diff --git a/rapsberrypi/web/3d_scatter_plot_d3v4.html b/rapsberrypi/web/3d_scatter_plot_d3v4.html new file mode 100644 index 000000000..8ccdb4532 --- /dev/null +++ b/rapsberrypi/web/3d_scatter_plot_d3v4.html @@ -0,0 +1,179 @@ + + + + + + + + + + + + \ No newline at end of file diff --git a/rapsberrypi/web/JSfiles/Aliro copy.js b/rapsberrypi/web/JSfiles/Aliro copy.js new file mode 100644 index 000000000..eb9eb726f --- /dev/null +++ b/rapsberrypi/web/JSfiles/Aliro copy.js @@ -0,0 +1,1814 @@ + +function pingURL() { + + // Aliro URL + // var URL = "http://localhost:5080" + var URL = "http://google.com" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + const sele = document.getElementById('temp'); + // make button with id temp always same size + // sele.style.width = "100%"; + // sele.style.height = "100%"; + + + sele.innerHTML = "Aliro is running"; + + // Add URL to the button id temp href + sele.href = URL; + + + // Create flashing/glowing button effect to the button id temp + + + + // if mouse is on the element with id temp, then make the innerHTML bold + + sele.addEventListener('mouseover', function () { + sele.style.fontWeight = 'bold'; + }); + + // if mouse is not on the element with id temp, then make the innerHTML normal + sele.addEventListener('mouseout', function () { + sele.style.fontWeight = 'normal'; + }); + + + + + // d3.select('#temp').text('Aliro is running'); + // d3.select('#temp').style('color', 'red'); + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + +// d3.select('#temp').text('Aliro is running'); +// d3.select('#temp').style('color', 'red'); + + + + +// Below is the code for information visualization with D3.js + + +function int_ml_01_titanic_data(){ + + var svg = d3.select("#dataviz_area") + // svg.append("circle").attr("cx", 2).attr("cy", 2).attr("r", 40).style("fill", "blue"); + // svg.append("circle").attr("cx", 140).attr("cy", 70).attr("r", 40).style("fill", "red"); + // svg.append("circle").attr("cx", 300).attr("cy", 100).attr("r", 40).style("fill", "green"); + + // make bar chart with random data + // Add effect to the bar chart when user scroll down, the bar chart will appear + // data set includes 1 to 30 + var dataset = [ 5, 10, 15, 20, 25,30, 40,2,4,5,6,7,8 ]; + svg.selectAll("rect") + .data(dataset) + .enter() + .append("rect") + .attr("x", function(d, i) { + return i * 30; + } + ) + .attr("y", function(d) { + return 150 - d * 5; + } + ) + .attr("width", 25) + .attr("height", function(d) { + return d * 5; + } + ) + .attr("fill", "teal"); + + // read data from csv file (C:\Users\User\Desktop\python_work\SoftTCBCS\Aliro_ED\Aliro_ED\Aliro_ED_album_template\data\datasets\pmlb_small\titanic.csv) + // d3.csv("data/datasets/pmlb_small/titanic/titanic.csv", function(data) { + + // console.log(data["Class Age Sex class"]); + // console.log("Hello") + // }); + + var positive_Sex =[] + var negative_Sex =[] + + d3.csv('data/datasets/pmlb_small/titanic/titanic.csv') + .then(function(data) { + // data is now whole data set + // draw chart in here! + // console.log(data); + for (var i = 0; i < data.length; i++) { + // console.log(data[i]["Class\tAge\tSex\tclass"]); + // console.log(data[i]["Class\tAge\tSex\tclass"]); + // parse string with \t + var str = data[i]["Class\tAge\tSex\tclass"]; + var string_data = str.split("\t"); + // convert string to float + var float_data = string_data.map(function(x){ return parseFloat(x) }); + + // console.log(float_data); + if (float_data[2]>0) + { + positive_Sex.push(float_data); + } + else + { + negative_Sex.push(float_data); + } + } + console.log(positive_Sex) + console.log(negative_Sex) + + // make the bar chart sex by class + + }) + .catch(function(error){ + // handle error + }); + + + + +} + + + + + + +function int_ml_01_iris_data(){ + + // var svg = d3.select("#dataviz_area") + + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 460 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")"); + + + d3.csv('data/datasets/pmlb_small/iris/iris_two_classes.csv') + .then(function(data) { + // data is now whole data set + // draw chart in here! + // console.log(data); + for (var i = 0; i < data.length; i++) { + // show data column names + // console.log(Object.keys(data[i])); + if (i==0) + { + var colunm_names=Object.keys(data[i])[0].split("\t"); + console.log(colunm_names); + } + + // console.log(data[i][Object.keys(data[i])]); + + + var str = data[i][Object.keys(data[i])]; + var string_data = str.split("\t"); + // convert string to float + var float_data = string_data.map(function(x){ return parseFloat(x) }); + console.log(float_data); + } + + + + + + }) + .catch(function(error){ + // handle error + }); + + + + +} + + + + + + +function colorClass(class_cat) { + if (class_cat==0) + { + return "#440154"; + } + else if (class_cat==1) + { + return "#21918c"; + } + else + { + return "#fde725"; + } + +} + +// if div id = intuition_exp is clicked, then run the function +// the function descrption is below +// when div id = intuition_exp is clicked, show div id addingnuance + +function oneDPlot_v2(){ + + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(0); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + +} + + +function twoDPlot_v2() { + // console.log("mouseleave"); + + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + +} + +function remove_boundaries_on2d_plot() +{ + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + //seclt all class named boundaries + svg.selectAll(".boundaries") + .transition() + .duration(1000) + .attr("opacity", "0") +} + + + +function drawing_boundaries_on_2d_plot() { + + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + + + + // mouseover the circles + svg.selectAll("circle") + .on("mouseover", function(d) { + console.log(x(d['petal-length'])); + console.log(y(d['sepal-length'])); + }) + + + + + +var svg = d3.select("#dataviz_area_div_svg") +// make a box brom 0,0 to 123, 138 on the svg + +var data_class1 = [ +[ + [0,0], + [123,270] +] + +]; + +var rects_class1 = svg.selectAll("hey") + .data(data_class1) + .enter() + .append("rect") + .attr("class","boundaries") + .attr("x", d=> d[0][0]) + .attr("y", d=> d[0][1]) + .transition() + .duration(2000) + .attr("width", d=> d[1][0] - d[0][0]) + .attr("height", d=> d[1][1] - d[0][1]) + .attr("fill", "#440154") + .attr("opacity", 0.2); + + + // 209.66666666666666 + // 120 +var data_class2 = +[ + [ + [123,0], + [209.7,270] + ] +]; + +var rects_class2 = svg.selectAll("hey") + .data(data_class2) + .enter() + .append("rect") + .attr("class","boundaries") + .attr("x", d=> d[0][0]) + .attr("y", d=> d[0][1]) + .transition() + .duration(2000) + .attr("width", d=> d[1][0] - d[0][0]) + .attr("height", d=> d[1][1] - d[0][1]) + .attr("fill", "#21918c") + .attr("opacity", 0.2); + +var data_class3 = +[ + [ + [209.7,0], + [400,270] + ] +]; + +var rects_class3 = svg.selectAll("hey") + .data(data_class3) + .enter() + .append("rect") + .attr("class","boundaries") + .attr("x", d=> d[0][0]) + .attr("y", d=> d[0][1]) + .transition() + .duration(2000) + .attr("width", d=> d[1][0] - d[0][0]) + .attr("height", d=> d[1][1] - d[0][1]) + .attr("fill", "#fde725") + .attr("opacity", 0.2); + + + +} + + + +function show_or_block_each_part(){ + + // console.log("show_or_block is clicked"); + + + + + + + + + // from FSI to adding nuance + d3.select("#fromfsitoaddn").on("click", function() { + + + // non "Adding nuance" div + document.getElementById("intuition_exp").style.display = "none"; + // block "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "block"; + + + + // plot the data on 2D plane + twoDPlot_v2() + + }); + + // document.getElementById("addingnuance").style.display = "none"; + + + + // from adding nuance to FSI + d3.select("#fromaddntofsi").on("click", function() { + + + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + // block "Adding nuance" div + document.getElementById("intuition_exp").style.display = "block"; + + + // project the data on 1D + oneDPlot_v2() + + + }); + + + + + + + + + + // from adding nuance to drawing boundaris + d3.select("#fromaddntodrawb").on("click", function() { + + // block "Adding nuance" div + document.getElementById("drawingboundaries").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + + + // draw boundaries on the 2D plane + drawing_boundaries_on_2d_plot() + + + }); + + + + + + // from drawing boundaris to adding nuance + d3.select("#fromdrawbtoaddn").on("click", function() { + + // block "Adding nuance" div + document.getElementById("addingnuance").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("drawingboundaries").style.display = "none"; + + + // plot the data on 2D plane + remove_boundaries_on2d_plot() + twoDPlot_v2() + + + }); + + + + + + + + + +} + + + + + + +function int_ml_01_test_iris_data(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 560 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + d3.csv("data/datasets/pmlb_small/iris/iris_two_classes.csv", function(data) { + + // show data column names + // console.log(Object.keys(data[0])); + console.log("int_ml_01_test_iris_data") + console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 15]) + .range([ height, 0]); + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr("r", 2) + .style("fill", "#69b3a2") + + // new X axis + x.domain([0,15]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + var tooltip = d3.select("#dataviz_area") + .append("div") + .style("opacity", 0) + .attr("class", "tooltip") + .style("background-color", "white") + .style("border", "solid") + .style("border-width", "1px") + .style("border-radius", "5px") + .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + var mouseover = function(d) { + tooltip + .style("opacity", 1) + } + + var mousemove = function(d) { + tooltip + .html("The exact value of
the Ground Living area is: " + d['petal-length']) + .style("left", (d3.mouse(this)[0]+20) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var mouseleave = function(d) { + tooltip + .transition() + .duration(200) + .style("opacity", 0) + } + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data.filter(function(d,i){return i<50})) // the .filter part is just to keep a few dots on the chart, not all of them + .enter() + .append("circle") + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr("r", 7) + .style("fill", "#69b3a2") + .style("opacity", 0.3) + .style("stroke", "white") + .on("mouseover", mouseover ) + .on("mousemove", mousemove ) + .on("mouseleave", mouseleave ); + + + + + + + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + + } + + +function int_ml_01_test_iris_data_tooltip_1d_barscatter(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 550 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function(data) { + + + + // show data column names + // console.log(Object.keys(data[0])); + // console.log("int_ml_01_test_iris_data_tooltip") + // console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + .range([ height, 0]); + + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + // sepal-length', 'sepal-width' + // sepal-length', 'petal-length' + // sepal-length', 'petal-width + // 'sepal-width', 'petal-length' + // 'sepal-width', 'petal-width' + // 'petal-length', 'petal-width' + // + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // make the x located in the middle of the rect + + .attr('x', 550/8) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr('y', function (d) { return y(d['sepal-length']); } ) + .attr('width', 550/2) + .attr('height',1) + + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + + // .attr("r", 2) + .attr("fill", "#69b3a2") + + // new X axis + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(4000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + svg.selectAll("rect") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + // .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // // A function that change this tooltip when the user hover a point. + // // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + // var mouseover = function(d) { + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + // } + + // var mousemove = function(d) { + // console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + // } + + // // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + // var mouseleave = function(d) { + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + // } + + // // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.2) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + + + + + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + + } + + + + + + + +function onedplotToTwodPlot(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 30, right:30, bottom: 30, left: 0}, + width = 400 - margin.left - margin.right, + height = 300 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .attr("viewBox", `-25 -15 400 250`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function(data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([ 0, width ]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + // .domain([0, 0]) + .range([ height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "1"); + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + .attr("cx", function (d) { return x(0)+165; } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + + + .attr("r", 2) + .style("fill", "#69b3a2") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(0)+165; } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }) + + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(5000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + + + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + + var project_x_axis = function(d) { + + console.log("project_x_axis"); + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*10)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(0); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function(d) { + + console.log("mouseover"); + + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*10)}) + .duration(1000) + + .attr("cx", function (d) { return x(0); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function(d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function(d) { + console.log("mouseleave"); + + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0,12]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + + + d3.select("#projectxaxia") + // .on("mousemove", mousemove ) + .on("click", project_x_axis ); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis ); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot ); + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + +function int_ml_01_test_iris_data_tooltip_2d(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 550 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function(data) { + + + + // show data column names + // console.log(Object.keys(data[0])); + console.log("int_ml_01_test_iris_data_tooltip") + console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 12]) + .range([ height, 0]); + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + // sepal-length', 'sepal-width' + // sepal-length', 'petal-length' + // sepal-length', 'petal-width + // 'sepal-width', 'petal-length' + // 'sepal-width', 'petal-width' + // 'petal-length', 'petal-width' + // + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + + + .attr("r", 2) + .style("fill", "#69b3a2") + + // new X axis + x.domain([0,9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // best + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['sepal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['sepal-width']); } ) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['petal-width']); } ) + // ok + // .attr("cx", function (d) { return x(d['petal-width']); } ) + // .attr("cy", function (d) { return y(d['petal-length']); } ) + + // give color to the dots based on the class + .style("fill", function(d){ return colorClass(d['class']) }); + + + + var tooltip = d3.select("#dataviz_area") + .append("div") + .style("opacity", 0) + .attr("class", "tooltip") + .style("background-color", "white") + .style("border", "solid") + .style("border-width", "1px") + .style("border-radius", "5px") + .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + var mouseover = function(d) { + console.log("mouseover"); + tooltip + .style("opacity", 1) + } + + var mousemove = function(d) { + console.log("mousemove"); + tooltip + .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var mouseleave = function(d) { + tooltip + .transition() + .duration(200) + .style("opacity", 0) + } + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + .enter() + .append("circle") + .attr("cx", function (d) { return x(d['petal-length']); } ) + .attr("cy", function (d) { return y(d['sepal-length']); } ) + .attr("r", 2) + .style("fill", "#69b3a2") + .style("opacity", 0.2) + .style("stroke", "white") + .on("mouseover", mouseover ) + .on("mousemove", mousemove ) + .on("mouseleave", mouseleave ); + + + + + + + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + +// https://d3-graph-gallery.com/graph/scatter_animation_start.html +function int_ml_01_test_data(){ + + + +// set the dimensions and margins of the graph +var margin = {top: 10, right: 30, bottom: 30, left: 60}, +width = 460 - margin.left - margin.right, +height = 400 - margin.top - margin.bottom; +// append the svg object to the body of the page +var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + +//Read the data +d3.csv("https://raw.githubusercontent.com/holtzy/data_to_viz/master/Example_dataset/2_TwoNum.csv", function(data) { + +console.log(data); + +// Add X axis +var x = d3.scaleLinear() +.domain([0, 0]) +.range([ 0, width ]); +svg.append("g") +.attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it +.attr("transform", "translate(0," + height + ")") +.call(d3.axisBottom(x)) +.attr("opacity", "0") + +// Add Y axis +var y = d3.scaleLinear() +.domain([0, 500000]) +.range([ height, 0]); +svg.append("g") +.call(d3.axisLeft(y)); + +// Add dots +svg.append('g') +.selectAll("dot") +.data(data) +.enter() +.append("circle") + .attr("cx", function (d) { return x(d.GrLivArea); } ) + .attr("cy", function (d) { return y(d.SalePrice); } ) + .attr("r", 1.5) + .style("fill", "#69b3a2") + +// new X axis +x.domain([0, 4000]) +svg.select(".myXaxis") +.transition() +.duration(2000) +.attr("opacity", "1") +.call(d3.axisBottom(x)); + +svg.selectAll("circle") +.transition() +.delay(function(d,i){return(i*3)}) +.duration(2000) +.attr("cx", function (d) { return x(d.GrLivArea); } ) +.attr("cy", function (d) { return y(d.SalePrice); } ) +}) + +} + + + + + +function int_ml_01_test_titanic_data(){ + + + + // set the dimensions and margins of the graph + var margin = {top: 10, right: 30, bottom: 30, left: 60}, + width = 460 - margin.left - margin.right, + height = 400 - margin.top - margin.bottom; + // append the svg object to the body of the page + var svg = d3.select("#dataviz_area") + .append("svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", + "translate(" + margin.left + "," + margin.top + ")") + + //Read the data + d3.csv("data/datasets/pmlb_small/titanic/titanic_Comma.csv", function(data) { + + console.log(data); + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + .range([ 0, width ]); + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + .domain([-1, 10]) + .range([ height, 0]); + svg.append("g") + .call(d3.axisLeft(y)); + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + .attr("cx", function (d) { return x(d.Class); } ) + .attr("cy", function (d) { return y(d.Age); } ) + .attr("r", 1.5) + .style("fill", "#69b3a2") + + // new X axis + x.domain([-10,10]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + svg.selectAll("circle") + .transition() + .delay(function(d,i){return(i*3)}) + .duration(2000) + .attr("cx", function (d) { return x(d.Class); } ) + .attr("cy", function (d) { return y(d.Age); } ) + }) + + } \ No newline at end of file diff --git a/rapsberrypi/web/JSfiles/Aliro.js b/rapsberrypi/web/JSfiles/Aliro.js new file mode 100644 index 000000000..381ce0ae9 --- /dev/null +++ b/rapsberrypi/web/JSfiles/Aliro.js @@ -0,0 +1,4050 @@ + +function pingURL() { + + // Aliro URL + var URL = "http://localhost:5080" + // var URL = "http://google.com" + // var URL = "http://www.daum.net" + var settings = { + + // Defines the configurations + // for the request + + cache: false, + dataType: "jsonp", + async: true, + crossDomain: true, + url: URL, + method: "GET", + headers: { + accept: "application/json", + "Access-Control-Allow-Origin": "*" + }, + timeout: 10000, + tryCount: 0, + tryLimit: 100, + // tryLimit: 2, + statusCode: { + 200: function (response) { + + + + + const sele = document.getElementById('temp'); + // make button with id temp always same size + // sele.style.width = "100%"; + // sele.style.height = "100%"; + + + sele.innerHTML = "Aliro is running"; + + // Add URL to the button id temp href + sele.href = URL; + + + // Create flashing/glowing button effect to the button id temp + + + + // if mouse is on the element with id temp, then make the innerHTML bold + + sele.addEventListener('mouseover', function () { + sele.style.fontWeight = 'bold'; + }); + + // if mouse is not on the element with id temp, then make the innerHTML normal + sele.addEventListener('mouseout', function () { + sele.style.fontWeight = 'normal'; + }); + + + + + // d3.select('#temp').text('Aliro is running'); + // d3.select('#temp').style('color', 'red'); + + + + + }, + 0: function () { + this.url = URL; + if (this.tryCount++ < this.tryLimit) { + + $.ajax(this); + } + } + }, + }; + + + + + $.ajax(settings) + + +} + +// d3.select('#temp').text('Aliro is running'); +// d3.select('#temp').style('color', 'red'); + + + + +// Below is the code for information visualization with D3.js + + + + + + + + + + + + + +function colorClass(class_cat) { + if (class_cat == 0) { + // return "#440154"; + return "#c701bb"; + } + else if (class_cat == 1) { + return "#21918c"; + } + else { + return "#fde725"; + } + +} + + + +function locationByColorClass(class_cat) { + if (class_cat == 0) { + return 100; + } + else if (class_cat == 1) { + return 200; + } + else { + return 300; + } + +} + +// if div id = intuition_exp is clicked, then run the function +// the function descrption is below +// when div id = intuition_exp is clicked, show div id addingnuance + +function oneDPlot_v2() { + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + +} + + +function twoDPlot_v2() { + // console.log("mouseleave"); + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // mouseover the circles + svg.selectAll("circle") + .on("mouseover", function (d) { + console.log(x(d['petal-length'])); + console.log(y(d['sepal-length'])); + }) + +} + +function remove_boundaries_on2d_plot() { + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + //seclt all class named boundaries + svg.selectAll(".boundaries") + .transition() + .duration(1000) + .attr("opacity", "0") +} + + + +function drawing_boundaries_on_2d_plot() { + + console.log("drawing boundaries on 2d plot"); + + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var svg = d3.select("#dataviz_area_div") + + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + + // Add Y axis + var y = d3.scaleLinear() + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + + + + // // mouseover the circles + // svg.selectAll("circle") + // .on("mouseover", function(d) { + // console.log(x(d['petal-length'])); + // console.log(y(d['sepal-length'])); + // }) + + + + + + var svg = d3.select("#dataviz_area_div_svg") + // make a box brom 0,0 to 123, 138 on the svg + + var data_class1 = [ + [ + [0, 0], + [156.7, height] + ] + + ]; + + var rects_class1 = svg.selectAll("hey") + .data(data_class1) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#440154") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_1"); + + + // 209.66666666666666 + // 120 + var data_class2 = + [ + [ + [156.7, 0], + [266.4, height] + ] + ]; + + var rects_class2 = svg.selectAll("hey") + .data(data_class2) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#21918c") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_2"); + + var data_class3 = + [ + [ + [266.4, 0], + [500, height] + ] + ]; + + var rects_class3 = svg.selectAll("hey") + .data(data_class3) + .enter() + .append("rect") + .attr("class", "boundaries") + .attr("x", d => d[0][0]) + .attr("y", d => d[0][1]) + .transition() + .duration(2000) + .attr("width", d => d[1][0] - d[0][0]) + .attr("height", d => d[1][1] - d[0][1]) + .attr("fill", "#fde725!important") + .attr("opacity", 0.2) + .attr("id","drawn_boundaries_3"); + + + +} + + + +function show_or_block_each_part() { + + // console.log("show_or_block is clicked"); + + + + + + + + + // from FSI to adding nuance + d3.select("#fromfsitoaddn").on("click", function () { + + + // non "Adding nuance" div + document.getElementById("intuition_exp").style.display = "none"; + // block "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "block"; + + + + // plot the data on 2D plane + twoDPlot_v2() + + }); + + // document.getElementById("addingnuance").style.display = "none"; + + + + // from adding nuance to FSI + d3.select("#fromaddntofsi").on("click", function () { + + + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + // block "Adding nuance" div + document.getElementById("intuition_exp").style.display = "block"; + + + // project the data on 1D + oneDPlot_v2() + + + }); + + + + + + + + + + // from adding nuance to drawing boundaris + d3.select("#fromaddntodrawb").on("click", function () { + + // block "Adding nuance" div + document.getElementById("drawingboundaries").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("addingnuance").style.display = "none"; + + + // draw boundaries on the 2D plane + drawing_boundaries_on_2d_plot() + + + }); + + + + + + // from drawing boundaris to adding nuance + d3.select("#fromdrawbtoaddn").on("click", function () { + + // block "Adding nuance" div + document.getElementById("addingnuance").style.display = "block"; + // none "Frist, some intuition" div + document.getElementById("drawingboundaries").style.display = "none"; + + + // plot the data on 2D plane + remove_boundaries_on2d_plot() + twoDPlot_v2() + + + }); + + + + + + + + + +} + + + + + +function onedplotToTwodPlot() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + .attr("stroke", "white") + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([0, 10]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "0") + // make y axis white + // .attr("fill", "white") + .attr("stroke", "white") + // .attr("stroke-width", "1px") + ; + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("circle") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + .attr("cx", function (d) { return x(0) + 165; }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + + + // .attr("r", 2) + .attr("r", 3.5) + .style("fill", "#69b3a2") + .style("stroke", "black") + .attr("class", function (d) { return (d['class']); }) + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(0) + 165; }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function (d, i) { return (i * 10) }) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); }) + // .attr("cy", function (d) { return y(0); }) + + // // give color to the dots based on the class + // .style("fill", function (d) { return colorClass(d['class']) }); + + + + + + + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(5000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + + + // console.log(num_circles); + + // var tooltip = d3.select("#dataviz_area") + // .append("div") + // .style("opacity", 0) + // .attr("class", "tooltip") + // .style("background-color", "white") + // .style("border", "solid") + // .style("border-width", "1px") + // .style("border-radius", "5px") + // .style("padding", "10px") + + // A function that change this tooltip when the user hover a point. + // Its opacity is set to 1: we can now see it. Plus it set the text and position of tooltip depending on the datapoint (d) + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + // force to click on the button #projectxaxia + + + + + d3.select("#projectxaxia") + // .on("mousemove", mousemove ) + .on("click", project_x_axis); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot); + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + + +function all_possible_corr() { } + + + + + + + + + +function boxplot() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + + {/* + + */} + + + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([4, 8.5]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "1"); + + + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + + .attr("rx", 3) + .attr("ry", 3) + .attr("width", 5) + .attr("height", 5) + .attr("class", function (d) { return "class " + d['class'] }) + .style("fill", "#69b3a2") + // opacity + .attr("opacity", "0.3") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("rect") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + // .attr("x", function (d) { return x(0)+165; } ) + // .attr("y", function (d) { return y(d['sepal-length']); } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + .attr("rx", 0) + .attr("ry", 0) + .attr("width", 30) + .attr("height", 5) + + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + .attr("opacity", "0.5") + + + + var num_rect = svg.selectAll("rect").size(); + console.log("num_rect: ", num_rect) + // + + + + + + + + + + + + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + + + var rotate_project_on_x_axis = function (d) { + + console.log("rotate_project_on_x_axis"); + + + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + // y.domain([0, 10]) + // svg.select(".myYaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "0") + // .call(d3.axisLeft(y)); + + + // x.domain([4,8.5]) + x.domain([4, 8.5]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + + // count the number of circles + + + + + // svg.selectAll("rect") + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + // // width and height of the rectangle 2 + // .attr('width',2) + // .attr('height',2) + // .attr('rx',3) + // .attr('ry',3) + + + + // calculate frequency of each class by data[1]['sepal-length'] + var frequency_class1 = {}; + var frequency_class2 = {}; + var frequency_class3 = {}; + + for (var i = 0; i < data.length; i++) { + // data[i]['class'] == '0' + + + if (data[i]['class'] == '0') { + // add count to frequency_class1[data[i]['sepal-length']] + if (frequency_class1[data[i]['sepal-length']] == undefined) { + frequency_class1[data[i]['sepal-length']] = 1; + } + else { + frequency_class1[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '1') { + // add count to frequency_class2[data[i]['sepal-length']] + if (frequency_class2[data[i]['sepal-length']] == undefined) { + frequency_class2[data[i]['sepal-length']] = 1; + } + else { + frequency_class2[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '2') { + // add count to frequency_class3[data[i]['sepal-length']] + if (frequency_class3[data[i]['sepal-length']] == undefined) { + frequency_class3[data[i]['sepal-length']] = 1; + } + else { + frequency_class3[data[i]['sepal-length']] += 1; + } + } + + + + + } + + + + + // console.log(frequency_class1[4.3]); + console.log(frequency_class1); + // get all keys of frequency_class1 + var keys_1 = Object.keys(frequency_class1); + console.log(frequency_class2); + var keys_2 = Object.keys(frequency_class2); + console.log(frequency_class3); + var keys_3 = Object.keys(frequency_class3); + + // set union keys_1, keys_2, keys_3 + var keys = keys_1.concat(keys_2, keys_3); + keys = [...new Set(keys)]; + // sort keys + keys.sort(function (a, b) { return a - b }); + console.log("keys:", keys); + // show length of keys + console.log("length of keys:", keys.length); + + + // print if frequency_class1 + + //show how many rectangles exist + console.log("number of rectangles:", svg.selectAll("rect").size()); + + // remove any rectangles if the keys.length is less than the number of rectangles + // that is, for example, if keys.length is 35, only 35 rectangles should be shown + // when rectangles are removed, make it transparent and removed + + if (keys.length < svg.selectAll("rect").size()) { + console.log("remove rectangles"); + svg.selectAll("rect") + .data(keys) + .exit() + .remove(); + console.log("after number of rectangles:", svg.selectAll("rect").size()); + + } + + + + // rotate 90 degree of rectangles + svg.selectAll("rect") + // .attr('opacity',0) + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(0); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // .attr('transform', 'translate(400,100)rotate(90)') + .attr('transform', 'translate(300,100) rotate(90)') + // .attr('transform', 'translate(400,100)') + // .attr('transform', 'rotate(90)') + // .attr('transform', 'translate(100,400)rotate(-90)') + // .attr('transform', 'rotate(-90)translate(10,200)') + .attr('opacity', 0.5) + // .attr("x", function(d){ return x(0) }); + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + .attr("x", function (d) { + // console.log("x(6)") + // console.log(x(6)) + return x(6); + }) + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + // console.log(data[1]['petal-length']); + // console.log(data[1]['sepal-length']); + + + // console.log(data); + // console.log(data[1]['sepal-length']); + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 0" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class1[keys_1[i]]) + return 20 * frequency_class1[keys_1[i]] + }) + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 1" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class2[keys_2[i]]) + return 20 * frequency_class2[keys_2[i]] + + }) + + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 2" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class3[keys_3[i]]) + return 20 * frequency_class3[keys_3[i]] + + }) + + + + + // plot rectangles based on frequency_class1, frequency_class2, frequency_class3 + // each rectangle has height frequency_class1 + // each rectangle has width 0.5 + // each rectangle has x = data[i]['sepal-length'] + + + + + // plot rectangles based on the frequency + + + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + // Add dots + // svg.append('g') + // .selectAll("dot") + // .data(data.filter(function(d,i){return i<100000})) // the .filter part is just to keep a few dots on the chart, not all of them + // .enter() + // .append("circle") + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + // .attr("r", 2) + // .style("fill", "#69b3a2") + // .style("opacity", 0.1) + // .style("stroke", "white") + // .on("mouseover", mouseover ) + // .on("mousemove", mousemove ) + // .on("mouseleave", mouseleave ); + + + // // svg.selectAll("circle") + // d3.select("#dataviz_area") + // .on("mouseover", project_y_axis ) + // // .on("mousemove", mousemove ) + // .on("mouseleave", twoDPlot ); + + + + // d3.select("#next") + // .on("mouseover", mouseover ) + // .on("mouseleave", mouseleave ); + + // click + // d3.select("#next") + // .on("click", function() { + // console.log("click"); + + + // }); + + + + // d3.select("#projectxaxia") + // // .on("mousemove", mousemove ) + // .on("click", project_x_axis ); + + + d3.select("#projectyaxia") + // .on("mousemove", mousemove ) + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + // .on("mouseover", function() { + // console.log("mouseover_next"); + + // }); + .on("click", twoDPlot); + + + + d3.select("#rotateprojectxaxia") + // .on("mousemove", mousemove ) + .on("click", rotate_project_on_x_axis); + + + + + // select all rectangles and make opacity 0 + // svg.selectAll("rect") + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + // .attr('opacity',0) + + // select all rectangles that have class attr is "class 0" + + + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + + + + + // d3.select("#rotateprojectxaxia") + // // .on("mousemove", mousemove ) + // .on("click", project_x_axis ); + + + }) + + // if user mouse over the dot, show the class + + + + + + + + + + + + + +} + + + + + + + + +function boxplot_direct_from_y() { + + + + // set the dimensions and margins of the graph + // var margin = {top: 30, right:30, bottom: 30, left: 0}, + // width = 400 - margin.left - margin.right, + // height = 300 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + // append the svg object to the body of the page + // var svg = d3.select("#dataviz_area") + // .append("svg") + // .attr("width", width + margin.left + margin.right) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", + // "translate(" + margin.left + "," + margin.top + ")") + + d3 = d3version4 + console.log("inside!!!!_d3version4") + console.log(d3.version) + + console.log("inside!!!!_d3v3") + console.log(d3v3.version) + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-25 -15 500 400`) + + // .attr("viewBox", "0 0 " + width + " " + height ) + + //Read the data + // "data/datasets/pmlb_small/iris/iris_Comma.csv" + // "data/datasets/pmlb_small/iris/iris_two_classes.csv" + + + d3.csv("data/datasets/pmlb_small/iris/iris_Comma.csv", function (data) { + + + // console.log(data) + + // 0:Setosa, + // Virginica + // Versicolor + + // Add X axis + var x = d3.scaleLinear() + .domain([0, 0]) + // get width from viewbox width + .range([0, width]); + + svg.append("g") + .attr("class", "myXaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0," + height + ")") + .attr("transform", "translate(0," + height + ")") + .call(d3.axisBottom(x)) + .attr("opacity", "0") + + // show white axis + .attr("stroke", "white") + + // Add Y axis + var y = d3.scaleLinear() + // .domain([0, 9]) + .domain([4, 8.5]) + // .domain([0, 0]) + .range([height, 0]); + + + // svg.append("g") + // .call(d3.axisLeft(y)) + + svg.append("g") + .attr("class", "myYaxis") // Note that here we give a class to the X axis, to be able to call it later and modify it + // .attr("transform", "translate(0, 0)") + // .attr("transform", "translate"+"(" + width +",0" + ")") + // .attr("transform", "translate"+"(" + -width +",0" + ")") + // .attr("transform", "translate(0," + width + ")") + .attr("transform", "translate(0," + "0" + ")") + .call(d3.axisLeft(y)) + .attr("opacity", "1") + .attr("stroke", "white"); + + + + // draw triangles 4, 8.5 + // i=0; + // while (i<=2) { + // svg.append("path") + // .attr("d", d3.symbol().type(d3.symbolTriangle).size(100)) + // // .attr("transform", function(d) { return "translate(" + x(0) + "," + 120+i + ")"; }) + // // .attr("transform", "rotate(90)") + // // rotate and translate + // .attr("transform", "rotate(90) translate(" + x(0) + "," + y(4+i) + ")") + // // .attr("transform", function(d) { return "translate(" + x(0) + "," + y(4+i) + ") rotate(90)"; }) + // .attr("fill", "black") + // .attr("opacity", "0.5") + // .attr("id", "triangle" + i) + + + // i+=30 + // } + + // translate(-1,119.7666625976562510) + // translate(1,238.7666625976562510) + + + + + + // Add dots + svg.append('g') + .selectAll("dot") + .data(data) + .enter() + .append("rect") + // sepal-length', 'sepal-width', 'petal-length', 'petal-width + + + // best + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { return locationByColorClass(d['class']) }) + // .attr("x", function(d){ return x(d['petal-length']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + + .attr("rx", 3) + .attr("ry", 3) + .attr("width", 5) + .attr("height", 5) + .attr("class", function (d) { return "class " + d['class'] }) + .style("fill", "#69b3a2") + // opacity + .attr("opacity", "0.3") + + // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + + + svg.selectAll("rect") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + // .attr("x", function (d) { return x(0)+165; } ) + .attr("x", function (d) { + console.log("x", x(d['petal-length'])) + return locationByColorClass(d['class']) + }) + // .attr("y", function (d) { return y(d['sepal-length']); } ) + // .attr("x", function(d){ return x(d['petal-length']) }) + .attr("y", function (d) { return y(d['sepal-length']); }) + .attr("rx", 0) + .attr("ry", 0) + .attr("width", 30) + .attr("height", 5) + + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }) + .attr("opacity", "0.5") + + + + var num_rect = svg.selectAll("rect").size(); + console.log("num_rect: ", num_rect) + // + + + + + + + + + + + + + var project_x_axis = function (d) { + + console.log("project_x_axis"); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(0); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + var project_y_axis = function (d) { + + // console.log("mouseover"); + + remove_boundaries_on2d_plot(); + + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + + + // make each circle access to the axis + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 10) }) + .duration(1000) + + .attr("cx", function (d) { return x(0); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + + + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + + + + var barchart = function (d) { + + console.log("rotate_project_on_x_axis"); + + + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + // y.domain([0, 10]) + // svg.select(".myYaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "0") + // .call(d3.axisLeft(y)); + + + // x.domain([4,8.5]) + x.domain([4, 8.5]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "0") + .call(d3.axisBottom(x)); + + + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + + + + + + + + + // calculate frequency of each class by data[1]['sepal-length'] + var frequency_class1 = {}; + var frequency_class2 = {}; + var frequency_class3 = {}; + + for (var i = 0; i < data.length; i++) { + // data[i]['class'] == '0' + + + if (data[i]['class'] == '0') { + // add count to frequency_class1[data[i]['sepal-length']] + if (frequency_class1[data[i]['sepal-length']] == undefined) { + frequency_class1[data[i]['sepal-length']] = 1; + } + else { + frequency_class1[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '1') { + // add count to frequency_class2[data[i]['sepal-length']] + if (frequency_class2[data[i]['sepal-length']] == undefined) { + frequency_class2[data[i]['sepal-length']] = 1; + } + else { + frequency_class2[data[i]['sepal-length']] += 1; + } + } + else if (data[i]['class'] == '2') { + // add count to frequency_class3[data[i]['sepal-length']] + if (frequency_class3[data[i]['sepal-length']] == undefined) { + frequency_class3[data[i]['sepal-length']] = 1; + } + else { + frequency_class3[data[i]['sepal-length']] += 1; + } + } + + + + + } + + + + + // console.log(frequency_class1[4.3]); + console.log(frequency_class1); + // get all keys of frequency_class1 + var keys_1 = Object.keys(frequency_class1); + console.log(frequency_class2); + var keys_2 = Object.keys(frequency_class2); + console.log(frequency_class3); + var keys_3 = Object.keys(frequency_class3); + + // set union keys_1, keys_2, keys_3 + var keys = keys_1.concat(keys_2, keys_3); + keys = [...new Set(keys)]; + // sort keys + keys.sort(function (a, b) { return a - b }); + console.log("keys:", keys); + // show length of keys + console.log("length of keys:", keys.length); + + + // print if frequency_class1 + + //show how many rectangles exist + console.log("number of rectangles:", svg.selectAll("rect").size()); + + // remove any rectangles if the keys.length is less than the number of rectangles + // that is, for example, if keys.length is 35, only 35 rectangles should be shown + // when rectangles are removed, make it fade out + + if (keys.length < svg.selectAll("rect").size()) { + + + console.log("remove rectangles"); + // svg.selectAll("rect") + // .data(keys) + // .transition() + // .duration(1000) + // .attr("opacity", "0") + // .remove(); + console.log("after number of rectangles:", svg.selectAll("rect").size()); + + + + + svg.selectAll("rect") + .data(keys) + .exit() + .remove(); + + + + + + + + + + } + + + + + + + // rotate 90 degree of rectangles + svg.selectAll("rect") + // .attr('opacity',0) + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(0); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // .attr('transform', 'translate(400,100)rotate(90)') + // .attr('transform', 'translate(300,100) rotate(90)') + // .attr('transform', 'translate(400,100)') + // .attr('transform', 'rotate(90)') + // .attr('transform', 'translate(100,400)rotate(-90)') + // .attr('transform', 'rotate(-90)translate(10,200)') + .attr('opacity', 0.5) + // .attr("x", function(d){ return x(0) }); + .transition() + .delay(function (d, i) { return (i * 5) }) + .duration(1000) + .attr("x", function (d) { + // console.log("x(6)") + // console.log(x(6)) + return x(4); + }) + // console.log("mouseover"); + // tooltip + // .style("opacity", 1) + + + // console.log(data[1]['petal-length']); + // console.log(data[1]['sepal-length']); + + + // console.log(data); + // console.log(data[1]['sepal-length']); + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 0" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class1[keys_1[i]]) + return 20 * frequency_class1[keys_1[i]] + }) + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 1" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class2[keys_2[i]]) + return 20 * frequency_class2[keys_2[i]] + + }) + + + + + + svg.selectAll("rect") + // // get each rectangle's class attribute + .filter(function (d, i) { return d3.select(this).attr("class") == "class 2" }) + // .transition() + // .delay(function(d,i){return(i*10)}) + // .duration(1000) + + // // change each rectangle's height based on frequency_class3 dictionary + .attr("width", function (d, i) { + + console.log(frequency_class3[keys_3[i]]) + return 20 * frequency_class3[keys_3[i]] + + }) + + + + + // plot rectangles based on frequency_class1, frequency_class2, frequency_class3 + // each rectangle has height frequency_class1 + // each rectangle has width 0.5 + // each rectangle has x = data[i]['sepal-length'] + + + + + // plot rectangles based on the frequency + + + + + + + + // console.log(trial_mouseover) + // if (trial_mouseover>5) + // { + // // new X axis + // x.domain([0,9]) + // svg.select(".myXaxis") + // .transition() + // .duration(2000) + // .attr("opacity", "1") + // .call(d3.axisBottom(x)); + + + + // svg.selectAll("circle") + // .transition() + // .delay(function(d,i){return(i*3)}) + // .duration(1000) + + // .attr("cx", function (d) { return x(d['petal-length']); } ) + // .attr("cy", function (d) { return y(d['sepal-length']); } ) + + // // give color to the dots based on the class + // .style("fill", function(d){ return colorClass(d['class']) }); + // } + + + + } + + var mousemove = function (d) { + console.log("mousemove"); + // tooltip + // .html("The exact value of
the Ground Living area is: " + d['sepal-length']) + // .style("left", (d3.mouse(this)[0]+90) + "px") // It is important to put the +90: other wise the tooltip is exactly where the point is an it creates a weird effect + // .style("top", (d3.mouse(this)[1]) + "px") + } + + var mouseover = function (d) { + console.log("mouseover y axis"); + } + + var showboundaries = function (d) { + + // check there are d3.symbolCircle or not + // if there are d3.symbolCircle, then change the candicate_points. + + + + + + + + // translate(-1,119.7666625976562510) + // translate(1,238.7666625976562510) + + candiate_points = [ + [1, 176], + [1, 240], + [1, 112], + [1, 264] + ] + + for (i = 0; i < candiate_points.length; i++) { + svg.append("path") + .attr("d", d3.symbol().type(d3.symbolCircle).size(95)) + .attr("transform", function (d) { + console.log("x point", d3.mouse(this)[0]) + console.log("y point", d3.mouse(this)[1]) + return "translate(" + candiate_points[i][0] + "," + candiate_points[i][1] + ")"; + }) + // show fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + // .style("opacity", 0.5) + .style("opacity", function (d) { + if (i / 2 < 1) { + return 0.5 + } + else if (i / 2 >= 1) { + return 0 + } + }) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + // .attr("class", "circle_symbol_indicator") + .attr("id", "indicator" + i) + .attr("class", function (d) { + if (i / 2 < 1) { + return "circle_symbol_indicator_first" + } + else if (i / 2 >= 1) { + return "circle_symbol_indicator_second" + } + + }) + + // make rectangles + svg.append("rect") + .attr("x", 0) + .attr("y", 0) + .attr("width", 0) + .attr("height", 0) + .attr("transform", function (d) { + return "translate(" + candiate_points[i][0] + "," + candiate_points[i][1] + ")"; + } + ) + .style("opacity", 0) + .transition() + .duration(2000) + // .style("opacity", 0.5) + .style("opacity", function (d) { + if (i / 2 < 1) { + return 0.5 + } + else if (i / 2 >= 1) { + return 0 + } + }) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + // .attr("class", "rect_indicator") + .attr("id", "indicator") + .attr("class", function (d) { + if (i / 2 < 1) { + return "rect_indicator_first" + } + else if (i / 2 >= 1) { + return "rect_indicator_second" + } + }) + .attr("width", 500) + .attr("height", 0.5) + // .attr("x", -50) + // .attr("y", -50) + + + + + } + // svg.append("path") + // // .attr("d", d3.symbol().type(d3.symbolDiamond).size(95)) + // .attr("d", d3.symbol().type(d3.symbolCircle).size(95)) + // .attr("transform", function(d) { + // console.log("x point",d3.mouse(this)[0]) + // console.log("y point",d3.mouse(this)[1]) + // return "translate(" + 1+ "," + 200 + ")"; + // }) + // .style("fill", "black") + // .style("stroke", "black") + // .style("stroke-width", 1) + // .style("opacity", 0.5) + // .attr("class", "tri_temp") + + + + + + + + } + + + + + var showboundariesSecondBound = function (d) { + + console.log("showboundariesSecondBound") + + // circle_symbol_indicator_first + // rect_indicator_first + // make class circle_symbol_indicator_first and rect_indicator_first to fade away + d3.selectAll(".circle_symbol_indicator_first") + .transition() + .duration(2000) + .style("opacity", 0) + .style("fill", "red") + .style("stroke", "red") + .style("stroke-width", 1) + + + d3.selectAll(".rect_indicator_first") + .transition() + .duration(2000) + .style("opacity", 0) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + + + + + d3.selectAll(".circle_symbol_indicator_second") + .transition() + .duration(2000) + .style("opacity", 0.5) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + + + d3.selectAll(".rect_indicator_second") + .transition() + .duration(2000) + .style("opacity", 0.5) + // .style("fill", "red") + // .style("stroke", "red") + .style("fill", "#CDD7E0") + .style("stroke", "#CDD7E0") + .style("stroke-width", 1) + + + + } + + + var showpiechart_v1 = function (d) { + console.log("showpiechart") + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var svg = d3.select("#dataviz_area_div_second") + .append("svg") + .attr("id", "dataviz_area_div_svg_second") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-200 -180 500 400`) + + + // generate random + + // show pie chart + var data_pc = [10, 20, 100]; + + // var width = 960, + // height = 500, + // radius = Math.min(width, height) / 2; + + // var width = 960, + // height = 500, + var radius = Math.min(width, height) / 3; + + + var color = d3.scaleOrdinal() + .range(["#98abc5", "#8a89a6", "#7b6888"]); + + var arc = d3.arc() + .outerRadius(radius - 10) + .innerRadius(0); + + var labelArc = d3.arc() + .outerRadius(radius - 40) + .innerRadius(radius - 40); + + var pie = d3.pie() + .sort(null) + .value(function (d) { return d; }); + + + + var g = svg.selectAll(".arc") + .data(pie(data_pc)) + .enter() + .append("g") + // // show fade in effect + // // .style("opacity", 1) + // .style("opacity", 0) + // .transition() + // .duration(2000) + .style("opacity", 0) + .attr("class", "arc") + .attr("id", "first_piechart"); + + g.append("path") + .attr("d", arc) + .style("fill", function (d) { return color(d.data); }); + + g.append("text") + // fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + .attr("transform", function (d) { return "translate(" + labelArc.centroid(d) + ")"; }) + .attr("dy", ".35em") + .text(function (d) { return d.data; }); + + // fade in effect + g.style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + + + + + } + + var showpiechart_v1_reset = function (d) { + console.log("showpiechart") + + + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 500 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + // remove all under svg id = dataviz_area_div_svg_second with fade out effect + d3.select("#dataviz_area_div_svg_second") + .selectAll("*") + .transition() + .duration(2000) + .style("opacity", 0) + .remove() + + // remove svg id = dataviz_area_div_svg_second + d3.select("#dataviz_area_div_svg_second") + .remove() + + + // d3.select("#dataviz_area_div_svg_second").selectAll("*").remove(); + + + + + + var svg = d3.select("#dataviz_area_div_second") + .append("svg") + .attr("id", "dataviz_area_div_svg_second") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("viewBox", `-25 -15 400 250`) + .attr("viewBox", `-200 -180 500 400`) + + + // generate random + + // show pie chart + var data_pc = [30, 10, 90]; + + // var width = 960, + // height = 500, + // radius = Math.min(width, height) / 2; + + // var width = 960, + // height = 500, + var radius = Math.min(width, height) / 3; + + + var color = d3.scaleOrdinal() + .range(["#98abc5", "#8a89a6", "#7b6888"]); + + var arc = d3.arc() + .outerRadius(radius - 10) + .innerRadius(0); + + var labelArc = d3.arc() + .outerRadius(radius - 40) + .innerRadius(radius - 40); + + var pie = d3.pie() + .sort(null) + .value(function (d) { return d; }); + + + + + + + + var g = svg.selectAll(".arc") + .data(pie(data_pc)) + .enter() + .append("g") + // // show fade in effect + // // .style("opacity", 1) + // .style("opacity", 0) + // .transition() + // .duration(2000) + .style("opacity", 0) + .attr("class", "arc") + .attr("id", "first_piechart"); + + g.append("path") + .attr("d", arc) + .style("fill", function (d) { return color(d.data); }); + + g.append("text") + // fade in effect + .style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + .attr("transform", function (d) { return "translate(" + labelArc.centroid(d) + ")"; }) + .attr("dy", ".35em") + .text(function (d) { return d.data; }); + + // fade in effect + g.style("opacity", 0) + .transition() + .duration(2000) + .style("opacity", 1) + + // make pie chart fade effecy when change the data of the pie chart + // d3.selectAll("#first_piechart") + // .transition() + // .duration(2000) + // .style("opacity", 0) + // .remove() + + + + + + + + // var data_pc_second = [25, 100, 10]; + + + // var g = svg.selectAll(".arc") + // .data(pie(data_pc_second)) + // .enter() + // .append("g") + // // // show fade in effect + // // // .style("opacity", 1) + // // .style("opacity", 0) + // // .transition() + // // .duration(2000) + // .style("opacity", 0) + // .attr("class", "arc") + // .attr("id","first_piechart"); + + // g.append("path") + // .attr("d", arc) + // .style("fill", function(d) { return color(d.data); }); + + // g.append("text") + // // fade in effect + // .style("opacity", 0) + // .transition() + // .duration(2000) + // .style("opacity", 1) + // .attr("transform", function(d) { return "translate(" + labelArc.centroid(d) + ")"; }) + // .attr("dy", ".35em") + // .text(function(d) { return d.data; }); + + // // fade in effect + // g.style("opacity", 0) + // .transition() + // .duration(2000) + // .style("opacity", 1) + + + } + + var showpiechart_v2 = function (d) { + console.log("showpiechart") + + + + + + + + + + } + + var showdonumchart = function (d) { + + var dataset = { + apples: [53245, 28479, 19697, 24037, 40245], + oranges: [200, 200, 200, 200] + }; + + var width = 960, + height = 500, + radius = Math.min(width, height) / 2; + + var enterClockwise = { + startAngle: 0, + endAngle: 0 + }; + + var enterAntiClockwise = { + startAngle: Math.PI * 2, + endAngle: Math.PI * 2 + }; + + var color = d3.scale.category20(); + + var pie = d3.layout.pie() + .sort(null); + + var arc = d3.svg.arc() + .innerRadius(radius - 100) + .outerRadius(radius - 20); + + var svg = d3.select('#Donut-chart').append('svg') + .attr('id', 'Donut-chart-render') + .attr("width", '100%') + .attr("height", '100%') + .attr('viewBox', (-width / 2) + ' ' + (-height / 2) + ' ' + width + ' ' + height) + .attr('preserveAspectRatio', 'xMinYMin') + + var path = svg.selectAll("path") + .data(pie(dataset.apples)) + .enter().append("path") + .attr("fill", function (d, i) { return color(i); }) + .attr("d", arc(enterClockwise)) + .each(function (d) { + this._current = { + data: d.data, + value: d.value, + startAngle: enterClockwise.startAngle, + endAngle: enterClockwise.endAngle + } + }); + + path.transition() + .duration(750) + .attrTween("d", arcTween); + + d3.selectAll("input").on("change", change); + + var timeout = setTimeout(function () { + d3.select("input[value=\"oranges\"]").property("checked", true).each(change); + }, 2000); + + function change() { + clearTimeout(timeout); + path = path.data(pie(dataset[this.value])); + path.enter().append("path") + .attr("fill", function (d, i) { + return color(i); + }) + .attr("d", arc(enterAntiClockwise)) + .each(function (d) { + this._current = { + data: d.data, + value: d.value, + startAngle: enterAntiClockwise.startAngle, + endAngle: enterAntiClockwise.endAngle + }; + }); // store the initial values + + path.exit() + .transition() + .duration(750) + .attrTween('d', arcTweenOut) + .remove() // now remove the exiting arcs + + path.transition().duration(750).attrTween("d", arcTween); // redraw the arcs + } + + function arcTween(a) { + var i = d3.interpolate(this._current, a); + this._current = i(0); + return function (t) { + return arc(i(t)); + }; + } + function arcTweenOut(a) { + var i = d3.interpolate(this._current, { startAngle: Math.PI * 2, endAngle: Math.PI * 2, value: 0 }); + this._current = i(0); + return function (t) { + return arc(i(t)); + }; + } + + + function type(d) { + d.value = +d.value; + return d; + } + + } + + var test = function (d) { + console.log("test"); + } + + + var thickyaxis = function (d) { + // make it thicker when mouse over on y axis class myYaxis + d3.select(".myYaxis") + .style("stroke-width", 3) + .style("opacity", 1) + } + + + var normalyaxis = function (d) { + // make it thicker when mouse over on y axis class myYaxis + d3.select(".myYaxis") + .style("stroke-width", 1) + .style("opacity", 1) + } + + + // A function that change this tooltip when the leaves a point: just need to set opacity to 0 again + var twoDPlot = function (d) { + console.log("mouseleave"); + + x.domain([0, 9]) + svg.select(".myXaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisBottom(x)); + + y.domain([0, 10]) + svg.select(".myYaxis") + .transition() + .duration(2000) + .attr("opacity", "1") + .call(d3.axisLeft(y)); + + + + svg.selectAll("circle") + .transition() + .delay(function (d, i) { return (i * 3) }) + .duration(1000) + + .attr("cx", function (d) { return x(d['petal-length']); }) + .attr("cy", function (d) { return y(d['sepal-length']); }) + + // give color to the dots based on the class + .style("fill", function (d) { return colorClass(d['class']) }); + + // tooltip + // .transition() + // .duration(200) + // .style("opacity", 0) + } + + + + + d3.select("#projectyaxia") + .on("click", project_y_axis); + + + + d3.select("#twoDPlot") + .on("click", twoDPlot); + + + + // d3.select("#rotateprojectxaxia") + // .on("click", rotate_project_on_x_axis ); + + + + d3.select("#rotateprojectxaxia") + .on("click", barchart); + + + + // mouse over on the class myYaxis + d3.select(".myYaxis") + .on("mouseover", thickyaxis) + .on("mouseout", normalyaxis) + .on("click", showboundaries) + .on("dblclick", showpiechart_v1); + + + d3.select("#show_piechart") + .on("click", showpiechart_v1); + + d3.select("#show_piechart_another") + // .on() + // .on("click", showpiechart_v1 ) + .on("click", showpiechart_v1_reset); + // .on("click", showpiechart_v2 ); + // .on("click", showdonumchart ); + // .on("click", test ); + + + // if select fbbfirsttosecondbound + d3.select("#fbbfirsttosecondbound") + .on("click", showboundariesSecondBound) + // .on("click", showpiechart ); + // .on("click", test ); + + + + + + + + + + }) + + + + + + + + + +} + + + + +function decisiontree() { + + d3=d3v3 + + + var label_names; + + var TOTAL_SIZE; + // default_colors = [ + // "#c25975", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + + + default_colors = [ + "#74BFA1", "#E37852", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + ] + + + + // default_colors = [ + // "#18dcdc", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#c25975", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + // differnt combination of colors + // default_colors = + + + + + //************************************* Options******************************************************// + + // var file_name = "structureC1.json" // generator_1 + // var file_namev2 = "structureC2_origin.json" // generator_2 + + var file_name = "structure_iris_dc_1.json" // generator_1 + var file_namev2 = "structure_iris_dc_1.json" // generator_2 + + // var file_name = "structure_iris_dc_1_80_size.json" // generator_1 + // var file_namev2 = "structure_iris_dc_1_80_size.json" // generator_2 + + // var file_name = "structure.json" // generator_1 + // var file_namev2 = "structure.json" // generator_2 + var version2 = true // if true json from generator_2 will be used + + + var tree_branch = false // if the thickness of the branches depend on the value of targt + color * / + var tree_branch_parent = true // true: thickness from the root if not the direct parent + // var tree_branch_color = "black" + + var tree_branch_color = "#A3A6A8" + var strokeness = 120 // the degree of separation between the nodes + var default_strokeness = 50 + var hover_percent_parent = false // if the display percentage depends on the direct parent or the root + var square = false + var rect_percent = true //display the percentage or the value in the small rectangles of the labels + var value_percent_top = true /// if we display the value and the percentage above the rectangle / + + var dict_leaf_y = { 1: 0, 2: -17.5, 3: -35, 4: -52.5, 5: -70, 6: -87.5, 6: -105, 7: -122.5, 8: -140, 9: -157.5, 10: -175 } + + + /****************************************************************************************************** */ + + + + + getDepth = function (obj) { + var depth = 0; + if (obj.children) { + obj.children.forEach(function (d) { + var tmpDepth = getDepth(d) + if (tmpDepth > depth) { + depth = tmpDepth + } + }) + } + return 1 + depth + } + + + // var margin = { top: 20, right: 120, bottom: 20, left: 180 }, + // width = 2000 + 960 - margin.right - margin.left, + // height = 800 - margin.top - margin.bottom; + + // current + // var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + // width = 500 - margin.left - margin.right, + // height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var i = 0, + duration = 550, + root; + + var tree + var diagonal + var svg + + var filetochoose = version2 ? file_namev2 : file_name + + d3.json(filetochoose, function (error, flare) { + if (error) throw error; + + console.log(getDepth(flare)) + + + tree = d3.layout.tree() + .separation(function (a, b) { return ((a.parent == root) && (b.parent == root)) ? strokeness : strokeness; }) + .size([height, getDepth(flare) * width / 8]); + + diagonal = d3.svg.diagonal() + .projection(function (d) { return [d.y, d.x]; }); + + // svg = d3.select("body").append("svg") + // .attr("width", getDepth(flare) * width / 8 + margin.right + margin.left) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + + + svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + + + TOTAL_SIZE = flare.size + l = flare.pred.replace(/of/g, "").split(', ') + for (var j = 0; j < l.length; j++) { + l[j] = l[j].split(' ')[2] + } + label_names = l + + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root, l.length); + // createLabels(l); + }); + + d3.select(self.frameElement).style("height", "480px"); + + function update(source, n_labels) { + + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + tpaths = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function (d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function (d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function (d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function (d) { + + return d._children ? "lightsteelblue" : "#fff"; + }); + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.name+' '+d.pred : d.name; }) + // .style("fill-opacity", 1e-6); + + function getTextWidth(text, fontSize, fontFace) { + var a = document.createElement('canvas'); + var b = a.getContext('2d'); + b.font = fontSize + 'px ' + fontFace; + return b.measureText(text).width; + } + + + + var rect = nodeEnter.append("rect") + .attr("width", 133 + 8) + .attr("height", 70) + .attr("x", -80) + .attr("y", -80) + .attr("rx", 6) + .attr("ry", 6) + .style("fill", function (d) { return (d.children || d._children) || version2 ? "#f0f0f0" : "#ffffff" }) + .style("stroke", function (d) { return (d.children || d._children) || version2 ? "rgb(155, 155, 155)" : "#ffffff" }) + .style("visibility", function (d) { return (d.children || d._children) || version2 ? "visible" : "hidden" }) + + nodeEnter.append("svg:image") + .attr("xlink:href", function (d) { return ((d.children || d._children) || version2) && d.type == 'categorical' ? 'http://fractalytics.io/wp-content/uploads/2019/05/cat.png' : 'http://fractalytics.io/wp-content/uploads/2019/05/num.png' }) + .attr("x", "-76") + .attr("y", "-74") + .attr("width", "20") + .attr("height", "20") + .style("visibility", function (d) { + if (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? 'hidden' : 'visible' + } + else return (d.children || d._children) || version2 ? "visible" : "hidden" + }); + + nodeEnter.append("text") + .attr("x", function (d) { + ttr = 13 + if (default_colors.length > 5) { + ttr = (40 * default_colors.length) / 2 + } + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%", 10, 'Verdana') + 5.7) - (133 + 8)) / 2 : ttr + }) + .attr("y", function (d) { + ttr = dict_leaf_y[label_names.length] - 15 + if (default_colors.length > 5) { + ttr = -20 + } + return (d.children || d._children) || version2 ? -87 : ttr; + + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "10px") + .style("font-family", "Verdana") + .style("stroke", "#c2c2c2") + .style("stroke-width", "0.05em") + .text(function (d) { return true ? d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%" : ""; }) + .attr('visibility', function () { + return value_percent_top ? 'visible' : 'hidden' + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { + if (((d.children || d._children) || version2) && d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 11) { + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + } + else return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].substring(0, 11), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + }) + .attr("y", function (d) { + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return -65 + else return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? -55 : -65 + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "14px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.05em") + + .text(function (d) { + if ((d.children || d._children) || version2) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 15 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1]).substring(0, 13) + '..' + + } + else return ""; + }) + .append('svg:title') + .text(function (d) { + return (d.children || d._children) || version2 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : "" + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('=', ''), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 }) + .attr("y", -45) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "12px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.04em") + .text(function (d) { + + var toreturn = (d.children || d._children) || version2 ? d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('!=', 'not').replace(/=|\!=/g, '').replace('<', '<=') : ""; + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return toreturn + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? '' : toreturn + }) + + + var labels_w = 133 / n_labels + for (var j = 0; j < n_labels; j++) { + var curr = j + + + + nodeEnter.append("rect") + .attr("width", function (d) { + var v; + if (d.pred) { + console.log(parseInt(d.pred.split(",")[curr].match(/\d+/)[0]), ' *133/', d.size) + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 133 / d.size; + } + else if (!d.children) { + v = 40 + } + + if (square) return (d.children || d._children) || version2 ? 133 / label_names.length - 4 : 40 + else return (d.children || d._children) || version2 ? v : 40 + }) + .attr("height", 20) + .attr('rx', function (d) { return square ? 0 : 4 }) + .attr('ry', function (d) { return square ? 0 : 4 }) + .attr("x", function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 13 + if (default_colors.length > 5) { + ttr = 10 + j * 45 + } + + + if (square) return (d.children || d._children) || version2 ? -76 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -76 + ttl : ttr + }) + .attr("y", (function (d) { + console.log(default_colors.length) + if (default_colors.length > 5) { + return (d.children || d._children) || version2 ? -34 : -10 + } else return (d.children || d._children) || version2 ? -34 : dict_leaf_y[label_names.length] - 4 + 20 * j + j * 4; + })) + .style("fill", function (d) { + if (default_colors.length == 0) { + return default_colors[j] + } else { + return default_colors[j] + } + + } + ) + .attr('visibility', function (d) { + + if (d.pred) { + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[curr].match(/\d+/)[0]); + v = v * 133 / d.size + return v != 0 || !d.children ? "visible" : "hidden" + }) + .attr('opacity', function (d) { + var val + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + val = (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + } + else if (!d.children) val = (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + return (d.children || d._children) || version2 ? 1 : val / 100 + 0.3 + + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + + + + + var subg = nodeEnter.append("g") + .attr("width", labels_w) + .attr("height", 20) + .attr("x", function (d) { + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + return -80 + ttl + + }) + .attr("y", -30) + + + subg.append("text") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + .attr("x", (function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 18 + if (default_colors.length > 5) { + ttr = 14 + j * 45 + } + + if (square) return (d.children || d._children) || version2 ? -71 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -71 + ttl : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 5 + } + + return (d.children || d._children) || version2 ? -19 : ttr; + + })) + .style("fill", "white") + .style("font-size", "12px") + .attr('visibility', function (d) { + if (d.pred && !square) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) > 20 ? "vivible" : "hidden" + } + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + subg.append('text') + .text(function (d) { + if (d.pred) { + return '' + } + else if (!d.children) { + return label_names[curr] + } + }) + .attr("x", (function (d) { + ttr = 60 + if (default_colors.length > 5) { + ttr = 18 + j * 45 + } + return (d.children || d._children) || version2 ? -66 + j * labels_w : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 25 + } + return (d.children || d._children) || version2 ? -15 : ttr; + })) + .style("font-size", "14px") + .style("fill", "rgb(78, 74, 74)") + .attr('transform', function (d) { + + return default_colors.length <= 5 ? '' : 'translate(' + (-30 + j * 20) + ',' + (10 + j * (-37)) + ') rotate(55 50 50)' + }) + + + + } + + + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.pred : ''; }) + // .style("fill-opacity", 1e-6) + + + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 10) + .style("fill", function (d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function (d) { return d.target.id; }); + + + if (tree_branch) var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, default_strokeness]); + else var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, 8]); + + var color = d3.scale.linear() + .domain([0, 50, 100]) + .range(["rgb(2, 255, 219)", "blue"]); + + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("id", function (d) { return d.target.id; }) + .attr("d", function (d) { + var o = { x: source.x0, y: source.y0 }; + return diagonal({ source: o, target: o }); + }) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }) + .style("stroke", function (d) { + + if (!d.target) { + return "#fff" + // return "#A3A6A8" + } + else return tree_branch_color; + }) + .append("svg:title") + .text(function (d, i) { + if (hover_percent_parent) { + var val = ((d.target.size / TOTAL_SIZE) * 100).toFixed(2); + } else { + var val = ((d.target.size / d.source.size) * 100).toFixed(2); + } + + return val + "%" + }) + + var tlink = svg.selectAll("text.tlink") + .data(tpaths, function (d) { return d.target.id; }); + + tlink.enter().insert("text", "g") + .attr("class", "tlink") + .attr("dy", function (d) { return d.target.side == "left" ? -10 : 15; }) + .append('textPath') + .attr("xlink:href", function (d) { return '#' + d.target.id; }) //place the ID of the path here + .style("text-anchor", "middle") //place the text halfway on the arc + .attr("startOffset", "45%") + .text(function (d) { return d.target.side == "left" ? "No" : "Yes"; }) + .attr('visibility', function (d) { return d.target.depth == 1 && !version2 ? 'visible' : 'hidden' }) + .attr("opacity", 0.5) + + + tlink.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }); + + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function (d) { + d.x0 = d.x; + d.y0 = d.y; + }); + + + // Toggle children on click. + function click(d) { + + // console.log("d", d) + // // d name has "petal width (cm) > 1.75" + + // var name = d.name; + // convert d.name to string + var name = d.name.toString(); + if (name.includes("petal width (cm) > 1.75")) { + // console.log("petal width (cm) > 1.75") + // dis-show mainDTcon + if (document.getElementById("mainDTcon").style.display == "none"){ + + document.getElementById("mainDTcon").style.display = "block"; + document.getElementById("mainDTfirst").style.display = "none"; + } + else { + document.getElementById("mainDTcon").style.display = "none"; + document.getElementById("mainDTfirst").style.display = "block"; + + } + + + } + // console.log("name", name) + + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d, n_labels); + } + + + } + + + + + function createLabels(labels) { + + + var Size = 400 + + + var svg1 = d3.select("body") + .append("svg") + .attr("width", Size) + .attr("height", Size) + .attr("class", "legends"); + + console.log(labels.length) + console.log(default_colors.slice(0, labels.length)) + default_colors = default_colors.slice(0, labels.length) + if (default_colors.length == 2) default_colors.push('') + if (default_colors.length == 0) { + var c_l = default_colors + } else { + var c_l = default_colors + } + + for (i = 0; i < c_l.length; i++) { + + console.log(labels[i], "", c_l[i]) + + var legendG = svg1 + .append("g") + .attr("transform", function (d) { + return "translate(" + 0 + "," + (30 * i + Size / 33 + Size / 50) + ")"; // place each legend on the right and bump each one down 15 pixels + }) + .attr("class", "legend"); + + legendG.append("rect") // make a matching color rect + .attr("width", 15) + .attr("height", 15) + .attr("fill", c_l[i]) + .style('visibility', function () { + return labels[i] ? "visible" : "hidden" + }) + + legendG.append("text") // add the text + .text(labels[i]) + .style("font-size", 30) + .attr("y", 12) + .attr("x", 21) + + } + + } +} + + + +function decisiontree_Version2(){ + + + d3=d3v3 + + // var margin = {top: 20, right: 120, bottom: 20, left: 180}, + // width = 960 - margin.right - margin.left, + // height = 480 - margin.top - margin.bottom; + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + +var i = 0, + duration = 750, + root; + +var tree = d3.layout.tree() + .size([height, width]); + +var diagonal = d3.svg.diagonal() + .projection(function(d) { return [d.y, d.x]; }); + +// var svg = d3.select("body").append("svg") +// .attr("width", width + margin.right + margin.left) +// .attr("height", height + margin.top + margin.bottom) +// .append("g") +// .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + var svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + +// d3.json("structure_iris_dc_2.json", function(error, flare) { + d3.json("structure_iris_dc_2.json", function(error, flare) { + if (error) throw error; + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root); +}); + +d3.select(self.frameElement).style("height", "480px"); + +function update(source) { + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function(d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function(d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function(d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function(d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeEnter.append("text") + .attr("x", function(d) { return d.children || d._children ? -10 : 10; }) + .attr("dy", ".35em") + .attr("text-anchor", function(d) { return d.children || d._children ? "end" : "start"; }) + .text(function(d) { return d.name; }) + .style("fill-opacity", 1e-6); + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function(d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 4.5) + .style("fill", function(d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function(d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function(d) { return d.target.id; }); + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("d", function(d) { + var o = {x: source.x0, y: source.y0}; + return diagonal({source: o, target: o}); + }); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal); + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function(d) { + var o = {x: source.x, y: source.y}; + return diagonal({source: o, target: o}); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function(d) { + d.x0 = d.x; + d.y0 = d.y; + }); +} + +// Toggle children on click. +function click(d) { + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d); +} + +} + + diff --git a/rapsberrypi/web/JSfiles/backgroundOverlayeffect.js b/rapsberrypi/web/JSfiles/backgroundOverlayeffect.js new file mode 100644 index 000000000..a26fb654c --- /dev/null +++ b/rapsberrypi/web/JSfiles/backgroundOverlayeffect.js @@ -0,0 +1,18 @@ +function on() { + document.getElementById("overlay").style.display = "block"; +} + +function off() { + document.getElementById("overlay").style.display = "block"; + } + + + + + + + +// wait until document.getElementById("overlay") is loaded +// then run the on() function + +document.getElementById("overlay").addEventListener("load", on()); diff --git a/rapsberrypi/web/JSfiles/carousel.js b/rapsberrypi/web/JSfiles/carousel.js new file mode 100644 index 000000000..25fb0e5f4 --- /dev/null +++ b/rapsberrypi/web/JSfiles/carousel.js @@ -0,0 +1,36 @@ +let slideIndex = 1; +showSlides(slideIndex); + +// Next/previous controls +function plusSlides(n) { + showSlides(slideIndex += n); +} + +// Thumbnail image controls +function currentSlide(n) { + showSlides(slideIndex = n); +} + +function showSlides(n) { + let i; + let slides = document.getElementsByClassName("mySlides"); + console.log("slides",slides); + let dots = document.getElementsByClassName("dot"); + if (n > slides.length) {slideIndex = 1} + if (n < 1) {slideIndex = slides.length} + for (i = 0; i < slides.length; i++) { + slides[i].style.display = "none"; + } + for (i = 0; i < dots.length; i++) { + dots[i].className = dots[i].className.replace(" active", ""); + } + +// wait until slides[(slideIndex - 1)] is defined + if (slides[(slideIndex - 1)]) { + slides[(slideIndex - 1)].style.display = "block"; + dots[(slideIndex - 1)].className += " active"; + } + +// slides[slideIndex-1].style.display = "block"; +// dots[slideIndex-1].className += " active"; +} \ No newline at end of file diff --git a/rapsberrypi/web/JSfiles/d3-3d.min.js b/rapsberrypi/web/JSfiles/d3-3d.min.js new file mode 100644 index 000000000..624542270 --- /dev/null +++ b/rapsberrypi/web/JSfiles/d3-3d.min.js @@ -0,0 +1 @@ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports):"function"==typeof define&&define.amd?define(["exports"],e):e((t="undefined"!=typeof globalThis?globalThis:t||self).d3={})}(this,function(t){"use strict";function g(t){var e=t.slice(0),r=0;e.push(e[0]);for(var o=0;o<=t.length-1;o++){var n=e[o].rotated,c=e[o+1].rotated;r+=(c.x-n.x)*(c.y+n.y)}return 0 b ? 1 : a >= b ? 0 : NaN; +} + +function bisector(compare) { + if (compare.length === 1) compare = ascendingComparator(compare); + return { + left: function(a, x, lo, hi) { + if (lo == null) lo = 0; + if (hi == null) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (compare(a[mid], x) < 0) lo = mid + 1; + else hi = mid; + } + return lo; + }, + right: function(a, x, lo, hi) { + if (lo == null) lo = 0; + if (hi == null) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (compare(a[mid], x) > 0) hi = mid; + else lo = mid + 1; + } + return lo; + } + }; +} + +function ascendingComparator(f) { + return function(d, x) { + return ascending(f(d), x); + }; +} + +var ascendingBisect = bisector(ascending); +var bisectRight = ascendingBisect.right; +var bisectLeft = ascendingBisect.left; + +function pairs(array, f) { + if (f == null) f = pair; + var i = 0, n = array.length - 1, p = array[0], pairs = new Array(n < 0 ? 0 : n); + while (i < n) pairs[i] = f(p, p = array[++i]); + return pairs; +} + +function pair(a, b) { + return [a, b]; +} + +function cross(values0, values1, reduce) { + var n0 = values0.length, + n1 = values1.length, + values = new Array(n0 * n1), + i0, + i1, + i, + value0; + + if (reduce == null) reduce = pair; + + for (i0 = i = 0; i0 < n0; ++i0) { + for (value0 = values0[i0], i1 = 0; i1 < n1; ++i1, ++i) { + values[i] = reduce(value0, values1[i1]); + } + } + + return values; +} + +function descending(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; +} + +function number(x) { + return x === null ? NaN : +x; +} + +function variance(values, valueof) { + var n = values.length, + m = 0, + i = -1, + mean = 0, + value, + delta, + sum = 0; + + if (valueof == null) { + while (++i < n) { + if (!isNaN(value = number(values[i]))) { + delta = value - mean; + mean += delta / ++m; + sum += delta * (value - mean); + } + } + } + + else { + while (++i < n) { + if (!isNaN(value = number(valueof(values[i], i, values)))) { + delta = value - mean; + mean += delta / ++m; + sum += delta * (value - mean); + } + } + } + + if (m > 1) return sum / (m - 1); +} + +function deviation(array, f) { + var v = variance(array, f); + return v ? Math.sqrt(v) : v; +} + +function extent(values, valueof) { + var n = values.length, + i = -1, + value, + min, + max; + + if (valueof == null) { + while (++i < n) { // Find the first comparable value. + if ((value = values[i]) != null && value >= value) { + min = max = value; + while (++i < n) { // Compare the remaining values. + if ((value = values[i]) != null) { + if (min > value) min = value; + if (max < value) max = value; + } + } + } + } + } + + else { + while (++i < n) { // Find the first comparable value. + if ((value = valueof(values[i], i, values)) != null && value >= value) { + min = max = value; + while (++i < n) { // Compare the remaining values. + if ((value = valueof(values[i], i, values)) != null) { + if (min > value) min = value; + if (max < value) max = value; + } + } + } + } + } + + return [min, max]; +} + +var array = Array.prototype; + +var slice = array.slice; +var map = array.map; + +function constant(x) { + return function() { + return x; + }; +} + +function identity(x) { + return x; +} + +function sequence(start, stop, step) { + start = +start, stop = +stop, step = (n = arguments.length) < 2 ? (stop = start, start = 0, 1) : n < 3 ? 1 : +step; + + var i = -1, + n = Math.max(0, Math.ceil((stop - start) / step)) | 0, + range = new Array(n); + + while (++i < n) { + range[i] = start + i * step; + } + + return range; +} + +var e10 = Math.sqrt(50); +var e5 = Math.sqrt(10); +var e2 = Math.sqrt(2); + +function ticks(start, stop, count) { + var reverse, + i = -1, + n, + ticks, + step; + + stop = +stop, start = +start, count = +count; + if (start === stop && count > 0) return [start]; + if (reverse = stop < start) n = start, start = stop, stop = n; + if ((step = tickIncrement(start, stop, count)) === 0 || !isFinite(step)) return []; + + if (step > 0) { + start = Math.ceil(start / step); + stop = Math.floor(stop / step); + ticks = new Array(n = Math.ceil(stop - start + 1)); + while (++i < n) ticks[i] = (start + i) * step; + } else { + start = Math.floor(start * step); + stop = Math.ceil(stop * step); + ticks = new Array(n = Math.ceil(start - stop + 1)); + while (++i < n) ticks[i] = (start - i) / step; + } + + if (reverse) ticks.reverse(); + + return ticks; +} + +function tickIncrement(start, stop, count) { + var step = (stop - start) / Math.max(0, count), + power = Math.floor(Math.log(step) / Math.LN10), + error = step / Math.pow(10, power); + return power >= 0 + ? (error >= e10 ? 10 : error >= e5 ? 5 : error >= e2 ? 2 : 1) * Math.pow(10, power) + : -Math.pow(10, -power) / (error >= e10 ? 10 : error >= e5 ? 5 : error >= e2 ? 2 : 1); +} + +function tickStep(start, stop, count) { + var step0 = Math.abs(stop - start) / Math.max(0, count), + step1 = Math.pow(10, Math.floor(Math.log(step0) / Math.LN10)), + error = step0 / step1; + if (error >= e10) step1 *= 10; + else if (error >= e5) step1 *= 5; + else if (error >= e2) step1 *= 2; + return stop < start ? -step1 : step1; +} + +function sturges(values) { + return Math.ceil(Math.log(values.length) / Math.LN2) + 1; +} + +function histogram() { + var value = identity, + domain = extent, + threshold = sturges; + + function histogram(data) { + var i, + n = data.length, + x, + values = new Array(n); + + for (i = 0; i < n; ++i) { + values[i] = value(data[i], i, data); + } + + var xz = domain(values), + x0 = xz[0], + x1 = xz[1], + tz = threshold(values, x0, x1); + + // Convert number of thresholds into uniform thresholds. + if (!Array.isArray(tz)) { + tz = tickStep(x0, x1, tz); + tz = sequence(Math.ceil(x0 / tz) * tz, Math.floor(x1 / tz) * tz, tz); // exclusive + } + + // Remove any thresholds outside the domain. + var m = tz.length; + while (tz[0] <= x0) tz.shift(), --m; + while (tz[m - 1] > x1) tz.pop(), --m; + + var bins = new Array(m + 1), + bin; + + // Initialize bins. + for (i = 0; i <= m; ++i) { + bin = bins[i] = []; + bin.x0 = i > 0 ? tz[i - 1] : x0; + bin.x1 = i < m ? tz[i] : x1; + } + + // Assign data to bins by value, ignoring any outside the domain. + for (i = 0; i < n; ++i) { + x = values[i]; + if (x0 <= x && x <= x1) { + bins[bisectRight(tz, x, 0, m)].push(data[i]); + } + } + + return bins; + } + + histogram.value = function(_) { + return arguments.length ? (value = typeof _ === "function" ? _ : constant(_), histogram) : value; + }; + + histogram.domain = function(_) { + return arguments.length ? (domain = typeof _ === "function" ? _ : constant([_[0], _[1]]), histogram) : domain; + }; + + histogram.thresholds = function(_) { + return arguments.length ? (threshold = typeof _ === "function" ? _ : Array.isArray(_) ? constant(slice.call(_)) : constant(_), histogram) : threshold; + }; + + return histogram; +} + +function threshold(values, p, valueof) { + if (valueof == null) valueof = number; + if (!(n = values.length)) return; + if ((p = +p) <= 0 || n < 2) return +valueof(values[0], 0, values); + if (p >= 1) return +valueof(values[n - 1], n - 1, values); + var n, + i = (n - 1) * p, + i0 = Math.floor(i), + value0 = +valueof(values[i0], i0, values), + value1 = +valueof(values[i0 + 1], i0 + 1, values); + return value0 + (value1 - value0) * (i - i0); +} + +function freedmanDiaconis(values, min, max) { + values = map.call(values, number).sort(ascending); + return Math.ceil((max - min) / (2 * (threshold(values, 0.75) - threshold(values, 0.25)) * Math.pow(values.length, -1 / 3))); +} + +function scott(values, min, max) { + return Math.ceil((max - min) / (3.5 * deviation(values) * Math.pow(values.length, -1 / 3))); +} + +function max(values, valueof) { + var n = values.length, + i = -1, + value, + max; + + if (valueof == null) { + while (++i < n) { // Find the first comparable value. + if ((value = values[i]) != null && value >= value) { + max = value; + while (++i < n) { // Compare the remaining values. + if ((value = values[i]) != null && value > max) { + max = value; + } + } + } + } + } + + else { + while (++i < n) { // Find the first comparable value. + if ((value = valueof(values[i], i, values)) != null && value >= value) { + max = value; + while (++i < n) { // Compare the remaining values. + if ((value = valueof(values[i], i, values)) != null && value > max) { + max = value; + } + } + } + } + } + + return max; +} + +function mean(values, valueof) { + var n = values.length, + m = n, + i = -1, + value, + sum = 0; + + if (valueof == null) { + while (++i < n) { + if (!isNaN(value = number(values[i]))) sum += value; + else --m; + } + } + + else { + while (++i < n) { + if (!isNaN(value = number(valueof(values[i], i, values)))) sum += value; + else --m; + } + } + + if (m) return sum / m; +} + +function median(values, valueof) { + var n = values.length, + i = -1, + value, + numbers = []; + + if (valueof == null) { + while (++i < n) { + if (!isNaN(value = number(values[i]))) { + numbers.push(value); + } + } + } + + else { + while (++i < n) { + if (!isNaN(value = number(valueof(values[i], i, values)))) { + numbers.push(value); + } + } + } + + return threshold(numbers.sort(ascending), 0.5); +} + +function merge(arrays) { + var n = arrays.length, + m, + i = -1, + j = 0, + merged, + array; + + while (++i < n) j += arrays[i].length; + merged = new Array(j); + + while (--n >= 0) { + array = arrays[n]; + m = array.length; + while (--m >= 0) { + merged[--j] = array[m]; + } + } + + return merged; +} + +function min(values, valueof) { + var n = values.length, + i = -1, + value, + min; + + if (valueof == null) { + while (++i < n) { // Find the first comparable value. + if ((value = values[i]) != null && value >= value) { + min = value; + while (++i < n) { // Compare the remaining values. + if ((value = values[i]) != null && min > value) { + min = value; + } + } + } + } + } + + else { + while (++i < n) { // Find the first comparable value. + if ((value = valueof(values[i], i, values)) != null && value >= value) { + min = value; + while (++i < n) { // Compare the remaining values. + if ((value = valueof(values[i], i, values)) != null && min > value) { + min = value; + } + } + } + } + } + + return min; +} + +function permute(array, indexes) { + var i = indexes.length, permutes = new Array(i); + while (i--) permutes[i] = array[indexes[i]]; + return permutes; +} + +function scan(values, compare) { + if (!(n = values.length)) return; + var n, + i = 0, + j = 0, + xi, + xj = values[j]; + + if (compare == null) compare = ascending; + + while (++i < n) { + if (compare(xi = values[i], xj) < 0 || compare(xj, xj) !== 0) { + xj = xi, j = i; + } + } + + if (compare(xj, xj) === 0) return j; +} + +function shuffle(array, i0, i1) { + var m = (i1 == null ? array.length : i1) - (i0 = i0 == null ? 0 : +i0), + t, + i; + + while (m) { + i = Math.random() * m-- | 0; + t = array[m + i0]; + array[m + i0] = array[i + i0]; + array[i + i0] = t; + } + + return array; +} + +function sum(values, valueof) { + var n = values.length, + i = -1, + value, + sum = 0; + + if (valueof == null) { + while (++i < n) { + if (value = +values[i]) sum += value; // Note: zero and null are equivalent. + } + } + + else { + while (++i < n) { + if (value = +valueof(values[i], i, values)) sum += value; + } + } + + return sum; +} + +function transpose(matrix) { + if (!(n = matrix.length)) return []; + for (var i = -1, m = min(matrix, length), transpose = new Array(m); ++i < m;) { + for (var j = -1, n, row = transpose[i] = new Array(n); ++j < n;) { + row[j] = matrix[j][i]; + } + } + return transpose; +} + +function length(d) { + return d.length; +} + +function zip() { + return transpose(arguments); +} + +var slice$1 = Array.prototype.slice; + +function identity$1(x) { + return x; +} + +var top = 1; +var right = 2; +var bottom = 3; +var left = 4; +var epsilon = 1e-6; + +function translateX(x) { + return "translate(" + (x + 0.5) + ",0)"; +} + +function translateY(y) { + return "translate(0," + (y + 0.5) + ")"; +} + +function number$1(scale) { + return function(d) { + return +scale(d); + }; +} + +function center(scale) { + var offset = Math.max(0, scale.bandwidth() - 1) / 2; // Adjust for 0.5px offset. + if (scale.round()) offset = Math.round(offset); + return function(d) { + return +scale(d) + offset; + }; +} + +function entering() { + return !this.__axis; +} + +function axis(orient, scale) { + var tickArguments = [], + tickValues = null, + tickFormat = null, + tickSizeInner = 6, + tickSizeOuter = 6, + tickPadding = 3, + k = orient === top || orient === left ? -1 : 1, + x = orient === left || orient === right ? "x" : "y", + transform = orient === top || orient === bottom ? translateX : translateY; + + function axis(context) { + var values = tickValues == null ? (scale.ticks ? scale.ticks.apply(scale, tickArguments) : scale.domain()) : tickValues, + format = tickFormat == null ? (scale.tickFormat ? scale.tickFormat.apply(scale, tickArguments) : identity$1) : tickFormat, + spacing = Math.max(tickSizeInner, 0) + tickPadding, + range = scale.range(), + range0 = +range[0] + 0.5, + range1 = +range[range.length - 1] + 0.5, + position = (scale.bandwidth ? center : number$1)(scale.copy()), + selection = context.selection ? context.selection() : context, + path = selection.selectAll(".domain").data([null]), + tick = selection.selectAll(".tick").data(values, scale).order(), + tickExit = tick.exit(), + tickEnter = tick.enter().append("g").attr("class", "tick"), + line = tick.select("line"), + text = tick.select("text"); + + path = path.merge(path.enter().insert("path", ".tick") + .attr("class", "domain") + .attr("stroke", "#000")); + + tick = tick.merge(tickEnter); + + line = line.merge(tickEnter.append("line") + .attr("stroke", "#000") + .attr(x + "2", k * tickSizeInner)); + + text = text.merge(tickEnter.append("text") + .attr("fill", "#000") + .attr(x, k * spacing) + .attr("dy", orient === top ? "0em" : orient === bottom ? "0.71em" : "0.32em")); + + if (context !== selection) { + path = path.transition(context); + tick = tick.transition(context); + line = line.transition(context); + text = text.transition(context); + + tickExit = tickExit.transition(context) + .attr("opacity", epsilon) + .attr("transform", function(d) { return isFinite(d = position(d)) ? transform(d) : this.getAttribute("transform"); }); + + tickEnter + .attr("opacity", epsilon) + .attr("transform", function(d) { var p = this.parentNode.__axis; return transform(p && isFinite(p = p(d)) ? p : position(d)); }); + } + + tickExit.remove(); + + path + .attr("d", orient === left || orient == right + ? "M" + k * tickSizeOuter + "," + range0 + "H0.5V" + range1 + "H" + k * tickSizeOuter + : "M" + range0 + "," + k * tickSizeOuter + "V0.5H" + range1 + "V" + k * tickSizeOuter); + + tick + .attr("opacity", 1) + .attr("transform", function(d) { return transform(position(d)); }); + + line + .attr(x + "2", k * tickSizeInner); + + text + .attr(x, k * spacing) + .text(format); + + selection.filter(entering) + .attr("fill", "none") + .attr("font-size", 10) + .attr("font-family", "sans-serif") + .attr("text-anchor", orient === right ? "start" : orient === left ? "end" : "middle"); + + selection + .each(function() { this.__axis = position; }); + } + + axis.scale = function(_) { + return arguments.length ? (scale = _, axis) : scale; + }; + + axis.ticks = function() { + return tickArguments = slice$1.call(arguments), axis; + }; + + axis.tickArguments = function(_) { + return arguments.length ? (tickArguments = _ == null ? [] : slice$1.call(_), axis) : tickArguments.slice(); + }; + + axis.tickValues = function(_) { + return arguments.length ? (tickValues = _ == null ? null : slice$1.call(_), axis) : tickValues && tickValues.slice(); + }; + + axis.tickFormat = function(_) { + return arguments.length ? (tickFormat = _, axis) : tickFormat; + }; + + axis.tickSize = function(_) { + return arguments.length ? (tickSizeInner = tickSizeOuter = +_, axis) : tickSizeInner; + }; + + axis.tickSizeInner = function(_) { + return arguments.length ? (tickSizeInner = +_, axis) : tickSizeInner; + }; + + axis.tickSizeOuter = function(_) { + return arguments.length ? (tickSizeOuter = +_, axis) : tickSizeOuter; + }; + + axis.tickPadding = function(_) { + return arguments.length ? (tickPadding = +_, axis) : tickPadding; + }; + + return axis; +} + +function axisTop(scale) { + return axis(top, scale); +} + +function axisRight(scale) { + return axis(right, scale); +} + +function axisBottom(scale) { + return axis(bottom, scale); +} + +function axisLeft(scale) { + return axis(left, scale); +} + +var noop = {value: function() {}}; + +function dispatch() { + for (var i = 0, n = arguments.length, _ = {}, t; i < n; ++i) { + if (!(t = arguments[i] + "") || (t in _)) throw new Error("illegal type: " + t); + _[t] = []; + } + return new Dispatch(_); +} + +function Dispatch(_) { + this._ = _; +} + +function parseTypenames(typenames, types) { + return typenames.trim().split(/^|\s+/).map(function(t) { + var name = "", i = t.indexOf("."); + if (i >= 0) name = t.slice(i + 1), t = t.slice(0, i); + if (t && !types.hasOwnProperty(t)) throw new Error("unknown type: " + t); + return {type: t, name: name}; + }); +} + +Dispatch.prototype = dispatch.prototype = { + constructor: Dispatch, + on: function(typename, callback) { + var _ = this._, + T = parseTypenames(typename + "", _), + t, + i = -1, + n = T.length; + + // If no callback was specified, return the callback of the given type and name. + if (arguments.length < 2) { + while (++i < n) if ((t = (typename = T[i]).type) && (t = get(_[t], typename.name))) return t; + return; + } + + // If a type was specified, set the callback for the given type and name. + // Otherwise, if a null callback was specified, remove callbacks of the given name. + if (callback != null && typeof callback !== "function") throw new Error("invalid callback: " + callback); + while (++i < n) { + if (t = (typename = T[i]).type) _[t] = set(_[t], typename.name, callback); + else if (callback == null) for (t in _) _[t] = set(_[t], typename.name, null); + } + + return this; + }, + copy: function() { + var copy = {}, _ = this._; + for (var t in _) copy[t] = _[t].slice(); + return new Dispatch(copy); + }, + call: function(type, that) { + if ((n = arguments.length - 2) > 0) for (var args = new Array(n), i = 0, n, t; i < n; ++i) args[i] = arguments[i + 2]; + if (!this._.hasOwnProperty(type)) throw new Error("unknown type: " + type); + for (t = this._[type], i = 0, n = t.length; i < n; ++i) t[i].value.apply(that, args); + }, + apply: function(type, that, args) { + if (!this._.hasOwnProperty(type)) throw new Error("unknown type: " + type); + for (var t = this._[type], i = 0, n = t.length; i < n; ++i) t[i].value.apply(that, args); + } +}; + +function get(type, name) { + for (var i = 0, n = type.length, c; i < n; ++i) { + if ((c = type[i]).name === name) { + return c.value; + } + } +} + +function set(type, name, callback) { + for (var i = 0, n = type.length; i < n; ++i) { + if (type[i].name === name) { + type[i] = noop, type = type.slice(0, i).concat(type.slice(i + 1)); + break; + } + } + if (callback != null) type.push({name: name, value: callback}); + return type; +} + +var xhtml = "http://www.w3.org/1999/xhtml"; + +var namespaces = { + svg: "http://www.w3.org/2000/svg", + xhtml: xhtml, + xlink: "http://www.w3.org/1999/xlink", + xml: "http://www.w3.org/XML/1998/namespace", + xmlns: "http://www.w3.org/2000/xmlns/" +}; + +function namespace(name) { + var prefix = name += "", i = prefix.indexOf(":"); + if (i >= 0 && (prefix = name.slice(0, i)) !== "xmlns") name = name.slice(i + 1); + return namespaces.hasOwnProperty(prefix) ? {space: namespaces[prefix], local: name} : name; +} + +function creatorInherit(name) { + return function() { + var document = this.ownerDocument, + uri = this.namespaceURI; + return uri === xhtml && document.documentElement.namespaceURI === xhtml + ? document.createElement(name) + : document.createElementNS(uri, name); + }; +} + +function creatorFixed(fullname) { + return function() { + return this.ownerDocument.createElementNS(fullname.space, fullname.local); + }; +} + +function creator(name) { + var fullname = namespace(name); + return (fullname.local + ? creatorFixed + : creatorInherit)(fullname); +} + +function none() {} + +function selector(selector) { + return selector == null ? none : function() { + return this.querySelector(selector); + }; +} + +function selection_select(select) { + if (typeof select !== "function") select = selector(select); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = new Array(n), node, subnode, i = 0; i < n; ++i) { + if ((node = group[i]) && (subnode = select.call(node, node.__data__, i, group))) { + if ("__data__" in node) subnode.__data__ = node.__data__; + subgroup[i] = subnode; + } + } + } + + return new Selection(subgroups, this._parents); +} + +function empty$1() { + return []; +} + +function selectorAll(selector) { + return selector == null ? empty$1 : function() { + return this.querySelectorAll(selector); + }; +} + +function selection_selectAll(select) { + if (typeof select !== "function") select = selectorAll(select); + + for (var groups = this._groups, m = groups.length, subgroups = [], parents = [], j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + subgroups.push(select.call(node, node.__data__, i, group)); + parents.push(node); + } + } + } + + return new Selection(subgroups, parents); +} + +var matcher = function(selector) { + return function() { + return this.matches(selector); + }; +}; + +if (typeof document !== "undefined") { + var element = document.documentElement; + if (!element.matches) { + var vendorMatches = element.webkitMatchesSelector + || element.msMatchesSelector + || element.mozMatchesSelector + || element.oMatchesSelector; + matcher = function(selector) { + return function() { + return vendorMatches.call(this, selector); + }; + }; + } +} + +var matcher$1 = matcher; + +function selection_filter(match) { + if (typeof match !== "function") match = matcher$1(match); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = [], node, i = 0; i < n; ++i) { + if ((node = group[i]) && match.call(node, node.__data__, i, group)) { + subgroup.push(node); + } + } + } + + return new Selection(subgroups, this._parents); +} + +function sparse(update) { + return new Array(update.length); +} + +function selection_enter() { + return new Selection(this._enter || this._groups.map(sparse), this._parents); +} + +function EnterNode(parent, datum) { + this.ownerDocument = parent.ownerDocument; + this.namespaceURI = parent.namespaceURI; + this._next = null; + this._parent = parent; + this.__data__ = datum; +} + +EnterNode.prototype = { + constructor: EnterNode, + appendChild: function(child) { return this._parent.insertBefore(child, this._next); }, + insertBefore: function(child, next) { return this._parent.insertBefore(child, next); }, + querySelector: function(selector) { return this._parent.querySelector(selector); }, + querySelectorAll: function(selector) { return this._parent.querySelectorAll(selector); } +}; + +function constant$1(x) { + return function() { + return x; + }; +} + +var keyPrefix = "$"; // Protect against keys like “__proto__”. + +function bindIndex(parent, group, enter, update, exit, data) { + var i = 0, + node, + groupLength = group.length, + dataLength = data.length; + + // Put any non-null nodes that fit into update. + // Put any null nodes into enter. + // Put any remaining data into enter. + for (; i < dataLength; ++i) { + if (node = group[i]) { + node.__data__ = data[i]; + update[i] = node; + } else { + enter[i] = new EnterNode(parent, data[i]); + } + } + + // Put any non-null nodes that don’t fit into exit. + for (; i < groupLength; ++i) { + if (node = group[i]) { + exit[i] = node; + } + } +} + +function bindKey(parent, group, enter, update, exit, data, key) { + var i, + node, + nodeByKeyValue = {}, + groupLength = group.length, + dataLength = data.length, + keyValues = new Array(groupLength), + keyValue; + + // Compute the key for each node. + // If multiple nodes have the same key, the duplicates are added to exit. + for (i = 0; i < groupLength; ++i) { + if (node = group[i]) { + keyValues[i] = keyValue = keyPrefix + key.call(node, node.__data__, i, group); + if (keyValue in nodeByKeyValue) { + exit[i] = node; + } else { + nodeByKeyValue[keyValue] = node; + } + } + } + + // Compute the key for each datum. + // If there a node associated with this key, join and add it to update. + // If there is not (or the key is a duplicate), add it to enter. + for (i = 0; i < dataLength; ++i) { + keyValue = keyPrefix + key.call(parent, data[i], i, data); + if (node = nodeByKeyValue[keyValue]) { + update[i] = node; + node.__data__ = data[i]; + nodeByKeyValue[keyValue] = null; + } else { + enter[i] = new EnterNode(parent, data[i]); + } + } + + // Add any remaining nodes that were not bound to data to exit. + for (i = 0; i < groupLength; ++i) { + if ((node = group[i]) && (nodeByKeyValue[keyValues[i]] === node)) { + exit[i] = node; + } + } +} + +function selection_data(value, key) { + if (!value) { + data = new Array(this.size()), j = -1; + this.each(function(d) { data[++j] = d; }); + return data; + } + + var bind = key ? bindKey : bindIndex, + parents = this._parents, + groups = this._groups; + + if (typeof value !== "function") value = constant$1(value); + + for (var m = groups.length, update = new Array(m), enter = new Array(m), exit = new Array(m), j = 0; j < m; ++j) { + var parent = parents[j], + group = groups[j], + groupLength = group.length, + data = value.call(parent, parent && parent.__data__, j, parents), + dataLength = data.length, + enterGroup = enter[j] = new Array(dataLength), + updateGroup = update[j] = new Array(dataLength), + exitGroup = exit[j] = new Array(groupLength); + + bind(parent, group, enterGroup, updateGroup, exitGroup, data, key); + + // Now connect the enter nodes to their following update node, such that + // appendChild can insert the materialized enter node before this node, + // rather than at the end of the parent node. + for (var i0 = 0, i1 = 0, previous, next; i0 < dataLength; ++i0) { + if (previous = enterGroup[i0]) { + if (i0 >= i1) i1 = i0 + 1; + while (!(next = updateGroup[i1]) && ++i1 < dataLength); + previous._next = next || null; + } + } + } + + update = new Selection(update, parents); + update._enter = enter; + update._exit = exit; + return update; +} + +function selection_exit() { + return new Selection(this._exit || this._groups.map(sparse), this._parents); +} + +function selection_merge(selection$$1) { + + for (var groups0 = this._groups, groups1 = selection$$1._groups, m0 = groups0.length, m1 = groups1.length, m = Math.min(m0, m1), merges = new Array(m0), j = 0; j < m; ++j) { + for (var group0 = groups0[j], group1 = groups1[j], n = group0.length, merge = merges[j] = new Array(n), node, i = 0; i < n; ++i) { + if (node = group0[i] || group1[i]) { + merge[i] = node; + } + } + } + + for (; j < m0; ++j) { + merges[j] = groups0[j]; + } + + return new Selection(merges, this._parents); +} + +function selection_order() { + + for (var groups = this._groups, j = -1, m = groups.length; ++j < m;) { + for (var group = groups[j], i = group.length - 1, next = group[i], node; --i >= 0;) { + if (node = group[i]) { + if (next && next !== node.nextSibling) next.parentNode.insertBefore(node, next); + next = node; + } + } + } + + return this; +} + +function selection_sort(compare) { + if (!compare) compare = ascending$1; + + function compareNode(a, b) { + return a && b ? compare(a.__data__, b.__data__) : !a - !b; + } + + for (var groups = this._groups, m = groups.length, sortgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, sortgroup = sortgroups[j] = new Array(n), node, i = 0; i < n; ++i) { + if (node = group[i]) { + sortgroup[i] = node; + } + } + sortgroup.sort(compareNode); + } + + return new Selection(sortgroups, this._parents).order(); +} + +function ascending$1(a, b) { + return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN; +} + +function selection_call() { + var callback = arguments[0]; + arguments[0] = this; + callback.apply(null, arguments); + return this; +} + +function selection_nodes() { + var nodes = new Array(this.size()), i = -1; + this.each(function() { nodes[++i] = this; }); + return nodes; +} + +function selection_node() { + + for (var groups = this._groups, j = 0, m = groups.length; j < m; ++j) { + for (var group = groups[j], i = 0, n = group.length; i < n; ++i) { + var node = group[i]; + if (node) return node; + } + } + + return null; +} + +function selection_size() { + var size = 0; + this.each(function() { ++size; }); + return size; +} + +function selection_empty() { + return !this.node(); +} + +function selection_each(callback) { + + for (var groups = this._groups, j = 0, m = groups.length; j < m; ++j) { + for (var group = groups[j], i = 0, n = group.length, node; i < n; ++i) { + if (node = group[i]) callback.call(node, node.__data__, i, group); + } + } + + return this; +} + +function attrRemove(name) { + return function() { + this.removeAttribute(name); + }; +} + +function attrRemoveNS(fullname) { + return function() { + this.removeAttributeNS(fullname.space, fullname.local); + }; +} + +function attrConstant(name, value) { + return function() { + this.setAttribute(name, value); + }; +} + +function attrConstantNS(fullname, value) { + return function() { + this.setAttributeNS(fullname.space, fullname.local, value); + }; +} + +function attrFunction(name, value) { + return function() { + var v = value.apply(this, arguments); + if (v == null) this.removeAttribute(name); + else this.setAttribute(name, v); + }; +} + +function attrFunctionNS(fullname, value) { + return function() { + var v = value.apply(this, arguments); + if (v == null) this.removeAttributeNS(fullname.space, fullname.local); + else this.setAttributeNS(fullname.space, fullname.local, v); + }; +} + +function selection_attr(name, value) { + var fullname = namespace(name); + + if (arguments.length < 2) { + var node = this.node(); + return fullname.local + ? node.getAttributeNS(fullname.space, fullname.local) + : node.getAttribute(fullname); + } + + return this.each((value == null + ? (fullname.local ? attrRemoveNS : attrRemove) : (typeof value === "function" + ? (fullname.local ? attrFunctionNS : attrFunction) + : (fullname.local ? attrConstantNS : attrConstant)))(fullname, value)); +} + +function defaultView(node) { + return (node.ownerDocument && node.ownerDocument.defaultView) // node is a Node + || (node.document && node) // node is a Window + || node.defaultView; // node is a Document +} + +function styleRemove(name) { + return function() { + this.style.removeProperty(name); + }; +} + +function styleConstant(name, value, priority) { + return function() { + this.style.setProperty(name, value, priority); + }; +} + +function styleFunction(name, value, priority) { + return function() { + var v = value.apply(this, arguments); + if (v == null) this.style.removeProperty(name); + else this.style.setProperty(name, v, priority); + }; +} + +function selection_style(name, value, priority) { + return arguments.length > 1 + ? this.each((value == null + ? styleRemove : typeof value === "function" + ? styleFunction + : styleConstant)(name, value, priority == null ? "" : priority)) + : styleValue(this.node(), name); +} + +function styleValue(node, name) { + return node.style.getPropertyValue(name) + || defaultView(node).getComputedStyle(node, null).getPropertyValue(name); +} + +function propertyRemove(name) { + return function() { + delete this[name]; + }; +} + +function propertyConstant(name, value) { + return function() { + this[name] = value; + }; +} + +function propertyFunction(name, value) { + return function() { + var v = value.apply(this, arguments); + if (v == null) delete this[name]; + else this[name] = v; + }; +} + +function selection_property(name, value) { + return arguments.length > 1 + ? this.each((value == null + ? propertyRemove : typeof value === "function" + ? propertyFunction + : propertyConstant)(name, value)) + : this.node()[name]; +} + +function classArray(string) { + return string.trim().split(/^|\s+/); +} + +function classList(node) { + return node.classList || new ClassList(node); +} + +function ClassList(node) { + this._node = node; + this._names = classArray(node.getAttribute("class") || ""); +} + +ClassList.prototype = { + add: function(name) { + var i = this._names.indexOf(name); + if (i < 0) { + this._names.push(name); + this._node.setAttribute("class", this._names.join(" ")); + } + }, + remove: function(name) { + var i = this._names.indexOf(name); + if (i >= 0) { + this._names.splice(i, 1); + this._node.setAttribute("class", this._names.join(" ")); + } + }, + contains: function(name) { + return this._names.indexOf(name) >= 0; + } +}; + +function classedAdd(node, names) { + var list = classList(node), i = -1, n = names.length; + while (++i < n) list.add(names[i]); +} + +function classedRemove(node, names) { + var list = classList(node), i = -1, n = names.length; + while (++i < n) list.remove(names[i]); +} + +function classedTrue(names) { + return function() { + classedAdd(this, names); + }; +} + +function classedFalse(names) { + return function() { + classedRemove(this, names); + }; +} + +function classedFunction(names, value) { + return function() { + (value.apply(this, arguments) ? classedAdd : classedRemove)(this, names); + }; +} + +function selection_classed(name, value) { + var names = classArray(name + ""); + + if (arguments.length < 2) { + var list = classList(this.node()), i = -1, n = names.length; + while (++i < n) if (!list.contains(names[i])) return false; + return true; + } + + return this.each((typeof value === "function" + ? classedFunction : value + ? classedTrue + : classedFalse)(names, value)); +} + +function textRemove() { + this.textContent = ""; +} + +function textConstant(value) { + return function() { + this.textContent = value; + }; +} + +function textFunction(value) { + return function() { + var v = value.apply(this, arguments); + this.textContent = v == null ? "" : v; + }; +} + +function selection_text(value) { + return arguments.length + ? this.each(value == null + ? textRemove : (typeof value === "function" + ? textFunction + : textConstant)(value)) + : this.node().textContent; +} + +function htmlRemove() { + this.innerHTML = ""; +} + +function htmlConstant(value) { + return function() { + this.innerHTML = value; + }; +} + +function htmlFunction(value) { + return function() { + var v = value.apply(this, arguments); + this.innerHTML = v == null ? "" : v; + }; +} + +function selection_html(value) { + return arguments.length + ? this.each(value == null + ? htmlRemove : (typeof value === "function" + ? htmlFunction + : htmlConstant)(value)) + : this.node().innerHTML; +} + +function raise() { + if (this.nextSibling) this.parentNode.appendChild(this); +} + +function selection_raise() { + return this.each(raise); +} + +function lower() { + if (this.previousSibling) this.parentNode.insertBefore(this, this.parentNode.firstChild); +} + +function selection_lower() { + return this.each(lower); +} + +function selection_append(name) { + var create = typeof name === "function" ? name : creator(name); + return this.select(function() { + return this.appendChild(create.apply(this, arguments)); + }); +} + +function constantNull() { + return null; +} + +function selection_insert(name, before) { + var create = typeof name === "function" ? name : creator(name), + select = before == null ? constantNull : typeof before === "function" ? before : selector(before); + return this.select(function() { + return this.insertBefore(create.apply(this, arguments), select.apply(this, arguments) || null); + }); +} + +function remove() { + var parent = this.parentNode; + if (parent) parent.removeChild(this); +} + +function selection_remove() { + return this.each(remove); +} + +function selection_cloneShallow() { + return this.parentNode.insertBefore(this.cloneNode(false), this.nextSibling); +} + +function selection_cloneDeep() { + return this.parentNode.insertBefore(this.cloneNode(true), this.nextSibling); +} + +function selection_clone(deep) { + return this.select(deep ? selection_cloneDeep : selection_cloneShallow); +} + +function selection_datum(value) { + return arguments.length + ? this.property("__data__", value) + : this.node().__data__; +} + +var filterEvents = {}; + +exports.event = null; + +if (typeof document !== "undefined") { + var element$1 = document.documentElement; + if (!("onmouseenter" in element$1)) { + filterEvents = {mouseenter: "mouseover", mouseleave: "mouseout"}; + } +} + +function filterContextListener(listener, index, group) { + listener = contextListener(listener, index, group); + return function(event) { + var related = event.relatedTarget; + if (!related || (related !== this && !(related.compareDocumentPosition(this) & 8))) { + listener.call(this, event); + } + }; +} + +function contextListener(listener, index, group) { + return function(event1) { + var event0 = exports.event; // Events can be reentrant (e.g., focus). + exports.event = event1; + try { + listener.call(this, this.__data__, index, group); + } finally { + exports.event = event0; + } + }; +} + +function parseTypenames$1(typenames) { + return typenames.trim().split(/^|\s+/).map(function(t) { + var name = "", i = t.indexOf("."); + if (i >= 0) name = t.slice(i + 1), t = t.slice(0, i); + return {type: t, name: name}; + }); +} + +function onRemove(typename) { + return function() { + var on = this.__on; + if (!on) return; + for (var j = 0, i = -1, m = on.length, o; j < m; ++j) { + if (o = on[j], (!typename.type || o.type === typename.type) && o.name === typename.name) { + this.removeEventListener(o.type, o.listener, o.capture); + } else { + on[++i] = o; + } + } + if (++i) on.length = i; + else delete this.__on; + }; +} + +function onAdd(typename, value, capture) { + var wrap = filterEvents.hasOwnProperty(typename.type) ? filterContextListener : contextListener; + return function(d, i, group) { + var on = this.__on, o, listener = wrap(value, i, group); + if (on) for (var j = 0, m = on.length; j < m; ++j) { + if ((o = on[j]).type === typename.type && o.name === typename.name) { + this.removeEventListener(o.type, o.listener, o.capture); + this.addEventListener(o.type, o.listener = listener, o.capture = capture); + o.value = value; + return; + } + } + this.addEventListener(typename.type, listener, capture); + o = {type: typename.type, name: typename.name, value: value, listener: listener, capture: capture}; + if (!on) this.__on = [o]; + else on.push(o); + }; +} + +function selection_on(typename, value, capture) { + var typenames = parseTypenames$1(typename + ""), i, n = typenames.length, t; + + if (arguments.length < 2) { + var on = this.node().__on; + if (on) for (var j = 0, m = on.length, o; j < m; ++j) { + for (i = 0, o = on[j]; i < n; ++i) { + if ((t = typenames[i]).type === o.type && t.name === o.name) { + return o.value; + } + } + } + return; + } + + on = value ? onAdd : onRemove; + if (capture == null) capture = false; + for (i = 0; i < n; ++i) this.each(on(typenames[i], value, capture)); + return this; +} + +function customEvent(event1, listener, that, args) { + var event0 = exports.event; + event1.sourceEvent = exports.event; + exports.event = event1; + try { + return listener.apply(that, args); + } finally { + exports.event = event0; + } +} + +function dispatchEvent(node, type, params) { + var window = defaultView(node), + event = window.CustomEvent; + + if (typeof event === "function") { + event = new event(type, params); + } else { + event = window.document.createEvent("Event"); + if (params) event.initEvent(type, params.bubbles, params.cancelable), event.detail = params.detail; + else event.initEvent(type, false, false); + } + + node.dispatchEvent(event); +} + +function dispatchConstant(type, params) { + return function() { + return dispatchEvent(this, type, params); + }; +} + +function dispatchFunction(type, params) { + return function() { + return dispatchEvent(this, type, params.apply(this, arguments)); + }; +} + +function selection_dispatch(type, params) { + return this.each((typeof params === "function" + ? dispatchFunction + : dispatchConstant)(type, params)); +} + +var root = [null]; + +function Selection(groups, parents) { + this._groups = groups; + this._parents = parents; +} + +function selection() { + return new Selection([[document.documentElement]], root); +} + +Selection.prototype = selection.prototype = { + constructor: Selection, + select: selection_select, + selectAll: selection_selectAll, + filter: selection_filter, + data: selection_data, + enter: selection_enter, + exit: selection_exit, + merge: selection_merge, + order: selection_order, + sort: selection_sort, + call: selection_call, + nodes: selection_nodes, + node: selection_node, + size: selection_size, + empty: selection_empty, + each: selection_each, + attr: selection_attr, + style: selection_style, + property: selection_property, + classed: selection_classed, + text: selection_text, + html: selection_html, + raise: selection_raise, + lower: selection_lower, + append: selection_append, + insert: selection_insert, + remove: selection_remove, + clone: selection_clone, + datum: selection_datum, + on: selection_on, + dispatch: selection_dispatch +}; + +function select(selector) { + return typeof selector === "string" + ? new Selection([[document.querySelector(selector)]], [document.documentElement]) + : new Selection([[selector]], root); +} + +function create(name) { + return select(creator(name).call(document.documentElement)); +} + +var nextId = 0; + +function local$1() { + return new Local; +} + +function Local() { + this._ = "@" + (++nextId).toString(36); +} + +Local.prototype = local$1.prototype = { + constructor: Local, + get: function(node) { + var id = this._; + while (!(id in node)) if (!(node = node.parentNode)) return; + return node[id]; + }, + set: function(node, value) { + return node[this._] = value; + }, + remove: function(node) { + return this._ in node && delete node[this._]; + }, + toString: function() { + return this._; + } +}; + +function sourceEvent() { + var current = exports.event, source; + while (source = current.sourceEvent) current = source; + return current; +} + +function point(node, event) { + var svg = node.ownerSVGElement || node; + + if (svg.createSVGPoint) { + var point = svg.createSVGPoint(); + point.x = event.clientX, point.y = event.clientY; + point = point.matrixTransform(node.getScreenCTM().inverse()); + return [point.x, point.y]; + } + + var rect = node.getBoundingClientRect(); + return [event.clientX - rect.left - node.clientLeft, event.clientY - rect.top - node.clientTop]; +} + +function mouse(node) { + var event = sourceEvent(); + if (event.changedTouches) event = event.changedTouches[0]; + return point(node, event); +} + +function selectAll(selector) { + return typeof selector === "string" + ? new Selection([document.querySelectorAll(selector)], [document.documentElement]) + : new Selection([selector == null ? [] : selector], root); +} + +function touch(node, touches, identifier) { + if (arguments.length < 3) identifier = touches, touches = sourceEvent().changedTouches; + + for (var i = 0, n = touches ? touches.length : 0, touch; i < n; ++i) { + if ((touch = touches[i]).identifier === identifier) { + return point(node, touch); + } + } + + return null; +} + +function touches(node, touches) { + if (touches == null) touches = sourceEvent().touches; + + for (var i = 0, n = touches ? touches.length : 0, points = new Array(n); i < n; ++i) { + points[i] = point(node, touches[i]); + } + + return points; +} + +function nopropagation() { + exports.event.stopImmediatePropagation(); +} + +function noevent() { + exports.event.preventDefault(); + exports.event.stopImmediatePropagation(); +} + +function dragDisable(view) { + var root = view.document.documentElement, + selection = select(view).on("dragstart.drag", noevent, true); + if ("onselectstart" in root) { + selection.on("selectstart.drag", noevent, true); + } else { + root.__noselect = root.style.MozUserSelect; + root.style.MozUserSelect = "none"; + } +} + +function yesdrag(view, noclick) { + var root = view.document.documentElement, + selection = select(view).on("dragstart.drag", null); + if (noclick) { + selection.on("click.drag", noevent, true); + setTimeout(function() { selection.on("click.drag", null); }, 0); + } + if ("onselectstart" in root) { + selection.on("selectstart.drag", null); + } else { + root.style.MozUserSelect = root.__noselect; + delete root.__noselect; + } +} + +function constant$2(x) { + return function() { + return x; + }; +} + +function DragEvent(target, type, subject, id, active, x, y, dx, dy, dispatch) { + this.target = target; + this.type = type; + this.subject = subject; + this.identifier = id; + this.active = active; + this.x = x; + this.y = y; + this.dx = dx; + this.dy = dy; + this._ = dispatch; +} + +DragEvent.prototype.on = function() { + var value = this._.on.apply(this._, arguments); + return value === this._ ? this : value; +}; + +// Ignore right-click, since that should open the context menu. +function defaultFilter$1() { + return !exports.event.button; +} + +function defaultContainer() { + return this.parentNode; +} + +function defaultSubject(d) { + return d == null ? {x: exports.event.x, y: exports.event.y} : d; +} + +function defaultTouchable() { + return "ontouchstart" in this; +} + +function drag() { + var filter = defaultFilter$1, + container = defaultContainer, + subject = defaultSubject, + touchable = defaultTouchable, + gestures = {}, + listeners = dispatch("start", "drag", "end"), + active = 0, + mousedownx, + mousedowny, + mousemoving, + touchending, + clickDistance2 = 0; + + function drag(selection) { + selection + .on("mousedown.drag", mousedowned) + .filter(touchable) + .on("touchstart.drag", touchstarted) + .on("touchmove.drag", touchmoved) + .on("touchend.drag touchcancel.drag", touchended) + .style("touch-action", "none") + .style("-webkit-tap-highlight-color", "rgba(0,0,0,0)"); + } + + function mousedowned() { + if (touchending || !filter.apply(this, arguments)) return; + var gesture = beforestart("mouse", container.apply(this, arguments), mouse, this, arguments); + if (!gesture) return; + select(exports.event.view).on("mousemove.drag", mousemoved, true).on("mouseup.drag", mouseupped, true); + dragDisable(exports.event.view); + nopropagation(); + mousemoving = false; + mousedownx = exports.event.clientX; + mousedowny = exports.event.clientY; + gesture("start"); + } + + function mousemoved() { + noevent(); + if (!mousemoving) { + var dx = exports.event.clientX - mousedownx, dy = exports.event.clientY - mousedowny; + mousemoving = dx * dx + dy * dy > clickDistance2; + } + gestures.mouse("drag"); + } + + function mouseupped() { + select(exports.event.view).on("mousemove.drag mouseup.drag", null); + yesdrag(exports.event.view, mousemoving); + noevent(); + gestures.mouse("end"); + } + + function touchstarted() { + if (!filter.apply(this, arguments)) return; + var touches = exports.event.changedTouches, + c = container.apply(this, arguments), + n = touches.length, i, gesture; + + for (i = 0; i < n; ++i) { + if (gesture = beforestart(touches[i].identifier, c, touch, this, arguments)) { + nopropagation(); + gesture("start"); + } + } + } + + function touchmoved() { + var touches = exports.event.changedTouches, + n = touches.length, i, gesture; + + for (i = 0; i < n; ++i) { + if (gesture = gestures[touches[i].identifier]) { + noevent(); + gesture("drag"); + } + } + } + + function touchended() { + var touches = exports.event.changedTouches, + n = touches.length, i, gesture; + + if (touchending) clearTimeout(touchending); + touchending = setTimeout(function() { touchending = null; }, 500); // Ghost clicks are delayed! + for (i = 0; i < n; ++i) { + if (gesture = gestures[touches[i].identifier]) { + nopropagation(); + gesture("end"); + } + } + } + + function beforestart(id, container, point, that, args) { + var p = point(container, id), s, dx, dy, + sublisteners = listeners.copy(); + + if (!customEvent(new DragEvent(drag, "beforestart", s, id, active, p[0], p[1], 0, 0, sublisteners), function() { + if ((exports.event.subject = s = subject.apply(that, args)) == null) return false; + dx = s.x - p[0] || 0; + dy = s.y - p[1] || 0; + return true; + })) return; + + return function gesture(type) { + var p0 = p, n; + switch (type) { + case "start": gestures[id] = gesture, n = active++; break; + case "end": delete gestures[id], --active; // nobreak + case "drag": p = point(container, id), n = active; break; + } + customEvent(new DragEvent(drag, type, s, id, n, p[0] + dx, p[1] + dy, p[0] - p0[0], p[1] - p0[1], sublisteners), sublisteners.apply, sublisteners, [type, that, args]); + }; + } + + drag.filter = function(_) { + return arguments.length ? (filter = typeof _ === "function" ? _ : constant$2(!!_), drag) : filter; + }; + + drag.container = function(_) { + return arguments.length ? (container = typeof _ === "function" ? _ : constant$2(_), drag) : container; + }; + + drag.subject = function(_) { + return arguments.length ? (subject = typeof _ === "function" ? _ : constant$2(_), drag) : subject; + }; + + drag.touchable = function(_) { + return arguments.length ? (touchable = typeof _ === "function" ? _ : constant$2(!!_), drag) : touchable; + }; + + drag.on = function() { + var value = listeners.on.apply(listeners, arguments); + return value === listeners ? drag : value; + }; + + drag.clickDistance = function(_) { + return arguments.length ? (clickDistance2 = (_ = +_) * _, drag) : Math.sqrt(clickDistance2); + }; + + return drag; +} + +function define(constructor, factory, prototype) { + constructor.prototype = factory.prototype = prototype; + prototype.constructor = constructor; +} + +function extend(parent, definition) { + var prototype = Object.create(parent.prototype); + for (var key in definition) prototype[key] = definition[key]; + return prototype; +} + +function Color() {} + +var darker = 0.7; +var brighter = 1 / darker; + +var reI = "\\s*([+-]?\\d+)\\s*"; +var reN = "\\s*([+-]?\\d*\\.?\\d+(?:[eE][+-]?\\d+)?)\\s*"; +var reP = "\\s*([+-]?\\d*\\.?\\d+(?:[eE][+-]?\\d+)?)%\\s*"; +var reHex3 = /^#([0-9a-f]{3})$/; +var reHex6 = /^#([0-9a-f]{6})$/; +var reRgbInteger = new RegExp("^rgb\\(" + [reI, reI, reI] + "\\)$"); +var reRgbPercent = new RegExp("^rgb\\(" + [reP, reP, reP] + "\\)$"); +var reRgbaInteger = new RegExp("^rgba\\(" + [reI, reI, reI, reN] + "\\)$"); +var reRgbaPercent = new RegExp("^rgba\\(" + [reP, reP, reP, reN] + "\\)$"); +var reHslPercent = new RegExp("^hsl\\(" + [reN, reP, reP] + "\\)$"); +var reHslaPercent = new RegExp("^hsla\\(" + [reN, reP, reP, reN] + "\\)$"); + +var named = { + aliceblue: 0xf0f8ff, + antiquewhite: 0xfaebd7, + aqua: 0x00ffff, + aquamarine: 0x7fffd4, + azure: 0xf0ffff, + beige: 0xf5f5dc, + bisque: 0xffe4c4, + black: 0x000000, + blanchedalmond: 0xffebcd, + blue: 0x0000ff, + blueviolet: 0x8a2be2, + brown: 0xa52a2a, + burlywood: 0xdeb887, + cadetblue: 0x5f9ea0, + chartreuse: 0x7fff00, + chocolate: 0xd2691e, + coral: 0xff7f50, + cornflowerblue: 0x6495ed, + cornsilk: 0xfff8dc, + crimson: 0xdc143c, + cyan: 0x00ffff, + darkblue: 0x00008b, + darkcyan: 0x008b8b, + darkgoldenrod: 0xb8860b, + darkgray: 0xa9a9a9, + darkgreen: 0x006400, + darkgrey: 0xa9a9a9, + darkkhaki: 0xbdb76b, + darkmagenta: 0x8b008b, + darkolivegreen: 0x556b2f, + darkorange: 0xff8c00, + darkorchid: 0x9932cc, + darkred: 0x8b0000, + darksalmon: 0xe9967a, + darkseagreen: 0x8fbc8f, + darkslateblue: 0x483d8b, + darkslategray: 0x2f4f4f, + darkslategrey: 0x2f4f4f, + darkturquoise: 0x00ced1, + darkviolet: 0x9400d3, + deeppink: 0xff1493, + deepskyblue: 0x00bfff, + dimgray: 0x696969, + dimgrey: 0x696969, + dodgerblue: 0x1e90ff, + firebrick: 0xb22222, + floralwhite: 0xfffaf0, + forestgreen: 0x228b22, + fuchsia: 0xff00ff, + gainsboro: 0xdcdcdc, + ghostwhite: 0xf8f8ff, + gold: 0xffd700, + goldenrod: 0xdaa520, + gray: 0x808080, + green: 0x008000, + greenyellow: 0xadff2f, + grey: 0x808080, + honeydew: 0xf0fff0, + hotpink: 0xff69b4, + indianred: 0xcd5c5c, + indigo: 0x4b0082, + ivory: 0xfffff0, + khaki: 0xf0e68c, + lavender: 0xe6e6fa, + lavenderblush: 0xfff0f5, + lawngreen: 0x7cfc00, + lemonchiffon: 0xfffacd, + lightblue: 0xadd8e6, + lightcoral: 0xf08080, + lightcyan: 0xe0ffff, + lightgoldenrodyellow: 0xfafad2, + lightgray: 0xd3d3d3, + lightgreen: 0x90ee90, + lightgrey: 0xd3d3d3, + lightpink: 0xffb6c1, + lightsalmon: 0xffa07a, + lightseagreen: 0x20b2aa, + lightskyblue: 0x87cefa, + lightslategray: 0x778899, + lightslategrey: 0x778899, + lightsteelblue: 0xb0c4de, + lightyellow: 0xffffe0, + lime: 0x00ff00, + limegreen: 0x32cd32, + linen: 0xfaf0e6, + magenta: 0xff00ff, + maroon: 0x800000, + mediumaquamarine: 0x66cdaa, + mediumblue: 0x0000cd, + mediumorchid: 0xba55d3, + mediumpurple: 0x9370db, + mediumseagreen: 0x3cb371, + mediumslateblue: 0x7b68ee, + mediumspringgreen: 0x00fa9a, + mediumturquoise: 0x48d1cc, + mediumvioletred: 0xc71585, + midnightblue: 0x191970, + mintcream: 0xf5fffa, + mistyrose: 0xffe4e1, + moccasin: 0xffe4b5, + navajowhite: 0xffdead, + navy: 0x000080, + oldlace: 0xfdf5e6, + olive: 0x808000, + olivedrab: 0x6b8e23, + orange: 0xffa500, + orangered: 0xff4500, + orchid: 0xda70d6, + palegoldenrod: 0xeee8aa, + palegreen: 0x98fb98, + paleturquoise: 0xafeeee, + palevioletred: 0xdb7093, + papayawhip: 0xffefd5, + peachpuff: 0xffdab9, + peru: 0xcd853f, + pink: 0xffc0cb, + plum: 0xdda0dd, + powderblue: 0xb0e0e6, + purple: 0x800080, + rebeccapurple: 0x663399, + red: 0xff0000, + rosybrown: 0xbc8f8f, + royalblue: 0x4169e1, + saddlebrown: 0x8b4513, + salmon: 0xfa8072, + sandybrown: 0xf4a460, + seagreen: 0x2e8b57, + seashell: 0xfff5ee, + sienna: 0xa0522d, + silver: 0xc0c0c0, + skyblue: 0x87ceeb, + slateblue: 0x6a5acd, + slategray: 0x708090, + slategrey: 0x708090, + snow: 0xfffafa, + springgreen: 0x00ff7f, + steelblue: 0x4682b4, + tan: 0xd2b48c, + teal: 0x008080, + thistle: 0xd8bfd8, + tomato: 0xff6347, + turquoise: 0x40e0d0, + violet: 0xee82ee, + wheat: 0xf5deb3, + white: 0xffffff, + whitesmoke: 0xf5f5f5, + yellow: 0xffff00, + yellowgreen: 0x9acd32 +}; + +define(Color, color, { + displayable: function() { + return this.rgb().displayable(); + }, + toString: function() { + return this.rgb() + ""; + } +}); + +function color(format) { + var m; + format = (format + "").trim().toLowerCase(); + return (m = reHex3.exec(format)) ? (m = parseInt(m[1], 16), new Rgb((m >> 8 & 0xf) | (m >> 4 & 0x0f0), (m >> 4 & 0xf) | (m & 0xf0), ((m & 0xf) << 4) | (m & 0xf), 1)) // #f00 + : (m = reHex6.exec(format)) ? rgbn(parseInt(m[1], 16)) // #ff0000 + : (m = reRgbInteger.exec(format)) ? new Rgb(m[1], m[2], m[3], 1) // rgb(255, 0, 0) + : (m = reRgbPercent.exec(format)) ? new Rgb(m[1] * 255 / 100, m[2] * 255 / 100, m[3] * 255 / 100, 1) // rgb(100%, 0%, 0%) + : (m = reRgbaInteger.exec(format)) ? rgba(m[1], m[2], m[3], m[4]) // rgba(255, 0, 0, 1) + : (m = reRgbaPercent.exec(format)) ? rgba(m[1] * 255 / 100, m[2] * 255 / 100, m[3] * 255 / 100, m[4]) // rgb(100%, 0%, 0%, 1) + : (m = reHslPercent.exec(format)) ? hsla(m[1], m[2] / 100, m[3] / 100, 1) // hsl(120, 50%, 50%) + : (m = reHslaPercent.exec(format)) ? hsla(m[1], m[2] / 100, m[3] / 100, m[4]) // hsla(120, 50%, 50%, 1) + : named.hasOwnProperty(format) ? rgbn(named[format]) + : format === "transparent" ? new Rgb(NaN, NaN, NaN, 0) + : null; +} + +function rgbn(n) { + return new Rgb(n >> 16 & 0xff, n >> 8 & 0xff, n & 0xff, 1); +} + +function rgba(r, g, b, a) { + if (a <= 0) r = g = b = NaN; + return new Rgb(r, g, b, a); +} + +function rgbConvert(o) { + if (!(o instanceof Color)) o = color(o); + if (!o) return new Rgb; + o = o.rgb(); + return new Rgb(o.r, o.g, o.b, o.opacity); +} + +function rgb(r, g, b, opacity) { + return arguments.length === 1 ? rgbConvert(r) : new Rgb(r, g, b, opacity == null ? 1 : opacity); +} + +function Rgb(r, g, b, opacity) { + this.r = +r; + this.g = +g; + this.b = +b; + this.opacity = +opacity; +} + +define(Rgb, rgb, extend(Color, { + brighter: function(k) { + k = k == null ? brighter : Math.pow(brighter, k); + return new Rgb(this.r * k, this.g * k, this.b * k, this.opacity); + }, + darker: function(k) { + k = k == null ? darker : Math.pow(darker, k); + return new Rgb(this.r * k, this.g * k, this.b * k, this.opacity); + }, + rgb: function() { + return this; + }, + displayable: function() { + return (0 <= this.r && this.r <= 255) + && (0 <= this.g && this.g <= 255) + && (0 <= this.b && this.b <= 255) + && (0 <= this.opacity && this.opacity <= 1); + }, + toString: function() { + var a = this.opacity; a = isNaN(a) ? 1 : Math.max(0, Math.min(1, a)); + return (a === 1 ? "rgb(" : "rgba(") + + Math.max(0, Math.min(255, Math.round(this.r) || 0)) + ", " + + Math.max(0, Math.min(255, Math.round(this.g) || 0)) + ", " + + Math.max(0, Math.min(255, Math.round(this.b) || 0)) + + (a === 1 ? ")" : ", " + a + ")"); + } +})); + +function hsla(h, s, l, a) { + if (a <= 0) h = s = l = NaN; + else if (l <= 0 || l >= 1) h = s = NaN; + else if (s <= 0) h = NaN; + return new Hsl(h, s, l, a); +} + +function hslConvert(o) { + if (o instanceof Hsl) return new Hsl(o.h, o.s, o.l, o.opacity); + if (!(o instanceof Color)) o = color(o); + if (!o) return new Hsl; + if (o instanceof Hsl) return o; + o = o.rgb(); + var r = o.r / 255, + g = o.g / 255, + b = o.b / 255, + min = Math.min(r, g, b), + max = Math.max(r, g, b), + h = NaN, + s = max - min, + l = (max + min) / 2; + if (s) { + if (r === max) h = (g - b) / s + (g < b) * 6; + else if (g === max) h = (b - r) / s + 2; + else h = (r - g) / s + 4; + s /= l < 0.5 ? max + min : 2 - max - min; + h *= 60; + } else { + s = l > 0 && l < 1 ? 0 : h; + } + return new Hsl(h, s, l, o.opacity); +} + +function hsl(h, s, l, opacity) { + return arguments.length === 1 ? hslConvert(h) : new Hsl(h, s, l, opacity == null ? 1 : opacity); +} + +function Hsl(h, s, l, opacity) { + this.h = +h; + this.s = +s; + this.l = +l; + this.opacity = +opacity; +} + +define(Hsl, hsl, extend(Color, { + brighter: function(k) { + k = k == null ? brighter : Math.pow(brighter, k); + return new Hsl(this.h, this.s, this.l * k, this.opacity); + }, + darker: function(k) { + k = k == null ? darker : Math.pow(darker, k); + return new Hsl(this.h, this.s, this.l * k, this.opacity); + }, + rgb: function() { + var h = this.h % 360 + (this.h < 0) * 360, + s = isNaN(h) || isNaN(this.s) ? 0 : this.s, + l = this.l, + m2 = l + (l < 0.5 ? l : 1 - l) * s, + m1 = 2 * l - m2; + return new Rgb( + hsl2rgb(h >= 240 ? h - 240 : h + 120, m1, m2), + hsl2rgb(h, m1, m2), + hsl2rgb(h < 120 ? h + 240 : h - 120, m1, m2), + this.opacity + ); + }, + displayable: function() { + return (0 <= this.s && this.s <= 1 || isNaN(this.s)) + && (0 <= this.l && this.l <= 1) + && (0 <= this.opacity && this.opacity <= 1); + } +})); + +/* From FvD 13.37, CSS Color Module Level 3 */ +function hsl2rgb(h, m1, m2) { + return (h < 60 ? m1 + (m2 - m1) * h / 60 + : h < 180 ? m2 + : h < 240 ? m1 + (m2 - m1) * (240 - h) / 60 + : m1) * 255; +} + +var deg2rad = Math.PI / 180; +var rad2deg = 180 / Math.PI; + +var Kn = 18; +var Xn = 0.950470; +var Yn = 1; +var Zn = 1.088830; +var t0 = 4 / 29; +var t1 = 6 / 29; +var t2 = 3 * t1 * t1; +var t3 = t1 * t1 * t1; + +function labConvert(o) { + if (o instanceof Lab) return new Lab(o.l, o.a, o.b, o.opacity); + if (o instanceof Hcl) { + var h = o.h * deg2rad; + return new Lab(o.l, Math.cos(h) * o.c, Math.sin(h) * o.c, o.opacity); + } + if (!(o instanceof Rgb)) o = rgbConvert(o); + var b = rgb2xyz(o.r), + a = rgb2xyz(o.g), + l = rgb2xyz(o.b), + x = xyz2lab((0.4124564 * b + 0.3575761 * a + 0.1804375 * l) / Xn), + y = xyz2lab((0.2126729 * b + 0.7151522 * a + 0.0721750 * l) / Yn), + z = xyz2lab((0.0193339 * b + 0.1191920 * a + 0.9503041 * l) / Zn); + return new Lab(116 * y - 16, 500 * (x - y), 200 * (y - z), o.opacity); +} + +function lab(l, a, b, opacity) { + return arguments.length === 1 ? labConvert(l) : new Lab(l, a, b, opacity == null ? 1 : opacity); +} + +function Lab(l, a, b, opacity) { + this.l = +l; + this.a = +a; + this.b = +b; + this.opacity = +opacity; +} + +define(Lab, lab, extend(Color, { + brighter: function(k) { + return new Lab(this.l + Kn * (k == null ? 1 : k), this.a, this.b, this.opacity); + }, + darker: function(k) { + return new Lab(this.l - Kn * (k == null ? 1 : k), this.a, this.b, this.opacity); + }, + rgb: function() { + var y = (this.l + 16) / 116, + x = isNaN(this.a) ? y : y + this.a / 500, + z = isNaN(this.b) ? y : y - this.b / 200; + y = Yn * lab2xyz(y); + x = Xn * lab2xyz(x); + z = Zn * lab2xyz(z); + return new Rgb( + xyz2rgb( 3.2404542 * x - 1.5371385 * y - 0.4985314 * z), // D65 -> sRGB + xyz2rgb(-0.9692660 * x + 1.8760108 * y + 0.0415560 * z), + xyz2rgb( 0.0556434 * x - 0.2040259 * y + 1.0572252 * z), + this.opacity + ); + } +})); + +function xyz2lab(t) { + return t > t3 ? Math.pow(t, 1 / 3) : t / t2 + t0; +} + +function lab2xyz(t) { + return t > t1 ? t * t * t : t2 * (t - t0); +} + +function xyz2rgb(x) { + return 255 * (x <= 0.0031308 ? 12.92 * x : 1.055 * Math.pow(x, 1 / 2.4) - 0.055); +} + +function rgb2xyz(x) { + return (x /= 255) <= 0.04045 ? x / 12.92 : Math.pow((x + 0.055) / 1.055, 2.4); +} + +function hclConvert(o) { + if (o instanceof Hcl) return new Hcl(o.h, o.c, o.l, o.opacity); + if (!(o instanceof Lab)) o = labConvert(o); + var h = Math.atan2(o.b, o.a) * rad2deg; + return new Hcl(h < 0 ? h + 360 : h, Math.sqrt(o.a * o.a + o.b * o.b), o.l, o.opacity); +} + +function hcl(h, c, l, opacity) { + return arguments.length === 1 ? hclConvert(h) : new Hcl(h, c, l, opacity == null ? 1 : opacity); +} + +function Hcl(h, c, l, opacity) { + this.h = +h; + this.c = +c; + this.l = +l; + this.opacity = +opacity; +} + +define(Hcl, hcl, extend(Color, { + brighter: function(k) { + return new Hcl(this.h, this.c, this.l + Kn * (k == null ? 1 : k), this.opacity); + }, + darker: function(k) { + return new Hcl(this.h, this.c, this.l - Kn * (k == null ? 1 : k), this.opacity); + }, + rgb: function() { + return labConvert(this).rgb(); + } +})); + +var A = -0.14861; +var B = +1.78277; +var C = -0.29227; +var D = -0.90649; +var E = +1.97294; +var ED = E * D; +var EB = E * B; +var BC_DA = B * C - D * A; + +function cubehelixConvert(o) { + if (o instanceof Cubehelix) return new Cubehelix(o.h, o.s, o.l, o.opacity); + if (!(o instanceof Rgb)) o = rgbConvert(o); + var r = o.r / 255, + g = o.g / 255, + b = o.b / 255, + l = (BC_DA * b + ED * r - EB * g) / (BC_DA + ED - EB), + bl = b - l, + k = (E * (g - l) - C * bl) / D, + s = Math.sqrt(k * k + bl * bl) / (E * l * (1 - l)), // NaN if l=0 or l=1 + h = s ? Math.atan2(k, bl) * rad2deg - 120 : NaN; + return new Cubehelix(h < 0 ? h + 360 : h, s, l, o.opacity); +} + +function cubehelix(h, s, l, opacity) { + return arguments.length === 1 ? cubehelixConvert(h) : new Cubehelix(h, s, l, opacity == null ? 1 : opacity); +} + +function Cubehelix(h, s, l, opacity) { + this.h = +h; + this.s = +s; + this.l = +l; + this.opacity = +opacity; +} + +define(Cubehelix, cubehelix, extend(Color, { + brighter: function(k) { + k = k == null ? brighter : Math.pow(brighter, k); + return new Cubehelix(this.h, this.s, this.l * k, this.opacity); + }, + darker: function(k) { + k = k == null ? darker : Math.pow(darker, k); + return new Cubehelix(this.h, this.s, this.l * k, this.opacity); + }, + rgb: function() { + var h = isNaN(this.h) ? 0 : (this.h + 120) * deg2rad, + l = +this.l, + a = isNaN(this.s) ? 0 : this.s * l * (1 - l), + cosh = Math.cos(h), + sinh = Math.sin(h); + return new Rgb( + 255 * (l + a * (A * cosh + B * sinh)), + 255 * (l + a * (C * cosh + D * sinh)), + 255 * (l + a * (E * cosh)), + this.opacity + ); + } +})); + +function basis(t1, v0, v1, v2, v3) { + var t2 = t1 * t1, t3 = t2 * t1; + return ((1 - 3 * t1 + 3 * t2 - t3) * v0 + + (4 - 6 * t2 + 3 * t3) * v1 + + (1 + 3 * t1 + 3 * t2 - 3 * t3) * v2 + + t3 * v3) / 6; +} + +function basis$1(values) { + var n = values.length - 1; + return function(t) { + var i = t <= 0 ? (t = 0) : t >= 1 ? (t = 1, n - 1) : Math.floor(t * n), + v1 = values[i], + v2 = values[i + 1], + v0 = i > 0 ? values[i - 1] : 2 * v1 - v2, + v3 = i < n - 1 ? values[i + 2] : 2 * v2 - v1; + return basis((t - i / n) * n, v0, v1, v2, v3); + }; +} + +function basisClosed(values) { + var n = values.length; + return function(t) { + var i = Math.floor(((t %= 1) < 0 ? ++t : t) * n), + v0 = values[(i + n - 1) % n], + v1 = values[i % n], + v2 = values[(i + 1) % n], + v3 = values[(i + 2) % n]; + return basis((t - i / n) * n, v0, v1, v2, v3); + }; +} + +function constant$3(x) { + return function() { + return x; + }; +} + +function linear(a, d) { + return function(t) { + return a + t * d; + }; +} + +function exponential(a, b, y) { + return a = Math.pow(a, y), b = Math.pow(b, y) - a, y = 1 / y, function(t) { + return Math.pow(a + t * b, y); + }; +} + +function hue(a, b) { + var d = b - a; + return d ? linear(a, d > 180 || d < -180 ? d - 360 * Math.round(d / 360) : d) : constant$3(isNaN(a) ? b : a); +} + +function gamma(y) { + return (y = +y) === 1 ? nogamma : function(a, b) { + return b - a ? exponential(a, b, y) : constant$3(isNaN(a) ? b : a); + }; +} + +function nogamma(a, b) { + var d = b - a; + return d ? linear(a, d) : constant$3(isNaN(a) ? b : a); +} + +var interpolateRgb = (function rgbGamma(y) { + var color$$1 = gamma(y); + + function rgb$$1(start, end) { + var r = color$$1((start = rgb(start)).r, (end = rgb(end)).r), + g = color$$1(start.g, end.g), + b = color$$1(start.b, end.b), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.r = r(t); + start.g = g(t); + start.b = b(t); + start.opacity = opacity(t); + return start + ""; + }; + } + + rgb$$1.gamma = rgbGamma; + + return rgb$$1; +})(1); + +function rgbSpline(spline) { + return function(colors) { + var n = colors.length, + r = new Array(n), + g = new Array(n), + b = new Array(n), + i, color$$1; + for (i = 0; i < n; ++i) { + color$$1 = rgb(colors[i]); + r[i] = color$$1.r || 0; + g[i] = color$$1.g || 0; + b[i] = color$$1.b || 0; + } + r = spline(r); + g = spline(g); + b = spline(b); + color$$1.opacity = 1; + return function(t) { + color$$1.r = r(t); + color$$1.g = g(t); + color$$1.b = b(t); + return color$$1 + ""; + }; + }; +} + +var rgbBasis = rgbSpline(basis$1); +var rgbBasisClosed = rgbSpline(basisClosed); + +function array$1(a, b) { + var nb = b ? b.length : 0, + na = a ? Math.min(nb, a.length) : 0, + x = new Array(na), + c = new Array(nb), + i; + + for (i = 0; i < na; ++i) x[i] = interpolateValue(a[i], b[i]); + for (; i < nb; ++i) c[i] = b[i]; + + return function(t) { + for (i = 0; i < na; ++i) c[i] = x[i](t); + return c; + }; +} + +function date(a, b) { + var d = new Date; + return a = +a, b -= a, function(t) { + return d.setTime(a + b * t), d; + }; +} + +function reinterpolate(a, b) { + return a = +a, b -= a, function(t) { + return a + b * t; + }; +} + +function object(a, b) { + var i = {}, + c = {}, + k; + + if (a === null || typeof a !== "object") a = {}; + if (b === null || typeof b !== "object") b = {}; + + for (k in b) { + if (k in a) { + i[k] = interpolateValue(a[k], b[k]); + } else { + c[k] = b[k]; + } + } + + return function(t) { + for (k in i) c[k] = i[k](t); + return c; + }; +} + +var reA = /[-+]?(?:\d+\.?\d*|\.?\d+)(?:[eE][-+]?\d+)?/g; +var reB = new RegExp(reA.source, "g"); + +function zero(b) { + return function() { + return b; + }; +} + +function one(b) { + return function(t) { + return b(t) + ""; + }; +} + +function interpolateString(a, b) { + var bi = reA.lastIndex = reB.lastIndex = 0, // scan index for next number in b + am, // current match in a + bm, // current match in b + bs, // string preceding current number in b, if any + i = -1, // index in s + s = [], // string constants and placeholders + q = []; // number interpolators + + // Coerce inputs to strings. + a = a + "", b = b + ""; + + // Interpolate pairs of numbers in a & b. + while ((am = reA.exec(a)) + && (bm = reB.exec(b))) { + if ((bs = bm.index) > bi) { // a string precedes the next number in b + bs = b.slice(bi, bs); + if (s[i]) s[i] += bs; // coalesce with previous string + else s[++i] = bs; + } + if ((am = am[0]) === (bm = bm[0])) { // numbers in a & b match + if (s[i]) s[i] += bm; // coalesce with previous string + else s[++i] = bm; + } else { // interpolate non-matching numbers + s[++i] = null; + q.push({i: i, x: reinterpolate(am, bm)}); + } + bi = reB.lastIndex; + } + + // Add remains of b. + if (bi < b.length) { + bs = b.slice(bi); + if (s[i]) s[i] += bs; // coalesce with previous string + else s[++i] = bs; + } + + // Special optimization for only a single match. + // Otherwise, interpolate each of the numbers and rejoin the string. + return s.length < 2 ? (q[0] + ? one(q[0].x) + : zero(b)) + : (b = q.length, function(t) { + for (var i = 0, o; i < b; ++i) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }); +} + +function interpolateValue(a, b) { + var t = typeof b, c; + return b == null || t === "boolean" ? constant$3(b) + : (t === "number" ? reinterpolate + : t === "string" ? ((c = color(b)) ? (b = c, interpolateRgb) : interpolateString) + : b instanceof color ? interpolateRgb + : b instanceof Date ? date + : Array.isArray(b) ? array$1 + : typeof b.valueOf !== "function" && typeof b.toString !== "function" || isNaN(b) ? object + : reinterpolate)(a, b); +} + +function interpolateRound(a, b) { + return a = +a, b -= a, function(t) { + return Math.round(a + b * t); + }; +} + +var degrees = 180 / Math.PI; + +var identity$2 = { + translateX: 0, + translateY: 0, + rotate: 0, + skewX: 0, + scaleX: 1, + scaleY: 1 +}; + +function decompose(a, b, c, d, e, f) { + var scaleX, scaleY, skewX; + if (scaleX = Math.sqrt(a * a + b * b)) a /= scaleX, b /= scaleX; + if (skewX = a * c + b * d) c -= a * skewX, d -= b * skewX; + if (scaleY = Math.sqrt(c * c + d * d)) c /= scaleY, d /= scaleY, skewX /= scaleY; + if (a * d < b * c) a = -a, b = -b, skewX = -skewX, scaleX = -scaleX; + return { + translateX: e, + translateY: f, + rotate: Math.atan2(b, a) * degrees, + skewX: Math.atan(skewX) * degrees, + scaleX: scaleX, + scaleY: scaleY + }; +} + +var cssNode; +var cssRoot; +var cssView; +var svgNode; + +function parseCss(value) { + if (value === "none") return identity$2; + if (!cssNode) cssNode = document.createElement("DIV"), cssRoot = document.documentElement, cssView = document.defaultView; + cssNode.style.transform = value; + value = cssView.getComputedStyle(cssRoot.appendChild(cssNode), null).getPropertyValue("transform"); + cssRoot.removeChild(cssNode); + value = value.slice(7, -1).split(","); + return decompose(+value[0], +value[1], +value[2], +value[3], +value[4], +value[5]); +} + +function parseSvg(value) { + if (value == null) return identity$2; + if (!svgNode) svgNode = document.createElementNS("http://www.w3.org/2000/svg", "g"); + svgNode.setAttribute("transform", value); + if (!(value = svgNode.transform.baseVal.consolidate())) return identity$2; + value = value.matrix; + return decompose(value.a, value.b, value.c, value.d, value.e, value.f); +} + +function interpolateTransform(parse, pxComma, pxParen, degParen) { + + function pop(s) { + return s.length ? s.pop() + " " : ""; + } + + function translate(xa, ya, xb, yb, s, q) { + if (xa !== xb || ya !== yb) { + var i = s.push("translate(", null, pxComma, null, pxParen); + q.push({i: i - 4, x: reinterpolate(xa, xb)}, {i: i - 2, x: reinterpolate(ya, yb)}); + } else if (xb || yb) { + s.push("translate(" + xb + pxComma + yb + pxParen); + } + } + + function rotate(a, b, s, q) { + if (a !== b) { + if (a - b > 180) b += 360; else if (b - a > 180) a += 360; // shortest path + q.push({i: s.push(pop(s) + "rotate(", null, degParen) - 2, x: reinterpolate(a, b)}); + } else if (b) { + s.push(pop(s) + "rotate(" + b + degParen); + } + } + + function skewX(a, b, s, q) { + if (a !== b) { + q.push({i: s.push(pop(s) + "skewX(", null, degParen) - 2, x: reinterpolate(a, b)}); + } else if (b) { + s.push(pop(s) + "skewX(" + b + degParen); + } + } + + function scale(xa, ya, xb, yb, s, q) { + if (xa !== xb || ya !== yb) { + var i = s.push(pop(s) + "scale(", null, ",", null, ")"); + q.push({i: i - 4, x: reinterpolate(xa, xb)}, {i: i - 2, x: reinterpolate(ya, yb)}); + } else if (xb !== 1 || yb !== 1) { + s.push(pop(s) + "scale(" + xb + "," + yb + ")"); + } + } + + return function(a, b) { + var s = [], // string constants and placeholders + q = []; // number interpolators + a = parse(a), b = parse(b); + translate(a.translateX, a.translateY, b.translateX, b.translateY, s, q); + rotate(a.rotate, b.rotate, s, q); + skewX(a.skewX, b.skewX, s, q); + scale(a.scaleX, a.scaleY, b.scaleX, b.scaleY, s, q); + a = b = null; // gc + return function(t) { + var i = -1, n = q.length, o; + while (++i < n) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; + }; +} + +var interpolateTransformCss = interpolateTransform(parseCss, "px, ", "px)", "deg)"); +var interpolateTransformSvg = interpolateTransform(parseSvg, ", ", ")", ")"); + +var rho = Math.SQRT2; +var rho2 = 2; +var rho4 = 4; +var epsilon2 = 1e-12; + +function cosh(x) { + return ((x = Math.exp(x)) + 1 / x) / 2; +} + +function sinh(x) { + return ((x = Math.exp(x)) - 1 / x) / 2; +} + +function tanh(x) { + return ((x = Math.exp(2 * x)) - 1) / (x + 1); +} + +// p0 = [ux0, uy0, w0] +// p1 = [ux1, uy1, w1] +function interpolateZoom(p0, p1) { + var ux0 = p0[0], uy0 = p0[1], w0 = p0[2], + ux1 = p1[0], uy1 = p1[1], w1 = p1[2], + dx = ux1 - ux0, + dy = uy1 - uy0, + d2 = dx * dx + dy * dy, + i, + S; + + // Special case for u0 ≅ u1. + if (d2 < epsilon2) { + S = Math.log(w1 / w0) / rho; + i = function(t) { + return [ + ux0 + t * dx, + uy0 + t * dy, + w0 * Math.exp(rho * t * S) + ]; + }; + } + + // General case. + else { + var d1 = Math.sqrt(d2), + b0 = (w1 * w1 - w0 * w0 + rho4 * d2) / (2 * w0 * rho2 * d1), + b1 = (w1 * w1 - w0 * w0 - rho4 * d2) / (2 * w1 * rho2 * d1), + r0 = Math.log(Math.sqrt(b0 * b0 + 1) - b0), + r1 = Math.log(Math.sqrt(b1 * b1 + 1) - b1); + S = (r1 - r0) / rho; + i = function(t) { + var s = t * S, + coshr0 = cosh(r0), + u = w0 / (rho2 * d1) * (coshr0 * tanh(rho * s + r0) - sinh(r0)); + return [ + ux0 + u * dx, + uy0 + u * dy, + w0 * coshr0 / cosh(rho * s + r0) + ]; + }; + } + + i.duration = S * 1000; + + return i; +} + +function hsl$1(hue$$1) { + return function(start, end) { + var h = hue$$1((start = hsl(start)).h, (end = hsl(end)).h), + s = nogamma(start.s, end.s), + l = nogamma(start.l, end.l), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.h = h(t); + start.s = s(t); + start.l = l(t); + start.opacity = opacity(t); + return start + ""; + }; + } +} + +var hsl$2 = hsl$1(hue); +var hslLong = hsl$1(nogamma); + +function lab$1(start, end) { + var l = nogamma((start = lab(start)).l, (end = lab(end)).l), + a = nogamma(start.a, end.a), + b = nogamma(start.b, end.b), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.l = l(t); + start.a = a(t); + start.b = b(t); + start.opacity = opacity(t); + return start + ""; + }; +} + +function hcl$1(hue$$1) { + return function(start, end) { + var h = hue$$1((start = hcl(start)).h, (end = hcl(end)).h), + c = nogamma(start.c, end.c), + l = nogamma(start.l, end.l), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.h = h(t); + start.c = c(t); + start.l = l(t); + start.opacity = opacity(t); + return start + ""; + }; + } +} + +var hcl$2 = hcl$1(hue); +var hclLong = hcl$1(nogamma); + +function cubehelix$1(hue$$1) { + return (function cubehelixGamma(y) { + y = +y; + + function cubehelix$$1(start, end) { + var h = hue$$1((start = cubehelix(start)).h, (end = cubehelix(end)).h), + s = nogamma(start.s, end.s), + l = nogamma(start.l, end.l), + opacity = nogamma(start.opacity, end.opacity); + return function(t) { + start.h = h(t); + start.s = s(t); + start.l = l(Math.pow(t, y)); + start.opacity = opacity(t); + return start + ""; + }; + } + + cubehelix$$1.gamma = cubehelixGamma; + + return cubehelix$$1; + })(1); +} + +var cubehelix$2 = cubehelix$1(hue); +var cubehelixLong = cubehelix$1(nogamma); + +function quantize(interpolator, n) { + var samples = new Array(n); + for (var i = 0; i < n; ++i) samples[i] = interpolator(i / (n - 1)); + return samples; +} + +var frame = 0; +var timeout = 0; +var interval = 0; +var pokeDelay = 1000; +var taskHead; +var taskTail; +var clockLast = 0; +var clockNow = 0; +var clockSkew = 0; +var clock = typeof performance === "object" && performance.now ? performance : Date; +var setFrame = typeof window === "object" && window.requestAnimationFrame ? window.requestAnimationFrame.bind(window) : function(f) { setTimeout(f, 17); }; + +function now() { + return clockNow || (setFrame(clearNow), clockNow = clock.now() + clockSkew); +} + +function clearNow() { + clockNow = 0; +} + +function Timer() { + this._call = + this._time = + this._next = null; +} + +Timer.prototype = timer.prototype = { + constructor: Timer, + restart: function(callback, delay, time) { + if (typeof callback !== "function") throw new TypeError("callback is not a function"); + time = (time == null ? now() : +time) + (delay == null ? 0 : +delay); + if (!this._next && taskTail !== this) { + if (taskTail) taskTail._next = this; + else taskHead = this; + taskTail = this; + } + this._call = callback; + this._time = time; + sleep(); + }, + stop: function() { + if (this._call) { + this._call = null; + this._time = Infinity; + sleep(); + } + } +}; + +function timer(callback, delay, time) { + var t = new Timer; + t.restart(callback, delay, time); + return t; +} + +function timerFlush() { + now(); // Get the current time, if not already set. + ++frame; // Pretend we’ve set an alarm, if we haven’t already. + var t = taskHead, e; + while (t) { + if ((e = clockNow - t._time) >= 0) t._call.call(null, e); + t = t._next; + } + --frame; +} + +function wake() { + clockNow = (clockLast = clock.now()) + clockSkew; + frame = timeout = 0; + try { + timerFlush(); + } finally { + frame = 0; + nap(); + clockNow = 0; + } +} + +function poke() { + var now = clock.now(), delay = now - clockLast; + if (delay > pokeDelay) clockSkew -= delay, clockLast = now; +} + +function nap() { + var t0, t1 = taskHead, t2, time = Infinity; + while (t1) { + if (t1._call) { + if (time > t1._time) time = t1._time; + t0 = t1, t1 = t1._next; + } else { + t2 = t1._next, t1._next = null; + t1 = t0 ? t0._next = t2 : taskHead = t2; + } + } + taskTail = t0; + sleep(time); +} + +function sleep(time) { + if (frame) return; // Soonest alarm already set, or will be. + if (timeout) timeout = clearTimeout(timeout); + var delay = time - clockNow; // Strictly less than if we recomputed clockNow. + if (delay > 24) { + if (time < Infinity) timeout = setTimeout(wake, time - clock.now() - clockSkew); + if (interval) interval = clearInterval(interval); + } else { + if (!interval) clockLast = clock.now(), interval = setInterval(poke, pokeDelay); + frame = 1, setFrame(wake); + } +} + +function timeout$1(callback, delay, time) { + var t = new Timer; + delay = delay == null ? 0 : +delay; + t.restart(function(elapsed) { + t.stop(); + callback(elapsed + delay); + }, delay, time); + return t; +} + +function interval$1(callback, delay, time) { + var t = new Timer, total = delay; + if (delay == null) return t.restart(callback, delay, time), t; + delay = +delay, time = time == null ? now() : +time; + t.restart(function tick(elapsed) { + elapsed += total; + t.restart(tick, total += delay, time); + callback(elapsed); + }, delay, time); + return t; +} + +var emptyOn = dispatch("start", "end", "interrupt"); +var emptyTween = []; + +var CREATED = 0; +var SCHEDULED = 1; +var STARTING = 2; +var STARTED = 3; +var RUNNING = 4; +var ENDING = 5; +var ENDED = 6; + +function schedule(node, name, id, index, group, timing) { + var schedules = node.__transition; + if (!schedules) node.__transition = {}; + else if (id in schedules) return; + create$1(node, id, { + name: name, + index: index, // For context during callback. + group: group, // For context during callback. + on: emptyOn, + tween: emptyTween, + time: timing.time, + delay: timing.delay, + duration: timing.duration, + ease: timing.ease, + timer: null, + state: CREATED + }); +} + +function init(node, id) { + var schedule = get$1(node, id); + if (schedule.state > CREATED) throw new Error("too late; already scheduled"); + return schedule; +} + +function set$1(node, id) { + var schedule = get$1(node, id); + if (schedule.state > STARTING) throw new Error("too late; already started"); + return schedule; +} + +function get$1(node, id) { + var schedule = node.__transition; + if (!schedule || !(schedule = schedule[id])) throw new Error("transition not found"); + return schedule; +} + +function create$1(node, id, self) { + var schedules = node.__transition, + tween; + + // Initialize the self timer when the transition is created. + // Note the actual delay is not known until the first callback! + schedules[id] = self; + self.timer = timer(schedule, 0, self.time); + + function schedule(elapsed) { + self.state = SCHEDULED; + self.timer.restart(start, self.delay, self.time); + + // If the elapsed delay is less than our first sleep, start immediately. + if (self.delay <= elapsed) start(elapsed - self.delay); + } + + function start(elapsed) { + var i, j, n, o; + + // If the state is not SCHEDULED, then we previously errored on start. + if (self.state !== SCHEDULED) return stop(); + + for (i in schedules) { + o = schedules[i]; + if (o.name !== self.name) continue; + + // While this element already has a starting transition during this frame, + // defer starting an interrupting transition until that transition has a + // chance to tick (and possibly end); see d3/d3-transition#54! + if (o.state === STARTED) return timeout$1(start); + + // Interrupt the active transition, if any. + // Dispatch the interrupt event. + if (o.state === RUNNING) { + o.state = ENDED; + o.timer.stop(); + o.on.call("interrupt", node, node.__data__, o.index, o.group); + delete schedules[i]; + } + + // Cancel any pre-empted transitions. No interrupt event is dispatched + // because the cancelled transitions never started. Note that this also + // removes this transition from the pending list! + else if (+i < id) { + o.state = ENDED; + o.timer.stop(); + delete schedules[i]; + } + } + + // Defer the first tick to end of the current frame; see d3/d3#1576. + // Note the transition may be canceled after start and before the first tick! + // Note this must be scheduled before the start event; see d3/d3-transition#16! + // Assuming this is successful, subsequent callbacks go straight to tick. + timeout$1(function() { + if (self.state === STARTED) { + self.state = RUNNING; + self.timer.restart(tick, self.delay, self.time); + tick(elapsed); + } + }); + + // Dispatch the start event. + // Note this must be done before the tween are initialized. + self.state = STARTING; + self.on.call("start", node, node.__data__, self.index, self.group); + if (self.state !== STARTING) return; // interrupted + self.state = STARTED; + + // Initialize the tween, deleting null tween. + tween = new Array(n = self.tween.length); + for (i = 0, j = -1; i < n; ++i) { + if (o = self.tween[i].value.call(node, node.__data__, self.index, self.group)) { + tween[++j] = o; + } + } + tween.length = j + 1; + } + + function tick(elapsed) { + var t = elapsed < self.duration ? self.ease.call(null, elapsed / self.duration) : (self.timer.restart(stop), self.state = ENDING, 1), + i = -1, + n = tween.length; + + while (++i < n) { + tween[i].call(null, t); + } + + // Dispatch the end event. + if (self.state === ENDING) { + self.on.call("end", node, node.__data__, self.index, self.group); + stop(); + } + } + + function stop() { + self.state = ENDED; + self.timer.stop(); + delete schedules[id]; + for (var i in schedules) return; // eslint-disable-line no-unused-vars + delete node.__transition; + } +} + +function interrupt(node, name) { + var schedules = node.__transition, + schedule$$1, + active, + empty = true, + i; + + if (!schedules) return; + + name = name == null ? null : name + ""; + + for (i in schedules) { + if ((schedule$$1 = schedules[i]).name !== name) { empty = false; continue; } + active = schedule$$1.state > STARTING && schedule$$1.state < ENDING; + schedule$$1.state = ENDED; + schedule$$1.timer.stop(); + if (active) schedule$$1.on.call("interrupt", node, node.__data__, schedule$$1.index, schedule$$1.group); + delete schedules[i]; + } + + if (empty) delete node.__transition; +} + +function selection_interrupt(name) { + return this.each(function() { + interrupt(this, name); + }); +} + +function tweenRemove(id, name) { + var tween0, tween1; + return function() { + var schedule$$1 = set$1(this, id), + tween = schedule$$1.tween; + + // If this node shared tween with the previous node, + // just assign the updated shared tween and we’re done! + // Otherwise, copy-on-write. + if (tween !== tween0) { + tween1 = tween0 = tween; + for (var i = 0, n = tween1.length; i < n; ++i) { + if (tween1[i].name === name) { + tween1 = tween1.slice(); + tween1.splice(i, 1); + break; + } + } + } + + schedule$$1.tween = tween1; + }; +} + +function tweenFunction(id, name, value) { + var tween0, tween1; + if (typeof value !== "function") throw new Error; + return function() { + var schedule$$1 = set$1(this, id), + tween = schedule$$1.tween; + + // If this node shared tween with the previous node, + // just assign the updated shared tween and we’re done! + // Otherwise, copy-on-write. + if (tween !== tween0) { + tween1 = (tween0 = tween).slice(); + for (var t = {name: name, value: value}, i = 0, n = tween1.length; i < n; ++i) { + if (tween1[i].name === name) { + tween1[i] = t; + break; + } + } + if (i === n) tween1.push(t); + } + + schedule$$1.tween = tween1; + }; +} + +function transition_tween(name, value) { + var id = this._id; + + name += ""; + + if (arguments.length < 2) { + var tween = get$1(this.node(), id).tween; + for (var i = 0, n = tween.length, t; i < n; ++i) { + if ((t = tween[i]).name === name) { + return t.value; + } + } + return null; + } + + return this.each((value == null ? tweenRemove : tweenFunction)(id, name, value)); +} + +function tweenValue(transition, name, value) { + var id = transition._id; + + transition.each(function() { + var schedule$$1 = set$1(this, id); + (schedule$$1.value || (schedule$$1.value = {}))[name] = value.apply(this, arguments); + }); + + return function(node) { + return get$1(node, id).value[name]; + }; +} + +function interpolate(a, b) { + var c; + return (typeof b === "number" ? reinterpolate + : b instanceof color ? interpolateRgb + : (c = color(b)) ? (b = c, interpolateRgb) + : interpolateString)(a, b); +} + +function attrRemove$1(name) { + return function() { + this.removeAttribute(name); + }; +} + +function attrRemoveNS$1(fullname) { + return function() { + this.removeAttributeNS(fullname.space, fullname.local); + }; +} + +function attrConstant$1(name, interpolate$$1, value1) { + var value00, + interpolate0; + return function() { + var value0 = this.getAttribute(name); + return value0 === value1 ? null + : value0 === value00 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value1); + }; +} + +function attrConstantNS$1(fullname, interpolate$$1, value1) { + var value00, + interpolate0; + return function() { + var value0 = this.getAttributeNS(fullname.space, fullname.local); + return value0 === value1 ? null + : value0 === value00 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value1); + }; +} + +function attrFunction$1(name, interpolate$$1, value) { + var value00, + value10, + interpolate0; + return function() { + var value0, value1 = value(this); + if (value1 == null) return void this.removeAttribute(name); + value0 = this.getAttribute(name); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function attrFunctionNS$1(fullname, interpolate$$1, value) { + var value00, + value10, + interpolate0; + return function() { + var value0, value1 = value(this); + if (value1 == null) return void this.removeAttributeNS(fullname.space, fullname.local); + value0 = this.getAttributeNS(fullname.space, fullname.local); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function transition_attr(name, value) { + var fullname = namespace(name), i = fullname === "transform" ? interpolateTransformSvg : interpolate; + return this.attrTween(name, typeof value === "function" + ? (fullname.local ? attrFunctionNS$1 : attrFunction$1)(fullname, i, tweenValue(this, "attr." + name, value)) + : value == null ? (fullname.local ? attrRemoveNS$1 : attrRemove$1)(fullname) + : (fullname.local ? attrConstantNS$1 : attrConstant$1)(fullname, i, value + "")); +} + +function attrTweenNS(fullname, value) { + function tween() { + var node = this, i = value.apply(node, arguments); + return i && function(t) { + node.setAttributeNS(fullname.space, fullname.local, i(t)); + }; + } + tween._value = value; + return tween; +} + +function attrTween(name, value) { + function tween() { + var node = this, i = value.apply(node, arguments); + return i && function(t) { + node.setAttribute(name, i(t)); + }; + } + tween._value = value; + return tween; +} + +function transition_attrTween(name, value) { + var key = "attr." + name; + if (arguments.length < 2) return (key = this.tween(key)) && key._value; + if (value == null) return this.tween(key, null); + if (typeof value !== "function") throw new Error; + var fullname = namespace(name); + return this.tween(key, (fullname.local ? attrTweenNS : attrTween)(fullname, value)); +} + +function delayFunction(id, value) { + return function() { + init(this, id).delay = +value.apply(this, arguments); + }; +} + +function delayConstant(id, value) { + return value = +value, function() { + init(this, id).delay = value; + }; +} + +function transition_delay(value) { + var id = this._id; + + return arguments.length + ? this.each((typeof value === "function" + ? delayFunction + : delayConstant)(id, value)) + : get$1(this.node(), id).delay; +} + +function durationFunction(id, value) { + return function() { + set$1(this, id).duration = +value.apply(this, arguments); + }; +} + +function durationConstant(id, value) { + return value = +value, function() { + set$1(this, id).duration = value; + }; +} + +function transition_duration(value) { + var id = this._id; + + return arguments.length + ? this.each((typeof value === "function" + ? durationFunction + : durationConstant)(id, value)) + : get$1(this.node(), id).duration; +} + +function easeConstant(id, value) { + if (typeof value !== "function") throw new Error; + return function() { + set$1(this, id).ease = value; + }; +} + +function transition_ease(value) { + var id = this._id; + + return arguments.length + ? this.each(easeConstant(id, value)) + : get$1(this.node(), id).ease; +} + +function transition_filter(match) { + if (typeof match !== "function") match = matcher$1(match); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = [], node, i = 0; i < n; ++i) { + if ((node = group[i]) && match.call(node, node.__data__, i, group)) { + subgroup.push(node); + } + } + } + + return new Transition(subgroups, this._parents, this._name, this._id); +} + +function transition_merge(transition$$1) { + if (transition$$1._id !== this._id) throw new Error; + + for (var groups0 = this._groups, groups1 = transition$$1._groups, m0 = groups0.length, m1 = groups1.length, m = Math.min(m0, m1), merges = new Array(m0), j = 0; j < m; ++j) { + for (var group0 = groups0[j], group1 = groups1[j], n = group0.length, merge = merges[j] = new Array(n), node, i = 0; i < n; ++i) { + if (node = group0[i] || group1[i]) { + merge[i] = node; + } + } + } + + for (; j < m0; ++j) { + merges[j] = groups0[j]; + } + + return new Transition(merges, this._parents, this._name, this._id); +} + +function start(name) { + return (name + "").trim().split(/^|\s+/).every(function(t) { + var i = t.indexOf("."); + if (i >= 0) t = t.slice(0, i); + return !t || t === "start"; + }); +} + +function onFunction(id, name, listener) { + var on0, on1, sit = start(name) ? init : set$1; + return function() { + var schedule$$1 = sit(this, id), + on = schedule$$1.on; + + // If this node shared a dispatch with the previous node, + // just assign the updated shared dispatch and we’re done! + // Otherwise, copy-on-write. + if (on !== on0) (on1 = (on0 = on).copy()).on(name, listener); + + schedule$$1.on = on1; + }; +} + +function transition_on(name, listener) { + var id = this._id; + + return arguments.length < 2 + ? get$1(this.node(), id).on.on(name) + : this.each(onFunction(id, name, listener)); +} + +function removeFunction(id) { + return function() { + var parent = this.parentNode; + for (var i in this.__transition) if (+i !== id) return; + if (parent) parent.removeChild(this); + }; +} + +function transition_remove() { + return this.on("end.remove", removeFunction(this._id)); +} + +function transition_select(select) { + var name = this._name, + id = this._id; + + if (typeof select !== "function") select = selector(select); + + for (var groups = this._groups, m = groups.length, subgroups = new Array(m), j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, subgroup = subgroups[j] = new Array(n), node, subnode, i = 0; i < n; ++i) { + if ((node = group[i]) && (subnode = select.call(node, node.__data__, i, group))) { + if ("__data__" in node) subnode.__data__ = node.__data__; + subgroup[i] = subnode; + schedule(subgroup[i], name, id, i, subgroup, get$1(node, id)); + } + } + } + + return new Transition(subgroups, this._parents, name, id); +} + +function transition_selectAll(select) { + var name = this._name, + id = this._id; + + if (typeof select !== "function") select = selectorAll(select); + + for (var groups = this._groups, m = groups.length, subgroups = [], parents = [], j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + for (var children = select.call(node, node.__data__, i, group), child, inherit = get$1(node, id), k = 0, l = children.length; k < l; ++k) { + if (child = children[k]) { + schedule(child, name, id, k, children, inherit); + } + } + subgroups.push(children); + parents.push(node); + } + } + } + + return new Transition(subgroups, parents, name, id); +} + +var Selection$1 = selection.prototype.constructor; + +function transition_selection() { + return new Selection$1(this._groups, this._parents); +} + +function styleRemove$1(name, interpolate$$1) { + var value00, + value10, + interpolate0; + return function() { + var value0 = styleValue(this, name), + value1 = (this.style.removeProperty(name), styleValue(this, name)); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function styleRemoveEnd(name) { + return function() { + this.style.removeProperty(name); + }; +} + +function styleConstant$1(name, interpolate$$1, value1) { + var value00, + interpolate0; + return function() { + var value0 = styleValue(this, name); + return value0 === value1 ? null + : value0 === value00 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value1); + }; +} + +function styleFunction$1(name, interpolate$$1, value) { + var value00, + value10, + interpolate0; + return function() { + var value0 = styleValue(this, name), + value1 = value(this); + if (value1 == null) value1 = (this.style.removeProperty(name), styleValue(this, name)); + return value0 === value1 ? null + : value0 === value00 && value1 === value10 ? interpolate0 + : interpolate0 = interpolate$$1(value00 = value0, value10 = value1); + }; +} + +function transition_style(name, value, priority) { + var i = (name += "") === "transform" ? interpolateTransformCss : interpolate; + return value == null ? this + .styleTween(name, styleRemove$1(name, i)) + .on("end.style." + name, styleRemoveEnd(name)) + : this.styleTween(name, typeof value === "function" + ? styleFunction$1(name, i, tweenValue(this, "style." + name, value)) + : styleConstant$1(name, i, value + ""), priority); +} + +function styleTween(name, value, priority) { + function tween() { + var node = this, i = value.apply(node, arguments); + return i && function(t) { + node.style.setProperty(name, i(t), priority); + }; + } + tween._value = value; + return tween; +} + +function transition_styleTween(name, value, priority) { + var key = "style." + (name += ""); + if (arguments.length < 2) return (key = this.tween(key)) && key._value; + if (value == null) return this.tween(key, null); + if (typeof value !== "function") throw new Error; + return this.tween(key, styleTween(name, value, priority == null ? "" : priority)); +} + +function textConstant$1(value) { + return function() { + this.textContent = value; + }; +} + +function textFunction$1(value) { + return function() { + var value1 = value(this); + this.textContent = value1 == null ? "" : value1; + }; +} + +function transition_text(value) { + return this.tween("text", typeof value === "function" + ? textFunction$1(tweenValue(this, "text", value)) + : textConstant$1(value == null ? "" : value + "")); +} + +function transition_transition() { + var name = this._name, + id0 = this._id, + id1 = newId(); + + for (var groups = this._groups, m = groups.length, j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + var inherit = get$1(node, id0); + schedule(node, name, id1, i, group, { + time: inherit.time + inherit.delay + inherit.duration, + delay: 0, + duration: inherit.duration, + ease: inherit.ease + }); + } + } + } + + return new Transition(groups, this._parents, name, id1); +} + +var id = 0; + +function Transition(groups, parents, name, id) { + this._groups = groups; + this._parents = parents; + this._name = name; + this._id = id; +} + +function transition(name) { + return selection().transition(name); +} + +function newId() { + return ++id; +} + +var selection_prototype = selection.prototype; + +Transition.prototype = transition.prototype = { + constructor: Transition, + select: transition_select, + selectAll: transition_selectAll, + filter: transition_filter, + merge: transition_merge, + selection: transition_selection, + transition: transition_transition, + call: selection_prototype.call, + nodes: selection_prototype.nodes, + node: selection_prototype.node, + size: selection_prototype.size, + empty: selection_prototype.empty, + each: selection_prototype.each, + on: transition_on, + attr: transition_attr, + attrTween: transition_attrTween, + style: transition_style, + styleTween: transition_styleTween, + text: transition_text, + remove: transition_remove, + tween: transition_tween, + delay: transition_delay, + duration: transition_duration, + ease: transition_ease +}; + +function linear$1(t) { + return +t; +} + +function quadIn(t) { + return t * t; +} + +function quadOut(t) { + return t * (2 - t); +} + +function quadInOut(t) { + return ((t *= 2) <= 1 ? t * t : --t * (2 - t) + 1) / 2; +} + +function cubicIn(t) { + return t * t * t; +} + +function cubicOut(t) { + return --t * t * t + 1; +} + +function cubicInOut(t) { + return ((t *= 2) <= 1 ? t * t * t : (t -= 2) * t * t + 2) / 2; +} + +var exponent = 3; + +var polyIn = (function custom(e) { + e = +e; + + function polyIn(t) { + return Math.pow(t, e); + } + + polyIn.exponent = custom; + + return polyIn; +})(exponent); + +var polyOut = (function custom(e) { + e = +e; + + function polyOut(t) { + return 1 - Math.pow(1 - t, e); + } + + polyOut.exponent = custom; + + return polyOut; +})(exponent); + +var polyInOut = (function custom(e) { + e = +e; + + function polyInOut(t) { + return ((t *= 2) <= 1 ? Math.pow(t, e) : 2 - Math.pow(2 - t, e)) / 2; + } + + polyInOut.exponent = custom; + + return polyInOut; +})(exponent); + +var pi = Math.PI; +var halfPi = pi / 2; + +function sinIn(t) { + return 1 - Math.cos(t * halfPi); +} + +function sinOut(t) { + return Math.sin(t * halfPi); +} + +function sinInOut(t) { + return (1 - Math.cos(pi * t)) / 2; +} + +function expIn(t) { + return Math.pow(2, 10 * t - 10); +} + +function expOut(t) { + return 1 - Math.pow(2, -10 * t); +} + +function expInOut(t) { + return ((t *= 2) <= 1 ? Math.pow(2, 10 * t - 10) : 2 - Math.pow(2, 10 - 10 * t)) / 2; +} + +function circleIn(t) { + return 1 - Math.sqrt(1 - t * t); +} + +function circleOut(t) { + return Math.sqrt(1 - --t * t); +} + +function circleInOut(t) { + return ((t *= 2) <= 1 ? 1 - Math.sqrt(1 - t * t) : Math.sqrt(1 - (t -= 2) * t) + 1) / 2; +} + +var b1 = 4 / 11; +var b2 = 6 / 11; +var b3 = 8 / 11; +var b4 = 3 / 4; +var b5 = 9 / 11; +var b6 = 10 / 11; +var b7 = 15 / 16; +var b8 = 21 / 22; +var b9 = 63 / 64; +var b0 = 1 / b1 / b1; + +function bounceIn(t) { + return 1 - bounceOut(1 - t); +} + +function bounceOut(t) { + return (t = +t) < b1 ? b0 * t * t : t < b3 ? b0 * (t -= b2) * t + b4 : t < b6 ? b0 * (t -= b5) * t + b7 : b0 * (t -= b8) * t + b9; +} + +function bounceInOut(t) { + return ((t *= 2) <= 1 ? 1 - bounceOut(1 - t) : bounceOut(t - 1) + 1) / 2; +} + +var overshoot = 1.70158; + +var backIn = (function custom(s) { + s = +s; + + function backIn(t) { + return t * t * ((s + 1) * t - s); + } + + backIn.overshoot = custom; + + return backIn; +})(overshoot); + +var backOut = (function custom(s) { + s = +s; + + function backOut(t) { + return --t * t * ((s + 1) * t + s) + 1; + } + + backOut.overshoot = custom; + + return backOut; +})(overshoot); + +var backInOut = (function custom(s) { + s = +s; + + function backInOut(t) { + return ((t *= 2) < 1 ? t * t * ((s + 1) * t - s) : (t -= 2) * t * ((s + 1) * t + s) + 2) / 2; + } + + backInOut.overshoot = custom; + + return backInOut; +})(overshoot); + +var tau = 2 * Math.PI; +var amplitude = 1; +var period = 0.3; + +var elasticIn = (function custom(a, p) { + var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau); + + function elasticIn(t) { + return a * Math.pow(2, 10 * --t) * Math.sin((s - t) / p); + } + + elasticIn.amplitude = function(a) { return custom(a, p * tau); }; + elasticIn.period = function(p) { return custom(a, p); }; + + return elasticIn; +})(amplitude, period); + +var elasticOut = (function custom(a, p) { + var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau); + + function elasticOut(t) { + return 1 - a * Math.pow(2, -10 * (t = +t)) * Math.sin((t + s) / p); + } + + elasticOut.amplitude = function(a) { return custom(a, p * tau); }; + elasticOut.period = function(p) { return custom(a, p); }; + + return elasticOut; +})(amplitude, period); + +var elasticInOut = (function custom(a, p) { + var s = Math.asin(1 / (a = Math.max(1, a))) * (p /= tau); + + function elasticInOut(t) { + return ((t = t * 2 - 1) < 0 + ? a * Math.pow(2, 10 * t) * Math.sin((s - t) / p) + : 2 - a * Math.pow(2, -10 * t) * Math.sin((s + t) / p)) / 2; + } + + elasticInOut.amplitude = function(a) { return custom(a, p * tau); }; + elasticInOut.period = function(p) { return custom(a, p); }; + + return elasticInOut; +})(amplitude, period); + +var defaultTiming = { + time: null, // Set on use. + delay: 0, + duration: 250, + ease: cubicInOut +}; + +function inherit(node, id) { + var timing; + while (!(timing = node.__transition) || !(timing = timing[id])) { + if (!(node = node.parentNode)) { + return defaultTiming.time = now(), defaultTiming; + } + } + return timing; +} + +function selection_transition(name) { + var id, + timing; + + if (name instanceof Transition) { + id = name._id, name = name._name; + } else { + id = newId(), (timing = defaultTiming).time = now(), name = name == null ? null : name + ""; + } + + for (var groups = this._groups, m = groups.length, j = 0; j < m; ++j) { + for (var group = groups[j], n = group.length, node, i = 0; i < n; ++i) { + if (node = group[i]) { + schedule(node, name, id, i, group, timing || inherit(node, id)); + } + } + } + + return new Transition(groups, this._parents, name, id); +} + +selection.prototype.interrupt = selection_interrupt; +selection.prototype.transition = selection_transition; + +var root$1 = [null]; + +function active(node, name) { + var schedules = node.__transition, + schedule$$1, + i; + + if (schedules) { + name = name == null ? null : name + ""; + for (i in schedules) { + if ((schedule$$1 = schedules[i]).state > SCHEDULED && schedule$$1.name === name) { + return new Transition([[node]], root$1, name, +i); + } + } + } + + return null; +} + +function constant$4(x) { + return function() { + return x; + }; +} + +function BrushEvent(target, type, selection) { + this.target = target; + this.type = type; + this.selection = selection; +} + +function nopropagation$1() { + exports.event.stopImmediatePropagation(); +} + +function noevent$1() { + exports.event.preventDefault(); + exports.event.stopImmediatePropagation(); +} + +var MODE_DRAG = {name: "drag"}; +var MODE_SPACE = {name: "space"}; +var MODE_HANDLE = {name: "handle"}; +var MODE_CENTER = {name: "center"}; + +var X = { + name: "x", + handles: ["e", "w"].map(type), + input: function(x, e) { return x && [[x[0], e[0][1]], [x[1], e[1][1]]]; }, + output: function(xy) { return xy && [xy[0][0], xy[1][0]]; } +}; + +var Y = { + name: "y", + handles: ["n", "s"].map(type), + input: function(y, e) { return y && [[e[0][0], y[0]], [e[1][0], y[1]]]; }, + output: function(xy) { return xy && [xy[0][1], xy[1][1]]; } +}; + +var XY = { + name: "xy", + handles: ["n", "e", "s", "w", "nw", "ne", "se", "sw"].map(type), + input: function(xy) { return xy; }, + output: function(xy) { return xy; } +}; + +var cursors = { + overlay: "crosshair", + selection: "move", + n: "ns-resize", + e: "ew-resize", + s: "ns-resize", + w: "ew-resize", + nw: "nwse-resize", + ne: "nesw-resize", + se: "nwse-resize", + sw: "nesw-resize" +}; + +var flipX = { + e: "w", + w: "e", + nw: "ne", + ne: "nw", + se: "sw", + sw: "se" +}; + +var flipY = { + n: "s", + s: "n", + nw: "sw", + ne: "se", + se: "ne", + sw: "nw" +}; + +var signsX = { + overlay: +1, + selection: +1, + n: null, + e: +1, + s: null, + w: -1, + nw: -1, + ne: +1, + se: +1, + sw: -1 +}; + +var signsY = { + overlay: +1, + selection: +1, + n: -1, + e: null, + s: +1, + w: null, + nw: -1, + ne: -1, + se: +1, + sw: +1 +}; + +function type(t) { + return {type: t}; +} + +// Ignore right-click, since that should open the context menu. +function defaultFilter() { + return !exports.event.button; +} + +function defaultExtent() { + var svg = this.ownerSVGElement || this; + return [[0, 0], [svg.width.baseVal.value, svg.height.baseVal.value]]; +} + +// Like d3.local, but with the name “__brush” rather than auto-generated. +function local(node) { + while (!node.__brush) if (!(node = node.parentNode)) return; + return node.__brush; +} + +function empty(extent) { + return extent[0][0] === extent[1][0] + || extent[0][1] === extent[1][1]; +} + +function brushSelection(node) { + var state = node.__brush; + return state ? state.dim.output(state.selection) : null; +} + +function brushX() { + return brush$1(X); +} + +function brushY() { + return brush$1(Y); +} + +function brush() { + return brush$1(XY); +} + +function brush$1(dim) { + var extent = defaultExtent, + filter = defaultFilter, + listeners = dispatch(brush, "start", "brush", "end"), + handleSize = 6, + touchending; + + function brush(group) { + var overlay = group + .property("__brush", initialize) + .selectAll(".overlay") + .data([type("overlay")]); + + overlay.enter().append("rect") + .attr("class", "overlay") + .attr("pointer-events", "all") + .attr("cursor", cursors.overlay) + .merge(overlay) + .each(function() { + var extent = local(this).extent; + select(this) + .attr("x", extent[0][0]) + .attr("y", extent[0][1]) + .attr("width", extent[1][0] - extent[0][0]) + .attr("height", extent[1][1] - extent[0][1]); + }); + + group.selectAll(".selection") + .data([type("selection")]) + .enter().append("rect") + .attr("class", "selection") + .attr("cursor", cursors.selection) + .attr("fill", "#777") + .attr("fill-opacity", 0.3) + .attr("stroke", "#fff") + .attr("shape-rendering", "crispEdges"); + + var handle = group.selectAll(".handle") + .data(dim.handles, function(d) { return d.type; }); + + handle.exit().remove(); + + handle.enter().append("rect") + .attr("class", function(d) { return "handle handle--" + d.type; }) + .attr("cursor", function(d) { return cursors[d.type]; }); + + group + .each(redraw) + .attr("fill", "none") + .attr("pointer-events", "all") + .style("-webkit-tap-highlight-color", "rgba(0,0,0,0)") + .on("mousedown.brush touchstart.brush", started); + } + + brush.move = function(group, selection) { + if (group.selection) { + group + .on("start.brush", function() { emitter(this, arguments).beforestart().start(); }) + .on("interrupt.brush end.brush", function() { emitter(this, arguments).end(); }) + .tween("brush", function() { + var that = this, + state = that.__brush, + emit = emitter(that, arguments), + selection0 = state.selection, + selection1 = dim.input(typeof selection === "function" ? selection.apply(this, arguments) : selection, state.extent), + i = interpolateValue(selection0, selection1); + + function tween(t) { + state.selection = t === 1 && empty(selection1) ? null : i(t); + redraw.call(that); + emit.brush(); + } + + return selection0 && selection1 ? tween : tween(1); + }); + } else { + group + .each(function() { + var that = this, + args = arguments, + state = that.__brush, + selection1 = dim.input(typeof selection === "function" ? selection.apply(that, args) : selection, state.extent), + emit = emitter(that, args).beforestart(); + + interrupt(that); + state.selection = selection1 == null || empty(selection1) ? null : selection1; + redraw.call(that); + emit.start().brush().end(); + }); + } + }; + + function redraw() { + var group = select(this), + selection = local(this).selection; + + if (selection) { + group.selectAll(".selection") + .style("display", null) + .attr("x", selection[0][0]) + .attr("y", selection[0][1]) + .attr("width", selection[1][0] - selection[0][0]) + .attr("height", selection[1][1] - selection[0][1]); + + group.selectAll(".handle") + .style("display", null) + .attr("x", function(d) { return d.type[d.type.length - 1] === "e" ? selection[1][0] - handleSize / 2 : selection[0][0] - handleSize / 2; }) + .attr("y", function(d) { return d.type[0] === "s" ? selection[1][1] - handleSize / 2 : selection[0][1] - handleSize / 2; }) + .attr("width", function(d) { return d.type === "n" || d.type === "s" ? selection[1][0] - selection[0][0] + handleSize : handleSize; }) + .attr("height", function(d) { return d.type === "e" || d.type === "w" ? selection[1][1] - selection[0][1] + handleSize : handleSize; }); + } + + else { + group.selectAll(".selection,.handle") + .style("display", "none") + .attr("x", null) + .attr("y", null) + .attr("width", null) + .attr("height", null); + } + } + + function emitter(that, args) { + return that.__brush.emitter || new Emitter(that, args); + } + + function Emitter(that, args) { + this.that = that; + this.args = args; + this.state = that.__brush; + this.active = 0; + } + + Emitter.prototype = { + beforestart: function() { + if (++this.active === 1) this.state.emitter = this, this.starting = true; + return this; + }, + start: function() { + if (this.starting) this.starting = false, this.emit("start"); + return this; + }, + brush: function() { + this.emit("brush"); + return this; + }, + end: function() { + if (--this.active === 0) delete this.state.emitter, this.emit("end"); + return this; + }, + emit: function(type) { + customEvent(new BrushEvent(brush, type, dim.output(this.state.selection)), listeners.apply, listeners, [type, this.that, this.args]); + } + }; + + function started() { + if (exports.event.touches) { if (exports.event.changedTouches.length < exports.event.touches.length) return noevent$1(); } + else if (touchending) return; + if (!filter.apply(this, arguments)) return; + + var that = this, + type = exports.event.target.__data__.type, + mode = (exports.event.metaKey ? type = "overlay" : type) === "selection" ? MODE_DRAG : (exports.event.altKey ? MODE_CENTER : MODE_HANDLE), + signX = dim === Y ? null : signsX[type], + signY = dim === X ? null : signsY[type], + state = local(that), + extent = state.extent, + selection = state.selection, + W = extent[0][0], w0, w1, + N = extent[0][1], n0, n1, + E = extent[1][0], e0, e1, + S = extent[1][1], s0, s1, + dx, + dy, + moving, + shifting = signX && signY && exports.event.shiftKey, + lockX, + lockY, + point0 = mouse(that), + point = point0, + emit = emitter(that, arguments).beforestart(); + + if (type === "overlay") { + state.selection = selection = [ + [w0 = dim === Y ? W : point0[0], n0 = dim === X ? N : point0[1]], + [e0 = dim === Y ? E : w0, s0 = dim === X ? S : n0] + ]; + } else { + w0 = selection[0][0]; + n0 = selection[0][1]; + e0 = selection[1][0]; + s0 = selection[1][1]; + } + + w1 = w0; + n1 = n0; + e1 = e0; + s1 = s0; + + var group = select(that) + .attr("pointer-events", "none"); + + var overlay = group.selectAll(".overlay") + .attr("cursor", cursors[type]); + + if (exports.event.touches) { + group + .on("touchmove.brush", moved, true) + .on("touchend.brush touchcancel.brush", ended, true); + } else { + var view = select(exports.event.view) + .on("keydown.brush", keydowned, true) + .on("keyup.brush", keyupped, true) + .on("mousemove.brush", moved, true) + .on("mouseup.brush", ended, true); + + dragDisable(exports.event.view); + } + + nopropagation$1(); + interrupt(that); + redraw.call(that); + emit.start(); + + function moved() { + var point1 = mouse(that); + if (shifting && !lockX && !lockY) { + if (Math.abs(point1[0] - point[0]) > Math.abs(point1[1] - point[1])) lockY = true; + else lockX = true; + } + point = point1; + moving = true; + noevent$1(); + move(); + } + + function move() { + var t; + + dx = point[0] - point0[0]; + dy = point[1] - point0[1]; + + switch (mode) { + case MODE_SPACE: + case MODE_DRAG: { + if (signX) dx = Math.max(W - w0, Math.min(E - e0, dx)), w1 = w0 + dx, e1 = e0 + dx; + if (signY) dy = Math.max(N - n0, Math.min(S - s0, dy)), n1 = n0 + dy, s1 = s0 + dy; + break; + } + case MODE_HANDLE: { + if (signX < 0) dx = Math.max(W - w0, Math.min(E - w0, dx)), w1 = w0 + dx, e1 = e0; + else if (signX > 0) dx = Math.max(W - e0, Math.min(E - e0, dx)), w1 = w0, e1 = e0 + dx; + if (signY < 0) dy = Math.max(N - n0, Math.min(S - n0, dy)), n1 = n0 + dy, s1 = s0; + else if (signY > 0) dy = Math.max(N - s0, Math.min(S - s0, dy)), n1 = n0, s1 = s0 + dy; + break; + } + case MODE_CENTER: { + if (signX) w1 = Math.max(W, Math.min(E, w0 - dx * signX)), e1 = Math.max(W, Math.min(E, e0 + dx * signX)); + if (signY) n1 = Math.max(N, Math.min(S, n0 - dy * signY)), s1 = Math.max(N, Math.min(S, s0 + dy * signY)); + break; + } + } + + if (e1 < w1) { + signX *= -1; + t = w0, w0 = e0, e0 = t; + t = w1, w1 = e1, e1 = t; + if (type in flipX) overlay.attr("cursor", cursors[type = flipX[type]]); + } + + if (s1 < n1) { + signY *= -1; + t = n0, n0 = s0, s0 = t; + t = n1, n1 = s1, s1 = t; + if (type in flipY) overlay.attr("cursor", cursors[type = flipY[type]]); + } + + if (state.selection) selection = state.selection; // May be set by brush.move! + if (lockX) w1 = selection[0][0], e1 = selection[1][0]; + if (lockY) n1 = selection[0][1], s1 = selection[1][1]; + + if (selection[0][0] !== w1 + || selection[0][1] !== n1 + || selection[1][0] !== e1 + || selection[1][1] !== s1) { + state.selection = [[w1, n1], [e1, s1]]; + redraw.call(that); + emit.brush(); + } + } + + function ended() { + nopropagation$1(); + if (exports.event.touches) { + if (exports.event.touches.length) return; + if (touchending) clearTimeout(touchending); + touchending = setTimeout(function() { touchending = null; }, 500); // Ghost clicks are delayed! + group.on("touchmove.brush touchend.brush touchcancel.brush", null); + } else { + yesdrag(exports.event.view, moving); + view.on("keydown.brush keyup.brush mousemove.brush mouseup.brush", null); + } + group.attr("pointer-events", "all"); + overlay.attr("cursor", cursors.overlay); + if (state.selection) selection = state.selection; // May be set by brush.move (on start)! + if (empty(selection)) state.selection = null, redraw.call(that); + emit.end(); + } + + function keydowned() { + switch (exports.event.keyCode) { + case 16: { // SHIFT + shifting = signX && signY; + break; + } + case 18: { // ALT + if (mode === MODE_HANDLE) { + if (signX) e0 = e1 - dx * signX, w0 = w1 + dx * signX; + if (signY) s0 = s1 - dy * signY, n0 = n1 + dy * signY; + mode = MODE_CENTER; + move(); + } + break; + } + case 32: { // SPACE; takes priority over ALT + if (mode === MODE_HANDLE || mode === MODE_CENTER) { + if (signX < 0) e0 = e1 - dx; else if (signX > 0) w0 = w1 - dx; + if (signY < 0) s0 = s1 - dy; else if (signY > 0) n0 = n1 - dy; + mode = MODE_SPACE; + overlay.attr("cursor", cursors.selection); + move(); + } + break; + } + default: return; + } + noevent$1(); + } + + function keyupped() { + switch (exports.event.keyCode) { + case 16: { // SHIFT + if (shifting) { + lockX = lockY = shifting = false; + move(); + } + break; + } + case 18: { // ALT + if (mode === MODE_CENTER) { + if (signX < 0) e0 = e1; else if (signX > 0) w0 = w1; + if (signY < 0) s0 = s1; else if (signY > 0) n0 = n1; + mode = MODE_HANDLE; + move(); + } + break; + } + case 32: { // SPACE + if (mode === MODE_SPACE) { + if (exports.event.altKey) { + if (signX) e0 = e1 - dx * signX, w0 = w1 + dx * signX; + if (signY) s0 = s1 - dy * signY, n0 = n1 + dy * signY; + mode = MODE_CENTER; + } else { + if (signX < 0) e0 = e1; else if (signX > 0) w0 = w1; + if (signY < 0) s0 = s1; else if (signY > 0) n0 = n1; + mode = MODE_HANDLE; + } + overlay.attr("cursor", cursors[type]); + move(); + } + break; + } + default: return; + } + noevent$1(); + } + } + + function initialize() { + var state = this.__brush || {selection: null}; + state.extent = extent.apply(this, arguments); + state.dim = dim; + return state; + } + + brush.extent = function(_) { + return arguments.length ? (extent = typeof _ === "function" ? _ : constant$4([[+_[0][0], +_[0][1]], [+_[1][0], +_[1][1]]]), brush) : extent; + }; + + brush.filter = function(_) { + return arguments.length ? (filter = typeof _ === "function" ? _ : constant$4(!!_), brush) : filter; + }; + + brush.handleSize = function(_) { + return arguments.length ? (handleSize = +_, brush) : handleSize; + }; + + brush.on = function() { + var value = listeners.on.apply(listeners, arguments); + return value === listeners ? brush : value; + }; + + return brush; +} + +var cos = Math.cos; +var sin = Math.sin; +var pi$1 = Math.PI; +var halfPi$1 = pi$1 / 2; +var tau$1 = pi$1 * 2; +var max$1 = Math.max; + +function compareValue(compare) { + return function(a, b) { + return compare( + a.source.value + a.target.value, + b.source.value + b.target.value + ); + }; +} + +function chord() { + var padAngle = 0, + sortGroups = null, + sortSubgroups = null, + sortChords = null; + + function chord(matrix) { + var n = matrix.length, + groupSums = [], + groupIndex = sequence(n), + subgroupIndex = [], + chords = [], + groups = chords.groups = new Array(n), + subgroups = new Array(n * n), + k, + x, + x0, + dx, + i, + j; + + // Compute the sum. + k = 0, i = -1; while (++i < n) { + x = 0, j = -1; while (++j < n) { + x += matrix[i][j]; + } + groupSums.push(x); + subgroupIndex.push(sequence(n)); + k += x; + } + + // Sort groups… + if (sortGroups) groupIndex.sort(function(a, b) { + return sortGroups(groupSums[a], groupSums[b]); + }); + + // Sort subgroups… + if (sortSubgroups) subgroupIndex.forEach(function(d, i) { + d.sort(function(a, b) { + return sortSubgroups(matrix[i][a], matrix[i][b]); + }); + }); + + // Convert the sum to scaling factor for [0, 2pi]. + // TODO Allow start and end angle to be specified? + // TODO Allow padding to be specified as percentage? + k = max$1(0, tau$1 - padAngle * n) / k; + dx = k ? padAngle : tau$1 / n; + + // Compute the start and end angle for each group and subgroup. + // Note: Opera has a bug reordering object literal properties! + x = 0, i = -1; while (++i < n) { + x0 = x, j = -1; while (++j < n) { + var di = groupIndex[i], + dj = subgroupIndex[di][j], + v = matrix[di][dj], + a0 = x, + a1 = x += v * k; + subgroups[dj * n + di] = { + index: di, + subindex: dj, + startAngle: a0, + endAngle: a1, + value: v + }; + } + groups[di] = { + index: di, + startAngle: x0, + endAngle: x, + value: groupSums[di] + }; + x += dx; + } + + // Generate chords for each (non-empty) subgroup-subgroup link. + i = -1; while (++i < n) { + j = i - 1; while (++j < n) { + var source = subgroups[j * n + i], + target = subgroups[i * n + j]; + if (source.value || target.value) { + chords.push(source.value < target.value + ? {source: target, target: source} + : {source: source, target: target}); + } + } + } + + return sortChords ? chords.sort(sortChords) : chords; + } + + chord.padAngle = function(_) { + return arguments.length ? (padAngle = max$1(0, _), chord) : padAngle; + }; + + chord.sortGroups = function(_) { + return arguments.length ? (sortGroups = _, chord) : sortGroups; + }; + + chord.sortSubgroups = function(_) { + return arguments.length ? (sortSubgroups = _, chord) : sortSubgroups; + }; + + chord.sortChords = function(_) { + return arguments.length ? (_ == null ? sortChords = null : (sortChords = compareValue(_))._ = _, chord) : sortChords && sortChords._; + }; + + return chord; +} + +var slice$2 = Array.prototype.slice; + +function constant$5(x) { + return function() { + return x; + }; +} + +var pi$2 = Math.PI; +var tau$2 = 2 * pi$2; +var epsilon$1 = 1e-6; +var tauEpsilon = tau$2 - epsilon$1; + +function Path() { + this._x0 = this._y0 = // start of current subpath + this._x1 = this._y1 = null; // end of current subpath + this._ = ""; +} + +function path() { + return new Path; +} + +Path.prototype = path.prototype = { + constructor: Path, + moveTo: function(x, y) { + this._ += "M" + (this._x0 = this._x1 = +x) + "," + (this._y0 = this._y1 = +y); + }, + closePath: function() { + if (this._x1 !== null) { + this._x1 = this._x0, this._y1 = this._y0; + this._ += "Z"; + } + }, + lineTo: function(x, y) { + this._ += "L" + (this._x1 = +x) + "," + (this._y1 = +y); + }, + quadraticCurveTo: function(x1, y1, x, y) { + this._ += "Q" + (+x1) + "," + (+y1) + "," + (this._x1 = +x) + "," + (this._y1 = +y); + }, + bezierCurveTo: function(x1, y1, x2, y2, x, y) { + this._ += "C" + (+x1) + "," + (+y1) + "," + (+x2) + "," + (+y2) + "," + (this._x1 = +x) + "," + (this._y1 = +y); + }, + arcTo: function(x1, y1, x2, y2, r) { + x1 = +x1, y1 = +y1, x2 = +x2, y2 = +y2, r = +r; + var x0 = this._x1, + y0 = this._y1, + x21 = x2 - x1, + y21 = y2 - y1, + x01 = x0 - x1, + y01 = y0 - y1, + l01_2 = x01 * x01 + y01 * y01; + + // Is the radius negative? Error. + if (r < 0) throw new Error("negative radius: " + r); + + // Is this path empty? Move to (x1,y1). + if (this._x1 === null) { + this._ += "M" + (this._x1 = x1) + "," + (this._y1 = y1); + } + + // Or, is (x1,y1) coincident with (x0,y0)? Do nothing. + else if (!(l01_2 > epsilon$1)) {} + + // Or, are (x0,y0), (x1,y1) and (x2,y2) collinear? + // Equivalently, is (x1,y1) coincident with (x2,y2)? + // Or, is the radius zero? Line to (x1,y1). + else if (!(Math.abs(y01 * x21 - y21 * x01) > epsilon$1) || !r) { + this._ += "L" + (this._x1 = x1) + "," + (this._y1 = y1); + } + + // Otherwise, draw an arc! + else { + var x20 = x2 - x0, + y20 = y2 - y0, + l21_2 = x21 * x21 + y21 * y21, + l20_2 = x20 * x20 + y20 * y20, + l21 = Math.sqrt(l21_2), + l01 = Math.sqrt(l01_2), + l = r * Math.tan((pi$2 - Math.acos((l21_2 + l01_2 - l20_2) / (2 * l21 * l01))) / 2), + t01 = l / l01, + t21 = l / l21; + + // If the start tangent is not coincident with (x0,y0), line to. + if (Math.abs(t01 - 1) > epsilon$1) { + this._ += "L" + (x1 + t01 * x01) + "," + (y1 + t01 * y01); + } + + this._ += "A" + r + "," + r + ",0,0," + (+(y01 * x20 > x01 * y20)) + "," + (this._x1 = x1 + t21 * x21) + "," + (this._y1 = y1 + t21 * y21); + } + }, + arc: function(x, y, r, a0, a1, ccw) { + x = +x, y = +y, r = +r; + var dx = r * Math.cos(a0), + dy = r * Math.sin(a0), + x0 = x + dx, + y0 = y + dy, + cw = 1 ^ ccw, + da = ccw ? a0 - a1 : a1 - a0; + + // Is the radius negative? Error. + if (r < 0) throw new Error("negative radius: " + r); + + // Is this path empty? Move to (x0,y0). + if (this._x1 === null) { + this._ += "M" + x0 + "," + y0; + } + + // Or, is (x0,y0) not coincident with the previous point? Line to (x0,y0). + else if (Math.abs(this._x1 - x0) > epsilon$1 || Math.abs(this._y1 - y0) > epsilon$1) { + this._ += "L" + x0 + "," + y0; + } + + // Is this arc empty? We’re done. + if (!r) return; + + // Does the angle go the wrong way? Flip the direction. + if (da < 0) da = da % tau$2 + tau$2; + + // Is this a complete circle? Draw two arcs to complete the circle. + if (da > tauEpsilon) { + this._ += "A" + r + "," + r + ",0,1," + cw + "," + (x - dx) + "," + (y - dy) + "A" + r + "," + r + ",0,1," + cw + "," + (this._x1 = x0) + "," + (this._y1 = y0); + } + + // Is this arc non-empty? Draw an arc! + else if (da > epsilon$1) { + this._ += "A" + r + "," + r + ",0," + (+(da >= pi$2)) + "," + cw + "," + (this._x1 = x + r * Math.cos(a1)) + "," + (this._y1 = y + r * Math.sin(a1)); + } + }, + rect: function(x, y, w, h) { + this._ += "M" + (this._x0 = this._x1 = +x) + "," + (this._y0 = this._y1 = +y) + "h" + (+w) + "v" + (+h) + "h" + (-w) + "Z"; + }, + toString: function() { + return this._; + } +}; + +function defaultSource(d) { + return d.source; +} + +function defaultTarget(d) { + return d.target; +} + +function defaultRadius(d) { + return d.radius; +} + +function defaultStartAngle(d) { + return d.startAngle; +} + +function defaultEndAngle(d) { + return d.endAngle; +} + +function ribbon() { + var source = defaultSource, + target = defaultTarget, + radius = defaultRadius, + startAngle = defaultStartAngle, + endAngle = defaultEndAngle, + context = null; + + function ribbon() { + var buffer, + argv = slice$2.call(arguments), + s = source.apply(this, argv), + t = target.apply(this, argv), + sr = +radius.apply(this, (argv[0] = s, argv)), + sa0 = startAngle.apply(this, argv) - halfPi$1, + sa1 = endAngle.apply(this, argv) - halfPi$1, + sx0 = sr * cos(sa0), + sy0 = sr * sin(sa0), + tr = +radius.apply(this, (argv[0] = t, argv)), + ta0 = startAngle.apply(this, argv) - halfPi$1, + ta1 = endAngle.apply(this, argv) - halfPi$1; + + if (!context) context = buffer = path(); + + context.moveTo(sx0, sy0); + context.arc(0, 0, sr, sa0, sa1); + if (sa0 !== ta0 || sa1 !== ta1) { // TODO sr !== tr? + context.quadraticCurveTo(0, 0, tr * cos(ta0), tr * sin(ta0)); + context.arc(0, 0, tr, ta0, ta1); + } + context.quadraticCurveTo(0, 0, sx0, sy0); + context.closePath(); + + if (buffer) return context = null, buffer + "" || null; + } + + ribbon.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$5(+_), ribbon) : radius; + }; + + ribbon.startAngle = function(_) { + return arguments.length ? (startAngle = typeof _ === "function" ? _ : constant$5(+_), ribbon) : startAngle; + }; + + ribbon.endAngle = function(_) { + return arguments.length ? (endAngle = typeof _ === "function" ? _ : constant$5(+_), ribbon) : endAngle; + }; + + ribbon.source = function(_) { + return arguments.length ? (source = _, ribbon) : source; + }; + + ribbon.target = function(_) { + return arguments.length ? (target = _, ribbon) : target; + }; + + ribbon.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, ribbon) : context; + }; + + return ribbon; +} + +var prefix = "$"; + +function Map() {} + +Map.prototype = map$1.prototype = { + constructor: Map, + has: function(key) { + return (prefix + key) in this; + }, + get: function(key) { + return this[prefix + key]; + }, + set: function(key, value) { + this[prefix + key] = value; + return this; + }, + remove: function(key) { + var property = prefix + key; + return property in this && delete this[property]; + }, + clear: function() { + for (var property in this) if (property[0] === prefix) delete this[property]; + }, + keys: function() { + var keys = []; + for (var property in this) if (property[0] === prefix) keys.push(property.slice(1)); + return keys; + }, + values: function() { + var values = []; + for (var property in this) if (property[0] === prefix) values.push(this[property]); + return values; + }, + entries: function() { + var entries = []; + for (var property in this) if (property[0] === prefix) entries.push({key: property.slice(1), value: this[property]}); + return entries; + }, + size: function() { + var size = 0; + for (var property in this) if (property[0] === prefix) ++size; + return size; + }, + empty: function() { + for (var property in this) if (property[0] === prefix) return false; + return true; + }, + each: function(f) { + for (var property in this) if (property[0] === prefix) f(this[property], property.slice(1), this); + } +}; + +function map$1(object, f) { + var map = new Map; + + // Copy constructor. + if (object instanceof Map) object.each(function(value, key) { map.set(key, value); }); + + // Index array by numeric index or specified key function. + else if (Array.isArray(object)) { + var i = -1, + n = object.length, + o; + + if (f == null) while (++i < n) map.set(i, object[i]); + else while (++i < n) map.set(f(o = object[i], i, object), o); + } + + // Convert object to map. + else if (object) for (var key in object) map.set(key, object[key]); + + return map; +} + +function nest() { + var keys = [], + sortKeys = [], + sortValues, + rollup, + nest; + + function apply(array, depth, createResult, setResult) { + if (depth >= keys.length) { + if (sortValues != null) array.sort(sortValues); + return rollup != null ? rollup(array) : array; + } + + var i = -1, + n = array.length, + key = keys[depth++], + keyValue, + value, + valuesByKey = map$1(), + values, + result = createResult(); + + while (++i < n) { + if (values = valuesByKey.get(keyValue = key(value = array[i]) + "")) { + values.push(value); + } else { + valuesByKey.set(keyValue, [value]); + } + } + + valuesByKey.each(function(values, key) { + setResult(result, key, apply(values, depth, createResult, setResult)); + }); + + return result; + } + + function entries(map, depth) { + if (++depth > keys.length) return map; + var array, sortKey = sortKeys[depth - 1]; + if (rollup != null && depth >= keys.length) array = map.entries(); + else array = [], map.each(function(v, k) { array.push({key: k, values: entries(v, depth)}); }); + return sortKey != null ? array.sort(function(a, b) { return sortKey(a.key, b.key); }) : array; + } + + return nest = { + object: function(array) { return apply(array, 0, createObject, setObject); }, + map: function(array) { return apply(array, 0, createMap, setMap); }, + entries: function(array) { return entries(apply(array, 0, createMap, setMap), 0); }, + key: function(d) { keys.push(d); return nest; }, + sortKeys: function(order) { sortKeys[keys.length - 1] = order; return nest; }, + sortValues: function(order) { sortValues = order; return nest; }, + rollup: function(f) { rollup = f; return nest; } + }; +} + +function createObject() { + return {}; +} + +function setObject(object, key, value) { + object[key] = value; +} + +function createMap() { + return map$1(); +} + +function setMap(map, key, value) { + map.set(key, value); +} + +function Set() {} + +var proto = map$1.prototype; + +Set.prototype = set$2.prototype = { + constructor: Set, + has: proto.has, + add: function(value) { + value += ""; + this[prefix + value] = value; + return this; + }, + remove: proto.remove, + clear: proto.clear, + values: proto.keys, + size: proto.size, + empty: proto.empty, + each: proto.each +}; + +function set$2(object, f) { + var set = new Set; + + // Copy constructor. + if (object instanceof Set) object.each(function(value) { set.add(value); }); + + // Otherwise, assume it’s an array. + else if (object) { + var i = -1, n = object.length; + if (f == null) while (++i < n) set.add(object[i]); + else while (++i < n) set.add(f(object[i], i, object)); + } + + return set; +} + +function keys(map) { + var keys = []; + for (var key in map) keys.push(key); + return keys; +} + +function values(map) { + var values = []; + for (var key in map) values.push(map[key]); + return values; +} + +function entries(map) { + var entries = []; + for (var key in map) entries.push({key: key, value: map[key]}); + return entries; +} + +var EOL = {}; +var EOF = {}; +var QUOTE = 34; +var NEWLINE = 10; +var RETURN = 13; + +function objectConverter(columns) { + return new Function("d", "return {" + columns.map(function(name, i) { + return JSON.stringify(name) + ": d[" + i + "]"; + }).join(",") + "}"); +} + +function customConverter(columns, f) { + var object = objectConverter(columns); + return function(row, i) { + return f(object(row), i, columns); + }; +} + +// Compute unique columns in order of discovery. +function inferColumns(rows) { + var columnSet = Object.create(null), + columns = []; + + rows.forEach(function(row) { + for (var column in row) { + if (!(column in columnSet)) { + columns.push(columnSet[column] = column); + } + } + }); + + return columns; +} + +function dsv(delimiter) { + var reFormat = new RegExp("[\"" + delimiter + "\n\r]"), + DELIMITER = delimiter.charCodeAt(0); + + function parse(text, f) { + var convert, columns, rows = parseRows(text, function(row, i) { + if (convert) return convert(row, i - 1); + columns = row, convert = f ? customConverter(row, f) : objectConverter(row); + }); + rows.columns = columns || []; + return rows; + } + + function parseRows(text, f) { + var rows = [], // output rows + N = text.length, + I = 0, // current character index + n = 0, // current line number + t, // current token + eof = N <= 0, // current token followed by EOF? + eol = false; // current token followed by EOL? + + // Strip the trailing newline. + if (text.charCodeAt(N - 1) === NEWLINE) --N; + if (text.charCodeAt(N - 1) === RETURN) --N; + + function token() { + if (eof) return EOF; + if (eol) return eol = false, EOL; + + // Unescape quotes. + var i, j = I, c; + if (text.charCodeAt(j) === QUOTE) { + while (I++ < N && text.charCodeAt(I) !== QUOTE || text.charCodeAt(++I) === QUOTE); + if ((i = I) >= N) eof = true; + else if ((c = text.charCodeAt(I++)) === NEWLINE) eol = true; + else if (c === RETURN) { eol = true; if (text.charCodeAt(I) === NEWLINE) ++I; } + return text.slice(j + 1, i - 1).replace(/""/g, "\""); + } + + // Find next delimiter or newline. + while (I < N) { + if ((c = text.charCodeAt(i = I++)) === NEWLINE) eol = true; + else if (c === RETURN) { eol = true; if (text.charCodeAt(I) === NEWLINE) ++I; } + else if (c !== DELIMITER) continue; + return text.slice(j, i); + } + + // Return last token before EOF. + return eof = true, text.slice(j, N); + } + + while ((t = token()) !== EOF) { + var row = []; + while (t !== EOL && t !== EOF) row.push(t), t = token(); + if (f && (row = f(row, n++)) == null) continue; + rows.push(row); + } + + return rows; + } + + function format(rows, columns) { + if (columns == null) columns = inferColumns(rows); + return [columns.map(formatValue).join(delimiter)].concat(rows.map(function(row) { + return columns.map(function(column) { + return formatValue(row[column]); + }).join(delimiter); + })).join("\n"); + } + + function formatRows(rows) { + return rows.map(formatRow).join("\n"); + } + + function formatRow(row) { + return row.map(formatValue).join(delimiter); + } + + function formatValue(text) { + return text == null ? "" + : reFormat.test(text += "") ? "\"" + text.replace(/"/g, "\"\"") + "\"" + : text; + } + + return { + parse: parse, + parseRows: parseRows, + format: format, + formatRows: formatRows + }; +} + +var csv = dsv(","); + +var csvParse = csv.parse; +var csvParseRows = csv.parseRows; +var csvFormat = csv.format; +var csvFormatRows = csv.formatRows; + +var tsv = dsv("\t"); + +var tsvParse = tsv.parse; +var tsvParseRows = tsv.parseRows; +var tsvFormat = tsv.format; +var tsvFormatRows = tsv.formatRows; + +function center$1(x, y) { + var nodes; + + if (x == null) x = 0; + if (y == null) y = 0; + + function force() { + var i, + n = nodes.length, + node, + sx = 0, + sy = 0; + + for (i = 0; i < n; ++i) { + node = nodes[i], sx += node.x, sy += node.y; + } + + for (sx = sx / n - x, sy = sy / n - y, i = 0; i < n; ++i) { + node = nodes[i], node.x -= sx, node.y -= sy; + } + } + + force.initialize = function(_) { + nodes = _; + }; + + force.x = function(_) { + return arguments.length ? (x = +_, force) : x; + }; + + force.y = function(_) { + return arguments.length ? (y = +_, force) : y; + }; + + return force; +} + +function constant$6(x) { + return function() { + return x; + }; +} + +function jiggle() { + return (Math.random() - 0.5) * 1e-6; +} + +function tree_add(d) { + var x = +this._x.call(null, d), + y = +this._y.call(null, d); + return add(this.cover(x, y), x, y, d); +} + +function add(tree, x, y, d) { + if (isNaN(x) || isNaN(y)) return tree; // ignore invalid points + + var parent, + node = tree._root, + leaf = {data: d}, + x0 = tree._x0, + y0 = tree._y0, + x1 = tree._x1, + y1 = tree._y1, + xm, + ym, + xp, + yp, + right, + bottom, + i, + j; + + // If the tree is empty, initialize the root as a leaf. + if (!node) return tree._root = leaf, tree; + + // Find the existing leaf for the new point, or add it. + while (node.length) { + if (right = x >= (xm = (x0 + x1) / 2)) x0 = xm; else x1 = xm; + if (bottom = y >= (ym = (y0 + y1) / 2)) y0 = ym; else y1 = ym; + if (parent = node, !(node = node[i = bottom << 1 | right])) return parent[i] = leaf, tree; + } + + // Is the new point is exactly coincident with the existing point? + xp = +tree._x.call(null, node.data); + yp = +tree._y.call(null, node.data); + if (x === xp && y === yp) return leaf.next = node, parent ? parent[i] = leaf : tree._root = leaf, tree; + + // Otherwise, split the leaf node until the old and new point are separated. + do { + parent = parent ? parent[i] = new Array(4) : tree._root = new Array(4); + if (right = x >= (xm = (x0 + x1) / 2)) x0 = xm; else x1 = xm; + if (bottom = y >= (ym = (y0 + y1) / 2)) y0 = ym; else y1 = ym; + } while ((i = bottom << 1 | right) === (j = (yp >= ym) << 1 | (xp >= xm))); + return parent[j] = node, parent[i] = leaf, tree; +} + +function addAll(data) { + var d, i, n = data.length, + x, + y, + xz = new Array(n), + yz = new Array(n), + x0 = Infinity, + y0 = Infinity, + x1 = -Infinity, + y1 = -Infinity; + + // Compute the points and their extent. + for (i = 0; i < n; ++i) { + if (isNaN(x = +this._x.call(null, d = data[i])) || isNaN(y = +this._y.call(null, d))) continue; + xz[i] = x; + yz[i] = y; + if (x < x0) x0 = x; + if (x > x1) x1 = x; + if (y < y0) y0 = y; + if (y > y1) y1 = y; + } + + // If there were no (valid) points, inherit the existing extent. + if (x1 < x0) x0 = this._x0, x1 = this._x1; + if (y1 < y0) y0 = this._y0, y1 = this._y1; + + // Expand the tree to cover the new points. + this.cover(x0, y0).cover(x1, y1); + + // Add the new points. + for (i = 0; i < n; ++i) { + add(this, xz[i], yz[i], data[i]); + } + + return this; +} + +function tree_cover(x, y) { + if (isNaN(x = +x) || isNaN(y = +y)) return this; // ignore invalid points + + var x0 = this._x0, + y0 = this._y0, + x1 = this._x1, + y1 = this._y1; + + // If the quadtree has no extent, initialize them. + // Integer extent are necessary so that if we later double the extent, + // the existing quadrant boundaries don’t change due to floating point error! + if (isNaN(x0)) { + x1 = (x0 = Math.floor(x)) + 1; + y1 = (y0 = Math.floor(y)) + 1; + } + + // Otherwise, double repeatedly to cover. + else if (x0 > x || x > x1 || y0 > y || y > y1) { + var z = x1 - x0, + node = this._root, + parent, + i; + + switch (i = (y < (y0 + y1) / 2) << 1 | (x < (x0 + x1) / 2)) { + case 0: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x1 = x0 + z, y1 = y0 + z, x > x1 || y > y1); + break; + } + case 1: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x0 = x1 - z, y1 = y0 + z, x0 > x || y > y1); + break; + } + case 2: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x1 = x0 + z, y0 = y1 - z, x > x1 || y0 > y); + break; + } + case 3: { + do parent = new Array(4), parent[i] = node, node = parent; + while (z *= 2, x0 = x1 - z, y0 = y1 - z, x0 > x || y0 > y); + break; + } + } + + if (this._root && this._root.length) this._root = node; + } + + // If the quadtree covers the point already, just return. + else return this; + + this._x0 = x0; + this._y0 = y0; + this._x1 = x1; + this._y1 = y1; + return this; +} + +function tree_data() { + var data = []; + this.visit(function(node) { + if (!node.length) do data.push(node.data); while (node = node.next) + }); + return data; +} + +function tree_extent(_) { + return arguments.length + ? this.cover(+_[0][0], +_[0][1]).cover(+_[1][0], +_[1][1]) + : isNaN(this._x0) ? undefined : [[this._x0, this._y0], [this._x1, this._y1]]; +} + +function Quad(node, x0, y0, x1, y1) { + this.node = node; + this.x0 = x0; + this.y0 = y0; + this.x1 = x1; + this.y1 = y1; +} + +function tree_find(x, y, radius) { + var data, + x0 = this._x0, + y0 = this._y0, + x1, + y1, + x2, + y2, + x3 = this._x1, + y3 = this._y1, + quads = [], + node = this._root, + q, + i; + + if (node) quads.push(new Quad(node, x0, y0, x3, y3)); + if (radius == null) radius = Infinity; + else { + x0 = x - radius, y0 = y - radius; + x3 = x + radius, y3 = y + radius; + radius *= radius; + } + + while (q = quads.pop()) { + + // Stop searching if this quadrant can’t contain a closer node. + if (!(node = q.node) + || (x1 = q.x0) > x3 + || (y1 = q.y0) > y3 + || (x2 = q.x1) < x0 + || (y2 = q.y1) < y0) continue; + + // Bisect the current quadrant. + if (node.length) { + var xm = (x1 + x2) / 2, + ym = (y1 + y2) / 2; + + quads.push( + new Quad(node[3], xm, ym, x2, y2), + new Quad(node[2], x1, ym, xm, y2), + new Quad(node[1], xm, y1, x2, ym), + new Quad(node[0], x1, y1, xm, ym) + ); + + // Visit the closest quadrant first. + if (i = (y >= ym) << 1 | (x >= xm)) { + q = quads[quads.length - 1]; + quads[quads.length - 1] = quads[quads.length - 1 - i]; + quads[quads.length - 1 - i] = q; + } + } + + // Visit this point. (Visiting coincident points isn’t necessary!) + else { + var dx = x - +this._x.call(null, node.data), + dy = y - +this._y.call(null, node.data), + d2 = dx * dx + dy * dy; + if (d2 < radius) { + var d = Math.sqrt(radius = d2); + x0 = x - d, y0 = y - d; + x3 = x + d, y3 = y + d; + data = node.data; + } + } + } + + return data; +} + +function tree_remove(d) { + if (isNaN(x = +this._x.call(null, d)) || isNaN(y = +this._y.call(null, d))) return this; // ignore invalid points + + var parent, + node = this._root, + retainer, + previous, + next, + x0 = this._x0, + y0 = this._y0, + x1 = this._x1, + y1 = this._y1, + x, + y, + xm, + ym, + right, + bottom, + i, + j; + + // If the tree is empty, initialize the root as a leaf. + if (!node) return this; + + // Find the leaf node for the point. + // While descending, also retain the deepest parent with a non-removed sibling. + if (node.length) while (true) { + if (right = x >= (xm = (x0 + x1) / 2)) x0 = xm; else x1 = xm; + if (bottom = y >= (ym = (y0 + y1) / 2)) y0 = ym; else y1 = ym; + if (!(parent = node, node = node[i = bottom << 1 | right])) return this; + if (!node.length) break; + if (parent[(i + 1) & 3] || parent[(i + 2) & 3] || parent[(i + 3) & 3]) retainer = parent, j = i; + } + + // Find the point to remove. + while (node.data !== d) if (!(previous = node, node = node.next)) return this; + if (next = node.next) delete node.next; + + // If there are multiple coincident points, remove just the point. + if (previous) return next ? previous.next = next : delete previous.next, this; + + // If this is the root point, remove it. + if (!parent) return this._root = next, this; + + // Remove this leaf. + next ? parent[i] = next : delete parent[i]; + + // If the parent now contains exactly one leaf, collapse superfluous parents. + if ((node = parent[0] || parent[1] || parent[2] || parent[3]) + && node === (parent[3] || parent[2] || parent[1] || parent[0]) + && !node.length) { + if (retainer) retainer[j] = node; + else this._root = node; + } + + return this; +} + +function removeAll(data) { + for (var i = 0, n = data.length; i < n; ++i) this.remove(data[i]); + return this; +} + +function tree_root() { + return this._root; +} + +function tree_size() { + var size = 0; + this.visit(function(node) { + if (!node.length) do ++size; while (node = node.next) + }); + return size; +} + +function tree_visit(callback) { + var quads = [], q, node = this._root, child, x0, y0, x1, y1; + if (node) quads.push(new Quad(node, this._x0, this._y0, this._x1, this._y1)); + while (q = quads.pop()) { + if (!callback(node = q.node, x0 = q.x0, y0 = q.y0, x1 = q.x1, y1 = q.y1) && node.length) { + var xm = (x0 + x1) / 2, ym = (y0 + y1) / 2; + if (child = node[3]) quads.push(new Quad(child, xm, ym, x1, y1)); + if (child = node[2]) quads.push(new Quad(child, x0, ym, xm, y1)); + if (child = node[1]) quads.push(new Quad(child, xm, y0, x1, ym)); + if (child = node[0]) quads.push(new Quad(child, x0, y0, xm, ym)); + } + } + return this; +} + +function tree_visitAfter(callback) { + var quads = [], next = [], q; + if (this._root) quads.push(new Quad(this._root, this._x0, this._y0, this._x1, this._y1)); + while (q = quads.pop()) { + var node = q.node; + if (node.length) { + var child, x0 = q.x0, y0 = q.y0, x1 = q.x1, y1 = q.y1, xm = (x0 + x1) / 2, ym = (y0 + y1) / 2; + if (child = node[0]) quads.push(new Quad(child, x0, y0, xm, ym)); + if (child = node[1]) quads.push(new Quad(child, xm, y0, x1, ym)); + if (child = node[2]) quads.push(new Quad(child, x0, ym, xm, y1)); + if (child = node[3]) quads.push(new Quad(child, xm, ym, x1, y1)); + } + next.push(q); + } + while (q = next.pop()) { + callback(q.node, q.x0, q.y0, q.x1, q.y1); + } + return this; +} + +function defaultX(d) { + return d[0]; +} + +function tree_x(_) { + return arguments.length ? (this._x = _, this) : this._x; +} + +function defaultY(d) { + return d[1]; +} + +function tree_y(_) { + return arguments.length ? (this._y = _, this) : this._y; +} + +function quadtree(nodes, x, y) { + var tree = new Quadtree(x == null ? defaultX : x, y == null ? defaultY : y, NaN, NaN, NaN, NaN); + return nodes == null ? tree : tree.addAll(nodes); +} + +function Quadtree(x, y, x0, y0, x1, y1) { + this._x = x; + this._y = y; + this._x0 = x0; + this._y0 = y0; + this._x1 = x1; + this._y1 = y1; + this._root = undefined; +} + +function leaf_copy(leaf) { + var copy = {data: leaf.data}, next = copy; + while (leaf = leaf.next) next = next.next = {data: leaf.data}; + return copy; +} + +var treeProto = quadtree.prototype = Quadtree.prototype; + +treeProto.copy = function() { + var copy = new Quadtree(this._x, this._y, this._x0, this._y0, this._x1, this._y1), + node = this._root, + nodes, + child; + + if (!node) return copy; + + if (!node.length) return copy._root = leaf_copy(node), copy; + + nodes = [{source: node, target: copy._root = new Array(4)}]; + while (node = nodes.pop()) { + for (var i = 0; i < 4; ++i) { + if (child = node.source[i]) { + if (child.length) nodes.push({source: child, target: node.target[i] = new Array(4)}); + else node.target[i] = leaf_copy(child); + } + } + } + + return copy; +}; + +treeProto.add = tree_add; +treeProto.addAll = addAll; +treeProto.cover = tree_cover; +treeProto.data = tree_data; +treeProto.extent = tree_extent; +treeProto.find = tree_find; +treeProto.remove = tree_remove; +treeProto.removeAll = removeAll; +treeProto.root = tree_root; +treeProto.size = tree_size; +treeProto.visit = tree_visit; +treeProto.visitAfter = tree_visitAfter; +treeProto.x = tree_x; +treeProto.y = tree_y; + +function x(d) { + return d.x + d.vx; +} + +function y(d) { + return d.y + d.vy; +} + +function collide(radius) { + var nodes, + radii, + strength = 1, + iterations = 1; + + if (typeof radius !== "function") radius = constant$6(radius == null ? 1 : +radius); + + function force() { + var i, n = nodes.length, + tree, + node, + xi, + yi, + ri, + ri2; + + for (var k = 0; k < iterations; ++k) { + tree = quadtree(nodes, x, y).visitAfter(prepare); + for (i = 0; i < n; ++i) { + node = nodes[i]; + ri = radii[node.index], ri2 = ri * ri; + xi = node.x + node.vx; + yi = node.y + node.vy; + tree.visit(apply); + } + } + + function apply(quad, x0, y0, x1, y1) { + var data = quad.data, rj = quad.r, r = ri + rj; + if (data) { + if (data.index > node.index) { + var x = xi - data.x - data.vx, + y = yi - data.y - data.vy, + l = x * x + y * y; + if (l < r * r) { + if (x === 0) x = jiggle(), l += x * x; + if (y === 0) y = jiggle(), l += y * y; + l = (r - (l = Math.sqrt(l))) / l * strength; + node.vx += (x *= l) * (r = (rj *= rj) / (ri2 + rj)); + node.vy += (y *= l) * r; + data.vx -= x * (r = 1 - r); + data.vy -= y * r; + } + } + return; + } + return x0 > xi + r || x1 < xi - r || y0 > yi + r || y1 < yi - r; + } + } + + function prepare(quad) { + if (quad.data) return quad.r = radii[quad.data.index]; + for (var i = quad.r = 0; i < 4; ++i) { + if (quad[i] && quad[i].r > quad.r) { + quad.r = quad[i].r; + } + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length, node; + radii = new Array(n); + for (i = 0; i < n; ++i) node = nodes[i], radii[node.index] = +radius(node, i, nodes); + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.iterations = function(_) { + return arguments.length ? (iterations = +_, force) : iterations; + }; + + force.strength = function(_) { + return arguments.length ? (strength = +_, force) : strength; + }; + + force.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : radius; + }; + + return force; +} + +function index(d) { + return d.index; +} + +function find(nodeById, nodeId) { + var node = nodeById.get(nodeId); + if (!node) throw new Error("missing: " + nodeId); + return node; +} + +function link(links) { + var id = index, + strength = defaultStrength, + strengths, + distance = constant$6(30), + distances, + nodes, + count, + bias, + iterations = 1; + + if (links == null) links = []; + + function defaultStrength(link) { + return 1 / Math.min(count[link.source.index], count[link.target.index]); + } + + function force(alpha) { + for (var k = 0, n = links.length; k < iterations; ++k) { + for (var i = 0, link, source, target, x, y, l, b; i < n; ++i) { + link = links[i], source = link.source, target = link.target; + x = target.x + target.vx - source.x - source.vx || jiggle(); + y = target.y + target.vy - source.y - source.vy || jiggle(); + l = Math.sqrt(x * x + y * y); + l = (l - distances[i]) / l * alpha * strengths[i]; + x *= l, y *= l; + target.vx -= x * (b = bias[i]); + target.vy -= y * b; + source.vx += x * (b = 1 - b); + source.vy += y * b; + } + } + } + + function initialize() { + if (!nodes) return; + + var i, + n = nodes.length, + m = links.length, + nodeById = map$1(nodes, id), + link; + + for (i = 0, count = new Array(n); i < m; ++i) { + link = links[i], link.index = i; + if (typeof link.source !== "object") link.source = find(nodeById, link.source); + if (typeof link.target !== "object") link.target = find(nodeById, link.target); + count[link.source.index] = (count[link.source.index] || 0) + 1; + count[link.target.index] = (count[link.target.index] || 0) + 1; + } + + for (i = 0, bias = new Array(m); i < m; ++i) { + link = links[i], bias[i] = count[link.source.index] / (count[link.source.index] + count[link.target.index]); + } + + strengths = new Array(m), initializeStrength(); + distances = new Array(m), initializeDistance(); + } + + function initializeStrength() { + if (!nodes) return; + + for (var i = 0, n = links.length; i < n; ++i) { + strengths[i] = +strength(links[i], i, links); + } + } + + function initializeDistance() { + if (!nodes) return; + + for (var i = 0, n = links.length; i < n; ++i) { + distances[i] = +distance(links[i], i, links); + } + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.links = function(_) { + return arguments.length ? (links = _, initialize(), force) : links; + }; + + force.id = function(_) { + return arguments.length ? (id = _, force) : id; + }; + + force.iterations = function(_) { + return arguments.length ? (iterations = +_, force) : iterations; + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initializeStrength(), force) : strength; + }; + + force.distance = function(_) { + return arguments.length ? (distance = typeof _ === "function" ? _ : constant$6(+_), initializeDistance(), force) : distance; + }; + + return force; +} + +function x$1(d) { + return d.x; +} + +function y$1(d) { + return d.y; +} + +var initialRadius = 10; +var initialAngle = Math.PI * (3 - Math.sqrt(5)); + +function simulation(nodes) { + var simulation, + alpha = 1, + alphaMin = 0.001, + alphaDecay = 1 - Math.pow(alphaMin, 1 / 300), + alphaTarget = 0, + velocityDecay = 0.6, + forces = map$1(), + stepper = timer(step), + event = dispatch("tick", "end"); + + if (nodes == null) nodes = []; + + function step() { + tick(); + event.call("tick", simulation); + if (alpha < alphaMin) { + stepper.stop(); + event.call("end", simulation); + } + } + + function tick() { + var i, n = nodes.length, node; + + alpha += (alphaTarget - alpha) * alphaDecay; + + forces.each(function(force) { + force(alpha); + }); + + for (i = 0; i < n; ++i) { + node = nodes[i]; + if (node.fx == null) node.x += node.vx *= velocityDecay; + else node.x = node.fx, node.vx = 0; + if (node.fy == null) node.y += node.vy *= velocityDecay; + else node.y = node.fy, node.vy = 0; + } + } + + function initializeNodes() { + for (var i = 0, n = nodes.length, node; i < n; ++i) { + node = nodes[i], node.index = i; + if (isNaN(node.x) || isNaN(node.y)) { + var radius = initialRadius * Math.sqrt(i), angle = i * initialAngle; + node.x = radius * Math.cos(angle); + node.y = radius * Math.sin(angle); + } + if (isNaN(node.vx) || isNaN(node.vy)) { + node.vx = node.vy = 0; + } + } + } + + function initializeForce(force) { + if (force.initialize) force.initialize(nodes); + return force; + } + + initializeNodes(); + + return simulation = { + tick: tick, + + restart: function() { + return stepper.restart(step), simulation; + }, + + stop: function() { + return stepper.stop(), simulation; + }, + + nodes: function(_) { + return arguments.length ? (nodes = _, initializeNodes(), forces.each(initializeForce), simulation) : nodes; + }, + + alpha: function(_) { + return arguments.length ? (alpha = +_, simulation) : alpha; + }, + + alphaMin: function(_) { + return arguments.length ? (alphaMin = +_, simulation) : alphaMin; + }, + + alphaDecay: function(_) { + return arguments.length ? (alphaDecay = +_, simulation) : +alphaDecay; + }, + + alphaTarget: function(_) { + return arguments.length ? (alphaTarget = +_, simulation) : alphaTarget; + }, + + velocityDecay: function(_) { + return arguments.length ? (velocityDecay = 1 - _, simulation) : 1 - velocityDecay; + }, + + force: function(name, _) { + return arguments.length > 1 ? (_ == null ? forces.remove(name) : forces.set(name, initializeForce(_)), simulation) : forces.get(name); + }, + + find: function(x, y, radius) { + var i = 0, + n = nodes.length, + dx, + dy, + d2, + node, + closest; + + if (radius == null) radius = Infinity; + else radius *= radius; + + for (i = 0; i < n; ++i) { + node = nodes[i]; + dx = x - node.x; + dy = y - node.y; + d2 = dx * dx + dy * dy; + if (d2 < radius) closest = node, radius = d2; + } + + return closest; + }, + + on: function(name, _) { + return arguments.length > 1 ? (event.on(name, _), simulation) : event.on(name); + } + }; +} + +function manyBody() { + var nodes, + node, + alpha, + strength = constant$6(-30), + strengths, + distanceMin2 = 1, + distanceMax2 = Infinity, + theta2 = 0.81; + + function force(_) { + var i, n = nodes.length, tree = quadtree(nodes, x$1, y$1).visitAfter(accumulate); + for (alpha = _, i = 0; i < n; ++i) node = nodes[i], tree.visit(apply); + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length, node; + strengths = new Array(n); + for (i = 0; i < n; ++i) node = nodes[i], strengths[node.index] = +strength(node, i, nodes); + } + + function accumulate(quad) { + var strength = 0, q, c, weight = 0, x, y, i; + + // For internal nodes, accumulate forces from child quadrants. + if (quad.length) { + for (x = y = i = 0; i < 4; ++i) { + if ((q = quad[i]) && (c = Math.abs(q.value))) { + strength += q.value, weight += c, x += c * q.x, y += c * q.y; + } + } + quad.x = x / weight; + quad.y = y / weight; + } + + // For leaf nodes, accumulate forces from coincident quadrants. + else { + q = quad; + q.x = q.data.x; + q.y = q.data.y; + do strength += strengths[q.data.index]; + while (q = q.next); + } + + quad.value = strength; + } + + function apply(quad, x1, _, x2) { + if (!quad.value) return true; + + var x = quad.x - node.x, + y = quad.y - node.y, + w = x2 - x1, + l = x * x + y * y; + + // Apply the Barnes-Hut approximation if possible. + // Limit forces for very close nodes; randomize direction if coincident. + if (w * w / theta2 < l) { + if (l < distanceMax2) { + if (x === 0) x = jiggle(), l += x * x; + if (y === 0) y = jiggle(), l += y * y; + if (l < distanceMin2) l = Math.sqrt(distanceMin2 * l); + node.vx += x * quad.value * alpha / l; + node.vy += y * quad.value * alpha / l; + } + return true; + } + + // Otherwise, process points directly. + else if (quad.length || l >= distanceMax2) return; + + // Limit forces for very close nodes; randomize direction if coincident. + if (quad.data !== node || quad.next) { + if (x === 0) x = jiggle(), l += x * x; + if (y === 0) y = jiggle(), l += y * y; + if (l < distanceMin2) l = Math.sqrt(distanceMin2 * l); + } + + do if (quad.data !== node) { + w = strengths[quad.data.index] * alpha / l; + node.vx += x * w; + node.vy += y * w; + } while (quad = quad.next); + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.distanceMin = function(_) { + return arguments.length ? (distanceMin2 = _ * _, force) : Math.sqrt(distanceMin2); + }; + + force.distanceMax = function(_) { + return arguments.length ? (distanceMax2 = _ * _, force) : Math.sqrt(distanceMax2); + }; + + force.theta = function(_) { + return arguments.length ? (theta2 = _ * _, force) : Math.sqrt(theta2); + }; + + return force; +} + +function radial(radius, x, y) { + var nodes, + strength = constant$6(0.1), + strengths, + radiuses; + + if (typeof radius !== "function") radius = constant$6(+radius); + if (x == null) x = 0; + if (y == null) y = 0; + + function force(alpha) { + for (var i = 0, n = nodes.length; i < n; ++i) { + var node = nodes[i], + dx = node.x - x || 1e-6, + dy = node.y - y || 1e-6, + r = Math.sqrt(dx * dx + dy * dy), + k = (radiuses[i] - r) * strengths[i] * alpha / r; + node.vx += dx * k; + node.vy += dy * k; + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length; + strengths = new Array(n); + radiuses = new Array(n); + for (i = 0; i < n; ++i) { + radiuses[i] = +radius(nodes[i], i, nodes); + strengths[i] = isNaN(radiuses[i]) ? 0 : +strength(nodes[i], i, nodes); + } + } + + force.initialize = function(_) { + nodes = _, initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : radius; + }; + + force.x = function(_) { + return arguments.length ? (x = +_, force) : x; + }; + + force.y = function(_) { + return arguments.length ? (y = +_, force) : y; + }; + + return force; +} + +function x$2(x) { + var strength = constant$6(0.1), + nodes, + strengths, + xz; + + if (typeof x !== "function") x = constant$6(x == null ? 0 : +x); + + function force(alpha) { + for (var i = 0, n = nodes.length, node; i < n; ++i) { + node = nodes[i], node.vx += (xz[i] - node.x) * strengths[i] * alpha; + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length; + strengths = new Array(n); + xz = new Array(n); + for (i = 0; i < n; ++i) { + strengths[i] = isNaN(xz[i] = +x(nodes[i], i, nodes)) ? 0 : +strength(nodes[i], i, nodes); + } + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.x = function(_) { + return arguments.length ? (x = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : x; + }; + + return force; +} + +function y$2(y) { + var strength = constant$6(0.1), + nodes, + strengths, + yz; + + if (typeof y !== "function") y = constant$6(y == null ? 0 : +y); + + function force(alpha) { + for (var i = 0, n = nodes.length, node; i < n; ++i) { + node = nodes[i], node.vy += (yz[i] - node.y) * strengths[i] * alpha; + } + } + + function initialize() { + if (!nodes) return; + var i, n = nodes.length; + strengths = new Array(n); + yz = new Array(n); + for (i = 0; i < n; ++i) { + strengths[i] = isNaN(yz[i] = +y(nodes[i], i, nodes)) ? 0 : +strength(nodes[i], i, nodes); + } + } + + force.initialize = function(_) { + nodes = _; + initialize(); + }; + + force.strength = function(_) { + return arguments.length ? (strength = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : strength; + }; + + force.y = function(_) { + return arguments.length ? (y = typeof _ === "function" ? _ : constant$6(+_), initialize(), force) : y; + }; + + return force; +} + +// Computes the decimal coefficient and exponent of the specified number x with +// significant digits p, where x is positive and p is in [1, 21] or undefined. +// For example, formatDecimal(1.23) returns ["123", 0]. +function formatDecimal(x, p) { + if ((i = (x = p ? x.toExponential(p - 1) : x.toExponential()).indexOf("e")) < 0) return null; // NaN, ±Infinity + var i, coefficient = x.slice(0, i); + + // The string returned by toExponential either has the form \d\.\d+e[-+]\d+ + // (e.g., 1.2e+3) or the form \de[-+]\d+ (e.g., 1e+3). + return [ + coefficient.length > 1 ? coefficient[0] + coefficient.slice(2) : coefficient, + +x.slice(i + 1) + ]; +} + +function exponent$1(x) { + return x = formatDecimal(Math.abs(x)), x ? x[1] : NaN; +} + +function formatGroup(grouping, thousands) { + return function(value, width) { + var i = value.length, + t = [], + j = 0, + g = grouping[0], + length = 0; + + while (i > 0 && g > 0) { + if (length + g + 1 > width) g = Math.max(1, width - length); + t.push(value.substring(i -= g, i + g)); + if ((length += g + 1) > width) break; + g = grouping[j = (j + 1) % grouping.length]; + } + + return t.reverse().join(thousands); + }; +} + +function formatNumerals(numerals) { + return function(value) { + return value.replace(/[0-9]/g, function(i) { + return numerals[+i]; + }); + }; +} + +function formatDefault(x, p) { + x = x.toPrecision(p); + + out: for (var n = x.length, i = 1, i0 = -1, i1; i < n; ++i) { + switch (x[i]) { + case ".": i0 = i1 = i; break; + case "0": if (i0 === 0) i0 = i; i1 = i; break; + case "e": break out; + default: if (i0 > 0) i0 = 0; break; + } + } + + return i0 > 0 ? x.slice(0, i0) + x.slice(i1 + 1) : x; +} + +var prefixExponent; + +function formatPrefixAuto(x, p) { + var d = formatDecimal(x, p); + if (!d) return x + ""; + var coefficient = d[0], + exponent = d[1], + i = exponent - (prefixExponent = Math.max(-8, Math.min(8, Math.floor(exponent / 3))) * 3) + 1, + n = coefficient.length; + return i === n ? coefficient + : i > n ? coefficient + new Array(i - n + 1).join("0") + : i > 0 ? coefficient.slice(0, i) + "." + coefficient.slice(i) + : "0." + new Array(1 - i).join("0") + formatDecimal(x, Math.max(0, p + i - 1))[0]; // less than 1y! +} + +function formatRounded(x, p) { + var d = formatDecimal(x, p); + if (!d) return x + ""; + var coefficient = d[0], + exponent = d[1]; + return exponent < 0 ? "0." + new Array(-exponent).join("0") + coefficient + : coefficient.length > exponent + 1 ? coefficient.slice(0, exponent + 1) + "." + coefficient.slice(exponent + 1) + : coefficient + new Array(exponent - coefficient.length + 2).join("0"); +} + +var formatTypes = { + "": formatDefault, + "%": function(x, p) { return (x * 100).toFixed(p); }, + "b": function(x) { return Math.round(x).toString(2); }, + "c": function(x) { return x + ""; }, + "d": function(x) { return Math.round(x).toString(10); }, + "e": function(x, p) { return x.toExponential(p); }, + "f": function(x, p) { return x.toFixed(p); }, + "g": function(x, p) { return x.toPrecision(p); }, + "o": function(x) { return Math.round(x).toString(8); }, + "p": function(x, p) { return formatRounded(x * 100, p); }, + "r": formatRounded, + "s": formatPrefixAuto, + "X": function(x) { return Math.round(x).toString(16).toUpperCase(); }, + "x": function(x) { return Math.round(x).toString(16); } +}; + +// [[fill]align][sign][symbol][0][width][,][.precision][type] +var re = /^(?:(.)?([<>=^]))?([+\-\( ])?([$#])?(0)?(\d+)?(,)?(\.\d+)?([a-z%])?$/i; + +function formatSpecifier(specifier) { + return new FormatSpecifier(specifier); +} + +formatSpecifier.prototype = FormatSpecifier.prototype; // instanceof + +function FormatSpecifier(specifier) { + if (!(match = re.exec(specifier))) throw new Error("invalid format: " + specifier); + + var match, + fill = match[1] || " ", + align = match[2] || ">", + sign = match[3] || "-", + symbol = match[4] || "", + zero = !!match[5], + width = match[6] && +match[6], + comma = !!match[7], + precision = match[8] && +match[8].slice(1), + type = match[9] || ""; + + // The "n" type is an alias for ",g". + if (type === "n") comma = true, type = "g"; + + // Map invalid types to the default format. + else if (!formatTypes[type]) type = ""; + + // If zero fill is specified, padding goes after sign and before digits. + if (zero || (fill === "0" && align === "=")) zero = true, fill = "0", align = "="; + + this.fill = fill; + this.align = align; + this.sign = sign; + this.symbol = symbol; + this.zero = zero; + this.width = width; + this.comma = comma; + this.precision = precision; + this.type = type; +} + +FormatSpecifier.prototype.toString = function() { + return this.fill + + this.align + + this.sign + + this.symbol + + (this.zero ? "0" : "") + + (this.width == null ? "" : Math.max(1, this.width | 0)) + + (this.comma ? "," : "") + + (this.precision == null ? "" : "." + Math.max(0, this.precision | 0)) + + this.type; +}; + +function identity$3(x) { + return x; +} + +var prefixes = ["y","z","a","f","p","n","\xB5","m","","k","M","G","T","P","E","Z","Y"]; + +function formatLocale(locale) { + var group = locale.grouping && locale.thousands ? formatGroup(locale.grouping, locale.thousands) : identity$3, + currency = locale.currency, + decimal = locale.decimal, + numerals = locale.numerals ? formatNumerals(locale.numerals) : identity$3, + percent = locale.percent || "%"; + + function newFormat(specifier) { + specifier = formatSpecifier(specifier); + + var fill = specifier.fill, + align = specifier.align, + sign = specifier.sign, + symbol = specifier.symbol, + zero = specifier.zero, + width = specifier.width, + comma = specifier.comma, + precision = specifier.precision, + type = specifier.type; + + // Compute the prefix and suffix. + // For SI-prefix, the suffix is lazily computed. + var prefix = symbol === "$" ? currency[0] : symbol === "#" && /[boxX]/.test(type) ? "0" + type.toLowerCase() : "", + suffix = symbol === "$" ? currency[1] : /[%p]/.test(type) ? percent : ""; + + // What format function should we use? + // Is this an integer type? + // Can this type generate exponential notation? + var formatType = formatTypes[type], + maybeSuffix = !type || /[defgprs%]/.test(type); + + // Set the default precision if not specified, + // or clamp the specified precision to the supported range. + // For significant precision, it must be in [1, 21]. + // For fixed precision, it must be in [0, 20]. + precision = precision == null ? (type ? 6 : 12) + : /[gprs]/.test(type) ? Math.max(1, Math.min(21, precision)) + : Math.max(0, Math.min(20, precision)); + + function format(value) { + var valuePrefix = prefix, + valueSuffix = suffix, + i, n, c; + + if (type === "c") { + valueSuffix = formatType(value) + valueSuffix; + value = ""; + } else { + value = +value; + + // Perform the initial formatting. + var valueNegative = value < 0; + value = formatType(Math.abs(value), precision); + + // If a negative value rounds to zero during formatting, treat as positive. + if (valueNegative && +value === 0) valueNegative = false; + + // Compute the prefix and suffix. + valuePrefix = (valueNegative ? (sign === "(" ? sign : "-") : sign === "-" || sign === "(" ? "" : sign) + valuePrefix; + valueSuffix = (type === "s" ? prefixes[8 + prefixExponent / 3] : "") + valueSuffix + (valueNegative && sign === "(" ? ")" : ""); + + // Break the formatted value into the integer “value” part that can be + // grouped, and fractional or exponential “suffix” part that is not. + if (maybeSuffix) { + i = -1, n = value.length; + while (++i < n) { + if (c = value.charCodeAt(i), 48 > c || c > 57) { + valueSuffix = (c === 46 ? decimal + value.slice(i + 1) : value.slice(i)) + valueSuffix; + value = value.slice(0, i); + break; + } + } + } + } + + // If the fill character is not "0", grouping is applied before padding. + if (comma && !zero) value = group(value, Infinity); + + // Compute the padding. + var length = valuePrefix.length + value.length + valueSuffix.length, + padding = length < width ? new Array(width - length + 1).join(fill) : ""; + + // If the fill character is "0", grouping is applied after padding. + if (comma && zero) value = group(padding + value, padding.length ? width - valueSuffix.length : Infinity), padding = ""; + + // Reconstruct the final output based on the desired alignment. + switch (align) { + case "<": value = valuePrefix + value + valueSuffix + padding; break; + case "=": value = valuePrefix + padding + value + valueSuffix; break; + case "^": value = padding.slice(0, length = padding.length >> 1) + valuePrefix + value + valueSuffix + padding.slice(length); break; + default: value = padding + valuePrefix + value + valueSuffix; break; + } + + return numerals(value); + } + + format.toString = function() { + return specifier + ""; + }; + + return format; + } + + function formatPrefix(specifier, value) { + var f = newFormat((specifier = formatSpecifier(specifier), specifier.type = "f", specifier)), + e = Math.max(-8, Math.min(8, Math.floor(exponent$1(value) / 3))) * 3, + k = Math.pow(10, -e), + prefix = prefixes[8 + e / 3]; + return function(value) { + return f(k * value) + prefix; + }; + } + + return { + format: newFormat, + formatPrefix: formatPrefix + }; +} + +var locale; + + + +defaultLocale({ + decimal: ".", + thousands: ",", + grouping: [3], + currency: ["$", ""] +}); + +function defaultLocale(definition) { + locale = formatLocale(definition); + exports.format = locale.format; + exports.formatPrefix = locale.formatPrefix; + return locale; +} + +function precisionFixed(step) { + return Math.max(0, -exponent$1(Math.abs(step))); +} + +function precisionPrefix(step, value) { + return Math.max(0, Math.max(-8, Math.min(8, Math.floor(exponent$1(value) / 3))) * 3 - exponent$1(Math.abs(step))); +} + +function precisionRound(step, max) { + step = Math.abs(step), max = Math.abs(max) - step; + return Math.max(0, exponent$1(max) - exponent$1(step)) + 1; +} + +// Adds floating point numbers with twice the normal precision. +// Reference: J. R. Shewchuk, Adaptive Precision Floating-Point Arithmetic and +// Fast Robust Geometric Predicates, Discrete & Computational Geometry 18(3) +// 305–363 (1997). +// Code adapted from GeographicLib by Charles F. F. Karney, +// http://geographiclib.sourceforge.net/ + +function adder() { + return new Adder; +} + +function Adder() { + this.reset(); +} + +Adder.prototype = { + constructor: Adder, + reset: function() { + this.s = // rounded value + this.t = 0; // exact error + }, + add: function(y) { + add$1(temp, y, this.t); + add$1(this, temp.s, this.s); + if (this.s) this.t += temp.t; + else this.s = temp.t; + }, + valueOf: function() { + return this.s; + } +}; + +var temp = new Adder; + +function add$1(adder, a, b) { + var x = adder.s = a + b, + bv = x - a, + av = x - bv; + adder.t = (a - av) + (b - bv); +} + +var epsilon$2 = 1e-6; +var epsilon2$1 = 1e-12; +var pi$3 = Math.PI; +var halfPi$2 = pi$3 / 2; +var quarterPi = pi$3 / 4; +var tau$3 = pi$3 * 2; + +var degrees$1 = 180 / pi$3; +var radians = pi$3 / 180; + +var abs = Math.abs; +var atan = Math.atan; +var atan2 = Math.atan2; +var cos$1 = Math.cos; +var ceil = Math.ceil; +var exp = Math.exp; + +var log = Math.log; +var pow = Math.pow; +var sin$1 = Math.sin; +var sign = Math.sign || function(x) { return x > 0 ? 1 : x < 0 ? -1 : 0; }; +var sqrt = Math.sqrt; +var tan = Math.tan; + +function acos(x) { + return x > 1 ? 0 : x < -1 ? pi$3 : Math.acos(x); +} + +function asin(x) { + return x > 1 ? halfPi$2 : x < -1 ? -halfPi$2 : Math.asin(x); +} + +function haversin(x) { + return (x = sin$1(x / 2)) * x; +} + +function noop$1() {} + +function streamGeometry(geometry, stream) { + if (geometry && streamGeometryType.hasOwnProperty(geometry.type)) { + streamGeometryType[geometry.type](geometry, stream); + } +} + +var streamObjectType = { + Feature: function(object, stream) { + streamGeometry(object.geometry, stream); + }, + FeatureCollection: function(object, stream) { + var features = object.features, i = -1, n = features.length; + while (++i < n) streamGeometry(features[i].geometry, stream); + } +}; + +var streamGeometryType = { + Sphere: function(object, stream) { + stream.sphere(); + }, + Point: function(object, stream) { + object = object.coordinates; + stream.point(object[0], object[1], object[2]); + }, + MultiPoint: function(object, stream) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) object = coordinates[i], stream.point(object[0], object[1], object[2]); + }, + LineString: function(object, stream) { + streamLine(object.coordinates, stream, 0); + }, + MultiLineString: function(object, stream) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) streamLine(coordinates[i], stream, 0); + }, + Polygon: function(object, stream) { + streamPolygon(object.coordinates, stream); + }, + MultiPolygon: function(object, stream) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) streamPolygon(coordinates[i], stream); + }, + GeometryCollection: function(object, stream) { + var geometries = object.geometries, i = -1, n = geometries.length; + while (++i < n) streamGeometry(geometries[i], stream); + } +}; + +function streamLine(coordinates, stream, closed) { + var i = -1, n = coordinates.length - closed, coordinate; + stream.lineStart(); + while (++i < n) coordinate = coordinates[i], stream.point(coordinate[0], coordinate[1], coordinate[2]); + stream.lineEnd(); +} + +function streamPolygon(coordinates, stream) { + var i = -1, n = coordinates.length; + stream.polygonStart(); + while (++i < n) streamLine(coordinates[i], stream, 1); + stream.polygonEnd(); +} + +function geoStream(object, stream) { + if (object && streamObjectType.hasOwnProperty(object.type)) { + streamObjectType[object.type](object, stream); + } else { + streamGeometry(object, stream); + } +} + +var areaRingSum = adder(); + +var areaSum = adder(); +var lambda00; +var phi00; +var lambda0; +var cosPhi0; +var sinPhi0; + +var areaStream = { + point: noop$1, + lineStart: noop$1, + lineEnd: noop$1, + polygonStart: function() { + areaRingSum.reset(); + areaStream.lineStart = areaRingStart; + areaStream.lineEnd = areaRingEnd; + }, + polygonEnd: function() { + var areaRing = +areaRingSum; + areaSum.add(areaRing < 0 ? tau$3 + areaRing : areaRing); + this.lineStart = this.lineEnd = this.point = noop$1; + }, + sphere: function() { + areaSum.add(tau$3); + } +}; + +function areaRingStart() { + areaStream.point = areaPointFirst; +} + +function areaRingEnd() { + areaPoint(lambda00, phi00); +} + +function areaPointFirst(lambda, phi) { + areaStream.point = areaPoint; + lambda00 = lambda, phi00 = phi; + lambda *= radians, phi *= radians; + lambda0 = lambda, cosPhi0 = cos$1(phi = phi / 2 + quarterPi), sinPhi0 = sin$1(phi); +} + +function areaPoint(lambda, phi) { + lambda *= radians, phi *= radians; + phi = phi / 2 + quarterPi; // half the angular distance from south pole + + // Spherical excess E for a spherical triangle with vertices: south pole, + // previous point, current point. Uses a formula derived from Cagnoli’s + // theorem. See Todhunter, Spherical Trig. (1871), Sec. 103, Eq. (2). + var dLambda = lambda - lambda0, + sdLambda = dLambda >= 0 ? 1 : -1, + adLambda = sdLambda * dLambda, + cosPhi = cos$1(phi), + sinPhi = sin$1(phi), + k = sinPhi0 * sinPhi, + u = cosPhi0 * cosPhi + k * cos$1(adLambda), + v = k * sdLambda * sin$1(adLambda); + areaRingSum.add(atan2(v, u)); + + // Advance the previous points. + lambda0 = lambda, cosPhi0 = cosPhi, sinPhi0 = sinPhi; +} + +function area(object) { + areaSum.reset(); + geoStream(object, areaStream); + return areaSum * 2; +} + +function spherical(cartesian) { + return [atan2(cartesian[1], cartesian[0]), asin(cartesian[2])]; +} + +function cartesian(spherical) { + var lambda = spherical[0], phi = spherical[1], cosPhi = cos$1(phi); + return [cosPhi * cos$1(lambda), cosPhi * sin$1(lambda), sin$1(phi)]; +} + +function cartesianDot(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2]; +} + +function cartesianCross(a, b) { + return [a[1] * b[2] - a[2] * b[1], a[2] * b[0] - a[0] * b[2], a[0] * b[1] - a[1] * b[0]]; +} + +// TODO return a +function cartesianAddInPlace(a, b) { + a[0] += b[0], a[1] += b[1], a[2] += b[2]; +} + +function cartesianScale(vector, k) { + return [vector[0] * k, vector[1] * k, vector[2] * k]; +} + +// TODO return d +function cartesianNormalizeInPlace(d) { + var l = sqrt(d[0] * d[0] + d[1] * d[1] + d[2] * d[2]); + d[0] /= l, d[1] /= l, d[2] /= l; +} + +var lambda0$1; +var phi0; +var lambda1; +var phi1; +var lambda2; +var lambda00$1; +var phi00$1; +var p0; +var deltaSum = adder(); +var ranges; +var range; + +var boundsStream = { + point: boundsPoint, + lineStart: boundsLineStart, + lineEnd: boundsLineEnd, + polygonStart: function() { + boundsStream.point = boundsRingPoint; + boundsStream.lineStart = boundsRingStart; + boundsStream.lineEnd = boundsRingEnd; + deltaSum.reset(); + areaStream.polygonStart(); + }, + polygonEnd: function() { + areaStream.polygonEnd(); + boundsStream.point = boundsPoint; + boundsStream.lineStart = boundsLineStart; + boundsStream.lineEnd = boundsLineEnd; + if (areaRingSum < 0) lambda0$1 = -(lambda1 = 180), phi0 = -(phi1 = 90); + else if (deltaSum > epsilon$2) phi1 = 90; + else if (deltaSum < -epsilon$2) phi0 = -90; + range[0] = lambda0$1, range[1] = lambda1; + } +}; + +function boundsPoint(lambda, phi) { + ranges.push(range = [lambda0$1 = lambda, lambda1 = lambda]); + if (phi < phi0) phi0 = phi; + if (phi > phi1) phi1 = phi; +} + +function linePoint(lambda, phi) { + var p = cartesian([lambda * radians, phi * radians]); + if (p0) { + var normal = cartesianCross(p0, p), + equatorial = [normal[1], -normal[0], 0], + inflection = cartesianCross(equatorial, normal); + cartesianNormalizeInPlace(inflection); + inflection = spherical(inflection); + var delta = lambda - lambda2, + sign$$1 = delta > 0 ? 1 : -1, + lambdai = inflection[0] * degrees$1 * sign$$1, + phii, + antimeridian = abs(delta) > 180; + if (antimeridian ^ (sign$$1 * lambda2 < lambdai && lambdai < sign$$1 * lambda)) { + phii = inflection[1] * degrees$1; + if (phii > phi1) phi1 = phii; + } else if (lambdai = (lambdai + 360) % 360 - 180, antimeridian ^ (sign$$1 * lambda2 < lambdai && lambdai < sign$$1 * lambda)) { + phii = -inflection[1] * degrees$1; + if (phii < phi0) phi0 = phii; + } else { + if (phi < phi0) phi0 = phi; + if (phi > phi1) phi1 = phi; + } + if (antimeridian) { + if (lambda < lambda2) { + if (angle(lambda0$1, lambda) > angle(lambda0$1, lambda1)) lambda1 = lambda; + } else { + if (angle(lambda, lambda1) > angle(lambda0$1, lambda1)) lambda0$1 = lambda; + } + } else { + if (lambda1 >= lambda0$1) { + if (lambda < lambda0$1) lambda0$1 = lambda; + if (lambda > lambda1) lambda1 = lambda; + } else { + if (lambda > lambda2) { + if (angle(lambda0$1, lambda) > angle(lambda0$1, lambda1)) lambda1 = lambda; + } else { + if (angle(lambda, lambda1) > angle(lambda0$1, lambda1)) lambda0$1 = lambda; + } + } + } + } else { + ranges.push(range = [lambda0$1 = lambda, lambda1 = lambda]); + } + if (phi < phi0) phi0 = phi; + if (phi > phi1) phi1 = phi; + p0 = p, lambda2 = lambda; +} + +function boundsLineStart() { + boundsStream.point = linePoint; +} + +function boundsLineEnd() { + range[0] = lambda0$1, range[1] = lambda1; + boundsStream.point = boundsPoint; + p0 = null; +} + +function boundsRingPoint(lambda, phi) { + if (p0) { + var delta = lambda - lambda2; + deltaSum.add(abs(delta) > 180 ? delta + (delta > 0 ? 360 : -360) : delta); + } else { + lambda00$1 = lambda, phi00$1 = phi; + } + areaStream.point(lambda, phi); + linePoint(lambda, phi); +} + +function boundsRingStart() { + areaStream.lineStart(); +} + +function boundsRingEnd() { + boundsRingPoint(lambda00$1, phi00$1); + areaStream.lineEnd(); + if (abs(deltaSum) > epsilon$2) lambda0$1 = -(lambda1 = 180); + range[0] = lambda0$1, range[1] = lambda1; + p0 = null; +} + +// Finds the left-right distance between two longitudes. +// This is almost the same as (lambda1 - lambda0 + 360°) % 360°, except that we want +// the distance between ±180° to be 360°. +function angle(lambda0, lambda1) { + return (lambda1 -= lambda0) < 0 ? lambda1 + 360 : lambda1; +} + +function rangeCompare(a, b) { + return a[0] - b[0]; +} + +function rangeContains(range, x) { + return range[0] <= range[1] ? range[0] <= x && x <= range[1] : x < range[0] || range[1] < x; +} + +function bounds(feature) { + var i, n, a, b, merged, deltaMax, delta; + + phi1 = lambda1 = -(lambda0$1 = phi0 = Infinity); + ranges = []; + geoStream(feature, boundsStream); + + // First, sort ranges by their minimum longitudes. + if (n = ranges.length) { + ranges.sort(rangeCompare); + + // Then, merge any ranges that overlap. + for (i = 1, a = ranges[0], merged = [a]; i < n; ++i) { + b = ranges[i]; + if (rangeContains(a, b[0]) || rangeContains(a, b[1])) { + if (angle(a[0], b[1]) > angle(a[0], a[1])) a[1] = b[1]; + if (angle(b[0], a[1]) > angle(a[0], a[1])) a[0] = b[0]; + } else { + merged.push(a = b); + } + } + + // Finally, find the largest gap between the merged ranges. + // The final bounding box will be the inverse of this gap. + for (deltaMax = -Infinity, n = merged.length - 1, i = 0, a = merged[n]; i <= n; a = b, ++i) { + b = merged[i]; + if ((delta = angle(a[1], b[0])) > deltaMax) deltaMax = delta, lambda0$1 = b[0], lambda1 = a[1]; + } + } + + ranges = range = null; + + return lambda0$1 === Infinity || phi0 === Infinity + ? [[NaN, NaN], [NaN, NaN]] + : [[lambda0$1, phi0], [lambda1, phi1]]; +} + +var W0; +var W1; +var X0; +var Y0; +var Z0; +var X1; +var Y1; +var Z1; +var X2; +var Y2; +var Z2; +var lambda00$2; +var phi00$2; +var x0; +var y0; +var z0; // previous point + +var centroidStream = { + sphere: noop$1, + point: centroidPoint, + lineStart: centroidLineStart, + lineEnd: centroidLineEnd, + polygonStart: function() { + centroidStream.lineStart = centroidRingStart; + centroidStream.lineEnd = centroidRingEnd; + }, + polygonEnd: function() { + centroidStream.lineStart = centroidLineStart; + centroidStream.lineEnd = centroidLineEnd; + } +}; + +// Arithmetic mean of Cartesian vectors. +function centroidPoint(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi); + centroidPointCartesian(cosPhi * cos$1(lambda), cosPhi * sin$1(lambda), sin$1(phi)); +} + +function centroidPointCartesian(x, y, z) { + ++W0; + X0 += (x - X0) / W0; + Y0 += (y - Y0) / W0; + Z0 += (z - Z0) / W0; +} + +function centroidLineStart() { + centroidStream.point = centroidLinePointFirst; +} + +function centroidLinePointFirst(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi); + x0 = cosPhi * cos$1(lambda); + y0 = cosPhi * sin$1(lambda); + z0 = sin$1(phi); + centroidStream.point = centroidLinePoint; + centroidPointCartesian(x0, y0, z0); +} + +function centroidLinePoint(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi), + x = cosPhi * cos$1(lambda), + y = cosPhi * sin$1(lambda), + z = sin$1(phi), + w = atan2(sqrt((w = y0 * z - z0 * y) * w + (w = z0 * x - x0 * z) * w + (w = x0 * y - y0 * x) * w), x0 * x + y0 * y + z0 * z); + W1 += w; + X1 += w * (x0 + (x0 = x)); + Y1 += w * (y0 + (y0 = y)); + Z1 += w * (z0 + (z0 = z)); + centroidPointCartesian(x0, y0, z0); +} + +function centroidLineEnd() { + centroidStream.point = centroidPoint; +} + +// See J. E. Brock, The Inertia Tensor for a Spherical Triangle, +// J. Applied Mechanics 42, 239 (1975). +function centroidRingStart() { + centroidStream.point = centroidRingPointFirst; +} + +function centroidRingEnd() { + centroidRingPoint(lambda00$2, phi00$2); + centroidStream.point = centroidPoint; +} + +function centroidRingPointFirst(lambda, phi) { + lambda00$2 = lambda, phi00$2 = phi; + lambda *= radians, phi *= radians; + centroidStream.point = centroidRingPoint; + var cosPhi = cos$1(phi); + x0 = cosPhi * cos$1(lambda); + y0 = cosPhi * sin$1(lambda); + z0 = sin$1(phi); + centroidPointCartesian(x0, y0, z0); +} + +function centroidRingPoint(lambda, phi) { + lambda *= radians, phi *= radians; + var cosPhi = cos$1(phi), + x = cosPhi * cos$1(lambda), + y = cosPhi * sin$1(lambda), + z = sin$1(phi), + cx = y0 * z - z0 * y, + cy = z0 * x - x0 * z, + cz = x0 * y - y0 * x, + m = sqrt(cx * cx + cy * cy + cz * cz), + w = asin(m), // line weight = angle + v = m && -w / m; // area weight multiplier + X2 += v * cx; + Y2 += v * cy; + Z2 += v * cz; + W1 += w; + X1 += w * (x0 + (x0 = x)); + Y1 += w * (y0 + (y0 = y)); + Z1 += w * (z0 + (z0 = z)); + centroidPointCartesian(x0, y0, z0); +} + +function centroid(object) { + W0 = W1 = + X0 = Y0 = Z0 = + X1 = Y1 = Z1 = + X2 = Y2 = Z2 = 0; + geoStream(object, centroidStream); + + var x = X2, + y = Y2, + z = Z2, + m = x * x + y * y + z * z; + + // If the area-weighted ccentroid is undefined, fall back to length-weighted ccentroid. + if (m < epsilon2$1) { + x = X1, y = Y1, z = Z1; + // If the feature has zero length, fall back to arithmetic mean of point vectors. + if (W1 < epsilon$2) x = X0, y = Y0, z = Z0; + m = x * x + y * y + z * z; + // If the feature still has an undefined ccentroid, then return. + if (m < epsilon2$1) return [NaN, NaN]; + } + + return [atan2(y, x) * degrees$1, asin(z / sqrt(m)) * degrees$1]; +} + +function constant$7(x) { + return function() { + return x; + }; +} + +function compose(a, b) { + + function compose(x, y) { + return x = a(x, y), b(x[0], x[1]); + } + + if (a.invert && b.invert) compose.invert = function(x, y) { + return x = b.invert(x, y), x && a.invert(x[0], x[1]); + }; + + return compose; +} + +function rotationIdentity(lambda, phi) { + return [lambda > pi$3 ? lambda - tau$3 : lambda < -pi$3 ? lambda + tau$3 : lambda, phi]; +} + +rotationIdentity.invert = rotationIdentity; + +function rotateRadians(deltaLambda, deltaPhi, deltaGamma) { + return (deltaLambda %= tau$3) ? (deltaPhi || deltaGamma ? compose(rotationLambda(deltaLambda), rotationPhiGamma(deltaPhi, deltaGamma)) + : rotationLambda(deltaLambda)) + : (deltaPhi || deltaGamma ? rotationPhiGamma(deltaPhi, deltaGamma) + : rotationIdentity); +} + +function forwardRotationLambda(deltaLambda) { + return function(lambda, phi) { + return lambda += deltaLambda, [lambda > pi$3 ? lambda - tau$3 : lambda < -pi$3 ? lambda + tau$3 : lambda, phi]; + }; +} + +function rotationLambda(deltaLambda) { + var rotation = forwardRotationLambda(deltaLambda); + rotation.invert = forwardRotationLambda(-deltaLambda); + return rotation; +} + +function rotationPhiGamma(deltaPhi, deltaGamma) { + var cosDeltaPhi = cos$1(deltaPhi), + sinDeltaPhi = sin$1(deltaPhi), + cosDeltaGamma = cos$1(deltaGamma), + sinDeltaGamma = sin$1(deltaGamma); + + function rotation(lambda, phi) { + var cosPhi = cos$1(phi), + x = cos$1(lambda) * cosPhi, + y = sin$1(lambda) * cosPhi, + z = sin$1(phi), + k = z * cosDeltaPhi + x * sinDeltaPhi; + return [ + atan2(y * cosDeltaGamma - k * sinDeltaGamma, x * cosDeltaPhi - z * sinDeltaPhi), + asin(k * cosDeltaGamma + y * sinDeltaGamma) + ]; + } + + rotation.invert = function(lambda, phi) { + var cosPhi = cos$1(phi), + x = cos$1(lambda) * cosPhi, + y = sin$1(lambda) * cosPhi, + z = sin$1(phi), + k = z * cosDeltaGamma - y * sinDeltaGamma; + return [ + atan2(y * cosDeltaGamma + z * sinDeltaGamma, x * cosDeltaPhi + k * sinDeltaPhi), + asin(k * cosDeltaPhi - x * sinDeltaPhi) + ]; + }; + + return rotation; +} + +function rotation(rotate) { + rotate = rotateRadians(rotate[0] * radians, rotate[1] * radians, rotate.length > 2 ? rotate[2] * radians : 0); + + function forward(coordinates) { + coordinates = rotate(coordinates[0] * radians, coordinates[1] * radians); + return coordinates[0] *= degrees$1, coordinates[1] *= degrees$1, coordinates; + } + + forward.invert = function(coordinates) { + coordinates = rotate.invert(coordinates[0] * radians, coordinates[1] * radians); + return coordinates[0] *= degrees$1, coordinates[1] *= degrees$1, coordinates; + }; + + return forward; +} + +// Generates a circle centered at [0°, 0°], with a given radius and precision. +function circleStream(stream, radius, delta, direction, t0, t1) { + if (!delta) return; + var cosRadius = cos$1(radius), + sinRadius = sin$1(radius), + step = direction * delta; + if (t0 == null) { + t0 = radius + direction * tau$3; + t1 = radius - step / 2; + } else { + t0 = circleRadius(cosRadius, t0); + t1 = circleRadius(cosRadius, t1); + if (direction > 0 ? t0 < t1 : t0 > t1) t0 += direction * tau$3; + } + for (var point, t = t0; direction > 0 ? t > t1 : t < t1; t -= step) { + point = spherical([cosRadius, -sinRadius * cos$1(t), -sinRadius * sin$1(t)]); + stream.point(point[0], point[1]); + } +} + +// Returns the signed angle of a cartesian point relative to [cosRadius, 0, 0]. +function circleRadius(cosRadius, point) { + point = cartesian(point), point[0] -= cosRadius; + cartesianNormalizeInPlace(point); + var radius = acos(-point[1]); + return ((-point[2] < 0 ? -radius : radius) + tau$3 - epsilon$2) % tau$3; +} + +function circle() { + var center = constant$7([0, 0]), + radius = constant$7(90), + precision = constant$7(6), + ring, + rotate, + stream = {point: point}; + + function point(x, y) { + ring.push(x = rotate(x, y)); + x[0] *= degrees$1, x[1] *= degrees$1; + } + + function circle() { + var c = center.apply(this, arguments), + r = radius.apply(this, arguments) * radians, + p = precision.apply(this, arguments) * radians; + ring = []; + rotate = rotateRadians(-c[0] * radians, -c[1] * radians, 0).invert; + circleStream(stream, r, p, 1); + c = {type: "Polygon", coordinates: [ring]}; + ring = rotate = null; + return c; + } + + circle.center = function(_) { + return arguments.length ? (center = typeof _ === "function" ? _ : constant$7([+_[0], +_[1]]), circle) : center; + }; + + circle.radius = function(_) { + return arguments.length ? (radius = typeof _ === "function" ? _ : constant$7(+_), circle) : radius; + }; + + circle.precision = function(_) { + return arguments.length ? (precision = typeof _ === "function" ? _ : constant$7(+_), circle) : precision; + }; + + return circle; +} + +function clipBuffer() { + var lines = [], + line; + return { + point: function(x, y) { + line.push([x, y]); + }, + lineStart: function() { + lines.push(line = []); + }, + lineEnd: noop$1, + rejoin: function() { + if (lines.length > 1) lines.push(lines.pop().concat(lines.shift())); + }, + result: function() { + var result = lines; + lines = []; + line = null; + return result; + } + }; +} + +function pointEqual(a, b) { + return abs(a[0] - b[0]) < epsilon$2 && abs(a[1] - b[1]) < epsilon$2; +} + +function Intersection(point, points, other, entry) { + this.x = point; + this.z = points; + this.o = other; // another intersection + this.e = entry; // is an entry? + this.v = false; // visited + this.n = this.p = null; // next & previous +} + +// A generalized polygon clipping algorithm: given a polygon that has been cut +// into its visible line segments, and rejoins the segments by interpolating +// along the clip edge. +function clipRejoin(segments, compareIntersection, startInside, interpolate, stream) { + var subject = [], + clip = [], + i, + n; + + segments.forEach(function(segment) { + if ((n = segment.length - 1) <= 0) return; + var n, p0 = segment[0], p1 = segment[n], x; + + // If the first and last points of a segment are coincident, then treat as a + // closed ring. TODO if all rings are closed, then the winding order of the + // exterior ring should be checked. + if (pointEqual(p0, p1)) { + stream.lineStart(); + for (i = 0; i < n; ++i) stream.point((p0 = segment[i])[0], p0[1]); + stream.lineEnd(); + return; + } + + subject.push(x = new Intersection(p0, segment, null, true)); + clip.push(x.o = new Intersection(p0, null, x, false)); + subject.push(x = new Intersection(p1, segment, null, false)); + clip.push(x.o = new Intersection(p1, null, x, true)); + }); + + if (!subject.length) return; + + clip.sort(compareIntersection); + link$1(subject); + link$1(clip); + + for (i = 0, n = clip.length; i < n; ++i) { + clip[i].e = startInside = !startInside; + } + + var start = subject[0], + points, + point; + + while (1) { + // Find first unvisited intersection. + var current = start, + isSubject = true; + while (current.v) if ((current = current.n) === start) return; + points = current.z; + stream.lineStart(); + do { + current.v = current.o.v = true; + if (current.e) { + if (isSubject) { + for (i = 0, n = points.length; i < n; ++i) stream.point((point = points[i])[0], point[1]); + } else { + interpolate(current.x, current.n.x, 1, stream); + } + current = current.n; + } else { + if (isSubject) { + points = current.p.z; + for (i = points.length - 1; i >= 0; --i) stream.point((point = points[i])[0], point[1]); + } else { + interpolate(current.x, current.p.x, -1, stream); + } + current = current.p; + } + current = current.o; + points = current.z; + isSubject = !isSubject; + } while (!current.v); + stream.lineEnd(); + } +} + +function link$1(array) { + if (!(n = array.length)) return; + var n, + i = 0, + a = array[0], + b; + while (++i < n) { + a.n = b = array[i]; + b.p = a; + a = b; + } + a.n = b = array[0]; + b.p = a; +} + +var sum$1 = adder(); + +function polygonContains(polygon, point) { + var lambda = point[0], + phi = point[1], + normal = [sin$1(lambda), -cos$1(lambda), 0], + angle = 0, + winding = 0; + + sum$1.reset(); + + for (var i = 0, n = polygon.length; i < n; ++i) { + if (!(m = (ring = polygon[i]).length)) continue; + var ring, + m, + point0 = ring[m - 1], + lambda0 = point0[0], + phi0 = point0[1] / 2 + quarterPi, + sinPhi0 = sin$1(phi0), + cosPhi0 = cos$1(phi0); + + for (var j = 0; j < m; ++j, lambda0 = lambda1, sinPhi0 = sinPhi1, cosPhi0 = cosPhi1, point0 = point1) { + var point1 = ring[j], + lambda1 = point1[0], + phi1 = point1[1] / 2 + quarterPi, + sinPhi1 = sin$1(phi1), + cosPhi1 = cos$1(phi1), + delta = lambda1 - lambda0, + sign$$1 = delta >= 0 ? 1 : -1, + absDelta = sign$$1 * delta, + antimeridian = absDelta > pi$3, + k = sinPhi0 * sinPhi1; + + sum$1.add(atan2(k * sign$$1 * sin$1(absDelta), cosPhi0 * cosPhi1 + k * cos$1(absDelta))); + angle += antimeridian ? delta + sign$$1 * tau$3 : delta; + + // Are the longitudes either side of the point’s meridian (lambda), + // and are the latitudes smaller than the parallel (phi)? + if (antimeridian ^ lambda0 >= lambda ^ lambda1 >= lambda) { + var arc = cartesianCross(cartesian(point0), cartesian(point1)); + cartesianNormalizeInPlace(arc); + var intersection = cartesianCross(normal, arc); + cartesianNormalizeInPlace(intersection); + var phiArc = (antimeridian ^ delta >= 0 ? -1 : 1) * asin(intersection[2]); + if (phi > phiArc || phi === phiArc && (arc[0] || arc[1])) { + winding += antimeridian ^ delta >= 0 ? 1 : -1; + } + } + } + } + + // First, determine whether the South pole is inside or outside: + // + // It is inside if: + // * the polygon winds around it in a clockwise direction. + // * the polygon does not (cumulatively) wind around it, but has a negative + // (counter-clockwise) area. + // + // Second, count the (signed) number of times a segment crosses a lambda + // from the point to the South pole. If it is zero, then the point is the + // same side as the South pole. + + return (angle < -epsilon$2 || angle < epsilon$2 && sum$1 < -epsilon$2) ^ (winding & 1); +} + +function clip(pointVisible, clipLine, interpolate, start) { + return function(sink) { + var line = clipLine(sink), + ringBuffer = clipBuffer(), + ringSink = clipLine(ringBuffer), + polygonStarted = false, + polygon, + segments, + ring; + + var clip = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { + clip.point = pointRing; + clip.lineStart = ringStart; + clip.lineEnd = ringEnd; + segments = []; + polygon = []; + }, + polygonEnd: function() { + clip.point = point; + clip.lineStart = lineStart; + clip.lineEnd = lineEnd; + segments = merge(segments); + var startInside = polygonContains(polygon, start); + if (segments.length) { + if (!polygonStarted) sink.polygonStart(), polygonStarted = true; + clipRejoin(segments, compareIntersection, startInside, interpolate, sink); + } else if (startInside) { + if (!polygonStarted) sink.polygonStart(), polygonStarted = true; + sink.lineStart(); + interpolate(null, null, 1, sink); + sink.lineEnd(); + } + if (polygonStarted) sink.polygonEnd(), polygonStarted = false; + segments = polygon = null; + }, + sphere: function() { + sink.polygonStart(); + sink.lineStart(); + interpolate(null, null, 1, sink); + sink.lineEnd(); + sink.polygonEnd(); + } + }; + + function point(lambda, phi) { + if (pointVisible(lambda, phi)) sink.point(lambda, phi); + } + + function pointLine(lambda, phi) { + line.point(lambda, phi); + } + + function lineStart() { + clip.point = pointLine; + line.lineStart(); + } + + function lineEnd() { + clip.point = point; + line.lineEnd(); + } + + function pointRing(lambda, phi) { + ring.push([lambda, phi]); + ringSink.point(lambda, phi); + } + + function ringStart() { + ringSink.lineStart(); + ring = []; + } + + function ringEnd() { + pointRing(ring[0][0], ring[0][1]); + ringSink.lineEnd(); + + var clean = ringSink.clean(), + ringSegments = ringBuffer.result(), + i, n = ringSegments.length, m, + segment, + point; + + ring.pop(); + polygon.push(ring); + ring = null; + + if (!n) return; + + // No intersections. + if (clean & 1) { + segment = ringSegments[0]; + if ((m = segment.length - 1) > 0) { + if (!polygonStarted) sink.polygonStart(), polygonStarted = true; + sink.lineStart(); + for (i = 0; i < m; ++i) sink.point((point = segment[i])[0], point[1]); + sink.lineEnd(); + } + return; + } + + // Rejoin connected segments. + // TODO reuse ringBuffer.rejoin()? + if (n > 1 && clean & 2) ringSegments.push(ringSegments.pop().concat(ringSegments.shift())); + + segments.push(ringSegments.filter(validSegment)); + } + + return clip; + }; +} + +function validSegment(segment) { + return segment.length > 1; +} + +// Intersections are sorted along the clip edge. For both antimeridian cutting +// and circle clipping, the same comparison is used. +function compareIntersection(a, b) { + return ((a = a.x)[0] < 0 ? a[1] - halfPi$2 - epsilon$2 : halfPi$2 - a[1]) + - ((b = b.x)[0] < 0 ? b[1] - halfPi$2 - epsilon$2 : halfPi$2 - b[1]); +} + +var clipAntimeridian = clip( + function() { return true; }, + clipAntimeridianLine, + clipAntimeridianInterpolate, + [-pi$3, -halfPi$2] +); + +// Takes a line and cuts into visible segments. Return values: 0 - there were +// intersections or the line was empty; 1 - no intersections; 2 - there were +// intersections, and the first and last segments should be rejoined. +function clipAntimeridianLine(stream) { + var lambda0 = NaN, + phi0 = NaN, + sign0 = NaN, + clean; // no intersections + + return { + lineStart: function() { + stream.lineStart(); + clean = 1; + }, + point: function(lambda1, phi1) { + var sign1 = lambda1 > 0 ? pi$3 : -pi$3, + delta = abs(lambda1 - lambda0); + if (abs(delta - pi$3) < epsilon$2) { // line crosses a pole + stream.point(lambda0, phi0 = (phi0 + phi1) / 2 > 0 ? halfPi$2 : -halfPi$2); + stream.point(sign0, phi0); + stream.lineEnd(); + stream.lineStart(); + stream.point(sign1, phi0); + stream.point(lambda1, phi0); + clean = 0; + } else if (sign0 !== sign1 && delta >= pi$3) { // line crosses antimeridian + if (abs(lambda0 - sign0) < epsilon$2) lambda0 -= sign0 * epsilon$2; // handle degeneracies + if (abs(lambda1 - sign1) < epsilon$2) lambda1 -= sign1 * epsilon$2; + phi0 = clipAntimeridianIntersect(lambda0, phi0, lambda1, phi1); + stream.point(sign0, phi0); + stream.lineEnd(); + stream.lineStart(); + stream.point(sign1, phi0); + clean = 0; + } + stream.point(lambda0 = lambda1, phi0 = phi1); + sign0 = sign1; + }, + lineEnd: function() { + stream.lineEnd(); + lambda0 = phi0 = NaN; + }, + clean: function() { + return 2 - clean; // if intersections, rejoin first and last segments + } + }; +} + +function clipAntimeridianIntersect(lambda0, phi0, lambda1, phi1) { + var cosPhi0, + cosPhi1, + sinLambda0Lambda1 = sin$1(lambda0 - lambda1); + return abs(sinLambda0Lambda1) > epsilon$2 + ? atan((sin$1(phi0) * (cosPhi1 = cos$1(phi1)) * sin$1(lambda1) + - sin$1(phi1) * (cosPhi0 = cos$1(phi0)) * sin$1(lambda0)) + / (cosPhi0 * cosPhi1 * sinLambda0Lambda1)) + : (phi0 + phi1) / 2; +} + +function clipAntimeridianInterpolate(from, to, direction, stream) { + var phi; + if (from == null) { + phi = direction * halfPi$2; + stream.point(-pi$3, phi); + stream.point(0, phi); + stream.point(pi$3, phi); + stream.point(pi$3, 0); + stream.point(pi$3, -phi); + stream.point(0, -phi); + stream.point(-pi$3, -phi); + stream.point(-pi$3, 0); + stream.point(-pi$3, phi); + } else if (abs(from[0] - to[0]) > epsilon$2) { + var lambda = from[0] < to[0] ? pi$3 : -pi$3; + phi = direction * lambda / 2; + stream.point(-lambda, phi); + stream.point(0, phi); + stream.point(lambda, phi); + } else { + stream.point(to[0], to[1]); + } +} + +function clipCircle(radius) { + var cr = cos$1(radius), + delta = 6 * radians, + smallRadius = cr > 0, + notHemisphere = abs(cr) > epsilon$2; // TODO optimise for this common case + + function interpolate(from, to, direction, stream) { + circleStream(stream, radius, delta, direction, from, to); + } + + function visible(lambda, phi) { + return cos$1(lambda) * cos$1(phi) > cr; + } + + // Takes a line and cuts into visible segments. Return values used for polygon + // clipping: 0 - there were intersections or the line was empty; 1 - no + // intersections 2 - there were intersections, and the first and last segments + // should be rejoined. + function clipLine(stream) { + var point0, // previous point + c0, // code for previous point + v0, // visibility of previous point + v00, // visibility of first point + clean; // no intersections + return { + lineStart: function() { + v00 = v0 = false; + clean = 1; + }, + point: function(lambda, phi) { + var point1 = [lambda, phi], + point2, + v = visible(lambda, phi), + c = smallRadius + ? v ? 0 : code(lambda, phi) + : v ? code(lambda + (lambda < 0 ? pi$3 : -pi$3), phi) : 0; + if (!point0 && (v00 = v0 = v)) stream.lineStart(); + // Handle degeneracies. + // TODO ignore if not clipping polygons. + if (v !== v0) { + point2 = intersect(point0, point1); + if (!point2 || pointEqual(point0, point2) || pointEqual(point1, point2)) { + point1[0] += epsilon$2; + point1[1] += epsilon$2; + v = visible(point1[0], point1[1]); + } + } + if (v !== v0) { + clean = 0; + if (v) { + // outside going in + stream.lineStart(); + point2 = intersect(point1, point0); + stream.point(point2[0], point2[1]); + } else { + // inside going out + point2 = intersect(point0, point1); + stream.point(point2[0], point2[1]); + stream.lineEnd(); + } + point0 = point2; + } else if (notHemisphere && point0 && smallRadius ^ v) { + var t; + // If the codes for two points are different, or are both zero, + // and there this segment intersects with the small circle. + if (!(c & c0) && (t = intersect(point1, point0, true))) { + clean = 0; + if (smallRadius) { + stream.lineStart(); + stream.point(t[0][0], t[0][1]); + stream.point(t[1][0], t[1][1]); + stream.lineEnd(); + } else { + stream.point(t[1][0], t[1][1]); + stream.lineEnd(); + stream.lineStart(); + stream.point(t[0][0], t[0][1]); + } + } + } + if (v && (!point0 || !pointEqual(point0, point1))) { + stream.point(point1[0], point1[1]); + } + point0 = point1, v0 = v, c0 = c; + }, + lineEnd: function() { + if (v0) stream.lineEnd(); + point0 = null; + }, + // Rejoin first and last segments if there were intersections and the first + // and last points were visible. + clean: function() { + return clean | ((v00 && v0) << 1); + } + }; + } + + // Intersects the great circle between a and b with the clip circle. + function intersect(a, b, two) { + var pa = cartesian(a), + pb = cartesian(b); + + // We have two planes, n1.p = d1 and n2.p = d2. + // Find intersection line p(t) = c1 n1 + c2 n2 + t (n1 ⨯ n2). + var n1 = [1, 0, 0], // normal + n2 = cartesianCross(pa, pb), + n2n2 = cartesianDot(n2, n2), + n1n2 = n2[0], // cartesianDot(n1, n2), + determinant = n2n2 - n1n2 * n1n2; + + // Two polar points. + if (!determinant) return !two && a; + + var c1 = cr * n2n2 / determinant, + c2 = -cr * n1n2 / determinant, + n1xn2 = cartesianCross(n1, n2), + A = cartesianScale(n1, c1), + B = cartesianScale(n2, c2); + cartesianAddInPlace(A, B); + + // Solve |p(t)|^2 = 1. + var u = n1xn2, + w = cartesianDot(A, u), + uu = cartesianDot(u, u), + t2 = w * w - uu * (cartesianDot(A, A) - 1); + + if (t2 < 0) return; + + var t = sqrt(t2), + q = cartesianScale(u, (-w - t) / uu); + cartesianAddInPlace(q, A); + q = spherical(q); + + if (!two) return q; + + // Two intersection points. + var lambda0 = a[0], + lambda1 = b[0], + phi0 = a[1], + phi1 = b[1], + z; + + if (lambda1 < lambda0) z = lambda0, lambda0 = lambda1, lambda1 = z; + + var delta = lambda1 - lambda0, + polar = abs(delta - pi$3) < epsilon$2, + meridian = polar || delta < epsilon$2; + + if (!polar && phi1 < phi0) z = phi0, phi0 = phi1, phi1 = z; + + // Check that the first point is between a and b. + if (meridian + ? polar + ? phi0 + phi1 > 0 ^ q[1] < (abs(q[0] - lambda0) < epsilon$2 ? phi0 : phi1) + : phi0 <= q[1] && q[1] <= phi1 + : delta > pi$3 ^ (lambda0 <= q[0] && q[0] <= lambda1)) { + var q1 = cartesianScale(u, (-w + t) / uu); + cartesianAddInPlace(q1, A); + return [q, spherical(q1)]; + } + } + + // Generates a 4-bit vector representing the location of a point relative to + // the small circle's bounding box. + function code(lambda, phi) { + var r = smallRadius ? radius : pi$3 - radius, + code = 0; + if (lambda < -r) code |= 1; // left + else if (lambda > r) code |= 2; // right + if (phi < -r) code |= 4; // below + else if (phi > r) code |= 8; // above + return code; + } + + return clip(visible, clipLine, interpolate, smallRadius ? [0, -radius] : [-pi$3, radius - pi$3]); +} + +function clipLine(a, b, x0, y0, x1, y1) { + var ax = a[0], + ay = a[1], + bx = b[0], + by = b[1], + t0 = 0, + t1 = 1, + dx = bx - ax, + dy = by - ay, + r; + + r = x0 - ax; + if (!dx && r > 0) return; + r /= dx; + if (dx < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dx > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = x1 - ax; + if (!dx && r < 0) return; + r /= dx; + if (dx < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dx > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + r = y0 - ay; + if (!dy && r > 0) return; + r /= dy; + if (dy < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dy > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = y1 - ay; + if (!dy && r < 0) return; + r /= dy; + if (dy < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dy > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + if (t0 > 0) a[0] = ax + t0 * dx, a[1] = ay + t0 * dy; + if (t1 < 1) b[0] = ax + t1 * dx, b[1] = ay + t1 * dy; + return true; +} + +var clipMax = 1e9; +var clipMin = -clipMax; + +// TODO Use d3-polygon’s polygonContains here for the ring check? +// TODO Eliminate duplicate buffering in clipBuffer and polygon.push? + +function clipRectangle(x0, y0, x1, y1) { + + function visible(x, y) { + return x0 <= x && x <= x1 && y0 <= y && y <= y1; + } + + function interpolate(from, to, direction, stream) { + var a = 0, a1 = 0; + if (from == null + || (a = corner(from, direction)) !== (a1 = corner(to, direction)) + || comparePoint(from, to) < 0 ^ direction > 0) { + do stream.point(a === 0 || a === 3 ? x0 : x1, a > 1 ? y1 : y0); + while ((a = (a + direction + 4) % 4) !== a1); + } else { + stream.point(to[0], to[1]); + } + } + + function corner(p, direction) { + return abs(p[0] - x0) < epsilon$2 ? direction > 0 ? 0 : 3 + : abs(p[0] - x1) < epsilon$2 ? direction > 0 ? 2 : 1 + : abs(p[1] - y0) < epsilon$2 ? direction > 0 ? 1 : 0 + : direction > 0 ? 3 : 2; // abs(p[1] - y1) < epsilon + } + + function compareIntersection(a, b) { + return comparePoint(a.x, b.x); + } + + function comparePoint(a, b) { + var ca = corner(a, 1), + cb = corner(b, 1); + return ca !== cb ? ca - cb + : ca === 0 ? b[1] - a[1] + : ca === 1 ? a[0] - b[0] + : ca === 2 ? a[1] - b[1] + : b[0] - a[0]; + } + + return function(stream) { + var activeStream = stream, + bufferStream = clipBuffer(), + segments, + polygon, + ring, + x__, y__, v__, // first point + x_, y_, v_, // previous point + first, + clean; + + var clipStream = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: polygonStart, + polygonEnd: polygonEnd + }; + + function point(x, y) { + if (visible(x, y)) activeStream.point(x, y); + } + + function polygonInside() { + var winding = 0; + + for (var i = 0, n = polygon.length; i < n; ++i) { + for (var ring = polygon[i], j = 1, m = ring.length, point = ring[0], a0, a1, b0 = point[0], b1 = point[1]; j < m; ++j) { + a0 = b0, a1 = b1, point = ring[j], b0 = point[0], b1 = point[1]; + if (a1 <= y1) { if (b1 > y1 && (b0 - a0) * (y1 - a1) > (b1 - a1) * (x0 - a0)) ++winding; } + else { if (b1 <= y1 && (b0 - a0) * (y1 - a1) < (b1 - a1) * (x0 - a0)) --winding; } + } + } + + return winding; + } + + // Buffer geometry within a polygon and then clip it en masse. + function polygonStart() { + activeStream = bufferStream, segments = [], polygon = [], clean = true; + } + + function polygonEnd() { + var startInside = polygonInside(), + cleanInside = clean && startInside, + visible = (segments = merge(segments)).length; + if (cleanInside || visible) { + stream.polygonStart(); + if (cleanInside) { + stream.lineStart(); + interpolate(null, null, 1, stream); + stream.lineEnd(); + } + if (visible) { + clipRejoin(segments, compareIntersection, startInside, interpolate, stream); + } + stream.polygonEnd(); + } + activeStream = stream, segments = polygon = ring = null; + } + + function lineStart() { + clipStream.point = linePoint; + if (polygon) polygon.push(ring = []); + first = true; + v_ = false; + x_ = y_ = NaN; + } + + // TODO rather than special-case polygons, simply handle them separately. + // Ideally, coincident intersection points should be jittered to avoid + // clipping issues. + function lineEnd() { + if (segments) { + linePoint(x__, y__); + if (v__ && v_) bufferStream.rejoin(); + segments.push(bufferStream.result()); + } + clipStream.point = point; + if (v_) activeStream.lineEnd(); + } + + function linePoint(x, y) { + var v = visible(x, y); + if (polygon) ring.push([x, y]); + if (first) { + x__ = x, y__ = y, v__ = v; + first = false; + if (v) { + activeStream.lineStart(); + activeStream.point(x, y); + } + } else { + if (v && v_) activeStream.point(x, y); + else { + var a = [x_ = Math.max(clipMin, Math.min(clipMax, x_)), y_ = Math.max(clipMin, Math.min(clipMax, y_))], + b = [x = Math.max(clipMin, Math.min(clipMax, x)), y = Math.max(clipMin, Math.min(clipMax, y))]; + if (clipLine(a, b, x0, y0, x1, y1)) { + if (!v_) { + activeStream.lineStart(); + activeStream.point(a[0], a[1]); + } + activeStream.point(b[0], b[1]); + if (!v) activeStream.lineEnd(); + clean = false; + } else if (v) { + activeStream.lineStart(); + activeStream.point(x, y); + clean = false; + } + } + } + x_ = x, y_ = y, v_ = v; + } + + return clipStream; + }; +} + +function extent$1() { + var x0 = 0, + y0 = 0, + x1 = 960, + y1 = 500, + cache, + cacheStream, + clip; + + return clip = { + stream: function(stream) { + return cache && cacheStream === stream ? cache : cache = clipRectangle(x0, y0, x1, y1)(cacheStream = stream); + }, + extent: function(_) { + return arguments.length ? (x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1], cache = cacheStream = null, clip) : [[x0, y0], [x1, y1]]; + } + }; +} + +var lengthSum = adder(); +var lambda0$2; +var sinPhi0$1; +var cosPhi0$1; + +var lengthStream = { + sphere: noop$1, + point: noop$1, + lineStart: lengthLineStart, + lineEnd: noop$1, + polygonStart: noop$1, + polygonEnd: noop$1 +}; + +function lengthLineStart() { + lengthStream.point = lengthPointFirst; + lengthStream.lineEnd = lengthLineEnd; +} + +function lengthLineEnd() { + lengthStream.point = lengthStream.lineEnd = noop$1; +} + +function lengthPointFirst(lambda, phi) { + lambda *= radians, phi *= radians; + lambda0$2 = lambda, sinPhi0$1 = sin$1(phi), cosPhi0$1 = cos$1(phi); + lengthStream.point = lengthPoint; +} + +function lengthPoint(lambda, phi) { + lambda *= radians, phi *= radians; + var sinPhi = sin$1(phi), + cosPhi = cos$1(phi), + delta = abs(lambda - lambda0$2), + cosDelta = cos$1(delta), + sinDelta = sin$1(delta), + x = cosPhi * sinDelta, + y = cosPhi0$1 * sinPhi - sinPhi0$1 * cosPhi * cosDelta, + z = sinPhi0$1 * sinPhi + cosPhi0$1 * cosPhi * cosDelta; + lengthSum.add(atan2(sqrt(x * x + y * y), z)); + lambda0$2 = lambda, sinPhi0$1 = sinPhi, cosPhi0$1 = cosPhi; +} + +function length$1(object) { + lengthSum.reset(); + geoStream(object, lengthStream); + return +lengthSum; +} + +var coordinates = [null, null]; +var object$1 = {type: "LineString", coordinates: coordinates}; + +function distance(a, b) { + coordinates[0] = a; + coordinates[1] = b; + return length$1(object$1); +} + +var containsObjectType = { + Feature: function(object, point) { + return containsGeometry(object.geometry, point); + }, + FeatureCollection: function(object, point) { + var features = object.features, i = -1, n = features.length; + while (++i < n) if (containsGeometry(features[i].geometry, point)) return true; + return false; + } +}; + +var containsGeometryType = { + Sphere: function() { + return true; + }, + Point: function(object, point) { + return containsPoint(object.coordinates, point); + }, + MultiPoint: function(object, point) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) if (containsPoint(coordinates[i], point)) return true; + return false; + }, + LineString: function(object, point) { + return containsLine(object.coordinates, point); + }, + MultiLineString: function(object, point) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) if (containsLine(coordinates[i], point)) return true; + return false; + }, + Polygon: function(object, point) { + return containsPolygon(object.coordinates, point); + }, + MultiPolygon: function(object, point) { + var coordinates = object.coordinates, i = -1, n = coordinates.length; + while (++i < n) if (containsPolygon(coordinates[i], point)) return true; + return false; + }, + GeometryCollection: function(object, point) { + var geometries = object.geometries, i = -1, n = geometries.length; + while (++i < n) if (containsGeometry(geometries[i], point)) return true; + return false; + } +}; + +function containsGeometry(geometry, point) { + return geometry && containsGeometryType.hasOwnProperty(geometry.type) + ? containsGeometryType[geometry.type](geometry, point) + : false; +} + +function containsPoint(coordinates, point) { + return distance(coordinates, point) === 0; +} + +function containsLine(coordinates, point) { + var ab = distance(coordinates[0], coordinates[1]), + ao = distance(coordinates[0], point), + ob = distance(point, coordinates[1]); + return ao + ob <= ab + epsilon$2; +} + +function containsPolygon(coordinates, point) { + return !!polygonContains(coordinates.map(ringRadians), pointRadians(point)); +} + +function ringRadians(ring) { + return ring = ring.map(pointRadians), ring.pop(), ring; +} + +function pointRadians(point) { + return [point[0] * radians, point[1] * radians]; +} + +function contains(object, point) { + return (object && containsObjectType.hasOwnProperty(object.type) + ? containsObjectType[object.type] + : containsGeometry)(object, point); +} + +function graticuleX(y0, y1, dy) { + var y = sequence(y0, y1 - epsilon$2, dy).concat(y1); + return function(x) { return y.map(function(y) { return [x, y]; }); }; +} + +function graticuleY(x0, x1, dx) { + var x = sequence(x0, x1 - epsilon$2, dx).concat(x1); + return function(y) { return x.map(function(x) { return [x, y]; }); }; +} + +function graticule() { + var x1, x0, X1, X0, + y1, y0, Y1, Y0, + dx = 10, dy = dx, DX = 90, DY = 360, + x, y, X, Y, + precision = 2.5; + + function graticule() { + return {type: "MultiLineString", coordinates: lines()}; + } + + function lines() { + return sequence(ceil(X0 / DX) * DX, X1, DX).map(X) + .concat(sequence(ceil(Y0 / DY) * DY, Y1, DY).map(Y)) + .concat(sequence(ceil(x0 / dx) * dx, x1, dx).filter(function(x) { return abs(x % DX) > epsilon$2; }).map(x)) + .concat(sequence(ceil(y0 / dy) * dy, y1, dy).filter(function(y) { return abs(y % DY) > epsilon$2; }).map(y)); + } + + graticule.lines = function() { + return lines().map(function(coordinates) { return {type: "LineString", coordinates: coordinates}; }); + }; + + graticule.outline = function() { + return { + type: "Polygon", + coordinates: [ + X(X0).concat( + Y(Y1).slice(1), + X(X1).reverse().slice(1), + Y(Y0).reverse().slice(1)) + ] + }; + }; + + graticule.extent = function(_) { + if (!arguments.length) return graticule.extentMinor(); + return graticule.extentMajor(_).extentMinor(_); + }; + + graticule.extentMajor = function(_) { + if (!arguments.length) return [[X0, Y0], [X1, Y1]]; + X0 = +_[0][0], X1 = +_[1][0]; + Y0 = +_[0][1], Y1 = +_[1][1]; + if (X0 > X1) _ = X0, X0 = X1, X1 = _; + if (Y0 > Y1) _ = Y0, Y0 = Y1, Y1 = _; + return graticule.precision(precision); + }; + + graticule.extentMinor = function(_) { + if (!arguments.length) return [[x0, y0], [x1, y1]]; + x0 = +_[0][0], x1 = +_[1][0]; + y0 = +_[0][1], y1 = +_[1][1]; + if (x0 > x1) _ = x0, x0 = x1, x1 = _; + if (y0 > y1) _ = y0, y0 = y1, y1 = _; + return graticule.precision(precision); + }; + + graticule.step = function(_) { + if (!arguments.length) return graticule.stepMinor(); + return graticule.stepMajor(_).stepMinor(_); + }; + + graticule.stepMajor = function(_) { + if (!arguments.length) return [DX, DY]; + DX = +_[0], DY = +_[1]; + return graticule; + }; + + graticule.stepMinor = function(_) { + if (!arguments.length) return [dx, dy]; + dx = +_[0], dy = +_[1]; + return graticule; + }; + + graticule.precision = function(_) { + if (!arguments.length) return precision; + precision = +_; + x = graticuleX(y0, y1, 90); + y = graticuleY(x0, x1, precision); + X = graticuleX(Y0, Y1, 90); + Y = graticuleY(X0, X1, precision); + return graticule; + }; + + return graticule + .extentMajor([[-180, -90 + epsilon$2], [180, 90 - epsilon$2]]) + .extentMinor([[-180, -80 - epsilon$2], [180, 80 + epsilon$2]]); +} + +function graticule10() { + return graticule()(); +} + +function interpolate$1(a, b) { + var x0 = a[0] * radians, + y0 = a[1] * radians, + x1 = b[0] * radians, + y1 = b[1] * radians, + cy0 = cos$1(y0), + sy0 = sin$1(y0), + cy1 = cos$1(y1), + sy1 = sin$1(y1), + kx0 = cy0 * cos$1(x0), + ky0 = cy0 * sin$1(x0), + kx1 = cy1 * cos$1(x1), + ky1 = cy1 * sin$1(x1), + d = 2 * asin(sqrt(haversin(y1 - y0) + cy0 * cy1 * haversin(x1 - x0))), + k = sin$1(d); + + var interpolate = d ? function(t) { + var B = sin$1(t *= d) / k, + A = sin$1(d - t) / k, + x = A * kx0 + B * kx1, + y = A * ky0 + B * ky1, + z = A * sy0 + B * sy1; + return [ + atan2(y, x) * degrees$1, + atan2(z, sqrt(x * x + y * y)) * degrees$1 + ]; + } : function() { + return [x0 * degrees$1, y0 * degrees$1]; + }; + + interpolate.distance = d; + + return interpolate; +} + +function identity$4(x) { + return x; +} + +var areaSum$1 = adder(); +var areaRingSum$1 = adder(); +var x00; +var y00; +var x0$1; +var y0$1; + +var areaStream$1 = { + point: noop$1, + lineStart: noop$1, + lineEnd: noop$1, + polygonStart: function() { + areaStream$1.lineStart = areaRingStart$1; + areaStream$1.lineEnd = areaRingEnd$1; + }, + polygonEnd: function() { + areaStream$1.lineStart = areaStream$1.lineEnd = areaStream$1.point = noop$1; + areaSum$1.add(abs(areaRingSum$1)); + areaRingSum$1.reset(); + }, + result: function() { + var area = areaSum$1 / 2; + areaSum$1.reset(); + return area; + } +}; + +function areaRingStart$1() { + areaStream$1.point = areaPointFirst$1; +} + +function areaPointFirst$1(x, y) { + areaStream$1.point = areaPoint$1; + x00 = x0$1 = x, y00 = y0$1 = y; +} + +function areaPoint$1(x, y) { + areaRingSum$1.add(y0$1 * x - x0$1 * y); + x0$1 = x, y0$1 = y; +} + +function areaRingEnd$1() { + areaPoint$1(x00, y00); +} + +var x0$2 = Infinity; +var y0$2 = x0$2; +var x1 = -x0$2; +var y1 = x1; + +var boundsStream$1 = { + point: boundsPoint$1, + lineStart: noop$1, + lineEnd: noop$1, + polygonStart: noop$1, + polygonEnd: noop$1, + result: function() { + var bounds = [[x0$2, y0$2], [x1, y1]]; + x1 = y1 = -(y0$2 = x0$2 = Infinity); + return bounds; + } +}; + +function boundsPoint$1(x, y) { + if (x < x0$2) x0$2 = x; + if (x > x1) x1 = x; + if (y < y0$2) y0$2 = y; + if (y > y1) y1 = y; +} + +// TODO Enforce positive area for exterior, negative area for interior? + +var X0$1 = 0; +var Y0$1 = 0; +var Z0$1 = 0; +var X1$1 = 0; +var Y1$1 = 0; +var Z1$1 = 0; +var X2$1 = 0; +var Y2$1 = 0; +var Z2$1 = 0; +var x00$1; +var y00$1; +var x0$3; +var y0$3; + +var centroidStream$1 = { + point: centroidPoint$1, + lineStart: centroidLineStart$1, + lineEnd: centroidLineEnd$1, + polygonStart: function() { + centroidStream$1.lineStart = centroidRingStart$1; + centroidStream$1.lineEnd = centroidRingEnd$1; + }, + polygonEnd: function() { + centroidStream$1.point = centroidPoint$1; + centroidStream$1.lineStart = centroidLineStart$1; + centroidStream$1.lineEnd = centroidLineEnd$1; + }, + result: function() { + var centroid = Z2$1 ? [X2$1 / Z2$1, Y2$1 / Z2$1] + : Z1$1 ? [X1$1 / Z1$1, Y1$1 / Z1$1] + : Z0$1 ? [X0$1 / Z0$1, Y0$1 / Z0$1] + : [NaN, NaN]; + X0$1 = Y0$1 = Z0$1 = + X1$1 = Y1$1 = Z1$1 = + X2$1 = Y2$1 = Z2$1 = 0; + return centroid; + } +}; + +function centroidPoint$1(x, y) { + X0$1 += x; + Y0$1 += y; + ++Z0$1; +} + +function centroidLineStart$1() { + centroidStream$1.point = centroidPointFirstLine; +} + +function centroidPointFirstLine(x, y) { + centroidStream$1.point = centroidPointLine; + centroidPoint$1(x0$3 = x, y0$3 = y); +} + +function centroidPointLine(x, y) { + var dx = x - x0$3, dy = y - y0$3, z = sqrt(dx * dx + dy * dy); + X1$1 += z * (x0$3 + x) / 2; + Y1$1 += z * (y0$3 + y) / 2; + Z1$1 += z; + centroidPoint$1(x0$3 = x, y0$3 = y); +} + +function centroidLineEnd$1() { + centroidStream$1.point = centroidPoint$1; +} + +function centroidRingStart$1() { + centroidStream$1.point = centroidPointFirstRing; +} + +function centroidRingEnd$1() { + centroidPointRing(x00$1, y00$1); +} + +function centroidPointFirstRing(x, y) { + centroidStream$1.point = centroidPointRing; + centroidPoint$1(x00$1 = x0$3 = x, y00$1 = y0$3 = y); +} + +function centroidPointRing(x, y) { + var dx = x - x0$3, + dy = y - y0$3, + z = sqrt(dx * dx + dy * dy); + + X1$1 += z * (x0$3 + x) / 2; + Y1$1 += z * (y0$3 + y) / 2; + Z1$1 += z; + + z = y0$3 * x - x0$3 * y; + X2$1 += z * (x0$3 + x); + Y2$1 += z * (y0$3 + y); + Z2$1 += z * 3; + centroidPoint$1(x0$3 = x, y0$3 = y); +} + +function PathContext(context) { + this._context = context; +} + +PathContext.prototype = { + _radius: 4.5, + pointRadius: function(_) { + return this._radius = _, this; + }, + polygonStart: function() { + this._line = 0; + }, + polygonEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._line === 0) this._context.closePath(); + this._point = NaN; + }, + point: function(x, y) { + switch (this._point) { + case 0: { + this._context.moveTo(x, y); + this._point = 1; + break; + } + case 1: { + this._context.lineTo(x, y); + break; + } + default: { + this._context.moveTo(x + this._radius, y); + this._context.arc(x, y, this._radius, 0, tau$3); + break; + } + } + }, + result: noop$1 +}; + +var lengthSum$1 = adder(); +var lengthRing; +var x00$2; +var y00$2; +var x0$4; +var y0$4; + +var lengthStream$1 = { + point: noop$1, + lineStart: function() { + lengthStream$1.point = lengthPointFirst$1; + }, + lineEnd: function() { + if (lengthRing) lengthPoint$1(x00$2, y00$2); + lengthStream$1.point = noop$1; + }, + polygonStart: function() { + lengthRing = true; + }, + polygonEnd: function() { + lengthRing = null; + }, + result: function() { + var length = +lengthSum$1; + lengthSum$1.reset(); + return length; + } +}; + +function lengthPointFirst$1(x, y) { + lengthStream$1.point = lengthPoint$1; + x00$2 = x0$4 = x, y00$2 = y0$4 = y; +} + +function lengthPoint$1(x, y) { + x0$4 -= x, y0$4 -= y; + lengthSum$1.add(sqrt(x0$4 * x0$4 + y0$4 * y0$4)); + x0$4 = x, y0$4 = y; +} + +function PathString() { + this._string = []; +} + +PathString.prototype = { + _radius: 4.5, + _circle: circle$1(4.5), + pointRadius: function(_) { + if ((_ = +_) !== this._radius) this._radius = _, this._circle = null; + return this; + }, + polygonStart: function() { + this._line = 0; + }, + polygonEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._line === 0) this._string.push("Z"); + this._point = NaN; + }, + point: function(x, y) { + switch (this._point) { + case 0: { + this._string.push("M", x, ",", y); + this._point = 1; + break; + } + case 1: { + this._string.push("L", x, ",", y); + break; + } + default: { + if (this._circle == null) this._circle = circle$1(this._radius); + this._string.push("M", x, ",", y, this._circle); + break; + } + } + }, + result: function() { + if (this._string.length) { + var result = this._string.join(""); + this._string = []; + return result; + } else { + return null; + } + } +}; + +function circle$1(radius) { + return "m0," + radius + + "a" + radius + "," + radius + " 0 1,1 0," + -2 * radius + + "a" + radius + "," + radius + " 0 1,1 0," + 2 * radius + + "z"; +} + +function index$1(projection, context) { + var pointRadius = 4.5, + projectionStream, + contextStream; + + function path(object) { + if (object) { + if (typeof pointRadius === "function") contextStream.pointRadius(+pointRadius.apply(this, arguments)); + geoStream(object, projectionStream(contextStream)); + } + return contextStream.result(); + } + + path.area = function(object) { + geoStream(object, projectionStream(areaStream$1)); + return areaStream$1.result(); + }; + + path.measure = function(object) { + geoStream(object, projectionStream(lengthStream$1)); + return lengthStream$1.result(); + }; + + path.bounds = function(object) { + geoStream(object, projectionStream(boundsStream$1)); + return boundsStream$1.result(); + }; + + path.centroid = function(object) { + geoStream(object, projectionStream(centroidStream$1)); + return centroidStream$1.result(); + }; + + path.projection = function(_) { + return arguments.length ? (projectionStream = _ == null ? (projection = null, identity$4) : (projection = _).stream, path) : projection; + }; + + path.context = function(_) { + if (!arguments.length) return context; + contextStream = _ == null ? (context = null, new PathString) : new PathContext(context = _); + if (typeof pointRadius !== "function") contextStream.pointRadius(pointRadius); + return path; + }; + + path.pointRadius = function(_) { + if (!arguments.length) return pointRadius; + pointRadius = typeof _ === "function" ? _ : (contextStream.pointRadius(+_), +_); + return path; + }; + + return path.projection(projection).context(context); +} + +function transform(methods) { + return { + stream: transformer(methods) + }; +} + +function transformer(methods) { + return function(stream) { + var s = new TransformStream; + for (var key in methods) s[key] = methods[key]; + s.stream = stream; + return s; + }; +} + +function TransformStream() {} + +TransformStream.prototype = { + constructor: TransformStream, + point: function(x, y) { this.stream.point(x, y); }, + sphere: function() { this.stream.sphere(); }, + lineStart: function() { this.stream.lineStart(); }, + lineEnd: function() { this.stream.lineEnd(); }, + polygonStart: function() { this.stream.polygonStart(); }, + polygonEnd: function() { this.stream.polygonEnd(); } +}; + +function fit(projection, fitBounds, object) { + var clip = projection.clipExtent && projection.clipExtent(); + projection.scale(150).translate([0, 0]); + if (clip != null) projection.clipExtent(null); + geoStream(object, projection.stream(boundsStream$1)); + fitBounds(boundsStream$1.result()); + if (clip != null) projection.clipExtent(clip); + return projection; +} + +function fitExtent(projection, extent, object) { + return fit(projection, function(b) { + var w = extent[1][0] - extent[0][0], + h = extent[1][1] - extent[0][1], + k = Math.min(w / (b[1][0] - b[0][0]), h / (b[1][1] - b[0][1])), + x = +extent[0][0] + (w - k * (b[1][0] + b[0][0])) / 2, + y = +extent[0][1] + (h - k * (b[1][1] + b[0][1])) / 2; + projection.scale(150 * k).translate([x, y]); + }, object); +} + +function fitSize(projection, size, object) { + return fitExtent(projection, [[0, 0], size], object); +} + +function fitWidth(projection, width, object) { + return fit(projection, function(b) { + var w = +width, + k = w / (b[1][0] - b[0][0]), + x = (w - k * (b[1][0] + b[0][0])) / 2, + y = -k * b[0][1]; + projection.scale(150 * k).translate([x, y]); + }, object); +} + +function fitHeight(projection, height, object) { + return fit(projection, function(b) { + var h = +height, + k = h / (b[1][1] - b[0][1]), + x = -k * b[0][0], + y = (h - k * (b[1][1] + b[0][1])) / 2; + projection.scale(150 * k).translate([x, y]); + }, object); +} + +var maxDepth = 16; +var cosMinDistance = cos$1(30 * radians); // cos(minimum angular distance) + +function resample(project, delta2) { + return +delta2 ? resample$1(project, delta2) : resampleNone(project); +} + +function resampleNone(project) { + return transformer({ + point: function(x, y) { + x = project(x, y); + this.stream.point(x[0], x[1]); + } + }); +} + +function resample$1(project, delta2) { + + function resampleLineTo(x0, y0, lambda0, a0, b0, c0, x1, y1, lambda1, a1, b1, c1, depth, stream) { + var dx = x1 - x0, + dy = y1 - y0, + d2 = dx * dx + dy * dy; + if (d2 > 4 * delta2 && depth--) { + var a = a0 + a1, + b = b0 + b1, + c = c0 + c1, + m = sqrt(a * a + b * b + c * c), + phi2 = asin(c /= m), + lambda2 = abs(abs(c) - 1) < epsilon$2 || abs(lambda0 - lambda1) < epsilon$2 ? (lambda0 + lambda1) / 2 : atan2(b, a), + p = project(lambda2, phi2), + x2 = p[0], + y2 = p[1], + dx2 = x2 - x0, + dy2 = y2 - y0, + dz = dy * dx2 - dx * dy2; + if (dz * dz / d2 > delta2 // perpendicular projected distance + || abs((dx * dx2 + dy * dy2) / d2 - 0.5) > 0.3 // midpoint close to an end + || a0 * a1 + b0 * b1 + c0 * c1 < cosMinDistance) { // angular distance + resampleLineTo(x0, y0, lambda0, a0, b0, c0, x2, y2, lambda2, a /= m, b /= m, c, depth, stream); + stream.point(x2, y2); + resampleLineTo(x2, y2, lambda2, a, b, c, x1, y1, lambda1, a1, b1, c1, depth, stream); + } + } + } + return function(stream) { + var lambda00, x00, y00, a00, b00, c00, // first point + lambda0, x0, y0, a0, b0, c0; // previous point + + var resampleStream = { + point: point, + lineStart: lineStart, + lineEnd: lineEnd, + polygonStart: function() { stream.polygonStart(); resampleStream.lineStart = ringStart; }, + polygonEnd: function() { stream.polygonEnd(); resampleStream.lineStart = lineStart; } + }; + + function point(x, y) { + x = project(x, y); + stream.point(x[0], x[1]); + } + + function lineStart() { + x0 = NaN; + resampleStream.point = linePoint; + stream.lineStart(); + } + + function linePoint(lambda, phi) { + var c = cartesian([lambda, phi]), p = project(lambda, phi); + resampleLineTo(x0, y0, lambda0, a0, b0, c0, x0 = p[0], y0 = p[1], lambda0 = lambda, a0 = c[0], b0 = c[1], c0 = c[2], maxDepth, stream); + stream.point(x0, y0); + } + + function lineEnd() { + resampleStream.point = point; + stream.lineEnd(); + } + + function ringStart() { + lineStart(); + resampleStream.point = ringPoint; + resampleStream.lineEnd = ringEnd; + } + + function ringPoint(lambda, phi) { + linePoint(lambda00 = lambda, phi), x00 = x0, y00 = y0, a00 = a0, b00 = b0, c00 = c0; + resampleStream.point = linePoint; + } + + function ringEnd() { + resampleLineTo(x0, y0, lambda0, a0, b0, c0, x00, y00, lambda00, a00, b00, c00, maxDepth, stream); + resampleStream.lineEnd = lineEnd; + lineEnd(); + } + + return resampleStream; + }; +} + +var transformRadians = transformer({ + point: function(x, y) { + this.stream.point(x * radians, y * radians); + } +}); + +function transformRotate(rotate) { + return transformer({ + point: function(x, y) { + var r = rotate(x, y); + return this.stream.point(r[0], r[1]); + } + }); +} + +function projection(project) { + return projectionMutator(function() { return project; })(); +} + +function projectionMutator(projectAt) { + var project, + k = 150, // scale + x = 480, y = 250, // translate + dx, dy, lambda = 0, phi = 0, // center + deltaLambda = 0, deltaPhi = 0, deltaGamma = 0, rotate, projectRotate, // rotate + theta = null, preclip = clipAntimeridian, // clip angle + x0 = null, y0, x1, y1, postclip = identity$4, // clip extent + delta2 = 0.5, projectResample = resample(projectTransform, delta2), // precision + cache, + cacheStream; + + function projection(point) { + point = projectRotate(point[0] * radians, point[1] * radians); + return [point[0] * k + dx, dy - point[1] * k]; + } + + function invert(point) { + point = projectRotate.invert((point[0] - dx) / k, (dy - point[1]) / k); + return point && [point[0] * degrees$1, point[1] * degrees$1]; + } + + function projectTransform(x, y) { + return x = project(x, y), [x[0] * k + dx, dy - x[1] * k]; + } + + projection.stream = function(stream) { + return cache && cacheStream === stream ? cache : cache = transformRadians(transformRotate(rotate)(preclip(projectResample(postclip(cacheStream = stream))))); + }; + + projection.preclip = function(_) { + return arguments.length ? (preclip = _, theta = undefined, reset()) : preclip; + }; + + projection.postclip = function(_) { + return arguments.length ? (postclip = _, x0 = y0 = x1 = y1 = null, reset()) : postclip; + }; + + projection.clipAngle = function(_) { + return arguments.length ? (preclip = +_ ? clipCircle(theta = _ * radians) : (theta = null, clipAntimeridian), reset()) : theta * degrees$1; + }; + + projection.clipExtent = function(_) { + return arguments.length ? (postclip = _ == null ? (x0 = y0 = x1 = y1 = null, identity$4) : clipRectangle(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reset()) : x0 == null ? null : [[x0, y0], [x1, y1]]; + }; + + projection.scale = function(_) { + return arguments.length ? (k = +_, recenter()) : k; + }; + + projection.translate = function(_) { + return arguments.length ? (x = +_[0], y = +_[1], recenter()) : [x, y]; + }; + + projection.center = function(_) { + return arguments.length ? (lambda = _[0] % 360 * radians, phi = _[1] % 360 * radians, recenter()) : [lambda * degrees$1, phi * degrees$1]; + }; + + projection.rotate = function(_) { + return arguments.length ? (deltaLambda = _[0] % 360 * radians, deltaPhi = _[1] % 360 * radians, deltaGamma = _.length > 2 ? _[2] % 360 * radians : 0, recenter()) : [deltaLambda * degrees$1, deltaPhi * degrees$1, deltaGamma * degrees$1]; + }; + + projection.precision = function(_) { + return arguments.length ? (projectResample = resample(projectTransform, delta2 = _ * _), reset()) : sqrt(delta2); + }; + + projection.fitExtent = function(extent, object) { + return fitExtent(projection, extent, object); + }; + + projection.fitSize = function(size, object) { + return fitSize(projection, size, object); + }; + + projection.fitWidth = function(width, object) { + return fitWidth(projection, width, object); + }; + + projection.fitHeight = function(height, object) { + return fitHeight(projection, height, object); + }; + + function recenter() { + projectRotate = compose(rotate = rotateRadians(deltaLambda, deltaPhi, deltaGamma), project); + var center = project(lambda, phi); + dx = x - center[0] * k; + dy = y + center[1] * k; + return reset(); + } + + function reset() { + cache = cacheStream = null; + return projection; + } + + return function() { + project = projectAt.apply(this, arguments); + projection.invert = project.invert && invert; + return recenter(); + }; +} + +function conicProjection(projectAt) { + var phi0 = 0, + phi1 = pi$3 / 3, + m = projectionMutator(projectAt), + p = m(phi0, phi1); + + p.parallels = function(_) { + return arguments.length ? m(phi0 = _[0] * radians, phi1 = _[1] * radians) : [phi0 * degrees$1, phi1 * degrees$1]; + }; + + return p; +} + +function cylindricalEqualAreaRaw(phi0) { + var cosPhi0 = cos$1(phi0); + + function forward(lambda, phi) { + return [lambda * cosPhi0, sin$1(phi) / cosPhi0]; + } + + forward.invert = function(x, y) { + return [x / cosPhi0, asin(y * cosPhi0)]; + }; + + return forward; +} + +function conicEqualAreaRaw(y0, y1) { + var sy0 = sin$1(y0), n = (sy0 + sin$1(y1)) / 2; + + // Are the parallels symmetrical around the Equator? + if (abs(n) < epsilon$2) return cylindricalEqualAreaRaw(y0); + + var c = 1 + sy0 * (2 * n - sy0), r0 = sqrt(c) / n; + + function project(x, y) { + var r = sqrt(c - 2 * n * sin$1(y)) / n; + return [r * sin$1(x *= n), r0 - r * cos$1(x)]; + } + + project.invert = function(x, y) { + var r0y = r0 - y; + return [atan2(x, abs(r0y)) / n * sign(r0y), asin((c - (x * x + r0y * r0y) * n * n) / (2 * n))]; + }; + + return project; +} + +function conicEqualArea() { + return conicProjection(conicEqualAreaRaw) + .scale(155.424) + .center([0, 33.6442]); +} + +function albers() { + return conicEqualArea() + .parallels([29.5, 45.5]) + .scale(1070) + .translate([480, 250]) + .rotate([96, 0]) + .center([-0.6, 38.7]); +} + +// The projections must have mutually exclusive clip regions on the sphere, +// as this will avoid emitting interleaving lines and polygons. +function multiplex(streams) { + var n = streams.length; + return { + point: function(x, y) { var i = -1; while (++i < n) streams[i].point(x, y); }, + sphere: function() { var i = -1; while (++i < n) streams[i].sphere(); }, + lineStart: function() { var i = -1; while (++i < n) streams[i].lineStart(); }, + lineEnd: function() { var i = -1; while (++i < n) streams[i].lineEnd(); }, + polygonStart: function() { var i = -1; while (++i < n) streams[i].polygonStart(); }, + polygonEnd: function() { var i = -1; while (++i < n) streams[i].polygonEnd(); } + }; +} + +// A composite projection for the United States, configured by default for +// 960×500. The projection also works quite well at 960×600 if you change the +// scale to 1285 and adjust the translate accordingly. The set of standard +// parallels for each region comes from USGS, which is published here: +// http://egsc.usgs.gov/isb/pubs/MapProjections/projections.html#albers +function albersUsa() { + var cache, + cacheStream, + lower48 = albers(), lower48Point, + alaska = conicEqualArea().rotate([154, 0]).center([-2, 58.5]).parallels([55, 65]), alaskaPoint, // EPSG:3338 + hawaii = conicEqualArea().rotate([157, 0]).center([-3, 19.9]).parallels([8, 18]), hawaiiPoint, // ESRI:102007 + point, pointStream = {point: function(x, y) { point = [x, y]; }}; + + function albersUsa(coordinates) { + var x = coordinates[0], y = coordinates[1]; + return point = null, (lower48Point.point(x, y), point) + || (alaskaPoint.point(x, y), point) + || (hawaiiPoint.point(x, y), point); + } + + albersUsa.invert = function(coordinates) { + var k = lower48.scale(), + t = lower48.translate(), + x = (coordinates[0] - t[0]) / k, + y = (coordinates[1] - t[1]) / k; + return (y >= 0.120 && y < 0.234 && x >= -0.425 && x < -0.214 ? alaska + : y >= 0.166 && y < 0.234 && x >= -0.214 && x < -0.115 ? hawaii + : lower48).invert(coordinates); + }; + + albersUsa.stream = function(stream) { + return cache && cacheStream === stream ? cache : cache = multiplex([lower48.stream(cacheStream = stream), alaska.stream(stream), hawaii.stream(stream)]); + }; + + albersUsa.precision = function(_) { + if (!arguments.length) return lower48.precision(); + lower48.precision(_), alaska.precision(_), hawaii.precision(_); + return reset(); + }; + + albersUsa.scale = function(_) { + if (!arguments.length) return lower48.scale(); + lower48.scale(_), alaska.scale(_ * 0.35), hawaii.scale(_); + return albersUsa.translate(lower48.translate()); + }; + + albersUsa.translate = function(_) { + if (!arguments.length) return lower48.translate(); + var k = lower48.scale(), x = +_[0], y = +_[1]; + + lower48Point = lower48 + .translate(_) + .clipExtent([[x - 0.455 * k, y - 0.238 * k], [x + 0.455 * k, y + 0.238 * k]]) + .stream(pointStream); + + alaskaPoint = alaska + .translate([x - 0.307 * k, y + 0.201 * k]) + .clipExtent([[x - 0.425 * k + epsilon$2, y + 0.120 * k + epsilon$2], [x - 0.214 * k - epsilon$2, y + 0.234 * k - epsilon$2]]) + .stream(pointStream); + + hawaiiPoint = hawaii + .translate([x - 0.205 * k, y + 0.212 * k]) + .clipExtent([[x - 0.214 * k + epsilon$2, y + 0.166 * k + epsilon$2], [x - 0.115 * k - epsilon$2, y + 0.234 * k - epsilon$2]]) + .stream(pointStream); + + return reset(); + }; + + albersUsa.fitExtent = function(extent, object) { + return fitExtent(albersUsa, extent, object); + }; + + albersUsa.fitSize = function(size, object) { + return fitSize(albersUsa, size, object); + }; + + albersUsa.fitWidth = function(width, object) { + return fitWidth(albersUsa, width, object); + }; + + albersUsa.fitHeight = function(height, object) { + return fitHeight(albersUsa, height, object); + }; + + function reset() { + cache = cacheStream = null; + return albersUsa; + } + + return albersUsa.scale(1070); +} + +function azimuthalRaw(scale) { + return function(x, y) { + var cx = cos$1(x), + cy = cos$1(y), + k = scale(cx * cy); + return [ + k * cy * sin$1(x), + k * sin$1(y) + ]; + } +} + +function azimuthalInvert(angle) { + return function(x, y) { + var z = sqrt(x * x + y * y), + c = angle(z), + sc = sin$1(c), + cc = cos$1(c); + return [ + atan2(x * sc, z * cc), + asin(z && y * sc / z) + ]; + } +} + +var azimuthalEqualAreaRaw = azimuthalRaw(function(cxcy) { + return sqrt(2 / (1 + cxcy)); +}); + +azimuthalEqualAreaRaw.invert = azimuthalInvert(function(z) { + return 2 * asin(z / 2); +}); + +function azimuthalEqualArea() { + return projection(azimuthalEqualAreaRaw) + .scale(124.75) + .clipAngle(180 - 1e-3); +} + +var azimuthalEquidistantRaw = azimuthalRaw(function(c) { + return (c = acos(c)) && c / sin$1(c); +}); + +azimuthalEquidistantRaw.invert = azimuthalInvert(function(z) { + return z; +}); + +function azimuthalEquidistant() { + return projection(azimuthalEquidistantRaw) + .scale(79.4188) + .clipAngle(180 - 1e-3); +} + +function mercatorRaw(lambda, phi) { + return [lambda, log(tan((halfPi$2 + phi) / 2))]; +} + +mercatorRaw.invert = function(x, y) { + return [x, 2 * atan(exp(y)) - halfPi$2]; +}; + +function mercator() { + return mercatorProjection(mercatorRaw) + .scale(961 / tau$3); +} + +function mercatorProjection(project) { + var m = projection(project), + center = m.center, + scale = m.scale, + translate = m.translate, + clipExtent = m.clipExtent, + x0 = null, y0, x1, y1; // clip extent + + m.scale = function(_) { + return arguments.length ? (scale(_), reclip()) : scale(); + }; + + m.translate = function(_) { + return arguments.length ? (translate(_), reclip()) : translate(); + }; + + m.center = function(_) { + return arguments.length ? (center(_), reclip()) : center(); + }; + + m.clipExtent = function(_) { + return arguments.length ? (_ == null ? x0 = y0 = x1 = y1 = null : (x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reclip()) : x0 == null ? null : [[x0, y0], [x1, y1]]; + }; + + function reclip() { + var k = pi$3 * scale(), + t = m(rotation(m.rotate()).invert([0, 0])); + return clipExtent(x0 == null + ? [[t[0] - k, t[1] - k], [t[0] + k, t[1] + k]] : project === mercatorRaw + ? [[Math.max(t[0] - k, x0), y0], [Math.min(t[0] + k, x1), y1]] + : [[x0, Math.max(t[1] - k, y0)], [x1, Math.min(t[1] + k, y1)]]); + } + + return reclip(); +} + +function tany(y) { + return tan((halfPi$2 + y) / 2); +} + +function conicConformalRaw(y0, y1) { + var cy0 = cos$1(y0), + n = y0 === y1 ? sin$1(y0) : log(cy0 / cos$1(y1)) / log(tany(y1) / tany(y0)), + f = cy0 * pow(tany(y0), n) / n; + + if (!n) return mercatorRaw; + + function project(x, y) { + if (f > 0) { if (y < -halfPi$2 + epsilon$2) y = -halfPi$2 + epsilon$2; } + else { if (y > halfPi$2 - epsilon$2) y = halfPi$2 - epsilon$2; } + var r = f / pow(tany(y), n); + return [r * sin$1(n * x), f - r * cos$1(n * x)]; + } + + project.invert = function(x, y) { + var fy = f - y, r = sign(n) * sqrt(x * x + fy * fy); + return [atan2(x, abs(fy)) / n * sign(fy), 2 * atan(pow(f / r, 1 / n)) - halfPi$2]; + }; + + return project; +} + +function conicConformal() { + return conicProjection(conicConformalRaw) + .scale(109.5) + .parallels([30, 30]); +} + +function equirectangularRaw(lambda, phi) { + return [lambda, phi]; +} + +equirectangularRaw.invert = equirectangularRaw; + +function equirectangular() { + return projection(equirectangularRaw) + .scale(152.63); +} + +function conicEquidistantRaw(y0, y1) { + var cy0 = cos$1(y0), + n = y0 === y1 ? sin$1(y0) : (cy0 - cos$1(y1)) / (y1 - y0), + g = cy0 / n + y0; + + if (abs(n) < epsilon$2) return equirectangularRaw; + + function project(x, y) { + var gy = g - y, nx = n * x; + return [gy * sin$1(nx), g - gy * cos$1(nx)]; + } + + project.invert = function(x, y) { + var gy = g - y; + return [atan2(x, abs(gy)) / n * sign(gy), g - sign(n) * sqrt(x * x + gy * gy)]; + }; + + return project; +} + +function conicEquidistant() { + return conicProjection(conicEquidistantRaw) + .scale(131.154) + .center([0, 13.9389]); +} + +function gnomonicRaw(x, y) { + var cy = cos$1(y), k = cos$1(x) * cy; + return [cy * sin$1(x) / k, sin$1(y) / k]; +} + +gnomonicRaw.invert = azimuthalInvert(atan); + +function gnomonic() { + return projection(gnomonicRaw) + .scale(144.049) + .clipAngle(60); +} + +function scaleTranslate(kx, ky, tx, ty) { + return kx === 1 && ky === 1 && tx === 0 && ty === 0 ? identity$4 : transformer({ + point: function(x, y) { + this.stream.point(x * kx + tx, y * ky + ty); + } + }); +} + +function identity$5() { + var k = 1, tx = 0, ty = 0, sx = 1, sy = 1, transform$$1 = identity$4, // scale, translate and reflect + x0 = null, y0, x1, y1, // clip extent + postclip = identity$4, + cache, + cacheStream, + projection; + + function reset() { + cache = cacheStream = null; + return projection; + } + + return projection = { + stream: function(stream) { + return cache && cacheStream === stream ? cache : cache = transform$$1(postclip(cacheStream = stream)); + }, + postclip: function(_) { + return arguments.length ? (postclip = _, x0 = y0 = x1 = y1 = null, reset()) : postclip; + }, + clipExtent: function(_) { + return arguments.length ? (postclip = _ == null ? (x0 = y0 = x1 = y1 = null, identity$4) : clipRectangle(x0 = +_[0][0], y0 = +_[0][1], x1 = +_[1][0], y1 = +_[1][1]), reset()) : x0 == null ? null : [[x0, y0], [x1, y1]]; + }, + scale: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate((k = +_) * sx, k * sy, tx, ty), reset()) : k; + }, + translate: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate(k * sx, k * sy, tx = +_[0], ty = +_[1]), reset()) : [tx, ty]; + }, + reflectX: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate(k * (sx = _ ? -1 : 1), k * sy, tx, ty), reset()) : sx < 0; + }, + reflectY: function(_) { + return arguments.length ? (transform$$1 = scaleTranslate(k * sx, k * (sy = _ ? -1 : 1), tx, ty), reset()) : sy < 0; + }, + fitExtent: function(extent, object) { + return fitExtent(projection, extent, object); + }, + fitSize: function(size, object) { + return fitSize(projection, size, object); + }, + fitWidth: function(width, object) { + return fitWidth(projection, width, object); + }, + fitHeight: function(height, object) { + return fitHeight(projection, height, object); + } + }; +} + +function naturalEarth1Raw(lambda, phi) { + var phi2 = phi * phi, phi4 = phi2 * phi2; + return [ + lambda * (0.8707 - 0.131979 * phi2 + phi4 * (-0.013791 + phi4 * (0.003971 * phi2 - 0.001529 * phi4))), + phi * (1.007226 + phi2 * (0.015085 + phi4 * (-0.044475 + 0.028874 * phi2 - 0.005916 * phi4))) + ]; +} + +naturalEarth1Raw.invert = function(x, y) { + var phi = y, i = 25, delta; + do { + var phi2 = phi * phi, phi4 = phi2 * phi2; + phi -= delta = (phi * (1.007226 + phi2 * (0.015085 + phi4 * (-0.044475 + 0.028874 * phi2 - 0.005916 * phi4))) - y) / + (1.007226 + phi2 * (0.015085 * 3 + phi4 * (-0.044475 * 7 + 0.028874 * 9 * phi2 - 0.005916 * 11 * phi4))); + } while (abs(delta) > epsilon$2 && --i > 0); + return [ + x / (0.8707 + (phi2 = phi * phi) * (-0.131979 + phi2 * (-0.013791 + phi2 * phi2 * phi2 * (0.003971 - 0.001529 * phi2)))), + phi + ]; +}; + +function naturalEarth1() { + return projection(naturalEarth1Raw) + .scale(175.295); +} + +function orthographicRaw(x, y) { + return [cos$1(y) * sin$1(x), sin$1(y)]; +} + +orthographicRaw.invert = azimuthalInvert(asin); + +function orthographic() { + return projection(orthographicRaw) + .scale(249.5) + .clipAngle(90 + epsilon$2); +} + +function stereographicRaw(x, y) { + var cy = cos$1(y), k = 1 + cos$1(x) * cy; + return [cy * sin$1(x) / k, sin$1(y) / k]; +} + +stereographicRaw.invert = azimuthalInvert(function(z) { + return 2 * atan(z); +}); + +function stereographic() { + return projection(stereographicRaw) + .scale(250) + .clipAngle(142); +} + +function transverseMercatorRaw(lambda, phi) { + return [log(tan((halfPi$2 + phi) / 2)), -lambda]; +} + +transverseMercatorRaw.invert = function(x, y) { + return [-y, 2 * atan(exp(x)) - halfPi$2]; +}; + +function transverseMercator() { + var m = mercatorProjection(transverseMercatorRaw), + center = m.center, + rotate = m.rotate; + + m.center = function(_) { + return arguments.length ? center([-_[1], _[0]]) : (_ = center(), [_[1], -_[0]]); + }; + + m.rotate = function(_) { + return arguments.length ? rotate([_[0], _[1], _.length > 2 ? _[2] + 90 : 90]) : (_ = rotate(), [_[0], _[1], _[2] - 90]); + }; + + return rotate([0, 0, 90]) + .scale(159.155); +} + +function defaultSeparation(a, b) { + return a.parent === b.parent ? 1 : 2; +} + +function meanX(children) { + return children.reduce(meanXReduce, 0) / children.length; +} + +function meanXReduce(x, c) { + return x + c.x; +} + +function maxY(children) { + return 1 + children.reduce(maxYReduce, 0); +} + +function maxYReduce(y, c) { + return Math.max(y, c.y); +} + +function leafLeft(node) { + var children; + while (children = node.children) node = children[0]; + return node; +} + +function leafRight(node) { + var children; + while (children = node.children) node = children[children.length - 1]; + return node; +} + +function cluster() { + var separation = defaultSeparation, + dx = 1, + dy = 1, + nodeSize = false; + + function cluster(root) { + var previousNode, + x = 0; + + // First walk, computing the initial x & y values. + root.eachAfter(function(node) { + var children = node.children; + if (children) { + node.x = meanX(children); + node.y = maxY(children); + } else { + node.x = previousNode ? x += separation(node, previousNode) : 0; + node.y = 0; + previousNode = node; + } + }); + + var left = leafLeft(root), + right = leafRight(root), + x0 = left.x - separation(left, right) / 2, + x1 = right.x + separation(right, left) / 2; + + // Second walk, normalizing x & y to the desired size. + return root.eachAfter(nodeSize ? function(node) { + node.x = (node.x - root.x) * dx; + node.y = (root.y - node.y) * dy; + } : function(node) { + node.x = (node.x - x0) / (x1 - x0) * dx; + node.y = (1 - (root.y ? node.y / root.y : 1)) * dy; + }); + } + + cluster.separation = function(x) { + return arguments.length ? (separation = x, cluster) : separation; + }; + + cluster.size = function(x) { + return arguments.length ? (nodeSize = false, dx = +x[0], dy = +x[1], cluster) : (nodeSize ? null : [dx, dy]); + }; + + cluster.nodeSize = function(x) { + return arguments.length ? (nodeSize = true, dx = +x[0], dy = +x[1], cluster) : (nodeSize ? [dx, dy] : null); + }; + + return cluster; +} + +function count(node) { + var sum = 0, + children = node.children, + i = children && children.length; + if (!i) sum = 1; + else while (--i >= 0) sum += children[i].value; + node.value = sum; +} + +function node_count() { + return this.eachAfter(count); +} + +function node_each(callback) { + var node = this, current, next = [node], children, i, n; + do { + current = next.reverse(), next = []; + while (node = current.pop()) { + callback(node), children = node.children; + if (children) for (i = 0, n = children.length; i < n; ++i) { + next.push(children[i]); + } + } + } while (next.length); + return this; +} + +function node_eachBefore(callback) { + var node = this, nodes = [node], children, i; + while (node = nodes.pop()) { + callback(node), children = node.children; + if (children) for (i = children.length - 1; i >= 0; --i) { + nodes.push(children[i]); + } + } + return this; +} + +function node_eachAfter(callback) { + var node = this, nodes = [node], next = [], children, i, n; + while (node = nodes.pop()) { + next.push(node), children = node.children; + if (children) for (i = 0, n = children.length; i < n; ++i) { + nodes.push(children[i]); + } + } + while (node = next.pop()) { + callback(node); + } + return this; +} + +function node_sum(value) { + return this.eachAfter(function(node) { + var sum = +value(node.data) || 0, + children = node.children, + i = children && children.length; + while (--i >= 0) sum += children[i].value; + node.value = sum; + }); +} + +function node_sort(compare) { + return this.eachBefore(function(node) { + if (node.children) { + node.children.sort(compare); + } + }); +} + +function node_path(end) { + var start = this, + ancestor = leastCommonAncestor(start, end), + nodes = [start]; + while (start !== ancestor) { + start = start.parent; + nodes.push(start); + } + var k = nodes.length; + while (end !== ancestor) { + nodes.splice(k, 0, end); + end = end.parent; + } + return nodes; +} + +function leastCommonAncestor(a, b) { + if (a === b) return a; + var aNodes = a.ancestors(), + bNodes = b.ancestors(), + c = null; + a = aNodes.pop(); + b = bNodes.pop(); + while (a === b) { + c = a; + a = aNodes.pop(); + b = bNodes.pop(); + } + return c; +} + +function node_ancestors() { + var node = this, nodes = [node]; + while (node = node.parent) { + nodes.push(node); + } + return nodes; +} + +function node_descendants() { + var nodes = []; + this.each(function(node) { + nodes.push(node); + }); + return nodes; +} + +function node_leaves() { + var leaves = []; + this.eachBefore(function(node) { + if (!node.children) { + leaves.push(node); + } + }); + return leaves; +} + +function node_links() { + var root = this, links = []; + root.each(function(node) { + if (node !== root) { // Don’t include the root’s parent, if any. + links.push({source: node.parent, target: node}); + } + }); + return links; +} + +function hierarchy(data, children) { + var root = new Node(data), + valued = +data.value && (root.value = data.value), + node, + nodes = [root], + child, + childs, + i, + n; + + if (children == null) children = defaultChildren; + + while (node = nodes.pop()) { + if (valued) node.value = +node.data.value; + if ((childs = children(node.data)) && (n = childs.length)) { + node.children = new Array(n); + for (i = n - 1; i >= 0; --i) { + nodes.push(child = node.children[i] = new Node(childs[i])); + child.parent = node; + child.depth = node.depth + 1; + } + } + } + + return root.eachBefore(computeHeight); +} + +function node_copy() { + return hierarchy(this).eachBefore(copyData); +} + +function defaultChildren(d) { + return d.children; +} + +function copyData(node) { + node.data = node.data.data; +} + +function computeHeight(node) { + var height = 0; + do node.height = height; + while ((node = node.parent) && (node.height < ++height)); +} + +function Node(data) { + this.data = data; + this.depth = + this.height = 0; + this.parent = null; +} + +Node.prototype = hierarchy.prototype = { + constructor: Node, + count: node_count, + each: node_each, + eachAfter: node_eachAfter, + eachBefore: node_eachBefore, + sum: node_sum, + sort: node_sort, + path: node_path, + ancestors: node_ancestors, + descendants: node_descendants, + leaves: node_leaves, + links: node_links, + copy: node_copy +}; + +var slice$3 = Array.prototype.slice; + +function shuffle$1(array) { + var m = array.length, + t, + i; + + while (m) { + i = Math.random() * m-- | 0; + t = array[m]; + array[m] = array[i]; + array[i] = t; + } + + return array; +} + +function enclose(circles) { + var i = 0, n = (circles = shuffle$1(slice$3.call(circles))).length, B = [], p, e; + + while (i < n) { + p = circles[i]; + if (e && enclosesWeak(e, p)) ++i; + else e = encloseBasis(B = extendBasis(B, p)), i = 0; + } + + return e; +} + +function extendBasis(B, p) { + var i, j; + + if (enclosesWeakAll(p, B)) return [p]; + + // If we get here then B must have at least one element. + for (i = 0; i < B.length; ++i) { + if (enclosesNot(p, B[i]) + && enclosesWeakAll(encloseBasis2(B[i], p), B)) { + return [B[i], p]; + } + } + + // If we get here then B must have at least two elements. + for (i = 0; i < B.length - 1; ++i) { + for (j = i + 1; j < B.length; ++j) { + if (enclosesNot(encloseBasis2(B[i], B[j]), p) + && enclosesNot(encloseBasis2(B[i], p), B[j]) + && enclosesNot(encloseBasis2(B[j], p), B[i]) + && enclosesWeakAll(encloseBasis3(B[i], B[j], p), B)) { + return [B[i], B[j], p]; + } + } + } + + // If we get here then something is very wrong. + throw new Error; +} + +function enclosesNot(a, b) { + var dr = a.r - b.r, dx = b.x - a.x, dy = b.y - a.y; + return dr < 0 || dr * dr < dx * dx + dy * dy; +} + +function enclosesWeak(a, b) { + var dr = a.r - b.r + 1e-6, dx = b.x - a.x, dy = b.y - a.y; + return dr > 0 && dr * dr > dx * dx + dy * dy; +} + +function enclosesWeakAll(a, B) { + for (var i = 0; i < B.length; ++i) { + if (!enclosesWeak(a, B[i])) { + return false; + } + } + return true; +} + +function encloseBasis(B) { + switch (B.length) { + case 1: return encloseBasis1(B[0]); + case 2: return encloseBasis2(B[0], B[1]); + case 3: return encloseBasis3(B[0], B[1], B[2]); + } +} + +function encloseBasis1(a) { + return { + x: a.x, + y: a.y, + r: a.r + }; +} + +function encloseBasis2(a, b) { + var x1 = a.x, y1 = a.y, r1 = a.r, + x2 = b.x, y2 = b.y, r2 = b.r, + x21 = x2 - x1, y21 = y2 - y1, r21 = r2 - r1, + l = Math.sqrt(x21 * x21 + y21 * y21); + return { + x: (x1 + x2 + x21 / l * r21) / 2, + y: (y1 + y2 + y21 / l * r21) / 2, + r: (l + r1 + r2) / 2 + }; +} + +function encloseBasis3(a, b, c) { + var x1 = a.x, y1 = a.y, r1 = a.r, + x2 = b.x, y2 = b.y, r2 = b.r, + x3 = c.x, y3 = c.y, r3 = c.r, + a2 = x1 - x2, + a3 = x1 - x3, + b2 = y1 - y2, + b3 = y1 - y3, + c2 = r2 - r1, + c3 = r3 - r1, + d1 = x1 * x1 + y1 * y1 - r1 * r1, + d2 = d1 - x2 * x2 - y2 * y2 + r2 * r2, + d3 = d1 - x3 * x3 - y3 * y3 + r3 * r3, + ab = a3 * b2 - a2 * b3, + xa = (b2 * d3 - b3 * d2) / (ab * 2) - x1, + xb = (b3 * c2 - b2 * c3) / ab, + ya = (a3 * d2 - a2 * d3) / (ab * 2) - y1, + yb = (a2 * c3 - a3 * c2) / ab, + A = xb * xb + yb * yb - 1, + B = 2 * (r1 + xa * xb + ya * yb), + C = xa * xa + ya * ya - r1 * r1, + r = -(A ? (B + Math.sqrt(B * B - 4 * A * C)) / (2 * A) : C / B); + return { + x: x1 + xa + xb * r, + y: y1 + ya + yb * r, + r: r + }; +} + +function place(a, b, c) { + var ax = a.x, + ay = a.y, + da = b.r + c.r, + db = a.r + c.r, + dx = b.x - ax, + dy = b.y - ay, + dc = dx * dx + dy * dy; + if (dc) { + var x = 0.5 + ((db *= db) - (da *= da)) / (2 * dc), + y = Math.sqrt(Math.max(0, 2 * da * (db + dc) - (db -= dc) * db - da * da)) / (2 * dc); + c.x = ax + x * dx + y * dy; + c.y = ay + x * dy - y * dx; + } else { + c.x = ax + db; + c.y = ay; + } +} + +function intersects(a, b) { + var dx = b.x - a.x, + dy = b.y - a.y, + dr = a.r + b.r; + return dr * dr - 1e-6 > dx * dx + dy * dy; +} + +function score(node) { + var a = node._, + b = node.next._, + ab = a.r + b.r, + dx = (a.x * b.r + b.x * a.r) / ab, + dy = (a.y * b.r + b.y * a.r) / ab; + return dx * dx + dy * dy; +} + +function Node$1(circle) { + this._ = circle; + this.next = null; + this.previous = null; +} + +function packEnclose(circles) { + if (!(n = circles.length)) return 0; + + var a, b, c, n, aa, ca, i, j, k, sj, sk; + + // Place the first circle. + a = circles[0], a.x = 0, a.y = 0; + if (!(n > 1)) return a.r; + + // Place the second circle. + b = circles[1], a.x = -b.r, b.x = a.r, b.y = 0; + if (!(n > 2)) return a.r + b.r; + + // Place the third circle. + place(b, a, c = circles[2]); + + // Initialize the front-chain using the first three circles a, b and c. + a = new Node$1(a), b = new Node$1(b), c = new Node$1(c); + a.next = c.previous = b; + b.next = a.previous = c; + c.next = b.previous = a; + + // Attempt to place each remaining circle… + pack: for (i = 3; i < n; ++i) { + place(a._, b._, c = circles[i]), c = new Node$1(c); + + // Find the closest intersecting circle on the front-chain, if any. + // “Closeness” is determined by linear distance along the front-chain. + // “Ahead” or “behind” is likewise determined by linear distance. + j = b.next, k = a.previous, sj = b._.r, sk = a._.r; + do { + if (sj <= sk) { + if (intersects(j._, c._)) { + b = j, a.next = b, b.previous = a, --i; + continue pack; + } + sj += j._.r, j = j.next; + } else { + if (intersects(k._, c._)) { + a = k, a.next = b, b.previous = a, --i; + continue pack; + } + sk += k._.r, k = k.previous; + } + } while (j !== k.next); + + // Success! Insert the new circle c between a and b. + c.previous = a, c.next = b, a.next = b.previous = b = c; + + // Compute the new closest circle pair to the centroid. + aa = score(a); + while ((c = c.next) !== b) { + if ((ca = score(c)) < aa) { + a = c, aa = ca; + } + } + b = a.next; + } + + // Compute the enclosing circle of the front chain. + a = [b._], c = b; while ((c = c.next) !== b) a.push(c._); c = enclose(a); + + // Translate the circles to put the enclosing circle around the origin. + for (i = 0; i < n; ++i) a = circles[i], a.x -= c.x, a.y -= c.y; + + return c.r; +} + +function siblings(circles) { + packEnclose(circles); + return circles; +} + +function optional(f) { + return f == null ? null : required(f); +} + +function required(f) { + if (typeof f !== "function") throw new Error; + return f; +} + +function constantZero() { + return 0; +} + +function constant$8(x) { + return function() { + return x; + }; +} + +function defaultRadius$1(d) { + return Math.sqrt(d.value); +} + +function index$2() { + var radius = null, + dx = 1, + dy = 1, + padding = constantZero; + + function pack(root) { + root.x = dx / 2, root.y = dy / 2; + if (radius) { + root.eachBefore(radiusLeaf(radius)) + .eachAfter(packChildren(padding, 0.5)) + .eachBefore(translateChild(1)); + } else { + root.eachBefore(radiusLeaf(defaultRadius$1)) + .eachAfter(packChildren(constantZero, 1)) + .eachAfter(packChildren(padding, root.r / Math.min(dx, dy))) + .eachBefore(translateChild(Math.min(dx, dy) / (2 * root.r))); + } + return root; + } + + pack.radius = function(x) { + return arguments.length ? (radius = optional(x), pack) : radius; + }; + + pack.size = function(x) { + return arguments.length ? (dx = +x[0], dy = +x[1], pack) : [dx, dy]; + }; + + pack.padding = function(x) { + return arguments.length ? (padding = typeof x === "function" ? x : constant$8(+x), pack) : padding; + }; + + return pack; +} + +function radiusLeaf(radius) { + return function(node) { + if (!node.children) { + node.r = Math.max(0, +radius(node) || 0); + } + }; +} + +function packChildren(padding, k) { + return function(node) { + if (children = node.children) { + var children, + i, + n = children.length, + r = padding(node) * k || 0, + e; + + if (r) for (i = 0; i < n; ++i) children[i].r += r; + e = packEnclose(children); + if (r) for (i = 0; i < n; ++i) children[i].r -= r; + node.r = e + r; + } + }; +} + +function translateChild(k) { + return function(node) { + var parent = node.parent; + node.r *= k; + if (parent) { + node.x = parent.x + k * node.x; + node.y = parent.y + k * node.y; + } + }; +} + +function roundNode(node) { + node.x0 = Math.round(node.x0); + node.y0 = Math.round(node.y0); + node.x1 = Math.round(node.x1); + node.y1 = Math.round(node.y1); +} + +function treemapDice(parent, x0, y0, x1, y1) { + var nodes = parent.children, + node, + i = -1, + n = nodes.length, + k = parent.value && (x1 - x0) / parent.value; + + while (++i < n) { + node = nodes[i], node.y0 = y0, node.y1 = y1; + node.x0 = x0, node.x1 = x0 += node.value * k; + } +} + +function partition() { + var dx = 1, + dy = 1, + padding = 0, + round = false; + + function partition(root) { + var n = root.height + 1; + root.x0 = + root.y0 = padding; + root.x1 = dx; + root.y1 = dy / n; + root.eachBefore(positionNode(dy, n)); + if (round) root.eachBefore(roundNode); + return root; + } + + function positionNode(dy, n) { + return function(node) { + if (node.children) { + treemapDice(node, node.x0, dy * (node.depth + 1) / n, node.x1, dy * (node.depth + 2) / n); + } + var x0 = node.x0, + y0 = node.y0, + x1 = node.x1 - padding, + y1 = node.y1 - padding; + if (x1 < x0) x0 = x1 = (x0 + x1) / 2; + if (y1 < y0) y0 = y1 = (y0 + y1) / 2; + node.x0 = x0; + node.y0 = y0; + node.x1 = x1; + node.y1 = y1; + }; + } + + partition.round = function(x) { + return arguments.length ? (round = !!x, partition) : round; + }; + + partition.size = function(x) { + return arguments.length ? (dx = +x[0], dy = +x[1], partition) : [dx, dy]; + }; + + partition.padding = function(x) { + return arguments.length ? (padding = +x, partition) : padding; + }; + + return partition; +} + +var keyPrefix$1 = "$"; +var preroot = {depth: -1}; +var ambiguous = {}; + +function defaultId(d) { + return d.id; +} + +function defaultParentId(d) { + return d.parentId; +} + +function stratify() { + var id = defaultId, + parentId = defaultParentId; + + function stratify(data) { + var d, + i, + n = data.length, + root, + parent, + node, + nodes = new Array(n), + nodeId, + nodeKey, + nodeByKey = {}; + + for (i = 0; i < n; ++i) { + d = data[i], node = nodes[i] = new Node(d); + if ((nodeId = id(d, i, data)) != null && (nodeId += "")) { + nodeKey = keyPrefix$1 + (node.id = nodeId); + nodeByKey[nodeKey] = nodeKey in nodeByKey ? ambiguous : node; + } + } + + for (i = 0; i < n; ++i) { + node = nodes[i], nodeId = parentId(data[i], i, data); + if (nodeId == null || !(nodeId += "")) { + if (root) throw new Error("multiple roots"); + root = node; + } else { + parent = nodeByKey[keyPrefix$1 + nodeId]; + if (!parent) throw new Error("missing: " + nodeId); + if (parent === ambiguous) throw new Error("ambiguous: " + nodeId); + if (parent.children) parent.children.push(node); + else parent.children = [node]; + node.parent = parent; + } + } + + if (!root) throw new Error("no root"); + root.parent = preroot; + root.eachBefore(function(node) { node.depth = node.parent.depth + 1; --n; }).eachBefore(computeHeight); + root.parent = null; + if (n > 0) throw new Error("cycle"); + + return root; + } + + stratify.id = function(x) { + return arguments.length ? (id = required(x), stratify) : id; + }; + + stratify.parentId = function(x) { + return arguments.length ? (parentId = required(x), stratify) : parentId; + }; + + return stratify; +} + +function defaultSeparation$1(a, b) { + return a.parent === b.parent ? 1 : 2; +} + +// function radialSeparation(a, b) { +// return (a.parent === b.parent ? 1 : 2) / a.depth; +// } + +// This function is used to traverse the left contour of a subtree (or +// subforest). It returns the successor of v on this contour. This successor is +// either given by the leftmost child of v or by the thread of v. The function +// returns null if and only if v is on the highest level of its subtree. +function nextLeft(v) { + var children = v.children; + return children ? children[0] : v.t; +} + +// This function works analogously to nextLeft. +function nextRight(v) { + var children = v.children; + return children ? children[children.length - 1] : v.t; +} + +// Shifts the current subtree rooted at w+. This is done by increasing +// prelim(w+) and mod(w+) by shift. +function moveSubtree(wm, wp, shift) { + var change = shift / (wp.i - wm.i); + wp.c -= change; + wp.s += shift; + wm.c += change; + wp.z += shift; + wp.m += shift; +} + +// All other shifts, applied to the smaller subtrees between w- and w+, are +// performed by this function. To prepare the shifts, we have to adjust +// change(w+), shift(w+), and change(w-). +function executeShifts(v) { + var shift = 0, + change = 0, + children = v.children, + i = children.length, + w; + while (--i >= 0) { + w = children[i]; + w.z += shift; + w.m += shift; + shift += w.s + (change += w.c); + } +} + +// If vi-’s ancestor is a sibling of v, returns vi-’s ancestor. Otherwise, +// returns the specified (default) ancestor. +function nextAncestor(vim, v, ancestor) { + return vim.a.parent === v.parent ? vim.a : ancestor; +} + +function TreeNode(node, i) { + this._ = node; + this.parent = null; + this.children = null; + this.A = null; // default ancestor + this.a = this; // ancestor + this.z = 0; // prelim + this.m = 0; // mod + this.c = 0; // change + this.s = 0; // shift + this.t = null; // thread + this.i = i; // number +} + +TreeNode.prototype = Object.create(Node.prototype); + +function treeRoot(root) { + var tree = new TreeNode(root, 0), + node, + nodes = [tree], + child, + children, + i, + n; + + while (node = nodes.pop()) { + if (children = node._.children) { + node.children = new Array(n = children.length); + for (i = n - 1; i >= 0; --i) { + nodes.push(child = node.children[i] = new TreeNode(children[i], i)); + child.parent = node; + } + } + } + + (tree.parent = new TreeNode(null, 0)).children = [tree]; + return tree; +} + +// Node-link tree diagram using the Reingold-Tilford "tidy" algorithm +function tree() { + var separation = defaultSeparation$1, + dx = 1, + dy = 1, + nodeSize = null; + + function tree(root) { + var t = treeRoot(root); + + // Compute the layout using Buchheim et al.’s algorithm. + t.eachAfter(firstWalk), t.parent.m = -t.z; + t.eachBefore(secondWalk); + + // If a fixed node size is specified, scale x and y. + if (nodeSize) root.eachBefore(sizeNode); + + // If a fixed tree size is specified, scale x and y based on the extent. + // Compute the left-most, right-most, and depth-most nodes for extents. + else { + var left = root, + right = root, + bottom = root; + root.eachBefore(function(node) { + if (node.x < left.x) left = node; + if (node.x > right.x) right = node; + if (node.depth > bottom.depth) bottom = node; + }); + var s = left === right ? 1 : separation(left, right) / 2, + tx = s - left.x, + kx = dx / (right.x + s + tx), + ky = dy / (bottom.depth || 1); + root.eachBefore(function(node) { + node.x = (node.x + tx) * kx; + node.y = node.depth * ky; + }); + } + + return root; + } + + // Computes a preliminary x-coordinate for v. Before that, FIRST WALK is + // applied recursively to the children of v, as well as the function + // APPORTION. After spacing out the children by calling EXECUTE SHIFTS, the + // node v is placed to the midpoint of its outermost children. + function firstWalk(v) { + var children = v.children, + siblings = v.parent.children, + w = v.i ? siblings[v.i - 1] : null; + if (children) { + executeShifts(v); + var midpoint = (children[0].z + children[children.length - 1].z) / 2; + if (w) { + v.z = w.z + separation(v._, w._); + v.m = v.z - midpoint; + } else { + v.z = midpoint; + } + } else if (w) { + v.z = w.z + separation(v._, w._); + } + v.parent.A = apportion(v, w, v.parent.A || siblings[0]); + } + + // Computes all real x-coordinates by summing up the modifiers recursively. + function secondWalk(v) { + v._.x = v.z + v.parent.m; + v.m += v.parent.m; + } + + // The core of the algorithm. Here, a new subtree is combined with the + // previous subtrees. Threads are used to traverse the inside and outside + // contours of the left and right subtree up to the highest common level. The + // vertices used for the traversals are vi+, vi-, vo-, and vo+, where the + // superscript o means outside and i means inside, the subscript - means left + // subtree and + means right subtree. For summing up the modifiers along the + // contour, we use respective variables si+, si-, so-, and so+. Whenever two + // nodes of the inside contours conflict, we compute the left one of the + // greatest uncommon ancestors using the function ANCESTOR and call MOVE + // SUBTREE to shift the subtree and prepare the shifts of smaller subtrees. + // Finally, we add a new thread (if necessary). + function apportion(v, w, ancestor) { + if (w) { + var vip = v, + vop = v, + vim = w, + vom = vip.parent.children[0], + sip = vip.m, + sop = vop.m, + sim = vim.m, + som = vom.m, + shift; + while (vim = nextRight(vim), vip = nextLeft(vip), vim && vip) { + vom = nextLeft(vom); + vop = nextRight(vop); + vop.a = v; + shift = vim.z + sim - vip.z - sip + separation(vim._, vip._); + if (shift > 0) { + moveSubtree(nextAncestor(vim, v, ancestor), v, shift); + sip += shift; + sop += shift; + } + sim += vim.m; + sip += vip.m; + som += vom.m; + sop += vop.m; + } + if (vim && !nextRight(vop)) { + vop.t = vim; + vop.m += sim - sop; + } + if (vip && !nextLeft(vom)) { + vom.t = vip; + vom.m += sip - som; + ancestor = v; + } + } + return ancestor; + } + + function sizeNode(node) { + node.x *= dx; + node.y = node.depth * dy; + } + + tree.separation = function(x) { + return arguments.length ? (separation = x, tree) : separation; + }; + + tree.size = function(x) { + return arguments.length ? (nodeSize = false, dx = +x[0], dy = +x[1], tree) : (nodeSize ? null : [dx, dy]); + }; + + tree.nodeSize = function(x) { + return arguments.length ? (nodeSize = true, dx = +x[0], dy = +x[1], tree) : (nodeSize ? [dx, dy] : null); + }; + + return tree; +} + +function treemapSlice(parent, x0, y0, x1, y1) { + var nodes = parent.children, + node, + i = -1, + n = nodes.length, + k = parent.value && (y1 - y0) / parent.value; + + while (++i < n) { + node = nodes[i], node.x0 = x0, node.x1 = x1; + node.y0 = y0, node.y1 = y0 += node.value * k; + } +} + +var phi = (1 + Math.sqrt(5)) / 2; + +function squarifyRatio(ratio, parent, x0, y0, x1, y1) { + var rows = [], + nodes = parent.children, + row, + nodeValue, + i0 = 0, + i1 = 0, + n = nodes.length, + dx, dy, + value = parent.value, + sumValue, + minValue, + maxValue, + newRatio, + minRatio, + alpha, + beta; + + while (i0 < n) { + dx = x1 - x0, dy = y1 - y0; + + // Find the next non-empty node. + do sumValue = nodes[i1++].value; while (!sumValue && i1 < n); + minValue = maxValue = sumValue; + alpha = Math.max(dy / dx, dx / dy) / (value * ratio); + beta = sumValue * sumValue * alpha; + minRatio = Math.max(maxValue / beta, beta / minValue); + + // Keep adding nodes while the aspect ratio maintains or improves. + for (; i1 < n; ++i1) { + sumValue += nodeValue = nodes[i1].value; + if (nodeValue < minValue) minValue = nodeValue; + if (nodeValue > maxValue) maxValue = nodeValue; + beta = sumValue * sumValue * alpha; + newRatio = Math.max(maxValue / beta, beta / minValue); + if (newRatio > minRatio) { sumValue -= nodeValue; break; } + minRatio = newRatio; + } + + // Position and record the row orientation. + rows.push(row = {value: sumValue, dice: dx < dy, children: nodes.slice(i0, i1)}); + if (row.dice) treemapDice(row, x0, y0, x1, value ? y0 += dy * sumValue / value : y1); + else treemapSlice(row, x0, y0, value ? x0 += dx * sumValue / value : x1, y1); + value -= sumValue, i0 = i1; + } + + return rows; +} + +var squarify = (function custom(ratio) { + + function squarify(parent, x0, y0, x1, y1) { + squarifyRatio(ratio, parent, x0, y0, x1, y1); + } + + squarify.ratio = function(x) { + return custom((x = +x) > 1 ? x : 1); + }; + + return squarify; +})(phi); + +function index$3() { + var tile = squarify, + round = false, + dx = 1, + dy = 1, + paddingStack = [0], + paddingInner = constantZero, + paddingTop = constantZero, + paddingRight = constantZero, + paddingBottom = constantZero, + paddingLeft = constantZero; + + function treemap(root) { + root.x0 = + root.y0 = 0; + root.x1 = dx; + root.y1 = dy; + root.eachBefore(positionNode); + paddingStack = [0]; + if (round) root.eachBefore(roundNode); + return root; + } + + function positionNode(node) { + var p = paddingStack[node.depth], + x0 = node.x0 + p, + y0 = node.y0 + p, + x1 = node.x1 - p, + y1 = node.y1 - p; + if (x1 < x0) x0 = x1 = (x0 + x1) / 2; + if (y1 < y0) y0 = y1 = (y0 + y1) / 2; + node.x0 = x0; + node.y0 = y0; + node.x1 = x1; + node.y1 = y1; + if (node.children) { + p = paddingStack[node.depth + 1] = paddingInner(node) / 2; + x0 += paddingLeft(node) - p; + y0 += paddingTop(node) - p; + x1 -= paddingRight(node) - p; + y1 -= paddingBottom(node) - p; + if (x1 < x0) x0 = x1 = (x0 + x1) / 2; + if (y1 < y0) y0 = y1 = (y0 + y1) / 2; + tile(node, x0, y0, x1, y1); + } + } + + treemap.round = function(x) { + return arguments.length ? (round = !!x, treemap) : round; + }; + + treemap.size = function(x) { + return arguments.length ? (dx = +x[0], dy = +x[1], treemap) : [dx, dy]; + }; + + treemap.tile = function(x) { + return arguments.length ? (tile = required(x), treemap) : tile; + }; + + treemap.padding = function(x) { + return arguments.length ? treemap.paddingInner(x).paddingOuter(x) : treemap.paddingInner(); + }; + + treemap.paddingInner = function(x) { + return arguments.length ? (paddingInner = typeof x === "function" ? x : constant$8(+x), treemap) : paddingInner; + }; + + treemap.paddingOuter = function(x) { + return arguments.length ? treemap.paddingTop(x).paddingRight(x).paddingBottom(x).paddingLeft(x) : treemap.paddingTop(); + }; + + treemap.paddingTop = function(x) { + return arguments.length ? (paddingTop = typeof x === "function" ? x : constant$8(+x), treemap) : paddingTop; + }; + + treemap.paddingRight = function(x) { + return arguments.length ? (paddingRight = typeof x === "function" ? x : constant$8(+x), treemap) : paddingRight; + }; + + treemap.paddingBottom = function(x) { + return arguments.length ? (paddingBottom = typeof x === "function" ? x : constant$8(+x), treemap) : paddingBottom; + }; + + treemap.paddingLeft = function(x) { + return arguments.length ? (paddingLeft = typeof x === "function" ? x : constant$8(+x), treemap) : paddingLeft; + }; + + return treemap; +} + +function binary(parent, x0, y0, x1, y1) { + var nodes = parent.children, + i, n = nodes.length, + sum, sums = new Array(n + 1); + + for (sums[0] = sum = i = 0; i < n; ++i) { + sums[i + 1] = sum += nodes[i].value; + } + + partition(0, n, parent.value, x0, y0, x1, y1); + + function partition(i, j, value, x0, y0, x1, y1) { + if (i >= j - 1) { + var node = nodes[i]; + node.x0 = x0, node.y0 = y0; + node.x1 = x1, node.y1 = y1; + return; + } + + var valueOffset = sums[i], + valueTarget = (value / 2) + valueOffset, + k = i + 1, + hi = j - 1; + + while (k < hi) { + var mid = k + hi >>> 1; + if (sums[mid] < valueTarget) k = mid + 1; + else hi = mid; + } + + if ((valueTarget - sums[k - 1]) < (sums[k] - valueTarget) && i + 1 < k) --k; + + var valueLeft = sums[k] - valueOffset, + valueRight = value - valueLeft; + + if ((x1 - x0) > (y1 - y0)) { + var xk = (x0 * valueRight + x1 * valueLeft) / value; + partition(i, k, valueLeft, x0, y0, xk, y1); + partition(k, j, valueRight, xk, y0, x1, y1); + } else { + var yk = (y0 * valueRight + y1 * valueLeft) / value; + partition(i, k, valueLeft, x0, y0, x1, yk); + partition(k, j, valueRight, x0, yk, x1, y1); + } + } +} + +function sliceDice(parent, x0, y0, x1, y1) { + (parent.depth & 1 ? treemapSlice : treemapDice)(parent, x0, y0, x1, y1); +} + +var resquarify = (function custom(ratio) { + + function resquarify(parent, x0, y0, x1, y1) { + if ((rows = parent._squarify) && (rows.ratio === ratio)) { + var rows, + row, + nodes, + i, + j = -1, + n, + m = rows.length, + value = parent.value; + + while (++j < m) { + row = rows[j], nodes = row.children; + for (i = row.value = 0, n = nodes.length; i < n; ++i) row.value += nodes[i].value; + if (row.dice) treemapDice(row, x0, y0, x1, y0 += (y1 - y0) * row.value / value); + else treemapSlice(row, x0, y0, x0 += (x1 - x0) * row.value / value, y1); + value -= row.value; + } + } else { + parent._squarify = rows = squarifyRatio(ratio, parent, x0, y0, x1, y1); + rows.ratio = ratio; + } + } + + resquarify.ratio = function(x) { + return custom((x = +x) > 1 ? x : 1); + }; + + return resquarify; +})(phi); + +function area$1(polygon) { + var i = -1, + n = polygon.length, + a, + b = polygon[n - 1], + area = 0; + + while (++i < n) { + a = b; + b = polygon[i]; + area += a[1] * b[0] - a[0] * b[1]; + } + + return area / 2; +} + +function centroid$1(polygon) { + var i = -1, + n = polygon.length, + x = 0, + y = 0, + a, + b = polygon[n - 1], + c, + k = 0; + + while (++i < n) { + a = b; + b = polygon[i]; + k += c = a[0] * b[1] - b[0] * a[1]; + x += (a[0] + b[0]) * c; + y += (a[1] + b[1]) * c; + } + + return k *= 3, [x / k, y / k]; +} + +// Returns the 2D cross product of AB and AC vectors, i.e., the z-component of +// the 3D cross product in a quadrant I Cartesian coordinate system (+x is +// right, +y is up). Returns a positive value if ABC is counter-clockwise, +// negative if clockwise, and zero if the points are collinear. +function cross$1(a, b, c) { + return (b[0] - a[0]) * (c[1] - a[1]) - (b[1] - a[1]) * (c[0] - a[0]); +} + +function lexicographicOrder(a, b) { + return a[0] - b[0] || a[1] - b[1]; +} + +// Computes the upper convex hull per the monotone chain algorithm. +// Assumes points.length >= 3, is sorted by x, unique in y. +// Returns an array of indices into points in left-to-right order. +function computeUpperHullIndexes(points) { + var n = points.length, + indexes = [0, 1], + size = 2; + + for (var i = 2; i < n; ++i) { + while (size > 1 && cross$1(points[indexes[size - 2]], points[indexes[size - 1]], points[i]) <= 0) --size; + indexes[size++] = i; + } + + return indexes.slice(0, size); // remove popped points +} + +function hull(points) { + if ((n = points.length) < 3) return null; + + var i, + n, + sortedPoints = new Array(n), + flippedPoints = new Array(n); + + for (i = 0; i < n; ++i) sortedPoints[i] = [+points[i][0], +points[i][1], i]; + sortedPoints.sort(lexicographicOrder); + for (i = 0; i < n; ++i) flippedPoints[i] = [sortedPoints[i][0], -sortedPoints[i][1]]; + + var upperIndexes = computeUpperHullIndexes(sortedPoints), + lowerIndexes = computeUpperHullIndexes(flippedPoints); + + // Construct the hull polygon, removing possible duplicate endpoints. + var skipLeft = lowerIndexes[0] === upperIndexes[0], + skipRight = lowerIndexes[lowerIndexes.length - 1] === upperIndexes[upperIndexes.length - 1], + hull = []; + + // Add upper hull in right-to-l order. + // Then add lower hull in left-to-right order. + for (i = upperIndexes.length - 1; i >= 0; --i) hull.push(points[sortedPoints[upperIndexes[i]][2]]); + for (i = +skipLeft; i < lowerIndexes.length - skipRight; ++i) hull.push(points[sortedPoints[lowerIndexes[i]][2]]); + + return hull; +} + +function contains$1(polygon, point) { + var n = polygon.length, + p = polygon[n - 1], + x = point[0], y = point[1], + x0 = p[0], y0 = p[1], + x1, y1, + inside = false; + + for (var i = 0; i < n; ++i) { + p = polygon[i], x1 = p[0], y1 = p[1]; + if (((y1 > y) !== (y0 > y)) && (x < (x0 - x1) * (y - y1) / (y0 - y1) + x1)) inside = !inside; + x0 = x1, y0 = y1; + } + + return inside; +} + +function length$2(polygon) { + var i = -1, + n = polygon.length, + b = polygon[n - 1], + xa, + ya, + xb = b[0], + yb = b[1], + perimeter = 0; + + while (++i < n) { + xa = xb; + ya = yb; + b = polygon[i]; + xb = b[0]; + yb = b[1]; + xa -= xb; + ya -= yb; + perimeter += Math.sqrt(xa * xa + ya * ya); + } + + return perimeter; +} + +var slice$4 = [].slice; + +var noabort = {}; + +function Queue(size) { + this._size = size; + this._call = + this._error = null; + this._tasks = []; + this._data = []; + this._waiting = + this._active = + this._ended = + this._start = 0; // inside a synchronous task callback? +} + +Queue.prototype = queue.prototype = { + constructor: Queue, + defer: function(callback) { + if (typeof callback !== "function") throw new Error("invalid callback"); + if (this._call) throw new Error("defer after await"); + if (this._error != null) return this; + var t = slice$4.call(arguments, 1); + t.push(callback); + ++this._waiting, this._tasks.push(t); + poke$1(this); + return this; + }, + abort: function() { + if (this._error == null) abort(this, new Error("abort")); + return this; + }, + await: function(callback) { + if (typeof callback !== "function") throw new Error("invalid callback"); + if (this._call) throw new Error("multiple await"); + this._call = function(error, results) { callback.apply(null, [error].concat(results)); }; + maybeNotify(this); + return this; + }, + awaitAll: function(callback) { + if (typeof callback !== "function") throw new Error("invalid callback"); + if (this._call) throw new Error("multiple await"); + this._call = callback; + maybeNotify(this); + return this; + } +}; + +function poke$1(q) { + if (!q._start) { + try { start$1(q); } // let the current task complete + catch (e) { + if (q._tasks[q._ended + q._active - 1]) abort(q, e); // task errored synchronously + else if (!q._data) throw e; // await callback errored synchronously + } + } +} + +function start$1(q) { + while (q._start = q._waiting && q._active < q._size) { + var i = q._ended + q._active, + t = q._tasks[i], + j = t.length - 1, + c = t[j]; + t[j] = end(q, i); + --q._waiting, ++q._active; + t = c.apply(null, t); + if (!q._tasks[i]) continue; // task finished synchronously + q._tasks[i] = t || noabort; + } +} + +function end(q, i) { + return function(e, r) { + if (!q._tasks[i]) return; // ignore multiple callbacks + --q._active, ++q._ended; + q._tasks[i] = null; + if (q._error != null) return; // ignore secondary errors + if (e != null) { + abort(q, e); + } else { + q._data[i] = r; + if (q._waiting) poke$1(q); + else maybeNotify(q); + } + }; +} + +function abort(q, e) { + var i = q._tasks.length, t; + q._error = e; // ignore active callbacks + q._data = undefined; // allow gc + q._waiting = NaN; // prevent starting + + while (--i >= 0) { + if (t = q._tasks[i]) { + q._tasks[i] = null; + if (t.abort) { + try { t.abort(); } + catch (e) { /* ignore */ } + } + } + } + + q._active = NaN; // allow notification + maybeNotify(q); +} + +function maybeNotify(q) { + if (!q._active && q._call) { + var d = q._data; + q._data = undefined; // allow gc + q._call(q._error, d); + } +} + +function queue(concurrency) { + if (concurrency == null) concurrency = Infinity; + else if (!((concurrency = +concurrency) >= 1)) throw new Error("invalid concurrency"); + return new Queue(concurrency); +} + +function defaultSource$1() { + return Math.random(); +} + +var uniform = (function sourceRandomUniform(source) { + function randomUniform(min, max) { + min = min == null ? 0 : +min; + max = max == null ? 1 : +max; + if (arguments.length === 1) max = min, min = 0; + else max -= min; + return function() { + return source() * max + min; + }; + } + + randomUniform.source = sourceRandomUniform; + + return randomUniform; +})(defaultSource$1); + +var normal = (function sourceRandomNormal(source) { + function randomNormal(mu, sigma) { + var x, r; + mu = mu == null ? 0 : +mu; + sigma = sigma == null ? 1 : +sigma; + return function() { + var y; + + // If available, use the second previously-generated uniform random. + if (x != null) y = x, x = null; + + // Otherwise, generate a new x and y. + else do { + x = source() * 2 - 1; + y = source() * 2 - 1; + r = x * x + y * y; + } while (!r || r > 1); + + return mu + sigma * y * Math.sqrt(-2 * Math.log(r) / r); + }; + } + + randomNormal.source = sourceRandomNormal; + + return randomNormal; +})(defaultSource$1); + +var logNormal = (function sourceRandomLogNormal(source) { + function randomLogNormal() { + var randomNormal = normal.source(source).apply(this, arguments); + return function() { + return Math.exp(randomNormal()); + }; + } + + randomLogNormal.source = sourceRandomLogNormal; + + return randomLogNormal; +})(defaultSource$1); + +var irwinHall = (function sourceRandomIrwinHall(source) { + function randomIrwinHall(n) { + return function() { + for (var sum = 0, i = 0; i < n; ++i) sum += source(); + return sum; + }; + } + + randomIrwinHall.source = sourceRandomIrwinHall; + + return randomIrwinHall; +})(defaultSource$1); + +var bates = (function sourceRandomBates(source) { + function randomBates(n) { + var randomIrwinHall = irwinHall.source(source)(n); + return function() { + return randomIrwinHall() / n; + }; + } + + randomBates.source = sourceRandomBates; + + return randomBates; +})(defaultSource$1); + +var exponential$1 = (function sourceRandomExponential(source) { + function randomExponential(lambda) { + return function() { + return -Math.log(1 - source()) / lambda; + }; + } + + randomExponential.source = sourceRandomExponential; + + return randomExponential; +})(defaultSource$1); + +function request(url, callback) { + var request, + event = dispatch("beforesend", "progress", "load", "error"), + mimeType, + headers = map$1(), + xhr = new XMLHttpRequest, + user = null, + password = null, + response, + responseType, + timeout = 0; + + // If IE does not support CORS, use XDomainRequest. + if (typeof XDomainRequest !== "undefined" + && !("withCredentials" in xhr) + && /^(http(s)?:)?\/\//.test(url)) xhr = new XDomainRequest; + + "onload" in xhr + ? xhr.onload = xhr.onerror = xhr.ontimeout = respond + : xhr.onreadystatechange = function(o) { xhr.readyState > 3 && respond(o); }; + + function respond(o) { + var status = xhr.status, result; + if (!status && hasResponse(xhr) + || status >= 200 && status < 300 + || status === 304) { + if (response) { + try { + result = response.call(request, xhr); + } catch (e) { + event.call("error", request, e); + return; + } + } else { + result = xhr; + } + event.call("load", request, result); + } else { + event.call("error", request, o); + } + } + + xhr.onprogress = function(e) { + event.call("progress", request, e); + }; + + request = { + header: function(name, value) { + name = (name + "").toLowerCase(); + if (arguments.length < 2) return headers.get(name); + if (value == null) headers.remove(name); + else headers.set(name, value + ""); + return request; + }, + + // If mimeType is non-null and no Accept header is set, a default is used. + mimeType: function(value) { + if (!arguments.length) return mimeType; + mimeType = value == null ? null : value + ""; + return request; + }, + + // Specifies what type the response value should take; + // for instance, arraybuffer, blob, document, or text. + responseType: function(value) { + if (!arguments.length) return responseType; + responseType = value; + return request; + }, + + timeout: function(value) { + if (!arguments.length) return timeout; + timeout = +value; + return request; + }, + + user: function(value) { + return arguments.length < 1 ? user : (user = value == null ? null : value + "", request); + }, + + password: function(value) { + return arguments.length < 1 ? password : (password = value == null ? null : value + "", request); + }, + + // Specify how to convert the response content to a specific type; + // changes the callback value on "load" events. + response: function(value) { + response = value; + return request; + }, + + // Alias for send("GET", …). + get: function(data, callback) { + return request.send("GET", data, callback); + }, + + // Alias for send("POST", …). + post: function(data, callback) { + return request.send("POST", data, callback); + }, + + // If callback is non-null, it will be used for error and load events. + send: function(method, data, callback) { + xhr.open(method, url, true, user, password); + if (mimeType != null && !headers.has("accept")) headers.set("accept", mimeType + ",*/*"); + if (xhr.setRequestHeader) headers.each(function(value, name) { xhr.setRequestHeader(name, value); }); + if (mimeType != null && xhr.overrideMimeType) xhr.overrideMimeType(mimeType); + if (responseType != null) xhr.responseType = responseType; + if (timeout > 0) xhr.timeout = timeout; + if (callback == null && typeof data === "function") callback = data, data = null; + if (callback != null && callback.length === 1) callback = fixCallback(callback); + if (callback != null) request.on("error", callback).on("load", function(xhr) { callback(null, xhr); }); + event.call("beforesend", request, xhr); + xhr.send(data == null ? null : data); + return request; + }, + + abort: function() { + xhr.abort(); + return request; + }, + + on: function() { + var value = event.on.apply(event, arguments); + return value === event ? request : value; + } + }; + + if (callback != null) { + if (typeof callback !== "function") throw new Error("invalid callback: " + callback); + return request.get(callback); + } + + return request; +} + +function fixCallback(callback) { + return function(error, xhr) { + callback(error == null ? xhr : null); + }; +} + +function hasResponse(xhr) { + var type = xhr.responseType; + return type && type !== "text" + ? xhr.response // null on error + : xhr.responseText; // "" on error +} + +function type$1(defaultMimeType, response) { + return function(url, callback) { + var r = request(url).mimeType(defaultMimeType).response(response); + if (callback != null) { + if (typeof callback !== "function") throw new Error("invalid callback: " + callback); + return r.get(callback); + } + return r; + }; +} + +var html = type$1("text/html", function(xhr) { + return document.createRange().createContextualFragment(xhr.responseText); +}); + +var json = type$1("application/json", function(xhr) { + return JSON.parse(xhr.responseText); +}); + +var text = type$1("text/plain", function(xhr) { + return xhr.responseText; +}); + +var xml = type$1("application/xml", function(xhr) { + var xml = xhr.responseXML; + if (!xml) throw new Error("parse error"); + return xml; +}); + +function dsv$1(defaultMimeType, parse) { + return function(url, row, callback) { + if (arguments.length < 3) callback = row, row = null; + var r = request(url).mimeType(defaultMimeType); + r.row = function(_) { return arguments.length ? r.response(responseOf(parse, row = _)) : row; }; + r.row(row); + return callback ? r.get(callback) : r; + }; +} + +function responseOf(parse, row) { + return function(request$$1) { + return parse(request$$1.responseText, row); + }; +} + +var csv$1 = dsv$1("text/csv", csvParse); + +var tsv$1 = dsv$1("text/tab-separated-values", tsvParse); + +var array$2 = Array.prototype; + +var map$3 = array$2.map; +var slice$5 = array$2.slice; + +var implicit = {name: "implicit"}; + +function ordinal(range) { + var index = map$1(), + domain = [], + unknown = implicit; + + range = range == null ? [] : slice$5.call(range); + + function scale(d) { + var key = d + "", i = index.get(key); + if (!i) { + if (unknown !== implicit) return unknown; + index.set(key, i = domain.push(d)); + } + return range[(i - 1) % range.length]; + } + + scale.domain = function(_) { + if (!arguments.length) return domain.slice(); + domain = [], index = map$1(); + var i = -1, n = _.length, d, key; + while (++i < n) if (!index.has(key = (d = _[i]) + "")) index.set(key, domain.push(d)); + return scale; + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), scale) : range.slice(); + }; + + scale.unknown = function(_) { + return arguments.length ? (unknown = _, scale) : unknown; + }; + + scale.copy = function() { + return ordinal() + .domain(domain) + .range(range) + .unknown(unknown); + }; + + return scale; +} + +function band() { + var scale = ordinal().unknown(undefined), + domain = scale.domain, + ordinalRange = scale.range, + range$$1 = [0, 1], + step, + bandwidth, + round = false, + paddingInner = 0, + paddingOuter = 0, + align = 0.5; + + delete scale.unknown; + + function rescale() { + var n = domain().length, + reverse = range$$1[1] < range$$1[0], + start = range$$1[reverse - 0], + stop = range$$1[1 - reverse]; + step = (stop - start) / Math.max(1, n - paddingInner + paddingOuter * 2); + if (round) step = Math.floor(step); + start += (stop - start - step * (n - paddingInner)) * align; + bandwidth = step * (1 - paddingInner); + if (round) start = Math.round(start), bandwidth = Math.round(bandwidth); + var values = sequence(n).map(function(i) { return start + step * i; }); + return ordinalRange(reverse ? values.reverse() : values); + } + + scale.domain = function(_) { + return arguments.length ? (domain(_), rescale()) : domain(); + }; + + scale.range = function(_) { + return arguments.length ? (range$$1 = [+_[0], +_[1]], rescale()) : range$$1.slice(); + }; + + scale.rangeRound = function(_) { + return range$$1 = [+_[0], +_[1]], round = true, rescale(); + }; + + scale.bandwidth = function() { + return bandwidth; + }; + + scale.step = function() { + return step; + }; + + scale.round = function(_) { + return arguments.length ? (round = !!_, rescale()) : round; + }; + + scale.padding = function(_) { + return arguments.length ? (paddingInner = paddingOuter = Math.max(0, Math.min(1, _)), rescale()) : paddingInner; + }; + + scale.paddingInner = function(_) { + return arguments.length ? (paddingInner = Math.max(0, Math.min(1, _)), rescale()) : paddingInner; + }; + + scale.paddingOuter = function(_) { + return arguments.length ? (paddingOuter = Math.max(0, Math.min(1, _)), rescale()) : paddingOuter; + }; + + scale.align = function(_) { + return arguments.length ? (align = Math.max(0, Math.min(1, _)), rescale()) : align; + }; + + scale.copy = function() { + return band() + .domain(domain()) + .range(range$$1) + .round(round) + .paddingInner(paddingInner) + .paddingOuter(paddingOuter) + .align(align); + }; + + return rescale(); +} + +function pointish(scale) { + var copy = scale.copy; + + scale.padding = scale.paddingOuter; + delete scale.paddingInner; + delete scale.paddingOuter; + + scale.copy = function() { + return pointish(copy()); + }; + + return scale; +} + +function point$1() { + return pointish(band().paddingInner(1)); +} + +function constant$9(x) { + return function() { + return x; + }; +} + +function number$2(x) { + return +x; +} + +var unit = [0, 1]; + +function deinterpolateLinear(a, b) { + return (b -= (a = +a)) + ? function(x) { return (x - a) / b; } + : constant$9(b); +} + +function deinterpolateClamp(deinterpolate) { + return function(a, b) { + var d = deinterpolate(a = +a, b = +b); + return function(x) { return x <= a ? 0 : x >= b ? 1 : d(x); }; + }; +} + +function reinterpolateClamp(reinterpolate) { + return function(a, b) { + var r = reinterpolate(a = +a, b = +b); + return function(t) { return t <= 0 ? a : t >= 1 ? b : r(t); }; + }; +} + +function bimap(domain, range, deinterpolate, reinterpolate) { + var d0 = domain[0], d1 = domain[1], r0 = range[0], r1 = range[1]; + if (d1 < d0) d0 = deinterpolate(d1, d0), r0 = reinterpolate(r1, r0); + else d0 = deinterpolate(d0, d1), r0 = reinterpolate(r0, r1); + return function(x) { return r0(d0(x)); }; +} + +function polymap(domain, range, deinterpolate, reinterpolate) { + var j = Math.min(domain.length, range.length) - 1, + d = new Array(j), + r = new Array(j), + i = -1; + + // Reverse descending domains. + if (domain[j] < domain[0]) { + domain = domain.slice().reverse(); + range = range.slice().reverse(); + } + + while (++i < j) { + d[i] = deinterpolate(domain[i], domain[i + 1]); + r[i] = reinterpolate(range[i], range[i + 1]); + } + + return function(x) { + var i = bisectRight(domain, x, 1, j) - 1; + return r[i](d[i](x)); + }; +} + +function copy(source, target) { + return target + .domain(source.domain()) + .range(source.range()) + .interpolate(source.interpolate()) + .clamp(source.clamp()); +} + +// deinterpolate(a, b)(x) takes a domain value x in [a,b] and returns the corresponding parameter t in [0,1]. +// reinterpolate(a, b)(t) takes a parameter t in [0,1] and returns the corresponding domain value x in [a,b]. +function continuous(deinterpolate, reinterpolate) { + var domain = unit, + range = unit, + interpolate$$1 = interpolateValue, + clamp = false, + piecewise, + output, + input; + + function rescale() { + piecewise = Math.min(domain.length, range.length) > 2 ? polymap : bimap; + output = input = null; + return scale; + } + + function scale(x) { + return (output || (output = piecewise(domain, range, clamp ? deinterpolateClamp(deinterpolate) : deinterpolate, interpolate$$1)))(+x); + } + + scale.invert = function(y) { + return (input || (input = piecewise(range, domain, deinterpolateLinear, clamp ? reinterpolateClamp(reinterpolate) : reinterpolate)))(+y); + }; + + scale.domain = function(_) { + return arguments.length ? (domain = map$3.call(_, number$2), rescale()) : domain.slice(); + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), rescale()) : range.slice(); + }; + + scale.rangeRound = function(_) { + return range = slice$5.call(_), interpolate$$1 = interpolateRound, rescale(); + }; + + scale.clamp = function(_) { + return arguments.length ? (clamp = !!_, rescale()) : clamp; + }; + + scale.interpolate = function(_) { + return arguments.length ? (interpolate$$1 = _, rescale()) : interpolate$$1; + }; + + return rescale(); +} + +function tickFormat(domain, count, specifier) { + var start = domain[0], + stop = domain[domain.length - 1], + step = tickStep(start, stop, count == null ? 10 : count), + precision; + specifier = formatSpecifier(specifier == null ? ",f" : specifier); + switch (specifier.type) { + case "s": { + var value = Math.max(Math.abs(start), Math.abs(stop)); + if (specifier.precision == null && !isNaN(precision = precisionPrefix(step, value))) specifier.precision = precision; + return exports.formatPrefix(specifier, value); + } + case "": + case "e": + case "g": + case "p": + case "r": { + if (specifier.precision == null && !isNaN(precision = precisionRound(step, Math.max(Math.abs(start), Math.abs(stop))))) specifier.precision = precision - (specifier.type === "e"); + break; + } + case "f": + case "%": { + if (specifier.precision == null && !isNaN(precision = precisionFixed(step))) specifier.precision = precision - (specifier.type === "%") * 2; + break; + } + } + return exports.format(specifier); +} + +function linearish(scale) { + var domain = scale.domain; + + scale.ticks = function(count) { + var d = domain(); + return ticks(d[0], d[d.length - 1], count == null ? 10 : count); + }; + + scale.tickFormat = function(count, specifier) { + return tickFormat(domain(), count, specifier); + }; + + scale.nice = function(count) { + if (count == null) count = 10; + + var d = domain(), + i0 = 0, + i1 = d.length - 1, + start = d[i0], + stop = d[i1], + step; + + if (stop < start) { + step = start, start = stop, stop = step; + step = i0, i0 = i1, i1 = step; + } + + step = tickIncrement(start, stop, count); + + if (step > 0) { + start = Math.floor(start / step) * step; + stop = Math.ceil(stop / step) * step; + step = tickIncrement(start, stop, count); + } else if (step < 0) { + start = Math.ceil(start * step) / step; + stop = Math.floor(stop * step) / step; + step = tickIncrement(start, stop, count); + } + + if (step > 0) { + d[i0] = Math.floor(start / step) * step; + d[i1] = Math.ceil(stop / step) * step; + domain(d); + } else if (step < 0) { + d[i0] = Math.ceil(start * step) / step; + d[i1] = Math.floor(stop * step) / step; + domain(d); + } + + return scale; + }; + + return scale; +} + +function linear$2() { + var scale = continuous(deinterpolateLinear, reinterpolate); + + scale.copy = function() { + return copy(scale, linear$2()); + }; + + return linearish(scale); +} + +function identity$6() { + var domain = [0, 1]; + + function scale(x) { + return +x; + } + + scale.invert = scale; + + scale.domain = scale.range = function(_) { + return arguments.length ? (domain = map$3.call(_, number$2), scale) : domain.slice(); + }; + + scale.copy = function() { + return identity$6().domain(domain); + }; + + return linearish(scale); +} + +function nice(domain, interval) { + domain = domain.slice(); + + var i0 = 0, + i1 = domain.length - 1, + x0 = domain[i0], + x1 = domain[i1], + t; + + if (x1 < x0) { + t = i0, i0 = i1, i1 = t; + t = x0, x0 = x1, x1 = t; + } + + domain[i0] = interval.floor(x0); + domain[i1] = interval.ceil(x1); + return domain; +} + +function deinterpolate(a, b) { + return (b = Math.log(b / a)) + ? function(x) { return Math.log(x / a) / b; } + : constant$9(b); +} + +function reinterpolate$1(a, b) { + return a < 0 + ? function(t) { return -Math.pow(-b, t) * Math.pow(-a, 1 - t); } + : function(t) { return Math.pow(b, t) * Math.pow(a, 1 - t); }; +} + +function pow10(x) { + return isFinite(x) ? +("1e" + x) : x < 0 ? 0 : x; +} + +function powp(base) { + return base === 10 ? pow10 + : base === Math.E ? Math.exp + : function(x) { return Math.pow(base, x); }; +} + +function logp(base) { + return base === Math.E ? Math.log + : base === 10 && Math.log10 + || base === 2 && Math.log2 + || (base = Math.log(base), function(x) { return Math.log(x) / base; }); +} + +function reflect(f) { + return function(x) { + return -f(-x); + }; +} + +function log$1() { + var scale = continuous(deinterpolate, reinterpolate$1).domain([1, 10]), + domain = scale.domain, + base = 10, + logs = logp(10), + pows = powp(10); + + function rescale() { + logs = logp(base), pows = powp(base); + if (domain()[0] < 0) logs = reflect(logs), pows = reflect(pows); + return scale; + } + + scale.base = function(_) { + return arguments.length ? (base = +_, rescale()) : base; + }; + + scale.domain = function(_) { + return arguments.length ? (domain(_), rescale()) : domain(); + }; + + scale.ticks = function(count) { + var d = domain(), + u = d[0], + v = d[d.length - 1], + r; + + if (r = v < u) i = u, u = v, v = i; + + var i = logs(u), + j = logs(v), + p, + k, + t, + n = count == null ? 10 : +count, + z = []; + + if (!(base % 1) && j - i < n) { + i = Math.round(i) - 1, j = Math.round(j) + 1; + if (u > 0) for (; i < j; ++i) { + for (k = 1, p = pows(i); k < base; ++k) { + t = p * k; + if (t < u) continue; + if (t > v) break; + z.push(t); + } + } else for (; i < j; ++i) { + for (k = base - 1, p = pows(i); k >= 1; --k) { + t = p * k; + if (t < u) continue; + if (t > v) break; + z.push(t); + } + } + } else { + z = ticks(i, j, Math.min(j - i, n)).map(pows); + } + + return r ? z.reverse() : z; + }; + + scale.tickFormat = function(count, specifier) { + if (specifier == null) specifier = base === 10 ? ".0e" : ","; + if (typeof specifier !== "function") specifier = exports.format(specifier); + if (count === Infinity) return specifier; + if (count == null) count = 10; + var k = Math.max(1, base * count / scale.ticks().length); // TODO fast estimate? + return function(d) { + var i = d / pows(Math.round(logs(d))); + if (i * base < base - 0.5) i *= base; + return i <= k ? specifier(d) : ""; + }; + }; + + scale.nice = function() { + return domain(nice(domain(), { + floor: function(x) { return pows(Math.floor(logs(x))); }, + ceil: function(x) { return pows(Math.ceil(logs(x))); } + })); + }; + + scale.copy = function() { + return copy(scale, log$1().base(base)); + }; + + return scale; +} + +function raise$1(x, exponent) { + return x < 0 ? -Math.pow(-x, exponent) : Math.pow(x, exponent); +} + +function pow$1() { + var exponent = 1, + scale = continuous(deinterpolate, reinterpolate), + domain = scale.domain; + + function deinterpolate(a, b) { + return (b = raise$1(b, exponent) - (a = raise$1(a, exponent))) + ? function(x) { return (raise$1(x, exponent) - a) / b; } + : constant$9(b); + } + + function reinterpolate(a, b) { + b = raise$1(b, exponent) - (a = raise$1(a, exponent)); + return function(t) { return raise$1(a + b * t, 1 / exponent); }; + } + + scale.exponent = function(_) { + return arguments.length ? (exponent = +_, domain(domain())) : exponent; + }; + + scale.copy = function() { + return copy(scale, pow$1().exponent(exponent)); + }; + + return linearish(scale); +} + +function sqrt$1() { + return pow$1().exponent(0.5); +} + +function quantile$$1() { + var domain = [], + range = [], + thresholds = []; + + function rescale() { + var i = 0, n = Math.max(1, range.length); + thresholds = new Array(n - 1); + while (++i < n) thresholds[i - 1] = threshold(domain, i / n); + return scale; + } + + function scale(x) { + if (!isNaN(x = +x)) return range[bisectRight(thresholds, x)]; + } + + scale.invertExtent = function(y) { + var i = range.indexOf(y); + return i < 0 ? [NaN, NaN] : [ + i > 0 ? thresholds[i - 1] : domain[0], + i < thresholds.length ? thresholds[i] : domain[domain.length - 1] + ]; + }; + + scale.domain = function(_) { + if (!arguments.length) return domain.slice(); + domain = []; + for (var i = 0, n = _.length, d; i < n; ++i) if (d = _[i], d != null && !isNaN(d = +d)) domain.push(d); + domain.sort(ascending); + return rescale(); + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), rescale()) : range.slice(); + }; + + scale.quantiles = function() { + return thresholds.slice(); + }; + + scale.copy = function() { + return quantile$$1() + .domain(domain) + .range(range); + }; + + return scale; +} + +function quantize$1() { + var x0 = 0, + x1 = 1, + n = 1, + domain = [0.5], + range = [0, 1]; + + function scale(x) { + if (x <= x) return range[bisectRight(domain, x, 0, n)]; + } + + function rescale() { + var i = -1; + domain = new Array(n); + while (++i < n) domain[i] = ((i + 1) * x1 - (i - n) * x0) / (n + 1); + return scale; + } + + scale.domain = function(_) { + return arguments.length ? (x0 = +_[0], x1 = +_[1], rescale()) : [x0, x1]; + }; + + scale.range = function(_) { + return arguments.length ? (n = (range = slice$5.call(_)).length - 1, rescale()) : range.slice(); + }; + + scale.invertExtent = function(y) { + var i = range.indexOf(y); + return i < 0 ? [NaN, NaN] + : i < 1 ? [x0, domain[0]] + : i >= n ? [domain[n - 1], x1] + : [domain[i - 1], domain[i]]; + }; + + scale.copy = function() { + return quantize$1() + .domain([x0, x1]) + .range(range); + }; + + return linearish(scale); +} + +function threshold$1() { + var domain = [0.5], + range = [0, 1], + n = 1; + + function scale(x) { + if (x <= x) return range[bisectRight(domain, x, 0, n)]; + } + + scale.domain = function(_) { + return arguments.length ? (domain = slice$5.call(_), n = Math.min(domain.length, range.length - 1), scale) : domain.slice(); + }; + + scale.range = function(_) { + return arguments.length ? (range = slice$5.call(_), n = Math.min(domain.length, range.length - 1), scale) : range.slice(); + }; + + scale.invertExtent = function(y) { + var i = range.indexOf(y); + return [domain[i - 1], domain[i]]; + }; + + scale.copy = function() { + return threshold$1() + .domain(domain) + .range(range); + }; + + return scale; +} + +var t0$1 = new Date; +var t1$1 = new Date; + +function newInterval(floori, offseti, count, field) { + + function interval(date) { + return floori(date = new Date(+date)), date; + } + + interval.floor = interval; + + interval.ceil = function(date) { + return floori(date = new Date(date - 1)), offseti(date, 1), floori(date), date; + }; + + interval.round = function(date) { + var d0 = interval(date), + d1 = interval.ceil(date); + return date - d0 < d1 - date ? d0 : d1; + }; + + interval.offset = function(date, step) { + return offseti(date = new Date(+date), step == null ? 1 : Math.floor(step)), date; + }; + + interval.range = function(start, stop, step) { + var range = [], previous; + start = interval.ceil(start); + step = step == null ? 1 : Math.floor(step); + if (!(start < stop) || !(step > 0)) return range; // also handles Invalid Date + do range.push(previous = new Date(+start)), offseti(start, step), floori(start); + while (previous < start && start < stop); + return range; + }; + + interval.filter = function(test) { + return newInterval(function(date) { + if (date >= date) while (floori(date), !test(date)) date.setTime(date - 1); + }, function(date, step) { + if (date >= date) { + if (step < 0) while (++step <= 0) { + while (offseti(date, -1), !test(date)) {} // eslint-disable-line no-empty + } else while (--step >= 0) { + while (offseti(date, +1), !test(date)) {} // eslint-disable-line no-empty + } + } + }); + }; + + if (count) { + interval.count = function(start, end) { + t0$1.setTime(+start), t1$1.setTime(+end); + floori(t0$1), floori(t1$1); + return Math.floor(count(t0$1, t1$1)); + }; + + interval.every = function(step) { + step = Math.floor(step); + return !isFinite(step) || !(step > 0) ? null + : !(step > 1) ? interval + : interval.filter(field + ? function(d) { return field(d) % step === 0; } + : function(d) { return interval.count(0, d) % step === 0; }); + }; + } + + return interval; +} + +var millisecond = newInterval(function() { + // noop +}, function(date, step) { + date.setTime(+date + step); +}, function(start, end) { + return end - start; +}); + +// An optimized implementation for this simple case. +millisecond.every = function(k) { + k = Math.floor(k); + if (!isFinite(k) || !(k > 0)) return null; + if (!(k > 1)) return millisecond; + return newInterval(function(date) { + date.setTime(Math.floor(date / k) * k); + }, function(date, step) { + date.setTime(+date + step * k); + }, function(start, end) { + return (end - start) / k; + }); +}; + +var milliseconds = millisecond.range; + +var durationSecond$1 = 1e3; +var durationMinute$1 = 6e4; +var durationHour$1 = 36e5; +var durationDay$1 = 864e5; +var durationWeek$1 = 6048e5; + +var second = newInterval(function(date) { + date.setTime(Math.floor(date / durationSecond$1) * durationSecond$1); +}, function(date, step) { + date.setTime(+date + step * durationSecond$1); +}, function(start, end) { + return (end - start) / durationSecond$1; +}, function(date) { + return date.getUTCSeconds(); +}); + +var seconds = second.range; + +var minute = newInterval(function(date) { + date.setTime(Math.floor(date / durationMinute$1) * durationMinute$1); +}, function(date, step) { + date.setTime(+date + step * durationMinute$1); +}, function(start, end) { + return (end - start) / durationMinute$1; +}, function(date) { + return date.getMinutes(); +}); + +var minutes = minute.range; + +var hour = newInterval(function(date) { + var offset = date.getTimezoneOffset() * durationMinute$1 % durationHour$1; + if (offset < 0) offset += durationHour$1; + date.setTime(Math.floor((+date - offset) / durationHour$1) * durationHour$1 + offset); +}, function(date, step) { + date.setTime(+date + step * durationHour$1); +}, function(start, end) { + return (end - start) / durationHour$1; +}, function(date) { + return date.getHours(); +}); + +var hours = hour.range; + +var day = newInterval(function(date) { + date.setHours(0, 0, 0, 0); +}, function(date, step) { + date.setDate(date.getDate() + step); +}, function(start, end) { + return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute$1) / durationDay$1; +}, function(date) { + return date.getDate() - 1; +}); + +var days = day.range; + +function weekday(i) { + return newInterval(function(date) { + date.setDate(date.getDate() - (date.getDay() + 7 - i) % 7); + date.setHours(0, 0, 0, 0); + }, function(date, step) { + date.setDate(date.getDate() + step * 7); + }, function(start, end) { + return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute$1) / durationWeek$1; + }); +} + +var sunday = weekday(0); +var monday = weekday(1); +var tuesday = weekday(2); +var wednesday = weekday(3); +var thursday = weekday(4); +var friday = weekday(5); +var saturday = weekday(6); + +var sundays = sunday.range; +var mondays = monday.range; +var tuesdays = tuesday.range; +var wednesdays = wednesday.range; +var thursdays = thursday.range; +var fridays = friday.range; +var saturdays = saturday.range; + +var month = newInterval(function(date) { + date.setDate(1); + date.setHours(0, 0, 0, 0); +}, function(date, step) { + date.setMonth(date.getMonth() + step); +}, function(start, end) { + return end.getMonth() - start.getMonth() + (end.getFullYear() - start.getFullYear()) * 12; +}, function(date) { + return date.getMonth(); +}); + +var months = month.range; + +var year = newInterval(function(date) { + date.setMonth(0, 1); + date.setHours(0, 0, 0, 0); +}, function(date, step) { + date.setFullYear(date.getFullYear() + step); +}, function(start, end) { + return end.getFullYear() - start.getFullYear(); +}, function(date) { + return date.getFullYear(); +}); + +// An optimized implementation for this simple case. +year.every = function(k) { + return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : newInterval(function(date) { + date.setFullYear(Math.floor(date.getFullYear() / k) * k); + date.setMonth(0, 1); + date.setHours(0, 0, 0, 0); + }, function(date, step) { + date.setFullYear(date.getFullYear() + step * k); + }); +}; + +var years = year.range; + +var utcMinute = newInterval(function(date) { + date.setUTCSeconds(0, 0); +}, function(date, step) { + date.setTime(+date + step * durationMinute$1); +}, function(start, end) { + return (end - start) / durationMinute$1; +}, function(date) { + return date.getUTCMinutes(); +}); + +var utcMinutes = utcMinute.range; + +var utcHour = newInterval(function(date) { + date.setUTCMinutes(0, 0, 0); +}, function(date, step) { + date.setTime(+date + step * durationHour$1); +}, function(start, end) { + return (end - start) / durationHour$1; +}, function(date) { + return date.getUTCHours(); +}); + +var utcHours = utcHour.range; + +var utcDay = newInterval(function(date) { + date.setUTCHours(0, 0, 0, 0); +}, function(date, step) { + date.setUTCDate(date.getUTCDate() + step); +}, function(start, end) { + return (end - start) / durationDay$1; +}, function(date) { + return date.getUTCDate() - 1; +}); + +var utcDays = utcDay.range; + +function utcWeekday(i) { + return newInterval(function(date) { + date.setUTCDate(date.getUTCDate() - (date.getUTCDay() + 7 - i) % 7); + date.setUTCHours(0, 0, 0, 0); + }, function(date, step) { + date.setUTCDate(date.getUTCDate() + step * 7); + }, function(start, end) { + return (end - start) / durationWeek$1; + }); +} + +var utcSunday = utcWeekday(0); +var utcMonday = utcWeekday(1); +var utcTuesday = utcWeekday(2); +var utcWednesday = utcWeekday(3); +var utcThursday = utcWeekday(4); +var utcFriday = utcWeekday(5); +var utcSaturday = utcWeekday(6); + +var utcSundays = utcSunday.range; +var utcMondays = utcMonday.range; +var utcTuesdays = utcTuesday.range; +var utcWednesdays = utcWednesday.range; +var utcThursdays = utcThursday.range; +var utcFridays = utcFriday.range; +var utcSaturdays = utcSaturday.range; + +var utcMonth = newInterval(function(date) { + date.setUTCDate(1); + date.setUTCHours(0, 0, 0, 0); +}, function(date, step) { + date.setUTCMonth(date.getUTCMonth() + step); +}, function(start, end) { + return end.getUTCMonth() - start.getUTCMonth() + (end.getUTCFullYear() - start.getUTCFullYear()) * 12; +}, function(date) { + return date.getUTCMonth(); +}); + +var utcMonths = utcMonth.range; + +var utcYear = newInterval(function(date) { + date.setUTCMonth(0, 1); + date.setUTCHours(0, 0, 0, 0); +}, function(date, step) { + date.setUTCFullYear(date.getUTCFullYear() + step); +}, function(start, end) { + return end.getUTCFullYear() - start.getUTCFullYear(); +}, function(date) { + return date.getUTCFullYear(); +}); + +// An optimized implementation for this simple case. +utcYear.every = function(k) { + return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : newInterval(function(date) { + date.setUTCFullYear(Math.floor(date.getUTCFullYear() / k) * k); + date.setUTCMonth(0, 1); + date.setUTCHours(0, 0, 0, 0); + }, function(date, step) { + date.setUTCFullYear(date.getUTCFullYear() + step * k); + }); +}; + +var utcYears = utcYear.range; + +function localDate(d) { + if (0 <= d.y && d.y < 100) { + var date = new Date(-1, d.m, d.d, d.H, d.M, d.S, d.L); + date.setFullYear(d.y); + return date; + } + return new Date(d.y, d.m, d.d, d.H, d.M, d.S, d.L); +} + +function utcDate(d) { + if (0 <= d.y && d.y < 100) { + var date = new Date(Date.UTC(-1, d.m, d.d, d.H, d.M, d.S, d.L)); + date.setUTCFullYear(d.y); + return date; + } + return new Date(Date.UTC(d.y, d.m, d.d, d.H, d.M, d.S, d.L)); +} + +function newYear(y) { + return {y: y, m: 0, d: 1, H: 0, M: 0, S: 0, L: 0}; +} + +function formatLocale$1(locale) { + var locale_dateTime = locale.dateTime, + locale_date = locale.date, + locale_time = locale.time, + locale_periods = locale.periods, + locale_weekdays = locale.days, + locale_shortWeekdays = locale.shortDays, + locale_months = locale.months, + locale_shortMonths = locale.shortMonths; + + var periodRe = formatRe(locale_periods), + periodLookup = formatLookup(locale_periods), + weekdayRe = formatRe(locale_weekdays), + weekdayLookup = formatLookup(locale_weekdays), + shortWeekdayRe = formatRe(locale_shortWeekdays), + shortWeekdayLookup = formatLookup(locale_shortWeekdays), + monthRe = formatRe(locale_months), + monthLookup = formatLookup(locale_months), + shortMonthRe = formatRe(locale_shortMonths), + shortMonthLookup = formatLookup(locale_shortMonths); + + var formats = { + "a": formatShortWeekday, + "A": formatWeekday, + "b": formatShortMonth, + "B": formatMonth, + "c": null, + "d": formatDayOfMonth, + "e": formatDayOfMonth, + "f": formatMicroseconds, + "H": formatHour24, + "I": formatHour12, + "j": formatDayOfYear, + "L": formatMilliseconds, + "m": formatMonthNumber, + "M": formatMinutes, + "p": formatPeriod, + "Q": formatUnixTimestamp, + "s": formatUnixTimestampSeconds, + "S": formatSeconds, + "u": formatWeekdayNumberMonday, + "U": formatWeekNumberSunday, + "V": formatWeekNumberISO, + "w": formatWeekdayNumberSunday, + "W": formatWeekNumberMonday, + "x": null, + "X": null, + "y": formatYear, + "Y": formatFullYear, + "Z": formatZone, + "%": formatLiteralPercent + }; + + var utcFormats = { + "a": formatUTCShortWeekday, + "A": formatUTCWeekday, + "b": formatUTCShortMonth, + "B": formatUTCMonth, + "c": null, + "d": formatUTCDayOfMonth, + "e": formatUTCDayOfMonth, + "f": formatUTCMicroseconds, + "H": formatUTCHour24, + "I": formatUTCHour12, + "j": formatUTCDayOfYear, + "L": formatUTCMilliseconds, + "m": formatUTCMonthNumber, + "M": formatUTCMinutes, + "p": formatUTCPeriod, + "Q": formatUnixTimestamp, + "s": formatUnixTimestampSeconds, + "S": formatUTCSeconds, + "u": formatUTCWeekdayNumberMonday, + "U": formatUTCWeekNumberSunday, + "V": formatUTCWeekNumberISO, + "w": formatUTCWeekdayNumberSunday, + "W": formatUTCWeekNumberMonday, + "x": null, + "X": null, + "y": formatUTCYear, + "Y": formatUTCFullYear, + "Z": formatUTCZone, + "%": formatLiteralPercent + }; + + var parses = { + "a": parseShortWeekday, + "A": parseWeekday, + "b": parseShortMonth, + "B": parseMonth, + "c": parseLocaleDateTime, + "d": parseDayOfMonth, + "e": parseDayOfMonth, + "f": parseMicroseconds, + "H": parseHour24, + "I": parseHour24, + "j": parseDayOfYear, + "L": parseMilliseconds, + "m": parseMonthNumber, + "M": parseMinutes, + "p": parsePeriod, + "Q": parseUnixTimestamp, + "s": parseUnixTimestampSeconds, + "S": parseSeconds, + "u": parseWeekdayNumberMonday, + "U": parseWeekNumberSunday, + "V": parseWeekNumberISO, + "w": parseWeekdayNumberSunday, + "W": parseWeekNumberMonday, + "x": parseLocaleDate, + "X": parseLocaleTime, + "y": parseYear, + "Y": parseFullYear, + "Z": parseZone, + "%": parseLiteralPercent + }; + + // These recursive directive definitions must be deferred. + formats.x = newFormat(locale_date, formats); + formats.X = newFormat(locale_time, formats); + formats.c = newFormat(locale_dateTime, formats); + utcFormats.x = newFormat(locale_date, utcFormats); + utcFormats.X = newFormat(locale_time, utcFormats); + utcFormats.c = newFormat(locale_dateTime, utcFormats); + + function newFormat(specifier, formats) { + return function(date) { + var string = [], + i = -1, + j = 0, + n = specifier.length, + c, + pad, + format; + + if (!(date instanceof Date)) date = new Date(+date); + + while (++i < n) { + if (specifier.charCodeAt(i) === 37) { + string.push(specifier.slice(j, i)); + if ((pad = pads[c = specifier.charAt(++i)]) != null) c = specifier.charAt(++i); + else pad = c === "e" ? " " : "0"; + if (format = formats[c]) c = format(date, pad); + string.push(c); + j = i + 1; + } + } + + string.push(specifier.slice(j, i)); + return string.join(""); + }; + } + + function newParse(specifier, newDate) { + return function(string) { + var d = newYear(1900), + i = parseSpecifier(d, specifier, string += "", 0), + week, day$$1; + if (i != string.length) return null; + + // If a UNIX timestamp is specified, return it. + if ("Q" in d) return new Date(d.Q); + + // The am-pm flag is 0 for AM, and 1 for PM. + if ("p" in d) d.H = d.H % 12 + d.p * 12; + + // Convert day-of-week and week-of-year to day-of-year. + if ("V" in d) { + if (d.V < 1 || d.V > 53) return null; + if (!("w" in d)) d.w = 1; + if ("Z" in d) { + week = utcDate(newYear(d.y)), day$$1 = week.getUTCDay(); + week = day$$1 > 4 || day$$1 === 0 ? utcMonday.ceil(week) : utcMonday(week); + week = utcDay.offset(week, (d.V - 1) * 7); + d.y = week.getUTCFullYear(); + d.m = week.getUTCMonth(); + d.d = week.getUTCDate() + (d.w + 6) % 7; + } else { + week = newDate(newYear(d.y)), day$$1 = week.getDay(); + week = day$$1 > 4 || day$$1 === 0 ? monday.ceil(week) : monday(week); + week = day.offset(week, (d.V - 1) * 7); + d.y = week.getFullYear(); + d.m = week.getMonth(); + d.d = week.getDate() + (d.w + 6) % 7; + } + } else if ("W" in d || "U" in d) { + if (!("w" in d)) d.w = "u" in d ? d.u % 7 : "W" in d ? 1 : 0; + day$$1 = "Z" in d ? utcDate(newYear(d.y)).getUTCDay() : newDate(newYear(d.y)).getDay(); + d.m = 0; + d.d = "W" in d ? (d.w + 6) % 7 + d.W * 7 - (day$$1 + 5) % 7 : d.w + d.U * 7 - (day$$1 + 6) % 7; + } + + // If a time zone is specified, all fields are interpreted as UTC and then + // offset according to the specified time zone. + if ("Z" in d) { + d.H += d.Z / 100 | 0; + d.M += d.Z % 100; + return utcDate(d); + } + + // Otherwise, all fields are in local time. + return newDate(d); + }; + } + + function parseSpecifier(d, specifier, string, j) { + var i = 0, + n = specifier.length, + m = string.length, + c, + parse; + + while (i < n) { + if (j >= m) return -1; + c = specifier.charCodeAt(i++); + if (c === 37) { + c = specifier.charAt(i++); + parse = parses[c in pads ? specifier.charAt(i++) : c]; + if (!parse || ((j = parse(d, string, j)) < 0)) return -1; + } else if (c != string.charCodeAt(j++)) { + return -1; + } + } + + return j; + } + + function parsePeriod(d, string, i) { + var n = periodRe.exec(string.slice(i)); + return n ? (d.p = periodLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseShortWeekday(d, string, i) { + var n = shortWeekdayRe.exec(string.slice(i)); + return n ? (d.w = shortWeekdayLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseWeekday(d, string, i) { + var n = weekdayRe.exec(string.slice(i)); + return n ? (d.w = weekdayLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseShortMonth(d, string, i) { + var n = shortMonthRe.exec(string.slice(i)); + return n ? (d.m = shortMonthLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseMonth(d, string, i) { + var n = monthRe.exec(string.slice(i)); + return n ? (d.m = monthLookup[n[0].toLowerCase()], i + n[0].length) : -1; + } + + function parseLocaleDateTime(d, string, i) { + return parseSpecifier(d, locale_dateTime, string, i); + } + + function parseLocaleDate(d, string, i) { + return parseSpecifier(d, locale_date, string, i); + } + + function parseLocaleTime(d, string, i) { + return parseSpecifier(d, locale_time, string, i); + } + + function formatShortWeekday(d) { + return locale_shortWeekdays[d.getDay()]; + } + + function formatWeekday(d) { + return locale_weekdays[d.getDay()]; + } + + function formatShortMonth(d) { + return locale_shortMonths[d.getMonth()]; + } + + function formatMonth(d) { + return locale_months[d.getMonth()]; + } + + function formatPeriod(d) { + return locale_periods[+(d.getHours() >= 12)]; + } + + function formatUTCShortWeekday(d) { + return locale_shortWeekdays[d.getUTCDay()]; + } + + function formatUTCWeekday(d) { + return locale_weekdays[d.getUTCDay()]; + } + + function formatUTCShortMonth(d) { + return locale_shortMonths[d.getUTCMonth()]; + } + + function formatUTCMonth(d) { + return locale_months[d.getUTCMonth()]; + } + + function formatUTCPeriod(d) { + return locale_periods[+(d.getUTCHours() >= 12)]; + } + + return { + format: function(specifier) { + var f = newFormat(specifier += "", formats); + f.toString = function() { return specifier; }; + return f; + }, + parse: function(specifier) { + var p = newParse(specifier += "", localDate); + p.toString = function() { return specifier; }; + return p; + }, + utcFormat: function(specifier) { + var f = newFormat(specifier += "", utcFormats); + f.toString = function() { return specifier; }; + return f; + }, + utcParse: function(specifier) { + var p = newParse(specifier, utcDate); + p.toString = function() { return specifier; }; + return p; + } + }; +} + +var pads = {"-": "", "_": " ", "0": "0"}; +var numberRe = /^\s*\d+/; +var percentRe = /^%/; +var requoteRe = /[\\^$*+?|[\]().{}]/g; + +function pad(value, fill, width) { + var sign = value < 0 ? "-" : "", + string = (sign ? -value : value) + "", + length = string.length; + return sign + (length < width ? new Array(width - length + 1).join(fill) + string : string); +} + +function requote(s) { + return s.replace(requoteRe, "\\$&"); +} + +function formatRe(names) { + return new RegExp("^(?:" + names.map(requote).join("|") + ")", "i"); +} + +function formatLookup(names) { + var map = {}, i = -1, n = names.length; + while (++i < n) map[names[i].toLowerCase()] = i; + return map; +} + +function parseWeekdayNumberSunday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 1)); + return n ? (d.w = +n[0], i + n[0].length) : -1; +} + +function parseWeekdayNumberMonday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 1)); + return n ? (d.u = +n[0], i + n[0].length) : -1; +} + +function parseWeekNumberSunday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.U = +n[0], i + n[0].length) : -1; +} + +function parseWeekNumberISO(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.V = +n[0], i + n[0].length) : -1; +} + +function parseWeekNumberMonday(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.W = +n[0], i + n[0].length) : -1; +} + +function parseFullYear(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 4)); + return n ? (d.y = +n[0], i + n[0].length) : -1; +} + +function parseYear(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.y = +n[0] + (+n[0] > 68 ? 1900 : 2000), i + n[0].length) : -1; +} + +function parseZone(d, string, i) { + var n = /^(Z)|([+-]\d\d)(?::?(\d\d))?/.exec(string.slice(i, i + 6)); + return n ? (d.Z = n[1] ? 0 : -(n[2] + (n[3] || "00")), i + n[0].length) : -1; +} + +function parseMonthNumber(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.m = n[0] - 1, i + n[0].length) : -1; +} + +function parseDayOfMonth(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.d = +n[0], i + n[0].length) : -1; +} + +function parseDayOfYear(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 3)); + return n ? (d.m = 0, d.d = +n[0], i + n[0].length) : -1; +} + +function parseHour24(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.H = +n[0], i + n[0].length) : -1; +} + +function parseMinutes(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.M = +n[0], i + n[0].length) : -1; +} + +function parseSeconds(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 2)); + return n ? (d.S = +n[0], i + n[0].length) : -1; +} + +function parseMilliseconds(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 3)); + return n ? (d.L = +n[0], i + n[0].length) : -1; +} + +function parseMicroseconds(d, string, i) { + var n = numberRe.exec(string.slice(i, i + 6)); + return n ? (d.L = Math.floor(n[0] / 1000), i + n[0].length) : -1; +} + +function parseLiteralPercent(d, string, i) { + var n = percentRe.exec(string.slice(i, i + 1)); + return n ? i + n[0].length : -1; +} + +function parseUnixTimestamp(d, string, i) { + var n = numberRe.exec(string.slice(i)); + return n ? (d.Q = +n[0], i + n[0].length) : -1; +} + +function parseUnixTimestampSeconds(d, string, i) { + var n = numberRe.exec(string.slice(i)); + return n ? (d.Q = (+n[0]) * 1000, i + n[0].length) : -1; +} + +function formatDayOfMonth(d, p) { + return pad(d.getDate(), p, 2); +} + +function formatHour24(d, p) { + return pad(d.getHours(), p, 2); +} + +function formatHour12(d, p) { + return pad(d.getHours() % 12 || 12, p, 2); +} + +function formatDayOfYear(d, p) { + return pad(1 + day.count(year(d), d), p, 3); +} + +function formatMilliseconds(d, p) { + return pad(d.getMilliseconds(), p, 3); +} + +function formatMicroseconds(d, p) { + return formatMilliseconds(d, p) + "000"; +} + +function formatMonthNumber(d, p) { + return pad(d.getMonth() + 1, p, 2); +} + +function formatMinutes(d, p) { + return pad(d.getMinutes(), p, 2); +} + +function formatSeconds(d, p) { + return pad(d.getSeconds(), p, 2); +} + +function formatWeekdayNumberMonday(d) { + var day$$1 = d.getDay(); + return day$$1 === 0 ? 7 : day$$1; +} + +function formatWeekNumberSunday(d, p) { + return pad(sunday.count(year(d), d), p, 2); +} + +function formatWeekNumberISO(d, p) { + var day$$1 = d.getDay(); + d = (day$$1 >= 4 || day$$1 === 0) ? thursday(d) : thursday.ceil(d); + return pad(thursday.count(year(d), d) + (year(d).getDay() === 4), p, 2); +} + +function formatWeekdayNumberSunday(d) { + return d.getDay(); +} + +function formatWeekNumberMonday(d, p) { + return pad(monday.count(year(d), d), p, 2); +} + +function formatYear(d, p) { + return pad(d.getFullYear() % 100, p, 2); +} + +function formatFullYear(d, p) { + return pad(d.getFullYear() % 10000, p, 4); +} + +function formatZone(d) { + var z = d.getTimezoneOffset(); + return (z > 0 ? "-" : (z *= -1, "+")) + + pad(z / 60 | 0, "0", 2) + + pad(z % 60, "0", 2); +} + +function formatUTCDayOfMonth(d, p) { + return pad(d.getUTCDate(), p, 2); +} + +function formatUTCHour24(d, p) { + return pad(d.getUTCHours(), p, 2); +} + +function formatUTCHour12(d, p) { + return pad(d.getUTCHours() % 12 || 12, p, 2); +} + +function formatUTCDayOfYear(d, p) { + return pad(1 + utcDay.count(utcYear(d), d), p, 3); +} + +function formatUTCMilliseconds(d, p) { + return pad(d.getUTCMilliseconds(), p, 3); +} + +function formatUTCMicroseconds(d, p) { + return formatUTCMilliseconds(d, p) + "000"; +} + +function formatUTCMonthNumber(d, p) { + return pad(d.getUTCMonth() + 1, p, 2); +} + +function formatUTCMinutes(d, p) { + return pad(d.getUTCMinutes(), p, 2); +} + +function formatUTCSeconds(d, p) { + return pad(d.getUTCSeconds(), p, 2); +} + +function formatUTCWeekdayNumberMonday(d) { + var dow = d.getUTCDay(); + return dow === 0 ? 7 : dow; +} + +function formatUTCWeekNumberSunday(d, p) { + return pad(utcSunday.count(utcYear(d), d), p, 2); +} + +function formatUTCWeekNumberISO(d, p) { + var day$$1 = d.getUTCDay(); + d = (day$$1 >= 4 || day$$1 === 0) ? utcThursday(d) : utcThursday.ceil(d); + return pad(utcThursday.count(utcYear(d), d) + (utcYear(d).getUTCDay() === 4), p, 2); +} + +function formatUTCWeekdayNumberSunday(d) { + return d.getUTCDay(); +} + +function formatUTCWeekNumberMonday(d, p) { + return pad(utcMonday.count(utcYear(d), d), p, 2); +} + +function formatUTCYear(d, p) { + return pad(d.getUTCFullYear() % 100, p, 2); +} + +function formatUTCFullYear(d, p) { + return pad(d.getUTCFullYear() % 10000, p, 4); +} + +function formatUTCZone() { + return "+0000"; +} + +function formatLiteralPercent() { + return "%"; +} + +function formatUnixTimestamp(d) { + return +d; +} + +function formatUnixTimestampSeconds(d) { + return Math.floor(+d / 1000); +} + +var locale$1; + + + + + +defaultLocale$1({ + dateTime: "%x, %X", + date: "%-m/%-d/%Y", + time: "%-I:%M:%S %p", + periods: ["AM", "PM"], + days: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], + shortDays: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], + months: ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"], + shortMonths: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"] +}); + +function defaultLocale$1(definition) { + locale$1 = formatLocale$1(definition); + exports.timeFormat = locale$1.format; + exports.timeParse = locale$1.parse; + exports.utcFormat = locale$1.utcFormat; + exports.utcParse = locale$1.utcParse; + return locale$1; +} + +var isoSpecifier = "%Y-%m-%dT%H:%M:%S.%LZ"; + +function formatIsoNative(date) { + return date.toISOString(); +} + +var formatIso = Date.prototype.toISOString + ? formatIsoNative + : exports.utcFormat(isoSpecifier); + +function parseIsoNative(string) { + var date = new Date(string); + return isNaN(date) ? null : date; +} + +var parseIso = +new Date("2000-01-01T00:00:00.000Z") + ? parseIsoNative + : exports.utcParse(isoSpecifier); + +var durationSecond = 1000; +var durationMinute = durationSecond * 60; +var durationHour = durationMinute * 60; +var durationDay = durationHour * 24; +var durationWeek = durationDay * 7; +var durationMonth = durationDay * 30; +var durationYear = durationDay * 365; + +function date$1(t) { + return new Date(t); +} + +function number$3(t) { + return t instanceof Date ? +t : +new Date(+t); +} + +function calendar(year$$1, month$$1, week, day$$1, hour$$1, minute$$1, second$$1, millisecond$$1, format) { + var scale = continuous(deinterpolateLinear, reinterpolate), + invert = scale.invert, + domain = scale.domain; + + var formatMillisecond = format(".%L"), + formatSecond = format(":%S"), + formatMinute = format("%I:%M"), + formatHour = format("%I %p"), + formatDay = format("%a %d"), + formatWeek = format("%b %d"), + formatMonth = format("%B"), + formatYear = format("%Y"); + + var tickIntervals = [ + [second$$1, 1, durationSecond], + [second$$1, 5, 5 * durationSecond], + [second$$1, 15, 15 * durationSecond], + [second$$1, 30, 30 * durationSecond], + [minute$$1, 1, durationMinute], + [minute$$1, 5, 5 * durationMinute], + [minute$$1, 15, 15 * durationMinute], + [minute$$1, 30, 30 * durationMinute], + [ hour$$1, 1, durationHour ], + [ hour$$1, 3, 3 * durationHour ], + [ hour$$1, 6, 6 * durationHour ], + [ hour$$1, 12, 12 * durationHour ], + [ day$$1, 1, durationDay ], + [ day$$1, 2, 2 * durationDay ], + [ week, 1, durationWeek ], + [ month$$1, 1, durationMonth ], + [ month$$1, 3, 3 * durationMonth ], + [ year$$1, 1, durationYear ] + ]; + + function tickFormat(date) { + return (second$$1(date) < date ? formatMillisecond + : minute$$1(date) < date ? formatSecond + : hour$$1(date) < date ? formatMinute + : day$$1(date) < date ? formatHour + : month$$1(date) < date ? (week(date) < date ? formatDay : formatWeek) + : year$$1(date) < date ? formatMonth + : formatYear)(date); + } + + function tickInterval(interval, start, stop, step) { + if (interval == null) interval = 10; + + // If a desired tick count is specified, pick a reasonable tick interval + // based on the extent of the domain and a rough estimate of tick size. + // Otherwise, assume interval is already a time interval and use it. + if (typeof interval === "number") { + var target = Math.abs(stop - start) / interval, + i = bisector(function(i) { return i[2]; }).right(tickIntervals, target); + if (i === tickIntervals.length) { + step = tickStep(start / durationYear, stop / durationYear, interval); + interval = year$$1; + } else if (i) { + i = tickIntervals[target / tickIntervals[i - 1][2] < tickIntervals[i][2] / target ? i - 1 : i]; + step = i[1]; + interval = i[0]; + } else { + step = Math.max(tickStep(start, stop, interval), 1); + interval = millisecond$$1; + } + } + + return step == null ? interval : interval.every(step); + } + + scale.invert = function(y) { + return new Date(invert(y)); + }; + + scale.domain = function(_) { + return arguments.length ? domain(map$3.call(_, number$3)) : domain().map(date$1); + }; + + scale.ticks = function(interval, step) { + var d = domain(), + t0 = d[0], + t1 = d[d.length - 1], + r = t1 < t0, + t; + if (r) t = t0, t0 = t1, t1 = t; + t = tickInterval(interval, t0, t1, step); + t = t ? t.range(t0, t1 + 1) : []; // inclusive stop + return r ? t.reverse() : t; + }; + + scale.tickFormat = function(count, specifier) { + return specifier == null ? tickFormat : format(specifier); + }; + + scale.nice = function(interval, step) { + var d = domain(); + return (interval = tickInterval(interval, d[0], d[d.length - 1], step)) + ? domain(nice(d, interval)) + : scale; + }; + + scale.copy = function() { + return copy(scale, calendar(year$$1, month$$1, week, day$$1, hour$$1, minute$$1, second$$1, millisecond$$1, format)); + }; + + return scale; +} + +function time() { + return calendar(year, month, sunday, day, hour, minute, second, millisecond, exports.timeFormat).domain([new Date(2000, 0, 1), new Date(2000, 0, 2)]); +} + +function utcTime() { + return calendar(utcYear, utcMonth, utcSunday, utcDay, utcHour, utcMinute, second, millisecond, exports.utcFormat).domain([Date.UTC(2000, 0, 1), Date.UTC(2000, 0, 2)]); +} + +function colors(s) { + return s.match(/.{6}/g).map(function(x) { + return "#" + x; + }); +} + +var category10 = colors("1f77b4ff7f0e2ca02cd627289467bd8c564be377c27f7f7fbcbd2217becf"); + +var category20b = colors("393b795254a36b6ecf9c9ede6379398ca252b5cf6bcedb9c8c6d31bd9e39e7ba52e7cb94843c39ad494ad6616be7969c7b4173a55194ce6dbdde9ed6"); + +var category20c = colors("3182bd6baed69ecae1c6dbefe6550dfd8d3cfdae6bfdd0a231a35474c476a1d99bc7e9c0756bb19e9ac8bcbddcdadaeb636363969696bdbdbdd9d9d9"); + +var category20 = colors("1f77b4aec7e8ff7f0effbb782ca02c98df8ad62728ff98969467bdc5b0d58c564bc49c94e377c2f7b6d27f7f7fc7c7c7bcbd22dbdb8d17becf9edae5"); + +var cubehelix$3 = cubehelixLong(cubehelix(300, 0.5, 0.0), cubehelix(-240, 0.5, 1.0)); + +var warm = cubehelixLong(cubehelix(-100, 0.75, 0.35), cubehelix(80, 1.50, 0.8)); + +var cool = cubehelixLong(cubehelix(260, 0.75, 0.35), cubehelix(80, 1.50, 0.8)); + +var rainbow = cubehelix(); + +function rainbow$1(t) { + if (t < 0 || t > 1) t -= Math.floor(t); + var ts = Math.abs(t - 0.5); + rainbow.h = 360 * t - 100; + rainbow.s = 1.5 - 1.5 * ts; + rainbow.l = 0.8 - 0.9 * ts; + return rainbow + ""; +} + +function ramp(range) { + var n = range.length; + return function(t) { + return range[Math.max(0, Math.min(n - 1, Math.floor(t * n)))]; + }; +} + +var viridis = ramp(colors("44015444025645045745055946075a46085c460a5d460b5e470d60470e6147106347116447136548146748166848176948186a481a6c481b6d481c6e481d6f481f70482071482173482374482475482576482677482878482979472a7a472c7a472d7b472e7c472f7d46307e46327e46337f463480453581453781453882443983443a83443b84433d84433e85423f854240864241864142874144874045884046883f47883f48893e49893e4a893e4c8a3d4d8a3d4e8a3c4f8a3c508b3b518b3b528b3a538b3a548c39558c39568c38588c38598c375a8c375b8d365c8d365d8d355e8d355f8d34608d34618d33628d33638d32648e32658e31668e31678e31688e30698e306a8e2f6b8e2f6c8e2e6d8e2e6e8e2e6f8e2d708e2d718e2c718e2c728e2c738e2b748e2b758e2a768e2a778e2a788e29798e297a8e297b8e287c8e287d8e277e8e277f8e27808e26818e26828e26828e25838e25848e25858e24868e24878e23888e23898e238a8d228b8d228c8d228d8d218e8d218f8d21908d21918c20928c20928c20938c1f948c1f958b1f968b1f978b1f988b1f998a1f9a8a1e9b8a1e9c891e9d891f9e891f9f881fa0881fa1881fa1871fa28720a38620a48621a58521a68522a78522a88423a98324aa8325ab8225ac8226ad8127ad8128ae8029af7f2ab07f2cb17e2db27d2eb37c2fb47c31b57b32b67a34b67935b77937b87838b9773aba763bbb753dbc743fbc7340bd7242be7144bf7046c06f48c16e4ac16d4cc26c4ec36b50c46a52c56954c56856c66758c7655ac8645cc8635ec96260ca6063cb5f65cb5e67cc5c69cd5b6ccd5a6ece5870cf5773d05675d05477d1537ad1517cd2507fd34e81d34d84d44b86d54989d5488bd6468ed64590d74393d74195d84098d83e9bd93c9dd93ba0da39a2da37a5db36a8db34aadc32addc30b0dd2fb2dd2db5de2bb8de29bade28bddf26c0df25c2df23c5e021c8e020cae11fcde11dd0e11cd2e21bd5e21ad8e219dae319dde318dfe318e2e418e5e419e7e419eae51aece51befe51cf1e51df4e61ef6e620f8e621fbe723fde725")); + +var magma = ramp(colors("00000401000501010601010802010902020b02020d03030f03031204041405041606051806051a07061c08071e0907200a08220b09240c09260d0a290e0b2b100b2d110c2f120d31130d34140e36150e38160f3b180f3d19103f1a10421c10441d11471e114920114b21114e22115024125325125527125829115a2a115c2c115f2d11612f116331116533106734106936106b38106c390f6e3b0f703d0f713f0f72400f74420f75440f764510774710784910784a10794c117a4e117b4f127b51127c52137c54137d56147d57157e59157e5a167e5c167f5d177f5f187f601880621980641a80651a80671b80681c816a1c816b1d816d1d816e1e81701f81721f817320817521817621817822817922827b23827c23827e24828025828125818326818426818627818827818928818b29818c29818e2a81902a81912b81932b80942c80962c80982d80992d809b2e7f9c2e7f9e2f7fa02f7fa1307ea3307ea5317ea6317da8327daa337dab337cad347cae347bb0357bb2357bb3367ab5367ab73779b83779ba3878bc3978bd3977bf3a77c03a76c23b75c43c75c53c74c73d73c83e73ca3e72cc3f71cd4071cf4070d0416fd2426fd3436ed5446dd6456cd8456cd9466bdb476adc4869de4968df4a68e04c67e24d66e34e65e44f64e55064e75263e85362e95462ea5661eb5760ec5860ed5a5fee5b5eef5d5ef05f5ef1605df2625df2645cf3655cf4675cf4695cf56b5cf66c5cf66e5cf7705cf7725cf8745cf8765cf9785df9795df97b5dfa7d5efa7f5efa815ffb835ffb8560fb8761fc8961fc8a62fc8c63fc8e64fc9065fd9266fd9467fd9668fd9869fd9a6afd9b6bfe9d6cfe9f6dfea16efea36ffea571fea772fea973feaa74feac76feae77feb078feb27afeb47bfeb67cfeb77efeb97ffebb81febd82febf84fec185fec287fec488fec68afec88cfeca8dfecc8ffecd90fecf92fed194fed395fed597fed799fed89afdda9cfddc9efddea0fde0a1fde2a3fde3a5fde5a7fde7a9fde9aafdebacfcecaefceeb0fcf0b2fcf2b4fcf4b6fcf6b8fcf7b9fcf9bbfcfbbdfcfdbf")); + +var inferno = ramp(colors("00000401000501010601010802010a02020c02020e03021004031204031405041706041907051b08051d09061f0a07220b07240c08260d08290e092b10092d110a30120a32140b34150b37160b39180c3c190c3e1b0c411c0c431e0c451f0c48210c4a230c4c240c4f260c51280b53290b552b0b572d0b592f0a5b310a5c320a5e340a5f3609613809623909633b09643d09653e0966400a67420a68440a68450a69470b6a490b6a4a0c6b4c0c6b4d0d6c4f0d6c510e6c520e6d540f6d550f6d57106e59106e5a116e5c126e5d126e5f136e61136e62146e64156e65156e67166e69166e6a176e6c186e6d186e6f196e71196e721a6e741a6e751b6e771c6d781c6d7a1d6d7c1d6d7d1e6d7f1e6c801f6c82206c84206b85216b87216b88226a8a226a8c23698d23698f24699025689225689326679526679727669827669a28659b29649d29649f2a63a02a63a22b62a32c61a52c60a62d60a82e5fa92e5eab2f5ead305dae305cb0315bb1325ab3325ab43359b63458b73557b93556ba3655bc3754bd3853bf3952c03a51c13a50c33b4fc43c4ec63d4dc73e4cc83f4bca404acb4149cc4248ce4347cf4446d04545d24644d34743d44842d54a41d74b3fd84c3ed94d3dda4e3cdb503bdd513ade5238df5337e05536e15635e25734e35933e45a31e55c30e65d2fe75e2ee8602de9612bea632aeb6429eb6628ec6726ed6925ee6a24ef6c23ef6e21f06f20f1711ff1731df2741cf3761bf37819f47918f57b17f57d15f67e14f68013f78212f78410f8850ff8870ef8890cf98b0bf98c0af98e09fa9008fa9207fa9407fb9606fb9706fb9906fb9b06fb9d07fc9f07fca108fca309fca50afca60cfca80dfcaa0ffcac11fcae12fcb014fcb216fcb418fbb61afbb81dfbba1ffbbc21fbbe23fac026fac228fac42afac62df9c72ff9c932f9cb35f8cd37f8cf3af7d13df7d340f6d543f6d746f5d949f5db4cf4dd4ff4df53f4e156f3e35af3e55df2e661f2e865f2ea69f1ec6df1ed71f1ef75f1f179f2f27df2f482f3f586f3f68af4f88ef5f992f6fa96f8fb9af9fc9dfafda1fcffa4")); + +var plasma = ramp(colors("0d088710078813078916078a19068c1b068d1d068e20068f2206902406912605912805922a05932c05942e05952f059631059733059735049837049938049a3a049a3c049b3e049c3f049c41049d43039e44039e46039f48039f4903a04b03a14c02a14e02a25002a25102a35302a35502a45601a45801a45901a55b01a55c01a65e01a66001a66100a76300a76400a76600a76700a86900a86a00a86c00a86e00a86f00a87100a87201a87401a87501a87701a87801a87a02a87b02a87d03a87e03a88004a88104a78305a78405a78606a68707a68808a68a09a58b0aa58d0ba58e0ca48f0da4910ea3920fa39410a29511a19613a19814a099159f9a169f9c179e9d189d9e199da01a9ca11b9ba21d9aa31e9aa51f99a62098a72197a82296aa2395ab2494ac2694ad2793ae2892b02991b12a90b22b8fb32c8eb42e8db52f8cb6308bb7318ab83289ba3388bb3488bc3587bd3786be3885bf3984c03a83c13b82c23c81c33d80c43e7fc5407ec6417dc7427cc8437bc9447aca457acb4679cc4778cc4977cd4a76ce4b75cf4c74d04d73d14e72d24f71d35171d45270d5536fd5546ed6556dd7566cd8576bd9586ada5a6ada5b69db5c68dc5d67dd5e66de5f65de6164df6263e06363e16462e26561e26660e3685fe4695ee56a5de56b5de66c5ce76e5be76f5ae87059e97158e97257ea7457eb7556eb7655ec7754ed7953ed7a52ee7b51ef7c51ef7e50f07f4ff0804ef1814df1834cf2844bf3854bf3874af48849f48948f58b47f58c46f68d45f68f44f79044f79143f79342f89441f89540f9973ff9983ef99a3efa9b3dfa9c3cfa9e3bfb9f3afba139fba238fca338fca537fca636fca835fca934fdab33fdac33fdae32fdaf31fdb130fdb22ffdb42ffdb52efeb72dfeb82cfeba2cfebb2bfebd2afebe2afec029fdc229fdc328fdc527fdc627fdc827fdca26fdcb26fccd25fcce25fcd025fcd225fbd324fbd524fbd724fad824fada24f9dc24f9dd25f8df25f8e125f7e225f7e425f6e626f6e826f5e926f5eb27f4ed27f3ee27f3f027f2f227f1f426f1f525f0f724f0f921")); + +function sequential(interpolator) { + var x0 = 0, + x1 = 1, + clamp = false; + + function scale(x) { + var t = (x - x0) / (x1 - x0); + return interpolator(clamp ? Math.max(0, Math.min(1, t)) : t); + } + + scale.domain = function(_) { + return arguments.length ? (x0 = +_[0], x1 = +_[1], scale) : [x0, x1]; + }; + + scale.clamp = function(_) { + return arguments.length ? (clamp = !!_, scale) : clamp; + }; + + scale.interpolator = function(_) { + return arguments.length ? (interpolator = _, scale) : interpolator; + }; + + scale.copy = function() { + return sequential(interpolator).domain([x0, x1]).clamp(clamp); + }; + + return linearish(scale); +} + +function constant$10(x) { + return function constant() { + return x; + }; +} + +var abs$1 = Math.abs; +var atan2$1 = Math.atan2; +var cos$2 = Math.cos; +var max$2 = Math.max; +var min$1 = Math.min; +var sin$2 = Math.sin; +var sqrt$2 = Math.sqrt; + +var epsilon$3 = 1e-12; +var pi$4 = Math.PI; +var halfPi$3 = pi$4 / 2; +var tau$4 = 2 * pi$4; + +function acos$1(x) { + return x > 1 ? 0 : x < -1 ? pi$4 : Math.acos(x); +} + +function asin$1(x) { + return x >= 1 ? halfPi$3 : x <= -1 ? -halfPi$3 : Math.asin(x); +} + +function arcInnerRadius(d) { + return d.innerRadius; +} + +function arcOuterRadius(d) { + return d.outerRadius; +} + +function arcStartAngle(d) { + return d.startAngle; +} + +function arcEndAngle(d) { + return d.endAngle; +} + +function arcPadAngle(d) { + return d && d.padAngle; // Note: optional! +} + +function intersect(x0, y0, x1, y1, x2, y2, x3, y3) { + var x10 = x1 - x0, y10 = y1 - y0, + x32 = x3 - x2, y32 = y3 - y2, + t = (x32 * (y0 - y2) - y32 * (x0 - x2)) / (y32 * x10 - x32 * y10); + return [x0 + t * x10, y0 + t * y10]; +} + +// Compute perpendicular offset line of length rc. +// http://mathworld.wolfram.com/Circle-LineIntersection.html +function cornerTangents(x0, y0, x1, y1, r1, rc, cw) { + var x01 = x0 - x1, + y01 = y0 - y1, + lo = (cw ? rc : -rc) / sqrt$2(x01 * x01 + y01 * y01), + ox = lo * y01, + oy = -lo * x01, + x11 = x0 + ox, + y11 = y0 + oy, + x10 = x1 + ox, + y10 = y1 + oy, + x00 = (x11 + x10) / 2, + y00 = (y11 + y10) / 2, + dx = x10 - x11, + dy = y10 - y11, + d2 = dx * dx + dy * dy, + r = r1 - rc, + D = x11 * y10 - x10 * y11, + d = (dy < 0 ? -1 : 1) * sqrt$2(max$2(0, r * r * d2 - D * D)), + cx0 = (D * dy - dx * d) / d2, + cy0 = (-D * dx - dy * d) / d2, + cx1 = (D * dy + dx * d) / d2, + cy1 = (-D * dx + dy * d) / d2, + dx0 = cx0 - x00, + dy0 = cy0 - y00, + dx1 = cx1 - x00, + dy1 = cy1 - y00; + + // Pick the closer of the two intersection points. + // TODO Is there a faster way to determine which intersection to use? + if (dx0 * dx0 + dy0 * dy0 > dx1 * dx1 + dy1 * dy1) cx0 = cx1, cy0 = cy1; + + return { + cx: cx0, + cy: cy0, + x01: -ox, + y01: -oy, + x11: cx0 * (r1 / r - 1), + y11: cy0 * (r1 / r - 1) + }; +} + +function arc() { + var innerRadius = arcInnerRadius, + outerRadius = arcOuterRadius, + cornerRadius = constant$10(0), + padRadius = null, + startAngle = arcStartAngle, + endAngle = arcEndAngle, + padAngle = arcPadAngle, + context = null; + + function arc() { + var buffer, + r, + r0 = +innerRadius.apply(this, arguments), + r1 = +outerRadius.apply(this, arguments), + a0 = startAngle.apply(this, arguments) - halfPi$3, + a1 = endAngle.apply(this, arguments) - halfPi$3, + da = abs$1(a1 - a0), + cw = a1 > a0; + + if (!context) context = buffer = path(); + + // Ensure that the outer radius is always larger than the inner radius. + if (r1 < r0) r = r1, r1 = r0, r0 = r; + + // Is it a point? + if (!(r1 > epsilon$3)) context.moveTo(0, 0); + + // Or is it a circle or annulus? + else if (da > tau$4 - epsilon$3) { + context.moveTo(r1 * cos$2(a0), r1 * sin$2(a0)); + context.arc(0, 0, r1, a0, a1, !cw); + if (r0 > epsilon$3) { + context.moveTo(r0 * cos$2(a1), r0 * sin$2(a1)); + context.arc(0, 0, r0, a1, a0, cw); + } + } + + // Or is it a circular or annular sector? + else { + var a01 = a0, + a11 = a1, + a00 = a0, + a10 = a1, + da0 = da, + da1 = da, + ap = padAngle.apply(this, arguments) / 2, + rp = (ap > epsilon$3) && (padRadius ? +padRadius.apply(this, arguments) : sqrt$2(r0 * r0 + r1 * r1)), + rc = min$1(abs$1(r1 - r0) / 2, +cornerRadius.apply(this, arguments)), + rc0 = rc, + rc1 = rc, + t0, + t1; + + // Apply padding? Note that since r1 ≥ r0, da1 ≥ da0. + if (rp > epsilon$3) { + var p0 = asin$1(rp / r0 * sin$2(ap)), + p1 = asin$1(rp / r1 * sin$2(ap)); + if ((da0 -= p0 * 2) > epsilon$3) p0 *= (cw ? 1 : -1), a00 += p0, a10 -= p0; + else da0 = 0, a00 = a10 = (a0 + a1) / 2; + if ((da1 -= p1 * 2) > epsilon$3) p1 *= (cw ? 1 : -1), a01 += p1, a11 -= p1; + else da1 = 0, a01 = a11 = (a0 + a1) / 2; + } + + var x01 = r1 * cos$2(a01), + y01 = r1 * sin$2(a01), + x10 = r0 * cos$2(a10), + y10 = r0 * sin$2(a10); + + // Apply rounded corners? + if (rc > epsilon$3) { + var x11 = r1 * cos$2(a11), + y11 = r1 * sin$2(a11), + x00 = r0 * cos$2(a00), + y00 = r0 * sin$2(a00); + + // Restrict the corner radius according to the sector angle. + if (da < pi$4) { + var oc = da0 > epsilon$3 ? intersect(x01, y01, x00, y00, x11, y11, x10, y10) : [x10, y10], + ax = x01 - oc[0], + ay = y01 - oc[1], + bx = x11 - oc[0], + by = y11 - oc[1], + kc = 1 / sin$2(acos$1((ax * bx + ay * by) / (sqrt$2(ax * ax + ay * ay) * sqrt$2(bx * bx + by * by))) / 2), + lc = sqrt$2(oc[0] * oc[0] + oc[1] * oc[1]); + rc0 = min$1(rc, (r0 - lc) / (kc - 1)); + rc1 = min$1(rc, (r1 - lc) / (kc + 1)); + } + } + + // Is the sector collapsed to a line? + if (!(da1 > epsilon$3)) context.moveTo(x01, y01); + + // Does the sector’s outer ring have rounded corners? + else if (rc1 > epsilon$3) { + t0 = cornerTangents(x00, y00, x01, y01, r1, rc1, cw); + t1 = cornerTangents(x11, y11, x10, y10, r1, rc1, cw); + + context.moveTo(t0.cx + t0.x01, t0.cy + t0.y01); + + // Have the corners merged? + if (rc1 < rc) context.arc(t0.cx, t0.cy, rc1, atan2$1(t0.y01, t0.x01), atan2$1(t1.y01, t1.x01), !cw); + + // Otherwise, draw the two corners and the ring. + else { + context.arc(t0.cx, t0.cy, rc1, atan2$1(t0.y01, t0.x01), atan2$1(t0.y11, t0.x11), !cw); + context.arc(0, 0, r1, atan2$1(t0.cy + t0.y11, t0.cx + t0.x11), atan2$1(t1.cy + t1.y11, t1.cx + t1.x11), !cw); + context.arc(t1.cx, t1.cy, rc1, atan2$1(t1.y11, t1.x11), atan2$1(t1.y01, t1.x01), !cw); + } + } + + // Or is the outer ring just a circular arc? + else context.moveTo(x01, y01), context.arc(0, 0, r1, a01, a11, !cw); + + // Is there no inner ring, and it’s a circular sector? + // Or perhaps it’s an annular sector collapsed due to padding? + if (!(r0 > epsilon$3) || !(da0 > epsilon$3)) context.lineTo(x10, y10); + + // Does the sector’s inner ring (or point) have rounded corners? + else if (rc0 > epsilon$3) { + t0 = cornerTangents(x10, y10, x11, y11, r0, -rc0, cw); + t1 = cornerTangents(x01, y01, x00, y00, r0, -rc0, cw); + + context.lineTo(t0.cx + t0.x01, t0.cy + t0.y01); + + // Have the corners merged? + if (rc0 < rc) context.arc(t0.cx, t0.cy, rc0, atan2$1(t0.y01, t0.x01), atan2$1(t1.y01, t1.x01), !cw); + + // Otherwise, draw the two corners and the ring. + else { + context.arc(t0.cx, t0.cy, rc0, atan2$1(t0.y01, t0.x01), atan2$1(t0.y11, t0.x11), !cw); + context.arc(0, 0, r0, atan2$1(t0.cy + t0.y11, t0.cx + t0.x11), atan2$1(t1.cy + t1.y11, t1.cx + t1.x11), cw); + context.arc(t1.cx, t1.cy, rc0, atan2$1(t1.y11, t1.x11), atan2$1(t1.y01, t1.x01), !cw); + } + } + + // Or is the inner ring just a circular arc? + else context.arc(0, 0, r0, a10, a00, cw); + } + + context.closePath(); + + if (buffer) return context = null, buffer + "" || null; + } + + arc.centroid = function() { + var r = (+innerRadius.apply(this, arguments) + +outerRadius.apply(this, arguments)) / 2, + a = (+startAngle.apply(this, arguments) + +endAngle.apply(this, arguments)) / 2 - pi$4 / 2; + return [cos$2(a) * r, sin$2(a) * r]; + }; + + arc.innerRadius = function(_) { + return arguments.length ? (innerRadius = typeof _ === "function" ? _ : constant$10(+_), arc) : innerRadius; + }; + + arc.outerRadius = function(_) { + return arguments.length ? (outerRadius = typeof _ === "function" ? _ : constant$10(+_), arc) : outerRadius; + }; + + arc.cornerRadius = function(_) { + return arguments.length ? (cornerRadius = typeof _ === "function" ? _ : constant$10(+_), arc) : cornerRadius; + }; + + arc.padRadius = function(_) { + return arguments.length ? (padRadius = _ == null ? null : typeof _ === "function" ? _ : constant$10(+_), arc) : padRadius; + }; + + arc.startAngle = function(_) { + return arguments.length ? (startAngle = typeof _ === "function" ? _ : constant$10(+_), arc) : startAngle; + }; + + arc.endAngle = function(_) { + return arguments.length ? (endAngle = typeof _ === "function" ? _ : constant$10(+_), arc) : endAngle; + }; + + arc.padAngle = function(_) { + return arguments.length ? (padAngle = typeof _ === "function" ? _ : constant$10(+_), arc) : padAngle; + }; + + arc.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, arc) : context; + }; + + return arc; +} + +function Linear(context) { + this._context = context; +} + +Linear.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; // proceed + default: this._context.lineTo(x, y); break; + } + } +}; + +function curveLinear(context) { + return new Linear(context); +} + +function x$3(p) { + return p[0]; +} + +function y$3(p) { + return p[1]; +} + +function line() { + var x$$1 = x$3, + y$$1 = y$3, + defined = constant$10(true), + context = null, + curve = curveLinear, + output = null; + + function line(data) { + var i, + n = data.length, + d, + defined0 = false, + buffer; + + if (context == null) output = curve(buffer = path()); + + for (i = 0; i <= n; ++i) { + if (!(i < n && defined(d = data[i], i, data)) === defined0) { + if (defined0 = !defined0) output.lineStart(); + else output.lineEnd(); + } + if (defined0) output.point(+x$$1(d, i, data), +y$$1(d, i, data)); + } + + if (buffer) return output = null, buffer + "" || null; + } + + line.x = function(_) { + return arguments.length ? (x$$1 = typeof _ === "function" ? _ : constant$10(+_), line) : x$$1; + }; + + line.y = function(_) { + return arguments.length ? (y$$1 = typeof _ === "function" ? _ : constant$10(+_), line) : y$$1; + }; + + line.defined = function(_) { + return arguments.length ? (defined = typeof _ === "function" ? _ : constant$10(!!_), line) : defined; + }; + + line.curve = function(_) { + return arguments.length ? (curve = _, context != null && (output = curve(context)), line) : curve; + }; + + line.context = function(_) { + return arguments.length ? (_ == null ? context = output = null : output = curve(context = _), line) : context; + }; + + return line; +} + +function area$2() { + var x0 = x$3, + x1 = null, + y0 = constant$10(0), + y1 = y$3, + defined = constant$10(true), + context = null, + curve = curveLinear, + output = null; + + function area(data) { + var i, + j, + k, + n = data.length, + d, + defined0 = false, + buffer, + x0z = new Array(n), + y0z = new Array(n); + + if (context == null) output = curve(buffer = path()); + + for (i = 0; i <= n; ++i) { + if (!(i < n && defined(d = data[i], i, data)) === defined0) { + if (defined0 = !defined0) { + j = i; + output.areaStart(); + output.lineStart(); + } else { + output.lineEnd(); + output.lineStart(); + for (k = i - 1; k >= j; --k) { + output.point(x0z[k], y0z[k]); + } + output.lineEnd(); + output.areaEnd(); + } + } + if (defined0) { + x0z[i] = +x0(d, i, data), y0z[i] = +y0(d, i, data); + output.point(x1 ? +x1(d, i, data) : x0z[i], y1 ? +y1(d, i, data) : y0z[i]); + } + } + + if (buffer) return output = null, buffer + "" || null; + } + + function arealine() { + return line().defined(defined).curve(curve).context(context); + } + + area.x = function(_) { + return arguments.length ? (x0 = typeof _ === "function" ? _ : constant$10(+_), x1 = null, area) : x0; + }; + + area.x0 = function(_) { + return arguments.length ? (x0 = typeof _ === "function" ? _ : constant$10(+_), area) : x0; + }; + + area.x1 = function(_) { + return arguments.length ? (x1 = _ == null ? null : typeof _ === "function" ? _ : constant$10(+_), area) : x1; + }; + + area.y = function(_) { + return arguments.length ? (y0 = typeof _ === "function" ? _ : constant$10(+_), y1 = null, area) : y0; + }; + + area.y0 = function(_) { + return arguments.length ? (y0 = typeof _ === "function" ? _ : constant$10(+_), area) : y0; + }; + + area.y1 = function(_) { + return arguments.length ? (y1 = _ == null ? null : typeof _ === "function" ? _ : constant$10(+_), area) : y1; + }; + + area.lineX0 = + area.lineY0 = function() { + return arealine().x(x0).y(y0); + }; + + area.lineY1 = function() { + return arealine().x(x0).y(y1); + }; + + area.lineX1 = function() { + return arealine().x(x1).y(y0); + }; + + area.defined = function(_) { + return arguments.length ? (defined = typeof _ === "function" ? _ : constant$10(!!_), area) : defined; + }; + + area.curve = function(_) { + return arguments.length ? (curve = _, context != null && (output = curve(context)), area) : curve; + }; + + area.context = function(_) { + return arguments.length ? (_ == null ? context = output = null : output = curve(context = _), area) : context; + }; + + return area; +} + +function descending$1(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; +} + +function identity$7(d) { + return d; +} + +function pie() { + var value = identity$7, + sortValues = descending$1, + sort = null, + startAngle = constant$10(0), + endAngle = constant$10(tau$4), + padAngle = constant$10(0); + + function pie(data) { + var i, + n = data.length, + j, + k, + sum = 0, + index = new Array(n), + arcs = new Array(n), + a0 = +startAngle.apply(this, arguments), + da = Math.min(tau$4, Math.max(-tau$4, endAngle.apply(this, arguments) - a0)), + a1, + p = Math.min(Math.abs(da) / n, padAngle.apply(this, arguments)), + pa = p * (da < 0 ? -1 : 1), + v; + + for (i = 0; i < n; ++i) { + if ((v = arcs[index[i] = i] = +value(data[i], i, data)) > 0) { + sum += v; + } + } + + // Optionally sort the arcs by previously-computed values or by data. + if (sortValues != null) index.sort(function(i, j) { return sortValues(arcs[i], arcs[j]); }); + else if (sort != null) index.sort(function(i, j) { return sort(data[i], data[j]); }); + + // Compute the arcs! They are stored in the original data's order. + for (i = 0, k = sum ? (da - n * pa) / sum : 0; i < n; ++i, a0 = a1) { + j = index[i], v = arcs[j], a1 = a0 + (v > 0 ? v * k : 0) + pa, arcs[j] = { + data: data[j], + index: i, + value: v, + startAngle: a0, + endAngle: a1, + padAngle: p + }; + } + + return arcs; + } + + pie.value = function(_) { + return arguments.length ? (value = typeof _ === "function" ? _ : constant$10(+_), pie) : value; + }; + + pie.sortValues = function(_) { + return arguments.length ? (sortValues = _, sort = null, pie) : sortValues; + }; + + pie.sort = function(_) { + return arguments.length ? (sort = _, sortValues = null, pie) : sort; + }; + + pie.startAngle = function(_) { + return arguments.length ? (startAngle = typeof _ === "function" ? _ : constant$10(+_), pie) : startAngle; + }; + + pie.endAngle = function(_) { + return arguments.length ? (endAngle = typeof _ === "function" ? _ : constant$10(+_), pie) : endAngle; + }; + + pie.padAngle = function(_) { + return arguments.length ? (padAngle = typeof _ === "function" ? _ : constant$10(+_), pie) : padAngle; + }; + + return pie; +} + +var curveRadialLinear = curveRadial(curveLinear); + +function Radial(curve) { + this._curve = curve; +} + +Radial.prototype = { + areaStart: function() { + this._curve.areaStart(); + }, + areaEnd: function() { + this._curve.areaEnd(); + }, + lineStart: function() { + this._curve.lineStart(); + }, + lineEnd: function() { + this._curve.lineEnd(); + }, + point: function(a, r) { + this._curve.point(r * Math.sin(a), r * -Math.cos(a)); + } +}; + +function curveRadial(curve) { + + function radial(context) { + return new Radial(curve(context)); + } + + radial._curve = curve; + + return radial; +} + +function lineRadial(l) { + var c = l.curve; + + l.angle = l.x, delete l.x; + l.radius = l.y, delete l.y; + + l.curve = function(_) { + return arguments.length ? c(curveRadial(_)) : c()._curve; + }; + + return l; +} + +function lineRadial$1() { + return lineRadial(line().curve(curveRadialLinear)); +} + +function areaRadial() { + var a = area$2().curve(curveRadialLinear), + c = a.curve, + x0 = a.lineX0, + x1 = a.lineX1, + y0 = a.lineY0, + y1 = a.lineY1; + + a.angle = a.x, delete a.x; + a.startAngle = a.x0, delete a.x0; + a.endAngle = a.x1, delete a.x1; + a.radius = a.y, delete a.y; + a.innerRadius = a.y0, delete a.y0; + a.outerRadius = a.y1, delete a.y1; + a.lineStartAngle = function() { return lineRadial(x0()); }, delete a.lineX0; + a.lineEndAngle = function() { return lineRadial(x1()); }, delete a.lineX1; + a.lineInnerRadius = function() { return lineRadial(y0()); }, delete a.lineY0; + a.lineOuterRadius = function() { return lineRadial(y1()); }, delete a.lineY1; + + a.curve = function(_) { + return arguments.length ? c(curveRadial(_)) : c()._curve; + }; + + return a; +} + +function pointRadial(x, y) { + return [(y = +y) * Math.cos(x -= Math.PI / 2), y * Math.sin(x)]; +} + +var slice$6 = Array.prototype.slice; + +function linkSource(d) { + return d.source; +} + +function linkTarget(d) { + return d.target; +} + +function link$2(curve) { + var source = linkSource, + target = linkTarget, + x$$1 = x$3, + y$$1 = y$3, + context = null; + + function link() { + var buffer, argv = slice$6.call(arguments), s = source.apply(this, argv), t = target.apply(this, argv); + if (!context) context = buffer = path(); + curve(context, +x$$1.apply(this, (argv[0] = s, argv)), +y$$1.apply(this, argv), +x$$1.apply(this, (argv[0] = t, argv)), +y$$1.apply(this, argv)); + if (buffer) return context = null, buffer + "" || null; + } + + link.source = function(_) { + return arguments.length ? (source = _, link) : source; + }; + + link.target = function(_) { + return arguments.length ? (target = _, link) : target; + }; + + link.x = function(_) { + return arguments.length ? (x$$1 = typeof _ === "function" ? _ : constant$10(+_), link) : x$$1; + }; + + link.y = function(_) { + return arguments.length ? (y$$1 = typeof _ === "function" ? _ : constant$10(+_), link) : y$$1; + }; + + link.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, link) : context; + }; + + return link; +} + +function curveHorizontal(context, x0, y0, x1, y1) { + context.moveTo(x0, y0); + context.bezierCurveTo(x0 = (x0 + x1) / 2, y0, x0, y1, x1, y1); +} + +function curveVertical(context, x0, y0, x1, y1) { + context.moveTo(x0, y0); + context.bezierCurveTo(x0, y0 = (y0 + y1) / 2, x1, y0, x1, y1); +} + +function curveRadial$1(context, x0, y0, x1, y1) { + var p0 = pointRadial(x0, y0), + p1 = pointRadial(x0, y0 = (y0 + y1) / 2), + p2 = pointRadial(x1, y0), + p3 = pointRadial(x1, y1); + context.moveTo(p0[0], p0[1]); + context.bezierCurveTo(p1[0], p1[1], p2[0], p2[1], p3[0], p3[1]); +} + +function linkHorizontal() { + return link$2(curveHorizontal); +} + +function linkVertical() { + return link$2(curveVertical); +} + +function linkRadial() { + var l = link$2(curveRadial$1); + l.angle = l.x, delete l.x; + l.radius = l.y, delete l.y; + return l; +} + +var circle$2 = { + draw: function(context, size) { + var r = Math.sqrt(size / pi$4); + context.moveTo(r, 0); + context.arc(0, 0, r, 0, tau$4); + } +}; + +var cross$2 = { + draw: function(context, size) { + var r = Math.sqrt(size / 5) / 2; + context.moveTo(-3 * r, -r); + context.lineTo(-r, -r); + context.lineTo(-r, -3 * r); + context.lineTo(r, -3 * r); + context.lineTo(r, -r); + context.lineTo(3 * r, -r); + context.lineTo(3 * r, r); + context.lineTo(r, r); + context.lineTo(r, 3 * r); + context.lineTo(-r, 3 * r); + context.lineTo(-r, r); + context.lineTo(-3 * r, r); + context.closePath(); + } +}; + +var tan30 = Math.sqrt(1 / 3); +var tan30_2 = tan30 * 2; + +var diamond = { + draw: function(context, size) { + var y = Math.sqrt(size / tan30_2), + x = y * tan30; + context.moveTo(0, -y); + context.lineTo(x, 0); + context.lineTo(0, y); + context.lineTo(-x, 0); + context.closePath(); + } +}; + +var ka = 0.89081309152928522810; +var kr = Math.sin(pi$4 / 10) / Math.sin(7 * pi$4 / 10); +var kx = Math.sin(tau$4 / 10) * kr; +var ky = -Math.cos(tau$4 / 10) * kr; + +var star = { + draw: function(context, size) { + var r = Math.sqrt(size * ka), + x = kx * r, + y = ky * r; + context.moveTo(0, -r); + context.lineTo(x, y); + for (var i = 1; i < 5; ++i) { + var a = tau$4 * i / 5, + c = Math.cos(a), + s = Math.sin(a); + context.lineTo(s * r, -c * r); + context.lineTo(c * x - s * y, s * x + c * y); + } + context.closePath(); + } +}; + +var square = { + draw: function(context, size) { + var w = Math.sqrt(size), + x = -w / 2; + context.rect(x, x, w, w); + } +}; + +var sqrt3 = Math.sqrt(3); + +var triangle = { + draw: function(context, size) { + var y = -Math.sqrt(size / (sqrt3 * 3)); + context.moveTo(0, y * 2); + context.lineTo(-sqrt3 * y, -y); + context.lineTo(sqrt3 * y, -y); + context.closePath(); + } +}; + +var c = -0.5; +var s = Math.sqrt(3) / 2; +var k = 1 / Math.sqrt(12); +var a = (k / 2 + 1) * 3; + +var wye = { + draw: function(context, size) { + var r = Math.sqrt(size / a), + x0 = r / 2, + y0 = r * k, + x1 = x0, + y1 = r * k + r, + x2 = -x1, + y2 = y1; + context.moveTo(x0, y0); + context.lineTo(x1, y1); + context.lineTo(x2, y2); + context.lineTo(c * x0 - s * y0, s * x0 + c * y0); + context.lineTo(c * x1 - s * y1, s * x1 + c * y1); + context.lineTo(c * x2 - s * y2, s * x2 + c * y2); + context.lineTo(c * x0 + s * y0, c * y0 - s * x0); + context.lineTo(c * x1 + s * y1, c * y1 - s * x1); + context.lineTo(c * x2 + s * y2, c * y2 - s * x2); + context.closePath(); + } +}; + +var symbols = [ + circle$2, + cross$2, + diamond, + square, + star, + triangle, + wye +]; + +function symbol() { + var type = constant$10(circle$2), + size = constant$10(64), + context = null; + + function symbol() { + var buffer; + if (!context) context = buffer = path(); + type.apply(this, arguments).draw(context, +size.apply(this, arguments)); + if (buffer) return context = null, buffer + "" || null; + } + + symbol.type = function(_) { + return arguments.length ? (type = typeof _ === "function" ? _ : constant$10(_), symbol) : type; + }; + + symbol.size = function(_) { + return arguments.length ? (size = typeof _ === "function" ? _ : constant$10(+_), symbol) : size; + }; + + symbol.context = function(_) { + return arguments.length ? (context = _ == null ? null : _, symbol) : context; + }; + + return symbol; +} + +function noop$2() {} + +function point$2(that, x, y) { + that._context.bezierCurveTo( + (2 * that._x0 + that._x1) / 3, + (2 * that._y0 + that._y1) / 3, + (that._x0 + 2 * that._x1) / 3, + (that._y0 + 2 * that._y1) / 3, + (that._x0 + 4 * that._x1 + x) / 6, + (that._y0 + 4 * that._y1 + y) / 6 + ); +} + +function Basis(context) { + this._context = context; +} + +Basis.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = + this._y0 = this._y1 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 3: point$2(this, this._x1, this._y1); // proceed + case 2: this._context.lineTo(this._x1, this._y1); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; break; + case 2: this._point = 3; this._context.lineTo((5 * this._x0 + this._x1) / 6, (5 * this._y0 + this._y1) / 6); // proceed + default: point$2(this, x, y); break; + } + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + } +}; + +function basis$2(context) { + return new Basis(context); +} + +function BasisClosed(context) { + this._context = context; +} + +BasisClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._x0 = this._x1 = this._x2 = this._x3 = this._x4 = + this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 1: { + this._context.moveTo(this._x2, this._y2); + this._context.closePath(); + break; + } + case 2: { + this._context.moveTo((this._x2 + 2 * this._x3) / 3, (this._y2 + 2 * this._y3) / 3); + this._context.lineTo((this._x3 + 2 * this._x2) / 3, (this._y3 + 2 * this._y2) / 3); + this._context.closePath(); + break; + } + case 3: { + this.point(this._x2, this._y2); + this.point(this._x3, this._y3); + this.point(this._x4, this._y4); + break; + } + } + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._x2 = x, this._y2 = y; break; + case 1: this._point = 2; this._x3 = x, this._y3 = y; break; + case 2: this._point = 3; this._x4 = x, this._y4 = y; this._context.moveTo((this._x0 + 4 * this._x1 + x) / 6, (this._y0 + 4 * this._y1 + y) / 6); break; + default: point$2(this, x, y); break; + } + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + } +}; + +function basisClosed$1(context) { + return new BasisClosed(context); +} + +function BasisOpen(context) { + this._context = context; +} + +BasisOpen.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = + this._y0 = this._y1 = NaN; + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; break; + case 1: this._point = 2; break; + case 2: this._point = 3; var x0 = (this._x0 + 4 * this._x1 + x) / 6, y0 = (this._y0 + 4 * this._y1 + y) / 6; this._line ? this._context.lineTo(x0, y0) : this._context.moveTo(x0, y0); break; + case 3: this._point = 4; // proceed + default: point$2(this, x, y); break; + } + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + } +}; + +function basisOpen(context) { + return new BasisOpen(context); +} + +function Bundle(context, beta) { + this._basis = new Basis(context); + this._beta = beta; +} + +Bundle.prototype = { + lineStart: function() { + this._x = []; + this._y = []; + this._basis.lineStart(); + }, + lineEnd: function() { + var x = this._x, + y = this._y, + j = x.length - 1; + + if (j > 0) { + var x0 = x[0], + y0 = y[0], + dx = x[j] - x0, + dy = y[j] - y0, + i = -1, + t; + + while (++i <= j) { + t = i / j; + this._basis.point( + this._beta * x[i] + (1 - this._beta) * (x0 + t * dx), + this._beta * y[i] + (1 - this._beta) * (y0 + t * dy) + ); + } + } + + this._x = this._y = null; + this._basis.lineEnd(); + }, + point: function(x, y) { + this._x.push(+x); + this._y.push(+y); + } +}; + +var bundle = (function custom(beta) { + + function bundle(context) { + return beta === 1 ? new Basis(context) : new Bundle(context, beta); + } + + bundle.beta = function(beta) { + return custom(+beta); + }; + + return bundle; +})(0.85); + +function point$3(that, x, y) { + that._context.bezierCurveTo( + that._x1 + that._k * (that._x2 - that._x0), + that._y1 + that._k * (that._y2 - that._y0), + that._x2 + that._k * (that._x1 - x), + that._y2 + that._k * (that._y1 - y), + that._x2, + that._y2 + ); +} + +function Cardinal(context, tension) { + this._context = context; + this._k = (1 - tension) / 6; +} + +Cardinal.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 2: this._context.lineTo(this._x2, this._y2); break; + case 3: point$3(this, this._x1, this._y1); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; this._x1 = x, this._y1 = y; break; + case 2: this._point = 3; // proceed + default: point$3(this, x, y); break; + } + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var cardinal = (function custom(tension) { + + function cardinal(context) { + return new Cardinal(context, tension); + } + + cardinal.tension = function(tension) { + return custom(+tension); + }; + + return cardinal; +})(0); + +function CardinalClosed(context, tension) { + this._context = context; + this._k = (1 - tension) / 6; +} + +CardinalClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._x0 = this._x1 = this._x2 = this._x3 = this._x4 = this._x5 = + this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = this._y5 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 1: { + this._context.moveTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 2: { + this._context.lineTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 3: { + this.point(this._x3, this._y3); + this.point(this._x4, this._y4); + this.point(this._x5, this._y5); + break; + } + } + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._x3 = x, this._y3 = y; break; + case 1: this._point = 2; this._context.moveTo(this._x4 = x, this._y4 = y); break; + case 2: this._point = 3; this._x5 = x, this._y5 = y; break; + default: point$3(this, x, y); break; + } + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var cardinalClosed = (function custom(tension) { + + function cardinal$$1(context) { + return new CardinalClosed(context, tension); + } + + cardinal$$1.tension = function(tension) { + return custom(+tension); + }; + + return cardinal$$1; +})(0); + +function CardinalOpen(context, tension) { + this._context = context; + this._k = (1 - tension) / 6; +} + +CardinalOpen.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; break; + case 1: this._point = 2; break; + case 2: this._point = 3; this._line ? this._context.lineTo(this._x2, this._y2) : this._context.moveTo(this._x2, this._y2); break; + case 3: this._point = 4; // proceed + default: point$3(this, x, y); break; + } + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var cardinalOpen = (function custom(tension) { + + function cardinal$$1(context) { + return new CardinalOpen(context, tension); + } + + cardinal$$1.tension = function(tension) { + return custom(+tension); + }; + + return cardinal$$1; +})(0); + +function point$4(that, x, y) { + var x1 = that._x1, + y1 = that._y1, + x2 = that._x2, + y2 = that._y2; + + if (that._l01_a > epsilon$3) { + var a = 2 * that._l01_2a + 3 * that._l01_a * that._l12_a + that._l12_2a, + n = 3 * that._l01_a * (that._l01_a + that._l12_a); + x1 = (x1 * a - that._x0 * that._l12_2a + that._x2 * that._l01_2a) / n; + y1 = (y1 * a - that._y0 * that._l12_2a + that._y2 * that._l01_2a) / n; + } + + if (that._l23_a > epsilon$3) { + var b = 2 * that._l23_2a + 3 * that._l23_a * that._l12_a + that._l12_2a, + m = 3 * that._l23_a * (that._l23_a + that._l12_a); + x2 = (x2 * b + that._x1 * that._l23_2a - x * that._l12_2a) / m; + y2 = (y2 * b + that._y1 * that._l23_2a - y * that._l12_2a) / m; + } + + that._context.bezierCurveTo(x1, y1, x2, y2, that._x2, that._y2); +} + +function CatmullRom(context, alpha) { + this._context = context; + this._alpha = alpha; +} + +CatmullRom.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._l01_a = this._l12_a = this._l23_a = + this._l01_2a = this._l12_2a = this._l23_2a = + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 2: this._context.lineTo(this._x2, this._y2); break; + case 3: this.point(this._x2, this._y2); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + + if (this._point) { + var x23 = this._x2 - x, + y23 = this._y2 - y; + this._l23_a = Math.sqrt(this._l23_2a = Math.pow(x23 * x23 + y23 * y23, this._alpha)); + } + + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; break; + case 2: this._point = 3; // proceed + default: point$4(this, x, y); break; + } + + this._l01_a = this._l12_a, this._l12_a = this._l23_a; + this._l01_2a = this._l12_2a, this._l12_2a = this._l23_2a; + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var catmullRom = (function custom(alpha) { + + function catmullRom(context) { + return alpha ? new CatmullRom(context, alpha) : new Cardinal(context, 0); + } + + catmullRom.alpha = function(alpha) { + return custom(+alpha); + }; + + return catmullRom; +})(0.5); + +function CatmullRomClosed(context, alpha) { + this._context = context; + this._alpha = alpha; +} + +CatmullRomClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._x0 = this._x1 = this._x2 = this._x3 = this._x4 = this._x5 = + this._y0 = this._y1 = this._y2 = this._y3 = this._y4 = this._y5 = NaN; + this._l01_a = this._l12_a = this._l23_a = + this._l01_2a = this._l12_2a = this._l23_2a = + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 1: { + this._context.moveTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 2: { + this._context.lineTo(this._x3, this._y3); + this._context.closePath(); + break; + } + case 3: { + this.point(this._x3, this._y3); + this.point(this._x4, this._y4); + this.point(this._x5, this._y5); + break; + } + } + }, + point: function(x, y) { + x = +x, y = +y; + + if (this._point) { + var x23 = this._x2 - x, + y23 = this._y2 - y; + this._l23_a = Math.sqrt(this._l23_2a = Math.pow(x23 * x23 + y23 * y23, this._alpha)); + } + + switch (this._point) { + case 0: this._point = 1; this._x3 = x, this._y3 = y; break; + case 1: this._point = 2; this._context.moveTo(this._x4 = x, this._y4 = y); break; + case 2: this._point = 3; this._x5 = x, this._y5 = y; break; + default: point$4(this, x, y); break; + } + + this._l01_a = this._l12_a, this._l12_a = this._l23_a; + this._l01_2a = this._l12_2a, this._l12_2a = this._l23_2a; + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var catmullRomClosed = (function custom(alpha) { + + function catmullRom$$1(context) { + return alpha ? new CatmullRomClosed(context, alpha) : new CardinalClosed(context, 0); + } + + catmullRom$$1.alpha = function(alpha) { + return custom(+alpha); + }; + + return catmullRom$$1; +})(0.5); + +function CatmullRomOpen(context, alpha) { + this._context = context; + this._alpha = alpha; +} + +CatmullRomOpen.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = this._x2 = + this._y0 = this._y1 = this._y2 = NaN; + this._l01_a = this._l12_a = this._l23_a = + this._l01_2a = this._l12_2a = this._l23_2a = + this._point = 0; + }, + lineEnd: function() { + if (this._line || (this._line !== 0 && this._point === 3)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + + if (this._point) { + var x23 = this._x2 - x, + y23 = this._y2 - y; + this._l23_a = Math.sqrt(this._l23_2a = Math.pow(x23 * x23 + y23 * y23, this._alpha)); + } + + switch (this._point) { + case 0: this._point = 1; break; + case 1: this._point = 2; break; + case 2: this._point = 3; this._line ? this._context.lineTo(this._x2, this._y2) : this._context.moveTo(this._x2, this._y2); break; + case 3: this._point = 4; // proceed + default: point$4(this, x, y); break; + } + + this._l01_a = this._l12_a, this._l12_a = this._l23_a; + this._l01_2a = this._l12_2a, this._l12_2a = this._l23_2a; + this._x0 = this._x1, this._x1 = this._x2, this._x2 = x; + this._y0 = this._y1, this._y1 = this._y2, this._y2 = y; + } +}; + +var catmullRomOpen = (function custom(alpha) { + + function catmullRom$$1(context) { + return alpha ? new CatmullRomOpen(context, alpha) : new CardinalOpen(context, 0); + } + + catmullRom$$1.alpha = function(alpha) { + return custom(+alpha); + }; + + return catmullRom$$1; +})(0.5); + +function LinearClosed(context) { + this._context = context; +} + +LinearClosed.prototype = { + areaStart: noop$2, + areaEnd: noop$2, + lineStart: function() { + this._point = 0; + }, + lineEnd: function() { + if (this._point) this._context.closePath(); + }, + point: function(x, y) { + x = +x, y = +y; + if (this._point) this._context.lineTo(x, y); + else this._point = 1, this._context.moveTo(x, y); + } +}; + +function linearClosed(context) { + return new LinearClosed(context); +} + +function sign$1(x) { + return x < 0 ? -1 : 1; +} + +// Calculate the slopes of the tangents (Hermite-type interpolation) based on +// the following paper: Steffen, M. 1990. A Simple Method for Monotonic +// Interpolation in One Dimension. Astronomy and Astrophysics, Vol. 239, NO. +// NOV(II), P. 443, 1990. +function slope3(that, x2, y2) { + var h0 = that._x1 - that._x0, + h1 = x2 - that._x1, + s0 = (that._y1 - that._y0) / (h0 || h1 < 0 && -0), + s1 = (y2 - that._y1) / (h1 || h0 < 0 && -0), + p = (s0 * h1 + s1 * h0) / (h0 + h1); + return (sign$1(s0) + sign$1(s1)) * Math.min(Math.abs(s0), Math.abs(s1), 0.5 * Math.abs(p)) || 0; +} + +// Calculate a one-sided slope. +function slope2(that, t) { + var h = that._x1 - that._x0; + return h ? (3 * (that._y1 - that._y0) / h - t) / 2 : t; +} + +// According to https://en.wikipedia.org/wiki/Cubic_Hermite_spline#Representations +// "you can express cubic Hermite interpolation in terms of cubic Bézier curves +// with respect to the four values p0, p0 + m0 / 3, p1 - m1 / 3, p1". +function point$5(that, t0, t1) { + var x0 = that._x0, + y0 = that._y0, + x1 = that._x1, + y1 = that._y1, + dx = (x1 - x0) / 3; + that._context.bezierCurveTo(x0 + dx, y0 + dx * t0, x1 - dx, y1 - dx * t1, x1, y1); +} + +function MonotoneX(context) { + this._context = context; +} + +MonotoneX.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x0 = this._x1 = + this._y0 = this._y1 = + this._t0 = NaN; + this._point = 0; + }, + lineEnd: function() { + switch (this._point) { + case 2: this._context.lineTo(this._x1, this._y1); break; + case 3: point$5(this, this._t0, slope2(this, this._t0)); break; + } + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + this._line = 1 - this._line; + }, + point: function(x, y) { + var t1 = NaN; + + x = +x, y = +y; + if (x === this._x1 && y === this._y1) return; // Ignore coincident points. + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; break; + case 2: this._point = 3; point$5(this, slope2(this, t1 = slope3(this, x, y)), t1); break; + default: point$5(this, this._t0, t1 = slope3(this, x, y)); break; + } + + this._x0 = this._x1, this._x1 = x; + this._y0 = this._y1, this._y1 = y; + this._t0 = t1; + } +}; + +function MonotoneY(context) { + this._context = new ReflectContext(context); +} + +(MonotoneY.prototype = Object.create(MonotoneX.prototype)).point = function(x, y) { + MonotoneX.prototype.point.call(this, y, x); +}; + +function ReflectContext(context) { + this._context = context; +} + +ReflectContext.prototype = { + moveTo: function(x, y) { this._context.moveTo(y, x); }, + closePath: function() { this._context.closePath(); }, + lineTo: function(x, y) { this._context.lineTo(y, x); }, + bezierCurveTo: function(x1, y1, x2, y2, x, y) { this._context.bezierCurveTo(y1, x1, y2, x2, y, x); } +}; + +function monotoneX(context) { + return new MonotoneX(context); +} + +function monotoneY(context) { + return new MonotoneY(context); +} + +function Natural(context) { + this._context = context; +} + +Natural.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x = []; + this._y = []; + }, + lineEnd: function() { + var x = this._x, + y = this._y, + n = x.length; + + if (n) { + this._line ? this._context.lineTo(x[0], y[0]) : this._context.moveTo(x[0], y[0]); + if (n === 2) { + this._context.lineTo(x[1], y[1]); + } else { + var px = controlPoints(x), + py = controlPoints(y); + for (var i0 = 0, i1 = 1; i1 < n; ++i0, ++i1) { + this._context.bezierCurveTo(px[0][i0], py[0][i0], px[1][i0], py[1][i0], x[i1], y[i1]); + } + } + } + + if (this._line || (this._line !== 0 && n === 1)) this._context.closePath(); + this._line = 1 - this._line; + this._x = this._y = null; + }, + point: function(x, y) { + this._x.push(+x); + this._y.push(+y); + } +}; + +// See https://www.particleincell.com/2012/bezier-splines/ for derivation. +function controlPoints(x) { + var i, + n = x.length - 1, + m, + a = new Array(n), + b = new Array(n), + r = new Array(n); + a[0] = 0, b[0] = 2, r[0] = x[0] + 2 * x[1]; + for (i = 1; i < n - 1; ++i) a[i] = 1, b[i] = 4, r[i] = 4 * x[i] + 2 * x[i + 1]; + a[n - 1] = 2, b[n - 1] = 7, r[n - 1] = 8 * x[n - 1] + x[n]; + for (i = 1; i < n; ++i) m = a[i] / b[i - 1], b[i] -= m, r[i] -= m * r[i - 1]; + a[n - 1] = r[n - 1] / b[n - 1]; + for (i = n - 2; i >= 0; --i) a[i] = (r[i] - a[i + 1]) / b[i]; + b[n - 1] = (x[n] + a[n - 1]) / 2; + for (i = 0; i < n - 1; ++i) b[i] = 2 * x[i + 1] - a[i + 1]; + return [a, b]; +} + +function natural(context) { + return new Natural(context); +} + +function Step(context, t) { + this._context = context; + this._t = t; +} + +Step.prototype = { + areaStart: function() { + this._line = 0; + }, + areaEnd: function() { + this._line = NaN; + }, + lineStart: function() { + this._x = this._y = NaN; + this._point = 0; + }, + lineEnd: function() { + if (0 < this._t && this._t < 1 && this._point === 2) this._context.lineTo(this._x, this._y); + if (this._line || (this._line !== 0 && this._point === 1)) this._context.closePath(); + if (this._line >= 0) this._t = 1 - this._t, this._line = 1 - this._line; + }, + point: function(x, y) { + x = +x, y = +y; + switch (this._point) { + case 0: this._point = 1; this._line ? this._context.lineTo(x, y) : this._context.moveTo(x, y); break; + case 1: this._point = 2; // proceed + default: { + if (this._t <= 0) { + this._context.lineTo(this._x, y); + this._context.lineTo(x, y); + } else { + var x1 = this._x * (1 - this._t) + x * this._t; + this._context.lineTo(x1, this._y); + this._context.lineTo(x1, y); + } + break; + } + } + this._x = x, this._y = y; + } +}; + +function step(context) { + return new Step(context, 0.5); +} + +function stepBefore(context) { + return new Step(context, 0); +} + +function stepAfter(context) { + return new Step(context, 1); +} + +function none$1(series, order) { + if (!((n = series.length) > 1)) return; + for (var i = 1, j, s0, s1 = series[order[0]], n, m = s1.length; i < n; ++i) { + s0 = s1, s1 = series[order[i]]; + for (j = 0; j < m; ++j) { + s1[j][1] += s1[j][0] = isNaN(s0[j][1]) ? s0[j][0] : s0[j][1]; + } + } +} + +function none$2(series) { + var n = series.length, o = new Array(n); + while (--n >= 0) o[n] = n; + return o; +} + +function stackValue(d, key) { + return d[key]; +} + +function stack() { + var keys = constant$10([]), + order = none$2, + offset = none$1, + value = stackValue; + + function stack(data) { + var kz = keys.apply(this, arguments), + i, + m = data.length, + n = kz.length, + sz = new Array(n), + oz; + + for (i = 0; i < n; ++i) { + for (var ki = kz[i], si = sz[i] = new Array(m), j = 0, sij; j < m; ++j) { + si[j] = sij = [0, +value(data[j], ki, j, data)]; + sij.data = data[j]; + } + si.key = ki; + } + + for (i = 0, oz = order(sz); i < n; ++i) { + sz[oz[i]].index = i; + } + + offset(sz, oz); + return sz; + } + + stack.keys = function(_) { + return arguments.length ? (keys = typeof _ === "function" ? _ : constant$10(slice$6.call(_)), stack) : keys; + }; + + stack.value = function(_) { + return arguments.length ? (value = typeof _ === "function" ? _ : constant$10(+_), stack) : value; + }; + + stack.order = function(_) { + return arguments.length ? (order = _ == null ? none$2 : typeof _ === "function" ? _ : constant$10(slice$6.call(_)), stack) : order; + }; + + stack.offset = function(_) { + return arguments.length ? (offset = _ == null ? none$1 : _, stack) : offset; + }; + + return stack; +} + +function expand(series, order) { + if (!((n = series.length) > 0)) return; + for (var i, n, j = 0, m = series[0].length, y; j < m; ++j) { + for (y = i = 0; i < n; ++i) y += series[i][j][1] || 0; + if (y) for (i = 0; i < n; ++i) series[i][j][1] /= y; + } + none$1(series, order); +} + +function diverging(series, order) { + if (!((n = series.length) > 1)) return; + for (var i, j = 0, d, dy, yp, yn, n, m = series[order[0]].length; j < m; ++j) { + for (yp = yn = 0, i = 0; i < n; ++i) { + if ((dy = (d = series[order[i]][j])[1] - d[0]) >= 0) { + d[0] = yp, d[1] = yp += dy; + } else if (dy < 0) { + d[1] = yn, d[0] = yn += dy; + } else { + d[0] = yp; + } + } + } +} + +function silhouette(series, order) { + if (!((n = series.length) > 0)) return; + for (var j = 0, s0 = series[order[0]], n, m = s0.length; j < m; ++j) { + for (var i = 0, y = 0; i < n; ++i) y += series[i][j][1] || 0; + s0[j][1] += s0[j][0] = -y / 2; + } + none$1(series, order); +} + +function wiggle(series, order) { + if (!((n = series.length) > 0) || !((m = (s0 = series[order[0]]).length) > 0)) return; + for (var y = 0, j = 1, s0, m, n; j < m; ++j) { + for (var i = 0, s1 = 0, s2 = 0; i < n; ++i) { + var si = series[order[i]], + sij0 = si[j][1] || 0, + sij1 = si[j - 1][1] || 0, + s3 = (sij0 - sij1) / 2; + for (var k = 0; k < i; ++k) { + var sk = series[order[k]], + skj0 = sk[j][1] || 0, + skj1 = sk[j - 1][1] || 0; + s3 += skj0 - skj1; + } + s1 += sij0, s2 += s3 * sij0; + } + s0[j - 1][1] += s0[j - 1][0] = y; + if (s1) y -= s2 / s1; + } + s0[j - 1][1] += s0[j - 1][0] = y; + none$1(series, order); +} + +function ascending$2(series) { + var sums = series.map(sum$2); + return none$2(series).sort(function(a, b) { return sums[a] - sums[b]; }); +} + +function sum$2(series) { + var s = 0, i = -1, n = series.length, v; + while (++i < n) if (v = +series[i][1]) s += v; + return s; +} + +function descending$2(series) { + return ascending$2(series).reverse(); +} + +function insideOut(series) { + var n = series.length, + i, + j, + sums = series.map(sum$2), + order = none$2(series).sort(function(a, b) { return sums[b] - sums[a]; }), + top = 0, + bottom = 0, + tops = [], + bottoms = []; + + for (i = 0; i < n; ++i) { + j = order[i]; + if (top < bottom) { + top += sums[j]; + tops.push(j); + } else { + bottom += sums[j]; + bottoms.push(j); + } + } + + return bottoms.reverse().concat(tops); +} + +function reverse(series) { + return none$2(series).reverse(); +} + +function constant$11(x) { + return function() { + return x; + }; +} + +function x$4(d) { + return d[0]; +} + +function y$4(d) { + return d[1]; +} + +function RedBlackTree() { + this._ = null; // root node +} + +function RedBlackNode(node) { + node.U = // parent node + node.C = // color - true for red, false for black + node.L = // left node + node.R = // right node + node.P = // previous node + node.N = null; // next node +} + +RedBlackTree.prototype = { + constructor: RedBlackTree, + + insert: function(after, node) { + var parent, grandpa, uncle; + + if (after) { + node.P = after; + node.N = after.N; + if (after.N) after.N.P = node; + after.N = node; + if (after.R) { + after = after.R; + while (after.L) after = after.L; + after.L = node; + } else { + after.R = node; + } + parent = after; + } else if (this._) { + after = RedBlackFirst(this._); + node.P = null; + node.N = after; + after.P = after.L = node; + parent = after; + } else { + node.P = node.N = null; + this._ = node; + parent = null; + } + node.L = node.R = null; + node.U = parent; + node.C = true; + + after = node; + while (parent && parent.C) { + grandpa = parent.U; + if (parent === grandpa.L) { + uncle = grandpa.R; + if (uncle && uncle.C) { + parent.C = uncle.C = false; + grandpa.C = true; + after = grandpa; + } else { + if (after === parent.R) { + RedBlackRotateLeft(this, parent); + after = parent; + parent = after.U; + } + parent.C = false; + grandpa.C = true; + RedBlackRotateRight(this, grandpa); + } + } else { + uncle = grandpa.L; + if (uncle && uncle.C) { + parent.C = uncle.C = false; + grandpa.C = true; + after = grandpa; + } else { + if (after === parent.L) { + RedBlackRotateRight(this, parent); + after = parent; + parent = after.U; + } + parent.C = false; + grandpa.C = true; + RedBlackRotateLeft(this, grandpa); + } + } + parent = after.U; + } + this._.C = false; + }, + + remove: function(node) { + if (node.N) node.N.P = node.P; + if (node.P) node.P.N = node.N; + node.N = node.P = null; + + var parent = node.U, + sibling, + left = node.L, + right = node.R, + next, + red; + + if (!left) next = right; + else if (!right) next = left; + else next = RedBlackFirst(right); + + if (parent) { + if (parent.L === node) parent.L = next; + else parent.R = next; + } else { + this._ = next; + } + + if (left && right) { + red = next.C; + next.C = node.C; + next.L = left; + left.U = next; + if (next !== right) { + parent = next.U; + next.U = node.U; + node = next.R; + parent.L = node; + next.R = right; + right.U = next; + } else { + next.U = parent; + parent = next; + node = next.R; + } + } else { + red = node.C; + node = next; + } + + if (node) node.U = parent; + if (red) return; + if (node && node.C) { node.C = false; return; } + + do { + if (node === this._) break; + if (node === parent.L) { + sibling = parent.R; + if (sibling.C) { + sibling.C = false; + parent.C = true; + RedBlackRotateLeft(this, parent); + sibling = parent.R; + } + if ((sibling.L && sibling.L.C) + || (sibling.R && sibling.R.C)) { + if (!sibling.R || !sibling.R.C) { + sibling.L.C = false; + sibling.C = true; + RedBlackRotateRight(this, sibling); + sibling = parent.R; + } + sibling.C = parent.C; + parent.C = sibling.R.C = false; + RedBlackRotateLeft(this, parent); + node = this._; + break; + } + } else { + sibling = parent.L; + if (sibling.C) { + sibling.C = false; + parent.C = true; + RedBlackRotateRight(this, parent); + sibling = parent.L; + } + if ((sibling.L && sibling.L.C) + || (sibling.R && sibling.R.C)) { + if (!sibling.L || !sibling.L.C) { + sibling.R.C = false; + sibling.C = true; + RedBlackRotateLeft(this, sibling); + sibling = parent.L; + } + sibling.C = parent.C; + parent.C = sibling.L.C = false; + RedBlackRotateRight(this, parent); + node = this._; + break; + } + } + sibling.C = true; + node = parent; + parent = parent.U; + } while (!node.C); + + if (node) node.C = false; + } +}; + +function RedBlackRotateLeft(tree, node) { + var p = node, + q = node.R, + parent = p.U; + + if (parent) { + if (parent.L === p) parent.L = q; + else parent.R = q; + } else { + tree._ = q; + } + + q.U = parent; + p.U = q; + p.R = q.L; + if (p.R) p.R.U = p; + q.L = p; +} + +function RedBlackRotateRight(tree, node) { + var p = node, + q = node.L, + parent = p.U; + + if (parent) { + if (parent.L === p) parent.L = q; + else parent.R = q; + } else { + tree._ = q; + } + + q.U = parent; + p.U = q; + p.L = q.R; + if (p.L) p.L.U = p; + q.R = p; +} + +function RedBlackFirst(node) { + while (node.L) node = node.L; + return node; +} + +function createEdge(left, right, v0, v1) { + var edge = [null, null], + index = edges.push(edge) - 1; + edge.left = left; + edge.right = right; + if (v0) setEdgeEnd(edge, left, right, v0); + if (v1) setEdgeEnd(edge, right, left, v1); + cells[left.index].halfedges.push(index); + cells[right.index].halfedges.push(index); + return edge; +} + +function createBorderEdge(left, v0, v1) { + var edge = [v0, v1]; + edge.left = left; + return edge; +} + +function setEdgeEnd(edge, left, right, vertex) { + if (!edge[0] && !edge[1]) { + edge[0] = vertex; + edge.left = left; + edge.right = right; + } else if (edge.left === right) { + edge[1] = vertex; + } else { + edge[0] = vertex; + } +} + +// Liang–Barsky line clipping. +function clipEdge(edge, x0, y0, x1, y1) { + var a = edge[0], + b = edge[1], + ax = a[0], + ay = a[1], + bx = b[0], + by = b[1], + t0 = 0, + t1 = 1, + dx = bx - ax, + dy = by - ay, + r; + + r = x0 - ax; + if (!dx && r > 0) return; + r /= dx; + if (dx < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dx > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = x1 - ax; + if (!dx && r < 0) return; + r /= dx; + if (dx < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dx > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + r = y0 - ay; + if (!dy && r > 0) return; + r /= dy; + if (dy < 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } else if (dy > 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } + + r = y1 - ay; + if (!dy && r < 0) return; + r /= dy; + if (dy < 0) { + if (r > t1) return; + if (r > t0) t0 = r; + } else if (dy > 0) { + if (r < t0) return; + if (r < t1) t1 = r; + } + + if (!(t0 > 0) && !(t1 < 1)) return true; // TODO Better check? + + if (t0 > 0) edge[0] = [ax + t0 * dx, ay + t0 * dy]; + if (t1 < 1) edge[1] = [ax + t1 * dx, ay + t1 * dy]; + return true; +} + +function connectEdge(edge, x0, y0, x1, y1) { + var v1 = edge[1]; + if (v1) return true; + + var v0 = edge[0], + left = edge.left, + right = edge.right, + lx = left[0], + ly = left[1], + rx = right[0], + ry = right[1], + fx = (lx + rx) / 2, + fy = (ly + ry) / 2, + fm, + fb; + + if (ry === ly) { + if (fx < x0 || fx >= x1) return; + if (lx > rx) { + if (!v0) v0 = [fx, y0]; + else if (v0[1] >= y1) return; + v1 = [fx, y1]; + } else { + if (!v0) v0 = [fx, y1]; + else if (v0[1] < y0) return; + v1 = [fx, y0]; + } + } else { + fm = (lx - rx) / (ry - ly); + fb = fy - fm * fx; + if (fm < -1 || fm > 1) { + if (lx > rx) { + if (!v0) v0 = [(y0 - fb) / fm, y0]; + else if (v0[1] >= y1) return; + v1 = [(y1 - fb) / fm, y1]; + } else { + if (!v0) v0 = [(y1 - fb) / fm, y1]; + else if (v0[1] < y0) return; + v1 = [(y0 - fb) / fm, y0]; + } + } else { + if (ly < ry) { + if (!v0) v0 = [x0, fm * x0 + fb]; + else if (v0[0] >= x1) return; + v1 = [x1, fm * x1 + fb]; + } else { + if (!v0) v0 = [x1, fm * x1 + fb]; + else if (v0[0] < x0) return; + v1 = [x0, fm * x0 + fb]; + } + } + } + + edge[0] = v0; + edge[1] = v1; + return true; +} + +function clipEdges(x0, y0, x1, y1) { + var i = edges.length, + edge; + + while (i--) { + if (!connectEdge(edge = edges[i], x0, y0, x1, y1) + || !clipEdge(edge, x0, y0, x1, y1) + || !(Math.abs(edge[0][0] - edge[1][0]) > epsilon$4 + || Math.abs(edge[0][1] - edge[1][1]) > epsilon$4)) { + delete edges[i]; + } + } +} + +function createCell(site) { + return cells[site.index] = { + site: site, + halfedges: [] + }; +} + +function cellHalfedgeAngle(cell, edge) { + var site = cell.site, + va = edge.left, + vb = edge.right; + if (site === vb) vb = va, va = site; + if (vb) return Math.atan2(vb[1] - va[1], vb[0] - va[0]); + if (site === va) va = edge[1], vb = edge[0]; + else va = edge[0], vb = edge[1]; + return Math.atan2(va[0] - vb[0], vb[1] - va[1]); +} + +function cellHalfedgeStart(cell, edge) { + return edge[+(edge.left !== cell.site)]; +} + +function cellHalfedgeEnd(cell, edge) { + return edge[+(edge.left === cell.site)]; +} + +function sortCellHalfedges() { + for (var i = 0, n = cells.length, cell, halfedges, j, m; i < n; ++i) { + if ((cell = cells[i]) && (m = (halfedges = cell.halfedges).length)) { + var index = new Array(m), + array = new Array(m); + for (j = 0; j < m; ++j) index[j] = j, array[j] = cellHalfedgeAngle(cell, edges[halfedges[j]]); + index.sort(function(i, j) { return array[j] - array[i]; }); + for (j = 0; j < m; ++j) array[j] = halfedges[index[j]]; + for (j = 0; j < m; ++j) halfedges[j] = array[j]; + } + } +} + +function clipCells(x0, y0, x1, y1) { + var nCells = cells.length, + iCell, + cell, + site, + iHalfedge, + halfedges, + nHalfedges, + start, + startX, + startY, + end, + endX, + endY, + cover = true; + + for (iCell = 0; iCell < nCells; ++iCell) { + if (cell = cells[iCell]) { + site = cell.site; + halfedges = cell.halfedges; + iHalfedge = halfedges.length; + + // Remove any dangling clipped edges. + while (iHalfedge--) { + if (!edges[halfedges[iHalfedge]]) { + halfedges.splice(iHalfedge, 1); + } + } + + // Insert any border edges as necessary. + iHalfedge = 0, nHalfedges = halfedges.length; + while (iHalfedge < nHalfedges) { + end = cellHalfedgeEnd(cell, edges[halfedges[iHalfedge]]), endX = end[0], endY = end[1]; + start = cellHalfedgeStart(cell, edges[halfedges[++iHalfedge % nHalfedges]]), startX = start[0], startY = start[1]; + if (Math.abs(endX - startX) > epsilon$4 || Math.abs(endY - startY) > epsilon$4) { + halfedges.splice(iHalfedge, 0, edges.push(createBorderEdge(site, end, + Math.abs(endX - x0) < epsilon$4 && y1 - endY > epsilon$4 ? [x0, Math.abs(startX - x0) < epsilon$4 ? startY : y1] + : Math.abs(endY - y1) < epsilon$4 && x1 - endX > epsilon$4 ? [Math.abs(startY - y1) < epsilon$4 ? startX : x1, y1] + : Math.abs(endX - x1) < epsilon$4 && endY - y0 > epsilon$4 ? [x1, Math.abs(startX - x1) < epsilon$4 ? startY : y0] + : Math.abs(endY - y0) < epsilon$4 && endX - x0 > epsilon$4 ? [Math.abs(startY - y0) < epsilon$4 ? startX : x0, y0] + : null)) - 1); + ++nHalfedges; + } + } + + if (nHalfedges) cover = false; + } + } + + // If there weren’t any edges, have the closest site cover the extent. + // It doesn’t matter which corner of the extent we measure! + if (cover) { + var dx, dy, d2, dc = Infinity; + + for (iCell = 0, cover = null; iCell < nCells; ++iCell) { + if (cell = cells[iCell]) { + site = cell.site; + dx = site[0] - x0; + dy = site[1] - y0; + d2 = dx * dx + dy * dy; + if (d2 < dc) dc = d2, cover = cell; + } + } + + if (cover) { + var v00 = [x0, y0], v01 = [x0, y1], v11 = [x1, y1], v10 = [x1, y0]; + cover.halfedges.push( + edges.push(createBorderEdge(site = cover.site, v00, v01)) - 1, + edges.push(createBorderEdge(site, v01, v11)) - 1, + edges.push(createBorderEdge(site, v11, v10)) - 1, + edges.push(createBorderEdge(site, v10, v00)) - 1 + ); + } + } + + // Lastly delete any cells with no edges; these were entirely clipped. + for (iCell = 0; iCell < nCells; ++iCell) { + if (cell = cells[iCell]) { + if (!cell.halfedges.length) { + delete cells[iCell]; + } + } + } +} + +var circlePool = []; + +var firstCircle; + +function Circle() { + RedBlackNode(this); + this.x = + this.y = + this.arc = + this.site = + this.cy = null; +} + +function attachCircle(arc) { + var lArc = arc.P, + rArc = arc.N; + + if (!lArc || !rArc) return; + + var lSite = lArc.site, + cSite = arc.site, + rSite = rArc.site; + + if (lSite === rSite) return; + + var bx = cSite[0], + by = cSite[1], + ax = lSite[0] - bx, + ay = lSite[1] - by, + cx = rSite[0] - bx, + cy = rSite[1] - by; + + var d = 2 * (ax * cy - ay * cx); + if (d >= -epsilon2$2) return; + + var ha = ax * ax + ay * ay, + hc = cx * cx + cy * cy, + x = (cy * ha - ay * hc) / d, + y = (ax * hc - cx * ha) / d; + + var circle = circlePool.pop() || new Circle; + circle.arc = arc; + circle.site = cSite; + circle.x = x + bx; + circle.y = (circle.cy = y + by) + Math.sqrt(x * x + y * y); // y bottom + + arc.circle = circle; + + var before = null, + node = circles._; + + while (node) { + if (circle.y < node.y || (circle.y === node.y && circle.x <= node.x)) { + if (node.L) node = node.L; + else { before = node.P; break; } + } else { + if (node.R) node = node.R; + else { before = node; break; } + } + } + + circles.insert(before, circle); + if (!before) firstCircle = circle; +} + +function detachCircle(arc) { + var circle = arc.circle; + if (circle) { + if (!circle.P) firstCircle = circle.N; + circles.remove(circle); + circlePool.push(circle); + RedBlackNode(circle); + arc.circle = null; + } +} + +var beachPool = []; + +function Beach() { + RedBlackNode(this); + this.edge = + this.site = + this.circle = null; +} + +function createBeach(site) { + var beach = beachPool.pop() || new Beach; + beach.site = site; + return beach; +} + +function detachBeach(beach) { + detachCircle(beach); + beaches.remove(beach); + beachPool.push(beach); + RedBlackNode(beach); +} + +function removeBeach(beach) { + var circle = beach.circle, + x = circle.x, + y = circle.cy, + vertex = [x, y], + previous = beach.P, + next = beach.N, + disappearing = [beach]; + + detachBeach(beach); + + var lArc = previous; + while (lArc.circle + && Math.abs(x - lArc.circle.x) < epsilon$4 + && Math.abs(y - lArc.circle.cy) < epsilon$4) { + previous = lArc.P; + disappearing.unshift(lArc); + detachBeach(lArc); + lArc = previous; + } + + disappearing.unshift(lArc); + detachCircle(lArc); + + var rArc = next; + while (rArc.circle + && Math.abs(x - rArc.circle.x) < epsilon$4 + && Math.abs(y - rArc.circle.cy) < epsilon$4) { + next = rArc.N; + disappearing.push(rArc); + detachBeach(rArc); + rArc = next; + } + + disappearing.push(rArc); + detachCircle(rArc); + + var nArcs = disappearing.length, + iArc; + for (iArc = 1; iArc < nArcs; ++iArc) { + rArc = disappearing[iArc]; + lArc = disappearing[iArc - 1]; + setEdgeEnd(rArc.edge, lArc.site, rArc.site, vertex); + } + + lArc = disappearing[0]; + rArc = disappearing[nArcs - 1]; + rArc.edge = createEdge(lArc.site, rArc.site, null, vertex); + + attachCircle(lArc); + attachCircle(rArc); +} + +function addBeach(site) { + var x = site[0], + directrix = site[1], + lArc, + rArc, + dxl, + dxr, + node = beaches._; + + while (node) { + dxl = leftBreakPoint(node, directrix) - x; + if (dxl > epsilon$4) node = node.L; else { + dxr = x - rightBreakPoint(node, directrix); + if (dxr > epsilon$4) { + if (!node.R) { + lArc = node; + break; + } + node = node.R; + } else { + if (dxl > -epsilon$4) { + lArc = node.P; + rArc = node; + } else if (dxr > -epsilon$4) { + lArc = node; + rArc = node.N; + } else { + lArc = rArc = node; + } + break; + } + } + } + + createCell(site); + var newArc = createBeach(site); + beaches.insert(lArc, newArc); + + if (!lArc && !rArc) return; + + if (lArc === rArc) { + detachCircle(lArc); + rArc = createBeach(lArc.site); + beaches.insert(newArc, rArc); + newArc.edge = rArc.edge = createEdge(lArc.site, newArc.site); + attachCircle(lArc); + attachCircle(rArc); + return; + } + + if (!rArc) { // && lArc + newArc.edge = createEdge(lArc.site, newArc.site); + return; + } + + // else lArc !== rArc + detachCircle(lArc); + detachCircle(rArc); + + var lSite = lArc.site, + ax = lSite[0], + ay = lSite[1], + bx = site[0] - ax, + by = site[1] - ay, + rSite = rArc.site, + cx = rSite[0] - ax, + cy = rSite[1] - ay, + d = 2 * (bx * cy - by * cx), + hb = bx * bx + by * by, + hc = cx * cx + cy * cy, + vertex = [(cy * hb - by * hc) / d + ax, (bx * hc - cx * hb) / d + ay]; + + setEdgeEnd(rArc.edge, lSite, rSite, vertex); + newArc.edge = createEdge(lSite, site, null, vertex); + rArc.edge = createEdge(site, rSite, null, vertex); + attachCircle(lArc); + attachCircle(rArc); +} + +function leftBreakPoint(arc, directrix) { + var site = arc.site, + rfocx = site[0], + rfocy = site[1], + pby2 = rfocy - directrix; + + if (!pby2) return rfocx; + + var lArc = arc.P; + if (!lArc) return -Infinity; + + site = lArc.site; + var lfocx = site[0], + lfocy = site[1], + plby2 = lfocy - directrix; + + if (!plby2) return lfocx; + + var hl = lfocx - rfocx, + aby2 = 1 / pby2 - 1 / plby2, + b = hl / plby2; + + if (aby2) return (-b + Math.sqrt(b * b - 2 * aby2 * (hl * hl / (-2 * plby2) - lfocy + plby2 / 2 + rfocy - pby2 / 2))) / aby2 + rfocx; + + return (rfocx + lfocx) / 2; +} + +function rightBreakPoint(arc, directrix) { + var rArc = arc.N; + if (rArc) return leftBreakPoint(rArc, directrix); + var site = arc.site; + return site[1] === directrix ? site[0] : Infinity; +} + +var epsilon$4 = 1e-6; +var epsilon2$2 = 1e-12; +var beaches; +var cells; +var circles; +var edges; + +function triangleArea(a, b, c) { + return (a[0] - c[0]) * (b[1] - a[1]) - (a[0] - b[0]) * (c[1] - a[1]); +} + +function lexicographic(a, b) { + return b[1] - a[1] + || b[0] - a[0]; +} + +function Diagram(sites, extent) { + var site = sites.sort(lexicographic).pop(), + x, + y, + circle; + + edges = []; + cells = new Array(sites.length); + beaches = new RedBlackTree; + circles = new RedBlackTree; + + while (true) { + circle = firstCircle; + if (site && (!circle || site[1] < circle.y || (site[1] === circle.y && site[0] < circle.x))) { + if (site[0] !== x || site[1] !== y) { + addBeach(site); + x = site[0], y = site[1]; + } + site = sites.pop(); + } else if (circle) { + removeBeach(circle.arc); + } else { + break; + } + } + + sortCellHalfedges(); + + if (extent) { + var x0 = +extent[0][0], + y0 = +extent[0][1], + x1 = +extent[1][0], + y1 = +extent[1][1]; + clipEdges(x0, y0, x1, y1); + clipCells(x0, y0, x1, y1); + } + + this.edges = edges; + this.cells = cells; + + beaches = + circles = + edges = + cells = null; +} + +Diagram.prototype = { + constructor: Diagram, + + polygons: function() { + var edges = this.edges; + + return this.cells.map(function(cell) { + var polygon = cell.halfedges.map(function(i) { return cellHalfedgeStart(cell, edges[i]); }); + polygon.data = cell.site.data; + return polygon; + }); + }, + + triangles: function() { + var triangles = [], + edges = this.edges; + + this.cells.forEach(function(cell, i) { + if (!(m = (halfedges = cell.halfedges).length)) return; + var site = cell.site, + halfedges, + j = -1, + m, + s0, + e1 = edges[halfedges[m - 1]], + s1 = e1.left === site ? e1.right : e1.left; + + while (++j < m) { + s0 = s1; + e1 = edges[halfedges[j]]; + s1 = e1.left === site ? e1.right : e1.left; + if (s0 && s1 && i < s0.index && i < s1.index && triangleArea(site, s0, s1) < 0) { + triangles.push([site.data, s0.data, s1.data]); + } + } + }); + + return triangles; + }, + + links: function() { + return this.edges.filter(function(edge) { + return edge.right; + }).map(function(edge) { + return { + source: edge.left.data, + target: edge.right.data + }; + }); + }, + + find: function(x, y, radius) { + var that = this, i0, i1 = that._found || 0, n = that.cells.length, cell; + + // Use the previously-found cell, or start with an arbitrary one. + while (!(cell = that.cells[i1])) if (++i1 >= n) return null; + var dx = x - cell.site[0], dy = y - cell.site[1], d2 = dx * dx + dy * dy; + + // Traverse the half-edges to find a closer cell, if any. + do { + cell = that.cells[i0 = i1], i1 = null; + cell.halfedges.forEach(function(e) { + var edge = that.edges[e], v = edge.left; + if ((v === cell.site || !v) && !(v = edge.right)) return; + var vx = x - v[0], vy = y - v[1], v2 = vx * vx + vy * vy; + if (v2 < d2) d2 = v2, i1 = v.index; + }); + } while (i1 !== null); + + that._found = i0; + + return radius == null || d2 <= radius * radius ? cell.site : null; + } +}; + +function voronoi() { + var x$$1 = x$4, + y$$1 = y$4, + extent = null; + + function voronoi(data) { + return new Diagram(data.map(function(d, i) { + var s = [Math.round(x$$1(d, i, data) / epsilon$4) * epsilon$4, Math.round(y$$1(d, i, data) / epsilon$4) * epsilon$4]; + s.index = i; + s.data = d; + return s; + }), extent); + } + + voronoi.polygons = function(data) { + return voronoi(data).polygons(); + }; + + voronoi.links = function(data) { + return voronoi(data).links(); + }; + + voronoi.triangles = function(data) { + return voronoi(data).triangles(); + }; + + voronoi.x = function(_) { + return arguments.length ? (x$$1 = typeof _ === "function" ? _ : constant$11(+_), voronoi) : x$$1; + }; + + voronoi.y = function(_) { + return arguments.length ? (y$$1 = typeof _ === "function" ? _ : constant$11(+_), voronoi) : y$$1; + }; + + voronoi.extent = function(_) { + return arguments.length ? (extent = _ == null ? null : [[+_[0][0], +_[0][1]], [+_[1][0], +_[1][1]]], voronoi) : extent && [[extent[0][0], extent[0][1]], [extent[1][0], extent[1][1]]]; + }; + + voronoi.size = function(_) { + return arguments.length ? (extent = _ == null ? null : [[0, 0], [+_[0], +_[1]]], voronoi) : extent && [extent[1][0] - extent[0][0], extent[1][1] - extent[0][1]]; + }; + + return voronoi; +} + +function constant$12(x) { + return function() { + return x; + }; +} + +function ZoomEvent(target, type, transform) { + this.target = target; + this.type = type; + this.transform = transform; +} + +function Transform(k, x, y) { + this.k = k; + this.x = x; + this.y = y; +} + +Transform.prototype = { + constructor: Transform, + scale: function(k) { + return k === 1 ? this : new Transform(this.k * k, this.x, this.y); + }, + translate: function(x, y) { + return x === 0 & y === 0 ? this : new Transform(this.k, this.x + this.k * x, this.y + this.k * y); + }, + apply: function(point) { + return [point[0] * this.k + this.x, point[1] * this.k + this.y]; + }, + applyX: function(x) { + return x * this.k + this.x; + }, + applyY: function(y) { + return y * this.k + this.y; + }, + invert: function(location) { + return [(location[0] - this.x) / this.k, (location[1] - this.y) / this.k]; + }, + invertX: function(x) { + return (x - this.x) / this.k; + }, + invertY: function(y) { + return (y - this.y) / this.k; + }, + rescaleX: function(x) { + return x.copy().domain(x.range().map(this.invertX, this).map(x.invert, x)); + }, + rescaleY: function(y) { + return y.copy().domain(y.range().map(this.invertY, this).map(y.invert, y)); + }, + toString: function() { + return "translate(" + this.x + "," + this.y + ") scale(" + this.k + ")"; + } +}; + +var identity$8 = new Transform(1, 0, 0); + +transform$1.prototype = Transform.prototype; + +function transform$1(node) { + return node.__zoom || identity$8; +} + +function nopropagation$2() { + exports.event.stopImmediatePropagation(); +} + +function noevent$2() { + exports.event.preventDefault(); + exports.event.stopImmediatePropagation(); +} + +// Ignore right-click, since that should open the context menu. +function defaultFilter$2() { + return !exports.event.button; +} + +function defaultExtent$1() { + var e = this, w, h; + if (e instanceof SVGElement) { + e = e.ownerSVGElement || e; + w = e.width.baseVal.value; + h = e.height.baseVal.value; + } else { + w = e.clientWidth; + h = e.clientHeight; + } + return [[0, 0], [w, h]]; +} + +function defaultTransform() { + return this.__zoom || identity$8; +} + +function defaultWheelDelta() { + return -exports.event.deltaY * (exports.event.deltaMode ? 120 : 1) / 500; +} + +function defaultTouchable$1() { + return "ontouchstart" in this; +} + +function defaultConstrain(transform$$1, extent, translateExtent) { + var dx0 = transform$$1.invertX(extent[0][0]) - translateExtent[0][0], + dx1 = transform$$1.invertX(extent[1][0]) - translateExtent[1][0], + dy0 = transform$$1.invertY(extent[0][1]) - translateExtent[0][1], + dy1 = transform$$1.invertY(extent[1][1]) - translateExtent[1][1]; + return transform$$1.translate( + dx1 > dx0 ? (dx0 + dx1) / 2 : Math.min(0, dx0) || Math.max(0, dx1), + dy1 > dy0 ? (dy0 + dy1) / 2 : Math.min(0, dy0) || Math.max(0, dy1) + ); +} + +function zoom() { + var filter = defaultFilter$2, + extent = defaultExtent$1, + constrain = defaultConstrain, + wheelDelta = defaultWheelDelta, + touchable = defaultTouchable$1, + scaleExtent = [0, Infinity], + translateExtent = [[-Infinity, -Infinity], [Infinity, Infinity]], + duration = 250, + interpolate = interpolateZoom, + gestures = [], + listeners = dispatch("start", "zoom", "end"), + touchstarting, + touchending, + touchDelay = 500, + wheelDelay = 150, + clickDistance2 = 0; + + function zoom(selection) { + selection + .property("__zoom", defaultTransform) + .on("wheel.zoom", wheeled) + .on("mousedown.zoom", mousedowned) + .on("dblclick.zoom", dblclicked) + .filter(touchable) + .on("touchstart.zoom", touchstarted) + .on("touchmove.zoom", touchmoved) + .on("touchend.zoom touchcancel.zoom", touchended) + .style("touch-action", "none") + .style("-webkit-tap-highlight-color", "rgba(0,0,0,0)"); + } + + zoom.transform = function(collection, transform$$1) { + var selection = collection.selection ? collection.selection() : collection; + selection.property("__zoom", defaultTransform); + if (collection !== selection) { + schedule(collection, transform$$1); + } else { + selection.interrupt().each(function() { + gesture(this, arguments) + .start() + .zoom(null, typeof transform$$1 === "function" ? transform$$1.apply(this, arguments) : transform$$1) + .end(); + }); + } + }; + + zoom.scaleBy = function(selection, k) { + zoom.scaleTo(selection, function() { + var k0 = this.__zoom.k, + k1 = typeof k === "function" ? k.apply(this, arguments) : k; + return k0 * k1; + }); + }; + + zoom.scaleTo = function(selection, k) { + zoom.transform(selection, function() { + var e = extent.apply(this, arguments), + t0 = this.__zoom, + p0 = centroid(e), + p1 = t0.invert(p0), + k1 = typeof k === "function" ? k.apply(this, arguments) : k; + return constrain(translate(scale(t0, k1), p0, p1), e, translateExtent); + }); + }; + + zoom.translateBy = function(selection, x, y) { + zoom.transform(selection, function() { + return constrain(this.__zoom.translate( + typeof x === "function" ? x.apply(this, arguments) : x, + typeof y === "function" ? y.apply(this, arguments) : y + ), extent.apply(this, arguments), translateExtent); + }); + }; + + zoom.translateTo = function(selection, x, y) { + zoom.transform(selection, function() { + var e = extent.apply(this, arguments), + t = this.__zoom, + p = centroid(e); + return constrain(identity$8.translate(p[0], p[1]).scale(t.k).translate( + typeof x === "function" ? -x.apply(this, arguments) : -x, + typeof y === "function" ? -y.apply(this, arguments) : -y + ), e, translateExtent); + }); + }; + + function scale(transform$$1, k) { + k = Math.max(scaleExtent[0], Math.min(scaleExtent[1], k)); + return k === transform$$1.k ? transform$$1 : new Transform(k, transform$$1.x, transform$$1.y); + } + + function translate(transform$$1, p0, p1) { + var x = p0[0] - p1[0] * transform$$1.k, y = p0[1] - p1[1] * transform$$1.k; + return x === transform$$1.x && y === transform$$1.y ? transform$$1 : new Transform(transform$$1.k, x, y); + } + + function centroid(extent) { + return [(+extent[0][0] + +extent[1][0]) / 2, (+extent[0][1] + +extent[1][1]) / 2]; + } + + function schedule(transition, transform$$1, center) { + transition + .on("start.zoom", function() { gesture(this, arguments).start(); }) + .on("interrupt.zoom end.zoom", function() { gesture(this, arguments).end(); }) + .tween("zoom", function() { + var that = this, + args = arguments, + g = gesture(that, args), + e = extent.apply(that, args), + p = center || centroid(e), + w = Math.max(e[1][0] - e[0][0], e[1][1] - e[0][1]), + a = that.__zoom, + b = typeof transform$$1 === "function" ? transform$$1.apply(that, args) : transform$$1, + i = interpolate(a.invert(p).concat(w / a.k), b.invert(p).concat(w / b.k)); + return function(t) { + if (t === 1) t = b; // Avoid rounding error on end. + else { var l = i(t), k = w / l[2]; t = new Transform(k, p[0] - l[0] * k, p[1] - l[1] * k); } + g.zoom(null, t); + }; + }); + } + + function gesture(that, args) { + for (var i = 0, n = gestures.length, g; i < n; ++i) { + if ((g = gestures[i]).that === that) { + return g; + } + } + return new Gesture(that, args); + } + + function Gesture(that, args) { + this.that = that; + this.args = args; + this.index = -1; + this.active = 0; + this.extent = extent.apply(that, args); + } + + Gesture.prototype = { + start: function() { + if (++this.active === 1) { + this.index = gestures.push(this) - 1; + this.emit("start"); + } + return this; + }, + zoom: function(key, transform$$1) { + if (this.mouse && key !== "mouse") this.mouse[1] = transform$$1.invert(this.mouse[0]); + if (this.touch0 && key !== "touch") this.touch0[1] = transform$$1.invert(this.touch0[0]); + if (this.touch1 && key !== "touch") this.touch1[1] = transform$$1.invert(this.touch1[0]); + this.that.__zoom = transform$$1; + this.emit("zoom"); + return this; + }, + end: function() { + if (--this.active === 0) { + gestures.splice(this.index, 1); + this.index = -1; + this.emit("end"); + } + return this; + }, + emit: function(type) { + customEvent(new ZoomEvent(zoom, type, this.that.__zoom), listeners.apply, listeners, [type, this.that, this.args]); + } + }; + + function wheeled() { + if (!filter.apply(this, arguments)) return; + var g = gesture(this, arguments), + t = this.__zoom, + k = Math.max(scaleExtent[0], Math.min(scaleExtent[1], t.k * Math.pow(2, wheelDelta.apply(this, arguments)))), + p = mouse(this); + + // If the mouse is in the same location as before, reuse it. + // If there were recent wheel events, reset the wheel idle timeout. + if (g.wheel) { + if (g.mouse[0][0] !== p[0] || g.mouse[0][1] !== p[1]) { + g.mouse[1] = t.invert(g.mouse[0] = p); + } + clearTimeout(g.wheel); + } + + // If this wheel event won’t trigger a transform change, ignore it. + else if (t.k === k) return; + + // Otherwise, capture the mouse point and location at the start. + else { + g.mouse = [p, t.invert(p)]; + interrupt(this); + g.start(); + } + + noevent$2(); + g.wheel = setTimeout(wheelidled, wheelDelay); + g.zoom("mouse", constrain(translate(scale(t, k), g.mouse[0], g.mouse[1]), g.extent, translateExtent)); + + function wheelidled() { + g.wheel = null; + g.end(); + } + } + + function mousedowned() { + if (touchending || !filter.apply(this, arguments)) return; + var g = gesture(this, arguments), + v = select(exports.event.view).on("mousemove.zoom", mousemoved, true).on("mouseup.zoom", mouseupped, true), + p = mouse(this), + x0 = exports.event.clientX, + y0 = exports.event.clientY; + + dragDisable(exports.event.view); + nopropagation$2(); + g.mouse = [p, this.__zoom.invert(p)]; + interrupt(this); + g.start(); + + function mousemoved() { + noevent$2(); + if (!g.moved) { + var dx = exports.event.clientX - x0, dy = exports.event.clientY - y0; + g.moved = dx * dx + dy * dy > clickDistance2; + } + g.zoom("mouse", constrain(translate(g.that.__zoom, g.mouse[0] = mouse(g.that), g.mouse[1]), g.extent, translateExtent)); + } + + function mouseupped() { + v.on("mousemove.zoom mouseup.zoom", null); + yesdrag(exports.event.view, g.moved); + noevent$2(); + g.end(); + } + } + + function dblclicked() { + if (!filter.apply(this, arguments)) return; + var t0 = this.__zoom, + p0 = mouse(this), + p1 = t0.invert(p0), + k1 = t0.k * (exports.event.shiftKey ? 0.5 : 2), + t1 = constrain(translate(scale(t0, k1), p0, p1), extent.apply(this, arguments), translateExtent); + + noevent$2(); + if (duration > 0) select(this).transition().duration(duration).call(schedule, t1, p0); + else select(this).call(zoom.transform, t1); + } + + function touchstarted() { + if (!filter.apply(this, arguments)) return; + var g = gesture(this, arguments), + touches = exports.event.changedTouches, + started, + n = touches.length, i, t, p; + + nopropagation$2(); + for (i = 0; i < n; ++i) { + t = touches[i], p = touch(this, touches, t.identifier); + p = [p, this.__zoom.invert(p), t.identifier]; + if (!g.touch0) g.touch0 = p, started = true; + else if (!g.touch1) g.touch1 = p; + } + + // If this is a dbltap, reroute to the (optional) dblclick.zoom handler. + if (touchstarting) { + touchstarting = clearTimeout(touchstarting); + if (!g.touch1) { + g.end(); + p = select(this).on("dblclick.zoom"); + if (p) p.apply(this, arguments); + return; + } + } + + if (started) { + touchstarting = setTimeout(function() { touchstarting = null; }, touchDelay); + interrupt(this); + g.start(); + } + } + + function touchmoved() { + var g = gesture(this, arguments), + touches = exports.event.changedTouches, + n = touches.length, i, t, p, l; + + noevent$2(); + if (touchstarting) touchstarting = clearTimeout(touchstarting); + for (i = 0; i < n; ++i) { + t = touches[i], p = touch(this, touches, t.identifier); + if (g.touch0 && g.touch0[2] === t.identifier) g.touch0[0] = p; + else if (g.touch1 && g.touch1[2] === t.identifier) g.touch1[0] = p; + } + t = g.that.__zoom; + if (g.touch1) { + var p0 = g.touch0[0], l0 = g.touch0[1], + p1 = g.touch1[0], l1 = g.touch1[1], + dp = (dp = p1[0] - p0[0]) * dp + (dp = p1[1] - p0[1]) * dp, + dl = (dl = l1[0] - l0[0]) * dl + (dl = l1[1] - l0[1]) * dl; + t = scale(t, Math.sqrt(dp / dl)); + p = [(p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2]; + l = [(l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2]; + } + else if (g.touch0) p = g.touch0[0], l = g.touch0[1]; + else return; + g.zoom("touch", constrain(translate(t, p, l), g.extent, translateExtent)); + } + + function touchended() { + var g = gesture(this, arguments), + touches = exports.event.changedTouches, + n = touches.length, i, t; + + nopropagation$2(); + if (touchending) clearTimeout(touchending); + touchending = setTimeout(function() { touchending = null; }, touchDelay); + for (i = 0; i < n; ++i) { + t = touches[i]; + if (g.touch0 && g.touch0[2] === t.identifier) delete g.touch0; + else if (g.touch1 && g.touch1[2] === t.identifier) delete g.touch1; + } + if (g.touch1 && !g.touch0) g.touch0 = g.touch1, delete g.touch1; + if (g.touch0) g.touch0[1] = this.__zoom.invert(g.touch0[0]); + else g.end(); + } + + zoom.wheelDelta = function(_) { + return arguments.length ? (wheelDelta = typeof _ === "function" ? _ : constant$12(+_), zoom) : wheelDelta; + }; + + zoom.filter = function(_) { + return arguments.length ? (filter = typeof _ === "function" ? _ : constant$12(!!_), zoom) : filter; + }; + + zoom.touchable = function(_) { + return arguments.length ? (touchable = typeof _ === "function" ? _ : constant$12(!!_), zoom) : touchable; + }; + + zoom.extent = function(_) { + return arguments.length ? (extent = typeof _ === "function" ? _ : constant$12([[+_[0][0], +_[0][1]], [+_[1][0], +_[1][1]]]), zoom) : extent; + }; + + zoom.scaleExtent = function(_) { + return arguments.length ? (scaleExtent[0] = +_[0], scaleExtent[1] = +_[1], zoom) : [scaleExtent[0], scaleExtent[1]]; + }; + + zoom.translateExtent = function(_) { + return arguments.length ? (translateExtent[0][0] = +_[0][0], translateExtent[1][0] = +_[1][0], translateExtent[0][1] = +_[0][1], translateExtent[1][1] = +_[1][1], zoom) : [[translateExtent[0][0], translateExtent[0][1]], [translateExtent[1][0], translateExtent[1][1]]]; + }; + + zoom.constrain = function(_) { + return arguments.length ? (constrain = _, zoom) : constrain; + }; + + zoom.duration = function(_) { + return arguments.length ? (duration = +_, zoom) : duration; + }; + + zoom.interpolate = function(_) { + return arguments.length ? (interpolate = _, zoom) : interpolate; + }; + + zoom.on = function() { + var value = listeners.on.apply(listeners, arguments); + return value === listeners ? zoom : value; + }; + + zoom.clickDistance = function(_) { + return arguments.length ? (clickDistance2 = (_ = +_) * _, zoom) : Math.sqrt(clickDistance2); + }; + + return zoom; +} + +exports.version = version; +exports.bisect = bisectRight; +exports.bisectRight = bisectRight; +exports.bisectLeft = bisectLeft; +exports.ascending = ascending; +exports.bisector = bisector; +exports.cross = cross; +exports.descending = descending; +exports.deviation = deviation; +exports.extent = extent; +exports.histogram = histogram; +exports.thresholdFreedmanDiaconis = freedmanDiaconis; +exports.thresholdScott = scott; +exports.thresholdSturges = sturges; +exports.max = max; +exports.mean = mean; +exports.median = median; +exports.merge = merge; +exports.min = min; +exports.pairs = pairs; +exports.permute = permute; +exports.quantile = threshold; +exports.range = sequence; +exports.scan = scan; +exports.shuffle = shuffle; +exports.sum = sum; +exports.ticks = ticks; +exports.tickIncrement = tickIncrement; +exports.tickStep = tickStep; +exports.transpose = transpose; +exports.variance = variance; +exports.zip = zip; +exports.axisTop = axisTop; +exports.axisRight = axisRight; +exports.axisBottom = axisBottom; +exports.axisLeft = axisLeft; +exports.brush = brush; +exports.brushX = brushX; +exports.brushY = brushY; +exports.brushSelection = brushSelection; +exports.chord = chord; +exports.ribbon = ribbon; +exports.nest = nest; +exports.set = set$2; +exports.map = map$1; +exports.keys = keys; +exports.values = values; +exports.entries = entries; +exports.color = color; +exports.rgb = rgb; +exports.hsl = hsl; +exports.lab = lab; +exports.hcl = hcl; +exports.cubehelix = cubehelix; +exports.dispatch = dispatch; +exports.drag = drag; +exports.dragDisable = dragDisable; +exports.dragEnable = yesdrag; +exports.dsvFormat = dsv; +exports.csvParse = csvParse; +exports.csvParseRows = csvParseRows; +exports.csvFormat = csvFormat; +exports.csvFormatRows = csvFormatRows; +exports.tsvParse = tsvParse; +exports.tsvParseRows = tsvParseRows; +exports.tsvFormat = tsvFormat; +exports.tsvFormatRows = tsvFormatRows; +exports.easeLinear = linear$1; +exports.easeQuad = quadInOut; +exports.easeQuadIn = quadIn; +exports.easeQuadOut = quadOut; +exports.easeQuadInOut = quadInOut; +exports.easeCubic = cubicInOut; +exports.easeCubicIn = cubicIn; +exports.easeCubicOut = cubicOut; +exports.easeCubicInOut = cubicInOut; +exports.easePoly = polyInOut; +exports.easePolyIn = polyIn; +exports.easePolyOut = polyOut; +exports.easePolyInOut = polyInOut; +exports.easeSin = sinInOut; +exports.easeSinIn = sinIn; +exports.easeSinOut = sinOut; +exports.easeSinInOut = sinInOut; +exports.easeExp = expInOut; +exports.easeExpIn = expIn; +exports.easeExpOut = expOut; +exports.easeExpInOut = expInOut; +exports.easeCircle = circleInOut; +exports.easeCircleIn = circleIn; +exports.easeCircleOut = circleOut; +exports.easeCircleInOut = circleInOut; +exports.easeBounce = bounceOut; +exports.easeBounceIn = bounceIn; +exports.easeBounceOut = bounceOut; +exports.easeBounceInOut = bounceInOut; +exports.easeBack = backInOut; +exports.easeBackIn = backIn; +exports.easeBackOut = backOut; +exports.easeBackInOut = backInOut; +exports.easeElastic = elasticOut; +exports.easeElasticIn = elasticIn; +exports.easeElasticOut = elasticOut; +exports.easeElasticInOut = elasticInOut; +exports.forceCenter = center$1; +exports.forceCollide = collide; +exports.forceLink = link; +exports.forceManyBody = manyBody; +exports.forceRadial = radial; +exports.forceSimulation = simulation; +exports.forceX = x$2; +exports.forceY = y$2; +exports.formatDefaultLocale = defaultLocale; +exports.formatLocale = formatLocale; +exports.formatSpecifier = formatSpecifier; +exports.precisionFixed = precisionFixed; +exports.precisionPrefix = precisionPrefix; +exports.precisionRound = precisionRound; +exports.geoArea = area; +exports.geoBounds = bounds; +exports.geoCentroid = centroid; +exports.geoCircle = circle; +exports.geoClipAntimeridian = clipAntimeridian; +exports.geoClipCircle = clipCircle; +exports.geoClipExtent = extent$1; +exports.geoClipRectangle = clipRectangle; +exports.geoContains = contains; +exports.geoDistance = distance; +exports.geoGraticule = graticule; +exports.geoGraticule10 = graticule10; +exports.geoInterpolate = interpolate$1; +exports.geoLength = length$1; +exports.geoPath = index$1; +exports.geoAlbers = albers; +exports.geoAlbersUsa = albersUsa; +exports.geoAzimuthalEqualArea = azimuthalEqualArea; +exports.geoAzimuthalEqualAreaRaw = azimuthalEqualAreaRaw; +exports.geoAzimuthalEquidistant = azimuthalEquidistant; +exports.geoAzimuthalEquidistantRaw = azimuthalEquidistantRaw; +exports.geoConicConformal = conicConformal; +exports.geoConicConformalRaw = conicConformalRaw; +exports.geoConicEqualArea = conicEqualArea; +exports.geoConicEqualAreaRaw = conicEqualAreaRaw; +exports.geoConicEquidistant = conicEquidistant; +exports.geoConicEquidistantRaw = conicEquidistantRaw; +exports.geoEquirectangular = equirectangular; +exports.geoEquirectangularRaw = equirectangularRaw; +exports.geoGnomonic = gnomonic; +exports.geoGnomonicRaw = gnomonicRaw; +exports.geoIdentity = identity$5; +exports.geoProjection = projection; +exports.geoProjectionMutator = projectionMutator; +exports.geoMercator = mercator; +exports.geoMercatorRaw = mercatorRaw; +exports.geoNaturalEarth1 = naturalEarth1; +exports.geoNaturalEarth1Raw = naturalEarth1Raw; +exports.geoOrthographic = orthographic; +exports.geoOrthographicRaw = orthographicRaw; +exports.geoStereographic = stereographic; +exports.geoStereographicRaw = stereographicRaw; +exports.geoTransverseMercator = transverseMercator; +exports.geoTransverseMercatorRaw = transverseMercatorRaw; +exports.geoRotation = rotation; +exports.geoStream = geoStream; +exports.geoTransform = transform; +exports.cluster = cluster; +exports.hierarchy = hierarchy; +exports.pack = index$2; +exports.packSiblings = siblings; +exports.packEnclose = enclose; +exports.partition = partition; +exports.stratify = stratify; +exports.tree = tree; +exports.treemap = index$3; +exports.treemapBinary = binary; +exports.treemapDice = treemapDice; +exports.treemapSlice = treemapSlice; +exports.treemapSliceDice = sliceDice; +exports.treemapSquarify = squarify; +exports.treemapResquarify = resquarify; +exports.interpolate = interpolateValue; +exports.interpolateArray = array$1; +exports.interpolateBasis = basis$1; +exports.interpolateBasisClosed = basisClosed; +exports.interpolateDate = date; +exports.interpolateNumber = reinterpolate; +exports.interpolateObject = object; +exports.interpolateRound = interpolateRound; +exports.interpolateString = interpolateString; +exports.interpolateTransformCss = interpolateTransformCss; +exports.interpolateTransformSvg = interpolateTransformSvg; +exports.interpolateZoom = interpolateZoom; +exports.interpolateRgb = interpolateRgb; +exports.interpolateRgbBasis = rgbBasis; +exports.interpolateRgbBasisClosed = rgbBasisClosed; +exports.interpolateHsl = hsl$2; +exports.interpolateHslLong = hslLong; +exports.interpolateLab = lab$1; +exports.interpolateHcl = hcl$2; +exports.interpolateHclLong = hclLong; +exports.interpolateCubehelix = cubehelix$2; +exports.interpolateCubehelixLong = cubehelixLong; +exports.quantize = quantize; +exports.path = path; +exports.polygonArea = area$1; +exports.polygonCentroid = centroid$1; +exports.polygonHull = hull; +exports.polygonContains = contains$1; +exports.polygonLength = length$2; +exports.quadtree = quadtree; +exports.queue = queue; +exports.randomUniform = uniform; +exports.randomNormal = normal; +exports.randomLogNormal = logNormal; +exports.randomBates = bates; +exports.randomIrwinHall = irwinHall; +exports.randomExponential = exponential$1; +exports.request = request; +exports.html = html; +exports.json = json; +exports.text = text; +exports.xml = xml; +exports.csv = csv$1; +exports.tsv = tsv$1; +exports.scaleBand = band; +exports.scalePoint = point$1; +exports.scaleIdentity = identity$6; +exports.scaleLinear = linear$2; +exports.scaleLog = log$1; +exports.scaleOrdinal = ordinal; +exports.scaleImplicit = implicit; +exports.scalePow = pow$1; +exports.scaleSqrt = sqrt$1; +exports.scaleQuantile = quantile$$1; +exports.scaleQuantize = quantize$1; +exports.scaleThreshold = threshold$1; +exports.scaleTime = time; +exports.scaleUtc = utcTime; +exports.schemeCategory10 = category10; +exports.schemeCategory20b = category20b; +exports.schemeCategory20c = category20c; +exports.schemeCategory20 = category20; +exports.interpolateCubehelixDefault = cubehelix$3; +exports.interpolateRainbow = rainbow$1; +exports.interpolateWarm = warm; +exports.interpolateCool = cool; +exports.interpolateViridis = viridis; +exports.interpolateMagma = magma; +exports.interpolateInferno = inferno; +exports.interpolatePlasma = plasma; +exports.scaleSequential = sequential; +exports.create = create; +exports.creator = creator; +exports.local = local$1; +exports.matcher = matcher$1; +exports.mouse = mouse; +exports.namespace = namespace; +exports.namespaces = namespaces; +exports.clientPoint = point; +exports.select = select; +exports.selectAll = selectAll; +exports.selection = selection; +exports.selector = selector; +exports.selectorAll = selectorAll; +exports.style = styleValue; +exports.touch = touch; +exports.touches = touches; +exports.window = defaultView; +exports.customEvent = customEvent; +exports.arc = arc; +exports.area = area$2; +exports.line = line; +exports.pie = pie; +exports.areaRadial = areaRadial; +exports.radialArea = areaRadial; +exports.lineRadial = lineRadial$1; +exports.radialLine = lineRadial$1; +exports.pointRadial = pointRadial; +exports.linkHorizontal = linkHorizontal; +exports.linkVertical = linkVertical; +exports.linkRadial = linkRadial; +exports.symbol = symbol; +exports.symbols = symbols; +exports.symbolCircle = circle$2; +exports.symbolCross = cross$2; +exports.symbolDiamond = diamond; +exports.symbolSquare = square; +exports.symbolStar = star; +exports.symbolTriangle = triangle; +exports.symbolWye = wye; +exports.curveBasisClosed = basisClosed$1; +exports.curveBasisOpen = basisOpen; +exports.curveBasis = basis$2; +exports.curveBundle = bundle; +exports.curveCardinalClosed = cardinalClosed; +exports.curveCardinalOpen = cardinalOpen; +exports.curveCardinal = cardinal; +exports.curveCatmullRomClosed = catmullRomClosed; +exports.curveCatmullRomOpen = catmullRomOpen; +exports.curveCatmullRom = catmullRom; +exports.curveLinearClosed = linearClosed; +exports.curveLinear = curveLinear; +exports.curveMonotoneX = monotoneX; +exports.curveMonotoneY = monotoneY; +exports.curveNatural = natural; +exports.curveStep = step; +exports.curveStepAfter = stepAfter; +exports.curveStepBefore = stepBefore; +exports.stack = stack; +exports.stackOffsetExpand = expand; +exports.stackOffsetDiverging = diverging; +exports.stackOffsetNone = none$1; +exports.stackOffsetSilhouette = silhouette; +exports.stackOffsetWiggle = wiggle; +exports.stackOrderAscending = ascending$2; +exports.stackOrderDescending = descending$2; +exports.stackOrderInsideOut = insideOut; +exports.stackOrderNone = none$2; +exports.stackOrderReverse = reverse; +exports.timeInterval = newInterval; +exports.timeMillisecond = millisecond; +exports.timeMilliseconds = milliseconds; +exports.utcMillisecond = millisecond; +exports.utcMilliseconds = milliseconds; +exports.timeSecond = second; +exports.timeSeconds = seconds; +exports.utcSecond = second; +exports.utcSeconds = seconds; +exports.timeMinute = minute; +exports.timeMinutes = minutes; +exports.timeHour = hour; +exports.timeHours = hours; +exports.timeDay = day; +exports.timeDays = days; +exports.timeWeek = sunday; +exports.timeWeeks = sundays; +exports.timeSunday = sunday; +exports.timeSundays = sundays; +exports.timeMonday = monday; +exports.timeMondays = mondays; +exports.timeTuesday = tuesday; +exports.timeTuesdays = tuesdays; +exports.timeWednesday = wednesday; +exports.timeWednesdays = wednesdays; +exports.timeThursday = thursday; +exports.timeThursdays = thursdays; +exports.timeFriday = friday; +exports.timeFridays = fridays; +exports.timeSaturday = saturday; +exports.timeSaturdays = saturdays; +exports.timeMonth = month; +exports.timeMonths = months; +exports.timeYear = year; +exports.timeYears = years; +exports.utcMinute = utcMinute; +exports.utcMinutes = utcMinutes; +exports.utcHour = utcHour; +exports.utcHours = utcHours; +exports.utcDay = utcDay; +exports.utcDays = utcDays; +exports.utcWeek = utcSunday; +exports.utcWeeks = utcSundays; +exports.utcSunday = utcSunday; +exports.utcSundays = utcSundays; +exports.utcMonday = utcMonday; +exports.utcMondays = utcMondays; +exports.utcTuesday = utcTuesday; +exports.utcTuesdays = utcTuesdays; +exports.utcWednesday = utcWednesday; +exports.utcWednesdays = utcWednesdays; +exports.utcThursday = utcThursday; +exports.utcThursdays = utcThursdays; +exports.utcFriday = utcFriday; +exports.utcFridays = utcFridays; +exports.utcSaturday = utcSaturday; +exports.utcSaturdays = utcSaturdays; +exports.utcMonth = utcMonth; +exports.utcMonths = utcMonths; +exports.utcYear = utcYear; +exports.utcYears = utcYears; +exports.timeFormatDefaultLocale = defaultLocale$1; +exports.timeFormatLocale = formatLocale$1; +exports.isoFormat = formatIso; +exports.isoParse = parseIso; +exports.now = now; +exports.timer = timer; +exports.timerFlush = timerFlush; +exports.timeout = timeout$1; +exports.interval = interval$1; +exports.transition = transition; +exports.active = active; +exports.interrupt = interrupt; +exports.voronoi = voronoi; +exports.zoom = zoom; +exports.zoomTransform = transform$1; +exports.zoomIdentity = identity$8; + +Object.defineProperty(exports, '__esModule', { value: true }); + +}))); \ No newline at end of file diff --git a/rapsberrypi/web/JSfiles/jquery-1.7.1.min.js b/rapsberrypi/web/JSfiles/jquery-1.7.1.min.js new file mode 100644 index 000000000..198b3ff07 --- /dev/null +++ b/rapsberrypi/web/JSfiles/jquery-1.7.1.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.7.1 jquery.com | jquery.org/license */ +(function(a,b){function cy(a){return f.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:!1}function cv(a){if(!ck[a]){var b=c.body,d=f("<"+a+">").appendTo(b),e=d.css("display");d.remove();if(e==="none"||e===""){cl||(cl=c.createElement("iframe"),cl.frameBorder=cl.width=cl.height=0),b.appendChild(cl);if(!cm||!cl.createElement)cm=(cl.contentWindow||cl.contentDocument).document,cm.write((c.compatMode==="CSS1Compat"?"":"")+""),cm.close();d=cm.createElement(a),cm.body.appendChild(d),e=f.css(d,"display"),b.removeChild(cl)}ck[a]=e}return ck[a]}function cu(a,b){var c={};f.each(cq.concat.apply([],cq.slice(0,b)),function(){c[this]=a});return c}function ct(){cr=b}function cs(){setTimeout(ct,0);return cr=f.now()}function cj(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}function ci(){try{return new a.XMLHttpRequest}catch(b){}}function cc(a,c){a.dataFilter&&(c=a.dataFilter(c,a.dataType));var d=a.dataTypes,e={},g,h,i=d.length,j,k=d[0],l,m,n,o,p;for(g=1;g0){if(c!=="border")for(;g=0===c})}function S(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function K(){return!0}function J(){return!1}function n(a,b,c){var d=b+"defer",e=b+"queue",g=b+"mark",h=f._data(a,d);h&&(c==="queue"||!f._data(a,e))&&(c==="mark"||!f._data(a,g))&&setTimeout(function(){!f._data(a,e)&&!f._data(a,g)&&(f.removeData(a,d,!0),h.fire())},0)}function m(a){for(var b in a){if(b==="data"&&f.isEmptyObject(a[b]))continue;if(b!=="toJSON")return!1}return!0}function l(a,c,d){if(d===b&&a.nodeType===1){var e="data-"+c.replace(k,"-$1").toLowerCase();d=a.getAttribute(e);if(typeof d=="string"){try{d=d==="true"?!0:d==="false"?!1:d==="null"?null:f.isNumeric(d)?parseFloat(d):j.test(d)?f.parseJSON(d):d}catch(g){}f.data(a,c,d)}else d=b}return d}function h(a){var b=g[a]={},c,d;a=a.split(/\s+/);for(c=0,d=a.length;c)[^>]*$|#([\w\-]*)$)/,j=/\S/,k=/^\s+/,l=/\s+$/,m=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,n=/^[\],:{}\s]*$/,o=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,p=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,q=/(?:^|:|,)(?:\s*\[)+/g,r=/(webkit)[ \/]([\w.]+)/,s=/(opera)(?:.*version)?[ \/]([\w.]+)/,t=/(msie) ([\w.]+)/,u=/(mozilla)(?:.*? rv:([\w.]+))?/,v=/-([a-z]|[0-9])/ig,w=/^-ms-/,x=function(a,b){return(b+"").toUpperCase()},y=d.userAgent,z,A,B,C=Object.prototype.toString,D=Object.prototype.hasOwnProperty,E=Array.prototype.push,F=Array.prototype.slice,G=String.prototype.trim,H=Array.prototype.indexOf,I={};e.fn=e.prototype={constructor:e,init:function(a,d,f){var g,h,j,k;if(!a)return this;if(a.nodeType){this.context=this[0]=a,this.length=1;return this}if(a==="body"&&!d&&c.body){this.context=c,this[0]=c.body,this.selector=a,this.length=1;return this}if(typeof a=="string"){a.charAt(0)!=="<"||a.charAt(a.length-1)!==">"||a.length<3?g=i.exec(a):g=[null,a,null];if(g&&(g[1]||!d)){if(g[1]){d=d instanceof e?d[0]:d,k=d?d.ownerDocument||d:c,j=m.exec(a),j?e.isPlainObject(d)?(a=[c.createElement(j[1])],e.fn.attr.call(a,d,!0)):a=[k.createElement(j[1])]:(j=e.buildFragment([g[1]],[k]),a=(j.cacheable?e.clone(j.fragment):j.fragment).childNodes);return e.merge(this,a)}h=c.getElementById(g[2]);if(h&&h.parentNode){if(h.id!==g[2])return f.find(a);this.length=1,this[0]=h}this.context=c,this.selector=a;return this}return!d||d.jquery?(d||f).find(a):this.constructor(d).find(a)}if(e.isFunction(a))return f.ready(a);a.selector!==b&&(this.selector=a.selector,this.context=a.context);return e.makeArray(a,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return F.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this[this.length+a]:this[a]},pushStack:function(a,b,c){var d=this.constructor();e.isArray(a)?E.apply(d,a):e.merge(d,a),d.prevObject=this,d.context=this.context,b==="find"?d.selector=this.selector+(this.selector?" ":"")+c:b&&(d.selector=this.selector+"."+b+"("+c+")");return d},each:function(a,b){return e.each(this,a,b)},ready:function(a){e.bindReady(),A.add(a);return this},eq:function(a){a=+a;return a===-1?this.slice(a):this.slice(a,a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(F.apply(this,arguments),"slice",F.call(arguments).join(","))},map:function(a){return this.pushStack(e.map(this,function(b,c){return a.call(b,c,b)}))},end:function(){return this.prevObject||this.constructor(null)},push:E,sort:[].sort,splice:[].splice},e.fn.init.prototype=e.fn,e.extend=e.fn.extend=function(){var a,c,d,f,g,h,i=arguments[0]||{},j=1,k=arguments.length,l=!1;typeof i=="boolean"&&(l=i,i=arguments[1]||{},j=2),typeof i!="object"&&!e.isFunction(i)&&(i={}),k===j&&(i=this,--j);for(;j0)return;A.fireWith(c,[e]),e.fn.trigger&&e(c).trigger("ready").off("ready")}},bindReady:function(){if(!A){A=e.Callbacks("once memory");if(c.readyState==="complete")return setTimeout(e.ready,1);if(c.addEventListener)c.addEventListener("DOMContentLoaded",B,!1),a.addEventListener("load",e.ready,!1);else if(c.attachEvent){c.attachEvent("onreadystatechange",B),a.attachEvent("onload",e.ready);var b=!1;try{b=a.frameElement==null}catch(d){}c.documentElement.doScroll&&b&&J()}}},isFunction:function(a){return e.type(a)==="function"},isArray:Array.isArray||function(a){return e.type(a)==="array"},isWindow:function(a){return a&&typeof a=="object"&&"setInterval"in a},isNumeric:function(a){return!isNaN(parseFloat(a))&&isFinite(a)},type:function(a){return a==null?String(a):I[C.call(a)]||"object"},isPlainObject:function(a){if(!a||e.type(a)!=="object"||a.nodeType||e.isWindow(a))return!1;try{if(a.constructor&&!D.call(a,"constructor")&&!D.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}var d;for(d in a);return d===b||D.call(a,d)},isEmptyObject:function(a){for(var b in a)return!1;return!0},error:function(a){throw new Error(a)},parseJSON:function(b){if(typeof b!="string"||!b)return null;b=e.trim(b);if(a.JSON&&a.JSON.parse)return a.JSON.parse(b);if(n.test(b.replace(o,"@").replace(p,"]").replace(q,"")))return(new Function("return "+b))();e.error("Invalid JSON: "+b)},parseXML:function(c){var d,f;try{a.DOMParser?(f=new DOMParser,d=f.parseFromString(c,"text/xml")):(d=new ActiveXObject("Microsoft.XMLDOM"),d.async="false",d.loadXML(c))}catch(g){d=b}(!d||!d.documentElement||d.getElementsByTagName("parsererror").length)&&e.error("Invalid XML: "+c);return d},noop:function(){},globalEval:function(b){b&&j.test(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(w,"ms-").replace(v,x)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,c,d){var f,g=0,h=a.length,i=h===b||e.isFunction(a);if(d){if(i){for(f in a)if(c.apply(a[f],d)===!1)break}else for(;g0&&a[0]&&a[j-1]||j===0||e.isArray(a));if(k)for(;i1?i.call(arguments,0):b,j.notifyWith(k,e)}}function l(a){return function(c){b[a]=arguments.length>1?i.call(arguments,0):c,--g||j.resolveWith(j,b)}}var b=i.call(arguments,0),c=0,d=b.length,e=Array(d),g=d,h=d,j=d<=1&&a&&f.isFunction(a.promise)?a:f.Deferred(),k=j.promise();if(d>1){for(;c
a",d=q.getElementsByTagName("*"),e=q.getElementsByTagName("a")[0];if(!d||!d.length||!e)return{};g=c.createElement("select"),h=g.appendChild(c.createElement("option")),i=q.getElementsByTagName("input")[0],b={leadingWhitespace:q.firstChild.nodeType===3,tbody:!q.getElementsByTagName("tbody").length,htmlSerialize:!!q.getElementsByTagName("link").length,style:/top/.test(e.getAttribute("style")),hrefNormalized:e.getAttribute("href")==="/a",opacity:/^0.55/.test(e.style.opacity),cssFloat:!!e.style.cssFloat,checkOn:i.value==="on",optSelected:h.selected,getSetAttribute:q.className!=="t",enctype:!!c.createElement("form").enctype,html5Clone:c.createElement("nav").cloneNode(!0).outerHTML!=="<:nav>",submitBubbles:!0,changeBubbles:!0,focusinBubbles:!1,deleteExpando:!0,noCloneEvent:!0,inlineBlockNeedsLayout:!1,shrinkWrapBlocks:!1,reliableMarginRight:!0},i.checked=!0,b.noCloneChecked=i.cloneNode(!0).checked,g.disabled=!0,b.optDisabled=!h.disabled;try{delete q.test}catch(s){b.deleteExpando=!1}!q.addEventListener&&q.attachEvent&&q.fireEvent&&(q.attachEvent("onclick",function(){b.noCloneEvent=!1}),q.cloneNode(!0).fireEvent("onclick")),i=c.createElement("input"),i.value="t",i.setAttribute("type","radio"),b.radioValue=i.value==="t",i.setAttribute("checked","checked"),q.appendChild(i),k=c.createDocumentFragment(),k.appendChild(q.lastChild),b.checkClone=k.cloneNode(!0).cloneNode(!0).lastChild.checked,b.appendChecked=i.checked,k.removeChild(i),k.appendChild(q),q.innerHTML="",a.getComputedStyle&&(j=c.createElement("div"),j.style.width="0",j.style.marginRight="0",q.style.width="2px",q.appendChild(j),b.reliableMarginRight=(parseInt((a.getComputedStyle(j,null)||{marginRight:0}).marginRight,10)||0)===0);if(q.attachEvent)for(o in{submit:1,change:1,focusin:1})n="on"+o,p=n in q,p||(q.setAttribute(n,"return;"),p=typeof q[n]=="function"),b[o+"Bubbles"]=p;k.removeChild(q),k=g=h=j=q=i=null,f(function(){var a,d,e,g,h,i,j,k,m,n,o,r=c.getElementsByTagName("body")[0];!r||(j=1,k="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;",m="visibility:hidden;border:0;",n="style='"+k+"border:5px solid #000;padding:0;'",o="
"+""+"
",a=c.createElement("div"),a.style.cssText=m+"width:0;height:0;position:static;top:0;margin-top:"+j+"px",r.insertBefore(a,r.firstChild),q=c.createElement("div"),a.appendChild(q),q.innerHTML="
t
",l=q.getElementsByTagName("td"),p=l[0].offsetHeight===0,l[0].style.display="",l[1].style.display="none",b.reliableHiddenOffsets=p&&l[0].offsetHeight===0,q.innerHTML="",q.style.width=q.style.paddingLeft="1px",f.boxModel=b.boxModel=q.offsetWidth===2,typeof q.style.zoom!="undefined"&&(q.style.display="inline",q.style.zoom=1,b.inlineBlockNeedsLayout=q.offsetWidth===2,q.style.display="",q.innerHTML="
",b.shrinkWrapBlocks=q.offsetWidth!==2),q.style.cssText=k+m,q.innerHTML=o,d=q.firstChild,e=d.firstChild,h=d.nextSibling.firstChild.firstChild,i={doesNotAddBorder:e.offsetTop!==5,doesAddBorderForTableAndCells:h.offsetTop===5},e.style.position="fixed",e.style.top="20px",i.fixedPosition=e.offsetTop===20||e.offsetTop===15,e.style.position=e.style.top="",d.style.overflow="hidden",d.style.position="relative",i.subtractsBorderForOverflowNotVisible=e.offsetTop===-5,i.doesNotIncludeMarginInBodyOffset=r.offsetTop!==j,r.removeChild(a),q=a=null,f.extend(b,i))});return b}();var j=/^(?:\{.*\}|\[.*\])$/,k=/([A-Z])/g;f.extend({cache:{},uuid:0,expando:"jQuery"+(f.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:!0,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:!0},hasData:function(a){a=a.nodeType?f.cache[a[f.expando]]:a[f.expando];return!!a&&!m(a)},data:function(a,c,d,e){if(!!f.acceptData(a)){var g,h,i,j=f.expando,k=typeof c=="string",l=a.nodeType,m=l?f.cache:a,n=l?a[j]:a[j]&&j,o=c==="events";if((!n||!m[n]||!o&&!e&&!m[n].data)&&k&&d===b)return;n||(l?a[j]=n=++f.uuid:n=j),m[n]||(m[n]={},l||(m[n].toJSON=f.noop));if(typeof c=="object"||typeof c=="function")e?m[n]=f.extend(m[n],c):m[n].data=f.extend(m[n].data,c);g=h=m[n],e||(h.data||(h.data={}),h=h.data),d!==b&&(h[f.camelCase(c)]=d);if(o&&!h[c])return g.events;k?(i=h[c],i==null&&(i=h[f.camelCase(c)])):i=h;return i}},removeData:function(a,b,c){if(!!f.acceptData(a)){var d,e,g,h=f.expando,i=a.nodeType,j=i?f.cache:a,k=i?a[h]:h;if(!j[k])return;if(b){d=c?j[k]:j[k].data;if(d){f.isArray(b)||(b in d?b=[b]:(b=f.camelCase(b),b in d?b=[b]:b=b.split(" ")));for(e=0,g=b.length;e-1)return!0;return!1},val:function(a){var c,d,e,g=this[0];{if(!!arguments.length){e=f.isFunction(a);return this.each(function(d){var g=f(this),h;if(this.nodeType===1){e?h=a.call(this,d,g.val()):h=a,h==null?h="":typeof h=="number"?h+="":f.isArray(h)&&(h=f.map(h,function(a){return a==null?"":a+""})),c=f.valHooks[this.nodeName.toLowerCase()]||f.valHooks[this.type];if(!c||!("set"in c)||c.set(this,h,"value")===b)this.value=h}})}if(g){c=f.valHooks[g.nodeName.toLowerCase()]||f.valHooks[g.type];if(c&&"get"in c&&(d=c.get(g,"value"))!==b)return d;d=g.value;return typeof d=="string"?d.replace(q,""):d==null?"":d}}}}),f.extend({valHooks:{option:{get:function(a){var b=a.attributes.value;return!b||b.specified?a.value:a.text}},select:{get:function(a){var b,c,d,e,g=a.selectedIndex,h=[],i=a.options,j=a.type==="select-one";if(g<0)return null;c=j?g:0,d=j?g+1:i.length;for(;c=0}),c.length||(a.selectedIndex=-1);return c}}},attrFn:{val:!0,css:!0,html:!0,text:!0,data:!0,width:!0,height:!0,offset:!0},attr:function(a,c,d,e){var g,h,i,j=a.nodeType;if(!!a&&j!==3&&j!==8&&j!==2){if(e&&c in f.attrFn)return f(a)[c](d);if(typeof a.getAttribute=="undefined")return f.prop(a,c,d);i=j!==1||!f.isXMLDoc(a),i&&(c=c.toLowerCase(),h=f.attrHooks[c]||(u.test(c)?x:w));if(d!==b){if(d===null){f.removeAttr(a,c);return}if(h&&"set"in h&&i&&(g=h.set(a,d,c))!==b)return g;a.setAttribute(c,""+d);return d}if(h&&"get"in h&&i&&(g=h.get(a,c))!==null)return g;g=a.getAttribute(c);return g===null?b:g}},removeAttr:function(a,b){var c,d,e,g,h=0;if(b&&a.nodeType===1){d=b.toLowerCase().split(p),g=d.length;for(;h=0}})});var z=/^(?:textarea|input|select)$/i,A=/^([^\.]*)?(?:\.(.+))?$/,B=/\bhover(\.\S+)?\b/,C=/^key/,D=/^(?:mouse|contextmenu)|click/,E=/^(?:focusinfocus|focusoutblur)$/,F=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,G=function(a){var b=F.exec(a);b&&(b[1]=(b[1]||"").toLowerCase(),b[3]=b[3]&&new RegExp("(?:^|\\s)"+b[3]+"(?:\\s|$)"));return b},H=function(a,b){var c=a.attributes||{};return(!b[1]||a.nodeName.toLowerCase()===b[1])&&(!b[2]||(c.id||{}).value===b[2])&&(!b[3]||b[3].test((c["class"]||{}).value))},I=function(a){return f.event.special.hover?a:a.replace(B,"mouseenter$1 mouseleave$1")}; +f.event={add:function(a,c,d,e,g){var h,i,j,k,l,m,n,o,p,q,r,s;if(!(a.nodeType===3||a.nodeType===8||!c||!d||!(h=f._data(a)))){d.handler&&(p=d,d=p.handler),d.guid||(d.guid=f.guid++),j=h.events,j||(h.events=j={}),i=h.handle,i||(h.handle=i=function(a){return typeof f!="undefined"&&(!a||f.event.triggered!==a.type)?f.event.dispatch.apply(i.elem,arguments):b},i.elem=a),c=f.trim(I(c)).split(" ");for(k=0;k=0&&(h=h.slice(0,-1),k=!0),h.indexOf(".")>=0&&(i=h.split("."),h=i.shift(),i.sort());if((!e||f.event.customEvent[h])&&!f.event.global[h])return;c=typeof c=="object"?c[f.expando]?c:new f.Event(h,c):new f.Event(h),c.type=h,c.isTrigger=!0,c.exclusive=k,c.namespace=i.join("."),c.namespace_re=c.namespace?new RegExp("(^|\\.)"+i.join("\\.(?:.*\\.)?")+"(\\.|$)"):null,o=h.indexOf(":")<0?"on"+h:"";if(!e){j=f.cache;for(l in j)j[l].events&&j[l].events[h]&&f.event.trigger(c,d,j[l].handle.elem,!0);return}c.result=b,c.target||(c.target=e),d=d!=null?f.makeArray(d):[],d.unshift(c),p=f.event.special[h]||{};if(p.trigger&&p.trigger.apply(e,d)===!1)return;r=[[e,p.bindType||h]];if(!g&&!p.noBubble&&!f.isWindow(e)){s=p.delegateType||h,m=E.test(s+h)?e:e.parentNode,n=null;for(;m;m=m.parentNode)r.push([m,s]),n=m;n&&n===e.ownerDocument&&r.push([n.defaultView||n.parentWindow||a,s])}for(l=0;le&&i.push({elem:this,matches:d.slice(e)});for(j=0;j0?this.on(b,null,a,c):this.trigger(b)},f.attrFn&&(f.attrFn[b]=!0),C.test(b)&&(f.event.fixHooks[b]=f.event.keyHooks),D.test(b)&&(f.event.fixHooks[b]=f.event.mouseHooks)}),function(){function x(a,b,c,e,f,g){for(var h=0,i=e.length;h0){k=j;break}}j=j[a]}e[h]=k}}}function w(a,b,c,e,f,g){for(var h=0,i=e.length;h+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,d="sizcache"+(Math.random()+"").replace(".",""),e=0,g=Object.prototype.toString,h=!1,i=!0,j=/\\/g,k=/\r\n/g,l=/\W/;[0,0].sort(function(){i=!1;return 0});var m=function(b,d,e,f){e=e||[],d=d||c;var h=d;if(d.nodeType!==1&&d.nodeType!==9)return[];if(!b||typeof b!="string")return e;var i,j,k,l,n,q,r,t,u=!0,v=m.isXML(d),w=[],x=b;do{a.exec(""),i=a.exec(x);if(i){x=i[3],w.push(i[1]);if(i[2]){l=i[3];break}}}while(i);if(w.length>1&&p.exec(b))if(w.length===2&&o.relative[w[0]])j=y(w[0]+w[1],d,f);else{j=o.relative[w[0]]?[d]:m(w.shift(),d);while(w.length)b=w.shift(),o.relative[b]&&(b+=w.shift()),j=y(b,j,f)}else{!f&&w.length>1&&d.nodeType===9&&!v&&o.match.ID.test(w[0])&&!o.match.ID.test(w[w.length-1])&&(n=m.find(w.shift(),d,v),d=n.expr?m.filter(n.expr,n.set)[0]:n.set[0]);if(d){n=f?{expr:w.pop(),set:s(f)}:m.find(w.pop(),w.length===1&&(w[0]==="~"||w[0]==="+")&&d.parentNode?d.parentNode:d,v),j=n.expr?m.filter(n.expr,n.set):n.set,w.length>0?k=s(j):u=!1;while(w.length)q=w.pop(),r=q,o.relative[q]?r=w.pop():q="",r==null&&(r=d),o.relative[q](k,r,v)}else k=w=[]}k||(k=j),k||m.error(q||b);if(g.call(k)==="[object Array]")if(!u)e.push.apply(e,k);else if(d&&d.nodeType===1)for(t=0;k[t]!=null;t++)k[t]&&(k[t]===!0||k[t].nodeType===1&&m.contains(d,k[t]))&&e.push(j[t]);else for(t=0;k[t]!=null;t++)k[t]&&k[t].nodeType===1&&e.push(j[t]);else s(k,e);l&&(m(l,h,e,f),m.uniqueSort(e));return e};m.uniqueSort=function(a){if(u){h=i,a.sort(u);if(h)for(var b=1;b0},m.find=function(a,b,c){var d,e,f,g,h,i;if(!a)return[];for(e=0,f=o.order.length;e":function(a,b){var c,d=typeof b=="string",e=0,f=a.length;if(d&&!l.test(b)){b=b.toLowerCase();for(;e=0)?c||d.push(h):c&&(b[g]=!1));return!1},ID:function(a){return a[1].replace(j,"")},TAG:function(a,b){return a[1].replace(j,"").toLowerCase()},CHILD:function(a){if(a[1]==="nth"){a[2]||m.error(a[0]),a[2]=a[2].replace(/^\+|\s*/g,"");var b=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(a[2]==="even"&&"2n"||a[2]==="odd"&&"2n+1"||!/\D/.test(a[2])&&"0n+"+a[2]||a[2]);a[2]=b[1]+(b[2]||1)-0,a[3]=b[3]-0}else a[2]&&m.error(a[0]);a[0]=e++;return a},ATTR:function(a,b,c,d,e,f){var g=a[1]=a[1].replace(j,"");!f&&o.attrMap[g]&&(a[1]=o.attrMap[g]),a[4]=(a[4]||a[5]||"").replace(j,""),a[2]==="~="&&(a[4]=" "+a[4]+" ");return a},PSEUDO:function(b,c,d,e,f){if(b[1]==="not")if((a.exec(b[3])||"").length>1||/^\w/.test(b[3]))b[3]=m(b[3],null,null,c);else{var g=m.filter(b[3],c,d,!0^f);d||e.push.apply(e,g);return!1}else if(o.match.POS.test(b[0])||o.match.CHILD.test(b[0]))return!0;return b},POS:function(a){a.unshift(!0);return a}},filters:{enabled:function(a){return a.disabled===!1&&a.type!=="hidden"},disabled:function(a){return a.disabled===!0},checked:function(a){return a.checked===!0},selected:function(a){a.parentNode&&a.parentNode.selectedIndex;return a.selected===!0},parent:function(a){return!!a.firstChild},empty:function(a){return!a.firstChild},has:function(a,b,c){return!!m(c[3],a).length},header:function(a){return/h\d/i.test(a.nodeName)},text:function(a){var b=a.getAttribute("type"),c=a.type;return a.nodeName.toLowerCase()==="input"&&"text"===c&&(b===c||b===null)},radio:function(a){return a.nodeName.toLowerCase()==="input"&&"radio"===a.type},checkbox:function(a){return a.nodeName.toLowerCase()==="input"&&"checkbox"===a.type},file:function(a){return a.nodeName.toLowerCase()==="input"&&"file"===a.type},password:function(a){return a.nodeName.toLowerCase()==="input"&&"password"===a.type},submit:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"submit"===a.type},image:function(a){return a.nodeName.toLowerCase()==="input"&&"image"===a.type},reset:function(a){var b=a.nodeName.toLowerCase();return(b==="input"||b==="button")&&"reset"===a.type},button:function(a){var b=a.nodeName.toLowerCase();return b==="input"&&"button"===a.type||b==="button"},input:function(a){return/input|select|textarea|button/i.test(a.nodeName)},focus:function(a){return a===a.ownerDocument.activeElement}},setFilters:{first:function(a,b){return b===0},last:function(a,b,c,d){return b===d.length-1},even:function(a,b){return b%2===0},odd:function(a,b){return b%2===1},lt:function(a,b,c){return bc[3]-0},nth:function(a,b,c){return c[3]-0===b},eq:function(a,b,c){return c[3]-0===b}},filter:{PSEUDO:function(a,b,c,d){var e=b[1],f=o.filters[e];if(f)return f(a,c,b,d);if(e==="contains")return(a.textContent||a.innerText||n([a])||"").indexOf(b[3])>=0;if(e==="not"){var g=b[3];for(var h=0,i=g.length;h=0}},ID:function(a,b){return a.nodeType===1&&a.getAttribute("id")===b},TAG:function(a,b){return b==="*"&&a.nodeType===1||!!a.nodeName&&a.nodeName.toLowerCase()===b},CLASS:function(a,b){return(" "+(a.className||a.getAttribute("class"))+" ").indexOf(b)>-1},ATTR:function(a,b){var c=b[1],d=m.attr?m.attr(a,c):o.attrHandle[c]?o.attrHandle[c](a):a[c]!=null?a[c]:a.getAttribute(c),e=d+"",f=b[2],g=b[4];return d==null?f==="!=":!f&&m.attr?d!=null:f==="="?e===g:f==="*="?e.indexOf(g)>=0:f==="~="?(" "+e+" ").indexOf(g)>=0:g?f==="!="?e!==g:f==="^="?e.indexOf(g)===0:f==="$="?e.substr(e.length-g.length)===g:f==="|="?e===g||e.substr(0,g.length+1)===g+"-":!1:e&&d!==!1},POS:function(a,b,c,d){var e=b[2],f=o.setFilters[e];if(f)return f(a,c,b,d)}}},p=o.match.POS,q=function(a,b){return"\\"+(b-0+1)};for(var r in o.match)o.match[r]=new RegExp(o.match[r].source+/(?![^\[]*\])(?![^\(]*\))/.source),o.leftMatch[r]=new RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[r].source.replace(/\\(\d+)/g,q));var s=function(a,b){a=Array.prototype.slice.call(a,0);if(b){b.push.apply(b,a);return b}return a};try{Array.prototype.slice.call(c.documentElement.childNodes,0)[0].nodeType}catch(t){s=function(a,b){var c=0,d=b||[];if(g.call(a)==="[object Array]")Array.prototype.push.apply(d,a);else if(typeof a.length=="number")for(var e=a.length;c",e.insertBefore(a,e.firstChild),c.getElementById(d)&&(o.find.ID=function(a,c,d){if(typeof c.getElementById!="undefined"&&!d){var e=c.getElementById(a[1]);return e?e.id===a[1]||typeof e.getAttributeNode!="undefined"&&e.getAttributeNode("id").nodeValue===a[1]?[e]:b:[]}},o.filter.ID=function(a,b){var c=typeof a.getAttributeNode!="undefined"&&a.getAttributeNode("id");return a.nodeType===1&&c&&c.nodeValue===b}),e.removeChild(a),e=a=null}(),function(){var a=c.createElement("div");a.appendChild(c.createComment("")),a.getElementsByTagName("*").length>0&&(o.find.TAG=function(a,b){var c=b.getElementsByTagName(a[1]);if(a[1]==="*"){var d=[];for(var e=0;c[e];e++)c[e].nodeType===1&&d.push(c[e]);c=d}return c}),a.innerHTML="",a.firstChild&&typeof a.firstChild.getAttribute!="undefined"&&a.firstChild.getAttribute("href")!=="#"&&(o.attrHandle.href=function(a){return a.getAttribute("href",2)}),a=null}(),c.querySelectorAll&&function(){var a=m,b=c.createElement("div"),d="__sizzle__";b.innerHTML="

";if(!b.querySelectorAll||b.querySelectorAll(".TEST").length!==0){m=function(b,e,f,g){e=e||c;if(!g&&!m.isXML(e)){var h=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b);if(h&&(e.nodeType===1||e.nodeType===9)){if(h[1])return s(e.getElementsByTagName(b),f);if(h[2]&&o.find.CLASS&&e.getElementsByClassName)return s(e.getElementsByClassName(h[2]),f)}if(e.nodeType===9){if(b==="body"&&e.body)return s([e.body],f);if(h&&h[3]){var i=e.getElementById(h[3]);if(!i||!i.parentNode)return s([],f);if(i.id===h[3])return s([i],f)}try{return s(e.querySelectorAll(b),f)}catch(j){}}else if(e.nodeType===1&&e.nodeName.toLowerCase()!=="object"){var k=e,l=e.getAttribute("id"),n=l||d,p=e.parentNode,q=/^\s*[+~]/.test(b);l?n=n.replace(/'/g,"\\$&"):e.setAttribute("id",n),q&&p&&(e=e.parentNode);try{if(!q||p)return s(e.querySelectorAll("[id='"+n+"'] "+b),f)}catch(r){}finally{l||k.removeAttribute("id")}}}return a(b,e,f,g)};for(var e in a)m[e]=a[e];b=null}}(),function(){var a=c.documentElement,b=a.matchesSelector||a.mozMatchesSelector||a.webkitMatchesSelector||a.msMatchesSelector;if(b){var d=!b.call(c.createElement("div"),"div"),e=!1;try{b.call(c.documentElement,"[test!='']:sizzle")}catch(f){e=!0}m.matchesSelector=function(a,c){c=c.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!m.isXML(a))try{if(e||!o.match.PSEUDO.test(c)&&!/!=/.test(c)){var f=b.call(a,c);if(f||!d||a.document&&a.document.nodeType!==11)return f}}catch(g){}return m(c,null,null,[a]).length>0}}}(),function(){var a=c.createElement("div");a.innerHTML="
";if(!!a.getElementsByClassName&&a.getElementsByClassName("e").length!==0){a.lastChild.className="e";if(a.getElementsByClassName("e").length===1)return;o.order.splice(1,0,"CLASS"),o.find.CLASS=function(a,b,c){if(typeof b.getElementsByClassName!="undefined"&&!c)return b.getElementsByClassName(a[1])},a=null}}(),c.documentElement.contains?m.contains=function(a,b){return a!==b&&(a.contains?a.contains(b):!0)}:c.documentElement.compareDocumentPosition?m.contains=function(a,b){return!!(a.compareDocumentPosition(b)&16)}:m.contains=function(){return!1},m.isXML=function(a){var b=(a?a.ownerDocument||a:0).documentElement;return b?b.nodeName!=="HTML":!1};var y=function(a,b,c){var d,e=[],f="",g=b.nodeType?[b]:b;while(d=o.match.PSEUDO.exec(a))f+=d[0],a=a.replace(o.match.PSEUDO,"");a=o.relative[a]?a+"*":a;for(var h=0,i=g.length;h0)for(h=g;h=0:f.filter(a,this).length>0:this.filter(a).length>0)},closest:function(a,b){var c=[],d,e,g=this[0];if(f.isArray(a)){var h=1;while(g&&g.ownerDocument&&g!==b){for(d=0;d-1:f.find.matchesSelector(g,a)){c.push(g);break}g=g.parentNode;if(!g||!g.ownerDocument||g===b||g.nodeType===11)break}}c=c.length>1?f.unique(c):c;return this.pushStack(c,"closest",a)},index:function(a){if(!a)return this[0]&&this[0].parentNode?this.prevAll().length:-1;if(typeof a=="string")return f.inArray(this[0],f(a));return f.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var c=typeof a=="string"?f(a,b):f.makeArray(a&&a.nodeType?[a]:a),d=f.merge(this.get(),c);return this.pushStack(S(c[0])||S(d[0])?d:f.unique(d))},andSelf:function(){return this.add(this.prevObject)}}),f.each({parent:function(a){var b=a.parentNode;return b&&b.nodeType!==11?b:null},parents:function(a){return f.dir(a,"parentNode")},parentsUntil:function(a,b,c){return f.dir(a,"parentNode",c)},next:function(a){return f.nth(a,2,"nextSibling")},prev:function(a){return f.nth(a,2,"previousSibling")},nextAll:function(a){return f.dir(a,"nextSibling")},prevAll:function(a){return f.dir(a,"previousSibling")},nextUntil:function(a,b,c){return f.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return f.dir(a,"previousSibling",c)},siblings:function(a){return f.sibling(a.parentNode.firstChild,a)},children:function(a){return f.sibling(a.firstChild)},contents:function(a){return f.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:f.makeArray(a.childNodes)}},function(a,b){f.fn[a]=function(c,d){var e=f.map(this,b,c);L.test(a)||(d=c),d&&typeof d=="string"&&(e=f.filter(d,e)),e=this.length>1&&!R[a]?f.unique(e):e,(this.length>1||N.test(d))&&M.test(a)&&(e=e.reverse());return this.pushStack(e,a,P.call(arguments).join(","))}}),f.extend({filter:function(a,b,c){c&&(a=":not("+a+")");return b.length===1?f.find.matchesSelector(b[0],a)?[b[0]]:[]:f.find.matches(a,b)},dir:function(a,c,d){var e=[],g=a[c];while(g&&g.nodeType!==9&&(d===b||g.nodeType!==1||!f(g).is(d)))g.nodeType===1&&e.push(g),g=g[c];return e},nth:function(a,b,c,d){b=b||1;var e=0;for(;a;a=a[c])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){var c=[];for(;a;a=a.nextSibling)a.nodeType===1&&a!==b&&c.push(a);return c}});var V="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",W=/ jQuery\d+="(?:\d+|null)"/g,X=/^\s+/,Y=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Z=/<([\w:]+)/,$=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]},bh=U(c);bg.optgroup=bg.option,bg.tbody=bg.tfoot=bg.colgroup=bg.caption=bg.thead,bg.th=bg.td,f.support.htmlSerialize||(bg._default=[1,"div
","
"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function() +{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1>");try{for(var c=0,d=this.length;c1&&l0?this.clone(!0):this).get();f(e[h])[b](j),d=d.concat(j)}return this.pushStack(d,a,e.selector)}}),f.extend({clone:function(a,b,c){var d,e,g,h=f.support.html5Clone||!bc.test("<"+a.nodeName)?a.cloneNode(!0):bo(a);if((!f.support.noCloneEvent||!f.support.noCloneChecked)&&(a.nodeType===1||a.nodeType===11)&&!f.isXMLDoc(a)){bk(a,h),d=bl(a),e=bl(h);for(g=0;d[g];++g)e[g]&&bk(d[g],e[g])}if(b){bj(a,h);if(c){d=bl(a),e=bl(h);for(g=0;d[g];++g)bj(d[g],e[g])}}d=e=null;return h},clean:function(a,b,d,e){var g;b=b||c,typeof b.createElement=="undefined"&&(b=b.ownerDocument||b[0]&&b[0].ownerDocument||c);var h=[],i;for(var j=0,k;(k=a[j])!=null;j++){typeof k=="number"&&(k+="");if(!k)continue;if(typeof k=="string")if(!_.test(k))k=b.createTextNode(k);else{k=k.replace(Y,"<$1>");var l=(Z.exec(k)||["",""])[1].toLowerCase(),m=bg[l]||bg._default,n=m[0],o=b.createElement("div");b===c?bh.appendChild(o):U(b).appendChild(o),o.innerHTML=m[1]+k+m[2];while(n--)o=o.lastChild;if(!f.support.tbody){var p=$.test(k),q=l==="table"&&!p?o.firstChild&&o.firstChild.childNodes:m[1]===""&&!p?o.childNodes:[];for(i=q.length-1;i>=0;--i)f.nodeName(q[i],"tbody")&&!q[i].childNodes.length&&q[i].parentNode.removeChild(q[i])}!f.support.leadingWhitespace&&X.test(k)&&o.insertBefore(b.createTextNode(X.exec(k)[0]),o.firstChild),k=o.childNodes}var r;if(!f.support.appendChecked)if(k[0]&&typeof (r=k.length)=="number")for(i=0;i=0)return b+"px"}}}),f.support.opacity||(f.cssHooks.opacity={get:function(a,b){return br.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=f.isNumeric(b)?"alpha(opacity="+b*100+")":"",g=d&&d.filter||c.filter||"";c.zoom=1;if(b>=1&&f.trim(g.replace(bq,""))===""){c.removeAttribute("filter");if(d&&!d.filter)return}c.filter=bq.test(g)?g.replace(bq,e):g+" "+e}}),f(function(){f.support.reliableMarginRight||(f.cssHooks.marginRight={get:function(a,b){var c;f.swap(a,{display:"inline-block"},function(){b?c=bz(a,"margin-right","marginRight"):c=a.style.marginRight});return c}})}),c.defaultView&&c.defaultView.getComputedStyle&&(bA=function(a,b){var c,d,e;b=b.replace(bs,"-$1").toLowerCase(),(d=a.ownerDocument.defaultView)&&(e=d.getComputedStyle(a,null))&&(c=e.getPropertyValue(b),c===""&&!f.contains(a.ownerDocument.documentElement,a)&&(c=f.style(a,b)));return c}),c.documentElement.currentStyle&&(bB=function(a,b){var c,d,e,f=a.currentStyle&&a.currentStyle[b],g=a.style;f===null&&g&&(e=g[b])&&(f=e),!bt.test(f)&&bu.test(f)&&(c=g.left,d=a.runtimeStyle&&a.runtimeStyle.left,d&&(a.runtimeStyle.left=a.currentStyle.left),g.left=b==="fontSize"?"1em":f||0,f=g.pixelLeft+"px",g.left=c,d&&(a.runtimeStyle.left=d));return f===""?"auto":f}),bz=bA||bB,f.expr&&f.expr.filters&&(f.expr.filters.hidden=function(a){var b=a.offsetWidth,c=a.offsetHeight;return b===0&&c===0||!f.support.reliableHiddenOffsets&&(a.style&&a.style.display||f.css(a,"display"))==="none"},f.expr.filters.visible=function(a){return!f.expr.filters.hidden(a)});var bD=/%20/g,bE=/\[\]$/,bF=/\r?\n/g,bG=/#.*$/,bH=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,bI=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,bJ=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,bK=/^(?:GET|HEAD)$/,bL=/^\/\//,bM=/\?/,bN=/)<[^<]*)*<\/script>/gi,bO=/^(?:select|textarea)/i,bP=/\s+/,bQ=/([?&])_=[^&]*/,bR=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bS=f.fn.load,bT={},bU={},bV,bW,bX=["*/"]+["*"];try{bV=e.href}catch(bY){bV=c.createElement("a"),bV.href="",bV=bV.href}bW=bR.exec(bV.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bS)return bS.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("
").append(c.replace(bN,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bO.test(this.nodeName)||bI.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bF,"\r\n")}}):{name:b.name,value:c.replace(bF,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b_(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b_(a,b);return a},ajaxSettings:{url:bV,isLocal:bJ.test(bW[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bX},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bZ(bT),ajaxTransport:bZ(bU),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?cb(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cc(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bH.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bG,"").replace(bL,bW[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bP),d.crossDomain==null&&(r=bR.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bW[1]&&r[2]==bW[2]&&(r[3]||(r[1]==="http:"?80:443))==(bW[3]||(bW[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bT,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bK.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bM.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bQ,"$1_="+x);d.url=y+(y===d.url?(bM.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bX+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bU,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)ca(g,a[g],c,e);return d.join("&").replace(bD,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cd=f.now(),ce=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cd++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ce.test(b.url)||e&&ce.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ce,l),b.url===j&&(e&&(k=k.replace(ce,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cf=a.ActiveXObject?function(){for(var a in ch)ch[a](0,1)}:!1,cg=0,ch;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ci()||cj()}:ci,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cf&&delete ch[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cg,cf&&(ch||(ch={},f(a).unload(cf)),ch[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var ck={},cl,cm,cn=/^(?:toggle|show|hide)$/,co=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cp,cq=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cr;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,d,"padding")):this[d]():null},f.fn["outer"+c]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,d,a?"margin":"border")):this[d]():null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNumeric(j)?j:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window); \ No newline at end of file diff --git a/rapsberrypi/web/JSfiles/nond3works.js b/rapsberrypi/web/JSfiles/nond3works.js new file mode 100644 index 000000000..2d0ffcec9 --- /dev/null +++ b/rapsberrypi/web/JSfiles/nond3works.js @@ -0,0 +1,94 @@ +document.getElementById("class1text").addEventListener("mouseover", mouseOverClass1); +document.getElementById("class1text").addEventListener("mouseout", mouseOutClass1); + +document.getElementById("class2text").addEventListener("mouseover", mouseOverClass2); +document.getElementById("class2text").addEventListener("mouseout", mouseOutClass2); + +document.getElementById("class3text").addEventListener("mouseover", mouseOverClass3); +document.getElementById("class3text").addEventListener("mouseout", mouseOutClass3); + + + +function mouseOverClass1() { + +console.log(document.getElementsByClassName("0")); +// change all the circle elements with class "0" to red + + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + + + + // make .style("stroke", "red") + document.getElementsByClassName("0")[i].style.stroke = "white"; + +} + +} + +function mouseOutClass1() { +console.log(document.getElementsByClassName("0")); + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + document.getElementsByClassName("0")[i].style.stroke = "black"; + +} +} + + + +function mouseOverClass2() { + + console.log(document.getElementsByClassName("0")); + // change all the circle elements with class "0" to red + + + for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + + + + // make .style("stroke", "red") + document.getElementsByClassName("1")[i].style.stroke = "white"; + + } + + } + +function mouseOutClass2() { +console.log(document.getElementsByClassName("0")); + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + document.getElementsByClassName("1")[i].style.stroke = "black"; + +} +} + + + +function mouseOverClass3() { + + console.log(document.getElementsByClassName("0")); + // change all the circle elements with class "0" to red + + + for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + + + + // make .style("stroke", "red") + document.getElementsByClassName("2")[i].style.stroke = "white"; + + } + + } + +function mouseOutClass3() { +console.log(document.getElementsByClassName("0")); + +for (var i = 0; i < document.getElementsByClassName("0").length; i++) { + document.getElementsByClassName("2")[i].style.stroke = "black"; + +} +} + + diff --git a/rapsberrypi/web/JSfiles/test.js b/rapsberrypi/web/JSfiles/test.js new file mode 100644 index 000000000..0c077dda3 --- /dev/null +++ b/rapsberrypi/web/JSfiles/test.js @@ -0,0 +1,763 @@ +function decisiontree() { + + d3=d3v3 + + + var label_names; + + var TOTAL_SIZE; + // default_colors = [ + // "#c25975", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + + + default_colors = [ + "#74BFA1", "#E37852", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#18dcdc", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + ] + + + + // default_colors = [ + // "#18dcdc", "#d26bff", "#2d5a47", "#093868", "#fcdfe6", "#94a2fa", "#faec94", "#decaee", "#daeeca", "#b54c0a", "#dc1818", "#c25975", "#000000", "#340000", "#86194c", "#fef65b", "#ff9b6f", "#491b47", "#171717", "#e8efec", "#1c6047", "#a2bae0", "#4978c3", "#f8fee0", "#dcfb66", "#91fb66", "#29663b", "#b4b7be", "#0088b2", "#88b200", "#c43210", "#f06848", "#f0bc48", "#d293a2", "#cccccc", "#59596a", "#fafae6", "#ffc125", "#ff4e50", "#f0e6fa", "#f6c1c3", "#363636" + // ] + + // differnt combination of colors + // default_colors = + + + + + //************************************* Options******************************************************// + + // var file_name = "structureC1.json" // generator_1 + // var file_namev2 = "structureC2_origin.json" // generator_2 + + var file_name = "structure_iris_dc_1.json" // generator_1 + var file_namev2 = "structure_iris_dc_1.json" // generator_2 + + // var file_name = "structure_iris_dc_1_80_size.json" // generator_1 + // var file_namev2 = "structure_iris_dc_1_80_size.json" // generator_2 + + // var file_name = "structure.json" // generator_1 + // var file_namev2 = "structure.json" // generator_2 + var version2 = true // if true json from generator_2 will be used + + + var tree_branch = false // if the thickness of the branches depend on the value of targt + color * / + var tree_branch_parent = true // true: thickness from the root if not the direct parent + // var tree_branch_color = "black" + + var tree_branch_color = "#A3A6A8" + var strokeness = 120 // the degree of separation between the nodes + var default_strokeness = 50 + var hover_percent_parent = false // if the display percentage depends on the direct parent or the root + var square = false + var rect_percent = true //display the percentage or the value in the small rectangles of the labels + var value_percent_top = true /// if we display the value and the percentage above the rectangle / + + var dict_leaf_y = { 1: 0, 2: -17.5, 3: -35, 4: -52.5, 5: -70, 6: -87.5, 6: -105, 7: -122.5, 8: -140, 9: -157.5, 10: -175 } + + + /****************************************************************************************************** */ + + + + + getDepth = function (obj) { + var depth = 0; + if (obj.children) { + obj.children.forEach(function (d) { + var tmpDepth = getDepth(d) + if (tmpDepth > depth) { + depth = tmpDepth + } + }) + } + return 1 + depth + } + + + // var margin = { top: 20, right: 120, bottom: 20, left: 180 }, + // width = 2000 + 960 - margin.right - margin.left, + // height = 800 - margin.top - margin.bottom; + + // current + // var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + // width = 500 - margin.left - margin.right, + // height = 350 * 600 / 500 - margin.top - margin.bottom; + + + var margin = { top: 30, right: 30, bottom: 30, left: 0 }, + width = 700 - margin.left - margin.right, + height = 350 * 600 / 500 - margin.top - margin.bottom; + + var i = 0, + duration = 550, + root; + + var tree + var diagonal + var svg + + var filetochoose = version2 ? file_namev2 : file_name + + d3.json(filetochoose, function (error, flare) { + if (error) throw error; + + console.log(getDepth(flare)) + + + tree = d3.layout.tree() + .separation(function (a, b) { return ((a.parent == root) && (b.parent == root)) ? strokeness : strokeness; }) + .size([height, getDepth(flare) * width / 8]); + + diagonal = d3.svg.diagonal() + .projection(function (d) { return [d.y, d.x]; }); + + // svg = d3.select("body").append("svg") + // .attr("width", getDepth(flare) * width / 8 + margin.right + margin.left) + // .attr("height", height + margin.top + margin.bottom) + // .append("g") + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); + + + + + svg = d3.select("#dataviz_area_div") + .append("svg") + .attr("id", "dataviz_area_div_svg") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + // .attr("transform", "translate(" + margin.left + "," + margin.top + ")") + // .attr("viewBox", `-25 -15 400 250`) + // .attr("viewBox", `-30 -30 500 400`) + // current + // .attr("viewBox", `-90 -30 500 400`) + // .attr("viewBox", `-90 -30 600 800`) + // .attr("viewBox", `-90 -30 600 500`) + .attr("viewBox", `30 -80 600 600`) + + + + TOTAL_SIZE = flare.size + l = flare.pred.replace(/of/g, "").split(', ') + for (var j = 0; j < l.length; j++) { + l[j] = l[j].split(' ')[2] + } + label_names = l + + + root = flare; + root.x0 = height / 2; + root.y0 = 0; + + function collapse(d) { + if (d.children) { + d._children = d.children; + d._children.forEach(collapse); + d.children = null; + } + } + + root.children.forEach(collapse); + update(root, l.length); + // createLabels(l); + }); + + d3.select(self.frameElement).style("height", "480px"); + + function update(source, n_labels) { + + + // Compute the new tree layout. + var nodes = tree.nodes(root).reverse(), + links = tree.links(nodes); + tpaths = tree.links(nodes); + + // Normalize for fixed-depth. + nodes.forEach(function (d) { d.y = d.depth * 180; }); + + // Update the nodes… + var node = svg.selectAll("g.node") + .data(nodes, function (d) { return d.id || (d.id = ++i); }); + + // Enter any new nodes at the parent's previous position. + var nodeEnter = node.enter().append("g") + .attr("class", "node") + .attr("transform", function (d) { return "translate(" + source.y0 + "," + source.x0 + ")"; }) + .on("click", click); + + nodeEnter.append("circle") + .attr("r", 1e-6) + .style("fill", function (d) { + + return d._children ? "lightsteelblue" : "#fff"; + }); + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.name+' '+d.pred : d.name; }) + // .style("fill-opacity", 1e-6); + + function getTextWidth(text, fontSize, fontFace) { + var a = document.createElement('canvas'); + var b = a.getContext('2d'); + b.font = fontSize + 'px ' + fontFace; + return b.measureText(text).width; + } + + + + var rect = nodeEnter.append("rect") + .attr("width", 133 + 8) + .attr("height", 70) + .attr("x", -80) + .attr("y", -80) + .attr("rx", 6) + .attr("ry", 6) + .style("fill", function (d) { return (d.children || d._children) || version2 ? "#f0f0f0" : "#ffffff" }) + .style("stroke", function (d) { return (d.children || d._children) || version2 ? "rgb(155, 155, 155)" : "#ffffff" }) + .style("visibility", function (d) { return (d.children || d._children) || version2 ? "visible" : "hidden" }) + + nodeEnter.append("svg:image") + .attr("xlink:href", function (d) { return ((d.children || d._children) || version2) && d.type == 'categorical' ? 'http://fractalytics.io/wp-content/uploads/2019/05/cat.png' : 'http://fractalytics.io/wp-content/uploads/2019/05/num.png' }) + .attr("x", "-76") + .attr("y", "-74") + .attr("width", "20") + .attr("height", "20") + .style("visibility", function (d) { + if (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? 'hidden' : 'visible' + } + else return (d.children || d._children) || version2 ? "visible" : "hidden" + }); + + nodeEnter.append("text") + .attr("x", function (d) { + ttr = 13 + if (default_colors.length > 5) { + ttr = (40 * default_colors.length) / 2 + } + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%", 10, 'Verdana') + 5.7) - (133 + 8)) / 2 : ttr + }) + .attr("y", function (d) { + ttr = dict_leaf_y[label_names.length] - 15 + if (default_colors.length > 5) { + ttr = -20 + } + return (d.children || d._children) || version2 ? -87 : ttr; + + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "10px") + .style("font-family", "Verdana") + .style("stroke", "#c2c2c2") + .style("stroke-width", "0.05em") + .text(function (d) { return true ? d.size + " / " + (d.size * 100 / TOTAL_SIZE).toFixed(0) + "%" : ""; }) + .attr('visibility', function () { + return value_percent_top ? 'visible' : 'hidden' + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { + if (((d.children || d._children) || version2) && d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 11) { + return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + } + else return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].substring(0, 11), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 + }) + .attr("y", function (d) { + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return -65 + else return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? -55 : -65 + }) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "14px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.05em") + + .text(function (d) { + if ((d.children || d._children) || version2) { + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1].length <= 15 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : (d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1]).substring(0, 13) + '..' + + } + else return ""; + }) + .append('svg:title') + .text(function (d) { + return (d.children || d._children) || version2 ? d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] : "" + }) + + + + + nodeEnter.append("text") + .attr("x", function (d) { return (d.children || d._children) || version2 ? -75 - ((getTextWidth(d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('=', ''), 14, 'Verdana') + 5.7) - (133 + 8)) / 2 : 0 }) + .attr("y", -45) + .attr("dy", ".35em") + .attr("text-anchor", "start") + .style("font-size", "12px") + .style("font-family", "Verdana") + .style("stroke", "black") + .style("stroke-width", "0.04em") + .text(function (d) { + + var toreturn = (d.children || d._children) || version2 ? d.name.replace(d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1], '').replace('!=', 'not').replace(/=|\!=/g, '').replace('<', '<=') : ""; + if (!d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)) return toreturn + return d.name.match(/(.*?)(<|>|=|!=|<=|>=|=<|=>)/i)[1] == 'Root ' ? '' : toreturn + }) + + + var labels_w = 133 / n_labels + for (var j = 0; j < n_labels; j++) { + var curr = j + + + + nodeEnter.append("rect") + .attr("width", function (d) { + var v; + if (d.pred) { + console.log(parseInt(d.pred.split(",")[curr].match(/\d+/)[0]), ' *133/', d.size) + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 133 / d.size; + } + else if (!d.children) { + v = 40 + } + + if (square) return (d.children || d._children) || version2 ? 133 / label_names.length - 4 : 40 + else return (d.children || d._children) || version2 ? v : 40 + }) + .attr("height", 20) + .attr('rx', function (d) { return square ? 0 : 4 }) + .attr('ry', function (d) { return square ? 0 : 4 }) + .attr("x", function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 13 + if (default_colors.length > 5) { + ttr = 10 + j * 45 + } + + + if (square) return (d.children || d._children) || version2 ? -76 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -76 + ttl : ttr + }) + .attr("y", (function (d) { + console.log(default_colors.length) + if (default_colors.length > 5) { + return (d.children || d._children) || version2 ? -34 : -10 + } else return (d.children || d._children) || version2 ? -34 : dict_leaf_y[label_names.length] - 4 + 20 * j + j * 4; + })) + .style("fill", function (d) { + if (default_colors.length == 0) { + return default_colors[j] + } else { + return default_colors[j] + } + + } + ) + .attr('visibility', function (d) { + + if (d.pred) { + v = parseInt(d.pred.split(",")[curr].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[curr].match(/\d+/)[0]); + v = v * 133 / d.size + return v != 0 || !d.children ? "visible" : "hidden" + }) + .attr('opacity', function (d) { + var val + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + val = (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + } + else if (!d.children) val = (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + return (d.children || d._children) || version2 ? 1 : val / 100 + 0.3 + + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + + + + + var subg = nodeEnter.append("g") + .attr("width", labels_w) + .attr("height", 20) + .attr("x", function (d) { + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + return -80 + ttl + + }) + .attr("y", -30) + + + subg.append("text") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + .attr("x", (function (d) { + + var v; + var ttl = 0 + if (curr > 0) { + + for (var l = 0; l <= curr - 1; l++) { + if (d.pred) { + v = parseInt(d.pred.split(",")[l].match(/\d+/)[0]); + } + else if (!d.children) v = parseInt(d.name.split(",")[l].match(/\d+/)[0]); + ttl = ttl + v * 133 / d.size + } + + } else { + ttl = 0 + } + + ttr = 18 + if (default_colors.length > 5) { + ttr = 14 + j * 45 + } + + if (square) return (d.children || d._children) || version2 ? -71 + j * (133 / label_names.length) : ttr + else return (d.children || d._children) || version2 ? -71 + ttl : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 5 + } + + return (d.children || d._children) || version2 ? -19 : ttr; + + })) + .style("fill", "white") + .style("font-size", "12px") + .attr('visibility', function (d) { + if (d.pred && !square) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) > 20 ? "vivible" : "hidden" + } + }) + .append("svg:title") + .text(function (d) { + if (d.pred) { + // console.log(d.pred.split(",")[curr].match(/\d+/)[0]) + return !rect_percent ? d.pred.split(",")[curr].match(/\d+/)[0] : (parseInt(d.pred.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + } + else if (!d.children) return !rect_percent ? d.name.split(",")[curr].match(/\d+/)[0] : (parseInt(d.name.split(",")[curr].match(/\d+/)[0]) * 100 / d.size).toFixed(0) + "%" + + }) + + subg.append('text') + .text(function (d) { + if (d.pred) { + return '' + } + else if (!d.children) { + return label_names[curr] + } + }) + .attr("x", (function (d) { + ttr = 60 + if (default_colors.length > 5) { + ttr = 18 + j * 45 + } + return (d.children || d._children) || version2 ? -66 + j * labels_w : ttr + })) + .attr("y", (function (d) { + ttr = dict_leaf_y[label_names.length] + 10 + 20 * j + j * 4 + if (default_colors.length > 5) { + ttr = 25 + } + return (d.children || d._children) || version2 ? -15 : ttr; + })) + .style("font-size", "14px") + .style("fill", "rgb(78, 74, 74)") + .attr('transform', function (d) { + + return default_colors.length <= 5 ? '' : 'translate(' + (-30 + j * 20) + ',' + (10 + j * (-37)) + ') rotate(55 50 50)' + }) + + + + } + + + + // nodeEnter.append("text") + // .attr("x", function(d) { return (d.children || d._children) || version2 ? -10 : 10; }) + // .attr("dy", ".35em") + // .attr("text-anchor", function(d) { return (d.children || d._children) || version2 ? "end" : "start"; }) + // .text(function(d) { return d.pred ? d.pred : ''; }) + // .style("fill-opacity", 1e-6) + + + + // Transition nodes to their new position. + var nodeUpdate = node.transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + d.y + "," + d.x + ")"; }); + + nodeUpdate.select("circle") + .attr("r", 10) + .style("fill", function (d) { return d._children ? "lightsteelblue" : "#fff"; }); + + nodeUpdate.select("text") + .style("fill-opacity", 1); + + // Transition exiting nodes to the parent's new position. + var nodeExit = node.exit().transition() + .duration(duration) + .attr("transform", function (d) { return "translate(" + source.y + "," + source.x + ")"; }) + .remove(); + + nodeExit.select("circle") + .attr("r", 1e-6); + + nodeExit.select("text") + .style("fill-opacity", 1e-6); + + // Update the links… + var link = svg.selectAll("path.link") + .data(links, function (d) { return d.target.id; }); + + + if (tree_branch) var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, default_strokeness]); + else var link_stoke_scale = d3.scale.linear().domain([0, 100]).range([1.5, 8]); + + var color = d3.scale.linear() + .domain([0, 50, 100]) + .range(["rgb(2, 255, 219)", "blue"]); + + + // Enter any new links at the parent's previous position. + link.enter().insert("path", "g") + .attr("class", "link") + .attr("id", function (d) { return d.target.id; }) + .attr("d", function (d) { + var o = { x: source.x0, y: source.y0 }; + return diagonal({ source: o, target: o }); + }) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }) + .style("stroke", function (d) { + + if (!d.target) { + return "#fff" + // return "#A3A6A8" + } + else return tree_branch_color; + }) + .append("svg:title") + .text(function (d, i) { + if (hover_percent_parent) { + var val = ((d.target.size / TOTAL_SIZE) * 100).toFixed(2); + } else { + var val = ((d.target.size / d.source.size) * 100).toFixed(2); + } + + return val + "%" + }) + + var tlink = svg.selectAll("text.tlink") + .data(tpaths, function (d) { return d.target.id; }); + + tlink.enter().insert("text", "g") + .attr("class", "tlink") + .attr("dy", function (d) { return d.target.side == "left" ? -10 : 15; }) + .append('textPath') + .attr("xlink:href", function (d) { return '#' + d.target.id; }) //place the ID of the path here + .style("text-anchor", "middle") //place the text halfway on the arc + .attr("startOffset", "45%") + .text(function (d) { return d.target.side == "left" ? "No" : "Yes"; }) + .attr('visibility', function (d) { return d.target.depth == 1 && !version2 ? 'visible' : 'hidden' }) + .attr("opacity", 0.5) + + + tlink.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Transition links to their new position. + link.transition() + .duration(duration) + .attr("d", diagonal) + .style("stroke-width", function (d) { + + if (!d.target) { + return link_stoke_scale(50) + } + else { + if (tree_branch) { + // console.log(d.target.size,'*100/',TOTAL_SIZE,link_stoke_scale(d.target.size*100/TOTAL_SIZE),tree_branch_parent) + // console.log(d.target.size,'*100/',d.source.size,link_stoke_scale(d.target.size*100/d.source.size),tree_branch_parent) + + return tree_branch_parent ? link_stoke_scale(d.target.size * 100 / TOTAL_SIZE) : link_stoke_scale(d.target.size * 100 / d.source.size) + } else { + + return link_stoke_scale(50) + } + } + }); + + + // Transition exiting nodes to the parent's new position. + link.exit().transition() + .duration(duration) + .attr("d", function (d) { + var o = { x: source.x, y: source.y }; + return diagonal({ source: o, target: o }); + }) + .remove(); + + // Stash the old positions for transition. + nodes.forEach(function (d) { + d.x0 = d.x; + d.y0 = d.y; + }); + + + // Toggle children on click. + function click(d) { + console.log(d) + + if (d.children) { + d._children = d.children; + d.children = null; + } else { + d.children = d._children; + d._children = null; + } + update(d, n_labels); + + } + + + } + + + + + function createLabels(labels) { + + + var Size = 400 + + + var svg1 = d3.select("body") + .append("svg") + .attr("width", Size) + .attr("height", Size) + .attr("class", "legends"); + + console.log(labels.length) + console.log(default_colors.slice(0, labels.length)) + default_colors = default_colors.slice(0, labels.length) + if (default_colors.length == 2) default_colors.push('') + if (default_colors.length == 0) { + var c_l = default_colors + } else { + var c_l = default_colors + } + + for (i = 0; i < c_l.length; i++) { + + console.log(labels[i], "", c_l[i]) + + var legendG = svg1 + .append("g") + .attr("transform", function (d) { + return "translate(" + 0 + "," + (30 * i + Size / 33 + Size / 50) + ")"; // place each legend on the right and bump each one down 15 pixels + }) + .attr("class", "legend"); + + legendG.append("rect") // make a matching color rect + .attr("width", 15) + .attr("height", 15) + .attr("fill", c_l[i]) + .style('visibility', function () { + return labels[i] ? "visible" : "hidden" + }) + + legendG.append("text") // add the text + .text(labels[i]) + .style("font-size", 30) + .attr("y", 12) + .attr("x", 21) + + } + + } + } \ No newline at end of file diff --git a/rapsberrypi/web/JSfiles/video.js b/rapsberrypi/web/JSfiles/video.js new file mode 100644 index 000000000..877f74566 --- /dev/null +++ b/rapsberrypi/web/JSfiles/video.js @@ -0,0 +1,20 @@ + +// Get the video +var video = document.getElementById("myVideo"); + +// Get the button +var btn = document.getElementById("myBtn"); + +// Pause and play the video, and change the button text +function PauseAndPlay() { + if (video.paused) { + video.play(); + btn.innerHTML = "Pause"; + } else { + video.pause(); + btn.innerHTML = "Play"; + } +} + +// make the video look darker when the mouse is over it + diff --git a/rapsberrypi/web/Logo/PENNAILOGO.png b/rapsberrypi/web/Logo/PENNAILOGO.png new file mode 100644 index 000000000..81c614de5 Binary files /dev/null and b/rapsberrypi/web/Logo/PENNAILOGO.png differ diff --git a/rapsberrypi/web/Logo/rpi-imager.ico b/rapsberrypi/web/Logo/rpi-imager.ico new file mode 100644 index 000000000..d25b955fc Binary files /dev/null and b/rapsberrypi/web/Logo/rpi-imager.ico differ diff --git a/rapsberrypi/web/Logo/rpi-imager.png b/rapsberrypi/web/Logo/rpi-imager.png new file mode 100644 index 000000000..1eb3aafb2 Binary files /dev/null and b/rapsberrypi/web/Logo/rpi-imager.png differ diff --git a/rapsberrypi/web/css/bootstrap.min.css b/rapsberrypi/web/css/bootstrap.min.css new file mode 100644 index 000000000..f85e2e0c3 --- /dev/null +++ b/rapsberrypi/web/css/bootstrap.min.css @@ -0,0 +1,6 @@ +@charset "UTF-8";/*! + * Bootstrap v5.2.1 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors + * Copyright 2011-2022 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-body-color-rgb:33,37,41;--bs-body-bg-rgb:255,255,255;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-bg:#fff;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-2xl:2rem;--bs-border-radius-pill:50rem;--bs-link-color:#0d6efd;--bs-link-hover-color:#0a58ca;--bs-code-color:#d63384;--bs-highlight-bg:#fff3cd}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:#6c757d;text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:#6c757d}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color:var(--bs-body-color);--bs-table-bg:transparent;--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-body-color);--bs-table-striped-bg:rgba(0, 0, 0, 0.05);--bs-table-active-color:var(--bs-body-color);--bs-table-active-bg:rgba(0, 0, 0, 0.1);--bs-table-hover-color:var(--bs-body-color);--bs-table-hover-bg:rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-accent-bg:var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg:var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg:var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#bacbe6;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#cbccce;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#bcd0c7;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#badce3;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#e6dbb9;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#dfc2c4;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#dfe0e1;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#373b3e;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:#6c757d}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;-webkit-appearance:none;-moz-appearance:none;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:#dde0e3}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + .5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:calc(1.5em + .75rem + 2px);padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:.375rem}.form-control-color::-webkit-color-swatch{border-radius:.375rem}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + 2px)}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + 2px)}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);-webkit-appearance:none;-moz-appearance:none;appearance:none;-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;width:100%;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:1px solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#198754;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:#198754}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:#198754}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:#198754}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:#dc3545}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:#dc3545}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:#dc3545}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:#212529;--bs-btn-bg:transparent;--bs-btn-border-width:1px;--bs-btn-border-color:transparent;--bs-btn-border-radius:0.375rem;--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:first-child:hover,:not(.btn-check)+.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:none;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:0.5rem}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:0.25rem}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:#212529;--bs-dropdown-bg:#fff;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:0.375rem;--bs-dropdown-border-width:1px;--bs-dropdown-inner-border-radius:calc(0.375rem - 1px);--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color:#212529;--bs-dropdown-link-hover-color:#1e2125;--bs-dropdown-link-hover-bg:#e9ecef;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:#6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:1px;--bs-nav-tabs-border-color:#dee2e6;--bs-nav-tabs-border-radius:0.375rem;--bs-nav-tabs-link-hover-border-color:#e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color:#495057;--bs-nav-tabs-link-active-bg:#fff;--bs-nav-tabs-link-active-border-color:#dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));background:0 0;border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:0.375rem;--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{background:0 0;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:transparent;border-color:transparent}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(0, 0, 0, 0.55);--bs-navbar-hover-color:rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color:rgba(0, 0, 0, 0.3);--bs-navbar-active-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color:rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius:0.375rem;--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .show>.nav-link{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-border-width:1px;--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(0.375rem - 1px);--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:#fff;--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:#fff;--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:1px;--bs-accordion-border-radius:0.375rem;--bs-accordion-inner-border-radius:calc(0.375rem - 1px);--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='var%28--bs-body-color%29'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color:#86b7fe;--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:#0c63e4;--bs-accordion-active-bg:#e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:#6c757d;--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:#6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:#fff;--bs-pagination-border-width:1px;--bs-pagination-border-color:#dee2e6;--bs-pagination-border-radius:0.375rem;--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:#e9ecef;--bs-pagination-hover-border-color:#dee2e6;--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:#e9ecef;--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:#6c757d;--bs-pagination-disabled-bg:#fff;--bs-pagination-disabled-border-color:#dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:0.5rem}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:0.25rem}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:1px solid var(--bs-alert-border-color);--bs-alert-border-radius:0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:#084298;--bs-alert-bg:#cfe2ff;--bs-alert-border-color:#b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color:#41464b;--bs-alert-bg:#e2e3e5;--bs-alert-border-color:#d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color:#0f5132;--bs-alert-bg:#d1e7dd;--bs-alert-border-color:#badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color:#055160;--bs-alert-bg:#cff4fc;--bs-alert-border-color:#b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color:#664d03;--bs-alert-bg:#fff3cd;--bs-alert-border-color:#ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color:#842029;--bs-alert-bg:#f8d7da;--bs-alert-border-color:#f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color:#636464;--bs-alert-bg:#fefefe;--bs-alert-border-color:#fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color:#141619;--bs-alert-bg:#d3d3d4;--bs-alert-border-color:#bcbebf}.alert-dark .alert-link{color:#101214}@-webkit-keyframes progress-bar-stripes{0%{background-position-x:1rem}}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:#e9ecef;--bs-progress-border-radius:0.375rem;--bs-progress-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{-webkit-animation:1s linear infinite progress-bar-stripes;animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{-webkit-animation:none;animation:none}}.list-group{--bs-list-group-color:#212529;--bs-list-group-bg:#fff;--bs-list-group-border-color:rgba(0, 0, 0, 0.125);--bs-list-group-border-width:1px;--bs-list-group-border-radius:0.375rem;--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:#495057;--bs-list-group-action-hover-color:#495057;--bs-list-group-action-hover-bg:#f8f9fa;--bs-list-group-action-active-color:#212529;--bs-list-group-action-active-bg:#e9ecef;--bs-list-group-disabled-color:#6c757d;--bs-list-group-disabled-bg:#fff;--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:transparent url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(255, 255, 255, 0.85);--bs-toast-border-width:1px;--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:0.375rem;--bs-toast-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color:#6c757d;--bs-toast-header-bg:rgba(255, 255, 255, 0.85);--bs-toast-header-border-color:rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:#fff;--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:1px;--bs-modal-border-radius:0.5rem;--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius:calc(0.5rem - 1px);--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:1px;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:#fff;--bs-tooltip-bg:#000;--bs-tooltip-border-radius:0.375rem;--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:0}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:0}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:#fff;--bs-popover-border-width:1px;--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:0.5rem;--bs-popover-inner-border-radius:calc(0.5rem - 1px);--bs-popover-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color: ;--bs-popover-header-bg:#f0f0f0;--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:#212529;--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;-webkit-animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@-webkit-keyframes spinner-border{to{transform:rotate(360deg)}}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@-webkit-keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg:#fff;--bs-offcanvas-border-width:1px;--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:575.98px){.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}}@media (max-width:575.98px){.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:767.98px){.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}}@media (max-width:767.98px){.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:991.98px){.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}}@media (max-width:991.98px){.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1199.98px){.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}}@media (max-width:1199.98px){.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media (max-width:1399.98px){.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}}@media (max-width:1399.98px){.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{-webkit-animation:placeholder-glow 2s ease-in-out infinite;animation:placeholder-glow 2s ease-in-out infinite}@-webkit-keyframes placeholder-glow{50%{opacity:.2}}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;-webkit-animation:placeholder-wave 2s linear infinite;animation:placeholder-wave 2s linear infinite}@-webkit-keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(13,110,253,var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(108,117,125,var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(25,135,84,var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(13,202,240,var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(255,193,7,var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(220,53,69,var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(248,249,250,var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(33,37,41,var(--bs-bg-opacity,1))!important}.link-primary{color:#0d6efd!important}.link-primary:focus,.link-primary:hover{color:#0a58ca!important}.link-secondary{color:#6c757d!important}.link-secondary:focus,.link-secondary:hover{color:#565e64!important}.link-success{color:#198754!important}.link-success:focus,.link-success:hover{color:#146c43!important}.link-info{color:#0dcaf0!important}.link-info:focus,.link-info:hover{color:#3dd5f3!important}.link-warning{color:#ffc107!important}.link-warning:focus,.link-warning:hover{color:#ffcd39!important}.link-danger{color:#dc3545!important}.link-danger:focus,.link-danger:hover{color:#b02a37!important}.link-light{color:#f8f9fa!important}.link-light:focus,.link-light:hover{color:#f9fafb!important}.link-dark{color:#212529!important}.link-dark:focus,.link-dark:hover{color:#1a1e21!important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute!important;width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-1{--bs-border-width:1px}.border-2{--bs-border-width:2px}.border-3{--bs-border-width:3px}.border-4{--bs-border-width:4px}.border-5{--bs-border-width:5px}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-light{font-weight:300!important}.fw-lighter{font-weight:lighter!important}.fw-normal{font-weight:400!important}.fw-bold{font-weight:700!important}.fw-semibold{font-weight:600!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:#6c757d!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-2xl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} diff --git a/rapsberrypi/web/css/style.css b/rapsberrypi/web/css/style.css new file mode 100644 index 000000000..e2493e324 --- /dev/null +++ b/rapsberrypi/web/css/style.css @@ -0,0 +1,420 @@ + +.bd-placeholder-img { +font-size: 1.125rem; +text-anchor: middle; +-webkit-user-select: none; +-moz-user-select: none; +user-select: none; +} + +@media (min-width: 768px) { +.bd-placeholder-img-lg { + font-size: 3.5rem; +} +} + +.b-example-divider { +height: 3rem; +background-color: rgba(0, 0, 0, .1); +border: solid rgba(0, 0, 0, .15); +border-width: 1px 0; +box-shadow: inset 0 .5em 1.5em rgba(0, 0, 0, .1), inset 0 .125em .5em rgba(0, 0, 0, .15); +} + +.b-example-vr { +flex-shrink: 0; +width: 1.5rem; +height: 100vh; +} + +.bi { +vertical-align: -.125em; +fill: currentColor; +} + +.nav-scroller { +position: relative; +z-index: 2; +height: 2.75rem; +overflow-y: hidden; +} + +.nav-scroller .nav { +display: flex; +flex-wrap: nowrap; +padding-bottom: 1rem; +margin-top: -1px; +overflow-x: auto; +text-align: center; +white-space: nowrap; +-webkit-overflow-scrolling: touch; +} + + +a#infanddownload { + --bs-btn-bg: #182435; + --bs-btn-hover-bg: #849ab9; +} + +a#downloadImage{ + --bs-btn-bg: #182435; + --bs-btn-hover-bg: #849ab9; +} + +.navbar{ + --bs-navbar-color: #1A1110!important; +} + + + + + +#mainName{ + color: #ffffff; + font-size: 2.5rem; + font-weight: 700; + font-family: 'Roboto', sans-serif; + text-shadow: 0 0 0.5rem #1A1110; + +} + + + +.bg-info { + --bs-bg-opacity: 0.1!important; +} + + +/* make element rect look transparent */ +rect { + /* fill: none; */ + stroke: none; +} + + +.card-body.bg-info{ + + --bs-bg-opacity: 0.1!important; + +} + + + +/*Filter styles*/ +.saturate { filter: saturate(3); } +.grayscale { filter: grayscale(100%); } +.contrast { filter: contrast(160%); } +.brightness { filter: brightness(0.25); } +.blur { filter: blur(3px); } +.invert { filter: invert(100%); } +.sepia { filter: sepia(100%); } +.huerotate { filter: hue-rotate(180deg); } +.rss.opacity { filter: opacity(50%); } + + + + +#changed { + -webkit-filter : hue-rotate(180deg); + filter : hue-rotate(180deg); +} + + + + +/* Style the video: 100% width and height to cover the entire window */ +#myVideo { +position: fixed; +right: 0; +bottom: 0; +min-width: 100%; +min-height: 100%; +z-index: -1; +background: rgba(0, 0, 0, 0.50); +} + +/* Add some content at the bottom of the video/page */ +.content { +position: fixed; +bottom: 0; +background: rgba(0, 0, 0, 0.5); +color: #f1f1f1; +width: 100%; +padding: 20px; +} + +/* Style the button used to pause/play the video */ +#myBtn { +width: 200px; +font-size: 18px; +padding: 10px; +border: none; +background: #000; +color: #fff; +cursor: pointer; +} + +#myBtn:hover { +background: #ddd; +color: black; +} + + + + + + +/* div class="row py-lg-5 bg-info" */ +.row.py-lg-5.bg-info{ +/* make edge round */ +border-radius: 1rem; +} + + + + + + + + + +/* carousel */ +* {box-sizing:border-box} + +/* Slideshow container */ +.slideshow-container { + max-width: 1000px; + position: relative; + margin: auto; +} + +/* Hide the images by default */ +.mySlides { + display: none; +} + +/* Next & previous buttons */ +.prev, .next { + cursor: pointer; + position: absolute; + top: 50%; + width: auto; + margin-top: -22px; + padding: 16px; + color: white; + font-weight: bold; + font-size: 18px; + transition: 0.6s ease; + border-radius: 0 3px 3px 0; + user-select: none; +} + +/* Position the "next button" to the right */ +.next { + right: 0; + border-radius: 3px 0 0 3px; +} +.prev { + left: 0; + border-radius: 3px 0 0 3px; + } + +/* On hover, add a black background color with a little bit see-through */ +.prev:hover, .next:hover { + /* background-color: rgba(0,0,0,0.8); */ +} + +/* Caption text */ +.text { + color: #f2f2f2; + font-size: 15px; + padding: 8px 12px; + position: absolute; + bottom: 8px; + width: 100%; + text-align: center; +} + +/* Number text (1/3 etc) */ +.numbertext { + color: #f2f2f2; + font-size: 12px; + padding: 8px 12px; + position: absolute; + top: 0; +} + +/* The dots/bullets/indicators */ +.dot { + cursor: pointer; + height: 15px; + width: 15px; + margin: 0 2px; + background-color: #bbb; + border-radius: 50%; + display: inline-block; + transition: background-color 0.6s ease; +} + +.active, .dot:hover { + background-color: #717171; + /* background-color: #ffffff; */ +} + +/* Fading animation */ +.fade { + animation-name: fade; + animation-duration: 1.5s; +} + +@keyframes fade { + from {opacity: .4} + to {opacity: 1} +} + + + + +/* domain is axis */ +.domain { + /* fill: rgb(255, 255, 255); */ + stroke: rgb(255, 255, 255); + /* shape-rendering: crispEdges; */ +} + + + +#mainLogo{ + /* -webkit-filter: invert(20%); */ + + /* make it black */ + /* -webkit-filter: invert(100%); */ + /* make it white */ + /* -webkit-filter: invert(120%); */ + + + +} + + + +.card-body.bg-secondary{ + background-color: #0d131b!important; + +} + + + + + + + + + +.videoContainer { + position: relative; + width: 100%; + height: 100%; + + border-radius: 5px; + background-attachment: scroll; + overflow: hidden; +} +.videoContainer video { + min-width: 100%; + min-height: 100%; + position: relative; + z-index: 1; +} +.videoContainer .overlay { + height: 100%; + width: 100%; + position: absolute; + top: 0px; + left: 0px; + z-index: 2; + background: green; + opacity: 0.5; +} + + + + + + +#overlay { + pointer-events:none; + position: fixed; + display: none; + width: 100%; + height: 100%; + top: 0; + left: 0; + right: 0; + bottom: 0; + background-color: rgba(0,0,0,0.3); + z-index: 1; + cursor: pointer; +} + + +.nav-item{ + color: transparent!important; + background-color: transparent!important; + -webkit-text-fill-color: rgb(255, 255, 255)!important; + list-style-type: none; + + /* change font size */ + font-size: 1.2rem; + +} + +.active, .dot:hover { + background-color: transparent!important; + /* mouseover color change */ + +} + + + + + /* Style buttons */ + .btn-download { + background-color: DodgerBlue; + border: none; + color: white; + padding: 12px 30px; + cursor: pointer; + font-size: 20px; + /* make left aligned */ + +} + +/* Darker background on mouse-over */ +.btn-download:hover { + background-color: RoyalBlue; +} + + + +.all-scroll {cursor: all-scroll;} + +#downloadA { + background: darkslategray!important; + color: white!important; +} + + + +#downloadLi { + --bs-btn-bg: #182435; + --bs-btn-hover-bg: #849ab9; +} + + +.footerCon{ + /* text color */ + color: #ffffff; + } + + diff --git a/rapsberrypi/web/data/datasets/pmlb_small/iris/README.md b/rapsberrypi/web/data/datasets/pmlb_small/iris/README.md new file mode 100644 index 000000000..05c2cab65 --- /dev/null +++ b/rapsberrypi/web/data/datasets/pmlb_small/iris/README.md @@ -0,0 +1,30 @@ +# iris + +## Summary Stats + +#instances: 150 + +#features: 4 + + #binary_features: 0 + + #integer_features: 0 + + #float_features: 4 + +Endpoint type: integer + +#Classes: 3 + +Imbalance metric: 0.0 + +## Feature Types + + sepal-length:continous + +sepal-width:continous + +petal-length:continous + +petal-width:continous + diff --git a/rapsberrypi/web/data/datasets/pmlb_small/iris/iris_Comma.csv b/rapsberrypi/web/data/datasets/pmlb_small/iris/iris_Comma.csv new file mode 100644 index 000000000..8eb1c5495 --- /dev/null +++ b/rapsberrypi/web/data/datasets/pmlb_small/iris/iris_Comma.csv @@ -0,0 +1,151 @@ +sepal-length,sepal-width,petal-length,petal-width,class +6.7,3.0,5.2,2.3,2 +6.0,2.2,5.0,1.5,2 +6.2,2.8,4.8,1.8,2 +7.7,3.8,6.7,2.2,2 +7.2,3.0,5.8,1.6,2 +5.5,2.4,3.8,1.1,1 +6.0,2.7,5.1,1.6,1 +5.5,2.5,4.0,1.3,1 +5.6,2.9,3.6,1.3,1 +5.7,2.9,4.2,1.3,1 +5.0,3.2,1.2,0.2,0 +4.9,3.1,1.5,0.1,0 +5.3,3.7,1.5,0.2,0 +4.8,3.1,1.6,0.2,0 +5.0,3.3,1.4,0.2,0 +6.3,3.4,5.6,2.4,2 +7.1,3.0,5.9,2.1,2 +6.3,2.8,5.1,1.5,2 +6.3,2.9,5.6,1.8,2 +5.8,2.7,5.1,1.9,2 +5.2,2.7,3.9,1.4,1 +5.6,3.0,4.1,1.3,1 +6.9,3.1,4.9,1.5,1 +6.2,2.9,4.3,1.3,1 +6.5,2.8,4.6,1.5,1 +5.0,3.0,1.6,0.2,0 +5.5,3.5,1.3,0.2,0 +5.1,3.5,1.4,0.3,0 +5.7,3.8,1.7,0.3,0 +5.5,4.2,1.4,0.2,0 +6.7,3.1,5.6,2.4,2 +5.8,2.8,5.1,2.4,2 +6.4,3.1,5.5,1.8,2 +7.9,3.8,6.4,2.0,2 +6.8,3.0,5.5,2.1,2 +6.0,3.4,4.5,1.6,1 +6.7,3.1,4.7,1.5,1 +5.7,2.8,4.1,1.3,1 +6.7,3.1,4.4,1.4,1 +5.9,3.0,4.2,1.5,1 +5.1,3.8,1.9,0.4,0 +4.9,3.1,1.5,0.1,0 +5.4,3.9,1.3,0.4,0 +5.1,3.5,1.4,0.2,0 +4.8,3.4,1.9,0.2,0 +6.3,3.3,6.0,2.5,2 +6.7,3.3,5.7,2.5,2 +6.3,2.7,4.9,1.8,2 +6.9,3.2,5.7,2.3,2 +4.9,2.5,4.5,1.7,2 +7.0,3.2,4.7,1.4,1 +6.6,2.9,4.6,1.3,1 +6.4,2.9,4.3,1.3,1 +6.3,2.5,4.9,1.5,1 +5.7,2.6,3.5,1.0,1 +5.4,3.4,1.5,0.4,0 +5.0,3.5,1.3,0.3,0 +4.5,2.3,1.3,0.3,0 +5.1,3.8,1.5,0.3,0 +4.4,3.0,1.3,0.2,0 +6.9,3.1,5.1,2.3,2 +7.3,2.9,6.3,1.8,2 +6.1,2.6,5.6,1.4,2 +7.4,2.8,6.1,1.9,2 +7.2,3.6,6.1,2.5,2 +5.9,3.2,4.8,1.8,1 +6.1,2.8,4.7,1.2,1 +6.3,3.3,4.7,1.6,1 +5.8,2.6,4.0,1.2,1 +6.0,2.2,4.0,1.0,1 +4.6,3.6,1.0,0.2,0 +4.7,3.2,1.6,0.2,0 +5.1,3.8,1.6,0.2,0 +4.4,3.2,1.3,0.2,0 +4.8,3.0,1.4,0.3,0 +5.6,2.8,4.9,2.0,2 +7.6,3.0,6.6,2.1,2 +6.5,3.0,5.5,1.8,2 +5.9,3.0,5.1,1.8,2 +6.3,2.5,5.0,1.9,2 +6.1,2.8,4.0,1.3,1 +6.6,3.0,4.4,1.4,1 +5.8,2.7,4.1,1.0,1 +5.0,2.0,3.5,1.0,1 +5.5,2.6,4.4,1.2,1 +4.6,3.4,1.4,0.3,0 +5.4,3.4,1.7,0.2,0 +4.7,3.2,1.3,0.2,0 +5.2,4.1,1.5,0.1,0 +5.0,3.4,1.5,0.2,0 +6.5,3.2,5.1,2.0,2 +6.8,3.2,5.9,2.3,2 +5.7,2.5,5.0,2.0,2 +6.4,2.8,5.6,2.2,2 +7.7,2.6,6.9,2.3,2 +6.3,2.3,4.4,1.3,1 +6.1,3.0,4.6,1.4,1 +5.8,2.7,3.9,1.2,1 +6.2,2.2,4.5,1.5,1 +5.0,2.3,3.3,1.0,1 +5.2,3.4,1.4,0.2,0 +5.2,3.5,1.5,0.2,0 +4.9,3.1,1.5,0.1,0 +5.4,3.7,1.5,0.2,0 +4.4,2.9,1.4,0.2,0 +6.4,3.2,5.3,2.3,2 +6.4,2.8,5.6,2.1,2 +6.5,3.0,5.8,2.2,2 +6.1,3.0,4.9,1.8,2 +6.7,2.5,5.8,1.8,2 +5.7,2.8,4.5,1.3,1 +5.6,2.7,4.2,1.3,1 +6.0,2.9,4.5,1.5,1 +5.5,2.3,4.0,1.3,1 +5.6,3.0,4.5,1.5,1 +5.1,3.3,1.7,0.5,0 +5.8,4.0,1.2,0.2,0 +4.6,3.1,1.5,0.2,0 +5.7,4.4,1.5,0.4,0 +4.9,3.0,1.4,0.2,0 +6.7,3.3,5.7,2.1,2 +6.4,2.7,5.3,1.9,2 +5.8,2.7,5.1,1.9,2 +6.2,3.4,5.4,2.3,2 +6.0,3.0,4.8,1.8,2 +5.6,2.5,3.9,1.1,1 +4.9,2.4,3.3,1.0,1 +5.1,2.5,3.0,1.1,1 +6.4,3.2,4.5,1.5,1 +5.7,3.0,4.2,1.2,1 +4.3,3.0,1.1,0.1,0 +5.1,3.7,1.5,0.4,0 +4.8,3.4,1.6,0.2,0 +4.6,3.2,1.4,0.2,0 +4.8,3.0,1.4,0.1,0 +6.9,3.1,5.4,2.1,2 +7.2,3.2,6.0,1.8,2 +7.7,3.0,6.1,2.3,2 +7.7,2.8,6.7,2.0,2 +6.5,3.0,5.2,2.0,2 +5.5,2.4,3.7,1.0,1 +5.4,3.0,4.5,1.5,1 +6.8,2.8,4.8,1.4,1 +6.1,2.9,4.7,1.4,1 +6.7,3.0,5.0,1.7,1 +5.0,3.5,1.6,0.6,0 +5.4,3.9,1.7,0.4,0 +5.1,3.4,1.5,0.2,0 +5.0,3.6,1.4,0.2,0 +5.0,3.4,1.6,0.4,0 diff --git a/rapsberrypi/web/firstThumbnail.png b/rapsberrypi/web/firstThumbnail.png new file mode 100644 index 000000000..bc8aaf882 Binary files /dev/null and b/rapsberrypi/web/firstThumbnail.png differ diff --git a/rapsberrypi/web/firstThumbnail_resized.png b/rapsberrypi/web/firstThumbnail_resized.png new file mode 100644 index 000000000..c14d28aff Binary files /dev/null and b/rapsberrypi/web/firstThumbnail_resized.png differ diff --git a/rapsberrypi/web/infAndDownloadpage.html b/rapsberrypi/web/infAndDownloadpage.html new file mode 100644 index 000000000..e993c2324 --- /dev/null +++ b/rapsberrypi/web/infAndDownloadpage.html @@ -0,0 +1,488 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+
+ + + + + + + Aliro Ed + + + +
  • + Download +
    • +
  • + Production +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
    +
    +
    + +
    + + + + +
    + +
    +
    +
    + + + + + + + + + + + + + + + + + + + +
    + + + + + +
    + +
    + + + + +
    +
    + + + +

    Overview

    +

    Welcome to the homepage of Aliro Ed.

    + + +

    Sponsor FileZilla development and reach developers, webmasters and bloggers + Welcome to the homepage of FileZilla®, the free FTP solution. The FileZilla Client not only supports FTP, + but also FTP over TLS (FTPS) and SFTP. It is open source software distributed free of charge under the terms of the GNU General Public License. + + + + +

    + + + + + + + + + +
    + + + + + +
    + +
    +

    News

    +

    Welcome to the homepage of Aliro Ed.

    +
    + + + + + +
    +
    + + + +
    + + + + + + + +
    +
    + +
    +
    +
    + + + + ... + + +
    +

    This card explains some intuition using scatterplot.

    +
    +
    + + + +
    +
    +
    +
    +
    +
    +
    + + ... + +
    +

    This card explains boundaries to distinguish class.

    +
    +
    + + + + +
    +
    +
    +
    +
    +
    +
    + ... +
    +

    This card explains how decision tree works. .

    +
    +
    + + + +
    +
    +
    +
    +
    + + + + +
    +
    +
    + + +
    + +
    +
    +

    + Back to top +

    + +

    Developed by AI Research Center at the Computational Biomedicine Department, Cedars-Sinai Medical Center, Los Angeles, CA, USA.

    +
    +
    + + + + + + + + + + + + + + diff --git a/rapsberrypi/web/int_ml_01.html b/rapsberrypi/web/int_ml_01.html new file mode 100644 index 000000000..e3dcdf224 --- /dev/null +++ b/rapsberrypi/web/int_ml_01.html @@ -0,0 +1,493 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + + + + + + +
    +
    + + + + + + + Aliro Ed + + + + +
  • + Download +
    • +
  • + Production +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • + + +
    +
    +
    + +
    + + + + +
    + +
    +
    +
    + + +

    + + + + + + + + + + + +

    + +
    + +
    + +
    + + + + +
    +
    + +

    First, some intuition

    +

    Consider the situation where you want to decide if a dot belongs in + Class_1 (Iris-setosa) or Class_2 (Iris-versicolor), or Class_3 (Iris-virginica). + + Assigning a class to a data point is called classification task in machine learning terms.

    + + + + +

    In the left chart, the dots are the data points. The color of the dots represents the class of the data point. + In this example, our task is to classify the data points into one of the three classes. + Now, let's click the red button to project the data points on the Y axis. + In the current chart, dots are projected on the sepal-length axis, which is Y axis. + Can we find points on the Y axis that separate the dots into three classes? + What about the X axis? Can we find points on the X axis that separate the dots into three classes? + Each of the sepal-length and petal-length can be used to classify the data points into the three classes.

    + +

    + + Can we do better classify the data points into the three classes using only both of the two features? Let's move to the next page.

    + + + + + + + + + + + +
    + + + + + + + +
    + + + + + + +
    +
    + + + +
    + + + + + + + +
    +
    + +
    +
    +
    + + + + ... + + +
    +

    This card explains some intuition using scatterplot.

    +
    +
    + + + +
    +
    +
    +
    +
    +
    +
    + + ... + +
    +

    This card explains boundaries to distinguish class.

    +
    +
    + + + + +
    +
    +
    +
    +
    +
    +
    + ... +
    +

    This card explains how decision tree works.

    +
    +
    + + + +
    +
    +
    +
    +
    + + + + +
    +
    +
    + + +
    + +
    +
    +

    + Back to top +

    + +

    Developed by AI Research Center at the Computational Biomedicine Department, Cedars-Sinai Medical Center, Los Angeles, CA, USA.

    + +
    +
    + + + + + + + + + + + + + + diff --git a/rapsberrypi/web/int_ml_01_onlyforchart.html b/rapsberrypi/web/int_ml_01_onlyforchart.html new file mode 100644 index 000000000..1b33f4027 --- /dev/null +++ b/rapsberrypi/web/int_ml_01_onlyforchart.html @@ -0,0 +1,143 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + + + + + +
    +
    + + + + PENNAILOGO + Aliro ED + + + +
    +
    +
    + +
    + +
    + +
    + + + + +
    + + + + + + + + + + + + diff --git a/rapsberrypi/web/int_ml_02.html b/rapsberrypi/web/int_ml_02.html new file mode 100644 index 000000000..2c628bafe --- /dev/null +++ b/rapsberrypi/web/int_ml_02.html @@ -0,0 +1,392 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + + + + + +
    +
    + + + + + + + Aliro Ed + + + + +
  • + Download +
    • +
  • + Production +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
    +
    +
    + +
    + + +
    + +
    +
    +
    + + +

    + + + + + + + + + + + +

    + +
    + +
    + +
    + + +
    + +
    + + + + +
    + +
    + +

    Better boundaries to distinguish classes

    +

    Let's transform our visualiztion into a histogram to see how frequently each species appears at each sepal-length. Please click the green button.

    +

    Class_1 (Iris-setosa) has the lowest average of sepal-length, Class_2 (Iris-versicolor) has the second lowest average of sepal-length, and Class_3 (Iris-virginica) has the highest average of sepal-length.

    +

    Please click the Y axis. It will show an example to put boundaries

    +

    Please click the Y axis. It will show an example to put boundaries to distinguish classes of iris flowers. Then please click the Different boundaries button. It will show an example to put different boundaries to distinguish classes of iris flowers.

    + + + + + +
    + + + + + + + +
    + + + + + + +
    +
    + + + + + + +
    +
    + +
    +
    +
    + + + + ... + + +
    +

    This card explains some intuition using scatterplot.

    +
    +
    + + + +
    +
    +
    +
    +
    +
    +
    + + ... + +
    +

    This card explains boundaries to distinguish class.

    +
    +
    + + + + +
    +
    +
    +
    +
    +
    +
    + ... +
    +

    This card explains how decision tree works.

    +
    +
    + + + +
    +
    +
    +
    +
    + + + + +
    +
    +
    + + +
    + +
    +
    +

    + Back to top +

    + +

    Developed by AI Research Center at the Computational Biomedicine Department, Cedars-Sinai Medical Center, Los Angeles, CA, USA.

    + +
    +
    + + + + + + + + + + + + + + + diff --git a/rapsberrypi/web/int_ml_03_decision_tree.html b/rapsberrypi/web/int_ml_03_decision_tree.html new file mode 100644 index 000000000..ab0d0ce64 --- /dev/null +++ b/rapsberrypi/web/int_ml_03_decision_tree.html @@ -0,0 +1,479 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + + + + + + +
    +
    + + + + + + + Aliro Ed + + + + +
  • + Download +
    • +
  • + Production +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
    +
    +
    + +
    + + + + +
    + +
    +
    +
    + + +

    + + + + + + + + + + + +

    + +
    + +
    + +
    + + +
    + +
    + + + +
    + +
    + +

    Decision tree with iris data

    + +

    + In this example, we are going to use the iris data set to build a decision tree. + The iris data set contains 100 samples of three different species of iris flowers. + There are four features in the dataset: sepal length, sepal width, petal length, and petal width. + And we are going to use decision tree to distinguish three different species of iris flowers with four features. + + +
    + If petal-length is less than 2.45, 33% of data point is setosa. + 67% of data point has petal-length greater than 2.45. + Let's look at the second split. +
    +

    + + + + + +
    + + + + + + + +
    + + + + + + +
    +
    + + + + + +
    +
    + +
    +
    +
    + + + + ... + + +
    +

    This card explains some intuition using scatterplot.

    +
    +
    + + + +
    +
    +
    +
    +
    +
    +
    + + ... + +
    +

    This card explains boundaries to distinguish class.

    +
    +
    + + + + +
    +
    +
    +
    +
    +
    +
    + ... +
    +

    This card explains how decision tree works.

    +
    +
    + + + +
    +
    +
    +
    +
    + + + + +
    +
    +
    + + +
    + +
    +
    +

    + Back to top +

    + +

    Developed by AI Research Center at the Computational Biomedicine Department, Cedars-Sinai Medical Center, Los Angeles, CA, USA.

    + +
    +
    + + + + + + + + + + + + + + + diff --git a/rapsberrypi/web/int_ml_03_decision_tree_version2.html b/rapsberrypi/web/int_ml_03_decision_tree_version2.html new file mode 100644 index 000000000..8d416012b --- /dev/null +++ b/rapsberrypi/web/int_ml_03_decision_tree_version2.html @@ -0,0 +1,292 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + + + + + +
    +
    + + + + PENNAILOGO + Aliro ED + + + +
    +
    +
    + +
    + +
    +
    +
    + + +

    + + + + + + + + + + + +

    + +
    + +
    + +
    + + +
    + +
    + + + +
    + +
    + +

    Finding better boundaries

    +

    Let’s say you had to determine whether a dot is in + Class_1 or in Class_2 or in Class_3. In machine learning terms, categorizing data points is a classification task.

    +

    Since San Francisco is relatively hilly, the elevation of a home may be a good way to distinguish the two cities.

    +

    Based on the home-elevation data to the right, you could argue that a home above 73 meters should be classified as one in San Francisco.

    + + + + +
    + + + + + + + +
    + + + + + + +
    +
    + + + + +
    + + + + + + + + + + + + + + + + diff --git a/rapsberrypi/web/main.html b/rapsberrypi/web/main.html new file mode 100644 index 000000000..7a2627e5e --- /dev/null +++ b/rapsberrypi/web/main.html @@ -0,0 +1,386 @@ + + + + + + + + + + Aliro ED + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
    + + + + + + +
    +
    + + + + + + + + + + Aliro Ed + + + + + + + +
  • + Download +
    • +
  • + Production +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • +
  • + +
    • + + + + + + + + + + + +
    +
    +
    + + +
    + + + + + + + + + + + + + + +
    + + + + + + +
    +
    + + +
    + + + +

    Aliro Ed

    + +

    Aliro Ed is a new way to learn and teach. It is a platform that allows you to create and share interactive content with your students. Aliro is a new way to learn and teach. It is a platform that allows you to create and share interactive content with your students.

    +

    + Download +

    + +
    + + + +
    + + + +

    Aliro Ed

    + +

    Aliro Ed is a new way to learn and teach. It is a platform that allows you to create and share interactive content with your students. Aliro is a new way to learn and teach. It is a platform that allows you to create and share interactive content with your students.

    +

    + Loading Aliro ED ... +

    + +
    + + +
    + + + +

    Aliro Ed_2

    + +

    Aliro Ed is a new way to learn and teach. It is a platform that allows you to create and share interactive content with your students. Aliro is a new way to learn and teach. It is a platform that allows you to create

    +

    + Loading Aliro ED ... +

    + +
    + + +
    + + + +

    Aliro Ed_3

    + +

    Aliro Ed is a new way to learn and teach.

    +

    + Loading Aliro ED ... +

    + +
    + + + + +
    +
    + + +
    + + + + +
    + +
    + + + + + + +
    +
    + +
    +
    +
    + + + + ... + + +
    +

    This card explains some intuition using scatterplot.

    +
    +
    + + + +
    +
    +
    +
    +
    +
    +
    + + ... + +
    +

    This card explains boundaries to distinguish class.

    +
    +
    + + + + +
    +
    +
    +
    +
    +
    +
    + ... +
    +

    This card explains how decision tree works.

    +
    +
    + + + +
    +
    +
    +
    +
    + + + + +
    +
    +
    + +
    + + + +
    +
    +

    + Back to top +

    + +

    Developed by AI Research Center at the Computational Biomedicine Department, Cedars-Sinai Medical Center, Los Angeles, CA, USA.

    + +
    +
    + + + + + + + + + + + + + + diff --git a/rapsberrypi/web/readme b/rapsberrypi/web/readme new file mode 100644 index 000000000..846e5104f --- /dev/null +++ b/rapsberrypi/web/readme @@ -0,0 +1 @@ +python3 -m http.server diff --git a/rapsberrypi/web/scatterplot_d3v4v6.html b/rapsberrypi/web/scatterplot_d3v4v6.html new file mode 100644 index 000000000..63e95d065 --- /dev/null +++ b/rapsberrypi/web/scatterplot_d3v4v6.html @@ -0,0 +1,73 @@ + + + + + + + +
    + + + \ No newline at end of file diff --git a/rapsberrypi/web/secondThumbnail.png b/rapsberrypi/web/secondThumbnail.png new file mode 100644 index 000000000..169872ef6 Binary files /dev/null and b/rapsberrypi/web/secondThumbnail.png differ diff --git a/rapsberrypi/web/secondThumbnail_resized.png b/rapsberrypi/web/secondThumbnail_resized.png new file mode 100644 index 000000000..8e6f92fc3 Binary files /dev/null and b/rapsberrypi/web/secondThumbnail_resized.png differ diff --git a/rapsberrypi/web/storage/test_download.json b/rapsberrypi/web/storage/test_download.json new file mode 100644 index 000000000..d474d25ff --- /dev/null +++ b/rapsberrypi/web/storage/test_download.json @@ -0,0 +1,257 @@ +{ + "name": "petal length (cm) > 2.45000004768", + "pred": "100 of no, 50 of yes", + "children": [ + { + "children": [ + { + "children": [ + { + + "name": "The number of data = 2", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "43 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "43 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "The number of data = 3", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "1 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + , + { + + "name": "2 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 3, + "pred": "0 of no, 0 of yes" + } + + ], + "name": "petal length (cm) > 4.85000038147", + "side": "right", + "type": "categorical", + "size": 25, + "pred": "22 of no, 3 of yes" + }, + { + + "name": "petal length (cm) > 4.94999980927", + "children": [ + + { + + "name": "The number of data = 6", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "2 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + , + { + + "name": "4 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 4, + "pred": "4 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 6, + "pred": "0 of no, 0 of yes" + }, + + { + + "name": "The number of data = 48", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "47 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 47, + "pred": "47 of no, 0 of yes" + } + , + { + + "name": "1 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 48, + "pred": "0 of no, 0 of yes" + } + + + + ], + "side": "left", + "type": "categorical", + "size": 25, + "pred": "4 of no, 21 of yes" + } + ], + "name": "petal width (cm) > 1.75", + "side": "right", + "type": "numerical", + "size": 50, + "pred": "46 of no, 54 of yes" + },{ + "name": "The number of data = 50", + "children": [ + + + + { + + "name": "50 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "50 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "0 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 30, + "pred": "0 of no, 0 of yes" + } + ], + "side": "right", + "size": 80 +} + + + diff --git a/rapsberrypi/web/structureC2.json b/rapsberrypi/web/structureC2.json new file mode 100644 index 000000000..e1aff8e7a --- /dev/null +++ b/rapsberrypi/web/structureC2.json @@ -0,0 +1,497 @@ +{ + "name": "petal length (cm) > 2.45000004768", + "pred": "100 of yes, 50 of no", + "children": [ + { + "children": [ + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "balance > 662.5", + "pred": "7 of no, 8 of yes", + "type": "numerical", + "side": "right", + "size": 15.0 + }, + { + "name": "balance <= 662.5", + "pred": "1 of no, 11 of yes", + "type": "numerical", + "side": "left", + "size": 12.0 + } + ], + "name": "campaign > 3.5", + "side": "right", + "type": "numerical", + "size": 27.0, + "pred": "8 of no, 19 of yes" + }, + { + "children": [ + { + "name": "job = technician", + "pred": "2 of no, 7 of yes", + "type": "categorical", + "side": "right", + "size": 9.0 + }, + { + "name": "job != technician", + "pred": "49 of no, 34 of yes", + "type": "categorical", + "side": "left", + "size": 83.0 + } + ], + "name": "campaign <= 3.5", + "side": "left", + "type": "numerical", + "size": 92.0, + "pred": "51 of no, 41 of yes" + } + ], + "name": "contact = cellular", + "side": "right", + "type": "categorical", + "size": 119.0, + "pred": "59 of no, 60 of yes" + }, + { + "children": [ + { + "children": [ + { + "name": "poutcome = success", + "pred": "1 of no, 0 of yes", + "type": "categorical", + "side": "right", + "size": 1.0 + }, + { + "name": "poutcome != success", + "pred": "0 of no, 7 of yes", + "type": "categorical", + "side": "left", + "size": 7.0 + } + ], + "name": "job = retired", + "side": "right", + "type": "categorical", + "size": 8.0, + "pred": "1 of no, 7 of yes" + }, + { + "children": [ + { + "name": "duration > 1249.5", + "pred": "4 of no, 7 of yes", + "type": "numerical", + "side": "right", + "size": 11.0 + }, + { + "name": "duration <= 1249.5", + "pred": "56 of no, 11 of yes", + "type": "numerical", + "side": "left", + "size": 67.0 + } + ], + "name": "job != retired", + "side": "left", + "type": "categorical", + "size": 78.0, + "pred": "60 of no, 18 of yes" + } + ], + "name": "contact != cellular", + "side": "left", + "type": "categorical", + "size": 86.0, + "pred": "61 of no, 25 of yes" + } + ], + "name": "marital = married", + "side": "right", + "type": "categorical", + "size": 205.0, + "pred": "120 of no, 85 of yes" + }, + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "duration > 1020.5", + "pred": "3 of no, 15 of yes", + "type": "numerical", + "side": "right", + "size": 18.0 + }, + { + "name": "duration <= 1020.5", + "pred": "24 of no, 15 of yes", + "type": "numerical", + "side": "left", + "size": 39.0 + } + ], + "name": "day > 19.5", + "side": "right", + "type": "numerical", + "size": 57.0, + "pred": "27 of no, 30 of yes" + }, + { + "children": [ + { + "name": "age > 55.5", + "pred": "5 of no, 3 of yes", + "type": "numerical", + "side": "right", + "size": 8.0 + }, + { + "name": "age <= 55.5", + "pred": "11 of no, 51 of yes", + "type": "numerical", + "side": "left", + "size": 62.0 + } + ], + "name": "day <= 19.5", + "side": "left", + "type": "numerical", + "size": 70.0, + "pred": "16 of no, 54 of yes" + } + ], + "name": "day > 7.5", + "side": "right", + "type": "numerical", + "size": 127.0, + "pred": "43 of no, 84 of yes" + }, + { + "children": [ + { + "name": "previous > 1.5", + "pred": "0 of no, 3 of yes", + "type": "numerical", + "side": "right", + "size": 3.0 + }, + { + "children": [ + { + "name": "duration > 678.5", + "pred": "16 of no, 6 of yes", + "type": "numerical", + "side": "right", + "size": 22.0 + }, + { + "name": "duration <= 678.5", + "pred": "0 of no, 2 of yes", + "type": "numerical", + "side": "left", + "size": 2.0 + } + ], + "name": "previous <= 1.5", + "side": "left", + "type": "numerical", + "size": 24.0, + "pred": "16 of no, 8 of yes" + } + ], + "name": "day <= 7.5", + "side": "left", + "type": "numerical", + "size": 27.0, + "pred": "16 of no, 11 of yes" + } + ], + "name": "marital != married", + "side": "left", + "type": "categorical", + "size": 154.0, + "pred": "59 of no, 95 of yes" + } + ], + "name": "duration > 645.5", + "side": "right", + "type": "numerical", + "size": 359.0, + "pred": "179 of no, 180 of yes" + }, + { + "children": [ + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "duration > 339.0", + "pred": "1 of no, 4 of yes", + "type": "numerical", + "side": "right", + "size": 5.0 + }, + { + "name": "duration <= 339.0", + "pred": "6 of no, 1 of yes", + "type": "numerical", + "side": "left", + "size": 7.0 + } + ], + "name": "month = may", + "side": "right", + "type": "categorical", + "size": 12.0, + "pred": "7 of no, 5 of yes" + }, + { + "children": [ + { + "name": "pdays > 35.5", + "pred": "11 of no, 62 of yes", + "type": "numerical", + "side": "right", + "size": 73.0 + }, + { + "name": "pdays <= 35.5", + "pred": "1 of no, 0 of yes", + "type": "numerical", + "side": "left", + "size": 1.0 + } + ], + "name": "month != may", + "side": "left", + "type": "categorical", + "size": 74.0, + "pred": "12 of no, 62 of yes" + } + ], + "name": "duration > 180.5", + "side": "right", + "type": "numerical", + "size": 86.0, + "pred": "19 of no, 67 of yes" + }, + { + "children": [ + { + "children": [ + { + "name": "job = technician", + "pred": "2 of no, 1 of yes", + "type": "categorical", + "side": "right", + "size": 3.0 + }, + { + "name": "job != technician", + "pred": "0 of no, 6 of yes", + "type": "categorical", + "side": "left", + "size": 6.0 + } + ], + "name": "education = tertiary", + "side": "right", + "type": "categorical", + "size": 9.0, + "pred": "2 of no, 7 of yes" + }, + { + "children": [ + { + "name": "marital = divorced", + "pred": "0 of no, 1 of yes", + "type": "categorical", + "side": "right", + "size": 1.0 + }, + { + "name": "marital != divorced", + "pred": "18 of no, 1 of yes", + "type": "categorical", + "side": "left", + "size": 19.0 + } + ], + "name": "education != tertiary", + "side": "left", + "type": "categorical", + "size": 20.0, + "pred": "18 of no, 2 of yes" + } + ], + "name": "duration <= 180.5", + "side": "left", + "type": "numerical", + "size": 29.0, + "pred": "20 of no, 9 of yes" + } + ], + "name": "poutcome = success", + "side": "right", + "type": "categorical", + "size": 115.0, + "pred": "39 of no, 76 of yes" + }, + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "balance > 5477.5", + "pred": "1 of no, 0 of yes", + "type": "numerical", + "side": "right", + "size": 1.0 + }, + { + "name": "balance <= 5477.5", + "pred": "0 of no, 11 of yes", + "type": "numerical", + "side": "left", + "size": 11.0 + } + ], + "name": "pdays > 373.0", + "side": "right", + "type": "numerical", + "size": 12.0, + "pred": "1 of no, 11 of yes" + }, + { + "children": [ + { + "name": "month = oct", + "pred": "11 of no, 16 of yes", + "type": "categorical", + "side": "right", + "size": 27.0 + }, + { + "name": "month != oct", + "pred": "1207 of no, 173 of yes", + "type": "categorical", + "side": "left", + "size": 1380.0 + } + ], + "name": "pdays <= 373.0", + "side": "left", + "type": "numerical", + "size": 1407.0, + "pred": "1218 of no, 189 of yes" + } + ], + "name": "duration > 222.5", + "side": "right", + "type": "numerical", + "size": 1419.0, + "pred": "1219 of no, 200 of yes" + }, + { + "children": [ + { + "children": [ + { + "name": "day > 19.5", + "pred": "6 of no, 9 of yes", + "type": "numerical", + "side": "right", + "size": 15.0 + }, + { + "name": "day <= 19.5", + "pred": "20 of no, 1 of yes", + "type": "numerical", + "side": "left", + "size": 21.0 + } + ], + "name": "month = oct", + "side": "right", + "type": "categorical", + "size": 36.0, + "pred": "26 of no, 10 of yes" + }, + { + "children": [ + { + "name": "month = mar", + "pred": "21 of no, 9 of yes", + "type": "categorical", + "side": "right", + "size": 30.0 + }, + { + "name": "month != mar", + "pred": "2516 of no, 46 of yes", + "type": "categorical", + "side": "left", + "size": 2562.0 + } + ], + "name": "month != oct", + "side": "left", + "type": "categorical", + "size": 2592.0, + "pred": "2537 of no, 55 of yes" + } + ], + "name": "duration <= 222.5", + "side": "left", + "type": "numerical", + "size": 2628.0, + "pred": "2563 of no, 65 of yes" + } + ], + "name": "poutcome != success", + "side": "left", + "type": "categorical", + "size": 4047.0, + "pred": "3782 of no, 265 of yes" + } + ], + "name": "50 of setosa, 0 of versicolor, 0 of virginica", + "side": "left", + "type": "numerical", + "size": 50, + "pred": "50 of setosa, 0 of versicolor&virginica" + } + + ], + "side": "right", + "size": 150 +} + + + + + + + + + + diff --git a/rapsberrypi/web/structureC2_origin.json b/rapsberrypi/web/structureC2_origin.json new file mode 100644 index 000000000..533c18ecb --- /dev/null +++ b/rapsberrypi/web/structureC2_origin.json @@ -0,0 +1,489 @@ +{ + "name": "Root >", + "pred": "4000 of no, 521 of yes", + "children": [ + { + "children": [ + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "balance > 662.5", + "pred": "7 of no, 8 of yes", + "type": "numerical", + "side": "right", + "size": 15.0 + }, + { + "name": "balance <= 662.5", + "pred": "1 of no, 11 of yes", + "type": "numerical", + "side": "left", + "size": 12.0 + } + ], + "name": "campaign > 3.5", + "side": "right", + "type": "numerical", + "size": 27.0, + "pred": "8 of no, 19 of yes" + }, + { + "children": [ + { + "name": "job = technician", + "pred": "2 of no, 7 of yes", + "type": "categorical", + "side": "right", + "size": 9.0 + }, + { + "name": "job != technician", + "pred": "49 of no, 34 of yes", + "type": "categorical", + "side": "left", + "size": 83.0 + } + ], + "name": "campaign <= 3.5", + "side": "left", + "type": "numerical", + "size": 92.0, + "pred": "51 of no, 41 of yes" + } + ], + "name": "contact = cellular", + "side": "right", + "type": "categorical", + "size": 119.0, + "pred": "59 of no, 60 of yes" + }, + { + "children": [ + { + "children": [ + { + "name": "poutcome = success", + "pred": "1 of no, 0 of yes", + "type": "categorical", + "side": "right", + "size": 1.0 + }, + { + "name": "poutcome != success", + "pred": "0 of no, 7 of yes", + "type": "categorical", + "side": "left", + "size": 7.0 + } + ], + "name": "job = retired", + "side": "right", + "type": "categorical", + "size": 8.0, + "pred": "1 of no, 7 of yes" + }, + { + "children": [ + { + "name": "duration > 1249.5", + "pred": "4 of no, 7 of yes", + "type": "numerical", + "side": "right", + "size": 11.0 + }, + { + "name": "duration <= 1249.5", + "pred": "56 of no, 11 of yes", + "type": "numerical", + "side": "left", + "size": 67.0 + } + ], + "name": "job != retired", + "side": "left", + "type": "categorical", + "size": 78.0, + "pred": "60 of no, 18 of yes" + } + ], + "name": "contact != cellular", + "side": "left", + "type": "categorical", + "size": 86.0, + "pred": "61 of no, 25 of yes" + } + ], + "name": "marital = married", + "side": "right", + "type": "categorical", + "size": 205.0, + "pred": "120 of no, 85 of yes" + }, + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "duration > 1020.5", + "pred": "3 of no, 15 of yes", + "type": "numerical", + "side": "right", + "size": 18.0 + }, + { + "name": "duration <= 1020.5", + "pred": "24 of no, 15 of yes", + "type": "numerical", + "side": "left", + "size": 39.0 + } + ], + "name": "day > 19.5", + "side": "right", + "type": "numerical", + "size": 57.0, + "pred": "27 of no, 30 of yes" + }, + { + "children": [ + { + "name": "age > 55.5", + "pred": "5 of no, 3 of yes", + "type": "numerical", + "side": "right", + "size": 8.0 + }, + { + "name": "age <= 55.5", + "pred": "11 of no, 51 of yes", + "type": "numerical", + "side": "left", + "size": 62.0 + } + ], + "name": "day <= 19.5", + "side": "left", + "type": "numerical", + "size": 70.0, + "pred": "16 of no, 54 of yes" + } + ], + "name": "day > 7.5", + "side": "right", + "type": "numerical", + "size": 127.0, + "pred": "43 of no, 84 of yes" + }, + { + "children": [ + { + "name": "previous > 1.5", + "pred": "0 of no, 3 of yes", + "type": "numerical", + "side": "right", + "size": 3.0 + }, + { + "children": [ + { + "name": "duration > 678.5", + "pred": "16 of no, 6 of yes", + "type": "numerical", + "side": "right", + "size": 22.0 + }, + { + "name": "duration <= 678.5", + "pred": "0 of no, 2 of yes", + "type": "numerical", + "side": "left", + "size": 2.0 + } + ], + "name": "previous <= 1.5", + "side": "left", + "type": "numerical", + "size": 24.0, + "pred": "16 of no, 8 of yes" + } + ], + "name": "day <= 7.5", + "side": "left", + "type": "numerical", + "size": 27.0, + "pred": "16 of no, 11 of yes" + } + ], + "name": "marital != married", + "side": "left", + "type": "categorical", + "size": 154.0, + "pred": "59 of no, 95 of yes" + } + ], + "name": "duration > 645.5", + "side": "right", + "type": "numerical", + "size": 359.0, + "pred": "179 of no, 180 of yes" + }, + { + "children": [ + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "duration > 339.0", + "pred": "1 of no, 4 of yes", + "type": "numerical", + "side": "right", + "size": 5.0 + }, + { + "name": "duration <= 339.0", + "pred": "6 of no, 1 of yes", + "type": "numerical", + "side": "left", + "size": 7.0 + } + ], + "name": "month = may", + "side": "right", + "type": "categorical", + "size": 12.0, + "pred": "7 of no, 5 of yes" + }, + { + "children": [ + { + "name": "pdays > 35.5", + "pred": "11 of no, 62 of yes", + "type": "numerical", + "side": "right", + "size": 73.0 + }, + { + "name": "pdays <= 35.5", + "pred": "1 of no, 0 of yes", + "type": "numerical", + "side": "left", + "size": 1.0 + } + ], + "name": "month != may", + "side": "left", + "type": "categorical", + "size": 74.0, + "pred": "12 of no, 62 of yes" + } + ], + "name": "duration > 180.5", + "side": "right", + "type": "numerical", + "size": 86.0, + "pred": "19 of no, 67 of yes" + }, + { + "children": [ + { + "children": [ + { + "name": "job = technician", + "pred": "2 of no, 1 of yes", + "type": "categorical", + "side": "right", + "size": 3.0 + }, + { + "name": "job != technician", + "pred": "0 of no, 6 of yes", + "type": "categorical", + "side": "left", + "size": 6.0 + } + ], + "name": "education = tertiary", + "side": "right", + "type": "categorical", + "size": 9.0, + "pred": "2 of no, 7 of yes" + }, + { + "children": [ + { + "name": "marital = divorced", + "pred": "0 of no, 1 of yes", + "type": "categorical", + "side": "right", + "size": 1.0 + }, + { + "name": "marital != divorced", + "pred": "18 of no, 1 of yes", + "type": "categorical", + "side": "left", + "size": 19.0 + } + ], + "name": "education != tertiary", + "side": "left", + "type": "categorical", + "size": 20.0, + "pred": "18 of no, 2 of yes" + } + ], + "name": "duration <= 180.5", + "side": "left", + "type": "numerical", + "size": 29.0, + "pred": "20 of no, 9 of yes" + } + ], + "name": "poutcome = success", + "side": "right", + "type": "categorical", + "size": 115.0, + "pred": "39 of no, 76 of yes" + }, + { + "children": [ + { + "children": [ + { + "children": [ + { + "name": "balance > 5477.5", + "pred": "1 of no, 0 of yes", + "type": "numerical", + "side": "right", + "size": 1.0 + }, + { + "name": "balance <= 5477.5", + "pred": "0 of no, 11 of yes", + "type": "numerical", + "side": "left", + "size": 11.0 + } + ], + "name": "pdays > 373.0", + "side": "right", + "type": "numerical", + "size": 12.0, + "pred": "1 of no, 11 of yes" + }, + { + "children": [ + { + "name": "month = oct", + "pred": "11 of no, 16 of yes", + "type": "categorical", + "side": "right", + "size": 27.0 + }, + { + "name": "month != oct", + "pred": "1207 of no, 173 of yes", + "type": "categorical", + "side": "left", + "size": 1380.0 + } + ], + "name": "pdays <= 373.0", + "side": "left", + "type": "numerical", + "size": 1407.0, + "pred": "1218 of no, 189 of yes" + } + ], + "name": "duration > 222.5", + "side": "right", + "type": "numerical", + "size": 1419.0, + "pred": "1219 of no, 200 of yes" + }, + { + "children": [ + { + "children": [ + { + "name": "day > 19.5", + "pred": "6 of no, 9 of yes", + "type": "numerical", + "side": "right", + "size": 15.0 + }, + { + "name": "day <= 19.5", + "pred": "20 of no, 1 of yes", + "type": "numerical", + "side": "left", + "size": 21.0 + } + ], + "name": "month = oct", + "side": "right", + "type": "categorical", + "size": 36.0, + "pred": "26 of no, 10 of yes" + }, + { + "children": [ + { + "name": "month = mar", + "pred": "21 of no, 9 of yes", + "type": "categorical", + "side": "right", + "size": 30.0 + }, + { + "name": "month != mar", + "pred": "2516 of no, 46 of yes", + "type": "categorical", + "side": "left", + "size": 2562.0 + } + ], + "name": "month != oct", + "side": "left", + "type": "categorical", + "size": 2592.0, + "pred": "2537 of no, 55 of yes" + } + ], + "name": "duration <= 222.5", + "side": "left", + "type": "numerical", + "size": 2628.0, + "pred": "2563 of no, 65 of yes" + } + ], + "name": "poutcome != success", + "side": "left", + "type": "categorical", + "size": 4047.0, + "pred": "3782 of no, 265 of yes" + } + ], + "name": "duration <= 645.5", + "side": "left", + "type": "numerical", + "size": 4162.0, + "pred": "3821 of no, 341 of yes" + } + ], + "side": "right", + "size": 4521.0 +} + + + diff --git a/rapsberrypi/web/structure_iris_dc_1.json b/rapsberrypi/web/structure_iris_dc_1.json new file mode 100644 index 000000000..d79fafedb --- /dev/null +++ b/rapsberrypi/web/structure_iris_dc_1.json @@ -0,0 +1,257 @@ +{ + "name": "petal length (cm) > 2.45000004768", + "pred": "100 of no, 50 of yes", + "children": [ + { + "children": [ + { + "children": [ + { + + "name": "The number of data = 43", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "43 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "43 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "The number of data = 3", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "1 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + , + { + + "name": "2 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 3, + "pred": "0 of no, 0 of yes" + } + + ], + "name": "petal length (cm) > 4.85000038147", + "side": "right", + "type": "categorical", + "size": 46, + "pred": "43 of no, 3 of yes" + }, + { + + "name": "petal length (cm) > 4.94999980927", + "children": [ + + { + + "name": "The number of data = 6", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "2 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + , + { + + "name": "4 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 4, + "pred": "4 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 6, + "pred": "0 of no, 0 of yes" + }, + + { + + "name": "The number of data = 48", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "47 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 47, + "pred": "47 of no, 0 of yes" + } + , + { + + "name": "1 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 48, + "pred": "0 of no, 0 of yes" + } + + + + ], + "side": "left", + "type": "categorical", + "size": 54, + "pred": "6 of no, 48 of yes" + } + ], + "name": "petal width (cm) > 1.75", + "side": "right", + "type": "numerical", + "size": 100, + "pred": "46 of no, 54 of yes" + },{ + "name": "The number of data = 50", + "children": [ + + + + { + + "name": "50 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "50 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "0 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "0 of no, 0 of yes" + } + ], + "side": "right", + "size": 150 +} + + + diff --git a/rapsberrypi/web/structure_iris_dc_1_80_size.json b/rapsberrypi/web/structure_iris_dc_1_80_size.json new file mode 100644 index 000000000..d474d25ff --- /dev/null +++ b/rapsberrypi/web/structure_iris_dc_1_80_size.json @@ -0,0 +1,257 @@ +{ + "name": "petal length (cm) > 2.45000004768", + "pred": "100 of no, 50 of yes", + "children": [ + { + "children": [ + { + "children": [ + { + + "name": "The number of data = 2", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "43 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "43 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 43, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "The number of data = 3", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "1 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + , + { + + "name": "2 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 3, + "pred": "0 of no, 0 of yes" + } + + ], + "name": "petal length (cm) > 4.85000038147", + "side": "right", + "type": "categorical", + "size": 25, + "pred": "22 of no, 3 of yes" + }, + { + + "name": "petal length (cm) > 4.94999980927", + "children": [ + + { + + "name": "The number of data = 6", + "children": [ + + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "2 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 2, + "pred": "2 of no, 0 of yes" + } + , + { + + "name": "4 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 4, + "pred": "4 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 6, + "pred": "0 of no, 0 of yes" + }, + + { + + "name": "The number of data = 48", + "children": [ + + + { + + "name": "0 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + }, + { + + "name": "47 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 47, + "pred": "47 of no, 0 of yes" + } + , + { + + "name": "1 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 1, + "pred": "1 of no, 0 of yes" + } + + + + + ], + "side": "right", + "type": "categorical", + "size": 48, + "pred": "0 of no, 0 of yes" + } + + + + ], + "side": "left", + "type": "categorical", + "size": 25, + "pred": "4 of no, 21 of yes" + } + ], + "name": "petal width (cm) > 1.75", + "side": "right", + "type": "numerical", + "size": 50, + "pred": "46 of no, 54 of yes" + },{ + "name": "The number of data = 50", + "children": [ + + + + { + + "name": "50 = setosa", + "children": [], + "side": "right", + "type": "categorical", + "size": 50, + "pred": "50 of no, 0 of yes" + }, + { + + "name": "0 = versicolor", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + , + { + + "name": "0 = virginica", + "children": [], + "side": "right", + "type": "categorical", + "size": 0, + "pred": "0 of no, 0 of yes" + } + + ], + "side": "right", + "type": "categorical", + "size": 30, + "pred": "0 of no, 0 of yes" + } + ], + "side": "right", + "size": 80 +} + + + diff --git a/rapsberrypi/web/structure_iris_dc_2.json b/rapsberrypi/web/structure_iris_dc_2.json new file mode 100644 index 000000000..8e4d41f37 --- /dev/null +++ b/rapsberrypi/web/structure_iris_dc_2.json @@ -0,0 +1,35 @@ +{ + "name": "petal length (cm) > 2.45000004768", + "children": [ + { + "name": "petal width (cm) > 1.75", + "children": [ + { + "name": "petal length (cm) > 4.85000038147", + "children": [ + { + "name": "0 of setosa, 0 of versicolor, 43 of virginica" + }, + { + "name": "0 of setosa, 1 of versicolor, 2 of virginica" + } + ] + }, + { + "name": "petal length (cm) > 4.94999980927", + "children": [ + { + "name": "0 of setosa, 2 of versicolor, 4 of virginica" + }, + { + "name": "0 of setosa, 47 of versicolor, 1 of virginica" + } + ] + } + ] + }, + { + "name": "50 of setosa, 0 of versicolor, 0 of virginica" + } + ] + } \ No newline at end of file diff --git a/rapsberrypi/web/thirdThumbnail.png b/rapsberrypi/web/thirdThumbnail.png new file mode 100644 index 000000000..b47d067bf Binary files /dev/null and b/rapsberrypi/web/thirdThumbnail.png differ diff --git a/rapsberrypi/web/thirdThumbnail_resized.png b/rapsberrypi/web/thirdThumbnail_resized.png new file mode 100644 index 000000000..f72fe736c Binary files /dev/null and b/rapsberrypi/web/thirdThumbnail_resized.png differ