[0], startY = start[1]; + if (Math.abs(endX - startX) > epsilon$4 || Math.abs(endY - startY) > epsilon$4) { + halfedges.splice(iHalfedge, 0, edges.push(createBorderEdge(site, end, + Math.abs(endX - x0) < epsilon$4 && y1 - endY > epsilon$4 ? [x0, Math.abs(startX - x0) < epsilon$4 ? startY : y1] + : Math.abs(endY - y1) < epsilon$4 && x1 - endX > epsilon$4 ? [Math.abs(startY - y1) < epsilon$4 ? startX : x1, y1] + : Math.abs(endX - x1) < epsilon$4 && endY - y0 > epsilon$4 ? [x1, Math.abs(startX - x1) < epsilon$4 ? startY : y0] + : Math.abs(endY - y0) < epsilon$4 && endX - x0 > epsilon$4 ? [Math.abs(startY - y0) < epsilon$4 ? startX : x0, y0] + : null)) - 1); + ++nHalfedges; + } + } + + if (nHalfedges) cover = false; + } + } + + // If there weren’t any edges, have the closest site cover the extent. + // It doesn’t matter which corner of the extent we measure! + if (cover) { + var dx, dy, d2, dc = Infinity; + + for (iCell = 0, cover = null; iCell < nCells; ++iCell) { + if (cell = cells[iCell]) { + site = cell.site; + dx = site[0] - x0; + dy = site[1] - y0; + d2 = dx * dx + dy * dy; + if (d2 < dc) dc = d2, cover = cell; + } + } + + if (cover) { + var v00 = [x0, y0], v01 = [x0, y1], v11 = [x1, y1], v10 = [x1, y0]; + cover.halfedges.push( + edges.push(createBorderEdge(site = cover.site, v00, v01)) - 1, + edges.push(createBorderEdge(site, v01, v11)) - 1, + edges.push(createBorderEdge(site, v11, v10)) - 1, + edges.push(createBorderEdge(site, v10, v00)) - 1 + ); + } + } + + // Lastly delete any cells with no edges; these were entirely clipped. + for (iCell = 0; iCell < nCells; ++iCell) { + if (cell = cells[iCell]) { + if (!cell.halfedges.length) { + delete cells[iCell]; + } + } + } +} + +var circlePool = []; + +var firstCircle; + +function Circle() { + RedBlackNode(this); + this.x = + this.y = + this.arc = + this.site = + this.cy = null; +} + +function attachCircle(arc) { + var lArc = arc.P, + rArc = arc.N; + + if (!lArc || !rArc) return; + + var lSite = lArc.site, + cSite = arc.site, + rSite = rArc.site; + + if (lSite === rSite) return; + + var bx = cSite[0], + by = cSite[1], + ax = lSite[0] - bx, + ay = lSite[1] - by, + cx = rSite[0] - bx, + cy = rSite[1] - by; + + var d = 2 * (ax * cy - ay * cx); + if (d >= -epsilon2$2) return; + + var ha = ax * ax + ay * ay, + hc = cx * cx + cy * cy, + x = (cy * ha - ay * hc) / d, + y = (ax * hc - cx * ha) / d; + + var circle = circlePool.pop() || new Circle; + circle.arc = arc; + circle.site = cSite; + circle.x = x + bx; + circle.y = (circle.cy = y + by) + Math.sqrt(x * x + y * y); // y bottom + + arc.circle = circle; + + var before = null, + node = circles._; + + while (node) { + if (circle.y < node.y || (circle.y === node.y && circle.x <= node.x)) { + if (node.L) node = node.L; + else { before = node.P; break; } + } else { + if (node.R) node = node.R; + else { before = node; break; } + } + } + + circles.insert(before, circle); + if (!before) firstCircle = circle; +} + +function detachCircle(arc) { + var circle = arc.circle; + if (circle) { + if (!circle.P) firstCircle = circle.N; + circles.remove(circle); + circlePool.push(circle); + RedBlackNode(circle); + arc.circle = null; + } +} + +var beachPool = []; + +function Beach() { + RedBlackNode(this); + this.edge = + this.site = + this.circle = null; +} + +function createBeach(site) { + var beach = beachPool.pop() || new Beach; + beach.site = site; + return beach; +} + +function detachBeach(beach) { + detachCircle(beach); + beaches.remove(beach); + beachPool.push(beach); + RedBlackNode(beach); +} + +function removeBeach(beach) { + var circle = beach.circle, + x = circle.x, + y = circle.cy, + vertex = [x, y], + previous = beach.P, + next = beach.N, + disappearing = [beach]; + + detachBeach(beach); + + var lArc = previous; + while (lArc.circle + && Math.abs(x - lArc.circle.x) < epsilon$4 + && Math.abs(y - lArc.circle.cy) < epsilon$4) { + previous = lArc.P; + disappearing.unshift(lArc); + detachBeach(lArc); + lArc = previous; + } + + disappearing.unshift(lArc); + detachCircle(lArc); + + var rArc = next; + while (rArc.circle + && Math.abs(x - rArc.circle.x) < epsilon$4 + && Math.abs(y - rArc.circle.cy) < epsilon$4) { + next = rArc.N; + disappearing.push(rArc); + detachBeach(rArc); + rArc = next; + } + + disappearing.push(rArc); + detachCircle(rArc); + + var nArcs = disappearing.length, + iArc; + for (iArc = 1; iArc < nArcs; ++iArc) { + rArc = disappearing[iArc]; + lArc = disappearing[iArc - 1]; + setEdgeEnd(rArc.edge, lArc.site, rArc.site, vertex); + } + + lArc = disappearing[0]; + rArc = disappearing[nArcs - 1]; + rArc.edge = createEdge(lArc.site, rArc.site, null, vertex); + + attachCircle(lArc); + attachCircle(rArc); +} + +function addBeach(site) { + var x = site[0], + directrix = site[1], + lArc, + rArc, + dxl, + dxr, + node = beaches._; + + while (node) { + dxl = leftBreakPoint(node, directrix) - x; + if (dxl > epsilon$4) node = node.L; else { + dxr = x - rightBreakPoint(node, directrix); + if (dxr > epsilon$4) { + if (!node.R) { + lArc = node; + break; + } + node = node.R; + } else { + if (dxl > -epsilon$4) { + lArc = node.P; + rArc = node; + } else if (dxr > -epsilon$4) { + lArc = node; + rArc = node.N; + } else { + lArc = rArc = node; + } + break; + } + } + } + + createCell(site); + var newArc = createBeach(site); + beaches.insert(lArc, newArc); + + if (!lArc && !rArc) return; + + if (lArc === rArc) { + detachCircle(lArc); + rArc = createBeach(lArc.site); + beaches.insert(newArc, rArc); + newArc.edge = rArc.edge = createEdge(lArc.site, newArc.site); + attachCircle(lArc); + attachCircle(rArc); + return; + } + + if (!rArc) { // && lArc + newArc.edge = createEdge(lArc.site, newArc.site); + return; + } + + // else lArc !== rArc + detachCircle(lArc); + detachCircle(rArc); + + var lSite = lArc.site, + ax = lSite[0], + ay = lSite[1], + bx = site[0] - ax, + by = site[1] - ay, + rSite = rArc.site, + cx = rSite[0] - ax, + cy = rSite[1] - ay, + d = 2 * (bx * cy - by * cx), + hb = bx * bx + by * by, + hc = cx * cx + cy * cy, + vertex = [(cy * hb - by * hc) / d + ax, (bx * hc - cx * hb) / d + ay]; + + setEdgeEnd(rArc.edge, lSite, rSite, vertex); + newArc.edge = createEdge(lSite, site, null, vertex); + rArc.edge = createEdge(site, rSite, null, vertex); + attachCircle(lArc); + attachCircle(rArc); +} + +function leftBreakPoint(arc, directrix) { + var site = arc.site, + rfocx = site[0], + rfocy = site[1], + pby2 = rfocy - directrix; + + if (!pby2) return rfocx; + + var lArc = arc.P; + if (!lArc) return -Infinity; + + site = lArc.site; + var lfocx = site[0], + lfocy = site[1], + plby2 = lfocy - directrix; + + if (!plby2) return lfocx; + + var hl = lfocx - rfocx, + aby2 = 1 / pby2 - 1 / plby2, + b = hl / plby2; + + if (aby2) return (-b + Math.sqrt(b * b - 2 * aby2 * (hl * hl / (-2 * plby2) - lfocy + plby2 / 2 + rfocy - pby2 / 2))) / aby2 + rfocx; + + return (rfocx + lfocx) / 2; +} + +function rightBreakPoint(arc, directrix) { + var rArc = arc.N; + if (rArc) return leftBreakPoint(rArc, directrix); + var site = arc.site; + return site[1] === directrix ? site[0] : Infinity; +} + +var epsilon$4 = 1e-6; +var epsilon2$2 = 1e-12; +var beaches; +var cells; +var circles; +var edges; + +function triangleArea(a, b, c) { + return (a[0] - c[0]) * (b[1] - a[1]) - (a[0] - b[0]) * (c[1] - a[1]); +} + +function lexicographic(a, b) { + return b[1] - a[1] + || b[0] - a[0]; +} + +function Diagram(sites, extent) { + var site = sites.sort(lexicographic).pop(), + x, + y, + circle; + + edges = []; + cells = new Array(sites.length); + beaches = new RedBlackTree; + circles = new RedBlackTree; + + while (true) { + circle = firstCircle; + if (site && (!circle || site[1] < circle.y || (site[1] === circle.y && site[0] < circle.x))) { + if (site[0] !== x || site[1] !== y) { + addBeach(site); + x = site[0], y = site[1]; + } + site = sites.pop(); + } else if (circle) { + removeBeach(circle.arc); + } else { + break; + } + } + + sortCellHalfedges(); + + if (extent) { + var x0 = +extent[0][0], + y0 = +extent[0][1], + x1 = +extent[1][0], + y1 = +extent[1][1]; + clipEdges(x0, y0, x1, y1); + clipCells(x0, y0, x1, y1); + } + + this.edges = edges; + this.cells = cells; + + beaches = + circles = + edges = + cells = null; +} + +Diagram.prototype = { + constructor: Diagram, + + polygons: function() { + var edges = this.edges; + + return this.cells.map(function(cell) { + var polygon = cell.halfedges.map(function(i) { return cellHalfedgeStart(cell, edges[i]); }); + polygon.data = cell.site.data; + return polygon; + }); + }, + + triangles: function() { + var triangles = [], + edges = this.edges; + + this.cells.forEach(function(cell, i) { + if (!(m = (halfedges = cell.halfedges).length)) return; + var site = cell.site, + halfedges, + j = -1, + m, + s0, + e1 = edges[halfedges[m - 1]], + s1 = e1.left === site ? e1.right : e1.left; + + while (++j < m) { + s0 = s1; + e1 = edges[halfedges[j]]; + s1 = e1.left === site ? e1.right : e1.left; + if (s0 && s1 && i < s0.index && i < s1.index && triangleArea(site, s0, s1) < 0) { + triangles.push([site.data, s0.data, s1.data]); + } + } + }); + + return triangles; + }, + + links: function() { + return this.edges.filter(function(edge) { + return edge.right; + }).map(function(edge) { + return { + source: edge.left.data, + target: edge.right.data + }; + }); + }, + + find: function(x, y, radius) { + var that = this, i0, i1 = that._found || 0, n = that.cells.length, cell; + + // Use the previously-found cell, or start with an arbitrary one. + while (!(cell = that.cells[i1])) if (++i1 >= n) return null; + var dx = x - cell.site[0], dy = y - cell.site[1], d2 = dx * dx + dy * dy; + + // Traverse the half-edges to find a closer cell, if any. + do { + cell = that.cells[i0 = i1], i1 = null; + cell.halfedges.forEach(function(e) { + var edge = that.edges[e], v = edge.left; + if ((v === cell.site || !v) && !(v = edge.right)) return; + var vx = x - v[0], vy = y - v[1], v2 = vx * vx + vy * vy; + if (v2 < d2) d2 = v2, i1 = v.index; + }); + } while (i1 !== null); + + that._found = i0; + + return radius == null || d2 <= radius * radius ? cell.site : null; + } +}; + +function voronoi() { + var x$$1 = x$4, + y$$1 = y$4, + extent = null; + + function voronoi(data) { + return new Diagram(data.map(function(d, i) { + var s = [Math.round(x$$1(d, i, data) / epsilon$4) * epsilon$4, Math.round(y$$1(d, i, data) / epsilon$4) * epsilon$4]; + s.index = i; + s.data = d; + return s; + }), extent); + } + + voronoi.polygons = function(data) { + return voronoi(data).polygons(); + }; + + voronoi.links = function(data) { + return voronoi(data).links(); + }; + + voronoi.triangles = function(data) { + return voronoi(data).triangles(); + }; + + voronoi.x = function(_) { + return arguments.length ? (x$$1 = typeof _ === "function" ? _ : constant$11(+_), voronoi) : x$$1; + }; + + voronoi.y = function(_) { + return arguments.length ? (y$$1 = typeof _ === "function" ? _ : constant$11(+_), voronoi) : y$$1; + }; + + voronoi.extent = function(_) { + return arguments.length ? (extent = _ == null ? null : [[+_[0][0], +_[0][1]], [+_[1][0], +_[1][1]]], voronoi) : extent && [[extent[0][0], extent[0][1]], [extent[1][0], extent[1][1]]]; + }; + + voronoi.size = function(_) { + return arguments.length ? (extent = _ == null ? null : [[0, 0], [+_[0], +_[1]]], voronoi) : extent && [extent[1][0] - extent[0][0], extent[1][1] - extent[0][1]]; + }; + + return voronoi; +} + +function constant$12(x) { + return function() { + return x; + }; +} + +function ZoomEvent(target, type, transform) { + this.target = target; + this.type = type; + this.transform = transform; +} + +function Transform(k, x, y) { + this.k = k; + this.x = x; + this.y = y; +} + +Transform.prototype = { + constructor: Transform, + scale: function(k) { + return k === 1 ? this : new Transform(this.k * k, this.x, this.y); + }, + translate: function(x, y) { + return x === 0 & y === 0 ? this : new Transform(this.k, this.x + this.k * x, this.y + this.k * y); + }, + apply: function(point) { + return [point[0] * this.k + this.x, point[1] * this.k + this.y]; + }, + applyX: function(x) { + return x * this.k + this.x; + }, + applyY: function(y) { + return y * this.k + this.y; + }, + invert: function(location) { + return [(location[0] - this.x) / this.k, (location[1] - this.y) / this.k]; + }, + invertX: function(x) { + return (x - this.x) / this.k; + }, + invertY: function(y) { + return (y - this.y) / this.k; + }, + rescaleX: function(x) { + return x.copy().domain(x.range().map(this.invertX, this).map(x.invert, x)); + }, + rescaleY: function(y) { + return y.copy().domain(y.range().map(this.invertY, this).map(y.invert, y)); + }, + toString: function() { + return "translate(" + this.x + "," + this.y + ") scale(" + this.k + ")"; + } +}; + +var identity$8 = new Transform(1, 0, 0); + +transform$1.prototype = Transform.prototype; + +function transform$1(node) { + return node.__zoom || identity$8; +} + +function nopropagation$2() { + exports.event.stopImmediatePropagation(); +} + +function noevent$2() { + exports.event.preventDefault(); + exports.event.stopImmediatePropagation(); +} + +// Ignore right-click, since that should open the context menu. +function defaultFilter$2() { + return !exports.event.button; +} + +function defaultExtent$1() { + var e = this, w, h; + if (e instanceof SVGElement) { + e = e.ownerSVGElement || e; + w = e.width.baseVal.value; + h = e.height.baseVal.value; + } else { + w = e.clientWidth; + h = e.clientHeight; + } + return [[0, 0], [w, h]]; +} + +function defaultTransform() { + return this.__zoom || identity$8; +} + +function defaultWheelDelta() { + return -exports.event.deltaY * (exports.event.deltaMode ? 120 : 1) / 500; +} + +function defaultTouchable$1() { + return "ontouchstart" in this; +} + +function defaultConstrain(transform$$1, extent, translateExtent) { + var dx0 = transform$$1.invertX(extent[0][0]) - translateExtent[0][0], + dx1 = transform$$1.invertX(extent[1][0]) - translateExtent[1][0], + dy0 = transform$$1.invertY(extent[0][1]) - translateExtent[0][1], + dy1 = transform$$1.invertY(extent[1][1]) - translateExtent[1][1]; + return transform$$1.translate( + dx1 > dx0 ? (dx0 + dx1) / 2 : Math.min(0, dx0) || Math.max(0, dx1), + dy1 > dy0 ? (dy0 + dy1) / 2 : Math.min(0, dy0) || Math.max(0, dy1) + ); +} + +function zoom() { + var filter = defaultFilter$2, + extent = defaultExtent$1, + constrain = defaultConstrain, + wheelDelta = defaultWheelDelta, + touchable = defaultTouchable$1, + scaleExtent = [0, Infinity], + translateExtent = [[-Infinity, -Infinity], [Infinity, Infinity]], + duration = 250, + interpolate = interpolateZoom, + gestures = [], + listeners = dispatch("start", "zoom", "end"), + touchstarting, + touchending, + touchDelay = 500, + wheelDelay = 150, + clickDistance2 = 0; + + function zoom(selection) { + selection + .property("__zoom", defaultTransform) + .on("wheel.zoom", wheeled) + .on("mousedown.zoom", mousedowned) + .on("dblclick.zoom", dblclicked) + .filter(touchable) + .on("touchstart.zoom", touchstarted) + .on("touchmove.zoom", touchmoved) + .on("touchend.zoom touchcancel.zoom", touchended) + .style("touch-action", "none") + .style("-webkit-tap-highlight-color", "rgba(0,0,0,0)"); + } + + zoom.transform = function(collection, transform$$1) { + var selection = collection.selection ? collection.selection() : collection; + selection.property("__zoom", defaultTransform); + if (collection !== selection) { + schedule(collection, transform$$1); + } else { + selection.interrupt().each(function() { + gesture(this, arguments) + .start() + .zoom(null, typeof transform$$1 === "function" ? transform$$1.apply(this, arguments) : transform$$1) + .end(); + }); + } + }; + + zoom.scaleBy = function(selection, k) { + zoom.scaleTo(selection, function() { + var k0 = this.__zoom.k, + k1 = typeof k === "function" ? k.apply(this, arguments) : k; + return k0 * k1; + }); + }; + + zoom.scaleTo = function(selection, k) { + zoom.transform(selection, function() { + var e = extent.apply(this, arguments), + t0 = this.__zoom, + p0 = centroid(e), + p1 = t0.invert(p0), + k1 = typeof k === "function" ? k.apply(this, arguments) : k; + return constrain(translate(scale(t0, k1), p0, p1), e, translateExtent); + }); + }; + + zoom.translateBy = function(selection, x, y) { + zoom.transform(selection, function() { + return constrain(this.__zoom.translate( + typeof x === "function" ? x.apply(this, arguments) : x, + typeof y === "function" ? y.apply(this, arguments) : y + ), extent.apply(this, arguments), translateExtent); + }); + }; + + zoom.translateTo = function(selection, x, y) { + zoom.transform(selection, function() { + var e = extent.apply(this, arguments), + t = this.__zoom, + p = centroid(e); + return constrain(identity$8.translate(p[0], p[1]).scale(t.k).translate( + typeof x === "function" ? -x.apply(this, arguments) : -x, + typeof y === "function" ? -y.apply(this, arguments) : -y + ), e, translateExtent); + }); + }; + + function scale(transform$$1, k) { + k = Math.max(scaleExtent[0], Math.min(scaleExtent[1], k)); + return k === transform$$1.k ? transform$$1 : new Transform(k, transform$$1.x, transform$$1.y); + } + + function translate(transform$$1, p0, p1) { + var x = p0[0] - p1[0] * transform$$1.k, y = p0[1] - p1[1] * transform$$1.k; + return x === transform$$1.x && y === transform$$1.y ? transform$$1 : new Transform(transform$$1.k, x, y); + } + + function centroid(extent) { + return [(+extent[0][0] + +extent[1][0]) / 2, (+extent[0][1] + +extent[1][1]) / 2]; + } + + function schedule(transition, transform$$1, center) { + transition + .on("start.zoom", function() { gesture(this, arguments).start(); }) + .on("interrupt.zoom end.zoom", function() { gesture(this, arguments).end(); }) + .tween("zoom", function() { + var that = this, + args = arguments, + g = gesture(that, args), + e = extent.apply(that, args), + p = center || centroid(e), + w = Math.max(e[1][0] - e[0][0], e[1][1] - e[0][1]), + a = that.__zoom, + b = typeof transform$$1 === "function" ? transform$$1.apply(that, args) : transform$$1, + i = interpolate(a.invert(p).concat(w / a.k), b.invert(p).concat(w / b.k)); + return function(t) { + if (t === 1) t = b; // Avoid rounding error on end. + else { var l = i(t), k = w / l[2]; t = new Transform(k, p[0] - l[0] * k, p[1] - l[1] * k); } + g.zoom(null, t); + }; + }); + } + + function gesture(that, args) { + for (var i = 0, n = gestures.length, g; i < n; ++i) { + if ((g = gestures[i]).that === that) { + return g; + } + } + return new Gesture(that, args); + } + + function Gesture(that, args) { + this.that = that; + this.args = args; + this.index = -1; + this.active = 0; + this.extent = extent.apply(that, args); + } + + Gesture.prototype = { + start: function() { + if (++this.active === 1) { + this.index = gestures.push(this) - 1; + this.emit("start"); + } + return this; + }, + zoom: function(key, transform$$1) { + if (this.mouse && key !== "mouse") this.mouse[1] = transform$$1.invert(this.mouse[0]); + if (this.touch0 && key !== "touch") this.touch0[1] = transform$$1.invert(this.touch0[0]); + if (this.touch1 && key !== "touch") this.touch1[1] = transform$$1.invert(this.touch1[0]); + this.that.__zoom = transform$$1; + this.emit("zoom"); + return this; + }, + end: function() { + if (--this.active === 0) { + gestures.splice(this.index, 1); + this.index = -1; + this.emit("end"); + } + return this; + }, + emit: function(type) { + customEvent(new ZoomEvent(zoom, type, this.that.__zoom), listeners.apply, listeners, [type, this.that, this.args]); + } + }; + + function wheeled() { + if (!filter.apply(this, arguments)) return; + var g = gesture(this, arguments), + t = this.__zoom, + k = Math.max(scaleExtent[0], Math.min(scaleExtent[1], t.k * Math.pow(2, wheelDelta.apply(this, arguments)))), + p = mouse(this); + + // If the mouse is in the same location as before, reuse it. + // If there were recent wheel events, reset the wheel idle timeout. + if (g.wheel) { + if (g.mouse[0][0] !== p[0] || g.mouse[0][1] !== p[1]) { + g.mouse[1] = t.invert(g.mouse[0] = p); + } + clearTimeout(g.wheel); + } + + // If this wheel event won’t trigger a transform change, ignore it. + else if (t.k === k) return; + + // Otherwise, capture the mouse point and location at the start. + else { + g.mouse = [p, t.invert(p)]; + interrupt(this); + g.start(); + } + + noevent$2(); + g.wheel = setTimeout(wheelidled, wheelDelay); + g.zoom("mouse", constrain(translate(scale(t, k), g.mouse[0], g.mouse[1]), g.extent, translateExtent)); + + function wheelidled() { + g.wheel = null; + g.end(); + } + } + + function mousedowned() { + if (touchending || !filter.apply(this, arguments)) return; + var g = gesture(this, arguments), + v = select(exports.event.view).on("mousemove.zoom", mousemoved, true).on("mouseup.zoom", mouseupped, true), + p = mouse(this), + x0 = exports.event.clientX, + y0 = exports.event.clientY; + + dragDisable(exports.event.view); + nopropagation$2(); + g.mouse = [p, this.__zoom.invert(p)]; + interrupt(this); + g.start(); + + function mousemoved() { + noevent$2(); + if (!g.moved) { + var dx = exports.event.clientX - x0, dy = exports.event.clientY - y0; + g.moved = dx * dx + dy * dy > clickDistance2; + } + g.zoom("mouse", constrain(translate(g.that.__zoom, g.mouse[0] = mouse(g.that), g.mouse[1]), g.extent, translateExtent)); + } + + function mouseupped() { + v.on("mousemove.zoom mouseup.zoom", null); + yesdrag(exports.event.view, g.moved); + noevent$2(); + g.end(); + } + } + + function dblclicked() { + if (!filter.apply(this, arguments)) return; + var t0 = this.__zoom, + p0 = mouse(this), + p1 = t0.invert(p0), + k1 = t0.k * (exports.event.shiftKey ? 0.5 : 2), + t1 = constrain(translate(scale(t0, k1), p0, p1), extent.apply(this, arguments), translateExtent); + + noevent$2(); + if (duration > 0) select(this).transition().duration(duration).call(schedule, t1, p0); + else select(this).call(zoom.transform, t1); + } + + function touchstarted() { + if (!filter.apply(this, arguments)) return; + var g = gesture(this, arguments), + touches = exports.event.changedTouches, + started, + n = touches.length, i, t, p; + + nopropagation$2(); + for (i = 0; i < n; ++i) { + t = touches[i], p = touch(this, touches, t.identifier); + p = [p, this.__zoom.invert(p), t.identifier]; + if (!g.touch0) g.touch0 = p, started = true; + else if (!g.touch1) g.touch1 = p; + } + + // If this is a dbltap, reroute to the (optional) dblclick.zoom handler. + if (touchstarting) { + touchstarting = clearTimeout(touchstarting); + if (!g.touch1) { + g.end(); + p = select(this).on("dblclick.zoom"); + if (p) p.apply(this, arguments); + return; + } + } + + if (started) { + touchstarting = setTimeout(function() { touchstarting = null; }, touchDelay); + interrupt(this); + g.start(); + } + } + + function touchmoved() { + var g = gesture(this, arguments), + touches = exports.event.changedTouches, + n = touches.length, i, t, p, l; + + noevent$2(); + if (touchstarting) touchstarting = clearTimeout(touchstarting); + for (i = 0; i < n; ++i) { + t = touches[i], p = touch(this, touches, t.identifier); + if (g.touch0 && g.touch0[2] === t.identifier) g.touch0[0] = p; + else if (g.touch1 && g.touch1[2] === t.identifier) g.touch1[0] = p; + } + t = g.that.__zoom; + if (g.touch1) { + var p0 = g.touch0[0], l0 = g.touch0[1], + p1 = g.touch1[0], l1 = g.touch1[1], + dp = (dp = p1[0] - p0[0]) * dp + (dp = p1[1] - p0[1]) * dp, + dl = (dl = l1[0] - l0[0]) * dl + (dl = l1[1] - l0[1]) * dl; + t = scale(t, Math.sqrt(dp / dl)); + p = [(p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2]; + l = [(l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2]; + } + else if (g.touch0) p = g.touch0[0], l = g.touch0[1]; + else return; + g.zoom("touch", constrain(translate(t, p, l), g.extent, translateExtent)); + } + + function touchended() { + var g = gesture(this, arguments), + touches = exports.event.changedTouches, + n = touches.length, i, t; + + nopropagation$2(); + if (touchending) clearTimeout(touchending); + touchending = setTimeout(function() { touchending = null; }, touchDelay); + for (i = 0; i < n; ++i) { + t = touches[i]; + if (g.touch0 && g.touch0[2] === t.identifier) delete g.touch0; + else if (g.touch1 && g.touch1[2] === t.identifier) delete g.touch1; + } + if (g.touch1 && !g.touch0) g.touch0 = g.touch1, delete g.touch1; + if (g.touch0) g.touch0[1] = this.__zoom.invert(g.touch0[0]); + else g.end(); + } + + zoom.wheelDelta = function(_) { + return arguments.length ? (wheelDelta = typeof _ === "function" ? _ : constant$12(+_), zoom) : wheelDelta; + }; + + zoom.filter = function(_) { + return arguments.length ? (filter = typeof _ === "function" ? _ : constant$12(!!_), zoom) : filter; + }; + + zoom.touchable = function(_) { + return arguments.length ? (touchable = typeof _ === "function" ? _ : constant$12(!!_), zoom) : touchable; + }; + + zoom.extent = function(_) { + return arguments.length ? (extent = typeof _ === "function" ? _ : constant$12([[+_[0][0], +_[0][1]], [+_[1][0], +_[1][1]]]), zoom) : extent; + }; + + zoom.scaleExtent = function(_) { + return arguments.length ? (scaleExtent[0] = +_[0], scaleExtent[1] = +_[1], zoom) : [scaleExtent[0], scaleExtent[1]]; + }; + + zoom.translateExtent = function(_) { + return arguments.length ? (translateExtent[0][0] = +_[0][0], translateExtent[1][0] = +_[1][0], translateExtent[0][1] = +_[0][1], translateExtent[1][1] = +_[1][1], zoom) : [[translateExtent[0][0], translateExtent[0][1]], [translateExtent[1][0], translateExtent[1][1]]]; + }; + + zoom.constrain = function(_) { + return arguments.length ? (constrain = _, zoom) : constrain; + }; + + zoom.duration = function(_) { + return arguments.length ? (duration = +_, zoom) : duration; + }; + + zoom.interpolate = function(_) { + return arguments.length ? (interpolate = _, zoom) : interpolate; + }; + + zoom.on = function() { + var value = listeners.on.apply(listeners, arguments); + return value === listeners ? zoom : value; + }; + + zoom.clickDistance = function(_) { + return arguments.length ? (clickDistance2 = (_ = +_) * _, zoom) : Math.sqrt(clickDistance2); + }; + + return zoom; +} + +exports.version = version; +exports.bisect = bisectRight; +exports.bisectRight = bisectRight; +exports.bisectLeft = bisectLeft; +exports.ascending = ascending; +exports.bisector = bisector; +exports.cross = cross; +exports.descending = descending; +exports.deviation = deviation; +exports.extent = extent; +exports.histogram = histogram; +exports.thresholdFreedmanDiaconis = freedmanDiaconis; +exports.thresholdScott = scott; +exports.thresholdSturges = sturges; +exports.max = max; +exports.mean = mean; +exports.median = median; +exports.merge = merge; +exports.min = min; +exports.pairs = pairs; +exports.permute = permute; +exports.quantile = threshold; +exports.range = sequence; +exports.scan = scan; +exports.shuffle = shuffle; +exports.sum = sum; +exports.ticks = ticks; +exports.tickIncrement = tickIncrement; +exports.tickStep = tickStep; +exports.transpose = transpose; +exports.variance = variance; +exports.zip = zip; +exports.axisTop = axisTop; +exports.axisRight = axisRight; +exports.axisBottom = axisBottom; +exports.axisLeft = axisLeft; +exports.brush = brush; +exports.brushX = brushX; +exports.brushY = brushY; +exports.brushSelection = brushSelection; +exports.chord = chord; +exports.ribbon = ribbon; +exports.nest = nest; +exports.set = set$2; +exports.map = map$1; +exports.keys = keys; +exports.values = values; +exports.entries = entries; +exports.color = color; +exports.rgb = rgb; +exports.hsl = hsl; +exports.lab = lab; +exports.hcl = hcl; +exports.cubehelix = cubehelix; +exports.dispatch = dispatch; +exports.drag = drag; +exports.dragDisable = dragDisable; +exports.dragEnable = yesdrag; +exports.dsvFormat = dsv; +exports.csvParse = csvParse; +exports.csvParseRows = csvParseRows; +exports.csvFormat = csvFormat; +exports.csvFormatRows = csvFormatRows; +exports.tsvParse = tsvParse; +exports.tsvParseRows = tsvParseRows; +exports.tsvFormat = tsvFormat; +exports.tsvFormatRows = tsvFormatRows; +exports.easeLinear = linear$1; +exports.easeQuad = quadInOut; +exports.easeQuadIn = quadIn; +exports.easeQuadOut = quadOut; +exports.easeQuadInOut = quadInOut; +exports.easeCubic = cubicInOut; +exports.easeCubicIn = cubicIn; +exports.easeCubicOut = cubicOut; +exports.easeCubicInOut = cubicInOut; +exports.easePoly = polyInOut; +exports.easePolyIn = polyIn; +exports.easePolyOut = polyOut; +exports.easePolyInOut = polyInOut; +exports.easeSin = sinInOut; +exports.easeSinIn = sinIn; +exports.easeSinOut = sinOut; +exports.easeSinInOut = sinInOut; +exports.easeExp = expInOut; +exports.easeExpIn = expIn; +exports.easeExpOut = expOut; +exports.easeExpInOut = expInOut; +exports.easeCircle = circleInOut; +exports.easeCircleIn = circleIn; +exports.easeCircleOut = circleOut; +exports.easeCircleInOut = circleInOut; +exports.easeBounce = bounceOut; +exports.easeBounceIn = bounceIn; +exports.easeBounceOut = bounceOut; +exports.easeBounceInOut = bounceInOut; +exports.easeBack = backInOut; +exports.easeBackIn = backIn; +exports.easeBackOut = backOut; +exports.easeBackInOut = backInOut; +exports.easeElastic = elasticOut; +exports.easeElasticIn = elasticIn; +exports.easeElasticOut = elasticOut; +exports.easeElasticInOut = elasticInOut; +exports.forceCenter = center$1; +exports.forceCollide = collide; +exports.forceLink = link; +exports.forceManyBody = manyBody; +exports.forceRadial = radial; +exports.forceSimulation = simulation; +exports.forceX = x$2; +exports.forceY = y$2; +exports.formatDefaultLocale = defaultLocale; +exports.formatLocale = formatLocale; +exports.formatSpecifier = formatSpecifier; +exports.precisionFixed = precisionFixed; +exports.precisionPrefix = precisionPrefix; +exports.precisionRound = precisionRound; +exports.geoArea = area; +exports.geoBounds = bounds; +exports.geoCentroid = centroid; +exports.geoCircle = circle; +exports.geoClipAntimeridian = clipAntimeridian; +exports.geoClipCircle = clipCircle; +exports.geoClipExtent = extent$1; +exports.geoClipRectangle = clipRectangle; +exports.geoContains = contains; +exports.geoDistance = distance; +exports.geoGraticule = graticule; +exports.geoGraticule10 = graticule10; +exports.geoInterpolate = interpolate$1; +exports.geoLength = length$1; +exports.geoPath = index$1; +exports.geoAlbers = albers; +exports.geoAlbersUsa = albersUsa; +exports.geoAzimuthalEqualArea = azimuthalEqualArea; +exports.geoAzimuthalEqualAreaRaw = azimuthalEqualAreaRaw; +exports.geoAzimuthalEquidistant = azimuthalEquidistant; +exports.geoAzimuthalEquidistantRaw = azimuthalEquidistantRaw; +exports.geoConicConformal = conicConformal; +exports.geoConicConformalRaw = conicConformalRaw; +exports.geoConicEqualArea = conicEqualArea; +exports.geoConicEqualAreaRaw = conicEqualAreaRaw; +exports.geoConicEquidistant = conicEquidistant; +exports.geoConicEquidistantRaw = conicEquidistantRaw; +exports.geoEquirectangular = equirectangular; +exports.geoEquirectangularRaw = equirectangularRaw; +exports.geoGnomonic = gnomonic; +exports.geoGnomonicRaw = gnomonicRaw; +exports.geoIdentity = identity$5; +exports.geoProjection = projection; +exports.geoProjectionMutator = projectionMutator; +exports.geoMercator = mercator; +exports.geoMercatorRaw = mercatorRaw; +exports.geoNaturalEarth1 = naturalEarth1; +exports.geoNaturalEarth1Raw = naturalEarth1Raw; +exports.geoOrthographic = orthographic; +exports.geoOrthographicRaw = orthographicRaw; +exports.geoStereographic = stereographic; +exports.geoStereographicRaw = stereographicRaw; +exports.geoTransverseMercator = transverseMercator; +exports.geoTransverseMercatorRaw = transverseMercatorRaw; +exports.geoRotation = rotation; +exports.geoStream = geoStream; +exports.geoTransform = transform; +exports.cluster = cluster; +exports.hierarchy = hierarchy; +exports.pack = index$2; +exports.packSiblings = siblings; +exports.packEnclose = enclose; +exports.partition = partition; +exports.stratify = stratify; +exports.tree = tree; +exports.treemap = index$3; +exports.treemapBinary = binary; +exports.treemapDice = treemapDice; +exports.treemapSlice = treemapSlice; +exports.treemapSliceDice = sliceDice; +exports.treemapSquarify = squarify; +exports.treemapResquarify = resquarify; +exports.interpolate = interpolateValue; +exports.interpolateArray = array$1; +exports.interpolateBasis = basis$1; +exports.interpolateBasisClosed = basisClosed; +exports.interpolateDate = date; +exports.interpolateNumber = reinterpolate; +exports.interpolateObject = object; +exports.interpolateRound = interpolateRound; +exports.interpolateString = interpolateString; +exports.interpolateTransformCss = interpolateTransformCss; +exports.interpolateTransformSvg = interpolateTransformSvg; +exports.interpolateZoom = interpolateZoom; +exports.interpolateRgb = interpolateRgb; +exports.interpolateRgbBasis = rgbBasis; +exports.interpolateRgbBasisClosed = rgbBasisClosed; +exports.interpolateHsl = hsl$2; +exports.interpolateHslLong = hslLong; +exports.interpolateLab = lab$1; +exports.interpolateHcl = hcl$2; +exports.interpolateHclLong = hclLong; +exports.interpolateCubehelix = cubehelix$2; +exports.interpolateCubehelixLong = cubehelixLong; +exports.quantize = quantize; +exports.path = path; +exports.polygonArea = area$1; +exports.polygonCentroid = centroid$1; +exports.polygonHull = hull; +exports.polygonContains = contains$1; +exports.polygonLength = length$2; +exports.quadtree = quadtree; +exports.queue = queue; +exports.randomUniform = uniform; +exports.randomNormal = normal; +exports.randomLogNormal = logNormal; +exports.randomBates = bates; +exports.randomIrwinHall = irwinHall; +exports.randomExponential = exponential$1; +exports.request = request; +exports.html = html; +exports.json = json; +exports.text = text; +exports.xml = xml; +exports.csv = csv$1; +exports.tsv = tsv$1; +exports.scaleBand = band; +exports.scalePoint = point$1; +exports.scaleIdentity = identity$6; +exports.scaleLinear = linear$2; +exports.scaleLog = log$1; +exports.scaleOrdinal = ordinal; +exports.scaleImplicit = implicit; +exports.scalePow = pow$1; +exports.scaleSqrt = sqrt$1; +exports.scaleQuantile = quantile$$1; +exports.scaleQuantize = quantize$1; +exports.scaleThreshold = threshold$1; +exports.scaleTime = time; +exports.scaleUtc = utcTime; +exports.schemeCategory10 = category10; +exports.schemeCategory20b = category20b; +exports.schemeCategory20c = category20c; +exports.schemeCategory20 = category20; +exports.interpolateCubehelixDefault = cubehelix$3; +exports.interpolateRainbow = rainbow$1; +exports.interpolateWarm = warm; +exports.interpolateCool = cool; +exports.interpolateViridis = viridis; +exports.interpolateMagma = magma; +exports.interpolateInferno = inferno; +exports.interpolatePlasma = plasma; +exports.scaleSequential = sequential; +exports.create = create; +exports.creator = creator; +exports.local = local$1; +exports.matcher = matcher$1; +exports.mouse = mouse; +exports.namespace = namespace; +exports.namespaces = namespaces; +exports.clientPoint = point; +exports.select = select; +exports.selectAll = selectAll; +exports.selection = selection; +exports.selector = selector; +exports.selectorAll = selectorAll; +exports.style = styleValue; +exports.touch = touch; +exports.touches = touches; +exports.window = defaultView; +exports.customEvent = customEvent; +exports.arc = arc; +exports.area = area$2; +exports.line = line; +exports.pie = pie; +exports.areaRadial = areaRadial; +exports.radialArea = areaRadial; +exports.lineRadial = lineRadial$1; +exports.radialLine = lineRadial$1; +exports.pointRadial = pointRadial; +exports.linkHorizontal = linkHorizontal; +exports.linkVertical = linkVertical; +exports.linkRadial = linkRadial; +exports.symbol = symbol; +exports.symbols = symbols; +exports.symbolCircle = circle$2; +exports.symbolCross = cross$2; +exports.symbolDiamond = diamond; +exports.symbolSquare = square; +exports.symbolStar = star; +exports.symbolTriangle = triangle; +exports.symbolWye = wye; +exports.curveBasisClosed = basisClosed$1; +exports.curveBasisOpen = basisOpen; +exports.curveBasis = basis$2; +exports.curveBundle = bundle; +exports.curveCardinalClosed = cardinalClosed; +exports.curveCardinalOpen = cardinalOpen; +exports.curveCardinal = cardinal; +exports.curveCatmullRomClosed = catmullRomClosed; +exports.curveCatmullRomOpen = catmullRomOpen; +exports.curveCatmullRom = catmullRom; +exports.curveLinearClosed = linearClosed; +exports.curveLinear = curveLinear; +exports.curveMonotoneX = monotoneX; +exports.curveMonotoneY = monotoneY; +exports.curveNatural = natural; +exports.curveStep = step; +exports.curveStepAfter = stepAfter; +exports.curveStepBefore = stepBefore; +exports.stack = stack; +exports.stackOffsetExpand = expand; +exports.stackOffsetDiverging = diverging; +exports.stackOffsetNone = none$1; +exports.stackOffsetSilhouette = silhouette; +exports.stackOffsetWiggle = wiggle; +exports.stackOrderAscending = ascending$2; +exports.stackOrderDescending = descending$2; +exports.stackOrderInsideOut = insideOut; +exports.stackOrderNone = none$2; +exports.stackOrderReverse = reverse; +exports.timeInterval = newInterval; +exports.timeMillisecond = millisecond; +exports.timeMilliseconds = milliseconds; +exports.utcMillisecond = millisecond; +exports.utcMilliseconds = milliseconds; +exports.timeSecond = second; +exports.timeSeconds = seconds; +exports.utcSecond = second; +exports.utcSeconds = seconds; +exports.timeMinute = minute; +exports.timeMinutes = minutes; +exports.timeHour = hour; +exports.timeHours = hours; +exports.timeDay = day; +exports.timeDays = days; +exports.timeWeek = sunday; +exports.timeWeeks = sundays; +exports.timeSunday = sunday; +exports.timeSundays = sundays; +exports.timeMonday = monday; +exports.timeMondays = mondays; +exports.timeTuesday = tuesday; +exports.timeTuesdays = tuesdays; +exports.timeWednesday = wednesday; +exports.timeWednesdays = wednesdays; +exports.timeThursday = thursday; +exports.timeThursdays = thursdays; +exports.timeFriday = friday; +exports.timeFridays = fridays; +exports.timeSaturday = saturday; +exports.timeSaturdays = saturdays; +exports.timeMonth = month; +exports.timeMonths = months; +exports.timeYear = year; +exports.timeYears = years; +exports.utcMinute = utcMinute; +exports.utcMinutes = utcMinutes; +exports.utcHour = utcHour; +exports.utcHours = utcHours; +exports.utcDay = utcDay; +exports.utcDays = utcDays; +exports.utcWeek = utcSunday; +exports.utcWeeks = utcSundays; +exports.utcSunday = utcSunday; +exports.utcSundays = utcSundays; +exports.utcMonday = utcMonday; +exports.utcMondays = utcMondays; +exports.utcTuesday = utcTuesday; +exports.utcTuesdays = utcTuesdays; +exports.utcWednesday = utcWednesday; +exports.utcWednesdays = utcWednesdays; +exports.utcThursday = utcThursday; +exports.utcThursdays = utcThursdays; +exports.utcFriday = utcFriday; +exports.utcFridays = utcFridays; +exports.utcSaturday = utcSaturday; +exports.utcSaturdays = utcSaturdays; +exports.utcMonth = utcMonth; +exports.utcMonths = utcMonths; +exports.utcYear = utcYear; +exports.utcYears = utcYears; +exports.timeFormatDefaultLocale = defaultLocale$1; +exports.timeFormatLocale = formatLocale$1; +exports.isoFormat = formatIso; +exports.isoParse = parseIso; +exports.now = now; +exports.timer = timer; +exports.timerFlush = timerFlush; +exports.timeout = timeout$1; +exports.interval = interval$1; +exports.transition = transition; +exports.active = active; +exports.interrupt = interrupt; +exports.voronoi = voronoi; +exports.zoom = zoom; +exports.zoomTransform = transform$1; +exports.zoomIdentity = identity$8; + +Object.defineProperty(exports, '__esModule', { value: true }); + +}))); \ No newline at end of file diff --git a/intropage/JSfiles/iris_tree_data.js b/intropage/JSfiles/iris_tree_data.js new file mode 100644 index 000000000..09c1d1f8e --- /dev/null +++ b/intropage/JSfiles/iris_tree_data.js @@ -0,0 +1,297 @@ +// make varialbe json format + +var iris_tree_Data = { + "name": "petal length (cm) > 2.45000004768", + "pred": "100 of no, 50 of yes", + "children": [ + { + "children": [ + { + "children": [ + { + + "name": "The number of data = 43", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "43 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "43 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "The number of data = 3", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "1 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + , + { + + "name": "2 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 3, + "pred": "0 of no, 0 of yes" + } + + ], + "name": "petal length (cm) > 4.85000038147", + "side": "right", + "type": "categorical", + "size": 46, + "pred": "43 of no, 3 of yes" + }, + { + + "name": "petal length (cm) > 4.94999980927", + "children": [ + + { + + "name": "The number of data = 6", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "2 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + , + { + + "name": "4 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 4, + "pred": "4 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 6, + "pred": "0 of no, 0 of yes" + }, + + { + + "name": "The number of data = 48", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "47 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 47, + "pred": "47 of no, 0 of yes" + } + , + { + + "name": "1 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 48, + "pred": "0 of no, 0 of yes" + } + + + + ], + "side": "left", + "type": "categorical", + "size": 54, + "pred": "6 of no, 48 of yes" + } + ], + "name": "petal width (cm) > 1.75", + "side": "right", + "type": "numerical", + "size": 100, + "pred": "46 of no, 54 of yes" + },{ + "name": "The number of data = 50", + "children": [ + + + + { + + "name": "50 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "50 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "0 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "0 of no, 0 of yes" + } + ], + "side": "right", + "size": 150 + } + + +var iris_tree_Data = { + "name": "petal length (cm) > 2.45000004768", + "children": [ + { + "name": "petal width (cm) > 1.75", + "children": [ + { + "name": "petal length (cm) > 4.85000038147", + "children": [ + { + "name": "0 of setosa, 0 of versicolor, 43 of virginica" + }, + { + "name": "0 of setosa, 1 of versicolor, 2 of virginica" + } + ] + }, + { + "name": "petal length (cm) > 4.94999980927", + "children": [ + { + "name": "0 of setosa, 2 of versicolor, 4 of virginica" + }, + { + "name": "0 of setosa, 47 of versicolor, 1 of virginica" + } + ] + } + ] + }, + { + "name": "50 of setosa, 0 of versicolor, 0 of virginica" + } + ] +} + + + + \ No newline at end of file diff --git a/intropage/JSfiles/jquery-1.7.1.min.js b/intropage/JSfiles/jquery-1.7.1.min.js new file mode 100644 index 000000000..198b3ff07 --- /dev/null +++ b/intropage/JSfiles/jquery-1.7.1.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.7.1 jquery.com | jquery.org/license */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!ck[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){cl||(cl=c.createElement("iframe"),cl.frameBorder=cl.width=cl.height=0),b.appendChild(cl);if(!cm||!cl.createElement)cm=(cl.contentWindow||cl.contentDocument).document,cm.write((c.compatMode==="CSS1Compat"?"":"")+""),cm.close();d=cm.createElement(a),cm.body.appendChild(d),e=f.css(d,"display"),b.removeChild(cl)}ck[a]=e}return ck[a]}function cu(a,b){var c={};f.each(cq.concat.apply([],cq.slice(0,b)),function(){c[this]=a});return c}function ct(){cr=b}function cs(){setTimeout(ct,0);return cr=f.now()}function cj(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ci(){try{return new a.XMLHttpRequest}catch(b){}}function cc(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g0){if(c!=="border")for(;g=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?parseFloat(d):j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c
a",d=q.getElementsByTagName("*"),e=q.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=q.getElementsByTagName("input")[0],b={leadingWhitespace:q.firstChild.nodeType===3,tbody:!q.getElementsByTagName("tbody").length,htmlSerialize:!!q.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:q.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete q.test}catch(s){b.deleteExpando=!1}!q.addEventListener&&q.attachEvent&&q.fireEvent&&(q.attachEvent("onclick",function(){b.noCloneEvent=!1}),q.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),q.appendChild(i),k=c.createDocumentFragment(),k.appendChild(q.lastChild),b.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,k.removeChild(i),k.appendChild(q),q.innerHTML="",a.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",q.style.width="2px",q.appendChild(j),b.reliableMarginRight=(parseInt((a.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0);if(q.attachEvent)for(o in{submit:1,change:1,focusin:1})n="on"+o,p=n in q,p||(q.setAttribute(n,"return;"),p=typeof q[n]=="function"),b[o+"Bubbles"]=p;k.removeChild(q),k=g=h=j=q=i=null,f(function(){var a,d,e,g,h,i,j,k,m,n,o,r=c.getElementsByTagName("body")[0];!r||(j=1,k="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;",m="visibility:hidden;border:0;",n="style='"+k+"border:5px solid #000;padding:0;'",o="
"+""+"
",a=c.createElement("div"),a.style.cssText=m+"width:0;height:0;position:static;top:0;margin-top:"+j+"px",r.insertBefore(a,r.firstChild),q=c.createElement("div"),a.appendChild(q),q.innerHTML="
t
",l=q.getElementsByTagName("td"),p=l[0].offsetHeight===0,l[0].style.display="",l[1].style.display="none",b.reliableHiddenOffsets=p&&l[0].offsetHeight===0,q.innerHTML="",q.style.width=q.style.paddingLeft="1px",f.boxModel=b.boxModel=q.offsetWidth===2,typeof q.style.zoom!="undefined"&&(q.style.display="inline",q.style.zoom=1,b.inlineBlockNeedsLayout=q.offsetWidth===2,q.style.display="",q.innerHTML="
",b.shrinkWrapBlocks=q.offsetWidth!==2),q.style.cssText=k+m,q.innerHTML=o,d=q.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,i={doesNotAddBorder:e.offsetTop!==5,doesAddBorderForTableAndCells:h.offsetTop===5},e.style.position="fixed",e.style.top="20px",i.fixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",i.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,i.doesNotIncludeMarginInBodyOffset=r.offsetTop!==j,r.removeChild(a),q=a=null,f.extend(b,i))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.nodeName.toLowerCase()]||f.valHooks[g.type];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;h=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/\bhover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")}; +f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;le&&i.push({elem:this,matches:d.slice(e)});for(j=0;j0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h0)for(h=g;h=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div
","
"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function() +{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1>");try{for(var c=0,d=this.length;c1&&l0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||!bc.test("<"+a.nodeName)?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!_.test(k))k=b.createTextNode(k);else{k=k.replace(Y,"<$1>");var l=(Z.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");b===c?bh.appendChild(o):U(b).appendChild(o),o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=$.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]===""&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&X.test(k)&&o.insertBefore(b.createTextNode(X.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return br.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bq,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bq.test(g)?g.replace(bq,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,b){var c,d,e;b=b.replace(bs,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b)));return c}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f===null&&g&&(e=g[b])&&(f=e),!bt.test(f)&&bu.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f||0,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bD=/%20/g,bE=/\[\]$/,bF=/\r?\n/g,bG=/#.*$/,bH=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bI=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bJ=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bK=/^(?:GET|HEAD)$/,bL=/^\/\//,bM=/\?/,bN=/)<[^<]*)*<\/script>/gi,bO=/^(?:select|textarea)/i,bP=/\s+/,bQ=/([?&])_=[^&]*/,bR=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bS=f.fn.load,bT={},bU={},bV,bW,bX=["*/"]+["*"];try{bV=e.href}catch(bY){bV=c.createElement("a"),bV.href="",bV=bV.href}bW=bR.exec(bV.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bS)return bS.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("
").append(c.replace(bN,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bO.test(this.nodeName)||bI.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bF,"\r\n")}}):{name:b.name,value:c.replace(bF,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b_(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b_(a,b);return a},ajaxSettings:{url:bV,isLocal:bJ.test(bW[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bX},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bZ(bT),ajaxTransport:bZ(bU),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?cb(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cc(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bH.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bG,"").replace(bL,bW[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bP),d.crossDomain==null&&(r=bR.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bW[1]&&r[2]==bW[2]&&(r[3]||(r[1]==="http:"?80:443))==(bW[3]||(bW[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bT,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bK.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bM.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bQ,"$1_="+x);d.url=y+(y===d.url?(bM.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bX+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bU,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)ca(g,a[g],c,e);return d.join("&").replace(bD,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cd=f.now(),ce=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cd++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ce.test(b.url)||e&&ce.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ce,l),b.url===j&&(e&&(k=k.replace(ce,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cf=a.ActiveXObject?function(){for(var a in ch)ch[a](0,1)}:!1,cg=0,ch;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ci()||cj()}:ci,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cf&&delete ch[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cg,cf&&(ch||(ch={},f(a).unload(cf)),ch[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var ck={},cl,cm,cn=/^(?:toggle|show|hide)$/,co=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cp,cq=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cr;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,d,"padding")):this[d]():null},f.fn["outer"+c]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,d,a?"margin":"border")):this[d]():null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNumeric(j)?j:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window); \ No newline at end of file diff --git a/intropage/JSfiles/nond3works.js b/intropage/JSfiles/nond3works.js new file mode 100644 index 000000000..2d0ffcec9 --- /dev/null +++ b/intropage/JSfiles/nond3works.js @@ -0,0 +1,94 @@ +document.getElementById("class1text").addEventListener("mouseover", mouseOverClass1); +document.getElementById("class1text").addEventListener("mouseout", mouseOutClass1); + +document.getElementById("class2text").addEventListener("mouseover", mouseOverClass2); +document.getElementById("class2text").addEventListener("mouseout", mouseOutClass2); + +document.getElementById("class3text").addEventListener("mouseover", mouseOverClass3); +document.getElementById("class3text").addEventListener("mouseout", mouseOutClass3); + + + +function mouseOverClass1() { + +console.log(document.getElementsByClassName("0")); +// change all the circle elements with class "0" to red + + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + + + + // make .style("stroke", "red") + document.getElementsByClassName("0")[i].style.stroke = "white"; + +} + +} + +function mouseOutClass1() { +console.log(document.getElementsByClassName("0")); + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + document.getElementsByClassName("0")[i].style.stroke = "black"; + +} +} + + + +function mouseOverClass2() { + + console.log(document.getElementsByClassName("0")); + // change all the circle elements with class "0" to red + + + for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + + + + // make .style("stroke", "red") + document.getElementsByClassName("1")[i].style.stroke = "white"; + + } + + } + +function mouseOutClass2() { +console.log(document.getElementsByClassName("0")); + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + document.getElementsByClassName("1")[i].style.stroke = "black"; + +} +} + + + +function mouseOverClass3() { + + console.log(document.getElementsByClassName("0")); + // change all the circle elements with class "0" to red + + + for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + + + + // make .style("stroke", "red") + document.getElementsByClassName("2")[i].style.stroke = "white"; + + } + + } + +function mouseOutClass3() { +console.log(document.getElementsByClassName("0")); + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + document.getElementsByClassName("2")[i].style.stroke = "black"; + +} +} + + diff --git a/intropage/JSfiles/test.js b/intropage/JSfiles/test.js new file mode 100644 index 000000000..0c077dda3 --- /dev/null +++ b/intropage/JSfiles/test.js @@ -0,0 +1,763 @@ +function decisiontree() { + + d3=d3v3 + + + var label_names; + + var TOTAL_SIZE; + // default_colors = [ + // "#c25975", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + + + default_colors = [ + "#74BFA1", "#E37852", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + ] + + + + // default_colors = [ + // "#18dcdc", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#c25975", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + // differnt combination of colors + // default_colors = + + + + + //************************************* Options******************************************************// + + // var file_name = "structureC1.json" // generator_1 + // var file_namev2 = "structureC2_origin.json" // generator_2 + + var file_name = "structure_iris_dc_1.json" // generator_1 + var file_namev2 = "structure_iris_dc_1.json" // generator_2 + + // var file_name = "structure_iris_dc_1_80_size.json" // generator_1 + // var file_namev2 = "structure_iris_dc_1_80_size.json" // generator_2 + + // var file_name = "structure.json" // generator_1 + // var file_namev2 = "structure.json" // generator_2 + var version2 = true // if true json from generator_2 will be used + + + var tree_branch = false // if the thickness of the branches depend on the value of targt + color * / + var tree_branch_parent = true // true: thickness from the root if not the direct parent + // var tree_branch_color = "black" + + var tree_branch_color = "#A3A6A8" + var strokeness = 120 // the degree of separation between the nodes + var default_strokeness = 50 + var hover_percent_parent = false // if the display percentage depends on the direct parent or the root + var square = false + var rect_percent = true //display the percentage or the value in the small rectangles of the labels + var value_percent_top = true /// if we display the value and the percentage above the rectangle / + + var dict_leaf_y = { 1: 0, 2: -17.5, 3: -35, 4: -52.5, 5: -70, 6: -87.5, 6: -105, 7: -122.5, 8: -140, 9: -157.5, 10: -175 } + + + /****************************************************************************************************** */ + + + + + getDepth = function (obj) { + var depth = 0; + if (obj.children) { + obj.children.forEach(function (d) { + var tmpDepth = getDepth(d) + if (tmpDepth > depth) { + depth = tmpDepth + } + }) + } + return 1 + depth + } + + + // var margin = { top: 20, right: 120, bottom: 20, left: 180 }, + // width = 2000 + 960 - margin.right - margin.left, + // height = 800 - margin.top - margin.bottom; + + // current + // var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + // width = 500 - margin.left - margin.right, + // height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var i = 0, + duration = 550, + root; + + var tree + var diagonal + var svg + + var filetochoose = version2 ? file_namev2 : file_name + + d3.json(filetochoose, function (error, flare) { + if (error) throw error; + + console.log(getDepth(flare)) + + + tree = d3.layout.tree() + .separation(function (a, b) { return ((a.parent == root) && (b.parent == root)) ? strokeness : strokeness; }) + .size([height, getDepth(flare) * width / 8]); + + diagonal = d3.svg.diagonal() + .projection(function (d) { return [d.y, d.x]; }); + + // svg = d3.select("body").append("svg") + // .attr("width", getDepth(flare) * width / 8 + margin.right + margin.left) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + + + svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + + + TOTAL_SIZE = flare.size + l = flare.pred.replace(/of/g, "").split(', ') + for (var j = 0; j < l.length; j++) { + l[j] = l[j].split(' ')[2] + } + label_names = l + + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root, l.length); + // createLabels(l); + }); + + d3.select(self.frameElement).style("height", "480px"); + + function update(source, n_labels) { + + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + tpaths = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function (d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function (d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function (d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function (d) { + + return d._children ? "lightsteelblue" : "#fff"; + }); + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.name+' '+d.pred : d.name; }) + // .style("fill-opacity", 1e-6); + + function getTextWidth(text, fontSize, fontFace) { + var a = document.createElement('canvas'); + var b = a.getContext('2d'); + b.font = fontSize + 'px ' + fontFace; + return b.measureText(text).width; + } + + + + var rect = nodeEnter.append("rect") + .attr("width", 133 + 8) + .attr("height", 70) + .attr("x", -80) + .attr("y", -80) + .attr("rx", 6) + .attr("ry", 6) + .style("fill", function (d) { return (d.children || d._children) || version2 ? "#f0f0f0" : "#ffffff" }) + .style("stroke", function (d) { return (d.children || d._children) || version2 ? "rgb(155, 155, 155)" : "#ffffff" }) + .style("visibility", function (d) { return (d.children || d._children) || version2 ? "visible" : "hidden" }) + + nodeEnter.append("svg:image") + .attr("xlink:href", function (d) { return ((d.children || d._children) || version2) && d.type == 'categorical' ? 'http://fractalytics.io/wp-content/uploads/2019/05/cat.png' : 'http://fractalytics.io/wp-content/uploads/2019/05/num.png' }) + .attr("x", "-76") + .attr("y", "-74") + .attr("width", "20") + .attr("height", "20") + .style("visibility", function (d) { + if (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? 'hidden' : 'visible' + } + else return (d.children || d._children) || version2 ? "visible" : "hidden" + }); + + nodeEnter.append("text") + .attr("x", function (d) { + ttr = 13 + if (default_colors.length > 5) { + ttr = (40 * default_colors.length) / 2 + } + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%", 10, 'Verdana') + 5.7) - (133 + 8)) / 2 : ttr + }) + .attr("y", function (d) { + ttr = dict_leaf_y[label_names.length] - 15 + if (default_colors.length > 5) { + ttr = -20 + } + return (d.children || d._children) || version2 ? -87 : ttr; + + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "10px") + .style("font-family", "Verdana") + .style("stroke", "#c2c2c2") + .style("stroke-width", "0.05em") + .text(function (d) { return true ? d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%" : ""; }) + .attr('visibility', function () { + return value_percent_top ? 'visible' : 'hidden' + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { + if (((d.children || d._children) || version2) && d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 11) { + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + } + else return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].substring(0, 11), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + }) + .attr("y", function (d) { + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return -65 + else return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? -55 : -65 + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "14px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.05em") + + .text(function (d) { + if ((d.children || d._children) || version2) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 15 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1]).substring(0, 13) + '..' + + } + else return ""; + }) + .append('svg:title') + .text(function (d) { + return (d.children || d._children) || version2 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : "" + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('=', ''), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 }) + .attr("y", -45) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "12px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.04em") + .text(function (d) { + + var toreturn = (d.children || d._children) || version2 ? d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('!=', 'not').replace(/=|\!=/g, '').replace('<', '<=') : ""; + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return toreturn + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? '' : toreturn + }) + + + var labels_w = 133 / n_labels + for (var j = 0; j < n_labels; j++) { + var curr = j + + + + nodeEnter.append("rect") + .attr("width", function (d) { + var v; + if (d.pred) { + console.log(parseInt(d.pred.split(",")[curr].match(/\d+/)[0]), ' *133/', d.size) + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 133 / d.size; + } + else if (!d.children) { + v = 40 + } + + if (square) return (d.children || d._children) || version2 ? 133 / label_names.length - 4 : 40 + else return (d.children || d._children) || version2 ? v : 40 + }) + .attr("height", 20) + .attr('rx', function (d) { return square ? 0 : 4 }) + .attr('ry', function (d) { return square ? 0 : 4 }) + .attr("x", function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 13 + if (default_colors.length > 5) { + ttr = 10 + j * 45 + } + + + if (square) return (d.children || d._children) || version2 ? -76 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -76 + ttl : ttr + }) + .attr("y", (function (d) { + console.log(default_colors.length) + if (default_colors.length > 5) { + return (d.children || d._children) || version2 ? -34 : -10 + } else return (d.children || d._children) || version2 ? -34 : dict_leaf_y[label_names.length] - 4 + 20 * j + j * 4; + })) + .style("fill", function (d) { + if (default_colors.length == 0) { + return default_colors[j] + } else { + return default_colors[j] + } + + } + ) + .attr('visibility', function (d) { + + if (d.pred) { + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[curr].match(/\d+/)[0]); + v = v * 133 / d.size + return v != 0 || !d.children ? "visible" : "hidden" + }) + .attr('opacity', function (d) { + var val + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + val = (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + } + else if (!d.children) val = (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + return (d.children || d._children) || version2 ? 1 : val / 100 + 0.3 + + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + + + + + var subg = nodeEnter.append("g") + .attr("width", labels_w) + .attr("height", 20) + .attr("x", function (d) { + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + return -80 + ttl + + }) + .attr("y", -30) + + + subg.append("text") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + .attr("x", (function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 18 + if (default_colors.length > 5) { + ttr = 14 + j * 45 + } + + if (square) return (d.children || d._children) || version2 ? -71 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -71 + ttl : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 5 + } + + return (d.children || d._children) || version2 ? -19 : ttr; + + })) + .style("fill", "white") + .style("font-size", "12px") + .attr('visibility', function (d) { + if (d.pred && !square) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) > 20 ? "vivible" : "hidden" + } + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + subg.append('text') + .text(function (d) { + if (d.pred) { + return '' + } + else if (!d.children) { + return label_names[curr] + } + }) + .attr("x", (function (d) { + ttr = 60 + if (default_colors.length > 5) { + ttr = 18 + j * 45 + } + return (d.children || d._children) || version2 ? -66 + j * labels_w : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 25 + } + return (d.children || d._children) || version2 ? -15 : ttr; + })) + .style("font-size", "14px") + .style("fill", "rgb(78, 74, 74)") + .attr('transform', function (d) { + + return default_colors.length <= 5 ? '' : 'translate(' + (-30 + j * 20) + ',' + (10 + j * (-37)) + ') rotate(55 50 50)' + }) + + + + } + + + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.pred : ''; }) + // .style("fill-opacity", 1e-6) + + + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 10) + .style("fill", function (d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function (d) { return d.target.id; }); + + + if (tree_branch) var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, default_strokeness]); + else var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, 8]); + + var color = d3.scale.linear() + .domain([0, 50, 100]) + .range(["rgb(2, 255, 219)", "blue"]); + + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("id", function (d) { return d.target.id; }) + .attr("d", function (d) { + var o = { x: source.x0, y: source.y0 }; + return diagonal({ source: o, target: o }); + }) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }) + .style("stroke", function (d) { + + if (!d.target) { + return "#fff" + // return "#A3A6A8" + } + else return tree_branch_color; + }) + .append("svg:title") + .text(function (d, i) { + if (hover_percent_parent) { + var val = ((d.target.size / TOTAL_SIZE) * 100).toFixed(2); + } else { + var val = ((d.target.size / d.source.size) * 100).toFixed(2); + } + + return val + "%" + }) + + var tlink = svg.selectAll("text.tlink") + .data(tpaths, function (d) { return d.target.id; }); + + tlink.enter().insert("text", "g") + .attr("class", "tlink") + .attr("dy", function (d) { return d.target.side == "left" ? -10 : 15; }) + .append('textPath') + .attr("xlink:href", function (d) { return '#' + d.target.id; }) //place the ID of the path here + .style("text-anchor", "middle") //place the text halfway on the arc + .attr("startOffset", "45%") + .text(function (d) { return d.target.side == "left" ? "No" : "Yes"; }) + .attr('visibility', function (d) { return d.target.depth == 1 && !version2 ? 'visible' : 'hidden' }) + .attr("opacity", 0.5) + + + tlink.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }); + + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function (d) { + d.x0 = d.x; + d.y0 = d.y; + }); + + + // Toggle children on click. + function click(d) { + console.log(d) + + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d, n_labels); + + } + + + } + + + + + function createLabels(labels) { + + + var Size = 400 + + + var svg1 = d3.select("body") + .append("svg") + .attr("width", Size) + .attr("height", Size) + .attr("class", "legends"); + + console.log(labels.length) + console.log(default_colors.slice(0, labels.length)) + default_colors = default_colors.slice(0, labels.length) + if (default_colors.length == 2) default_colors.push('') + if (default_colors.length == 0) { + var c_l = default_colors + } else { + var c_l = default_colors + } + + for (i = 0; i < c_l.length; i++) { + + console.log(labels[i], "", c_l[i]) + + var legendG = svg1 + .append("g") + .attr("transform", function (d) { + return "translate(" + 0 + "," + (30 * i + Size / 33 + Size / 50) + ")"; // place each legend on the right and bump each one down 15 pixels + }) + .attr("class", "legend"); + + legendG.append("rect") // make a matching color rect + .attr("width", 15) + .attr("height", 15) + .attr("fill", c_l[i]) + .style('visibility', function () { + return labels[i] ? "visible" : "hidden" + }) + + legendG.append("text") // add the text + .text(labels[i]) + .style("font-size", 30) + .attr("y", 12) + .attr("x", 21) + + } + + } + } \ No newline at end of file diff --git a/intropage/Logo/PENNAILOGO.png b/intropage/Logo/PENNAILOGO.png new file mode 100644 index 000000000..81c614de5 Binary files /dev/null and b/intropage/Logo/PENNAILOGO.png differ diff --git a/intropage/Logo/favicon.ico b/intropage/Logo/favicon.ico new file mode 100644 index 000000000..38db6eb6b Binary files /dev/null and b/intropage/Logo/favicon.ico differ diff --git a/intropage/Logo/rpi-imager.icns b/intropage/Logo/rpi-imager.icns new file mode 100644 index 000000000..ddb72dee9 Binary files /dev/null and b/intropage/Logo/rpi-imager.icns differ diff --git a/intropage/Logo/rpi-imager.ico b/intropage/Logo/rpi-imager.ico new file mode 100644 index 000000000..d25b955fc Binary files /dev/null and b/intropage/Logo/rpi-imager.ico differ diff --git a/intropage/Logo/rpi-imager.png b/intropage/Logo/rpi-imager.png new file mode 100644 index 000000000..1eb3aafb2 Binary files /dev/null and b/intropage/Logo/rpi-imager.png differ diff --git a/intropage/Readme.md b/intropage/Readme.md new file mode 100644 index 000000000..5bf1cc704 --- /dev/null +++ b/intropage/Readme.md @@ -0,0 +1 @@ +# Aliro_ED_album_template_product_rp_dep_electron diff --git a/intropage/barchart.png b/intropage/barchart.png new file mode 100644 index 000000000..0670f123f Binary files /dev/null and b/intropage/barchart.png differ diff --git a/intropage/css/bootstrap.min.css b/intropage/css/bootstrap.min.css new file mode 100644 index 000000000..306b29532 --- /dev/null +++ b/intropage/css/bootstrap.min.css @@ -0,0 +1,6 @@ +@charset "UTF-8";/*! + * Bootstrap v5.2.1 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors + * Copyright 2011-2022 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-body-color-rgb:33,37,41;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-link-color:#0d6efd;--bs-link-hover-color:#0a58ca;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:#6c757d;text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:#6c757d}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);--bs-table-bg:transparent;--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-body-color);--bs-table-striped-bg:rgba(0, 0, 0, 0.05);--bs-table-active-color:var(--bs-body-color);--bs-table-active-bg:rgba(0, 0, 0, 0.1);--bs-table-hover-color:var(--bs-body-color);--bs-table-hover-bg:rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg:var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg:var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#bacbe6;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#cbccce;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#bcd0c7;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#badce3;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#e6dbb9;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#dfc2c4;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#dfe0e1;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#373b3e;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:#6c757d}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;-webkit-appearance:none;-moz-appearance:none;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:#dde0e3}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + .5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:calc(1.5em + .75rem + 2px);padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:.375rem}.form-control-color::-webkit-color-swatch{border-radius:.375rem}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + 2px)}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + 2px)}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);-webkit-appearance:none;-moz-appearance:none;appearance:none;-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;width:100%;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:1px solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#198754;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:#198754}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:#198754}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:#198754}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:#dc3545}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:#dc3545}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:#dc3545}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#212529;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:0.375rem;--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:first-child:hover,:not(.btn-check)+.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn btn-primary{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-secondary{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:none;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:#212529;--bs-dropdown-bg:#fff;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:0.375rem;--bs-dropdown-border-width:1px;--bs-dropdown-inner-border-radius:calc(0.375rem - 1px);--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color:#212529;--bs-dropdown-link-hover-color:#1e2125;--bs-dropdown-link-hover-bg:#e9ecef;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:1px;--bs-nav-tabs-border-color:#dee2e6;--bs-nav-tabs-border-radius:0.375rem;--bs-nav-tabs-link-hover-border-color:#e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color:#495057;--bs-nav-tabs-link-active-bg:#fff;--bs-nav-tabs-link-active-border-color:#dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));background:0 0;border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:0.375rem;--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(0, 0, 0, 0.55);--bs-navbar-hover-color:rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color:rgba(0, 0, 0, 0.3);--bs-navbar-active-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color:rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius:0.375rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:#fff;--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:1px;--bs-accordion-border-radius:0.375rem;--bs-accordion-inner-border-radius:calc(0.375rem - 1px);--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='var%28--bs-body-color%29'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:#0c63e4;--bs-accordion-active-bg:#e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:#6c757d;--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:#6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:#fff;--bs-pagination-border-width:1px;--bs-pagination-border-color:#dee2e6;--bs-pagination-border-radius:0.375rem;--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:#e9ecef;--bs-pagination-hover-border-color:#dee2e6;--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:#e9ecef;--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:#6c757d;--bs-pagination-disabled-bg:#fff;--bs-pagination-disabled-border-color:#dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:1px solid var(--bs-alert-border-color);--bs-alert-border-radius:0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:#084298;--bs-alert-bg:#cfe2ff;--bs-alert-border-color:#b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color:#41464b;--bs-alert-bg:#e2e3e5;--bs-alert-border-color:#d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color:#0f5132;--bs-alert-bg:#d1e7dd;--bs-alert-border-color:#badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color:#055160;--bs-alert-bg:#cff4fc;--bs-alert-border-color:#b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color:#664d03;--bs-alert-bg:#fff3cd;--bs-alert-border-color:#ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color:#842029;--bs-alert-bg:#f8d7da;--bs-alert-border-color:#f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color:#636464;--bs-alert-bg:#fefefe;--bs-alert-border-color:#fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color:#141619;--bs-alert-bg:#d3d3d4;--bs-alert-border-color:#bcbebf}.alert-dark .alert-link{color:#101214}@-webkit-keyframes progress-bar-stripes{0%{background-position-x:1rem}}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:#e9ecef;--bs-progress-border-radius:0.375rem;--bs-progress-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{-webkit-animation:1s linear infinite progress-bar-stripes;animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.list-group{--bs-list-group-color:#212529;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(0, 0, 0, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#212529;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#6c757d;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(255, 255, 255, 0.85);--bs-toast-border-width:1px;--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:0.375rem;--bs-toast-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color:#6c757d;--bs-toast-header-bg:rgba(255, 255, 255, 0.85);--bs-toast-header-border-color:rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:#fff;--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:1px;--bs-modal-border-radius:0.5rem;--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius:calc(0.5rem - 1px);--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:1px;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:#fff;--bs-tooltip-bg:#000;--bs-tooltip-border-radius:0.375rem;--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:0}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:0}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:#fff;--bs-popover-border-width:1px;--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:0.5rem;--bs-popover-inner-border-radius:calc(0.5rem - 1px);--bs-popover-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color: ;--bs-popover-header-bg:#f0f0f0;--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:#212529;--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;-webkit-animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@-webkit-keyframes spinner-border{to{transform:rotate(360deg)}}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@-webkit-keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg:#fff;--bs-offcanvas-border-width:1px;--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{-webkit-animation:placeholder-glow 2s ease-in-out infinite;animation:placeholder-glow 2s ease-in-out infinite}@-webkit-keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;-webkit-animation:placeholder-wave 2s linear infinite;animation:placeholder-wave 2s linear infinite}@-webkit-keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(13,110,253,var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(108,117,125,var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(25,135,84,var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(13,202,240,var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(255,193,7,var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(220,53,69,var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(248,249,250,var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(33,37,41,var(--bs-bg-opacity,1))!important}.link-primary{color:#0d6efd!important}.link-primary:focus,.link-primary:hover{color:#0a58ca!important}.link-secondary{color:#6c757d!important}.link-secondary:focus,.link-secondary:hover{color:#565e64!important}.link-success{color:#198754!important}.link-success:focus,.link-success:hover{color:#146c43!important}.link-info{color:#0dcaf0!important}.link-info:focus,.link-info:hover{color:#3dd5f3!important}.link-warning{color:#ffc107!important}.link-warning:focus,.link-warning:hover{color:#ffcd39!important}.link-danger{color:#dc3545!important}.link-danger:focus,.link-danger:hover{color:#b02a37!important}.link-light{color:#f8f9fa!important}.link-light:focus,.link-light:hover{color:#f9fafb!important}.link-dark{color:#212529!important}.link-dark:focus,.link-dark:hover{color:#1a1e21!important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute!important;width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-1{--bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-normal{font-weight:400!important}.fw-bold{font-weight:700!important}.fw-semibold{font-weight:600!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:#6c757d!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} diff --git a/intropage/css/style.css b/intropage/css/style.css new file mode 100644 index 000000000..fdddf763b --- /dev/null +++ b/intropage/css/style.css @@ -0,0 +1,563 @@ + +.bd-placeholder-img { +font-size: 1.125rem; +text-anchor: middle; +-webkit-user-select: none; +-moz-user-select: none; +user-select: none; +} + +@media (min-width: 768px) { +.bd-placeholder-img-lg { + font-size: 3.5rem; +} +} + +.b-example-divider { +height: 3rem; +background-color: rgba(0, 0, 0, .1); +border: solid rgba(0, 0, 0, .15); +border-width: 1px 0; +box-shadow: inset 0 .5em 1.5em rgba(0, 0, 0, .1), inset 0 .125em .5em rgba(0, 0, 0, .15); +} + +.b-example-vr { +flex-shrink: 0; +width: 1.5rem; +height: 100vh; +} + +.bi { +vertical-align: -.125em; +fill: currentColor; +} + +.nav-scroller { +position: relative; +z-index: 2; +height: 2.75rem; +overflow-y: hidden; +} + +.nav-scroller .nav { +display: flex; +flex-wrap: nowrap; +padding-bottom: 1rem; +margin-top: -1px; +overflow-x: auto; +text-align: center; +white-space: nowrap; +-webkit-overflow-scrolling: touch; +} + + +a#infanddownload, #loadingbutton { + /* --bs-btn-bg: #182435; + --bs-btn-hover-bg: #849ab9; */ + --bs-btn-bg: #f2efe9; + /* --bs-btn-hover-bg: #e3085d; */ + --bs-btn-hover-bg: #c6678f; + /* change text color */ + --bs-btn-color: #e3085d; + + /* change border color */ + --bs-btn-border-color: #182435; + --bs-btn-hover-border-color: #f2efe9; +} + +/* #infanddownload{ + visibility: hidden; +} */ + +a#downloadImage{ + --bs-btn-bg: #182435; + --bs-btn-hover-bg: #849ab9; +} + +.navbar{ + --bs-navbar-color: #1A1110!important; +} + + + + + +#mainName{ + /* color: #ffffff; */ + /* color: #e3085d; */ + color: #C31C4A; + font-size: 2.5rem; + font-weight: 700; + font-family: 'Roboto', sans-serif; + + /* text-shadow: 0 0 0.5rem #1A1110; */ + +} + + + +.bg-info { + --bs-bg-opacity: 0.3!important; + /* --bs-bg-color: #c02e1e!important; */ + /* background-color: #e1970f!important; */ +} + + +#topaliro, #bottomfooter{ + /* --bs-bg-opacity: 0!important; */ + background-color: #f2efe9!important; + /* no round */ + border-radius: 0!important; +} + + + +/* make element rect look transparent */ +rect { + /* fill: none; */ + stroke: none; +} + + +.card-body.bg-info{ + + --bs-bg-opacity: 0.1!important; + +} + + + +/*Filter styles*/ +.saturate { filter: saturate(3); } +.grayscale { filter: grayscale(100%); } +.contrast { filter: contrast(160%); } +.brightness { filter: brightness(0.25); } +.blur { filter: blur(3px); } +.invert { filter: invert(100%); } +.sepia { filter: sepia(100%); } +.huerotate { filter: hue-rotate(180deg); } +.rss.opacity { filter: opacity(50%); } + + + + +#changed { + -webkit-filter : hue-rotate(180deg); + filter : hue-rotate(180deg); +} + + + + +/* Style the video: 100% width and height to cover the entire window */ +#myVideo { +position: fixed; +right: 0; +bottom: 0; +min-width: 100%; +min-height: 100%; +z-index: -1; +background: rgba(0, 0, 0, 0.50); +visibility: hidden; +} + +/* main background color */ +main { +/* background: #e3085d; */ +background: #C31C4A; + +/* background: #C6878F; */ +} + +/* Add some content at the bottom of the video/page */ +.content { +position: fixed; +bottom: 0; +background: rgba(0, 0, 0, 0.5); +color: #f1f1f1; +width: 100%; +padding: 20px; +} + +/* Style the button used to pause/play the video */ +#myBtn { +width: 200px; +font-size: 18px; +padding: 10px; +border: none; +background: #000; +color: #fff; +cursor: pointer; +} + +#myBtn:hover { +background: #ddd; +color: black; +} + + + + + + +/* div class="row py-lg-5 bg-info" */ +.row.py-lg-5.bg-info{ +/* make edge round */ +border-radius: 1rem; +} + + +.bg-my{ + background-color: #F2EFE9; + border-radius: 1rem; + +} + + + + + + + + +/* carousel */ +* {box-sizing:border-box} + +/* Slideshow container */ +.slideshow-container { + max-width: 1000px; + position: relative; + margin: auto; +} + +/* Hide the images by default */ +.mySlides { + display: none; +} + +/* Next & previous buttons */ +.prev, .next { + cursor: pointer; + position: absolute; + top: 50%; + width: auto; + margin-top: -22px; + padding: 16px; + color: white; + font-weight: bold; + font-size: 18px; + transition: 0.6s ease; + border-radius: 0 3px 3px 0; + user-select: none; +} +a{ + text-decoration: none!important; +} +/* Position the "next button" to the right */ +.next { + right: 0; + border-radius: 3px 0 0 3px; +} +.prev { + left: 0; + border-radius: 3px 0 0 3px; + } + +/* On hover, add a black background color with a little bit see-through */ +.prev:hover, .next:hover { + /* background-color: rgba(0,0,0,0.8); */ +} + +/* Caption text */ +.text { + color: #f2f2f2; + font-size: 15px; + padding: 8px 12px; + position: absolute; + bottom: 8px; + width: 100%; + text-align: center; +} + +/* Number text (1/3 etc) */ +.numbertext { + color: #f2f2f2; + font-size: 12px; + padding: 8px 12px; + position: absolute; + top: 0; +} + +/* The dots/bullets/indicators */ +.dot { + cursor: pointer; + height: 15px; + width: 15px; + margin: 0 2px; + background-color: #bbb; + border-radius: 50%; + display: inline-block; + transition: background-color 0.6s ease; +} + +.active, .dot:hover { + background-color: #717171; + /* background-color: #ffffff; */ +} + +/* Fading animation */ +.fade { + animation-name: fade; + animation-duration: 1.5s; +} + +@keyframes fade { + from {opacity: .4} + to {opacity: 1} +} + + + + +/* domain is axis */ +.domain { + /* fill: rgb(255, 255, 255); */ + stroke: rgb(0, 0, 0)!important; + /* shape-rendering: crispEdges; */ +} + + + +#mainLogo{ + /* -webkit-filter: invert(20%); */ + + /* make it black */ + /* -webkit-filter: invert(100%); */ + /* make it white */ + /* -webkit-filter: invert(120%); */ + + + +} + + + +.card-body.bg-secondary{ + /* background-color: #0d131b!important; */ + /* background-color: #137833!important; */ + background-color: #73877B!important; + + + +} + + + +.bg-danger { + /* --bs-bg-opacity: 1!important; */ + /* --bs-bg-color: #c02e1e!important; */ + /* background-color: #e1970f!important; */ +} + + + + + + + + +.videoContainer { + position: relative; + width: 100%; + height: 100%; + + border-radius: 5px; + background-attachment: scroll; + overflow: hidden; +} +.videoContainer video { + min-width: 100%; + min-height: 100%; + position: relative; + z-index: 1; +} +.videoContainer .overlay { + height: 100%; + width: 100%; + position: absolute; + top: 0px; + left: 0px; + z-index: 2; + background: green; + opacity: 0.5; +} + + + + + + +#overlay { + pointer-events:none; + position: fixed; + display: none; + width: 100%; + height: 100%; + top: 0; + left: 0; + right: 0; + bottom: 0; + /* background-color: rgba(0,0,0,0.3); */ +/*background-color: rgba(0,0,0,0.4);*/ + /* background-color: rgba(255, 255, 255, 0.3); */ + z-index: 1; + cursor: pointer; +} + + +.nav-item{ + color: transparent!important; + background-color: transparent!important; + /* -webkit-text-fill-color: rgb(255, 255, 255)!important; */ + list-style-type: none; + + /* change font size */ + font-size: 1.2rem; + +} + +.active, .dot:hover { + background-color: transparent!important; + /* mouseover color change */ + +} + + + + + /* Style buttons */ + .btn-download { + background-color: DodgerBlue; + border: none; + color: white; + padding: 12px 30px; + cursor: pointer; + font-size: 20px; + /* make left aligned */ + +} + +/* Darker background on mouse-over */ +.btn-download:hover { + background-color: RoyalBlue; +} + + + +.all-scroll {cursor: all-scroll;} + +#downloadA { + background: darkslategray!important; + color: white!important; +} + + + +#downloadLi { + --bs-btn-bg: #182435; + --bs-btn-hover-bg: #849ab9; +} + + + + + + + + +.blinking { + animation: blinker 1.5s cubic-bezier(.5, 0, 1, 1) infinite alternate; + /* position:absolute; */ + position:inherit; + /* transform translate to the right side of web page */ + /* transform: translate(550%, -90%); */ + /* transform: translate(0, 0); */ + /* transform: translate(50%, 0); */ + + /* locate all ways */ + +} + +@keyframes blinker { +from { opacity: 1; } +to { opacity: 0; } +} + + +a#Downloadpage{ + + color:white!important; + visibility: hidden; + +} + +a#loadingeds{ + /* color:red!important; */ + color:#C31C4A!important; + /* make the text bold */ + font-weight: bold; + +} + + + +/* #blinkingtextcir{ + visibility: hidden; +} */ + +body { + + background-color: #4a4a4d !important; +} + + +/* #backtotop{ + color:rgb(255, 255, 255) +} */ + +/* #navbarHeader{ + background-color: #0d131b!important; +} */ + +#footertex{ + color:#e3085d!important; + + /* color: #C31C4A!important; */ +} + + + + + + +/* div class="row py-lg-5 bg-info" */ +.row.py-lg-5.bg-success{ + /* make edge round */ + border-radius: 1rem; + + } + + .bg-success { + /* --bs-bg-opacity: 1!important; */ + --bs-bg-color: #b1928f!important; + /* background-color :#849ab9!important; */ + /* background-color: #e1970f!important; */ + /* background-color: #0d131b!important; */ + } + + + + + .dfboubutton{ + cursor:pointer; + } \ No newline at end of file diff --git a/intropage/decisiontree.png b/intropage/decisiontree.png new file mode 100644 index 000000000..f19b5741f Binary files /dev/null and b/intropage/decisiontree.png differ diff --git a/intropage/firstThumbnail.png b/intropage/firstThumbnail.png new file mode 100644 index 000000000..bc8aaf882 Binary files /dev/null and b/intropage/firstThumbnail.png differ diff --git a/intropage/firstThumbnail_resized.png b/intropage/firstThumbnail_resized.png new file mode 100644 index 000000000..c14d28aff Binary files /dev/null and b/intropage/firstThumbnail_resized.png differ diff --git a/intropage/firstThumbnail_scatter.png b/intropage/firstThumbnail_scatter.png new file mode 100644 index 000000000..66a794328 Binary files /dev/null and b/intropage/firstThumbnail_scatter.png differ diff --git a/raspberrypi/intropage/main.html b/intropage/index.html similarity index 99% rename from raspberrypi/intropage/main.html rename to intropage/index.html index 56aa6ff28..2a0650fe1 100644 --- a/raspberrypi/intropage/main.html +++ b/intropage/index.html @@ -76,7 +76,7 @@

Contact