diff --git a/.buildinfo b/.buildinfo new file mode 100644 index 0000000..5ba9201 --- /dev/null +++ b/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: a7d3501fa1157aac60e969e72f559716 +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/.nojekyll b/.nojekyll new file mode 100644 index 0000000..e69de29 diff --git a/_autosummary/mappymatch.constructs.coordinate.html b/_autosummary/mappymatch.constructs.coordinate.html new file mode 100644 index 0000000..38736f1 --- /dev/null +++ b/_autosummary/mappymatch.constructs.coordinate.html @@ -0,0 +1,674 @@ + + + + + + + + + + + mappymatch.constructs.coordinate — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.constructs.coordinate

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.constructs.coordinate#

+

Classes

+
+ + + + + +

Coordinate(coordinate_id, geom, crs)

Represents a single coordinate with a CRS and a geometry

+
+
+
+class mappymatch.constructs.coordinate.Coordinate(coordinate_id: Any, geom: Point, crs: CRS)[source]#
+

Represents a single coordinate with a CRS and a geometry

+
+
Attributes:

coordinate_id: The unique identifier for this coordinate +geom: The geometry of this coordinate +crs: The CRS of this coordinate +x: The x value of this coordinate +y: The y value of this coordinate

+
+
+
+
Parameters:
+
    +

  • coordinate_id (Any)

    • +

  • geom (Point)

    • +

  • crs (CRS)

    • +
+
+
+
+
+coordinate_id: Any#
+

Alias for field number 0

+
+ +
+
+geom: Point#
+

Alias for field number 1

+
+ +
+
+crs: CRS#
+

Alias for field number 2

+
+ +
+
+classmethod from_lat_lon(lat, lon)[source]#
+

Build a coordinate from a latitude/longitude

+
+
Return type:
+

Coordinate

+
+
Parameters:
+
    +

  • lat (float)

    • +

  • lon (float)

    • +
+
+
+
+
Args:

lat: The latitude +lon: The longitude

+
+
Returns:

A new coordinate

+
+
+
+ +
+
+property x: float#
+
+ +
+
+property y: float#
+
+ +
+
+to_crs(new_crs)[source]#
+

Convert this coordinate to a new CRS

+
+
Return type:
+

Coordinate

+
+
Parameters:
+

new_crs (Any)

+
+
+
+
Args:

new_crs: The new CRS to convert to

+
+
Returns:

A new coordinate with the new CRS

+
+
Raises:

A ValueError if it fails to convert the coordinate

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.constructs.geofence.html b/_autosummary/mappymatch.constructs.geofence.html new file mode 100644 index 0000000..875413c --- /dev/null +++ b/_autosummary/mappymatch.constructs.geofence.html @@ -0,0 +1,649 @@ + + + + + + + + + + + mappymatch.constructs.geofence — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.constructs.geofence

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.constructs.geofence#

+

Classes

+
+ + + + + +

Geofence(crs, geometry)

A geofence is basically a shapely polygon with a CRS

+
+
+
+class mappymatch.constructs.geofence.Geofence(crs, geometry)[source]#
+

A geofence is basically a shapely polygon with a CRS

+
+
Args:

geom: The polygon geometry of the geofence +crs: The CRS of the geofence

+
+
+
+
Parameters:
+
    +

  • crs (CRS)

    • +

  • geometry (Polygon)

    • +
+
+
+
+
+classmethod from_geojson(file)[source]#
+

Creates a new geofence from a geojson file.

+
+
Return type:
+

Geofence

+
+
Parameters:
+

file (Path | str)

+
+
+
+
Args:

file: The path to the geojson file

+
+
Returns:

A new geofence

+
+
+
+ +
+
+classmethod from_trace(trace, padding=1000.0, crs=<Geographic 2D CRS: EPSG:4326> Name: WGS 84 Axis Info [ellipsoidal]: - Lat[north]: Geodetic latitude (degree) - Lon[east]: Geodetic longitude (degree) Area of Use: - name: World. - bounds: (-180.0, -90.0, 180.0, 90.0) Datum: World Geodetic System 1984 ensemble - Ellipsoid: WGS 84 - Prime Meridian: Greenwich, buffer_res=2)[source]#
+

Create a new geofence from a trace.

+

This is done by computing a radial buffer around the +entire trace (as a line).

+
+
Return type:
+

Geofence

+
+
Parameters:
+
    +

  • trace (Trace)

    • +

  • padding (float)

    • +

  • crs (CRS)

    • +

  • buffer_res (int)

    • +
+
+
+
+
Args:

trace: The trace to compute the bounding polygon for. +padding: The padding (in meters) around the trace line. +crs: The coordinate reference system to use. +buffer_res: The resolution of the surrounding buffer.

+
+
Returns:

The computed bounding polygon.

+
+
+
+ +
+
+to_geojson()[source]#
+

Converts the geofence to a geojson string.

+
+
Return type:
+

str

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.constructs.html b/_autosummary/mappymatch.constructs.html new file mode 100644 index 0000000..cdd54ce --- /dev/null +++ b/_autosummary/mappymatch.constructs.html @@ -0,0 +1,545 @@ + + + + + + + + + + + mappymatch.constructs — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.constructs

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.constructs#

+

Modules

+
+ + + + + + + + + + + + + + + + + +

coordinate

geofence

match

road

trace

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.constructs.match.html b/_autosummary/mappymatch.constructs.match.html new file mode 100644 index 0000000..8e5a3df --- /dev/null +++ b/_autosummary/mappymatch.constructs.match.html @@ -0,0 +1,644 @@ + + + + + + + + + + + mappymatch.constructs.match — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.constructs.match

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.constructs.match#

+

Classes

+
+ + + + + +

Match(road, coordinate, distance)

Represents a match made by a Matcher

+
+
+
+class mappymatch.constructs.match.Match(road: Road | None, coordinate: Coordinate, distance: float)[source]#
+

Represents a match made by a Matcher

+
+
Attributes:

road: The road that was matched; None if no road was found; +coordinate: The original coordinate that was matched; +distance: The distance to the matched road; If no road was found, this is infinite

+
+
+
+
Parameters:
+
+
+
+
+
+road: Optional[Road]#
+

Alias for field number 0

+
+ +
+
+coordinate: Coordinate#
+

Alias for field number 1

+
+ +
+
+distance: float#
+

Alias for field number 2

+
+ +
+
+set_coordinate(c)[source]#
+

Set the coordinate of this match

+
+
Args:

c: The new coordinate

+
+
Returns:

The match with the new coordinate

+
+
+
+
Parameters:
+

c (Coordinate)

+
+
+
+ +
+
+to_flat_dict()[source]#
+

Convert this match to a flat dictionary

+
+
Return type:
+

dict

+
+
+
+
Returns:

A flat dictionary with all match information

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.constructs.road.html b/_autosummary/mappymatch.constructs.road.html new file mode 100644 index 0000000..002037c --- /dev/null +++ b/_autosummary/mappymatch.constructs.road.html @@ -0,0 +1,737 @@ + + + + + + + + + + + mappymatch.constructs.road — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.constructs.road

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.constructs.road#

+

Classes

+
+ + + + + + + + +

Road(road_id, geom[, metadata])

Represents a road that can be matched to;

RoadId(start, end, key)

+
+
+
+class mappymatch.constructs.road.RoadId(start, end, key)[source]#
+
+
Parameters:
+
    +

  • start (int | str | None)

    • +

  • end (int | str | None)

    • +

  • key (int | str | None)

    • +
+
+
+
+
+start: Union[int, str, None]#
+

Alias for field number 0

+
+ +
+
+end: Union[int, str, None]#
+

Alias for field number 1

+
+ +
+
+key: Union[int, str, None]#
+

Alias for field number 2

+
+ +
+
+to_string()[source]#
+
+
Return type:
+

str

+
+
+
+ +
+
+to_json()[source]#
+
+
Return type:
+

Dict[str, Any]

+
+
+
+ +
+
+classmethod from_string(s)[source]#
+
+
Return type:
+

RoadId

+
+
Parameters:
+

s (str)

+
+
+
+ +
+
+classmethod from_json(json)[source]#
+
+
Return type:
+

RoadId

+
+
Parameters:
+

json (Dict[str, Any])

+
+
+
+ +
+ +
+
+class mappymatch.constructs.road.Road(road_id: RoadId, geom: LineString, metadata: dict | None = None)[source]#
+

Represents a road that can be matched to;

+
+
Attributes:

road_id: The unique identifier for this road +geom: The geometry of this road +origin_junction_id: The unique identifier of the origin junction of this road +destination_junction_id: The unique identifier of the destination junction of this road +metadata: an optional dictionary for storing additional metadata

+
+
+
+
Parameters:
+
    +

  • road_id (RoadId)

    • +

  • geom (LineString)

    • +

  • metadata (dict | None)

    • +
+
+
+
+
+road_id: RoadId#
+

Alias for field number 0

+
+ +
+
+geom: LineString#
+

Alias for field number 1

+
+ +
+
+metadata: Optional[dict]#
+

Alias for field number 2

+
+ +
+
+to_dict()[source]#
+

Convert the road to a dictionary

+
+
Return type:
+

Dict[str, Any]

+
+
+
+ +
+
+to_flat_dict()[source]#
+

Convert the road to a flat dictionary

+
+
Return type:
+

Dict[str, Any]

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.constructs.trace.html b/_autosummary/mappymatch.constructs.trace.html new file mode 100644 index 0000000..6f76b82 --- /dev/null +++ b/_autosummary/mappymatch.constructs.trace.html @@ -0,0 +1,849 @@ + + + + + + + + + + + mappymatch.constructs.trace — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.constructs.trace

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.constructs.trace#

+

Classes

+
+ + + + + +

Trace(frame)

A Trace is a collection of coordinates that represents a trajectory to be matched.

+
+
+
+class mappymatch.constructs.trace.Trace(frame)[source]#
+

A Trace is a collection of coordinates that represents a trajectory to be matched.

+
+
Attributes:

coords: A list of all the coordinates +crs: The CRS of the trace +index: The index of the trace

+
+
+
+
Parameters:
+

frame (GeoDataFrame)

+
+
+
+
+property index: Index#
+

Get index to underlying GeoDataFrame.

+
+ +
+
+property coords: List[Coordinate]#
+

Get coordinates as Coordinate objects.

+
+ +
+
+property crs: CRS#
+

Get Coordinate Reference System(CRS) to underlying GeoDataFrame.

+
+ +
+
+classmethod from_geo_dataframe(frame, xy=True)[source]#
+

Builds a trace from a geopandas dataframe

+

Expects the dataframe to have geometry column

+
+
Return type:
+

Trace

+
+
Parameters:
+
    +

  • frame (GeoDataFrame)

    • +

  • xy (bool)

    • +
+
+
+
+
Args:

frame: geopandas dataframe with _one_ trace +xy: should the trace be projected to epsg 3857?

+
+
Returns:

The trace built from the geopandas dataframe

+
+
+
+ +
+
+classmethod from_dataframe(dataframe, xy=True, lat_column='latitude', lon_column='longitude')[source]#
+

Builds a trace from a pandas dataframe

+

Expects the dataframe to have latitude / longitude information in the epsg 4326 format

+
+
Return type:
+

Trace

+
+
Parameters:
+
    +

  • dataframe (DataFrame)

    • +

  • xy (bool)

    • +

  • lat_column (str)

    • +

  • lon_column (str)

    • +
+
+
+
+
Args:

dataframe: pandas dataframe with _one_ trace +xy: should the trace be projected to epsg 3857? +lat_column: the name of the latitude column +lon_column: the name of the longitude column

+
+
Returns:

The trace built from the pandas dataframe

+
+
+
+ +
+
+classmethod from_gpx(file, xy=True)[source]#
+

Builds a trace from a gpx file.

+

Expects the file to have simple gpx structure: a sequence of lat, lon pairs

+
+
Return type:
+

Trace

+
+
Parameters:
+
    +

  • file (str | Path)

    • +

  • xy (bool)

    • +
+
+
+
+
Args:

file: the gpx file +xy: should the trace be projected to epsg 3857?

+
+
Returns:

The trace built from the gpx file

+
+
+
+ +
+
+classmethod from_csv(file, xy=True, lat_column='latitude', lon_column='longitude')[source]#
+

Builds a trace from a csv file.

+

Expects the file to have latitude / longitude information in the epsg 4326 format

+
+
Return type:
+

Trace

+
+
Parameters:
+
    +

  • file (str | Path)

    • +

  • xy (bool)

    • +

  • lat_column (str)

    • +

  • lon_column (str)

    • +
+
+
+
+
Args:

file: the csv file +xy: should the trace be projected to epsg 3857? +lat_column: the name of the latitude column +lon_column: the name of the longitude column

+
+
Returns:

The trace built from the csv file

+
+
+
+ +
+
+classmethod from_parquet(file, xy=True)[source]#
+

Read a trace from a parquet file

+
+
Args:

file: the parquet file +xy: should the trace be projected to epsg 3857?

+
+
Returns:

The trace built from the parquet file

+
+
+
+
Parameters:
+
    +

  • file (str | Path)

    • +

  • xy (bool)

    • +
+
+
+
+ +
+
+classmethod from_geojson(file, index_property=None, xy=True)[source]#
+

Reads a trace from a geojson file; +If index_property is not specified, this will set any property columns as the index.

+
+
Args:

file: the geojson file +index_property: the name of the property to use as the index +xy: should the trace be projected to epsg 3857?

+
+
Returns:

The trace built from the geojson file

+
+
+
+
Parameters:
+
    +

  • file (str | Path)

    • +

  • index_property (str | None)

    • +

  • xy (bool)

    • +
+
+
+
+ +
+
+downsample(npoints)[source]#
+

Downsample the trace to a given number of points

+
+
Return type:
+

Trace

+
+
Parameters:
+

npoints (int)

+
+
+
+
Args:

npoints: the number of points to downsample to

+
+
Returns:

The downsampled trace

+
+
+
+ +
+
+drop(index=typing.List)[source]#
+

Remove points from the trace specified by the index parameter

+
+
Return type:
+

Trace

+
+
+
+
Args:

index: the index of the points to drop (0 based index)

+
+
Returns:

The trace with the points removed

+
+
+
+ +
+
+to_crs(new_crs)[source]#
+

Converts the crs of a trace to a new crs

+
+
Return type:
+

Trace

+
+
Parameters:
+

new_crs (CRS)

+
+
+
+
Args:

new_crs: the new crs to convert to

+
+
Returns:

A new trace with the new crs

+
+
+
+ +
+
+to_geojson(file)[source]#
+

Write the trace to a geojson file

+
+
Args:

file: the file to write to

+
+
+
+
Parameters:
+

file (str | Path)

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.html b/_autosummary/mappymatch.maps.html new file mode 100644 index 0000000..54ba410 --- /dev/null +++ b/_autosummary/mappymatch.maps.html @@ -0,0 +1,539 @@ + + + + + + + + + + + mappymatch.maps — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.maps#

+

Modules

+
+ + + + + + + + + + + +

igraph

map_interface

nx

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.igraph.html b/_autosummary/mappymatch.maps.igraph.html new file mode 100644 index 0000000..d9121c6 --- /dev/null +++ b/_autosummary/mappymatch.maps.igraph.html @@ -0,0 +1,533 @@ + + + + + + + + + + + mappymatch.maps.igraph — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.igraph

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.maps.igraph#

+

Modules

+
+ + + + + +

igraph_map

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.igraph.igraph_map.html b/_autosummary/mappymatch.maps.igraph.igraph_map.html new file mode 100644 index 0000000..c98d313 --- /dev/null +++ b/_autosummary/mappymatch.maps.igraph.igraph_map.html @@ -0,0 +1,794 @@ + + + + + + + + + + + mappymatch.maps.igraph.igraph_map — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.igraph.igraph_map

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.maps.igraph.igraph_map#

+

Classes

+
+ + + + + +

IGraphMap(graph)

A road map that uses an igraph graph to represent its roads.

+
+
+
+class mappymatch.maps.igraph.igraph_map.IGraphMap(graph)[source]#
+

A road map that uses an igraph graph to represent its roads.

+
+
Attributes:

ig: The igraph graph that represents the road map +road_mapping: A mapping from road ids to igraph edge ids +crs: The coordinate reference system of the map

+
+
+
+
Parameters:
+

graph (ig.Graph)

+
+
+
+
+property distance_weight: str#
+

Get the distance weight

+
+
Returns:

The distance weight

+
+
+
+ +
+
+property time_weight: str#
+

Get the time weight

+
+
Returns:

The time weight

+
+
+
+ +
+
+road_by_id(road_id)[source]#
+

Get a road by its id

+
+
Return type:
+

Optional[Road]

+
+
Parameters:
+

road_id (RoadId)

+
+
+
+
Args:

road_id: The id of the road to get

+
+
Returns:

The road with the given id, or None if it does not exist

+
+
+
+ +
+
+set_road_attributes(attributes)[source]#
+

Set the attributes of the roads in the map

+
+
Args:

attributes: A dictionary mapping road ids to dictionaries of attributes

+
+
Returns:

None

+
+
+
+
Parameters:
+

attributes (Dict[RoadId, Dict[str, Any]])

+
+
+
+ +
+
+property roads: List[Road]#
+

Get a list of all the roads in the map

+
+
Returns:

A list of all the roads in the map

+
+
+
+ +
+
+classmethod from_nx_graph(nx_graph)[source]#
+

Build an IGraphMap from a networkx graph

+
+
Return type:
+

IGraphMap

+
+
Parameters:
+

nx_graph (MultiDiGraph)

+
+
+
+ +
+
+classmethod from_file(file)[source]#
+

Build a IGraphMap instance from a file

+
+
Return type:
+

IGraphMap

+
+
Parameters:
+

file (str | Path)

+
+
+
+
Args:

file: The graph pickle file to load the graph from

+
+
Returns:

A IGraphMap instance

+
+
+
+ +
+
+classmethod from_geofence(geofence, xy=True, network_type=NetworkType.DRIVE)[source]#
+

Read an OSM network graph into a IGraphMap

+
+
Return type:
+

IGraphMap

+
+
Parameters:
+
+
+
+
+
Args:

geofence: the geofence to clip the graph to +xy: whether to use xy coordinates or lat/lon +network_type: the network type to use for the graph

+
+
Returns:

a IGraphMap

+
+
+
+ +
+
+to_file(outfile)[source]#
+

Save the graph to a pickle file

+
+
Args:

outfile: The file to save the graph to

+
+
+
+
Parameters:
+

outfile (str | Path)

+
+
+
+ +
+
+nearest_road(coord, buffer=10.0)[source]#
+

A helper function to get the nearest road.

+
+
Return type:
+

Road

+
+
Parameters:
+
+
+
+
+
Args:

coord: The coordinate to find the nearest road to +buffer: The buffer to search around the coordinate

+
+
Returns:

The nearest road to the coordinate

+
+
+
+ +
+
+shortest_path(origin, destination, weight=None)[source]#
+

Computes the shortest path between an origin and a destination

+
+
Return type:
+

List[Road]

+
+
Parameters:
+
+
+
+
+
Args:

origin: The origin coordinate +destination: The destination coordinate +weight: The weight to use for the path, either a string or a function

+
+
Returns:

A list of roads that form the shortest path

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.map_interface.html b/_autosummary/mappymatch.maps.map_interface.html new file mode 100644 index 0000000..a1dfdd3 --- /dev/null +++ b/_autosummary/mappymatch.maps.map_interface.html @@ -0,0 +1,677 @@ + + + + + + + + + + + mappymatch.maps.map_interface — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.map_interface

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.maps.map_interface#

+

Classes

+
+ + + + + +

MapInterface()

Abstract base class for a Matcher

+
+
+
+class mappymatch.maps.map_interface.MapInterface[source]#
+

Abstract base class for a Matcher

+
+
+abstract property distance_weight: str#
+

Get the distance weight

+
+
Returns:

The distance weight

+
+
+
+ +
+
+abstract property time_weight: str#
+

Get the time weight

+
+
Returns:

The time weight

+
+
+
+ +
+
+abstract property roads: List[Road]#
+

Get a list of all the roads in the map

+
+
Returns:

A list of all the roads in the map

+
+
+
+ +
+
+abstract road_by_id(road_id)[source]#
+

Get a road by its id

+
+
Return type:
+

Optional[Road]

+
+
Parameters:
+

road_id (RoadId)

+
+
+
+
Args:

road_id: The id of the road to get

+
+
Returns:

The road with the given id or None if it does not exist

+
+
+
+ +
+
+abstract nearest_road(coord)[source]#
+

Return the nearest road to a coordinate

+
+
Return type:
+

Road

+
+
Parameters:
+

coord (Coordinate)

+
+
+
+
Args:

coord: The coordinate to find the nearest road to

+
+
Returns:

The nearest road to the coordinate

+
+
+
+ +
+
+abstract shortest_path(origin, destination, weight=None)[source]#
+

Computes the shortest path on the road network

+
+
Return type:
+

List[Road]

+
+
Parameters:
+
+
+
+
+
Args:

origin: The origin coordinate +destination: The destination coordinate +weight: The weight to use for the path

+
+
Returns:

A list of roads that form the shortest path

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.nx.html b/_autosummary/mappymatch.maps.nx.html new file mode 100644 index 0000000..2be705d --- /dev/null +++ b/_autosummary/mappymatch.maps.nx.html @@ -0,0 +1,536 @@ + + + + + + + + + + + mappymatch.maps.nx — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.nx

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.maps.nx#

+

Modules

+
+ + + + + + + + +

nx_map

readers

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.nx.nx_map.html b/_autosummary/mappymatch.maps.nx.nx_map.html new file mode 100644 index 0000000..31efdbb --- /dev/null +++ b/_autosummary/mappymatch.maps.nx.nx_map.html @@ -0,0 +1,808 @@ + + + + + + + + + + + mappymatch.maps.nx.nx_map — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.nx.nx_map

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.maps.nx.nx_map#

+

Classes

+
+ + + + + +

NxMap(graph)

A road map that uses a networkx graph to represent its roads.

+
+
+
+class mappymatch.maps.nx.nx_map.NxMap(graph)[source]#
+

A road map that uses a networkx graph to represent its roads.

+
+
Attributes:

g: The networkx graph that represents the road map +crs: The coordinate reference system of the map

+
+
+
+
Parameters:
+

graph (nx.MultiDiGraph)

+
+
+
+
+property distance_weight: str#
+

Get the distance weight

+
+
Returns:

The distance weight

+
+
+
+ +
+
+property time_weight: str#
+

Get the time weight

+
+
Returns:

The time weight

+
+
+
+ +
+
+road_by_id(road_id)[source]#
+

Get a road by its id

+
+
Return type:
+

Optional[Road]

+
+
Parameters:
+

road_id (RoadId)

+
+
+
+
Args:

road_id: The id of the road to get

+
+
Returns:

The road with the given id, or None if it does not exist

+
+
+
+ +
+
+set_road_attributes(attributes)[source]#
+

Set the attributes of the roads in the map

+
+
Args:

attributes: A dictionary mapping road ids to dictionaries of attributes

+
+
Returns:

None

+
+
+
+
Parameters:
+

attributes (Dict[RoadId, Dict[str, Any]])

+
+
+
+ +
+
+property roads: List[Road]#
+

Get a list of all the roads in the map

+
+
Returns:

A list of all the roads in the map

+
+
+
+ +
+
+classmethod from_file(file)[source]#
+

Build a NxMap instance from a file

+
+
Return type:
+

NxMap

+
+
Parameters:
+

file (str | Path)

+
+
+
+
Args:

file: The graph pickle file to load the graph from

+
+
Returns:

A NxMap instance

+
+
+
+ +
+
+classmethod from_geofence(geofence, xy=True, network_type=NetworkType.DRIVE, custom_filter=None)[source]#
+

Read an OSM network graph into a NxMap

+
+
Return type:
+

NxMap

+
+
Parameters:
+
+
+
+
+
Args:

geofence: the geofence to clip the graph to +xy: whether to use xy coordinates or lat/lon +network_type: the network type to use for the graph +custom_filter: a custom filter to pass to osmnx like '["highway"~"motorway|primary"]'

+
+
Returns:

a NxMap

+
+
+
+ +
+
+to_file(outfile)[source]#
+

Save the graph to a pickle file

+
+
Args:

outfile: The file to save the graph to

+
+
+
+
Parameters:
+

outfile (str | Path)

+
+
+
+ +
+
+classmethod from_dict(d)[source]#
+

Build a NxMap instance from a dictionary

+
+
Return type:
+

NxMap

+
+
Parameters:
+

d (Dict[str, Any])

+
+
+
+ +
+
+to_dict()[source]#
+

Convert the map to a dictionary

+
+
Return type:
+

Dict[str, Any]

+
+
+
+ +
+
+nearest_road(coord, buffer=10.0)[source]#
+

A helper function to get the nearest road.

+
+
Return type:
+

Road

+
+
Parameters:
+
+
+
+
+
Args:

coord: The coordinate to find the nearest road to +buffer: The buffer to search around the coordinate

+
+
Returns:

The nearest road to the coordinate

+
+
+
+ +
+
+shortest_path(origin, destination, weight=None)[source]#
+

Computes the shortest path between an origin and a destination

+
+
Return type:
+

List[Road]

+
+
Parameters:
+
+
+
+
+
Args:

origin: The origin coordinate +destination: The destination coordinate +weight: The weight to use for the path, either a string or a function

+
+
Returns:

A list of roads that form the shortest path

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.nx.readers.html b/_autosummary/mappymatch.maps.nx.readers.html new file mode 100644 index 0000000..041eaa6 --- /dev/null +++ b/_autosummary/mappymatch.maps.nx.readers.html @@ -0,0 +1,533 @@ + + + + + + + + + + + mappymatch.maps.nx.readers — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.nx.readers

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.maps.nx.readers#

+

Modules

+
+ + + + + +

osm_readers

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.maps.nx.readers.osm_readers.html b/_autosummary/mappymatch.maps.nx.readers.osm_readers.html new file mode 100644 index 0000000..b5742e2 --- /dev/null +++ b/_autosummary/mappymatch.maps.nx.readers.osm_readers.html @@ -0,0 +1,706 @@ + + + + + + + + + + + mappymatch.maps.nx.readers.osm_readers — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.maps.nx.readers.osm_readers

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.maps.nx.readers.osm_readers#

+

Functions

+
+ + + + + + + + + + + +

compress(g)

a hacky way to delete unnecessary data on the networkx graph

nx_graph_from_osmnx(geofence, network_type)

Build a networkx graph from OSM data

parse_osmnx_graph(graph, network_type[, xy])

Parse the raw osmnx graph into a graph that we can use with our NxMap

+
+

Classes

+
+ + + + + +

NetworkType(value[, names, module, ...])

Enumerator for Network Types supported by osmnx.

+
+
+
+class mappymatch.maps.nx.readers.osm_readers.NetworkType(value, names=None, *values, module=None, qualname=None, type=None, start=1, boundary=None)[source]#
+

Enumerator for Network Types supported by osmnx.

+
+
+ALL_PRIVATE = 'all_private'#
+
+ +
+
+ALL = 'all'#
+
+ +
+
+BIKE = 'bike'#
+
+ +
+
+DRIVE = 'drive'#
+
+ +
+
+DRIVE_SERVICE = 'drive_service'#
+
+ +
+
+WALK = 'walk'#
+
+ +
+ +
+
+mappymatch.maps.nx.readers.osm_readers.nx_graph_from_osmnx(geofence, network_type, xy=True, custom_filter=None)[source]#
+

Build a networkx graph from OSM data

+
+
Return type:
+

MultiDiGraph

+
+
Parameters:
+
+
+
+
+
Args:

geofence: the geofence to clip the graph to +network_type: the network type to use for the graph +xy: whether to use xy coordinates or lat/lon +custom_filter: a custom filter to pass to osmnx

+
+
Returns:

a networkx graph of the OSM network

+
+
+
+ +
+
+mappymatch.maps.nx.readers.osm_readers.parse_osmnx_graph(graph, network_type, xy=True)[source]#
+

Parse the raw osmnx graph into a graph that we can use with our NxMap

+
+
Return type:
+

MultiDiGraph

+
+
Parameters:
+
    +

  • graph (MultiDiGraph)

    • +

  • network_type (NetworkType)

    • +

  • xy (bool)

    • +
+
+
+
+
Args:

geofence: the geofence to clip the graph to +xy: whether to use xy coordinates or lat/lon +network_type: the network type to use for the graph

+
+
Returns:

a cleaned networkx graph of the OSM network

+
+
+
+ +
+
+mappymatch.maps.nx.readers.osm_readers.compress(g)[source]#
+

a hacky way to delete unnecessary data on the networkx graph

+
+
Return type:
+

MultiDiGraph

+
+
Parameters:
+

g (MultiDiGraph)

+
+
+
+
Args:

g: the networkx graph to compress

+
+
Returns:

the compressed networkx graph

+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.html b/_autosummary/mappymatch.matchers.html new file mode 100644 index 0000000..77095d8 --- /dev/null +++ b/_autosummary/mappymatch.matchers.html @@ -0,0 +1,548 @@ + + + + + + + + + + + mappymatch.matchers — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.matchers#

+

Modules

+
+ + + + + + + + + + + + + + + + + + + + +

lcss

line_snap

match_result

matcher_interface

osrm

valhalla

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.lcss.constructs.html b/_autosummary/mappymatch.matchers.lcss.constructs.html new file mode 100644 index 0000000..406127a --- /dev/null +++ b/_autosummary/mappymatch.matchers.lcss.constructs.html @@ -0,0 +1,778 @@ + + + + + + + + + + + mappymatch.matchers.lcss.constructs — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.lcss.constructs

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.lcss.constructs#

+

Classes

+
+ + + + + + + + +

CuttingPoint(trace_index)

A cutting point represents where the LCSS algorithm cuts the trace into a sub-segment.

TrajectorySegment(trace, path[, matches, ...])

Represents a pairing of a trace and candidate path

+
+
+
+class mappymatch.matchers.lcss.constructs.CuttingPoint(trace_index: signedinteger | int)[source]#
+

A cutting point represents where the LCSS algorithm cuts the trace into a sub-segment.

+
+
Attributes:

trace_index: An index of where to cut the trace

+
+
+
+
Parameters:
+

trace_index (signedinteger | int)

+
+
+
+
+trace_index: Union[signedinteger, int]#
+

Alias for field number 0

+
+ +
+ +
+
+class mappymatch.matchers.lcss.constructs.TrajectorySegment(trace: Trace, path: List[Road], matches: List[Match] = [], score: float = 0, cutting_points: List[CuttingPoint] = [])[source]#
+

Represents a pairing of a trace and candidate path

+
+
Attributes:

trace: The trace in the segment +path: The candidate path in the segment +matches: The matches between the trace and the path +score: The similarity score between the trace and the path +cutting_points: The points where the trace and path are to be cut

+
+
+
+
Parameters:
+
+
+
+
+
+trace: Trace#
+

Alias for field number 0

+
+ +
+
+path: List[Road]#
+

Alias for field number 1

+
+ +
+
+matches: List[Match]#
+

Alias for field number 2

+
+ +
+
+score: float#
+

Alias for field number 3

+
+ +
+
+cutting_points: List[CuttingPoint]#
+

Alias for field number 4

+
+ +
+
+set_score(score)[source]#
+

Sets the score of the trajectory segment

+
+
Return type:
+

TrajectorySegment

+
+
Parameters:
+

score (float)

+
+
+
+
Args:

score: The score of the trajectory segment

+
+
Returns:

The updated trajectory segment

+
+
+
+ +
+
+set_cutting_points(cutting_points)[source]#
+

Sets the cutting points of the trajectory segment

+
+
Return type:
+

TrajectorySegment

+
+
+
+
Args:

cutting_points: The cutting points of the trajectory segment

+
+
Returns:

The updated trajectory segment

+
+
+
+ +
+
+set_matches(matches)[source]#
+

Sets the matches of the trajectory segment

+
+
Return type:
+

TrajectorySegment

+
+
+
+
Args:

matches: The matches of the trajectory segment

+
+
Returns:

The updated trajectory segment

+
+
+
+ +
+
+score_and_match(distance_epsilon, max_distance)[source]#
+

Computes the score of a trace, pair matching and also matches the coordinates to the nearest road.

+
+
Return type:
+

TrajectorySegment

+
+
Parameters:
+
    +

  • distance_epsilon (float)

    • +

  • max_distance (float)

    • +
+
+
+
+
Args:

distance_epsilon: The distance threshold for matching +max_distance: The maximum distance between the trace and the path

+
+
Returns:

The updated trajectory segment with a score and matches

+
+
+
+ +
+
+compute_cutting_points(distance_epsilon, cutting_thresh, random_cuts)[source]#
+
+
Return type:
+

TrajectorySegment

+
+
Parameters:
+
    +

  • distance_epsilon (float)

    • +

  • cutting_thresh (float)

    • +

  • random_cuts (int)

    • +
+
+
+
+
Computes the cutting points for a trajectory segment by:
    +

  • computing the furthest point

    • +

  • adding points that are close to the distance epsilon

    • +
+
+
Args:

distance_epsilon: The distance threshold for matching +cutting_thresh: The threshold for cutting the trace +random_cuts: The number of random cuts to add

+
+
Returns:

The updated trajectory segment with cutting points

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.lcss.html b/_autosummary/mappymatch.matchers.lcss.html new file mode 100644 index 0000000..4ce850d --- /dev/null +++ b/_autosummary/mappymatch.matchers.lcss.html @@ -0,0 +1,542 @@ + + + + + + + + + + + mappymatch.matchers.lcss — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.lcss

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.matchers.lcss#

+

Modules

+
+ + + + + + + + + + + + + + +

constructs

lcss

ops

utils

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.lcss.lcss.html b/_autosummary/mappymatch.matchers.lcss.lcss.html new file mode 100644 index 0000000..9affc66 --- /dev/null +++ b/_autosummary/mappymatch.matchers.lcss.lcss.html @@ -0,0 +1,642 @@ + + + + + + + + + + + mappymatch.matchers.lcss.lcss — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.lcss.lcss

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.lcss.lcss#

+

Classes

+
+ + + + + +

LCSSMatcher(road_map[, distance_epsilon, ...])

A map matcher based on the paper:

+
+
+
+class mappymatch.matchers.lcss.lcss.LCSSMatcher(road_map, distance_epsilon=50.0, similarity_cutoff=0.9, cutting_threshold=10.0, random_cuts=0, distance_threshold=10000)[source]#
+

A map matcher based on the paper:

+

Zhu, Lei, Jacob R. Holden, and Jeffrey D. Gonder. +"Trajectory Segmentation Map-Matching Approach for Large-Scale, +High-Resolution GPS Data." +Transportation Research Record: Journal of the Transportation Research +Board 2645 (2017): 67-75.

+
+
Args:

road_map: The road map to use for matching +distance_epsilon: The distance epsilon to use for matching (default: 50 meters) +similarity_cutoff: The similarity cutoff to use for stopping the algorithm (default: 0.9) +cutting_threshold: The distance threshold to use for computing cutting points (default: 10 meters) +random_cuts: The number of random cuts to add at each iteration (default: 0) +distance_threshold: The distance threshold above which no match is made (default: 10000 meters)

+
+
+
+
Parameters:
+
    +

  • road_map (MapInterface)

    • +

  • distance_epsilon (float)

    • +

  • similarity_cutoff (float)

    • +

  • cutting_threshold (float)

    • +

  • random_cuts (int)

    • +

  • distance_threshold (float)

    • +
+
+
+
+
+match_trace(trace)[source]#
+

Take in a trace of gps points and return a list of matching link ids

+
+
Return type:
+

MatchResult

+
+
Parameters:
+

trace (Trace)

+
+
+
+
Args:

trace: The trace to match

+
+
Returns:

A list of Match objects

+
+
+
+ +
+
+match_trace_batch(trace_batch, processes=1)[source]#
+

Take in a batch of traces and return a batch of matching link ids

+
+
Return type:
+

List[MatchResult]

+
+
Parameters:
+
    +

  • trace_batch (List[Trace])

    • +

  • processes (int)

    • +
+
+
+
+
Args:

trace_batch: The batch of traces to match

+
+
Returns:

A batch of Match objects

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.lcss.ops.html b/_autosummary/mappymatch.matchers.lcss.ops.html new file mode 100644 index 0000000..81bb0bd --- /dev/null +++ b/_autosummary/mappymatch.matchers.lcss.ops.html @@ -0,0 +1,776 @@ + + + + + + + + + + + mappymatch.matchers.lcss.ops — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.lcss.ops

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.lcss.ops#

+

Functions

+
+ + + + + + + + + + + + + + + + + + + + +

add_matches_for_stationary_points(matches, ...)

Takes a set of matches and adds duplicate match entries for stationary

drop_stationary_points(trace, stationary_index)

Drops stationary points from the trace, keeping the first point

find_stationary_points(trace)

Find the positional index of all stationary points in a trace

new_path(road_map, trace)

Computes a shortest path and returns the path

same_trajectory_scheme(scheme1, scheme2)

Compares two trajectory schemes for equality

split_trajectory_segment(road_map, ...)

Splits a trajectory segment based on the provided cutting points.

+
+

Classes

+
+ + + + + +

StationaryIndex(i_index, c_index)

An index of a stationary point in a trajectory

+
+
+
+mappymatch.matchers.lcss.ops.new_path(road_map, trace)[source]#
+

Computes a shortest path and returns the path

+
+
Return type:
+

List[Road]

+
+
Parameters:
+
+
+
+
+
Args:

road_map: the road map to match to +trace: the trace to match

+
+
Returns:

the path that most closely matches the trace

+
+
+
+ +
+
+mappymatch.matchers.lcss.ops.split_trajectory_segment(road_map, trajectory_segment)[source]#
+

Splits a trajectory segment based on the provided cutting points.

+

Merge back any segments that are too short

+
+
Return type:
+

List[TrajectorySegment]

+
+
Parameters:
+
+
+
+
+
Args:

road_map: the road map to match to +trajectory_segment: the trajectory segment to split +distance_epsilon: the distance epsilon

+
+
Returns:

a list of split segments or the original segment if it can't be split

+
+
+
+ +
+
+mappymatch.matchers.lcss.ops.same_trajectory_scheme(scheme1, scheme2)[source]#
+

Compares two trajectory schemes for equality

+
+
Return type:
+

bool

+
+
Parameters:
+
+
+
+
+
Args:

scheme1: the first trajectory scheme +scheme2: the second trajectory scheme

+
+
Returns:

True if the two schemes are equal, False otherwise

+
+
+
+ +
+
+class mappymatch.matchers.lcss.ops.StationaryIndex(i_index: List[int], c_index: List[Any])[source]#
+

An index of a stationary point in a trajectory

+
+
Attributes:

trace_index: the index of the trace +coord_index: the index of the coordinate

+
+
+
+
Parameters:
+
    +

  • i_index (List[int])

    • +

  • c_index (List[Any])

    • +
+
+
+
+
+i_index: List[int]#
+

Alias for field number 0

+
+ +
+
+c_index: List[Any]#
+

Alias for field number 1

+
+ +
+ +
+
+mappymatch.matchers.lcss.ops.find_stationary_points(trace)[source]#
+

Find the positional index of all stationary points in a trace

+
+
Return type:
+

List[StationaryIndex]

+
+
Parameters:
+

trace (Trace)

+
+
+
+
Args:

trace: the trace to find the stationary points in

+
+
Returns:

a list of stationary indices

+
+
+
+ +
+
+mappymatch.matchers.lcss.ops.drop_stationary_points(trace, stationary_index)[source]#
+

Drops stationary points from the trace, keeping the first point

+
+
Return type:
+

Trace

+
+
Parameters:
+
+
+
+
+
Args:

trace: the trace to drop the stationary points from +stationary_index: the stationary indices to drop

+
+
Returns:

the trace with the stationary points dropped

+
+
+
+ +
+
+mappymatch.matchers.lcss.ops.add_matches_for_stationary_points(matches, stationary_index)[source]#
+

Takes a set of matches and adds duplicate match entries for stationary

+
+
Return type:
+

List[Match]

+
+
Parameters:
+
+
+
+
+
Args:

matches: the matches to add the stationary points to +stationary_index: the stationary indices to add

+
+
Returns:

the matches with the stationary points added

+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.lcss.utils.html b/_autosummary/mappymatch.matchers.lcss.utils.html new file mode 100644 index 0000000..b4c19cb --- /dev/null +++ b/_autosummary/mappymatch.matchers.lcss.utils.html @@ -0,0 +1,682 @@ + + + + + + + + + + + mappymatch.matchers.lcss.utils — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.lcss.utils

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

mappymatch.matchers.lcss.utils#

+

Functions

+
+ + + + + + + + + + + + + + +

compress(cutting_points)

Compress a list of cutting points if they happen to be directly adjacent to another

forward_merge(merge_list, condition)

Helper function to merge items in a list by adding them to the next eligible element.

merge(merge_list, condition)

Combines the forward and reverse merges to catch edge cases at the tail ends of the list

reverse_merge(merge_list, condition)

Helper function to merge items in a list by adding them to the next eligible element.

+
+
+
+mappymatch.matchers.lcss.utils.forward_merge(merge_list, condition)[source]#
+

Helper function to merge items in a list by adding them to the next eligible element. +This merge moves left to right.

+

For example, given the list:

+

[1, 2, 3, 4, 5]

+

And the condition, x < 3, the function yields:

+
+
Return type:
+

List

+
+
Parameters:
+
    +

  • merge_list (List)

    • +

  • condition (Callable[[Any], bool])

    • +
+
+
+
>>> forward_merge([1,2,3,4,5], lambda x: x < 3)
+>>> [6, 4, 5]
+
+
+
+
Args:

merge_list: the list to merge +condition: the merge condition

+
+
Returns:

a list of the merged items

+
+
+
+ +
+
+mappymatch.matchers.lcss.utils.reverse_merge(merge_list, condition)[source]#
+

Helper function to merge items in a list by adding them to the next eligible element. +This merge moves right to left.

+

For example, given the list:

+

[1, 2, 3, 4, 5]

+

And the condition, x < 3, the function yields:

+
+
Return type:
+

List

+
+
Parameters:
+
    +

  • merge_list (List)

    • +

  • condition (Callable[[Any], bool])

    • +
+
+
+
>>> list(reverse_merge([1,2,3,4,5], lambda x: x < 3))
+>>> [3, 3, 4, 5]
+
+
+
+
Args:

merge_list: the list to merge +condition: the merge condition

+
+
Returns:

a list of the merged items

+
+
+
+ +
+
+mappymatch.matchers.lcss.utils.merge(merge_list, condition)[source]#
+

Combines the forward and reverse merges to catch edge cases at the tail ends of the list

+
+
Return type:
+

List

+
+
Parameters:
+
    +

  • merge_list (List)

    • +

  • condition (Callable[[Any], bool])

    • +
+
+
+
+
Args:

merge_list: the list to merge +condition: the merge condition

+
+
Returns:

a list of the merged items

+
+
+
+ +
+
+mappymatch.matchers.lcss.utils.compress(cutting_points)[source]#
+

Compress a list of cutting points if they happen to be directly adjacent to another

+
+
Return type:
+

Generator

+
+
Parameters:
+

cutting_points (List)

+
+
+
+
Args:

cutting_points: the list of cutting points

+
+
Returns:

a generator of compressed cutting points

+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+
+ Contents +
+
+ +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.line_snap.html b/_autosummary/mappymatch.matchers.line_snap.html new file mode 100644 index 0000000..c2039e3 --- /dev/null +++ b/_autosummary/mappymatch.matchers.line_snap.html @@ -0,0 +1,622 @@ + + + + + + + + + + + mappymatch.matchers.line_snap — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.line_snap

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.line_snap#

+

Classes

+
+ + + + + +

LineSnapMatcher(road_map)

A crude (but fast) map matcher that just snaps points to the nearest road network link.

+
+
+
+class mappymatch.matchers.line_snap.LineSnapMatcher(road_map)[source]#
+

A crude (but fast) map matcher that just snaps points to the nearest road network link.

+
+
Attributes:

map: The map to match against

+
+
+
+
Parameters:
+

road_map (MapInterface)

+
+
+
+
+match_trace(trace)[source]#
+

Take in a trace of gps points and return a list of matching link ids

+
+
Return type:
+

MatchResult

+
+
Parameters:
+

trace (Trace)

+
+
+
+
Args:

trace: The trace to match

+
+
Returns:

A list of Match objects

+
+
+
+ +
+
+match_trace_batch(trace_batch)[source]#
+

Take in a batch of traces and return a batch of matching link ids

+
+
Return type:
+

List[MatchResult]

+
+
Parameters:
+

trace_batch (List[Trace])

+
+
+
+
Args:

trace_batch: The batch of traces to match

+
+
Returns:

A batch of Match objects

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.match_result.html b/_autosummary/mappymatch.matchers.match_result.html new file mode 100644 index 0000000..85d566c --- /dev/null +++ b/_autosummary/mappymatch.matchers.match_result.html @@ -0,0 +1,663 @@ + + + + + + + + + + + mappymatch.matchers.match_result — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.match_result

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.match_result#

+

Classes

+
+ + + + + +

MatchResult(matches[, path])

+
+
+
+class mappymatch.matchers.match_result.MatchResult(matches, path=None)[source]#
+
+
Parameters:
+
    +

  • matches (List[Match])

    • +

  • path (List[Road] | None)

    • +
+
+
+
+
+matches: List[Match]#
+
+ +
+
+path: Optional[List[Road]] = None#
+
+ +
+
+property crs#
+
+ +
+
+matches_to_geodataframe()[source]#
+

Returns a geodataframe with all the coordinates and their resulting match (or NA if no match) in each row

+
+
Return type:
+

GeoDataFrame

+
+
+
+ +
+
+matches_to_dataframe()[source]#
+

Returns a dataframe with all the coordinates and their resulting match (or NA if no match) in each row.

+
+
Return type:
+

DataFrame

+
+
+
+
Returns:

A pandas dataframe

+
+
+
+ +
+
+path_to_dataframe()[source]#
+

Returns a dataframe with the resulting estimated trace path through the road network. +The dataframe is empty if there was no path.

+
+
Return type:
+

DataFrame

+
+
+
+
Returns:

A pandas dataframe

+
+
+
+ +
+
+path_to_geodataframe()[source]#
+

Returns a geodataframe with the resulting estimated trace path through the road network. +The geodataframe is empty if there was no path.

+
+
Return type:
+

GeoDataFrame

+
+
+
+
Returns:

A geopandas geodataframe

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.matcher_interface.html b/_autosummary/mappymatch.matchers.matcher_interface.html new file mode 100644 index 0000000..75424b6 --- /dev/null +++ b/_autosummary/mappymatch.matchers.matcher_interface.html @@ -0,0 +1,613 @@ + + + + + + + + + + + mappymatch.matchers.matcher_interface — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.matcher_interface

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.matcher_interface#

+

Classes

+
+ + + + + +

MatcherInterface()

Abstract base class for a Matcher

+
+
+
+class mappymatch.matchers.matcher_interface.MatcherInterface[source]#
+

Abstract base class for a Matcher

+
+
+abstract match_trace(trace)[source]#
+

Take in a trace of gps points and return a list of matching link ids

+
+
Return type:
+

MatchResult

+
+
Parameters:
+

trace (Trace)

+
+
+
+
Args:

trace: The trace to match

+
+
Returns:

A list of Match objects

+
+
+
+ +
+
+abstract match_trace_batch(trace_batch)[source]#
+

Take in a batch of traces and return a batch of matching link ids

+
+
Return type:
+

List[MatchResult]

+
+
Parameters:
+

trace_batch (List[Trace])

+
+
+
+
Args:

trace_batch: The batch of traces to match

+
+
Returns:

A batch of Match objects

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.osrm.html b/_autosummary/mappymatch.matchers.osrm.html new file mode 100644 index 0000000..256081f --- /dev/null +++ b/_autosummary/mappymatch.matchers.osrm.html @@ -0,0 +1,644 @@ + + + + + + + + + + + mappymatch.matchers.osrm — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.osrm

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.osrm#

+

Functions

+
+ + + + + +

parse_osrm_json(j, trace)

parse the json response from the osrm match service

+
+

Classes

+
+ + + + + +

OsrmMatcher([osrm_address, osrm_profile, ...])

pings an OSRM server for map matching

+
+
+
+mappymatch.matchers.osrm.parse_osrm_json(j, trace)[source]#
+

parse the json response from the osrm match service

+
+
Parameters:
+
    +

  • j (dict) -- the json object

    • +

  • trace (Trace)

    • +
+
+
Return type:
+

list[Match]

+
+
Returns:
+

a list of matches

+
+
+
+ +
+
+class mappymatch.matchers.osrm.OsrmMatcher(osrm_address='http://router.project-osrm.org', osrm_profile='driving', osrm_version='v1')[source]#
+

pings an OSRM server for map matching

+
+
+match_trace(trace)[source]#
+

Take in a trace of gps points and return a list of matching link ids

+
+
Return type:
+

MatchResult

+
+
Parameters:
+

trace (Trace)

+
+
+
+
Args:

trace: The trace to match

+
+
Returns:

A list of Match objects

+
+
+
+ +
+
+match_trace_batch(trace_batch)[source]#
+

Take in a batch of traces and return a batch of matching link ids

+
+
Return type:
+

list[MatchResult]

+
+
Parameters:
+

trace_batch (list[Trace])

+
+
+
+
Args:

trace_batch: The batch of traces to match

+
+
Returns:

A batch of Match objects

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.matchers.valhalla.html b/_autosummary/mappymatch.matchers.valhalla.html new file mode 100644 index 0000000..c51e2a0 --- /dev/null +++ b/_autosummary/mappymatch.matchers.valhalla.html @@ -0,0 +1,664 @@ + + + + + + + + + + + mappymatch.matchers.valhalla — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.matchers.valhalla

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.matchers.valhalla#

+

Functions

+
+ + + + + + + + +

build_match_result(trace, matched_points, path)

builds a mappymatch MatchResult from the result of a Valhalla map matching request

build_path_from_result(edges, shape)

builds a mappymatch path from the result of a Valhalla map matching request

+
+

Classes

+
+ + + + + +

ValhallaMatcher([valhalla_url, cost_model, ...])

pings a Valhalla server for map matching

+
+
+
+mappymatch.matchers.valhalla.build_path_from_result(edges, shape)[source]#
+

builds a mappymatch path from the result of a Valhalla map matching request

+
+
Return type:
+

List[Road]

+
+
Parameters:
+
    +

  • edges (List[dict])

    • +

  • shape (List[Tuple[float, float]])

    • +
+
+
+
+ +
+
+mappymatch.matchers.valhalla.build_match_result(trace, matched_points, path)[source]#
+

builds a mappymatch MatchResult from the result of a Valhalla map matching request

+
+
Return type:
+

MatchResult

+
+
Parameters:
+
    +

  • trace (Trace)

    • +

  • matched_points (List[dict])

    • +

  • path (List[Road])

    • +
+
+
+
+ +
+
+class mappymatch.matchers.valhalla.ValhallaMatcher(valhalla_url='https://valhalla1.openstreetmap.de/trace_attributes', cost_model='auto', shape_match='map_snap', attributes={'edge.length', 'edge.speed'})[source]#
+

pings a Valhalla server for map matching

+
+
+match_trace(trace)[source]#
+

Take in a trace of gps points and return a list of matching link ids

+
+
Return type:
+

MatchResult

+
+
Parameters:
+

trace (Trace)

+
+
+
+
Args:

trace: The trace to match

+
+
Returns:

A list of Match objects

+
+
+
+ +
+
+match_trace_batch(trace_batch)[source]#
+

Take in a batch of traces and return a batch of matching link ids

+
+
Return type:
+

list[MatchResult]

+
+
Parameters:
+

trace_batch (list[Trace])

+
+
+
+
Args:

trace_batch: The batch of traces to match

+
+
Returns:

A batch of Match objects

+
+
+
+ +
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.crs.html b/_autosummary/mappymatch.utils.crs.html new file mode 100644 index 0000000..bb6b6ea --- /dev/null +++ b/_autosummary/mappymatch.utils.crs.html @@ -0,0 +1,524 @@ + + + + + + + + + + + mappymatch.utils.crs — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils.crs

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.utils.crs#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.exceptions.html b/_autosummary/mappymatch.utils.exceptions.html new file mode 100644 index 0000000..15e31c2 --- /dev/null +++ b/_autosummary/mappymatch.utils.exceptions.html @@ -0,0 +1,565 @@ + + + + + + + + + + + mappymatch.utils.exceptions — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils.exceptions

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

mappymatch.utils.exceptions#

+

Exceptions

+
+ + + + + +

MapException

An exception for any errors that occur with the MapInterface

+
+
+
+exception mappymatch.utils.exceptions.MapException[source]#
+

An exception for any errors that occur with the MapInterface

+
+ +
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+
+ Contents +
+
+ +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.geo.html b/_autosummary/mappymatch.utils.geo.html new file mode 100644 index 0000000..2cb14dd --- /dev/null +++ b/_autosummary/mappymatch.utils.geo.html @@ -0,0 +1,641 @@ + + + + + + + + + + + mappymatch.utils.geo — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils.geo

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

mappymatch.utils.geo#

+

Functions

+
+ + + + + + + + + + + +

coord_to_coord_dist(a, b)

Compute the distance between two coordinates.

latlon_to_xy(lat, lon)

Tramsform lat,lon coordinates to x and y.

xy_to_latlon(x, y)

Tramsform x,y coordinates to lat and lon

+
+
+
+mappymatch.utils.geo.xy_to_latlon(x, y)[source]#
+

Tramsform x,y coordinates to lat and lon

+
+
Return type:
+

Tuple[float, float]

+
+
Parameters:
+
    +

  • x (float)

    • +

  • y (float)

    • +
+
+
+
+
Args:

x: X. +y: Y.

+
+
Returns:

Transformed lat and lon as lat, lon.

+
+
+
+ +
+
+mappymatch.utils.geo.latlon_to_xy(lat, lon)[source]#
+

Tramsform lat,lon coordinates to x and y.

+
+
Return type:
+

Tuple[float, float]

+
+
Parameters:
+
    +

  • lat (float)

    • +

  • lon (float)

    • +
+
+
+
+
Args:

lat: The latitude. +lon: The longitude.

+
+
Returns:

Transformed x and y as x, y.

+
+
+
+ +
+
+mappymatch.utils.geo.coord_to_coord_dist(a, b)[source]#
+

Compute the distance between two coordinates.

+
+
Return type:
+

float

+
+
Parameters:
+
+
+
+
+
Args:

a: The first coordinate +b: The second coordinate

+
+
Returns:

The distance in meters

+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+
+ Contents +
+
+ +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.html b/_autosummary/mappymatch.utils.html new file mode 100644 index 0000000..c68ed08 --- /dev/null +++ b/_autosummary/mappymatch.utils.html @@ -0,0 +1,548 @@ + + + + + + + + + + + mappymatch.utils — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils

+ +
+
+ +
+
+
+ + + + +
+ +
+

mappymatch.utils#

+

Modules

+
+ + + + + + + + + + + + + + + + + + + + +

crs

exceptions

geo

plot

process_trace

url

+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.plot.html b/_autosummary/mappymatch.utils.plot.html new file mode 100644 index 0000000..0c5521a --- /dev/null +++ b/_autosummary/mappymatch.utils.plot.html @@ -0,0 +1,708 @@ + + + + + + + + + + + mappymatch.utils.plot — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils.plot

+ +
+ +
+
+ + + + +
+ +
+

mappymatch.utils.plot#

+

Functions

+
+ + + + + + + + + + + + + + + + + + + + +

plot_geofence(geofence[, m])

Plot geofence.

plot_map(tmap[, m])

Plot the roads on an NxMap.

plot_match_distances(matches)

Plot the points deviance from known roads with matplotlib.

plot_matches(matches[, crs])

Plots a trace and the relevant matches on a folium map.

plot_path(path, crs[, m, line_color, ...])

Plot a list of roads.

plot_trace(trace[, m, point_color, line_color])

Plot a trace.

+
+
+
+mappymatch.utils.plot.plot_geofence(geofence, m=None)[source]#
+

Plot geofence.

+
+
Args:

geofence: The geofence to plot +m: the folium map to plot on

+
+
Returns:

The updated folium map with the geofence.

+
+
+
+
Parameters:
+
+
+
+
+ +
+
+mappymatch.utils.plot.plot_trace(trace, m=None, point_color='black', line_color='green')[source]#
+

Plot a trace.

+
+
Args:

trace: The trace. +m: the folium map to plot on +point_color: The color the points will be plotted in. +line_color: The color for lines. If None, no lines will be plotted.

+
+
Returns:

An updated folium map with a plot of trace.

+
+
+
+
Parameters:
+
    +

  • trace (Trace)

    • +

  • m (Map | None)

    • +

  • point_color (str)

    • +

  • line_color (str | None)

    • +
+
+
+
+ +
+
+mappymatch.utils.plot.plot_matches(matches, crs=<Projected CRS: EPSG:3857> Name: WGS 84 / Pseudo-Mercator Axis Info [cartesian]: - X[east]: Easting (metre) - Y[north]: Northing (metre) Area of Use: - name: World between 85.06°S and 85.06°N. - bounds: (-180.0, -85.06, 180.0, 85.06) Coordinate Operation: - name: Popular Visualisation Pseudo-Mercator - method: Popular Visualisation Pseudo Mercator Datum: World Geodetic System 1984 ensemble - Ellipsoid: WGS 84 - Prime Meridian: Greenwich)[source]#
+

Plots a trace and the relevant matches on a folium map.

+

Args: +matches: A list of matches or a MatchResult. +crs: what crs to plot in. Defaults to XY_CRS.

+
+
Returns:

A folium map with trace and matches plotted.

+
+
+
+
Parameters:
+

matches (MatchResult | List[Match])

+
+
+
+ +
+
+mappymatch.utils.plot.plot_map(tmap, m=None)[source]#
+

Plot the roads on an NxMap.

+
+
Args:

tmap: The Nxmap to plot. +m: the folium map to add to

+
+
Returns:

The folium map with the roads plotted.

+
+
+
+
Parameters:
+
    +

  • tmap (NxMap)

    • +

  • m (Map | None)

    • +
+
+
+
+ +
+
+mappymatch.utils.plot.plot_match_distances(matches)[source]#
+

Plot the points deviance from known roads with matplotlib.

+
+
Args:

matches (MatchResult): The coordinates of guessed points in the area in the form of a MatchResult object.

+
+
+
+
Parameters:
+

matches (MatchResult)

+
+
+
+ +
+
+mappymatch.utils.plot.plot_path(path, crs, m=None, line_color='red', line_weight=10, line_opacity=0.8)[source]#
+

Plot a list of roads.

+
+
Args:

path: The path to plot. +crs: The crs of the path. +m: The folium map to add to. +line_color: The color of the line. +line_weight: The weight of the line. +line_opacity: The opacity of the line.

+
+
+
+
Parameters:
+
    +

  • path (List[Road])

    • +

  • crs (CRS)

    • +

  • m (Map | None)

    • +
+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.process_trace.html b/_autosummary/mappymatch.utils.process_trace.html new file mode 100644 index 0000000..7c09592 --- /dev/null +++ b/_autosummary/mappymatch.utils.process_trace.html @@ -0,0 +1,613 @@ + + + + + + + + + + + mappymatch.utils.process_trace — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils.process_trace

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

mappymatch.utils.process_trace#

+

Functions

+
+ + + + + + + + +

remove_bad_start_from_trace(trace, ...)

Remove points at the beginning of a trace if it is a gap is too big.

split_large_trace(trace, ideal_size)

Split up a trace into a list of smaller traces.

+
+
+
+mappymatch.utils.process_trace.split_large_trace(trace, ideal_size)[source]#
+

Split up a trace into a list of smaller traces.

+
+
Return type:
+

list[Trace]

+
+
Parameters:
+
    +

  • trace (Trace)

    • +

  • ideal_size (int)

    • +
+
+
+
+
Args:

trace: the trace to split. +ideal_size: the target number of coordinates for each new trace.

+
+
Returns:

A list of split traces.

+
+
+
+ +
+
+mappymatch.utils.process_trace.remove_bad_start_from_trace(trace, distance_threshold)[source]#
+

Remove points at the beginning of a trace if it is a gap is too big.

+

Too big is defined by distance threshold.

+
+
Return type:
+

Trace

+
+
Parameters:
+
    +

  • trace (Trace)

    • +

  • distance_threshold (float)

    • +
+
+
+
+
Args:

trace: The trace. +distance_threshold: The distance threshold.

+
+
Returns:

The new trace.

+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+
+ Contents +
+
+ +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_autosummary/mappymatch.utils.url.html b/_autosummary/mappymatch.utils.url.html new file mode 100644 index 0000000..64a0235 --- /dev/null +++ b/_autosummary/mappymatch.utils.url.html @@ -0,0 +1,569 @@ + + + + + + + + + + + mappymatch.utils.url — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

mappymatch.utils.url

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

mappymatch.utils.url#

+

Functions

+
+ + + + + +

multiurljoin(urls)

Make a url from uri's.

+
+
+
+mappymatch.utils.url.multiurljoin(urls)[source]#
+

Make a url from uri's.

+
+
Return type:
+

str

+
+
Parameters:
+

urls (List[str])

+
+
+
+
Args:

urls: list of uri

+
+
Returns:

Url as uri/uri/...

+
+
+
+ +
+ + + + +
+ + + + + + + + +
+ + + + +
+ + +
+
+ Contents +
+
+ +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_images/5c86f44a9ee8baf7d06c2b637f97cf578ac561757400541ee32fc19256194df8.png b/_images/5c86f44a9ee8baf7d06c2b637f97cf578ac561757400541ee32fc19256194df8.png new file mode 100644 index 0000000..07c63c4 Binary files /dev/null and b/_images/5c86f44a9ee8baf7d06c2b637f97cf578ac561757400541ee32fc19256194df8.png differ diff --git a/_images/ce377be033cf72b2b4774bc8d53d5420a5b3656e750453ebb78e87db048f73fd.png b/_images/ce377be033cf72b2b4774bc8d53d5420a5b3656e750453ebb78e87db048f73fd.png new file mode 100644 index 0000000..886d26d Binary files /dev/null and b/_images/ce377be033cf72b2b4774bc8d53d5420a5b3656e750453ebb78e87db048f73fd.png differ diff --git a/_modules/index.html b/_modules/index.html new file mode 100644 index 0000000..2e29642 --- /dev/null +++ b/_modules/index.html @@ -0,0 +1,467 @@ + + + + + + + + + + Overview: module code — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

All modules for which code is available

+ + +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/constructs/coordinate.html b/_modules/mappymatch/constructs/coordinate.html new file mode 100644 index 0000000..34d44c1 --- /dev/null +++ b/_modules/mappymatch/constructs/coordinate.html @@ -0,0 +1,544 @@ + + + + + + + + + + mappymatch.constructs.coordinate — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.constructs.coordinate

+from __future__ import annotations
+
+import math
+from typing import Any, NamedTuple
+
+from pyproj import CRS, Transformer
+from pyproj.exceptions import ProjError
+from shapely.geometry import Point
+
+from mappymatch.utils.crs import LATLON_CRS
+
+
+

+[docs]
+class Coordinate(NamedTuple):
+    """
+    Represents a single coordinate with a CRS and a geometry
+
+    Attributes:
+        coordinate_id: The unique identifier for this coordinate
+        geom: The geometry of this coordinate
+        crs: The CRS of this coordinate
+        x: The x value of this coordinate
+        y: The y value of this coordinate
+    """
+
+    coordinate_id: Any
+    geom: Point
+    crs: CRS
+
+    def __repr__(self):
+        crs_a = self.crs.to_authority() if self.crs else "Null"
+        return f"Coordinate(coordinate_id={self.coordinate_id}, x={self.x}, y={self.y}, crs={crs_a})"
+
+

+[docs]
+    @classmethod
+    def from_lat_lon(cls, lat: float, lon: float) -> Coordinate:
+        """
+        Build a coordinate from a latitude/longitude
+
+        Args:
+            lat: The latitude
+            lon: The longitude
+
+        Returns:
+            A new coordinate
+        """
+        return cls(coordinate_id=None, geom=Point(lon, lat), crs=LATLON_CRS)

+
+
+    @property
+    def x(self) -> float:
+        return self.geom.x
+
+    @property
+    def y(self) -> float:
+        return self.geom.y
+
+

+[docs]
+    def to_crs(self, new_crs: Any) -> Coordinate:
+        """
+        Convert this coordinate to a new CRS
+
+        Args:
+            new_crs: The new CRS to convert to
+
+        Returns:
+            A new coordinate with the new CRS
+
+        Raises:
+            A ValueError if it fails to convert the coordinate
+        """
+        # convert the incoming crs to an pyproj.crs.CRS object; this could fail
+        try:
+            new_crs = CRS(new_crs)
+        except ProjError as e:
+            raise ValueError(
+                f"Could not parse incoming `new_crs` parameter: {new_crs}"
+            ) from e
+
+        if new_crs == self.crs:
+            return self
+
+        transformer = Transformer.from_crs(self.crs, new_crs)
+        new_x, new_y = transformer.transform(self.geom.y, self.geom.x)
+
+        if math.isinf(new_x) or math.isinf(new_y):
+            raise ValueError(
+                f"Unable to convert {self.crs} ({self.geom.x}, {self.geom.y}) -> {new_crs} ({new_x}, {new_y})"
+            )
+
+        return Coordinate(
+            coordinate_id=self.coordinate_id,
+            geom=Point(new_x, new_y),
+            crs=new_crs,
+        )

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/constructs/geofence.html b/_modules/mappymatch/constructs/geofence.html new file mode 100644 index 0000000..245c409 --- /dev/null +++ b/_modules/mappymatch/constructs/geofence.html @@ -0,0 +1,558 @@ + + + + + + + + + + mappymatch.constructs.geofence — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.constructs.geofence

+from __future__ import annotations
+
+import json
+from pathlib import Path
+from typing import Union
+
+from geopandas import read_file
+from pyproj import CRS, Transformer
+from shapely.geometry import LineString, Polygon, mapping
+from shapely.ops import transform
+
+from mappymatch.constructs.trace import Trace
+from mappymatch.utils.crs import LATLON_CRS
+
+
+

+[docs]
+class Geofence:
+    """
+    A geofence is basically a shapely polygon with a CRS
+
+    Args:
+        geom: The polygon geometry of the geofence
+        crs: The CRS of the geofence
+    """
+
+    def __init__(self, crs: CRS, geometry: Polygon):
+        self.crs = crs
+        self.geometry = geometry
+
+

+[docs]
+    @classmethod
+    def from_geojson(cls, file: Union[Path, str]) -> Geofence:
+        """
+        Creates a new geofence from a geojson file.
+
+        Args:
+            file: The path to the geojson file
+
+        Returns:
+            A new geofence
+        """
+        filepath = Path(file)
+        frame = read_file(filepath)
+
+        if len(frame) > 1:
+            raise TypeError(
+                "found multiple polygons in the input; please only provide one"
+            )
+        elif frame.crs is None:
+            raise TypeError(
+                "no crs information found in the file; please make sure file has a crs"
+            )
+
+        polygon = frame.iloc[0].geometry
+
+        return Geofence(crs=frame.crs, geometry=polygon)

+
+
+

+[docs]
+    @classmethod
+    def from_trace(
+        cls,
+        trace: Trace,
+        padding: float = 1e3,
+        crs: CRS = LATLON_CRS,
+        buffer_res: int = 2,
+    ) -> Geofence:
+        """
+        Create a new geofence from a trace.
+
+        This is done by computing a radial buffer around the
+        entire trace (as a line).
+
+        Args:
+            trace: The trace to compute the bounding polygon for.
+            padding: The padding (in meters) around the trace line.
+            crs: The coordinate reference system to use.
+            buffer_res: The resolution of the surrounding buffer.
+
+        Returns:
+            The computed bounding polygon.
+        """
+
+        trace_line_string = LineString([c.geom for c in trace.coords])
+
+        # Add buffer to LineString.
+        polygon = trace_line_string.buffer(padding, buffer_res)
+
+        if trace.crs != crs:
+            project = Transformer.from_crs(trace.crs, crs, always_xy=True).transform
+            polygon = transform(project, polygon)
+            return Geofence(crs=crs, geometry=polygon)
+
+        return Geofence(crs=trace.crs, geometry=polygon)

+
+
+

+[docs]
+    def to_geojson(self) -> str:
+        """
+        Converts the geofence to a geojson string.
+        """
+        if self.crs != LATLON_CRS:
+            transformer = Transformer.from_crs(self.crs, LATLON_CRS)
+            geometry: Polygon = transformer.transform(self.geometry)  # type: ignore
+        else:
+            geometry = self.geometry
+
+        return json.dumps(mapping(geometry))

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/constructs/match.html b/_modules/mappymatch/constructs/match.html new file mode 100644 index 0000000..4b9e1f3 --- /dev/null +++ b/_modules/mappymatch/constructs/match.html @@ -0,0 +1,502 @@ + + + + + + + + + + mappymatch.constructs.match — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.constructs.match

+from typing import NamedTuple, Optional
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.constructs.road import Road
+
+
+

+[docs]
+class Match(NamedTuple):
+    """
+    Represents a match made by a Matcher
+
+    Attributes:
+        road: The road that was matched; None if no road was found;
+        coordinate: The original coordinate that was matched;
+        distance: The distance to the matched road; If no road was found, this is infinite
+    """
+
+    road: Optional[Road]
+    coordinate: Coordinate
+    distance: float
+
+

+[docs]
+    def set_coordinate(self, c: Coordinate):
+        """
+        Set the coordinate of this match
+
+        Args:
+            c: The new coordinate
+
+        Returns:
+           The match with the new coordinate
+        """
+        return self._replace(coordinate=c)

+
+
+

+[docs]
+    def to_flat_dict(self) -> dict:
+        """
+        Convert this match to a flat dictionary
+
+        Returns:
+            A flat dictionary with all match information
+        """
+        out = {"coordinate_id": self.coordinate.coordinate_id}
+
+        if self.road is None:
+            out["road_id"] = None
+            return out
+        else:
+            out["distance_to_road"] = self.distance
+            road_dict = self.road.to_flat_dict()
+            out.update(road_dict)
+            return out

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/constructs/road.html b/_modules/mappymatch/constructs/road.html new file mode 100644 index 0000000..09af2e7 --- /dev/null +++ b/_modules/mappymatch/constructs/road.html @@ -0,0 +1,534 @@ + + + + + + + + + + mappymatch.constructs.road — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.constructs.road

+from __future__ import annotations
+
+from typing import Any, Dict, NamedTuple, Optional, Union
+
+from shapely.geometry import LineString
+
+
+

+[docs]
+class RoadId(NamedTuple):
+    start: Optional[Union[int, str]]
+    end: Optional[Union[int, str]]
+    key: Optional[Union[int, str]]
+
+

+[docs]
+    def to_string(self) -> str:
+        return f"{self.start},{self.end},{self.key}"

+
+
+

+[docs]
+    def to_json(self) -> Dict[str, Any]:
+        return self._asdict()

+
+
+

+[docs]
+    @classmethod
+    def from_string(cls, s: str) -> RoadId:
+        start, end, key = s.split(",")
+        return cls(start, end, key)

+
+
+

+[docs]
+    @classmethod
+    def from_json(cls, json: Dict[str, Any]) -> RoadId:
+        return cls(**json)

+

+
+
+
+

+[docs]
+class Road(NamedTuple):
+    """
+    Represents a road that can be matched to;
+
+    Attributes:
+        road_id: The unique identifier for this road
+        geom: The geometry of this road
+        origin_junction_id: The unique identifier of the origin junction of this road
+        destination_junction_id: The unique identifier of the destination junction of this road
+        metadata: an optional dictionary for storing additional metadata
+    """
+
+    road_id: RoadId
+
+    geom: LineString
+    metadata: Optional[dict] = None
+
+

+[docs]
+    def to_dict(self) -> Dict[str, Any]:
+        """
+        Convert the road to a dictionary
+        """
+        d = self._asdict()
+        d["origin_junction_id"] = self.road_id.start
+        d["destination_junction_id"] = self.road_id.end
+        d["road_key"] = self.road_id.key
+
+        return d

+
+
+

+[docs]
+    def to_flat_dict(self) -> Dict[str, Any]:
+        """
+        Convert the road to a flat dictionary
+        """
+        if self.metadata is None:
+            return self.to_dict()
+        else:
+            d = {**self.to_dict(), **self.metadata}
+            del d["metadata"]
+            return d

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/constructs/trace.html b/_modules/mappymatch/constructs/trace.html new file mode 100644 index 0000000..795f08c --- /dev/null +++ b/_modules/mappymatch/constructs/trace.html @@ -0,0 +1,787 @@ + + + + + + + + + + mappymatch.constructs.trace — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.constructs.trace

+from __future__ import annotations
+
+import re
+from functools import cached_property
+from pathlib import Path
+from typing import List, Optional, Union
+
+import numpy as np
+import pandas as pd
+from geopandas import GeoDataFrame, points_from_xy, read_file, read_parquet
+from pyproj import CRS
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.utils.crs import LATLON_CRS, XY_CRS
+
+
+

+[docs]
+class Trace:
+    """
+    A Trace is a collection of coordinates that represents a trajectory to be matched.
+
+    Attributes:
+        coords: A list of all the coordinates
+        crs: The CRS of the trace
+        index: The index of the trace
+    """
+
+    _frame: GeoDataFrame
+
+    def __init__(self, frame: GeoDataFrame):
+        if frame.index.has_duplicates:
+            duplicates = frame.index[frame.index.duplicated()].values
+            raise IndexError(
+                f"Trace cannot have duplicates in the index but found {duplicates}"
+            )
+        self._frame = frame
+
+    def __getitem__(self, i) -> Trace:
+        if isinstance(i, int):
+            i = [i]
+        new_frame = self._frame.iloc[i]
+        return Trace(new_frame)
+
+    def __add__(self, other: Trace) -> Trace:
+        if self.crs != other.crs:
+            raise TypeError("cannot add two traces together with different crs")
+        new_frame = pd.concat([self._frame, other._frame])
+        return Trace(new_frame)
+
+    def __len__(self):
+        """Number of coordinate pairs."""
+        return len(self._frame)
+
+    def __str__(self):
+        output_lines = [
+            "Mappymatch Trace object",
+            f'coords: {self.coords if hasattr(self, "coords") else None}',
+            f"frame: {self._frame}",
+        ]
+        return "\n".join(output_lines)
+
+    def __repr__(self):
+        return self.__str__()
+
+    @property
+    def index(self) -> pd.Index:
+        """Get index to underlying GeoDataFrame."""
+        return self._frame.index
+
+    @cached_property
+    def coords(self) -> List[Coordinate]:
+        """
+        Get coordinates as Coordinate objects.
+        """
+        coords_list = [
+            Coordinate(i, g, self.crs)
+            for i, g in zip(self._frame.index, self._frame.geometry)
+        ]
+        return coords_list
+
+    @property
+    def crs(self) -> CRS:
+        """Get Coordinate Reference System(CRS) to underlying GeoDataFrame."""
+        return self._frame.crs
+
+

+[docs]
+    @classmethod
+    def from_geo_dataframe(
+        cls,
+        frame: GeoDataFrame,
+        xy: bool = True,
+    ) -> Trace:
+        """
+        Builds a trace from a geopandas dataframe
+
+        Expects the dataframe to have geometry column
+
+        Args:
+            frame: geopandas dataframe with _one_ trace
+            xy: should the trace be projected to epsg 3857?
+
+        Returns:
+            The trace built from the geopandas dataframe
+        """
+        # get rid of any extra info besides geometry and index
+        frame = GeoDataFrame(geometry=frame.geometry, index=frame.index)
+        if xy:
+            frame = frame.to_crs(XY_CRS)
+        return Trace(frame)

+
+
+

+[docs]
+    @classmethod
+    def from_dataframe(
+        cls,
+        dataframe: pd.DataFrame,
+        xy: bool = True,
+        lat_column: str = "latitude",
+        lon_column: str = "longitude",
+    ) -> Trace:
+        """
+        Builds a trace from a pandas dataframe
+
+        Expects the dataframe to have latitude / longitude information in the epsg 4326 format
+
+        Args:
+            dataframe: pandas dataframe with _one_ trace
+            xy: should the trace be projected to epsg 3857?
+            lat_column: the name of the latitude column
+            lon_column: the name of the longitude column
+
+        Returns:
+            The trace built from the pandas dataframe
+        """
+        frame = GeoDataFrame(
+            geometry=points_from_xy(dataframe[lon_column], dataframe[lat_column]),
+            index=dataframe.index,
+            crs=LATLON_CRS,
+        )
+
+        return Trace.from_geo_dataframe(frame, xy)

+
+
+

+[docs]
+    @classmethod
+    def from_gpx(
+        cls,
+        file: Union[str, Path],
+        xy: bool = True,
+    ) -> Trace:
+        """
+        Builds a trace from a gpx file.
+
+        Expects the file to have simple gpx structure: a sequence of lat, lon pairs
+
+        Args:
+            file: the gpx file
+            xy: should the trace be projected to epsg 3857?
+
+        Returns:
+            The trace built from the gpx file
+        """
+        filepath = Path(file)
+        if not filepath.is_file():
+            raise FileNotFoundError(file)
+        elif not filepath.suffix == ".gpx":
+            raise TypeError(
+                f"file of type {filepath.suffix} does not appear to be a gpx file"
+            )
+        data = open(filepath).read()
+
+        lat_column, lon_column = "lat", "lon"
+        lat = np.array(re.findall(r'lat="([^"]+)', data), dtype=float)
+        lon = np.array(re.findall(r'lon="([^"]+)', data), dtype=float)
+        df = pd.DataFrame(zip(lat, lon), columns=[lat_column, lon_column])
+        return Trace.from_dataframe(df, xy, lat_column, lon_column)

+
+
+

+[docs]
+    @classmethod
+    def from_csv(
+        cls,
+        file: Union[str, Path],
+        xy: bool = True,
+        lat_column: str = "latitude",
+        lon_column: str = "longitude",
+    ) -> Trace:
+        """
+        Builds a trace from a csv file.
+
+        Expects the file to have latitude / longitude information in the epsg 4326 format
+
+        Args:
+            file: the csv file
+            xy: should the trace be projected to epsg 3857?
+            lat_column: the name of the latitude column
+            lon_column: the name of the longitude column
+
+        Returns:
+            The trace built from the csv file
+        """
+        filepath = Path(file)
+        if not filepath.is_file():
+            raise FileNotFoundError(file)
+        elif not filepath.suffix == ".csv":
+            raise TypeError(
+                f"file of type {filepath.suffix} does not appear to be a csv file"
+            )
+
+        columns = pd.read_csv(filepath, nrows=0).columns.to_list()
+        if lat_column in columns and lon_column in columns:
+            df = pd.read_csv(filepath)
+            return Trace.from_dataframe(df, xy, lat_column, lon_column)
+        else:
+            raise ValueError(
+                "Could not find any geometry information in the file; "
+                "Make sure there are latitude and longitude columns "
+                "[and provide the lat/lon column names to this function]"
+            )

+
+
+

+[docs]
+    @classmethod
+    def from_parquet(cls, file: Union[str, Path], xy: bool = True):
+        """
+        Read a trace from a parquet file
+
+        Args:
+            file: the parquet file
+            xy: should the trace be projected to epsg 3857?
+
+        Returns:
+            The trace built from the parquet file
+        """
+        filepath = Path(file)
+        frame = read_parquet(filepath)
+
+        return Trace.from_geo_dataframe(frame, xy)

+
+
+

+[docs]
+    @classmethod
+    def from_geojson(
+        cls,
+        file: Union[str, Path],
+        index_property: Optional[str] = None,
+        xy: bool = True,
+    ):
+        """
+        Reads a trace from a geojson file;
+        If index_property is not specified, this will set any property columns as the index.
+
+        Args:
+            file: the geojson file
+            index_property: the name of the property to use as the index
+            xy: should the trace be projected to epsg 3857?
+
+        Returns:
+            The trace built from the geojson file
+        """
+        filepath = Path(file)
+        frame = read_file(filepath)
+        if index_property and index_property in frame.columns:
+            frame = frame.set_index(index_property)
+        else:
+            gname = frame.geometry.name
+            index_cols = [c for c in frame.columns if c != gname]
+            frame = frame.set_index(index_cols)
+
+        return Trace.from_geo_dataframe(frame, xy)

+
+
+

+[docs]
+    def downsample(self, npoints: int) -> Trace:
+        """
+        Downsample the trace to a given number of points
+
+        Args:
+            npoints: the number of points to downsample to
+
+        Returns:
+            The downsampled trace
+        """
+        s = list(np.linspace(0, len(self._frame) - 1, npoints).astype(int))
+
+        new_frame = self._frame.iloc[s]
+
+        return Trace(new_frame)

+
+
+

+[docs]
+    def drop(self, index=List) -> Trace:
+        """
+        Remove points from the trace specified by the index parameter
+
+        Args:
+            index: the index of the points to drop (0 based index)
+
+        Returns:
+            The trace with the points removed
+        """
+        new_frame = self._frame.drop(index)
+
+        return Trace(new_frame)

+
+
+

+[docs]
+    def to_crs(self, new_crs: CRS) -> Trace:
+        """
+        Converts the crs of a trace to a new crs
+
+        Args:
+            new_crs: the new crs to convert to
+
+        Returns:
+            A new trace with the new crs
+        """
+        new_frame = self._frame.to_crs(new_crs)
+        return Trace(new_frame)

+
+
+

+[docs]
+    def to_geojson(self, file: Union[str, Path]):
+        """
+        Write the trace to a geojson file
+
+        Args:
+            file: the file to write to
+        """
+        self._frame.to_file(file, driver="GeoJSON")

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/maps/igraph/igraph_map.html b/_modules/mappymatch/maps/igraph/igraph_map.html new file mode 100644 index 0000000..efde94f --- /dev/null +++ b/_modules/mappymatch/maps/igraph/igraph_map.html @@ -0,0 +1,892 @@ + + + + + + + + + + mappymatch.maps.igraph.igraph_map — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.maps.igraph.igraph_map

+from __future__ import annotations
+
+from pathlib import Path
+from typing import Any, Callable, Dict, List, Optional, Set, Union
+
+import igraph as ig
+import networkx as nx
+import numpy as np
+import rtree as rt
+from shapely.geometry import Point
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.constructs.geofence import Geofence
+from mappymatch.constructs.road import Road, RoadId
+from mappymatch.maps.map_interface import (
+    DEFAULT_DISTANCE_WEIGHT,
+    DEFAULT_TIME_WEIGHT,
+    MapInterface,
+)
+from mappymatch.maps.nx.readers.osm_readers import (
+    NetworkType,
+    nx_graph_from_osmnx,
+)
+from mappymatch.utils.crs import CRS, LATLON_CRS
+
+DEFAULT_GEOMETRY_KEY = "geometry"
+DEFAULT_METADATA_KEY = "metadata"
+DEFAULT_CRS_KEY = "crs"
+DEFAULT_NODE_ID_NAME = "node_id"
+DEFAULT_EDGE_ID_NAME = "edge_id"
+
+
+

+[docs]
+class IGraphMap(MapInterface):
+    """
+    A road map that uses an igraph graph to represent its roads.
+
+    Attributes:
+        ig: The igraph graph that represents the road map
+        road_mapping: A mapping from road ids to igraph edge ids
+        crs: The coordinate reference system of the map
+    """
+
+    def __init__(self, graph: ig.Graph):
+        self.g = graph
+
+        if "crs_key" not in graph.attributes():
+            crs_key = DEFAULT_CRS_KEY
+        else:
+            crs_key = graph["crs_key"]
+
+        if crs_key not in graph.attributes():
+            raise ValueError(
+                "Input graph must have pyproj crs;"
+                "You can set it like: `graph['crs'] = pyproj.CRS('EPSG:4326')`"
+            )
+
+        crs = graph[crs_key]
+
+        if not isinstance(crs, CRS):
+            raise TypeError(
+                "Input graph must have pyproj crs;"
+                "You can set it like: `graph.graph['crs'] = pyproj.CRS('EPSG:4326')`"
+            )
+
+        self.crs = crs
+
+        if "distance_weight" not in graph.attributes():
+            dist_weight = DEFAULT_DISTANCE_WEIGHT
+        else:
+            dist_weight = graph["distance_weight"]
+
+        if "time_weight" not in graph.attributes():
+            time_weight = DEFAULT_TIME_WEIGHT
+        else:
+            time_weight = graph["time_weight"]
+
+        if "geometry_key" not in graph.attributes():
+            geom_key = DEFAULT_GEOMETRY_KEY
+        else:
+            geom_key = graph["geometry_key"]
+
+        if "metadata_key" not in graph.attributes():
+            metadata_key = DEFAULT_METADATA_KEY
+        else:
+            metadata_key = graph["metadata_key"]
+
+        if "node_id_name" not in graph.attributes():
+            node_id_name = DEFAULT_NODE_ID_NAME
+        else:
+            node_id_name = graph["node_id_name"]
+
+        if "edge_id_name" not in graph.attributes():
+            edge_id_name = DEFAULT_EDGE_ID_NAME
+        else:
+            edge_id_name = graph["edge_id_name"]
+
+        self._dist_weight = dist_weight
+        self._time_weight = time_weight
+        self._geom_key = geom_key
+        self._metadata_key = metadata_key
+        self._crs_key = crs_key
+        self._node_id_name = node_id_name
+        self._edge_id_name = edge_id_name
+
+        # store the names of any additional added attributes
+        self._additional_attribute_names: Set[str] = set()
+
+        self._build_rtree()
+
+        # build mapping from mappymatch road id to igraph edge id
+        self.road_mapping = {}
+        for e in self.g.es:
+            source_node_id = e.source_vertex[self._node_id_name]
+            target_node_id = e.target_vertex[self._node_id_name]
+            road_key = e[self._edge_id_name]
+
+            road_id = RoadId(source_node_id, target_node_id, road_key)
+            self.road_mapping[road_id] = e.index
+
+    def _build_road(
+        self,
+        edge_index: int,
+    ) -> Road:
+        """
+        Build a road from a road id, pulling the edge data from the graph
+
+        Be sure to check if the road id (_has_road_id) is in the graph before calling this method
+        """
+        edge = self.g.es[edge_index]
+        source_node_id = edge.source_vertex[self._node_id_name]
+        target_node_id = edge.target_vertex[self._node_id_name]
+        road_key = edge[self._edge_id_name]
+
+        edge_data = edge.attributes()
+        metadata = edge_data.get(self._metadata_key)
+
+        if metadata is None:
+            metadata = {}
+        else:
+            metadata = metadata.copy()
+
+        metadata[self._dist_weight] = edge_data.get(self._dist_weight)
+        metadata[self._time_weight] = edge_data.get(self._time_weight)
+
+        for attr in self._additional_attribute_names:
+            metadata[attr] = edge_data.get(attr)
+
+        road = Road(
+            RoadId(source_node_id, target_node_id, road_key),
+            edge_data[self._geom_key],
+            metadata=metadata,
+        )
+
+        return road
+
+    def _build_rtree(self):
+        idx = rt.index.Index()
+
+        for e in self.g.es:
+            geom = e.attributes()[self._geom_key]
+            box = geom.bounds
+
+            idx.insert(e.index, box)
+
+        self.rtree = idx
+
+    def __str__(self):
+        output_lines = [
+            "Mappymatch IGraphMap object",
+            f"graph: {self.g}",
+        ]
+        return "\n".join(output_lines)
+
+    def __repr__(self):
+        return self.__str__()
+
+    @property
+    def distance_weight(self) -> str:
+        return self._dist_weight
+
+    @property
+    def time_weight(self) -> str:
+        return self._time_weight
+
+

+[docs]
+    def road_by_id(self, road_id: RoadId) -> Optional[Road]:
+        """
+        Get a road by its id
+
+        Args:
+            road_id: The id of the road to get
+
+        Returns:
+            The road with the given id, or None if it does not exist
+        """
+        if road_id not in self.road_mapping:
+            return None
+
+        return self._build_road(self.road_mapping[road_id])

+
+
+

+[docs]
+    def set_road_attributes(self, attributes: Dict[RoadId, Dict[str, Any]]):
+        """
+        Set the attributes of the roads in the map
+
+        Args:
+            attributes: A dictionary mapping road ids to dictionaries of attributes
+
+        Returns:
+            None
+        """
+        geom_updated = False
+        for road_id, attrs in attributes.items():
+            edge_id = self.road_mapping.get(road_id)
+            if edge_id is None:
+                raise ValueError(f"Road id {road_id} not found in graph")
+            for attr, val in attrs.items():
+                self._additional_attribute_names.add(attr)
+                if attr == self._geom_key:
+                    geom_updated = True
+                self.g.es[edge_id][attr] = val
+
+        if geom_updated:
+            self._build_rtree()

+
+
+    @property
+    def roads(self) -> List[Road]:
+        roads = [self._build_road(e.index) for e in self.g.es]
+        return roads
+
+

+[docs]
+    @classmethod
+    def from_nx_graph(cls, nx_graph: nx.MultiDiGraph) -> IGraphMap:
+        """
+        Build an IGraphMap from a networkx graph
+        """
+        igraph = ig.Graph.from_networkx(nx_graph)
+
+        igraph.vs[DEFAULT_NODE_ID_NAME] = igraph.vs["_nx_name"]
+        del igraph.vs["_nx_name"]
+        igraph.es[DEFAULT_EDGE_ID_NAME] = igraph.es["_nx_multiedge_key"]
+        del igraph.es["_nx_multiedge_key"]
+
+        return IGraphMap(igraph)

+
+
+

+[docs]
+    @classmethod
+    def from_file(cls, file: Union[str, Path]) -> IGraphMap:
+        """
+        Build a IGraphMap instance from a file
+
+        Args:
+            file: The graph pickle file to load the graph from
+
+        Returns:
+            A IGraphMap instance
+        """
+        file = Path(file)
+        if not file.suffix == ".pickle":
+            raise ValueError("file must be a pickle file")
+        g = ig.Graph.Read_Pickle(str(file))
+        return IGraphMap(g)

+
+
+

+[docs]
+    @classmethod
+    def from_geofence(
+        cls,
+        geofence: Geofence,
+        xy: bool = True,
+        network_type: NetworkType = NetworkType.DRIVE,
+    ) -> IGraphMap:
+        """
+        Read an OSM network graph into a IGraphMap
+
+        Args:
+            geofence: the geofence to clip the graph to
+            xy: whether to use xy coordinates or lat/lon
+            network_type: the network type to use for the graph
+
+        Returns:
+            a IGraphMap
+        """
+        if geofence.crs != LATLON_CRS:
+            raise TypeError(
+                f"the geofence must in the epsg:4326 crs but got {geofence.crs.to_authority()}"
+            )
+
+        nx_graph = nx_graph_from_osmnx(
+            geofence=geofence, network_type=network_type, xy=xy
+        )
+
+        return IGraphMap.from_nx_graph(nx_graph)

+
+
+

+[docs]
+    def to_file(self, outfile: Union[str, Path]):
+        """
+        Save the graph to a pickle file
+
+        Args:
+            outfile: The file to save the graph to
+        """
+        outfile = Path(outfile)
+        if outfile.suffix != ".pickle":
+            raise ValueError("outfile must have a .pickle suffix")
+
+        self.g.write_pickle(str(outfile))

+
+
+    def _nearest_edge_index(self, coord: Coordinate, buffer: float = 10.0) -> int:
+        """
+        An internal method to find the nearest edge to a coordinate
+
+        Args:
+            coord: The coordinate to find the nearest road to
+            buffer: The buffer to search around the coordinate
+
+        Returns:
+            The nearest edge index to the coordinate
+        """
+        if coord.crs != self.crs:
+            raise ValueError(
+                f"crs of origin {coord.crs} must match crs of map {self.crs}"
+            )
+        nearest_candidates = list(
+            self.rtree.nearest(coord.geom.buffer(buffer).bounds, 1),
+        )
+
+        if len(nearest_candidates) == 0:
+            raise ValueError(f"No roads found for {coord}")
+        elif len(nearest_candidates) == 1:
+            nearest_id = nearest_candidates[0]
+        else:
+            distances = [
+                self._build_road(i).geom.distance(coord.geom)
+                for i in nearest_candidates
+            ]
+            nearest_id = nearest_candidates[np.argmin(distances)]
+
+        return nearest_id
+
+

+[docs]
+    def nearest_road(self, coord: Coordinate, buffer: float = 10.0) -> Road:
+        """
+        A helper function to get the nearest road.
+
+        Args:
+            coord: The coordinate to find the nearest road to
+            buffer: The buffer to search around the coordinate
+
+        Returns:
+            The nearest road to the coordinate
+        """
+        nearest_edge_index = self._nearest_edge_index(coord, buffer)
+        return self._build_road(nearest_edge_index)

+
+
+

+[docs]
+    def shortest_path(
+        self,
+        origin: Coordinate,
+        destination: Coordinate,
+        weight: Optional[Union[str, Callable]] = None,
+    ) -> List[Road]:
+        """
+        Computes the shortest path between an origin and a destination
+
+        Args:
+            origin: The origin coordinate
+            destination: The destination coordinate
+            weight: The weight to use for the path, either a string or a function
+
+        Returns:
+            A list of roads that form the shortest path
+        """
+        if weight is None:
+            weight = self._time_weight
+
+        if callable(weight):
+            raise NotImplementedError("IGraphMap does not support custom weights")
+
+        if weight not in self.g.es.attributes():
+            raise ValueError(f"weight {weight} is not a valid attribute of the graph")
+
+        if origin.crs != self.crs:
+            raise ValueError(
+                f"crs of origin {origin.crs} must match crs of map {self.crs}"
+            )
+        elif destination.crs != self.crs:
+            raise ValueError(
+                f"crs of destination {destination.crs} must match crs of map {self.crs}"
+            )
+
+        origin_edge_index = self._nearest_edge_index(origin)
+        dest_edge_index = self._nearest_edge_index(destination)
+
+        # find which road is closest to the origin and destination
+        origin_road = self._build_road(origin_edge_index)
+        dest_road = self._build_road(dest_edge_index)
+
+        ostart = Point(origin_road.geom.coords[0])
+        oend = Point(origin_road.geom.coords[-1])
+
+        dstart = Point(dest_road.geom.coords[0])
+        dend = Point(dest_road.geom.coords[-1])
+
+        u_dist = ostart.distance(origin.geom)
+        v_dist = oend.distance(origin.geom)
+
+        if u_dist <= v_dist:
+            origin_vertex_id = self.g.es[origin_edge_index].source
+        else:
+            origin_vertex_id = self.g.es[origin_edge_index].target
+
+        u_dist = dstart.distance(destination.geom)
+        v_dist = dend.distance(destination.geom)
+
+        if u_dist <= v_dist:
+            dest_vertex_id = self.g.es[dest_edge_index].source
+        else:
+            dest_vertex_id = self.g.es[dest_edge_index].target
+
+        edge_path = self.g.get_shortest_paths(
+            origin_vertex_id,
+            dest_vertex_id,
+            weights=self.g.es[weight],
+            output="epath",
+        )
+
+        roads = [self._build_road(i) for i in edge_path[0]]
+
+        return roads

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/maps/map_interface.html b/_modules/mappymatch/maps/map_interface.html new file mode 100644 index 0000000..3f7f731 --- /dev/null +++ b/_modules/mappymatch/maps/map_interface.html @@ -0,0 +1,550 @@ + + + + + + + + + + mappymatch.maps.map_interface — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.maps.map_interface

+from __future__ import annotations
+
+from abc import ABCMeta, abstractmethod
+from typing import Callable, List, Optional, Union
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.constructs.road import Road, RoadId
+
+DEFAULT_DISTANCE_WEIGHT = "kilometers"
+DEFAULT_TIME_WEIGHT = "minutes"
+
+
+

+[docs]
+class MapInterface(metaclass=ABCMeta):
+    """
+    Abstract base class for a Matcher
+    """
+
+    @property
+    @abstractmethod
+    def distance_weight(self) -> str:
+        """
+        Get the distance weight
+
+        Returns:
+            The distance weight
+        """
+        return DEFAULT_DISTANCE_WEIGHT
+
+    @property
+    @abstractmethod
+    def time_weight(self) -> str:
+        """
+        Get the time weight
+
+        Returns:
+            The time weight
+        """
+        return DEFAULT_TIME_WEIGHT
+
+    @property
+    @abstractmethod
+    def roads(self) -> List[Road]:
+        """
+        Get a list of all the roads in the map
+
+        Returns:
+            A list of all the roads in the map
+        """
+
+

+[docs]
+    @abstractmethod
+    def road_by_id(self, road_id: RoadId) -> Optional[Road]:
+        """
+        Get a road by its id
+
+        Args:
+            road_id: The id of the road to get
+
+        Returns:
+            The road with the given id or None if it does not exist
+        """

+
+
+

+[docs]
+    @abstractmethod
+    def nearest_road(
+        self,
+        coord: Coordinate,
+    ) -> Road:
+        """
+        Return the nearest road to a coordinate
+
+        Args:
+            coord: The coordinate to find the nearest road to
+
+        Returns:
+            The nearest road to the coordinate
+        """

+
+
+

+[docs]
+    @abstractmethod
+    def shortest_path(
+        self,
+        origin: Coordinate,
+        destination: Coordinate,
+        weight: Optional[Union[str, Callable]] = None,
+    ) -> List[Road]:
+        """
+        Computes the shortest path on the road network
+
+        Args:
+            origin: The origin coordinate
+            destination: The destination coordinate
+            weight: The weight to use for the path
+
+        Returns:
+            A list of roads that form the shortest path
+        """

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/maps/nx/nx_map.html b/_modules/mappymatch/maps/nx/nx_map.html new file mode 100644 index 0000000..5c9e112 --- /dev/null +++ b/_modules/mappymatch/maps/nx/nx_map.html @@ -0,0 +1,884 @@ + + + + + + + + + + mappymatch.maps.nx.nx_map — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.maps.nx.nx_map

+from __future__ import annotations
+
+import json
+from pathlib import Path
+from typing import Any, Callable, Dict, List, Optional, Set, Union
+
+import networkx as nx
+import numpy as np
+import rtree as rt
+import shapely.wkt as wkt
+from shapely.geometry import Point
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.constructs.geofence import Geofence
+from mappymatch.constructs.road import Road, RoadId
+from mappymatch.maps.map_interface import (
+    DEFAULT_DISTANCE_WEIGHT,
+    DEFAULT_TIME_WEIGHT,
+    MapInterface,
+)
+from mappymatch.maps.nx.readers.osm_readers import (
+    NetworkType,
+    nx_graph_from_osmnx,
+)
+from mappymatch.utils.crs import CRS, LATLON_CRS
+
+DEFAULT_GEOMETRY_KEY = "geometry"
+DEFAULT_METADATA_KEY = "metadata"
+DEFAULT_CRS_KEY = "crs"
+
+
+

+[docs]
+class NxMap(MapInterface):
+    """
+    A road map that uses a networkx graph to represent its roads.
+
+    Attributes:
+        g: The networkx graph that represents the road map
+        crs: The coordinate reference system of the map
+    """
+
+    def __init__(self, graph: nx.MultiDiGraph):
+        self.g = graph
+
+        crs_key = graph.graph.get("crs_key", DEFAULT_CRS_KEY)
+
+        if crs_key not in graph.graph:
+            raise ValueError(
+                "Input graph must have pyproj crs;"
+                "You can set it like: `graph.graph['crs'] = pyproj.CRS('EPSG:4326')`"
+            )
+
+        crs = graph.graph[crs_key]
+
+        if not isinstance(crs, CRS):
+            raise TypeError(
+                "Input graph must have pyproj crs;"
+                "You can set it like: `graph.graph['crs'] = pyproj.CRS('EPSG:4326')`"
+            )
+
+        self.crs = crs
+
+        dist_weight = graph.graph.get("distance_weight", DEFAULT_DISTANCE_WEIGHT)
+        time_weight = graph.graph.get("time_weight", DEFAULT_TIME_WEIGHT)
+        geom_key = graph.graph.get("geometry_key", DEFAULT_GEOMETRY_KEY)
+        metadata_key = graph.graph.get("metadata_key", DEFAULT_METADATA_KEY)
+
+        self._dist_weight = dist_weight
+        self._time_weight = time_weight
+        self._geom_key = geom_key
+        self._metadata_key = metadata_key
+        self._crs_key = crs_key
+
+        self._addtional_attribute_names: Set[str] = set()
+
+        self._build_rtree()
+
+    def _has_road_id(self, road_id: RoadId) -> bool:
+        return self.g.has_edge(*road_id)
+
+    def _build_road(
+        self,
+        road_id: RoadId,
+    ) -> Road:
+        """
+        Build a road from a road id, pulling the edge data from the graph
+
+        Be sure to check if the road id (_has_road_id) is in the graph before calling this method
+        """
+        edge_data = self.g.get_edge_data(*road_id)
+
+        metadata = edge_data.get(self._metadata_key)
+
+        if metadata is None:
+            metadata = {}
+        else:
+            metadata = metadata.copy()
+
+        metadata[self._dist_weight] = edge_data.get(self._dist_weight)
+        metadata[self._time_weight] = edge_data.get(self._time_weight)
+
+        for attr_name in self._addtional_attribute_names:
+            metadata[attr_name] = edge_data.get(attr_name)
+
+        road = Road(
+            road_id,
+            edge_data[self._geom_key],
+            metadata=metadata,
+        )
+
+        return road
+
+    def _build_rtree(self):
+        idx = rt.index.Index()
+        for i, gtuple in enumerate(self.g.edges(data=True, keys=True)):
+            u, v, k, d = gtuple
+            road_id = RoadId(u, v, k)
+            # road = self._build_road(u, v, k, d)
+            geom = d[self._geom_key]
+            box = geom.bounds
+
+            idx.insert(i, box, obj=road_id)
+
+            # road_lookup[road.road_id] = road
+
+        self.rtree = idx
+        # self._road_lookup: Dict[RoadId, Road] = road_lookup
+
+    def __str__(self):
+        output_lines = [
+            "Mappymatch NxMap object",
+            f"roads: {len(self._road_lookup)} Road objects",
+            f"graph: {self.g}",
+        ]
+        return "\n".join(output_lines)
+
+    def __repr__(self):
+        return self.__str__()
+
+    @property
+    def distance_weight(self) -> str:
+        return self._dist_weight
+
+    @property
+    def time_weight(self) -> str:
+        return self._time_weight
+
+

+[docs]
+    def road_by_id(self, road_id: RoadId) -> Optional[Road]:
+        """
+        Get a road by its id
+
+        Args:
+            road_id: The id of the road to get
+
+        Returns:
+            The road with the given id, or None if it does not exist
+        """
+        if self._has_road_id(road_id):
+            return self._build_road(road_id)
+        else:
+            return None

+
+
+

+[docs]
+    def set_road_attributes(self, attributes: Dict[RoadId, Dict[str, Any]]):
+        """
+        Set the attributes of the roads in the map
+
+        Args:
+            attributes: A dictionary mapping road ids to dictionaries of attributes
+
+        Returns:
+            None
+        """
+        for attrs in attributes.values():
+            for attr_name in attrs.keys():
+                self._addtional_attribute_names.add(attr_name)
+
+        nx.set_edge_attributes(self.g, attributes)
+        self._build_rtree()

+
+
+    @property
+    def roads(self) -> List[Road]:
+        roads = [
+            self._build_road(RoadId(u, v, k)) for u, v, k in self.g.edges(keys=True)
+        ]
+        return roads
+
+

+[docs]
+    @classmethod
+    def from_file(cls, file: Union[str, Path]) -> NxMap:
+        """
+        Build a NxMap instance from a file
+
+        Args:
+            file: The graph pickle file to load the graph from
+
+        Returns:
+            A NxMap instance
+        """
+        p = Path(file)
+        if p.suffix == ".pickle":
+            raise ValueError(
+                "NxMap does not support reading from pickle files, please use .json instead"
+            )
+        elif p.suffix == ".json":
+            with p.open("r") as f:
+                return NxMap.from_dict(json.load(f))
+        else:
+            raise TypeError("NxMap only supports reading from json files")

+
+
+

+[docs]
+    @classmethod
+    def from_geofence(
+        cls,
+        geofence: Geofence,
+        xy: bool = True,
+        network_type: NetworkType = NetworkType.DRIVE,
+        custom_filter: Optional[str] = None,
+    ) -> NxMap:
+        """
+        Read an OSM network graph into a NxMap
+
+        Args:
+            geofence: the geofence to clip the graph to
+            xy: whether to use xy coordinates or lat/lon
+            network_type: the network type to use for the graph
+            custom_filter: a custom filter to pass to osmnx like '["highway"~"motorway|primary"]'
+
+        Returns:
+            a NxMap
+        """
+        if geofence.crs != LATLON_CRS:
+            raise TypeError(
+                f"the geofence must in the epsg:4326 crs but got {geofence.crs.to_authority()}"
+            )
+
+        nx_graph = nx_graph_from_osmnx(
+            geofence=geofence,
+            network_type=network_type,
+            xy=xy,
+            custom_filter=custom_filter,
+        )
+
+        return NxMap(nx_graph)

+
+
+

+[docs]
+    def to_file(self, outfile: Union[str, Path]):
+        """
+        Save the graph to a pickle file
+
+        Args:
+            outfile: The file to save the graph to
+        """
+        outfile = Path(outfile)
+
+        if outfile.suffix == ".pickle":
+            raise ValueError(
+                "NxMap does not support writing to pickle files, please use .json instead"
+            )
+        elif outfile.suffix == ".json":
+            graph_dict = self.to_dict()
+            with open(outfile, "w") as f:
+                json.dump(graph_dict, f)
+        else:
+            raise TypeError("NxMap only supports writing to json files")

+
+
+

+[docs]
+    @classmethod
+    def from_dict(cls, d: Dict[str, Any]) -> NxMap:
+        """
+        Build a NxMap instance from a dictionary
+        """
+        geom_key = d["graph"].get("geometry_key", DEFAULT_GEOMETRY_KEY)
+
+        for link in d["links"]:
+            geom_wkt = link[geom_key]
+            link[geom_key] = wkt.loads(geom_wkt)
+
+        crs_key = d["graph"].get("crs_key", DEFAULT_CRS_KEY)
+        crs = CRS.from_wkt(d["graph"][crs_key])
+        d["graph"][crs_key] = crs
+
+        g = nx.readwrite.json_graph.node_link_graph(d)
+
+        return NxMap(g)

+
+
+

+[docs]
+    def to_dict(self) -> Dict[str, Any]:
+        """
+        Convert the map to a dictionary
+        """
+        graph_dict = nx.readwrite.json_graph.node_link_data(self.g)
+
+        # convert geometries to well know text
+        for link in graph_dict["links"]:
+            geom = link[self._geom_key]
+            link[self._geom_key] = geom.wkt
+
+        # convert crs to well known text
+        crs_key = graph_dict["graph"].get("crs_key", DEFAULT_CRS_KEY)
+        graph_dict["graph"][crs_key] = self.crs.to_wkt()
+
+        return graph_dict

+
+
+

+[docs]
+    def nearest_road(self, coord: Coordinate, buffer: float = 10.0) -> Road:
+        """
+        A helper function to get the nearest road.
+
+        Args:
+            coord: The coordinate to find the nearest road to
+            buffer: The buffer to search around the coordinate
+
+        Returns:
+            The nearest road to the coordinate
+        """
+        if coord.crs != self.crs:
+            raise ValueError(
+                f"crs of origin {coord.crs} must match crs of map {self.crs}"
+            )
+        nearest_candidates = list(
+            map(
+                lambda c: c.object,
+                (self.rtree.nearest(coord.geom.buffer(buffer).bounds, 1, objects=True)),
+            )
+        )
+
+        if len(nearest_candidates) == 0:
+            raise ValueError(f"No roads found for {coord}")
+        elif len(nearest_candidates) == 1:
+            nearest_id = nearest_candidates[0]
+        else:
+            distances = [
+                self._build_road(i).geom.distance(coord.geom)
+                for i in nearest_candidates
+            ]
+            nearest_id = nearest_candidates[np.argmin(distances)]
+
+        road = self._build_road(nearest_id)
+
+        return road

+
+
+

+[docs]
+    def shortest_path(
+        self,
+        origin: Coordinate,
+        destination: Coordinate,
+        weight: Optional[Union[str, Callable]] = None,
+    ) -> List[Road]:
+        """
+        Computes the shortest path between an origin and a destination
+
+        Args:
+            origin: The origin coordinate
+            destination: The destination coordinate
+            weight: The weight to use for the path, either a string or a function
+
+        Returns:
+            A list of roads that form the shortest path
+        """
+        if origin.crs != self.crs:
+            raise ValueError(
+                f"crs of origin {origin.crs} must match crs of map {self.crs}"
+            )
+        elif destination.crs != self.crs:
+            raise ValueError(
+                f"crs of destination {destination.crs} must match crs of map {self.crs}"
+            )
+
+        if weight is None:
+            weight = self._time_weight
+
+        origin_road = self.nearest_road(origin)
+        dest_road = self.nearest_road(destination)
+
+        ostart = Point(origin_road.geom.coords[0])
+        oend = Point(origin_road.geom.coords[-1])
+
+        dstart = Point(dest_road.geom.coords[0])
+        dend = Point(dest_road.geom.coords[-1])
+
+        u_dist = ostart.distance(origin.geom)
+        v_dist = oend.distance(origin.geom)
+
+        if u_dist <= v_dist:
+            origin_id = origin_road.road_id.start
+        else:
+            origin_id = origin_road.road_id.end
+
+        u_dist = dstart.distance(destination.geom)
+        v_dist = dend.distance(destination.geom)
+
+        if u_dist <= v_dist:
+            dest_id = dest_road.road_id.start
+        else:
+            dest_id = dest_road.road_id.end
+
+        nx_route = nx.shortest_path(
+            self.g,
+            origin_id,
+            dest_id,
+            weight=weight,
+        )
+
+        path = []
+        for i in range(1, len(nx_route)):
+            road_start_node = nx_route[i - 1]
+            road_end_node = nx_route[i]
+
+            edge_data = self.g.get_edge_data(road_start_node, road_end_node)
+            road_key = list(edge_data.keys())[0]
+
+            road_id = RoadId(road_start_node, road_end_node, road_key)
+
+            road = self._build_road(road_id)
+
+            path.append(road)
+
+        return path

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/maps/nx/readers/osm_readers.html b/_modules/mappymatch/maps/nx/readers/osm_readers.html new file mode 100644 index 0000000..14e3c01 --- /dev/null +++ b/_modules/mappymatch/maps/nx/readers/osm_readers.html @@ -0,0 +1,639 @@ + + + + + + + + + + mappymatch.maps.nx.readers.osm_readers — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.maps.nx.readers.osm_readers

+from __future__ import annotations
+
+import logging as log
+from enum import Enum
+from typing import Optional
+
+import networkx as nx
+from shapely.geometry import LineString
+
+from mappymatch.constructs.geofence import Geofence
+from mappymatch.utils.crs import XY_CRS
+from mappymatch.utils.exceptions import MapException
+
+log.basicConfig(level=log.INFO)
+
+
+METERS_TO_KM = 1 / 1000
+DEFAULT_MPH = 30
+
+
+

+[docs]
+class NetworkType(Enum):
+    """
+    Enumerator for Network Types supported by osmnx.
+    """
+
+    ALL_PRIVATE = "all_private"
+    ALL = "all"
+    BIKE = "bike"
+    DRIVE = "drive"
+    DRIVE_SERVICE = "drive_service"
+    WALK = "walk"

+
+
+
+

+[docs]
+def nx_graph_from_osmnx(
+    geofence: Geofence,
+    network_type: NetworkType,
+    xy: bool = True,
+    custom_filter: Optional[str] = None,
+) -> nx.MultiDiGraph:
+    """
+    Build a networkx graph from OSM data
+
+    Args:
+        geofence: the geofence to clip the graph to
+        network_type: the network type to use for the graph
+        xy: whether to use xy coordinates or lat/lon
+        custom_filter: a custom filter to pass to osmnx
+
+    Returns:
+        a networkx graph of the OSM network
+    """
+    try:
+        import osmnx as ox
+    except ImportError:
+        raise MapException("osmnx is not installed but is required for this map type")
+    ox.settings.log_console = False
+
+    raw_graph = ox.graph_from_polygon(
+        geofence.geometry,
+        network_type=network_type.value,
+        custom_filter=custom_filter,
+    )
+    return parse_osmnx_graph(raw_graph, network_type, xy=xy)

+
+
+
+

+[docs]
+def parse_osmnx_graph(
+    graph: nx.MultiDiGraph,
+    network_type: NetworkType,
+    xy: bool = True,
+) -> nx.MultiDiGraph:
+    """
+    Parse the raw osmnx graph into a graph that we can use with our NxMap
+
+    Args:
+        geofence: the geofence to clip the graph to
+        xy: whether to use xy coordinates or lat/lon
+        network_type: the network type to use for the graph
+
+    Returns:
+        a cleaned networkx graph of the OSM network
+    """
+    try:
+        import osmnx as ox
+    except ImportError:
+        raise MapException("osmnx is not installed but is required for this map type")
+    ox.settings.log_console = False
+    g = graph
+
+    if xy:
+        g = ox.project_graph(g, to_crs=XY_CRS)
+
+    g = ox.add_edge_speeds(g)
+    g = ox.add_edge_travel_times(g)
+
+    length_meters = nx.get_edge_attributes(g, "length")
+    kilometers = {k: v * METERS_TO_KM for k, v in length_meters.items()}
+    nx.set_edge_attributes(g, kilometers, "kilometers")
+
+    # this makes sure there are no graph 'dead-ends'
+    sg_components = nx.strongly_connected_components(g)
+
+    if not sg_components:
+        raise MapException(
+            "road network has no strongly connected components and is not routable; "
+            "check polygon boundaries."
+        )
+
+    g = nx.MultiDiGraph(g.subgraph(max(sg_components, key=len)))
+
+    no_geom = 0
+    for u, v, d in g.edges(data=True):
+        if "geometry" not in d:
+            if no_geom < 10:
+                print(d)
+            # we'll build a pseudo-geometry using the x, y data from the nodes
+            unode = g.nodes[u]
+            vnode = g.nodes[v]
+            line = LineString([(unode["x"], unode["y"]), (vnode["x"], vnode["y"])])
+            d["geometry"] = line
+            no_geom += 1
+    if no_geom > 0:
+        total_links = len(g.edges)
+        print(
+            f"Warning: found {no_geom} of {total_links} links with no geometry; "
+            "creating link geometries from the node endpoints"
+        )
+
+    g = compress(g)
+
+    # TODO: these should all be sourced from the same location
+    g.graph["distance_weight"] = "kilometers"
+    g.graph["time_weight"] = "travel_time"
+    g.graph["geometry_key"] = "geometry"
+    g.graph["network_type"] = network_type.value
+
+    return g

+
+
+
+

+[docs]
+def compress(g: nx.MultiDiGraph) -> nx.MultiDiGraph:
+    """
+    a hacky way to delete unnecessary data on the networkx graph
+
+    Args:
+        g: the networkx graph to compress
+
+    Returns:
+        the compressed networkx graph
+    """
+    keys_to_delete = [
+        "oneway",
+        "ref",
+        "access",
+        "lanes",
+        "name",
+        "maxspeed",
+        "highway",
+        "length",
+        "speed_kph",
+        "osmid",
+        "street_count",
+        "junction",
+        "bridge",
+        "tunnel",
+        "reversed",
+        "y",
+        "x",
+    ]
+
+    for _, _, d in g.edges(data=True):
+        for k in keys_to_delete:
+            try:
+                del d[k]
+            except KeyError:
+                continue
+
+    for _, d in g.nodes(data=True):
+        for k in keys_to_delete:
+            try:
+                del d[k]
+            except KeyError:
+                continue
+
+    return g

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/lcss/constructs.html b/_modules/mappymatch/matchers/lcss/constructs.html new file mode 100644 index 0000000..9342ac1 --- /dev/null +++ b/_modules/mappymatch/matchers/lcss/constructs.html @@ -0,0 +1,719 @@ + + + + + + + + + + mappymatch.matchers.lcss.constructs — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.lcss.constructs

+from __future__ import annotations
+
+import logging
+import random
+from typing import List, NamedTuple, Union
+
+import numpy as np
+from numpy import ndarray, signedinteger
+
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.road import Road
+from mappymatch.constructs.trace import Trace
+from mappymatch.matchers.lcss.utils import compress
+from mappymatch.utils.geo import coord_to_coord_dist
+
+log = logging.getLogger(__name__)
+
+
+

+[docs]
+class CuttingPoint(NamedTuple):
+    """
+    A cutting point represents where the LCSS algorithm cuts the trace into a sub-segment.
+
+    Attributes:
+        trace_index: An index of where to cut the trace
+    """
+
+    trace_index: Union[signedinteger, int]

+
+
+
+

+[docs]
+class TrajectorySegment(NamedTuple):
+    """
+    Represents a pairing of a trace and candidate path
+
+    Attributes:
+        trace: The trace in the segment
+        path: The candidate path in the segment
+        matches: The matches between the trace and the path
+        score: The similarity score between the trace and the path
+        cutting_points: The points where the trace and path are to be cut
+    """
+
+    trace: Trace
+    path: List[Road]
+
+    matches: List[Match] = []
+
+    score: float = 0
+
+    cutting_points: List[CuttingPoint] = []
+
+    def __add__(self, other):
+        new_traces = self.trace + other.trace
+        new_paths = self.path + other.path
+        return TrajectorySegment(new_traces, new_paths)
+
+

+[docs]
+    def set_score(self, score: float) -> TrajectorySegment:
+        """
+        Sets the score of the trajectory segment
+
+        Args:
+            score: The score of the trajectory segment
+
+        Returns:
+            The updated trajectory segment
+        """
+        return self._replace(score=score)

+
+
+

+[docs]
+    def set_cutting_points(self, cutting_points) -> TrajectorySegment:
+        """
+        Sets the cutting points of the trajectory segment
+
+        Args:
+            cutting_points: The cutting points of the trajectory segment
+
+        Returns:
+            The updated trajectory segment
+        """
+        return self._replace(cutting_points=cutting_points)

+
+
+

+[docs]
+    def set_matches(self, matches) -> TrajectorySegment:
+        """
+        Sets the matches of the trajectory segment
+
+        Args:
+            matches: The matches of the trajectory segment
+
+        Returns:
+            The updated trajectory segment
+        """
+        return self._replace(matches=matches)

+
+
+

+[docs]
+    def score_and_match(
+        self,
+        distance_epsilon: float,
+        max_distance: float,
+    ) -> TrajectorySegment:
+        """
+        Computes the score of a trace, pair matching and also matches the coordinates to the nearest road.
+
+        Args:
+            distance_epsilon: The distance threshold for matching
+            max_distance: The maximum distance between the trace and the path
+
+        Returns:
+            The updated trajectory segment with a score and matches
+        """
+        trace = self.trace
+        path = self.path
+
+        m = len(trace.coords)
+        n = len(path)
+
+        matched_roads = []
+
+        if m < 1:
+            # todo: find a better way to handle this edge case
+            raise Exception("traces of 0 points can't be matched")
+        elif n < 2:
+            # a path was not found for this segment; might not be matchable;
+            # we set a score of zero and return a set of no-matches
+            matches = [
+                Match(road=None, distance=np.inf, coordinate=c)
+                for c in self.trace.coords
+            ]
+            return self.set_score(0).set_matches(matches)
+
+        C = [[0 for i in range(n + 1)] for j in range(m + 1)]
+
+        f = trace._frame
+        distances = np.array([f.distance(r.geom).values for r in path])
+
+        for i in range(1, m + 1):
+            nearest_road = None
+            min_dist = np.inf
+            coord = trace.coords[i - 1]
+            for j in range(1, n + 1):
+                road = path[j - 1]
+
+                # dt = road_to_coord_dist(road, coord)
+                dt = distances[j - 1][i - 1]
+
+                if dt < min_dist:
+                    min_dist = dt
+                    nearest_road = road
+
+                if dt < distance_epsilon:
+                    point_similarity = 1 - (dt / distance_epsilon)
+                else:
+                    point_similarity = 0
+
+                C[i][j] = max(
+                    (C[i - 1][j - 1] + point_similarity),
+                    C[i][j - 1],
+                    C[i - 1][j],
+                )
+
+            if min_dist > max_distance:
+                nearest_road = None
+                min_dist = np.inf
+
+            match = Match(
+                road=nearest_road,
+                distance=min_dist,
+                coordinate=coord,
+            )
+            matched_roads.append(match)
+
+        sim_score = C[m][n] / float(min(m, n))
+
+        return self.set_score(sim_score).set_matches(matched_roads)

+
+
+

+[docs]
+    def compute_cutting_points(
+        self,
+        distance_epsilon: float,
+        cutting_thresh: float,
+        random_cuts: int,
+    ) -> TrajectorySegment:
+        """
+        Computes the cutting points for a trajectory segment by:
+         - computing the furthest point
+         - adding points that are close to the distance epsilon
+
+        Args:
+            distance_epsilon: The distance threshold for matching
+            cutting_thresh: The threshold for cutting the trace
+            random_cuts: The number of random cuts to add
+
+        Returns:
+            The updated trajectory segment with cutting points
+        """
+        cutting_points = []
+
+        no_match = all([not m.road for m in self.matches])
+
+        if not self.path or no_match:
+            # no path computed or no matches found, possible edge cases:
+            # 1. trace starts and ends in the same location: pick points far from the start and end
+            start = self.trace.coords[0]
+            end = self.trace.coords[-1]
+
+            start_end_dist = start.geom.distance(end.geom)
+
+            if start_end_dist < distance_epsilon:
+                p1 = np.argmax(
+                    [coord_to_coord_dist(start, c) for c in self.trace.coords]
+                )
+                p2 = np.argmax([coord_to_coord_dist(end, c) for c in self.trace.coords])
+                assert not isinstance(p1, ndarray)
+                assert not isinstance(p2, ndarray)
+                # To do - np.argmax returns array of indices where the highest value is found.
+                # if there is only one highest value an int is returned. CuttingPoint takes an int.
+                # if an array is returned by argmax, this throws an error
+                cp1 = CuttingPoint(p1)
+                cp2 = CuttingPoint(p2)
+
+                cutting_points.extend([cp1, cp2])
+            else:
+                # pick the middle point on the trace:
+                mid = int(len(self.trace) / 2)
+                cp = CuttingPoint(mid)
+                cutting_points.append(cp)
+        else:
+            # find furthest point
+            pre_i = np.argmax([m.distance for m in self.matches if m.road])
+            cutting_points.append(CuttingPoint(pre_i))
+
+            # collect points that are close to the distance threshold
+            for i, m in enumerate(self.matches):
+                if m.road:
+                    if abs(m.distance - distance_epsilon) < cutting_thresh:
+                        cutting_points.append(CuttingPoint(i))
+
+        # add random points
+        for _ in range(random_cuts):
+            cpi = random.randint(0, len(self.trace) - 1)
+            cutting_points.append(CuttingPoint(cpi))
+
+        # merge cutting points that are adjacent to one another
+        compressed_cuts = list(compress(cutting_points))
+
+        # it doesn't make sense to cut the trace at the start or end so discard any
+        # points that apear in the [0, 1, -1, -2] position with respect to a trace
+        n = len(self.trace)
+        final_cuts = list(
+            filter(
+                lambda cp: cp.trace_index not in [0, 1, n - 2, n - 1],
+                compressed_cuts,
+            )
+        )
+
+        return self.set_cutting_points(final_cuts)

+

+
+
+
+TrajectoryScheme = List[TrajectorySegment]
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/lcss/lcss.html b/_modules/mappymatch/matchers/lcss/lcss.html new file mode 100644 index 0000000..d9b486e --- /dev/null +++ b/_modules/mappymatch/matchers/lcss/lcss.html @@ -0,0 +1,610 @@ + + + + + + + + + + mappymatch.matchers.lcss.lcss — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.lcss.lcss

+import functools as ft
+import logging
+
+from shapely.geometry import Point
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.maps.map_interface import MapInterface
+from mappymatch.matchers.lcss.constructs import TrajectorySegment
+from mappymatch.matchers.lcss.ops import (
+    add_matches_for_stationary_points,
+    drop_stationary_points,
+    find_stationary_points,
+    new_path,
+    same_trajectory_scheme,
+    split_trajectory_segment,
+)
+from mappymatch.matchers.matcher_interface import (
+    List,
+    MatcherInterface,
+    MatchResult,
+    Trace,
+)
+
+log = logging.getLogger(__name__)
+
+
+

+[docs]
+class LCSSMatcher(MatcherInterface):
+    """
+    A map matcher based on the paper:
+
+    Zhu, Lei, Jacob R. Holden, and Jeffrey D. Gonder.
+    "Trajectory Segmentation Map-Matching Approach for Large-Scale,
+    High-Resolution GPS Data."
+    Transportation Research Record: Journal of the Transportation Research
+    Board 2645 (2017): 67-75.
+
+    Args:
+        road_map: The road map to use for matching
+        distance_epsilon: The distance epsilon to use for matching (default: 50 meters)
+        similarity_cutoff: The similarity cutoff to use for stopping the algorithm (default: 0.9)
+        cutting_threshold: The distance threshold to use for computing cutting points (default: 10 meters)
+        random_cuts: The number of random cuts to add at each iteration (default: 0)
+        distance_threshold: The distance threshold above which no match is made (default: 10000 meters)
+    """
+
+    def __init__(
+        self,
+        road_map: MapInterface,
+        distance_epsilon: float = 50.0,
+        similarity_cutoff: float = 0.9,
+        cutting_threshold: float = 10.0,
+        random_cuts: int = 0,
+        distance_threshold: float = 10000,
+    ):
+        self.road_map = road_map
+        self.distance_epsilon = distance_epsilon
+        self.similarity_cutoff = similarity_cutoff
+        self.cutting_threshold = cutting_threshold
+        self.random_cuts = random_cuts
+        self.distance_threshold = distance_threshold
+
+

+[docs]
+    def match_trace(self, trace: Trace) -> MatchResult:
+        def _join_segment(a: TrajectorySegment, b: TrajectorySegment):
+            new_traces = a.trace + b.trace
+            new_path = a.path + b.path
+
+            # test to see if there is a gap between the paths and if so,
+            # try to connect it
+            if len(a.path) > 1 and len(b.path) > 1:
+                end_road = a.path[-1]
+                start_road = b.path[0]
+                if end_road.road_id.end != start_road.road_id.start:
+                    o = Coordinate(
+                        coordinate_id=None,
+                        geom=Point(end_road.geom.coords[-1]),
+                        crs=new_traces.crs,
+                    )
+                    d = Coordinate(
+                        coordinate_id=None,
+                        geom=Point(start_road.geom.coords[0]),
+                        crs=new_traces.crs,
+                    )
+                    path = self.road_map.shortest_path(o, d)
+                    new_path = a.path + path + b.path
+
+            return TrajectorySegment(new_traces, new_path)
+
+        stationary_index = find_stationary_points(trace)
+
+        sub_trace = drop_stationary_points(trace, stationary_index)
+
+        road_map = self.road_map
+        de = self.distance_epsilon
+        ct = self.cutting_threshold
+        rc = self.random_cuts
+        dt = self.distance_threshold
+        initial_segment = (
+            TrajectorySegment(trace=sub_trace, path=new_path(road_map, sub_trace))
+            .score_and_match(de, dt)
+            .compute_cutting_points(de, ct, rc)
+        )
+
+        initial_scheme = split_trajectory_segment(road_map, initial_segment)
+        scheme = initial_scheme
+
+        n = 0
+        while n < 10:
+            next_scheme = []
+            for segment in scheme:
+                scored_segment = segment.score_and_match(de, dt).compute_cutting_points(
+                    de, ct, rc
+                )
+                if scored_segment.score >= self.similarity_cutoff:
+                    next_scheme.append(scored_segment)
+                else:
+                    # split and check the score
+                    new_split = split_trajectory_segment(road_map, scored_segment)
+                    joined_segment = ft.reduce(
+                        _join_segment, new_split
+                    ).score_and_match(de, dt)
+                    if joined_segment.score > scored_segment.score:
+                        # we found a better fit
+                        next_scheme.extend(new_split)
+                    else:
+                        next_scheme.append(scored_segment)
+            n += 1
+            if same_trajectory_scheme(scheme, next_scheme):
+                break
+
+            scheme = next_scheme
+
+        joined_segment = ft.reduce(_join_segment, scheme).score_and_match(de, dt)
+
+        matches = joined_segment.matches
+
+        matches_w_stationary_points = add_matches_for_stationary_points(
+            matches, stationary_index
+        )
+
+        return MatchResult(matches_w_stationary_points, joined_segment.path)

+
+
+

+[docs]
+    def match_trace_batch(
+        self,
+        trace_batch: List[Trace],
+        processes: int = 1,
+    ) -> List[MatchResult]:
+        if processes <= 1:
+            results = [self.match_trace(t) for t in trace_batch]
+        else:
+            raise NotImplementedError(
+                "Using `processes>1` is not available due to a known issue with rtree serialization."
+                "See https://github.com/Toblerity/rtree/issues/87 for more information."
+            )
+            # with Pool(processes=processes) as p:
+            #     results = p.map(self.match_trace, trace_batch)
+
+        return results

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/lcss/ops.html b/_modules/mappymatch/matchers/lcss/ops.html new file mode 100644 index 0000000..368a522 --- /dev/null +++ b/_modules/mappymatch/matchers/lcss/ops.html @@ -0,0 +1,699 @@ + + + + + + + + + + mappymatch.matchers.lcss.ops — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.lcss.ops

+import logging
+from copy import deepcopy
+from typing import Any, List, NamedTuple
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.road import Road
+from mappymatch.constructs.trace import Trace
+from mappymatch.maps.map_interface import MapInterface
+from mappymatch.matchers.lcss.constructs import (
+    TrajectoryScheme,
+    TrajectorySegment,
+)
+from mappymatch.matchers.lcss.utils import merge
+
+log = logging.getLogger(__name__)
+
+
+

+[docs]
+def new_path(
+    road_map: MapInterface,
+    trace: Trace,
+) -> List[Road]:
+    """
+    Computes a shortest path and returns the path
+
+    Args:
+        road_map: the road map to match to
+        trace: the trace to match
+
+    Returns:
+        the path that most closely matches the trace
+    """
+    if len(trace.coords) < 1:
+        return []
+
+    origin = trace.coords[0]
+    destination = trace.coords[-1]
+
+    new_path = road_map.shortest_path(origin, destination)
+
+    return new_path

+
+
+
+

+[docs]
+def split_trajectory_segment(
+    road_map: MapInterface,
+    trajectory_segment: TrajectorySegment,
+) -> List[TrajectorySegment]:
+    """
+    Splits a trajectory segment based on the provided cutting points.
+
+    Merge back any segments that are too short
+
+    Args:
+        road_map: the road map to match to
+        trajectory_segment: the trajectory segment to split
+        distance_epsilon: the distance epsilon
+
+    Returns:
+        a list of split segments or the original segment if it can't be split
+    """
+    trace = trajectory_segment.trace
+    cutting_points = trajectory_segment.cutting_points
+
+    def _short_segment(ts: TrajectorySegment):
+        if len(ts.trace) < 2 or len(ts.path) < 1:
+            return True
+        return False
+
+    if len(trace.coords) < 2:
+        # segment is too short to split
+        return [trajectory_segment]
+    elif len(cutting_points) < 1:
+        # no points to cut
+        return [trajectory_segment]
+
+    new_paths = []
+    new_traces = []
+
+    # using type: ignore below because, trace_index can only be a signedinteger or integer
+    # mypy wants it to only be an int, but this should never affect code functionality
+    # start
+    scp = cutting_points[0]
+    new_trace = trace[: scp.trace_index]  # type: ignore
+    new_paths.append(new_path(road_map, new_trace))
+    new_traces.append(new_trace)
+
+    # mids
+    for i in range(len(cutting_points) - 1):
+        cp = cutting_points[i]
+        ncp = cutting_points[i + 1]
+        new_trace = trace[cp.trace_index : ncp.trace_index]  # type: ignore
+        new_paths.append(new_path(road_map, new_trace))
+        new_traces.append(new_trace)
+
+    # end
+    ecp = cutting_points[-1]
+    new_trace = trace[ecp.trace_index :]  # type: ignore
+    new_paths.append(new_path(road_map, new_trace))
+    new_traces.append(new_trace)
+
+    if not any(new_paths):
+        # can't split
+        return [trajectory_segment]
+    elif not any(new_traces):
+        # can't split
+        return [trajectory_segment]
+    else:
+        segments = [TrajectorySegment(t, p) for t, p in zip(new_traces, new_paths)]
+
+    merged_segments = merge(segments, _short_segment)
+
+    return merged_segments

+
+
+
+

+[docs]
+def same_trajectory_scheme(
+    scheme1: TrajectoryScheme, scheme2: TrajectoryScheme
+) -> bool:
+    """
+    Compares two trajectory schemes for equality
+
+    Args:
+        scheme1: the first trajectory scheme
+        scheme2: the second trajectory scheme
+
+    Returns:
+        True if the two schemes are equal, False otherwise
+    """
+    same_paths = all(map(lambda a, b: a.path == b.path, scheme1, scheme2))
+    same_traces = all(
+        map(lambda a, b: a.trace.coords == b.trace.coords, scheme1, scheme2)
+    )
+
+    return same_paths and same_traces

+
+
+
+

+[docs]
+class StationaryIndex(NamedTuple):
+    """
+    An index of a stationary point in a trajectory
+
+    Attributes:
+        trace_index: the index of the trace
+        coord_index: the index of the coordinate
+    """
+
+    i_index: List[int]  # i based index on the trace
+    c_index: List[Any]  # coordinate ids

+
+
+
+

+[docs]
+def find_stationary_points(trace: Trace) -> List[StationaryIndex]:
+    """
+    Find the positional index of all stationary points in a trace
+
+    Args:
+        trace: the trace to find the stationary points in
+
+    Returns:
+        a list of stationary indices
+    """
+    f = trace._frame
+    coords = trace.coords
+    dist = f.distance(f.shift())
+    index_collections = []
+    index = set()
+    for i in range(1, len(dist)):
+        d = dist.iloc[i]  # distance to previous point
+        if d < 0.001:
+            index.add(i - 1)
+            index.add(i)
+        else:
+            # there is distance between this point and the previous
+            if index:
+                l_index = sorted(list(index))
+                cids = [coords[li].coordinate_id for li in l_index]
+                si = StationaryIndex(l_index, cids)
+                index_collections.append(si)
+                index = set()
+
+    # catch any group of points at the end
+    if index:
+        l_index = sorted(list(index))
+        cids = [coords[li].coordinate_id for li in l_index]
+        si = StationaryIndex(l_index, cids)
+        index_collections.append(si)
+
+    return index_collections

+
+
+
+

+[docs]
+def drop_stationary_points(
+    trace: Trace, stationary_index: List[StationaryIndex]
+) -> Trace:
+    """
+    Drops stationary points from the trace, keeping the first point
+
+    Args:
+        trace: the trace to drop the stationary points from
+        stationary_index: the stationary indices to drop
+
+    Returns:
+        the trace with the stationary points dropped
+    """
+    for si in stationary_index:
+        trace = trace.drop(si.c_index[1:])
+
+    return trace

+
+
+
+

+[docs]
+def add_matches_for_stationary_points(
+    matches: List[Match],
+    stationary_index: List[StationaryIndex],
+) -> List[Match]:
+    """
+    Takes a set of matches and adds duplicate match entries for stationary
+
+    Args:
+        matches: the matches to add the stationary points to
+        stationary_index: the stationary indices to add
+
+    Returns:
+        the matches with the stationary points added
+    """
+    matches = deepcopy(matches)
+
+    for si in stationary_index:
+        mi = si.i_index[0]
+        m = matches[mi]
+        new_matches = [
+            m.set_coordinate(
+                Coordinate(ci, geom=m.coordinate.geom, crs=m.coordinate.crs)
+            )
+            for ci in si.c_index[1:]
+        ]
+        matches[si.i_index[1] : si.i_index[1]] = new_matches
+
+    return matches

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/lcss/utils.html b/_modules/mappymatch/matchers/lcss/utils.html new file mode 100644 index 0000000..b2de4d1 --- /dev/null +++ b/_modules/mappymatch/matchers/lcss/utils.html @@ -0,0 +1,586 @@ + + + + + + + + + + mappymatch.matchers.lcss.utils — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.lcss.utils

+import functools as ft
+from itertools import groupby
+from operator import itemgetter
+from typing import Any, Callable, Generator, List
+
+
+

+[docs]
+def forward_merge(merge_list: List, condition: Callable[[Any], bool]) -> List:
+    """
+    Helper function to merge items in a list by adding them to the next eligible element.
+    This merge moves left to right.
+
+    For example, given the list:
+
+    [1, 2, 3, 4, 5]
+
+    And the condition, x < 3, the function yields:
+
+    >>> forward_merge([1,2,3,4,5], lambda x: x < 3)
+    >>> [6, 4, 5]
+
+    Args:
+        merge_list: the list to merge
+        condition: the merge condition
+
+    Returns:
+        a list of the merged items
+    """
+    items = []
+
+    def _flatten(ml):
+        return ft.reduce(lambda acc, x: acc + x, ml)
+
+    merge_items = []
+    for i, item in enumerate(merge_list):
+        if condition(item):
+            merge_items.append(item)
+        elif merge_items:
+            # we found a large item and have short items to merge
+            merge_items.append(item)
+            items.append(_flatten(merge_items))
+            merge_items = []
+        else:
+            items.append(item)
+
+    if merge_items:
+        # we got to the end but still have merge items;
+        items.append(_flatten(merge_items))
+
+    return items

+
+
+
+

+[docs]
+def reverse_merge(merge_list: List, condition: Callable[[Any], bool]) -> List:
+    """
+    Helper function to merge items in a list by adding them to the next eligible element.
+    This merge moves right to left.
+
+    For example, given the list:
+
+    [1, 2, 3, 4, 5]
+
+    And the condition, x < 3, the function yields:
+
+    >>> list(reverse_merge([1,2,3,4,5], lambda x: x < 3))
+    >>> [3, 3, 4, 5]
+
+    Args:
+        merge_list: the list to merge
+        condition: the merge condition
+
+    Returns:
+        a list of the merged items
+    """
+    items = []
+
+    def _flatten(ml):
+        return ft.reduce(lambda acc, x: x + acc, ml)
+
+    merge_items = []
+    for i in reversed(range(len(merge_list))):
+        item = merge_list[i]
+        if condition(item):
+            merge_items.append(item)
+        elif merge_items:
+            # we found a large item and have short items to merge
+            merge_items.append(item)
+            items.append(_flatten(merge_items))
+            merge_items = []
+        else:
+            items.append(item)
+
+    if merge_items:
+        # we got to the end but still have merge items;
+        items.append(_flatten(merge_items))
+
+    return list(reversed(items))

+
+
+
+

+[docs]
+def merge(merge_list: List, condition: Callable[[Any], bool]) -> List:
+    """
+    Combines the forward and reverse merges to catch edge cases at the tail ends of the list
+
+    Args:
+        merge_list: the list to merge
+        condition: the merge condition
+
+    Returns:
+        a list of the merged items
+    """
+    f_merge = forward_merge(merge_list, condition)
+
+    if any(map(condition, f_merge)):
+        return reverse_merge(f_merge, condition)
+    else:
+        return f_merge

+
+
+
+

+[docs]
+def compress(cutting_points: List) -> Generator:
+    """
+    Compress a list of cutting points if they happen to be directly adjacent to another
+
+    Args:
+        cutting_points: the list of cutting points
+
+    Returns:
+        a generator of compressed cutting points
+    """
+    sorted_cuts = sorted(cutting_points, key=lambda c: c.trace_index)
+    for k, g in groupby(enumerate(sorted_cuts), lambda x: x[0] - x[1].trace_index):
+        all_cps = list(map(itemgetter(1), g))
+        yield all_cps[int(len(all_cps) / 2)]

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/line_snap.html b/_modules/mappymatch/matchers/line_snap.html new file mode 100644 index 0000000..004863e --- /dev/null +++ b/_modules/mappymatch/matchers/line_snap.html @@ -0,0 +1,491 @@ + + + + + + + + + + mappymatch.matchers.line_snap — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.line_snap

+import logging
+from typing import List
+
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.trace import Trace
+from mappymatch.maps.map_interface import MapInterface
+from mappymatch.matchers.matcher_interface import MatcherInterface, MatchResult
+
+log = logging.getLogger(__name__)
+
+
+

+[docs]
+class LineSnapMatcher(MatcherInterface):
+    """
+    A crude (but fast) map matcher that just snaps points to the nearest road network link.
+
+    Attributes:
+        map: The map to match against
+    """
+
+    def __init__(self, road_map: MapInterface):
+        self.map = road_map
+
+

+[docs]
+    def match_trace(self, trace: Trace) -> MatchResult:
+        matches = []
+
+        for coord in trace.coords:
+            nearest_road = self.map.nearest_road(coord)
+            nearest_point = nearest_road.geom.interpolate(
+                nearest_road.geom.project(coord.geom)
+            )
+            dist = nearest_road.geom.distance(nearest_point)
+            match = Match(nearest_road, coord, dist)
+            matches.append(match)
+
+        return MatchResult(matches)

+
+
+

+[docs]
+    def match_trace_batch(self, trace_batch: List[Trace]) -> List[MatchResult]:
+        return [self.match_trace(t) for t in trace_batch]

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/match_result.html b/_modules/mappymatch/matchers/match_result.html new file mode 100644 index 0000000..7757a7a --- /dev/null +++ b/_modules/mappymatch/matchers/match_result.html @@ -0,0 +1,544 @@ + + + + + + + + + + mappymatch.matchers.match_result — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.match_result

+from dataclasses import dataclass
+from typing import List, Optional
+
+import geopandas as gpd
+import numpy as np
+import pandas as pd
+
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.road import Road
+
+
+

+[docs]
+@dataclass
+class MatchResult:
+    matches: List[Match]
+    path: Optional[List[Road]] = None
+
+    @property
+    def crs(self):
+        first_crs = self.matches[0].coordinate.crs
+        if not all([first_crs.equals(m.coordinate.crs) for m in self.matches]):
+            raise ValueError(
+                "Found that there were different CRS within the matches. "
+                "These must all be equal to use this function"
+            )
+        return first_crs
+
+

+[docs]
+    def matches_to_geodataframe(self) -> gpd.GeoDataFrame:
+        """
+        Returns a geodataframe with all the coordinates and their resulting match (or NA if no match) in each row
+        """
+        df = self.matches_to_dataframe()
+        gdf = gpd.GeoDataFrame(df, geometry="geom")
+
+        if len(self.matches) == 0:
+            return gdf
+
+        gdf = gdf.set_crs(self.crs)
+
+        return gdf

+
+
+

+[docs]
+    def matches_to_dataframe(self) -> pd.DataFrame:
+        """
+        Returns a dataframe with all the coordinates and their resulting match (or NA if no match) in each row.
+
+        Returns:
+            A pandas dataframe
+        """
+        df = pd.DataFrame([m.to_flat_dict() for m in self.matches])
+        df = df.fillna(np.nan)
+
+        return df

+
+
+

+[docs]
+    def path_to_dataframe(self) -> pd.DataFrame:
+        """
+        Returns a dataframe with the resulting estimated trace path through the road network.
+        The dataframe is empty if there was no path.
+
+        Returns:
+            A pandas dataframe
+        """
+        if self.path is None:
+            return pd.DataFrame()
+
+        df = pd.DataFrame([r.to_flat_dict() for r in self.path])
+        df = df.fillna(np.nan)
+
+        return df

+
+
+

+[docs]
+    def path_to_geodataframe(self) -> gpd.GeoDataFrame:
+        """
+        Returns a geodataframe with the resulting estimated trace path through the road network.
+        The geodataframe is empty if there was no path.
+
+        Returns:
+            A geopandas geodataframe
+        """
+        if self.path is None:
+            return gpd.GeoDataFrame()
+
+        df = self.path_to_dataframe()
+        gdf = gpd.GeoDataFrame(df, geometry="geom")
+
+        gdf = gdf.set_crs(self.crs)
+
+        return gdf

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/matcher_interface.html b/_modules/mappymatch/matchers/matcher_interface.html new file mode 100644 index 0000000..422a452 --- /dev/null +++ b/_modules/mappymatch/matchers/matcher_interface.html @@ -0,0 +1,488 @@ + + + + + + + + + + mappymatch.matchers.matcher_interface — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.matcher_interface

+from abc import ABCMeta, abstractmethod
+from typing import List
+
+from mappymatch.constructs.trace import Trace
+from mappymatch.matchers.match_result import MatchResult
+
+
+

+[docs]
+class MatcherInterface(metaclass=ABCMeta):
+    """
+    Abstract base class for a Matcher
+    """
+
+

+[docs]
+    @abstractmethod
+    def match_trace(self, trace: Trace) -> MatchResult:
+        """
+        Take in a trace of gps points and return a list of matching link ids
+
+        Args:
+            trace: The trace to match
+
+        Returns:
+            A list of Match objects
+        """

+
+
+

+[docs]
+    @abstractmethod
+    def match_trace_batch(self, trace_batch: List[Trace]) -> List[MatchResult]:
+        """
+        Take in a batch of traces and return a batch of matching link ids
+
+        Args:
+            trace_batch: The batch of traces to match
+
+        Returns:
+            A batch of Match objects
+        """

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/osrm.html b/_modules/mappymatch/matchers/osrm.html new file mode 100644 index 0000000..92044fa --- /dev/null +++ b/_modules/mappymatch/matchers/osrm.html @@ -0,0 +1,558 @@ + + + + + + + + + + mappymatch.matchers.osrm — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.osrm

+from __future__ import annotations
+
+import logging
+
+import requests
+
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.road import Road, RoadId
+from mappymatch.constructs.trace import Trace
+from mappymatch.matchers.matcher_interface import MatcherInterface, MatchResult
+from mappymatch.utils.crs import LATLON_CRS
+from mappymatch.utils.url import multiurljoin
+
+log = logging.getLogger(__name__)
+
+DEFAULT_OSRM_ADDRESS = "http://router.project-osrm.org"
+
+
+

+[docs]
+def parse_osrm_json(j: dict, trace: Trace) -> list[Match]:
+    """
+    parse the json response from the osrm match service
+
+    :param j: the json object
+
+    :return: a list of matches
+    """
+    matchings = j.get("matchings")
+    if not matchings:
+        raise ValueError("could not find any link matchings in response")
+
+    legs = matchings[0].get("legs")
+    if not legs:
+        raise ValueError("could not find any link legs in response")
+
+    def _parse_leg(d: dict, i: int) -> Match:
+        annotation = d.get("annotation")
+        if not annotation:
+            raise ValueError("leg has no annotation information")
+        nodes = annotation.get("nodes")
+        if not nodes:
+            raise ValueError("leg has no osm node information")
+        origin_junction_id = f"{nodes[0]}"
+        destination_junction_id = f"{nodes[0]}"
+
+        # TODO: we need to get geometry, distance info from OSRM if available
+        road_id = RoadId(origin_junction_id, destination_junction_id, 0)
+        road = Road(
+            road_id=road_id,
+            geom=None,
+        )
+        match = Match(road=road, coordinate=trace.coords[i], distance=float("infinity"))
+        return match
+
+    return [_parse_leg(d, i) for i, d in enumerate(legs)]

+
+
+
+

+[docs]
+class OsrmMatcher(MatcherInterface):
+    """
+    pings an OSRM server for map matching
+    """
+
+    def __init__(
+        self,
+        osrm_address=DEFAULT_OSRM_ADDRESS,
+        osrm_profile="driving",
+        osrm_version="v1",
+    ):
+        self.osrm_api_base = multiurljoin(
+            [osrm_address, "match", osrm_version, osrm_profile]
+        )
+
+

+[docs]
+    def match_trace(self, trace: Trace) -> MatchResult:
+        if not trace.crs == LATLON_CRS:
+            raise TypeError(
+                f"this matcher requires traces to be in the CRS of EPSG:{LATLON_CRS.to_epsg()} "
+                f"but found EPSG:{trace.crs.to_epsg()}"
+            )
+
+        if len(trace.coords) > 100:
+            trace = trace.downsample(100)
+
+        coordinate_str = ""
+        for coord in trace.coords:
+            coordinate_str += f"{coord.x},{coord.y};"
+
+        # remove the trailing semicolon
+        coordinate_str = coordinate_str[:-1]
+
+        osrm_request = self.osrm_api_base + coordinate_str + "?annotations=true"
+        print(osrm_request)
+
+        r = requests.get(osrm_request)
+
+        if not r.status_code == requests.codes.ok:
+            r.raise_for_status()
+
+        result = parse_osrm_json(r.json(), trace)
+
+        return MatchResult(result)

+
+
+

+[docs]
+    def match_trace_batch(self, trace_batch: list[Trace]) -> list[MatchResult]:
+        return [self.match_trace(t) for t in trace_batch]

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/matchers/valhalla.html b/_modules/mappymatch/matchers/valhalla.html new file mode 100644 index 0000000..8511f10 --- /dev/null +++ b/_modules/mappymatch/matchers/valhalla.html @@ -0,0 +1,615 @@ + + + + + + + + + + mappymatch.matchers.valhalla — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.matchers.valhalla

+from __future__ import annotations
+
+import json
+import logging
+from typing import List, Tuple
+
+import numpy as np
+import polyline
+import requests
+from shapely.geometry import LineString
+
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.road import Road, RoadId
+from mappymatch.constructs.trace import Trace
+from mappymatch.matchers.matcher_interface import MatcherInterface, MatchResult
+from mappymatch.utils.crs import LATLON_CRS
+
+log = logging.getLogger(__name__)
+
+DEMO_VALHALLA_ADDRESS = "https://valhalla1.openstreetmap.de/trace_attributes"
+REQUIRED_ATTRIBUTES = set(
+    [
+        "edge.way_id",
+        "matched.distance_from_trace_point",
+        "shape",
+        "edge.begin_shape_index",
+        "edge.end_shape_index",
+        "matched.edge_index",
+    ]
+)
+DEFAULT_ATTRIBUTES = set(
+    [
+        "edge.length",
+        "edge.speed",
+    ]
+)
+
+
+

+[docs]
+def build_path_from_result(
+    edges: List[dict], shape: List[Tuple[float, float]]
+) -> List[Road]:
+    """
+    builds a mappymatch path from the result of a Valhalla map matching request
+    """
+    path = []
+    for edge in edges:
+        way_id = edge["way_id"]
+        road_id = RoadId(start=None, end=None, key=way_id)
+        start_point_i = edge["begin_shape_index"]
+        end_point_i = edge["end_shape_index"]
+        start_point = shape[start_point_i]
+        end_point = shape[end_point_i]
+        geom = LineString([start_point, end_point])
+
+        speed = edge["speed"]
+        length = edge["length"]
+
+        metadata = {
+            "speed_mph": speed,
+            "length_miles": length,
+        }
+
+        road = Road(road_id=road_id, geom=geom, metadata=metadata)
+
+        path.append(road)
+
+    return path

+
+
+
+

+[docs]
+def build_match_result(
+    trace: Trace, matched_points: List[dict], path: List[Road]
+) -> MatchResult:
+    """
+    builds a mappymatch MatchResult from the result of a Valhalla map matching request
+    """
+    matches = []
+    for i, coord in enumerate(trace.coords):
+        mp = matched_points[i]
+        ei = mp.get("edge_index")
+        dist = mp.get("distance_from_trace_point")
+        if ei is None:
+            road = None
+        else:
+            try:
+                road = path[ei]
+            except IndexError:
+                road = None
+
+        if dist is None:
+            dist = np.inf
+
+        match = Match(road, coord, dist)
+
+        matches.append(match)
+
+    return MatchResult(matches=matches, path=path)

+
+
+
+

+[docs]
+class ValhallaMatcher(MatcherInterface):
+    """
+    pings a Valhalla server for map matching
+    """
+
+    def __init__(
+        self,
+        valhalla_url=DEMO_VALHALLA_ADDRESS,
+        cost_model="auto",
+        shape_match="map_snap",
+        attributes=DEFAULT_ATTRIBUTES,
+    ):
+        self.url_base = valhalla_url
+        self.cost_model = cost_model
+        self.shape_match = shape_match
+
+        all_attributes = list(REQUIRED_ATTRIBUTES.union(set(attributes)))
+        self.attributes = all_attributes
+
+

+[docs]
+    def match_trace(self, trace: Trace) -> MatchResult:
+        if not trace.crs == LATLON_CRS:
+            trace = trace.to_crs(LATLON_CRS)
+
+        points = [{"lat": c.y, "lon": c.x} for c in trace.coords]
+
+        json_payload = json.dumps(
+            {
+                "shape": points,
+                "costing": self.cost_model,
+                "shape_match": self.shape_match,
+                "filters": {
+                    "attributes": self.attributes,
+                    "action": "include",
+                },
+                "units": "miles",
+            }
+        )
+
+        valhalla_request = f"{self.url_base}?json={json_payload}"
+
+        r = requests.get(valhalla_request)
+
+        if not r.status_code == requests.codes.ok:
+            r.raise_for_status()
+
+        j = r.json()
+
+        edges = j["edges"]
+        shape = polyline.decode(j["shape"], precision=6, geojson=True)
+        matched_points = j["matched_points"]
+
+        path = build_path_from_result(edges, shape)
+        result = build_match_result(trace, matched_points, path)
+
+        return result

+
+
+

+[docs]
+    def match_trace_batch(self, trace_batch: list[Trace]) -> list[MatchResult]:
+        return [self.match_trace(t) for t in trace_batch]

+

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/utils/exceptions.html b/_modules/mappymatch/utils/exceptions.html new file mode 100644 index 0000000..b380124 --- /dev/null +++ b/_modules/mappymatch/utils/exceptions.html @@ -0,0 +1,453 @@ + + + + + + + + + + mappymatch.utils.exceptions — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.utils.exceptions

+

+[docs]
+class MapException(Exception):
+    """
+    An exception for any errors that occur with the MapInterface
+    """
+
+    pass

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/utils/geo.html b/_modules/mappymatch/utils/geo.html new file mode 100644 index 0000000..e954d11 --- /dev/null +++ b/_modules/mappymatch/utils/geo.html @@ -0,0 +1,509 @@ + + + + + + + + + + mappymatch.utils.geo — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.utils.geo

+from typing import Tuple
+
+from pyproj import Transformer
+
+from mappymatch.constructs.coordinate import Coordinate
+from mappymatch.utils.crs import LATLON_CRS, XY_CRS
+
+
+

+[docs]
+def xy_to_latlon(x: float, y: float) -> Tuple[float, float]:
+    """
+    Tramsform x,y coordinates to lat and lon
+
+    Args:
+        x: X.
+        y: Y.
+
+    Returns:
+        Transformed lat and lon as lat, lon.
+    """
+    transformer = Transformer.from_crs(XY_CRS, LATLON_CRS)
+    lat, lon = transformer.transform(x, y)
+
+    return lat, lon

+
+
+
+

+[docs]
+def latlon_to_xy(lat: float, lon: float) -> Tuple[float, float]:
+    """
+    Tramsform lat,lon coordinates to x and y.
+
+    Args:
+        lat: The latitude.
+        lon: The longitude.
+
+    Returns:
+        Transformed x and y as x, y.
+    """
+    transformer = Transformer.from_crs(LATLON_CRS, XY_CRS)
+    x, y = transformer.transform(lat, lon)
+
+    return x, y

+
+
+
+

+[docs]
+def coord_to_coord_dist(a: Coordinate, b: Coordinate) -> float:
+    """
+    Compute the distance between two coordinates.
+
+    Args:
+        a: The first coordinate
+        b: The second coordinate
+
+    Returns:
+        The distance in meters
+    """
+    dist = a.geom.distance(b.geom)
+
+    return dist

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/utils/plot.html b/_modules/mappymatch/utils/plot.html new file mode 100644 index 0000000..0e89f9a --- /dev/null +++ b/_modules/mappymatch/utils/plot.html @@ -0,0 +1,706 @@ + + + + + + + + + + mappymatch.utils.plot — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.utils.plot

+from typing import List, Optional, Union
+
+import folium
+import geopandas as gpd
+import matplotlib.pyplot as plt
+import pandas as pd
+from pyproj import CRS
+from shapely.geometry import Point
+
+from mappymatch.constructs.geofence import Geofence
+from mappymatch.constructs.match import Match
+from mappymatch.constructs.road import Road
+from mappymatch.constructs.trace import Trace
+from mappymatch.maps.nx.nx_map import NxMap
+from mappymatch.matchers.matcher_interface import MatchResult
+from mappymatch.utils.crs import LATLON_CRS, XY_CRS
+
+
+

+[docs]
+def plot_geofence(geofence: Geofence, m: Optional[folium.Map] = None):
+    """
+    Plot geofence.
+
+    Args:
+        geofence: The geofence to plot
+        m: the folium map to plot on
+
+    Returns:
+        The updated folium map with the geofence.
+    """
+    if not geofence.crs == LATLON_CRS:
+        raise NotImplementedError("can currently only plot a geofence with lat lon crs")
+
+    if not m:
+        c = geofence.geometry.centroid.coords[0]
+        m = folium.Map(location=[c[1], c[0]], zoom_start=11)
+
+    folium.GeoJson(geofence.geometry).add_to(m)
+
+    return m

+
+
+
+

+[docs]
+def plot_trace(
+    trace: Trace,
+    m: Optional[folium.Map] = None,
+    point_color: str = "black",
+    line_color: Optional[str] = "green",
+):
+    """
+    Plot a trace.
+
+    Args:
+        trace: The trace.
+        m: the folium map to plot on
+        point_color: The color the points will be plotted in.
+        line_color: The color for lines. If None, no lines will be plotted.
+
+    Returns:
+        An updated folium map with a plot of trace.
+    """
+
+    if not trace.crs == LATLON_CRS:
+        trace = trace.to_crs(LATLON_CRS)
+
+    if not m:
+        mid_coord = trace.coords[int(len(trace) / 2)]
+        m = folium.Map(location=[mid_coord.y, mid_coord.x], zoom_start=11)
+
+    for i, c in enumerate(trace.coords):
+        folium.Circle(
+            location=(c.y, c.x),
+            radius=5,
+            color=point_color,
+            tooltip=i,
+            fill=True,
+            fill_opacity=0.8,
+            fill_color=point_color,
+        ).add_to(m)
+
+    if line_color is not None:
+        folium.PolyLine([(p.y, p.x) for p in trace.coords], color=line_color).add_to(m)
+
+    return m

+
+
+
+

+[docs]
+def plot_matches(matches: Union[MatchResult, List[Match]], crs=XY_CRS):
+    """
+    Plots a trace and the relevant matches on a folium map.
+
+    Args:
+    matches: A list of matches or a MatchResult.
+    crs: what crs to plot in. Defaults to XY_CRS.
+
+    Returns:
+        A folium map with trace and matches plotted.
+    """
+    if isinstance(matches, MatchResult):
+        matches = matches.matches
+
+    def _match_to_road(m):
+        """Private function."""
+        d = {"road_id": m.road.road_id, "geom": m.road.geom}
+        return d
+
+    def _match_to_coord(m):
+        """Private function."""
+        d = {
+            "road_id": m.road.road_id,
+            "geom": Point(m.coordinate.x, m.coordinate.y),
+            "distance": m.distance,
+        }
+
+        return d
+
+    road_df = pd.DataFrame([_match_to_road(m) for m in matches if m.road])
+    road_df = road_df.loc[road_df.road_id.shift() != road_df.road_id]
+    road_gdf = gpd.GeoDataFrame(road_df, geometry=road_df.geom, crs=crs).drop(
+        columns=["geom"]
+    )
+    road_gdf = road_gdf.to_crs(LATLON_CRS)
+
+    coord_df = pd.DataFrame([_match_to_coord(m) for m in matches if m.road])
+
+    coord_gdf = gpd.GeoDataFrame(coord_df, geometry=coord_df.geom, crs=crs).drop(
+        columns=["geom"]
+    )
+    coord_gdf = coord_gdf.to_crs(LATLON_CRS)
+
+    mid_i = int(len(coord_gdf) / 2)
+    mid_coord = coord_gdf.iloc[mid_i].geometry
+
+    fmap = folium.Map(location=[mid_coord.y, mid_coord.x], zoom_start=11)
+
+    for coord in coord_gdf.itertuples():
+        folium.Circle(
+            location=(coord.geometry.y, coord.geometry.x),
+            radius=5,
+            tooltip=f"road_id: {coord.road_id}\ndistance: {coord.distance}",
+        ).add_to(fmap)
+
+    for road in road_gdf.itertuples():
+        folium.PolyLine(
+            [(lat, lon) for lon, lat in road.geometry.coords],
+            color="red",
+            tooltip=road.road_id,
+        ).add_to(fmap)
+
+    return fmap

+
+
+
+

+[docs]
+def plot_map(tmap: NxMap, m: Optional[folium.Map] = None):
+    """
+    Plot the roads on an NxMap.
+
+    Args:
+        tmap: The Nxmap to plot.
+        m: the folium map to add to
+
+    Returns:
+        The folium map with the roads plotted.
+    """
+
+    # TODO make this generic to all map types, not just NxMap
+    roads = list(tmap.g.edges(data=True))
+    road_df = pd.DataFrame([r[2] for r in roads])
+    gdf = gpd.GeoDataFrame(road_df, geometry=road_df[tmap._geom_key], crs=tmap.crs)
+    if gdf.crs != LATLON_CRS:
+        gdf = gdf.to_crs(LATLON_CRS)
+
+    if not m:
+        c = gdf.iloc[int(len(gdf) / 2)].geometry.centroid.coords[0]
+        m = folium.Map(location=[c[1], c[0]], zoom_start=11)
+
+    for t in gdf.itertuples():
+        folium.PolyLine(
+            [(lat, lon) for lon, lat in t.geometry.coords],
+            color="red",
+        ).add_to(m)
+
+    return m

+
+
+
+

+[docs]
+def plot_match_distances(matches: MatchResult):
+    """
+    Plot the points deviance from known roads with matplotlib.
+
+    Args:
+        matches (MatchResult): The coordinates of guessed points in the area in the form of a MatchResult object.
+    """
+
+    y = [
+        m.distance for m in matches.matches
+    ]  # y contains distances to the expected line for all of the matches which will be plotted on the y-axis.
+    x = [
+        i for i in range(0, len(y))
+    ]  # x contains placeholder values for every y value (distance measurement) along the x-axis.
+
+    plt.figure(figsize=(15, 7))
+    plt.autoscale(enable=True)
+    plt.scatter(x, y)
+    plt.title("Distance To Nearest Road")
+    plt.ylabel("Meters")
+    plt.xlabel("Point Along The Path")
+    plt.show()

+
+
+
+

+[docs]
+def plot_path(
+    path: List[Road],
+    crs: CRS,
+    m: Optional[folium.Map] = None,
+    line_color="red",
+    line_weight=10,
+    line_opacity=0.8,
+):
+    """
+    Plot a list of roads.
+
+    Args:
+        path: The path to plot.
+        crs: The crs of the path.
+        m: The folium map to add to.
+        line_color: The color of the line.
+        line_weight: The weight of the line.
+        line_opacity: The opacity of the line.
+    """
+    road_df = pd.DataFrame([{"geom": r.geom} for r in path])
+    road_gdf = gpd.GeoDataFrame(road_df, geometry=road_df.geom, crs=crs)
+    road_gdf = road_gdf.to_crs(LATLON_CRS)
+
+    if m is None:
+        mid_i = int(len(road_gdf) / 2)
+        mid_coord = road_gdf.iloc[mid_i].geometry.coords[0]
+
+        m = folium.Map(location=[mid_coord[1], mid_coord[0]], zoom_start=11)
+
+    for i, road in enumerate(road_gdf.itertuples()):
+        folium.PolyLine(
+            [(lat, lon) for lon, lat in road.geometry.coords],
+            color=line_color,
+            tooltip=i,
+            weight=line_weight,
+            opacity=line_opacity,
+        ).add_to(m)
+
+    return m

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/utils/process_trace.html b/_modules/mappymatch/utils/process_trace.html new file mode 100644 index 0000000..e000ff0 --- /dev/null +++ b/_modules/mappymatch/utils/process_trace.html @@ -0,0 +1,512 @@ + + + + + + + + + + mappymatch.utils.process_trace — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.utils.process_trace

+from __future__ import annotations
+
+from mappymatch.constructs.trace import Trace
+
+
+

+[docs]
+def split_large_trace(trace: Trace, ideal_size: int) -> list[Trace]:
+    """
+    Split up a trace into a list of smaller traces.
+
+    Args:
+        trace: the trace to split.
+        ideal_size: the target number of coordinates for each new trace.
+
+    Returns:
+        A list of split traces.
+    """
+    if len(trace) <= ideal_size:
+        return [trace]
+    else:
+        ts = [trace[i : i + ideal_size] for i in range(0, len(trace), ideal_size)]
+
+        # check to make sure the last trace isn't too small
+        if len(ts[-1]) <= 10:
+            last_trace = ts.pop()
+            ts[-1] = ts[-1] + last_trace
+
+        return ts

+
+
+
+

+[docs]
+def remove_bad_start_from_trace(trace: Trace, distance_threshold: float) -> Trace:
+    """
+    Remove points at the beginning of a trace if it is a gap is too big.
+
+    Too big is defined by distance threshold.
+
+    Args:
+        trace: The trace.
+        distance_threshold: The distance threshold.
+
+    Returns:
+        The new trace.
+    """
+
+    def _trim_frame(frame):
+        """Pivate no docstring required."""
+        for index in range(len(frame)):
+            rows = frame.iloc[index : index + 2]
+
+            if len(rows) < 2:
+                return frame
+
+            current_point = rows.geometry.iloc[0]
+            next_point = rows.geometry.iloc[1]
+
+            if current_point != next_point:
+                dist = current_point.distance(next_point)
+                if dist > distance_threshold:
+                    return frame.iloc[index + 1 :]
+                else:
+                    return frame
+
+    return Trace.from_geo_dataframe(_trim_frame(trace._frame))

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/mappymatch/utils/url.html b/_modules/mappymatch/utils/url.html new file mode 100644 index 0000000..a6db5ea --- /dev/null +++ b/_modules/mappymatch/utils/url.html @@ -0,0 +1,469 @@ + + + + + + + + + + mappymatch.utils.url — mappymatch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + +
+ + + Ctrl+K +
+ + +
+ +
+ + +
+
+ + +
+
+ + + + + + + + +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for mappymatch.utils.url

+from functools import reduce
+from typing import List
+from urllib.parse import urljoin
+
+
+def _parse_uri(uri: str) -> str:
+    """Internal use."""
+    return uri if uri.endswith("/") else f"{uri}/"
+
+
+

+[docs]
+def multiurljoin(urls: List[str]) -> str:
+    """
+    Make a url from uri's.
+
+    Args:
+        urls: list of uri
+
+    Returns:
+        Url as uri/uri/...
+    """
+    parsed_urls = [_parse_uri(uri) for uri in urls]
+    return reduce(urljoin, parsed_urls)

+
+
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.constructs.coordinate.rst b/_sources/_autosummary/mappymatch.constructs.coordinate.rst new file mode 100644 index 0000000..e5ffeed --- /dev/null +++ b/_sources/_autosummary/mappymatch.constructs.coordinate.rst @@ -0,0 +1,12 @@ +mappymatch.constructs.coordinate +================================ + +.. automodule:: mappymatch.constructs.coordinate + + + .. rubric:: Classes + + .. autosummary:: + + Coordinate + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.constructs.geofence.rst b/_sources/_autosummary/mappymatch.constructs.geofence.rst new file mode 100644 index 0000000..71f2a8a --- /dev/null +++ b/_sources/_autosummary/mappymatch.constructs.geofence.rst @@ -0,0 +1,12 @@ +mappymatch.constructs.geofence +============================== + +.. automodule:: mappymatch.constructs.geofence + + + .. rubric:: Classes + + .. autosummary:: + + Geofence + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.constructs.match.rst b/_sources/_autosummary/mappymatch.constructs.match.rst new file mode 100644 index 0000000..578163d --- /dev/null +++ b/_sources/_autosummary/mappymatch.constructs.match.rst @@ -0,0 +1,12 @@ +mappymatch.constructs.match +=========================== + +.. automodule:: mappymatch.constructs.match + + + .. rubric:: Classes + + .. autosummary:: + + Match + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.constructs.road.rst b/_sources/_autosummary/mappymatch.constructs.road.rst new file mode 100644 index 0000000..ffc1cf0 --- /dev/null +++ b/_sources/_autosummary/mappymatch.constructs.road.rst @@ -0,0 +1,13 @@ +mappymatch.constructs.road +========================== + +.. automodule:: mappymatch.constructs.road + + + .. rubric:: Classes + + .. autosummary:: + + Road + RoadId + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.constructs.rst b/_sources/_autosummary/mappymatch.constructs.rst new file mode 100644 index 0000000..70cb562 --- /dev/null +++ b/_sources/_autosummary/mappymatch.constructs.rst @@ -0,0 +1,17 @@ +mappymatch.constructs +===================== + +.. automodule:: mappymatch.constructs + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + coordinate + geofence + match + road + trace diff --git a/_sources/_autosummary/mappymatch.constructs.trace.rst b/_sources/_autosummary/mappymatch.constructs.trace.rst new file mode 100644 index 0000000..4aba5d7 --- /dev/null +++ b/_sources/_autosummary/mappymatch.constructs.trace.rst @@ -0,0 +1,12 @@ +mappymatch.constructs.trace +=========================== + +.. automodule:: mappymatch.constructs.trace + + + .. rubric:: Classes + + .. autosummary:: + + Trace + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.maps.igraph.igraph_map.rst b/_sources/_autosummary/mappymatch.maps.igraph.igraph_map.rst new file mode 100644 index 0000000..b3f81ec --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.igraph.igraph_map.rst @@ -0,0 +1,12 @@ +mappymatch.maps.igraph.igraph\_map +================================== + +.. automodule:: mappymatch.maps.igraph.igraph_map + + + .. rubric:: Classes + + .. autosummary:: + + IGraphMap + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.maps.igraph.rst b/_sources/_autosummary/mappymatch.maps.igraph.rst new file mode 100644 index 0000000..0eb47e0 --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.igraph.rst @@ -0,0 +1,13 @@ +mappymatch.maps.igraph +====================== + +.. automodule:: mappymatch.maps.igraph + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + igraph_map diff --git a/_sources/_autosummary/mappymatch.maps.map_interface.rst b/_sources/_autosummary/mappymatch.maps.map_interface.rst new file mode 100644 index 0000000..28b4ee1 --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.map_interface.rst @@ -0,0 +1,12 @@ +mappymatch.maps.map\_interface +============================== + +.. automodule:: mappymatch.maps.map_interface + + + .. rubric:: Classes + + .. autosummary:: + + MapInterface + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.maps.nx.nx_map.rst b/_sources/_autosummary/mappymatch.maps.nx.nx_map.rst new file mode 100644 index 0000000..1ea5049 --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.nx.nx_map.rst @@ -0,0 +1,12 @@ +mappymatch.maps.nx.nx\_map +========================== + +.. automodule:: mappymatch.maps.nx.nx_map + + + .. rubric:: Classes + + .. autosummary:: + + NxMap + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.maps.nx.readers.osm_readers.rst b/_sources/_autosummary/mappymatch.maps.nx.readers.osm_readers.rst new file mode 100644 index 0000000..bdbf13b --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.nx.readers.osm_readers.rst @@ -0,0 +1,20 @@ +mappymatch.maps.nx.readers.osm\_readers +======================================= + +.. automodule:: mappymatch.maps.nx.readers.osm_readers + + + .. rubric:: Functions + + .. autosummary:: + + compress + nx_graph_from_osmnx + parse_osmnx_graph + + .. rubric:: Classes + + .. autosummary:: + + NetworkType + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.maps.nx.readers.rst b/_sources/_autosummary/mappymatch.maps.nx.readers.rst new file mode 100644 index 0000000..e40e0bb --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.nx.readers.rst @@ -0,0 +1,13 @@ +mappymatch.maps.nx.readers +========================== + +.. automodule:: mappymatch.maps.nx.readers + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + osm_readers diff --git a/_sources/_autosummary/mappymatch.maps.nx.rst b/_sources/_autosummary/mappymatch.maps.nx.rst new file mode 100644 index 0000000..d5f45ee --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.nx.rst @@ -0,0 +1,14 @@ +mappymatch.maps.nx +================== + +.. automodule:: mappymatch.maps.nx + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + nx_map + readers diff --git a/_sources/_autosummary/mappymatch.maps.rst b/_sources/_autosummary/mappymatch.maps.rst new file mode 100644 index 0000000..f9a0dd5 --- /dev/null +++ b/_sources/_autosummary/mappymatch.maps.rst @@ -0,0 +1,15 @@ +mappymatch.maps +=============== + +.. automodule:: mappymatch.maps + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + igraph + map_interface + nx diff --git a/_sources/_autosummary/mappymatch.matchers.lcss.constructs.rst b/_sources/_autosummary/mappymatch.matchers.lcss.constructs.rst new file mode 100644 index 0000000..4d9268f --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.lcss.constructs.rst @@ -0,0 +1,13 @@ +mappymatch.matchers.lcss.constructs +=================================== + +.. automodule:: mappymatch.matchers.lcss.constructs + + + .. rubric:: Classes + + .. autosummary:: + + CuttingPoint + TrajectorySegment + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.lcss.lcss.rst b/_sources/_autosummary/mappymatch.matchers.lcss.lcss.rst new file mode 100644 index 0000000..1b53867 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.lcss.lcss.rst @@ -0,0 +1,12 @@ +mappymatch.matchers.lcss.lcss +============================= + +.. automodule:: mappymatch.matchers.lcss.lcss + + + .. rubric:: Classes + + .. autosummary:: + + LCSSMatcher + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.lcss.ops.rst b/_sources/_autosummary/mappymatch.matchers.lcss.ops.rst new file mode 100644 index 0000000..60f6596 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.lcss.ops.rst @@ -0,0 +1,23 @@ +mappymatch.matchers.lcss.ops +============================ + +.. automodule:: mappymatch.matchers.lcss.ops + + + .. rubric:: Functions + + .. autosummary:: + + add_matches_for_stationary_points + drop_stationary_points + find_stationary_points + new_path + same_trajectory_scheme + split_trajectory_segment + + .. rubric:: Classes + + .. autosummary:: + + StationaryIndex + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.lcss.rst b/_sources/_autosummary/mappymatch.matchers.lcss.rst new file mode 100644 index 0000000..e8d106f --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.lcss.rst @@ -0,0 +1,16 @@ +mappymatch.matchers.lcss +======================== + +.. automodule:: mappymatch.matchers.lcss + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + constructs + lcss + ops + utils diff --git a/_sources/_autosummary/mappymatch.matchers.lcss.utils.rst b/_sources/_autosummary/mappymatch.matchers.lcss.utils.rst new file mode 100644 index 0000000..cac3410 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.lcss.utils.rst @@ -0,0 +1,15 @@ +mappymatch.matchers.lcss.utils +============================== + +.. automodule:: mappymatch.matchers.lcss.utils + + + .. rubric:: Functions + + .. autosummary:: + + compress + forward_merge + merge + reverse_merge + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.line_snap.rst b/_sources/_autosummary/mappymatch.matchers.line_snap.rst new file mode 100644 index 0000000..8a1d37e --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.line_snap.rst @@ -0,0 +1,12 @@ +mappymatch.matchers.line\_snap +============================== + +.. automodule:: mappymatch.matchers.line_snap + + + .. rubric:: Classes + + .. autosummary:: + + LineSnapMatcher + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.match_result.rst b/_sources/_autosummary/mappymatch.matchers.match_result.rst new file mode 100644 index 0000000..e9831c9 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.match_result.rst @@ -0,0 +1,12 @@ +mappymatch.matchers.match\_result +================================= + +.. automodule:: mappymatch.matchers.match_result + + + .. rubric:: Classes + + .. autosummary:: + + MatchResult + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.matcher_interface.rst b/_sources/_autosummary/mappymatch.matchers.matcher_interface.rst new file mode 100644 index 0000000..502963b --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.matcher_interface.rst @@ -0,0 +1,12 @@ +mappymatch.matchers.matcher\_interface +====================================== + +.. automodule:: mappymatch.matchers.matcher_interface + + + .. rubric:: Classes + + .. autosummary:: + + MatcherInterface + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.osrm.rst b/_sources/_autosummary/mappymatch.matchers.osrm.rst new file mode 100644 index 0000000..9463901 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.osrm.rst @@ -0,0 +1,18 @@ +mappymatch.matchers.osrm +======================== + +.. automodule:: mappymatch.matchers.osrm + + + .. rubric:: Functions + + .. autosummary:: + + parse_osrm_json + + .. rubric:: Classes + + .. autosummary:: + + OsrmMatcher + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.matchers.rst b/_sources/_autosummary/mappymatch.matchers.rst new file mode 100644 index 0000000..f842aa3 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.rst @@ -0,0 +1,18 @@ +mappymatch.matchers +=================== + +.. automodule:: mappymatch.matchers + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + lcss + line_snap + match_result + matcher_interface + osrm + valhalla diff --git a/_sources/_autosummary/mappymatch.matchers.valhalla.rst b/_sources/_autosummary/mappymatch.matchers.valhalla.rst new file mode 100644 index 0000000..39edf42 --- /dev/null +++ b/_sources/_autosummary/mappymatch.matchers.valhalla.rst @@ -0,0 +1,19 @@ +mappymatch.matchers.valhalla +============================ + +.. automodule:: mappymatch.matchers.valhalla + + + .. rubric:: Functions + + .. autosummary:: + + build_match_result + build_path_from_result + + .. rubric:: Classes + + .. autosummary:: + + ValhallaMatcher + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.utils.crs.rst b/_sources/_autosummary/mappymatch.utils.crs.rst new file mode 100644 index 0000000..e6126d8 --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.crs.rst @@ -0,0 +1,6 @@ +mappymatch.utils.crs +==================== + +.. automodule:: mappymatch.utils.crs + + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.utils.exceptions.rst b/_sources/_autosummary/mappymatch.utils.exceptions.rst new file mode 100644 index 0000000..a1996b5 --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.exceptions.rst @@ -0,0 +1,12 @@ +mappymatch.utils.exceptions +=========================== + +.. automodule:: mappymatch.utils.exceptions + + + .. rubric:: Exceptions + + .. autosummary:: + + MapException + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.utils.geo.rst b/_sources/_autosummary/mappymatch.utils.geo.rst new file mode 100644 index 0000000..2016df4 --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.geo.rst @@ -0,0 +1,14 @@ +mappymatch.utils.geo +==================== + +.. automodule:: mappymatch.utils.geo + + + .. rubric:: Functions + + .. autosummary:: + + coord_to_coord_dist + latlon_to_xy + xy_to_latlon + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.utils.plot.rst b/_sources/_autosummary/mappymatch.utils.plot.rst new file mode 100644 index 0000000..95536b0 --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.plot.rst @@ -0,0 +1,17 @@ +mappymatch.utils.plot +===================== + +.. automodule:: mappymatch.utils.plot + + + .. rubric:: Functions + + .. autosummary:: + + plot_geofence + plot_map + plot_match_distances + plot_matches + plot_path + plot_trace + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.utils.process_trace.rst b/_sources/_autosummary/mappymatch.utils.process_trace.rst new file mode 100644 index 0000000..21c0d84 --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.process_trace.rst @@ -0,0 +1,13 @@ +mappymatch.utils.process\_trace +=============================== + +.. automodule:: mappymatch.utils.process_trace + + + .. rubric:: Functions + + .. autosummary:: + + remove_bad_start_from_trace + split_large_trace + \ No newline at end of file diff --git a/_sources/_autosummary/mappymatch.utils.rst b/_sources/_autosummary/mappymatch.utils.rst new file mode 100644 index 0000000..614dedc --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.rst @@ -0,0 +1,18 @@ +mappymatch.utils +================ + +.. automodule:: mappymatch.utils + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + crs + exceptions + geo + plot + process_trace + url diff --git a/_sources/_autosummary/mappymatch.utils.url.rst b/_sources/_autosummary/mappymatch.utils.url.rst new file mode 100644 index 0000000..b927a28 --- /dev/null +++ b/_sources/_autosummary/mappymatch.utils.url.rst @@ -0,0 +1,12 @@ +mappymatch.utils.url +==================== + +.. automodule:: mappymatch.utils.url + + + .. rubric:: Functions + + .. autosummary:: + + multiurljoin + \ No newline at end of file diff --git a/_sources/api-docs.md b/_sources/api-docs.md new file mode 100644 index 0000000..aa360d4 --- /dev/null +++ b/_sources/api-docs.md @@ -0,0 +1,12 @@ +# API Documentation + +```{eval-rst} +.. autosummary:: + :toctree: _autosummary + :recursive: + + mappymatch.constructs + mappymatch.maps + mappymatch.matchers + mappymatch.utils +``` diff --git a/_sources/home.md b/_sources/home.md new file mode 100644 index 0000000..d5caaf3 --- /dev/null +++ b/_sources/home.md @@ -0,0 +1,13 @@ +# Mappymatch + +Mappymatch is a pure-Python package developed and open-sourced by the National Renewable Energy Laboratory. It contains a collection of "Matchers" that enable matching a GPS trace (series of GPS coordinates) to a map. + +## The Current Matchers + +- **`LCSSMatcher`**: A matcher that implements the LCSS algorithm described in this [paper](https://doi.org/10.3141%2F2645-08). Works best with high-resolution GPS traces. +- **`OsrmMatcher`**: A light matcher that pings an OSRM server to request map matching results. See the [official documentation](http://project-osrm.org/) for more info. +- **`ValhallaMatcher`**: A matcher to ping a [Valhalla](https://www.interline.io/valhalla/) server for map matching results. + +## Currently Supported Map Formats + +- **Open Street Maps** diff --git a/_sources/install.md b/_sources/install.md new file mode 100644 index 0000000..783d8af --- /dev/null +++ b/_sources/install.md @@ -0,0 +1,37 @@ +# Install + +## From PyPI + +```bash +pip install mappymatch +``` + +```{note} +While mappymatch is a pure python package, some of the geospatial dependnecies can be hard to install via pip. +If you encounted issues, our recommended solution is to install the package from the source code, using conda +to facilitate the packages that can be challenging to install. + +We hope to eventually provide a conda distribution (help doing this would be greatly appreciated!) +``` + +## From Source + +Clone the repo: + +```bash +git clone https://github.com/NREL/mappymatch.git && cd mappymatch +``` + +Get [Anaconda](https://www.anaconda.com/download) or [miniconda](https://docs.anaconda.com/miniconda/). + +Then, use the `environment.yml` file (in the repo) to install dependencies: + +```bash +conda env create -f environment.yml +``` + +To activate the `mappymatch` environment: + +```bash +conda activate mappymatch +``` diff --git a/_sources/lcss-example.ipynb b/_sources/lcss-example.ipynb new file mode 100644 index 0000000..6d53ecb --- /dev/null +++ b/_sources/lcss-example.ipynb @@ -0,0 +1,575 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "320f93ac-5965-44a4-8d20-40b8944a60a5", + "metadata": {}, + "source": [ + "# LCSS Example\n", + "\n", + "An example of using the LCSSMatcher to match a gps trace to the Open Street Maps road network" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "id": "dbf22ede-f3b6-4940-b866-15263b8eeaff", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch import package_root" + ] + }, + { + "cell_type": "markdown", + "id": "fcbd7d7d-91fc-4bbe-849f-b91b4d919c6f", + "metadata": {}, + "source": [ + "First, we load the trace from a file. \n", + "The mappymatch package has a few sample traces included that we can use for demonstration.\n", + "\n", + "Before we build the trace, though, let's take a look at the file to see how mappymatch expects the input data:" + ] + }, + { + "cell_type": "code", + "execution_count": 2, + "id": "a626d87a-382e-4d04-9e02-886f3a168701", + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "
\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "
latitudelongitude
039.655210-104.919169
139.655449-104.919274
239.655690-104.919381
339.655936-104.919486
439.656182-104.919593
\n", + "
" + ], + "text/plain": [ + " latitude longitude\n", + "0 39.655210 -104.919169\n", + "1 39.655449 -104.919274\n", + "2 39.655690 -104.919381\n", + "3 39.655936 -104.919486\n", + "4 39.656182 -104.919593" + ] + }, + "execution_count": 2, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "import pandas as pd\n", + "\n", + "df = pd.read_csv(package_root() / \"resources/traces/sample_trace_3.csv\")\n", + "df.head()" + ] + }, + { + "cell_type": "markdown", + "id": "cd2ba449-3b1b-44ea-be6a-a11a12cca1a7", + "metadata": {}, + "source": [ + "Notice that we expect the input data to be in the EPSG:4326 coordinate reference system. \n", + "If your input data is not in this format, you'll need to convert it prior to building a Trace object.\n", + "\n", + "In order to idenfiy which coordinate is which in a trace, mappymatch uses the dataframe index as the coordinate index and so in this case, we just have a simple range based index for each coordinate.\n", + "We could set a different index on the dataframe and mappymatch would use that to identify the coordinates.\n", + "\n", + "Now, let's load the trace from the same file:" + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "id": "278d868d-1095-427b-a6ef-55db76f9353c", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.constructs.trace import Trace\n", + "\n", + "trace = Trace.from_csv(\n", + " package_root() / \"resources/traces/sample_trace_3.csv\",\n", + " lat_column=\"latitude\",\n", + " lon_column=\"longitude\",\n", + " xy=True,\n", + ")" + ] + }, + { + "cell_type": "markdown", + "id": "d5791707-491f-4c16-b5a9-51147a6ec896", + "metadata": {}, + "source": [ + "Notice here that we pass three optional arguments to the `from_csv` function. \n", + "By default, mappymatch expects the latitude and longitude columns to be named \"latitude\" and \"longitude\" but you can pass your own values if needed.\n", + "Also by default, mappymatch converts the trace into the web mercator coordinate reference system (EPSG:3857) by setting `xy=True`.\n", + "The LCSS matcher computes the cartesian distance between geometries and so a projected coordiante reference system is ideal.\n", + "In a future version of mappymatch we hope to support any projected coordiante system but right now we only support EPSG:3857.\n", + "\n", + "Okay, let's plot the trace to see what it looks like (mappymatch uses folium under the hood for plotting):" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "4e1284f1-ef05-4732-9b20-891c444d5c68", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.utils.plot import plot_trace\n", + "\n", + "plot_trace(trace, point_color=\"black\", line_color=\"yellow\")" + ] + }, + { + "cell_type": "markdown", + "id": "a54fd4fa-974b-4e96-8224-b90e31ffdd37", + "metadata": {}, + "source": [ + "Next, we need to get a road map to match our Trace to.\n", + "One way to do this is to build a small geofence around the trace and then download a map that just fits around our trace:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "cc5f7cb1-8f01-45b3-8216-59d7fd7f1f22", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.constructs.geofence import Geofence\n", + "\n", + "geofence = Geofence.from_trace(trace, padding=2e3)" + ] + }, + { + "cell_type": "markdown", + "id": "c581bf51-878b-4968-991c-de77becea543", + "metadata": {}, + "source": [ + "Notice that we pass an optional argument to the constructor.\n", + "The padding defines how large around the trace we should build our geofence and is in the same units as the trace.\n", + "In our case, the trace has been projected to the web mercator CRS and so our units would be in approximate meters, 1e3 meters or 1 kilomter \n", + "\n", + "Now, let's plot both the trace and the geofence:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "0e8008c3-01ec-42be-b62e-730cfc35e995", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.utils.plot import plot_geofence\n", + "\n", + "plot_trace(trace, point_color=\"black\", m=plot_geofence(geofence))" + ] + }, + { + "cell_type": "markdown", + "id": "c294fc6c-4ad3-4f2a-a819-5772c887a65e", + "metadata": {}, + "source": [ + "At this point, we're ready to download a road network.\n", + "Mappymatch has a couple of ways to represent a road network: The `NxMap` and the `IGraphMap` which use `networkx` and `igraph`, respectively, under the hood to represent the road graph structure.\n", + "You might experiment with both to see if one is more performant or memory efficient in your use case.\n", + "\n", + "In this example we'll use the `NxMap`:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1259d790-758b-413c-8ab1-19106ee5b3c8", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.maps.nx.nx_map import NxMap, NetworkType\n", + "\n", + "nx_map = NxMap.from_geofence(\n", + " geofence,\n", + " network_type=NetworkType.DRIVE,\n", + ")" + ] + }, + { + "cell_type": "markdown", + "id": "7388a8a5-4396-4c95-bc23-aeb8c057d57a", + "metadata": {}, + "source": [ + "The `from_geofence` constructor uses the osmnx package under the hood to download a road network.\n", + "\n", + "Notice we pass the optional argument `network_type` which defaults to `NetworkType.DRIVE` but can be used to get a different network like `NetworkType.BIKE` or `NetworkType.WALK`\n", + "\n", + "Now, we can plot the map to make sure we have the network that we want to match to:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "6dd7f2f8-9407-418c-912d-723cf7672624", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.utils.plot import plot_map\n", + "\n", + "plot_map(nx_map)" + ] + }, + { + "cell_type": "markdown", + "id": "3e3e4926-7e63-4098-986a-605aa772a9d8", + "metadata": {}, + "source": [ + "Now, we're ready to perform the actual map matching. \n", + "\n", + "In this example we'll use the `LCSSMatcher` which implements the algorithm described in this paper:\n", + "\n", + "[Zhu, Lei, Jacob R. Holden, and Jeffrey D. Gonder.\n", + "\"Trajectory Segmentation Map-Matching Approach for Large-Scale, High-Resolution GPS Data.\"\n", + "Transportation Research Record: Journal of the Transportation Research Board 2645 (2017): 67-75.](https://doi.org/10.3141%2F2645-08)\n", + "\n", + "We won't go into detail here for how to tune the paramters but checkout the referenced paper for more details if you're interested. \n", + "The default parameters have been set based on internal testing on high resolution driving GPS traces. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "272e5779-5b3b-4862-9d5e-850866758554", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.matchers.lcss.lcss import LCSSMatcher\n", + "\n", + "matcher = LCSSMatcher(nx_map)\n", + "\n", + "match_result = matcher.match_trace(trace)" + ] + }, + { + "cell_type": "markdown", + "id": "64ab014b-3084-48a0-a89a-d579ca296dc6", + "metadata": {}, + "source": [ + "Now that we have the results, let's plot them:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "5dcdab12-0592-472e-bd7d-b00add9d8533", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.utils.plot import plot_matches\n", + "\n", + "plot_matches(match_result.matches)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1e470152-4b65-4844-a014-b922c5cbd8f8", + "metadata": {}, + "outputs": [], + "source": [ + "match_result.path_to_geodataframe().plot()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "5f7e52f4-b52a-4788-a990-f603378ea090", + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "markdown", + "id": "d9ac54eb-d5e0-45db-a90d-cf42906a3bc6", + "metadata": {}, + "source": [ + "The `plot_matches` function plots the roads that each point has been matched to and labels them with the road id.\n", + "\n", + "In some cases, if the trace is much sparser (for example if it was collected a lower resolution), you might want see the estimated path, rather than the explict matched roads.\n", + "\n", + "For example, let's reduce the trace frequency to every 30th point and re-match it:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "70d10607-71f6-4706-878a-8ab7332f7543", + "metadata": {}, + "outputs": [], + "source": [ + "reduced_trace = trace[0::30]" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "3668f51e-da5e-485a-8d8b-e2f76fd1c173", + "metadata": {}, + "outputs": [], + "source": [ + "plot_trace(reduced_trace, point_color=\"black\", line_color=\"yellow\")" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b203d89a-3384-4fcb-81ff-dc62f34277d0", + "metadata": {}, + "outputs": [], + "source": [ + "reduced_matches = matcher.match_trace(reduced_trace)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "f56f70f8-7732-4801-af04-bffce4176853", + "metadata": {}, + "outputs": [], + "source": [ + "plot_matches(reduced_matches.matches)" + ] + }, + { + "cell_type": "markdown", + "id": "a4d7ac4f-d822-491a-9a1d-77cd42f0a7d7", + "metadata": {}, + "source": [ + "The match result also has a `path` attribute with the estiamted path through the network:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "6c389db6-427f-4b91-8857-06d36ea51809", + "metadata": {}, + "outputs": [], + "source": [ + "from mappymatch.utils.plot import plot_path" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a8e63658-1de5-4313-b5c3-989afa0c5951", + "metadata": {}, + "outputs": [], + "source": [ + "plot_trace(\n", + " reduced_trace, point_color=\"blue\", m=plot_path(reduced_matches.path, crs=trace.crs)\n", + ")" + ] + }, + { + "cell_type": "markdown", + "id": "fdc744b4-9399-4a64-a0f9-a02791aaf859", + "metadata": {}, + "source": [ + "Lastly, we might want to convert the results into a format more suitible for saving to file or merging with some other dataset. \n", + "To do this, we can convert the result into a dataframe:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "456d58c4-d507-461d-be9d-75b80341a406", + "metadata": {}, + "outputs": [], + "source": [ + "result_df = reduced_matches.matches_to_dataframe()\n", + "result_df.head()" + ] + }, + { + "cell_type": "markdown", + "id": "de20d601-aab6-4cab-ac98-3b25b8b433e1", + "metadata": {}, + "source": [ + "Here, for each coordinate, we have the distance to the matched road, and then attributes of the road itself like the geometry, the OSM node id and the road distance and travel time.\n", + "\n", + "We can also get a dataframe for the path:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e4bf8cf9-83a7-4347-9c7c-164ff0fe4413", + "metadata": {}, + "outputs": [], + "source": [ + "path_df = reduced_matches.path_to_dataframe()\n", + "path_df.head()" + ] + }, + { + "cell_type": "markdown", + "id": "1e38cdb0-0028-4c23-88a0-e6fdafe295ce", + "metadata": {}, + "source": [ + "Another thing we can do is to only get a certain set of road types to match to. For example, let's say I only want to consider highways and primary roads for matching, I can do so by passing a custom filter when building the road network: " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "57168d3b-c9d0-47ae-9a84-a405b31ddf73", + "metadata": {}, + "outputs": [], + "source": [ + "nx_map = NxMap.from_geofence(\n", + " geofence,\n", + " network_type=NetworkType.DRIVE,\n", + " custom_filter='[\"highway\"~\"motorway|primary\"]',\n", + ")" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "faea5546-bda5-4642-9b75-26692efce16a", + "metadata": {}, + "outputs": [], + "source": [ + "plot_map(nx_map)" + ] + }, + { + "cell_type": "markdown", + "id": "04f39101-11cc-4cd5-92de-5b1f191de3b4", + "metadata": {}, + "source": [ + "Above you can see that now we have a much reduced graph to match to, let's see what happens" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "35436094-897b-4537-b161-73eadd294625", + "metadata": {}, + "outputs": [], + "source": [ + "matcher = LCSSMatcher(nx_map)\n", + "\n", + "match_result = matcher.match_trace(trace)\n", + "\n", + "plot_matches(match_result.matches)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "820813b6-dba1-4a1c-aa37-fcba0deb20f1", + "metadata": {}, + "outputs": [], + "source": [ + "plot_path(match_result.path, crs=trace.crs)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2137e503-0b00-4358-a1c8-be34ab6d10eb", + "metadata": {}, + "outputs": [], + "source": [ + "path_gdf = match_result.path_to_geodataframe()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a5b3a413-7325-4629-89ad-664aab4ece10", + "metadata": {}, + "outputs": [], + "source": [ + "path_gdf.plot()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2731f4d7-a9df-455f-859a-f22e48e40f37", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.12.7" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/quick-start.md b/_sources/quick-start.md new file mode 100644 index 0000000..a0fb92e --- /dev/null +++ b/_sources/quick-start.md @@ -0,0 +1,5 @@ +# Quick Start + +First, follow the [installation instructions](install). + +Then, checkout the [LCSS example](lcss-example). diff --git a/_sphinx_design_static/design-tabs.js b/_sphinx_design_static/design-tabs.js new file mode 100644 index 0000000..b25bd6a --- /dev/null +++ b/_sphinx_design_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_sphinx_design_static/sphinx-design.min.css b/_sphinx_design_static/sphinx-design.min.css new file mode 100644 index 0000000..860c36d --- /dev/null +++ b/_sphinx_design_static/sphinx-design.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative;font-size:var(--sd-fontsize-dropdown)}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary.sd-summary-title{padding:.5em .6em .5em 1em;font-size:var(--sd-fontsize-dropdown-title);font-weight:var(--sd-fontweight-dropdown-title);user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;list-style:none;display:inline-flex;justify-content:space-between}details.sd-dropdown summary.sd-summary-title::-webkit-details-marker{display:none}details.sd-dropdown summary.sd-summary-title:focus{outline:none}details.sd-dropdown summary.sd-summary-title .sd-summary-icon{margin-right:.6em;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary.sd-summary-title .sd-summary-text{flex-grow:1;line-height:1.5;padding-right:.5rem}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker{pointer-events:none;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker svg{opacity:.6}details.sd-dropdown summary.sd-summary-title:hover .sd-summary-state-marker svg{opacity:1;transform:scale(1.1)}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown .sd-summary-chevron-right{transition:.25s}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-right{transform:rotate(90deg)}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-down{transform:rotate(180deg)}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-bg: rgba(0, 113, 188, 0.2);--sd-color-secondary-bg: rgba(108, 117, 125, 0.2);--sd-color-success-bg: rgba(40, 167, 69, 0.2);--sd-color-info-bg: rgba(23, 162, 184, 0.2);--sd-color-warning-bg: rgba(240, 179, 126, 0.2);--sd-color-danger-bg: rgba(220, 53, 69, 0.2);--sd-color-light-bg: rgba(248, 249, 250, 0.2);--sd-color-muted-bg: rgba(108, 117, 125, 0.2);--sd-color-dark-bg: rgba(33, 37, 41, 0.2);--sd-color-black-bg: rgba(0, 0, 0, 0.2);--sd-color-white-bg: rgba(255, 255, 255, 0.2);--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem;--sd-fontsize-dropdown: inherit;--sd-fontsize-dropdown-title: 1rem;--sd-fontweight-dropdown-title: 700} diff --git a/_static/basic.css b/_static/basic.css new file mode 100644 index 0000000..2af6139 --- /dev/null +++ b/_static/basic.css @@ -0,0 +1,925 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 270px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a:visited { + color: #551A8B; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} + +nav.contents, +aside.topic, +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ + +nav.contents, +aside.topic, +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +nav.contents > :last-child, +aside.topic > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +nav.contents::after, +aside.topic::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +aside.footnote > span, +div.citation > span { + float: left; +} +aside.footnote > span:last-of-type, +div.citation > span:last-of-type { + padding-right: 0.5em; +} +aside.footnote > p { + margin-left: 2em; +} +div.citation > p { + margin-left: 4em; +} +aside.footnote > p:last-of-type, +div.citation > p:last-of-type { + margin-bottom: 0em; +} +aside.footnote > p:last-of-type:after, +div.citation > p:last-of-type:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +.sig dd { + margin-top: 0px; + margin-bottom: 0px; +} + +.sig dl { + margin-top: 0px; + margin-bottom: 0px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +.translated { + background-color: rgba(207, 255, 207, 0.2) +} + +.untranslated { + background-color: rgba(255, 207, 207, 0.2) +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/_static/check-solid.svg b/_static/check-solid.svg new file mode 100644 index 0000000..92fad4b --- /dev/null +++ b/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/_static/clipboard.min.js b/_static/clipboard.min.js new file mode 100644 index 0000000..54b3c46 --- /dev/null +++ b/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/_static/copybutton.css b/_static/copybutton.css new file mode 100644 index 0000000..f1916ec --- /dev/null +++ b/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/_static/copybutton.js b/_static/copybutton.js new file mode 100644 index 0000000..2ea7ff3 --- /dev/null +++ b/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/_static/copybutton_funcs.js b/_static/copybutton_funcs.js new file mode 100644 index 0000000..dbe1aaa --- /dev/null +++ b/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/_static/design-tabs.js b/_static/design-tabs.js new file mode 100644 index 0000000..b25bd6a --- /dev/null +++ b/_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/doctools.js b/_static/doctools.js new file mode 100644 index 0000000..4d67807 --- /dev/null +++ b/_static/doctools.js @@ -0,0 +1,156 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const BLACKLISTED_KEY_CONTROL_ELEMENTS = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", +]); + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + document.addEventListener("keydown", (event) => { + // bail for input elements + if (BLACKLISTED_KEY_CONTROL_ELEMENTS.has(document.activeElement.tagName)) return; + // bail with special keys + if (event.altKey || event.ctrlKey || event.metaKey) return; + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/_static/documentation_options.js b/_static/documentation_options.js new file mode 100644 index 0000000..22c7467 --- /dev/null +++ b/_static/documentation_options.js @@ -0,0 +1,13 @@ +const DOCUMENTATION_OPTIONS = { + VERSION: '', + LANGUAGE: 'python', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: false, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: true, +}; \ No newline at end of file diff --git a/_static/file.png b/_static/file.png new file mode 100644 index 0000000..a858a41 Binary files /dev/null and b/_static/file.png differ diff --git a/_static/images/logo_binder.svg b/_static/images/logo_binder.svg new file mode 100644 index 0000000..45fecf7 --- /dev/null +++ b/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/_static/images/logo_colab.png b/_static/images/logo_colab.png new file mode 100644 index 0000000..b7560ec Binary files /dev/null and b/_static/images/logo_colab.png differ diff --git a/_static/images/logo_deepnote.svg b/_static/images/logo_deepnote.svg new file mode 100644 index 0000000..fa77ebf --- /dev/null +++ b/_static/images/logo_deepnote.svg @@ -0,0 +1 @@ + diff --git a/_static/images/logo_jupyterhub.svg b/_static/images/logo_jupyterhub.svg new file mode 100644 index 0000000..60cfe9f --- /dev/null +++ b/_static/images/logo_jupyterhub.svg @@ -0,0 +1 @@ +logo_jupyterhubHub diff --git a/_static/language_data.js b/_static/language_data.js new file mode 100644 index 0000000..367b8ed --- /dev/null +++ b/_static/language_data.js @@ -0,0 +1,199 @@ +/* + * language_data.js + * ~~~~~~~~~~~~~~~~ + * + * This script contains the language-specific data used by searchtools.js, + * namely the list of stopwords, stemmer, scorer and splitter. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +var stopwords = ["a", "and", "are", "as", "at", "be", "but", "by", "for", "if", "in", "into", "is", "it", "near", "no", "not", "of", "on", "or", "such", "that", "the", "their", "then", "there", "these", "they", "this", "to", "was", "will", "with"]; + + +/* Non-minified version is copied as a separate JS file, if available */ + +/** + * Porter Stemmer + */ +var Stemmer = function() { + + var step2list = { + ational: 'ate', + tional: 'tion', + enci: 'ence', + anci: 'ance', + izer: 'ize', + bli: 'ble', + alli: 'al', + entli: 'ent', + eli: 'e', + ousli: 'ous', + ization: 'ize', + ation: 'ate', + ator: 'ate', + alism: 'al', + iveness: 'ive', + fulness: 'ful', + ousness: 'ous', + aliti: 'al', + iviti: 'ive', + biliti: 'ble', + logi: 'log' + }; + + var step3list = { + icate: 'ic', + ative: '', + alize: 'al', + iciti: 'ic', + ical: 'ic', + ful: '', + ness: '' + }; + + var c = "[^aeiou]"; // consonant + var v = "[aeiouy]"; // vowel + var C = c + "[^aeiouy]*"; // consonant sequence + var V = v + "[aeiou]*"; // vowel sequence + + var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0 + var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1 + var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1 + var s_v = "^(" + C + ")?" + v; // vowel in stem + + this.stemWord = function (w) { + var stem; + var suffix; + var firstch; + var origword = w; + + if (w.length < 3) + return w; + + var re; + var re2; + var re3; + var re4; + + firstch = w.substr(0,1); + if (firstch == "y") + w = firstch.toUpperCase() + w.substr(1); + + // Step 1a + re = /^(.+?)(ss|i)es$/; + re2 = /^(.+?)([^s])s$/; + + if (re.test(w)) + w = w.replace(re,"$1$2"); + else if (re2.test(w)) + w = w.replace(re2,"$1$2"); + + // Step 1b + re = /^(.+?)eed$/; + re2 = /^(.+?)(ed|ing)$/; + if (re.test(w)) { + var fp = re.exec(w); + re = new RegExp(mgr0); + if (re.test(fp[1])) { + re = /.$/; + w = w.replace(re,""); + } + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1]; + re2 = new RegExp(s_v); + if (re2.test(stem)) { + w = stem; + re2 = /(at|bl|iz)$/; + re3 = new RegExp("([^aeiouylsz])\\1$"); + re4 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re2.test(w)) + w = w + "e"; + else if (re3.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + else if (re4.test(w)) + w = w + "e"; + } + } + + // Step 1c + re = /^(.+?)y$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(s_v); + if (re.test(stem)) + w = stem + "i"; + } + + // Step 2 + re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step2list[suffix]; + } + + // Step 3 + re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step3list[suffix]; + } + + // Step 4 + re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/; + re2 = /^(.+?)(s|t)(ion)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + if (re.test(stem)) + w = stem; + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1] + fp[2]; + re2 = new RegExp(mgr1); + if (re2.test(stem)) + w = stem; + } + + // Step 5 + re = /^(.+?)e$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + re2 = new RegExp(meq1); + re3 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) + w = stem; + } + re = /ll$/; + re2 = new RegExp(mgr1); + if (re.test(w) && re2.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + + // and turn initial Y back to y + if (firstch == "y") + w = firstch.toLowerCase() + w.substr(1); + return w; + } +} + diff --git a/_static/locales/ar/LC_MESSAGES/booktheme.mo b/_static/locales/ar/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..15541a6 Binary files /dev/null and b/_static/locales/ar/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ar/LC_MESSAGES/booktheme.po b/_static/locales/ar/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..34d404c --- /dev/null +++ b/_static/locales/ar/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ar\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "طباعة إلى PDF" + +msgid "Theme by the" +msgstr "موضوع بواسطة" + +msgid "Download source file" +msgstr "تنزيل ملف المصدر" + +msgid "open issue" +msgstr "قضية مفتوحة" + +msgid "Contents" +msgstr "محتويات" + +msgid "previous page" +msgstr "الصفحة السابقة" + +msgid "Download notebook file" +msgstr "تنزيل ملف دفتر الملاحظات" + +msgid "Copyright" +msgstr "حقوق النشر" + +msgid "Download this page" +msgstr "قم بتنزيل هذه الصفحة" + +msgid "Source repository" +msgstr "مستودع المصدر" + +msgid "By" +msgstr "بواسطة" + +msgid "repository" +msgstr "مخزن" + +msgid "Last updated on" +msgstr "آخر تحديث في" + +msgid "Toggle navigation" +msgstr "تبديل التنقل" + +msgid "Sphinx Book Theme" +msgstr "موضوع كتاب أبو الهول" + +msgid "suggest edit" +msgstr "أقترح تحرير" + +msgid "Open an issue" +msgstr "افتح قضية" + +msgid "Launch" +msgstr "إطلاق" + +msgid "Fullscreen mode" +msgstr "وضع ملء الشاشة" + +msgid "Edit this page" +msgstr "قم بتحرير هذه الصفحة" + +msgid "By the" +msgstr "بواسطة" + +msgid "next page" +msgstr "الصفحة التالية" diff --git a/_static/locales/bg/LC_MESSAGES/booktheme.mo b/_static/locales/bg/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..da95120 Binary files /dev/null and b/_static/locales/bg/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/bg/LC_MESSAGES/booktheme.po b/_static/locales/bg/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..7420c19 --- /dev/null +++ b/_static/locales/bg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Печат в PDF" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Download source file" +msgstr "Изтеглете изходния файл" + +msgid "open issue" +msgstr "отворен брой" + +msgid "Contents" +msgstr "Съдържание" + +msgid "previous page" +msgstr "предишна страница" + +msgid "Download notebook file" +msgstr "Изтеглете файла на бележника" + +msgid "Copyright" +msgstr "Авторско право" + +msgid "Download this page" +msgstr "Изтеглете тази страница" + +msgid "Source repository" +msgstr "Хранилище на източника" + +msgid "By" +msgstr "От" + +msgid "repository" +msgstr "хранилище" + +msgid "Last updated on" +msgstr "Последна актуализация на" + +msgid "Toggle navigation" +msgstr "Превключване на навигацията" + +msgid "Sphinx Book Theme" +msgstr "Тема на книгата Sphinx" + +msgid "suggest edit" +msgstr "предложи редактиране" + +msgid "Open an issue" +msgstr "Отворете проблем" + +msgid "Launch" +msgstr "Стартиране" + +msgid "Fullscreen mode" +msgstr "Режим на цял екран" + +msgid "Edit this page" +msgstr "Редактирайте тази страница" + +msgid "By the" +msgstr "По" + +msgid "next page" +msgstr "Следваща страница" diff --git a/_static/locales/bn/LC_MESSAGES/booktheme.mo b/_static/locales/bn/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..6b96639 Binary files /dev/null and b/_static/locales/bn/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/bn/LC_MESSAGES/booktheme.po b/_static/locales/bn/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..63a07c3 --- /dev/null +++ b/_static/locales/bn/LC_MESSAGES/booktheme.po @@ -0,0 +1,63 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bn\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "পিডিএফ প্রিন্ট করুন" + +msgid "Theme by the" +msgstr "থিম দ্বারা" + +msgid "Download source file" +msgstr "উত্স ফাইল ডাউনলোড করুন" + +msgid "open issue" +msgstr "খোলা সমস্যা" + +msgid "previous page" +msgstr "আগের পৃষ্ঠা" + +msgid "Download notebook file" +msgstr "নোটবুক ফাইল ডাউনলোড করুন" + +msgid "Copyright" +msgstr "কপিরাইট" + +msgid "Download this page" +msgstr "এই পৃষ্ঠাটি ডাউনলোড করুন" + +msgid "Source repository" +msgstr "উত্স সংগ্রহস্থল" + +msgid "By" +msgstr "দ্বারা" + +msgid "Last updated on" +msgstr "সর্বশেষ আপডেট" + +msgid "Toggle navigation" +msgstr "নেভিগেশন টগল করুন" + +msgid "Sphinx Book Theme" +msgstr "স্পিনিক্স বুক থিম" + +msgid "Open an issue" +msgstr "একটি সমস্যা খুলুন" + +msgid "Launch" +msgstr "শুরু করা" + +msgid "Edit this page" +msgstr "এই পৃষ্ঠাটি সম্পাদনা করুন" + +msgid "By the" +msgstr "দ্বারা" + +msgid "next page" +msgstr "পরবর্তী পৃষ্ঠা" diff --git a/_static/locales/ca/LC_MESSAGES/booktheme.mo b/_static/locales/ca/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..a4dd30e Binary files /dev/null and b/_static/locales/ca/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ca/LC_MESSAGES/booktheme.po b/_static/locales/ca/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..8fb358b --- /dev/null +++ b/_static/locales/ca/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ca\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimeix a PDF" + +msgid "Theme by the" +msgstr "Tema del" + +msgid "Download source file" +msgstr "Baixeu el fitxer font" + +msgid "open issue" +msgstr "número obert" + +msgid "previous page" +msgstr "Pàgina anterior" + +msgid "Download notebook file" +msgstr "Descarregar fitxer de quadern" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "Descarregueu aquesta pàgina" + +msgid "Source repository" +msgstr "Dipòsit de fonts" + +msgid "By" +msgstr "Per" + +msgid "Last updated on" +msgstr "Darrera actualització el" + +msgid "Toggle navigation" +msgstr "Commuta la navegació" + +msgid "Sphinx Book Theme" +msgstr "Tema del llibre Esfinx" + +msgid "suggest edit" +msgstr "suggerir edició" + +msgid "Open an issue" +msgstr "Obriu un número" + +msgid "Launch" +msgstr "Llançament" + +msgid "Edit this page" +msgstr "Editeu aquesta pàgina" + +msgid "By the" +msgstr "Per la" + +msgid "next page" +msgstr "pàgina següent" diff --git a/_static/locales/cs/LC_MESSAGES/booktheme.mo b/_static/locales/cs/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..c39e01a Binary files /dev/null and b/_static/locales/cs/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/cs/LC_MESSAGES/booktheme.po b/_static/locales/cs/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..c6ef469 --- /dev/null +++ b/_static/locales/cs/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: cs\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Tisk do PDF" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Download source file" +msgstr "Stáhněte si zdrojový soubor" + +msgid "open issue" +msgstr "otevřené číslo" + +msgid "Contents" +msgstr "Obsah" + +msgid "previous page" +msgstr "předchozí stránka" + +msgid "Download notebook file" +msgstr "Stáhnout soubor poznámkového bloku" + +msgid "Copyright" +msgstr "autorská práva" + +msgid "Download this page" +msgstr "Stáhněte si tuto stránku" + +msgid "Source repository" +msgstr "Zdrojové úložiště" + +msgid "By" +msgstr "Podle" + +msgid "repository" +msgstr "úložiště" + +msgid "Last updated on" +msgstr "Naposledy aktualizováno" + +msgid "Toggle navigation" +msgstr "Přepnout navigaci" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "suggest edit" +msgstr "navrhnout úpravy" + +msgid "Open an issue" +msgstr "Otevřete problém" + +msgid "Launch" +msgstr "Zahájení" + +msgid "Fullscreen mode" +msgstr "Režim celé obrazovky" + +msgid "Edit this page" +msgstr "Upravit tuto stránku" + +msgid "By the" +msgstr "Podle" + +msgid "next page" +msgstr "další strana" diff --git a/_static/locales/da/LC_MESSAGES/booktheme.mo b/_static/locales/da/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..f43157d Binary files /dev/null and b/_static/locales/da/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/da/LC_MESSAGES/booktheme.po b/_static/locales/da/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..306a38e --- /dev/null +++ b/_static/locales/da/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: da\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Udskriv til PDF" + +msgid "Theme by the" +msgstr "Tema af" + +msgid "Download source file" +msgstr "Download kildefil" + +msgid "open issue" +msgstr "åbent nummer" + +msgid "Contents" +msgstr "Indhold" + +msgid "previous page" +msgstr "forrige side" + +msgid "Download notebook file" +msgstr "Download notesbog-fil" + +msgid "Copyright" +msgstr "ophavsret" + +msgid "Download this page" +msgstr "Download denne side" + +msgid "Source repository" +msgstr "Kildelager" + +msgid "By" +msgstr "Ved" + +msgid "repository" +msgstr "lager" + +msgid "Last updated on" +msgstr "Sidst opdateret den" + +msgid "Toggle navigation" +msgstr "Skift navigation" + +msgid "Sphinx Book Theme" +msgstr "Sphinx bogtema" + +msgid "suggest edit" +msgstr "foreslå redigering" + +msgid "Open an issue" +msgstr "Åbn et problem" + +msgid "Launch" +msgstr "Start" + +msgid "Fullscreen mode" +msgstr "Fuldskærmstilstand" + +msgid "Edit this page" +msgstr "Rediger denne side" + +msgid "By the" +msgstr "Ved" + +msgid "next page" +msgstr "Næste side" diff --git a/_static/locales/de/LC_MESSAGES/booktheme.mo b/_static/locales/de/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..648b565 Binary files /dev/null and b/_static/locales/de/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/de/LC_MESSAGES/booktheme.po b/_static/locales/de/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..4925360 --- /dev/null +++ b/_static/locales/de/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: de\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "In PDF drucken" + +msgid "Theme by the" +msgstr "Thema von der" + +msgid "Download source file" +msgstr "Quelldatei herunterladen" + +msgid "open issue" +msgstr "offenes Thema" + +msgid "Contents" +msgstr "Inhalt" + +msgid "previous page" +msgstr "vorherige Seite" + +msgid "Download notebook file" +msgstr "Notebook-Datei herunterladen" + +msgid "Copyright" +msgstr "Urheberrechte ©" + +msgid "Download this page" +msgstr "Laden Sie diese Seite herunter" + +msgid "Source repository" +msgstr "Quell-Repository" + +msgid "By" +msgstr "Durch" + +msgid "repository" +msgstr "Repository" + +msgid "Last updated on" +msgstr "Zuletzt aktualisiert am" + +msgid "Toggle navigation" +msgstr "Navigation umschalten" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-Buch-Thema" + +msgid "suggest edit" +msgstr "vorschlagen zu bearbeiten" + +msgid "Open an issue" +msgstr "Öffnen Sie ein Problem" + +msgid "Launch" +msgstr "Starten" + +msgid "Fullscreen mode" +msgstr "Vollbildmodus" + +msgid "Edit this page" +msgstr "Bearbeite diese Seite" + +msgid "By the" +msgstr "Bis zum" + +msgid "next page" +msgstr "Nächste Seite" diff --git a/_static/locales/el/LC_MESSAGES/booktheme.mo b/_static/locales/el/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..fca6e93 Binary files /dev/null and b/_static/locales/el/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/el/LC_MESSAGES/booktheme.po b/_static/locales/el/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..3e01acb --- /dev/null +++ b/_static/locales/el/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: el\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Εκτύπωση σε PDF" + +msgid "Theme by the" +msgstr "Θέμα από το" + +msgid "Download source file" +msgstr "Λήψη αρχείου προέλευσης" + +msgid "open issue" +msgstr "ανοιχτό ζήτημα" + +msgid "Contents" +msgstr "Περιεχόμενα" + +msgid "previous page" +msgstr "προηγούμενη σελίδα" + +msgid "Download notebook file" +msgstr "Λήψη αρχείου σημειωματάριου" + +msgid "Copyright" +msgstr "Πνευματική ιδιοκτησία" + +msgid "Download this page" +msgstr "Λήψη αυτής της σελίδας" + +msgid "Source repository" +msgstr "Αποθήκη πηγής" + +msgid "By" +msgstr "Με" + +msgid "repository" +msgstr "αποθήκη" + +msgid "Last updated on" +msgstr "Τελευταία ενημέρωση στις" + +msgid "Toggle navigation" +msgstr "Εναλλαγή πλοήγησης" + +msgid "Sphinx Book Theme" +msgstr "Θέμα βιβλίου Sphinx" + +msgid "suggest edit" +msgstr "προτείνω επεξεργασία" + +msgid "Open an issue" +msgstr "Ανοίξτε ένα ζήτημα" + +msgid "Launch" +msgstr "Εκτόξευση" + +msgid "Fullscreen mode" +msgstr "ΛΕΙΤΟΥΡΓΙΑ ΠΛΗΡΟΥΣ ΟΘΟΝΗΣ" + +msgid "Edit this page" +msgstr "Επεξεργαστείτε αυτήν τη σελίδα" + +msgid "By the" +msgstr "Από το" + +msgid "next page" +msgstr "επόμενη σελίδα" diff --git a/_static/locales/eo/LC_MESSAGES/booktheme.mo b/_static/locales/eo/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d1072bb Binary files /dev/null and b/_static/locales/eo/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/eo/LC_MESSAGES/booktheme.po b/_static/locales/eo/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..f7ed226 --- /dev/null +++ b/_static/locales/eo/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: eo\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Presi al PDF" + +msgid "Theme by the" +msgstr "Temo de la" + +msgid "Download source file" +msgstr "Elŝutu fontodosieron" + +msgid "open issue" +msgstr "malferma numero" + +msgid "Contents" +msgstr "Enhavo" + +msgid "previous page" +msgstr "antaŭa paĝo" + +msgid "Download notebook file" +msgstr "Elŝutu kajeran dosieron" + +msgid "Copyright" +msgstr "Kopirajto" + +msgid "Download this page" +msgstr "Elŝutu ĉi tiun paĝon" + +msgid "Source repository" +msgstr "Fonto-deponejo" + +msgid "By" +msgstr "De" + +msgid "repository" +msgstr "deponejo" + +msgid "Last updated on" +msgstr "Laste ĝisdatigita la" + +msgid "Toggle navigation" +msgstr "Ŝalti navigadon" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa Libro-Temo" + +msgid "suggest edit" +msgstr "sugesti redaktadon" + +msgid "Open an issue" +msgstr "Malfermu numeron" + +msgid "Launch" +msgstr "Lanĉo" + +msgid "Fullscreen mode" +msgstr "Plenekrana reĝimo" + +msgid "Edit this page" +msgstr "Redaktu ĉi tiun paĝon" + +msgid "By the" +msgstr "Per la" + +msgid "next page" +msgstr "sekva paĝo" diff --git a/_static/locales/es/LC_MESSAGES/booktheme.mo b/_static/locales/es/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..ba2ee4d Binary files /dev/null and b/_static/locales/es/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/es/LC_MESSAGES/booktheme.po b/_static/locales/es/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..5e0029e --- /dev/null +++ b/_static/locales/es/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: es\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimir en PDF" + +msgid "Theme by the" +msgstr "Tema por el" + +msgid "Download source file" +msgstr "Descargar archivo fuente" + +msgid "open issue" +msgstr "Tema abierto" + +msgid "Contents" +msgstr "Contenido" + +msgid "previous page" +msgstr "pagina anterior" + +msgid "Download notebook file" +msgstr "Descargar archivo de cuaderno" + +msgid "Copyright" +msgstr "Derechos de autor" + +msgid "Download this page" +msgstr "Descarga esta pagina" + +msgid "Source repository" +msgstr "Repositorio de origen" + +msgid "By" +msgstr "Por" + +msgid "repository" +msgstr "repositorio" + +msgid "Last updated on" +msgstr "Ultima actualización en" + +msgid "Toggle navigation" +msgstr "Navegación de palanca" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro de la esfinge" + +msgid "suggest edit" +msgstr "sugerir editar" + +msgid "Open an issue" +msgstr "Abrir un problema" + +msgid "Launch" +msgstr "Lanzamiento" + +msgid "Fullscreen mode" +msgstr "Modo de pantalla completa" + +msgid "Edit this page" +msgstr "Edita esta página" + +msgid "By the" +msgstr "Por el" + +msgid "next page" +msgstr "siguiente página" diff --git a/_static/locales/et/LC_MESSAGES/booktheme.mo b/_static/locales/et/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..983b823 Binary files /dev/null and b/_static/locales/et/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/et/LC_MESSAGES/booktheme.po b/_static/locales/et/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..8680982 --- /dev/null +++ b/_static/locales/et/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: et\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Prindi PDF-i" + +msgid "Theme by the" +msgstr "Teema" + +msgid "Download source file" +msgstr "Laadige alla lähtefail" + +msgid "open issue" +msgstr "avatud küsimus" + +msgid "Contents" +msgstr "Sisu" + +msgid "previous page" +msgstr "eelmine leht" + +msgid "Download notebook file" +msgstr "Laadige sülearvuti fail alla" + +msgid "Copyright" +msgstr "Autoriõigus" + +msgid "Download this page" +msgstr "Laadige see leht alla" + +msgid "Source repository" +msgstr "Allikahoidla" + +msgid "By" +msgstr "Kõrval" + +msgid "repository" +msgstr "hoidla" + +msgid "Last updated on" +msgstr "Viimati uuendatud" + +msgid "Toggle navigation" +msgstr "Lülita navigeerimine sisse" + +msgid "Sphinx Book Theme" +msgstr "Sfinksiraamatu teema" + +msgid "suggest edit" +msgstr "soovita muuta" + +msgid "Open an issue" +msgstr "Avage probleem" + +msgid "Launch" +msgstr "Käivitage" + +msgid "Fullscreen mode" +msgstr "Täisekraanirežiim" + +msgid "Edit this page" +msgstr "Muutke seda lehte" + +msgid "By the" +msgstr "Autor" + +msgid "next page" +msgstr "järgmine leht" diff --git a/_static/locales/fi/LC_MESSAGES/booktheme.mo b/_static/locales/fi/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d8ac054 Binary files /dev/null and b/_static/locales/fi/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/fi/LC_MESSAGES/booktheme.po b/_static/locales/fi/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..34dac21 --- /dev/null +++ b/_static/locales/fi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Tulosta PDF-tiedostoon" + +msgid "Theme by the" +msgstr "Teeman tekijä" + +msgid "Download source file" +msgstr "Lataa lähdetiedosto" + +msgid "open issue" +msgstr "avoin ongelma" + +msgid "Contents" +msgstr "Sisällys" + +msgid "previous page" +msgstr "Edellinen sivu" + +msgid "Download notebook file" +msgstr "Lataa muistikirjatiedosto" + +msgid "Copyright" +msgstr "Tekijänoikeus" + +msgid "Download this page" +msgstr "Lataa tämä sivu" + +msgid "Source repository" +msgstr "Lähteen arkisto" + +msgid "By" +msgstr "Tekijä" + +msgid "repository" +msgstr "arkisto" + +msgid "Last updated on" +msgstr "Viimeksi päivitetty" + +msgid "Toggle navigation" +msgstr "Vaihda navigointia" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-kirjan teema" + +msgid "suggest edit" +msgstr "ehdottaa muokkausta" + +msgid "Open an issue" +msgstr "Avaa ongelma" + +msgid "Launch" +msgstr "Tuoda markkinoille" + +msgid "Fullscreen mode" +msgstr "Koko näytön tila" + +msgid "Edit this page" +msgstr "Muokkaa tätä sivua" + +msgid "By the" +msgstr "Mukaan" + +msgid "next page" +msgstr "seuraava sivu" diff --git a/_static/locales/fr/LC_MESSAGES/booktheme.mo b/_static/locales/fr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..f663d39 Binary files /dev/null and b/_static/locales/fr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/fr/LC_MESSAGES/booktheme.po b/_static/locales/fr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..8991a1b --- /dev/null +++ b/_static/locales/fr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimer au format PDF" + +msgid "Theme by the" +msgstr "Thème par le" + +msgid "Download source file" +msgstr "Télécharger le fichier source" + +msgid "open issue" +msgstr "signaler un problème" + +msgid "Contents" +msgstr "Contenu" + +msgid "previous page" +msgstr "page précédente" + +msgid "Download notebook file" +msgstr "Télécharger le fichier notebook" + +msgid "Copyright" +msgstr "droits d'auteur" + +msgid "Download this page" +msgstr "Téléchargez cette page" + +msgid "Source repository" +msgstr "Dépôt source" + +msgid "By" +msgstr "Par" + +msgid "repository" +msgstr "dépôt" + +msgid "Last updated on" +msgstr "Dernière mise à jour le" + +msgid "Toggle navigation" +msgstr "Basculer la navigation" + +msgid "Sphinx Book Theme" +msgstr "Thème du livre Sphinx" + +msgid "suggest edit" +msgstr "suggestion de modification" + +msgid "Open an issue" +msgstr "Ouvrez un problème" + +msgid "Launch" +msgstr "lancement" + +msgid "Fullscreen mode" +msgstr "Mode plein écran" + +msgid "Edit this page" +msgstr "Modifier cette page" + +msgid "By the" +msgstr "Par le" + +msgid "next page" +msgstr "page suivante" diff --git a/_static/locales/hr/LC_MESSAGES/booktheme.mo b/_static/locales/hr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..eca4a1a Binary files /dev/null and b/_static/locales/hr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/hr/LC_MESSAGES/booktheme.po b/_static/locales/hr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..42c4233 --- /dev/null +++ b/_static/locales/hr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: hr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Ispis u PDF" + +msgid "Theme by the" +msgstr "Tema autora" + +msgid "Download source file" +msgstr "Preuzmi izvornu datoteku" + +msgid "open issue" +msgstr "otvoreno izdanje" + +msgid "Contents" +msgstr "Sadržaj" + +msgid "previous page" +msgstr "Prethodna stranica" + +msgid "Download notebook file" +msgstr "Preuzmi datoteku bilježnice" + +msgid "Copyright" +msgstr "Autorska prava" + +msgid "Download this page" +msgstr "Preuzmite ovu stranicu" + +msgid "Source repository" +msgstr "Izvorno spremište" + +msgid "By" +msgstr "Po" + +msgid "repository" +msgstr "spremište" + +msgid "Last updated on" +msgstr "Posljednje ažuriranje:" + +msgid "Toggle navigation" +msgstr "Uključi / isključi navigaciju" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "suggest edit" +msgstr "predloži uređivanje" + +msgid "Open an issue" +msgstr "Otvorite izdanje" + +msgid "Launch" +msgstr "Pokrenite" + +msgid "Fullscreen mode" +msgstr "Način preko cijelog zaslona" + +msgid "Edit this page" +msgstr "Uredite ovu stranicu" + +msgid "By the" +msgstr "Od strane" + +msgid "next page" +msgstr "sljedeća stranica" diff --git a/_static/locales/id/LC_MESSAGES/booktheme.mo b/_static/locales/id/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d07a06a Binary files /dev/null and b/_static/locales/id/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/id/LC_MESSAGES/booktheme.po b/_static/locales/id/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..b8d8d89 --- /dev/null +++ b/_static/locales/id/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: id\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Download source file" +msgstr "Unduh file sumber" + +msgid "open issue" +msgstr "masalah terbuka" + +msgid "Contents" +msgstr "Isi" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "Download notebook file" +msgstr "Unduh file notebook" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download this page" +msgstr "Unduh halaman ini" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "By" +msgstr "Oleh" + +msgid "repository" +msgstr "gudang" + +msgid "Last updated on" +msgstr "Terakhir diperbarui saat" + +msgid "Toggle navigation" +msgstr "Alihkan navigasi" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "suggest edit" +msgstr "menyarankan edit" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Launch" +msgstr "Meluncurkan" + +msgid "Fullscreen mode" +msgstr "Mode layar penuh" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "By the" +msgstr "Oleh" + +msgid "next page" +msgstr "halaman selanjutnya" diff --git a/_static/locales/it/LC_MESSAGES/booktheme.mo b/_static/locales/it/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..53ba476 Binary files /dev/null and b/_static/locales/it/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/it/LC_MESSAGES/booktheme.po b/_static/locales/it/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..36fca59 --- /dev/null +++ b/_static/locales/it/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: it\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Stampa in PDF" + +msgid "Theme by the" +msgstr "Tema di" + +msgid "Download source file" +msgstr "Scarica il file sorgente" + +msgid "open issue" +msgstr "questione aperta" + +msgid "Contents" +msgstr "Contenuti" + +msgid "previous page" +msgstr "pagina precedente" + +msgid "Download notebook file" +msgstr "Scarica il file del taccuino" + +msgid "Copyright" +msgstr "Diritto d'autore" + +msgid "Download this page" +msgstr "Scarica questa pagina" + +msgid "Source repository" +msgstr "Repository di origine" + +msgid "By" +msgstr "Di" + +msgid "repository" +msgstr "repository" + +msgid "Last updated on" +msgstr "Ultimo aggiornamento il" + +msgid "Toggle navigation" +msgstr "Attiva / disattiva la navigazione" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro della Sfinge" + +msgid "suggest edit" +msgstr "suggerisci modifica" + +msgid "Open an issue" +msgstr "Apri un problema" + +msgid "Launch" +msgstr "Lanciare" + +msgid "Fullscreen mode" +msgstr "Modalità schermo intero" + +msgid "Edit this page" +msgstr "Modifica questa pagina" + +msgid "By the" +msgstr "Dal" + +msgid "next page" +msgstr "pagina successiva" diff --git a/_static/locales/iw/LC_MESSAGES/booktheme.mo b/_static/locales/iw/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..a45c657 Binary files /dev/null and b/_static/locales/iw/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/iw/LC_MESSAGES/booktheme.po b/_static/locales/iw/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..dede9cb --- /dev/null +++ b/_static/locales/iw/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: iw\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "הדפס לקובץ PDF" + +msgid "Theme by the" +msgstr "נושא מאת" + +msgid "Download source file" +msgstr "הורד את קובץ המקור" + +msgid "open issue" +msgstr "בעיה פתוחה" + +msgid "Contents" +msgstr "תוכן" + +msgid "previous page" +msgstr "עמוד קודם" + +msgid "Download notebook file" +msgstr "הורד קובץ מחברת" + +msgid "Copyright" +msgstr "זכויות יוצרים" + +msgid "Download this page" +msgstr "הורד דף זה" + +msgid "Source repository" +msgstr "מאגר המקורות" + +msgid "By" +msgstr "על ידי" + +msgid "repository" +msgstr "מאגר" + +msgid "Last updated on" +msgstr "עודכן לאחרונה ב" + +msgid "Toggle navigation" +msgstr "החלף ניווט" + +msgid "Sphinx Book Theme" +msgstr "נושא ספר ספינקס" + +msgid "suggest edit" +msgstr "מציע לערוך" + +msgid "Open an issue" +msgstr "פתח גיליון" + +msgid "Launch" +msgstr "לְהַשִׁיק" + +msgid "Fullscreen mode" +msgstr "מצב מסך מלא" + +msgid "Edit this page" +msgstr "ערוך דף זה" + +msgid "By the" +msgstr "דרך" + +msgid "next page" +msgstr "עמוד הבא" diff --git a/_static/locales/ja/LC_MESSAGES/booktheme.mo b/_static/locales/ja/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..1cefd29 Binary files /dev/null and b/_static/locales/ja/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ja/LC_MESSAGES/booktheme.po b/_static/locales/ja/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..2615f0d --- /dev/null +++ b/_static/locales/ja/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ja\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDFに印刷" + +msgid "Theme by the" +msgstr "のテーマ" + +msgid "Download source file" +msgstr "ソースファイルをダウンロード" + +msgid "open issue" +msgstr "未解決の問題" + +msgid "Contents" +msgstr "目次" + +msgid "previous page" +msgstr "前のページ" + +msgid "Download notebook file" +msgstr "ノートブックファイルをダウンロード" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "このページをダウンロード" + +msgid "Source repository" +msgstr "ソースリポジトリ" + +msgid "By" +msgstr "著者" + +msgid "repository" +msgstr "リポジトリ" + +msgid "Last updated on" +msgstr "最終更新日" + +msgid "Toggle navigation" +msgstr "ナビゲーションを切り替え" + +msgid "Sphinx Book Theme" +msgstr "スフィンクスの本のテーマ" + +msgid "suggest edit" +msgstr "編集を提案する" + +msgid "Open an issue" +msgstr "問題を報告" + +msgid "Launch" +msgstr "起動" + +msgid "Fullscreen mode" +msgstr "全画面モード" + +msgid "Edit this page" +msgstr "このページを編集" + +msgid "By the" +msgstr "によって" + +msgid "next page" +msgstr "次のページ" diff --git a/_static/locales/ko/LC_MESSAGES/booktheme.mo b/_static/locales/ko/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..06c7ec9 Binary files /dev/null and b/_static/locales/ko/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ko/LC_MESSAGES/booktheme.po b/_static/locales/ko/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..c9e13a4 --- /dev/null +++ b/_static/locales/ko/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ko\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF로 인쇄" + +msgid "Theme by the" +msgstr "테마별" + +msgid "Download source file" +msgstr "소스 파일 다운로드" + +msgid "open issue" +msgstr "열린 문제" + +msgid "Contents" +msgstr "내용" + +msgid "previous page" +msgstr "이전 페이지" + +msgid "Download notebook file" +msgstr "노트북 파일 다운로드" + +msgid "Copyright" +msgstr "저작권" + +msgid "Download this page" +msgstr "이 페이지 다운로드" + +msgid "Source repository" +msgstr "소스 저장소" + +msgid "By" +msgstr "으로" + +msgid "repository" +msgstr "저장소" + +msgid "Last updated on" +msgstr "마지막 업데이트" + +msgid "Toggle navigation" +msgstr "탐색 전환" + +msgid "Sphinx Book Theme" +msgstr "스핑크스 도서 테마" + +msgid "suggest edit" +msgstr "편집 제안" + +msgid "Open an issue" +msgstr "이슈 열기" + +msgid "Launch" +msgstr "시작하다" + +msgid "Fullscreen mode" +msgstr "전체 화면으로보기" + +msgid "Edit this page" +msgstr "이 페이지 편집" + +msgid "By the" +msgstr "에 의해" + +msgid "next page" +msgstr "다음 페이지" diff --git a/_static/locales/lt/LC_MESSAGES/booktheme.mo b/_static/locales/lt/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..4468ba0 Binary files /dev/null and b/_static/locales/lt/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/lt/LC_MESSAGES/booktheme.po b/_static/locales/lt/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..35eabd9 --- /dev/null +++ b/_static/locales/lt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Spausdinti į PDF" + +msgid "Theme by the" +msgstr "Tema" + +msgid "Download source file" +msgstr "Atsisiųsti šaltinio failą" + +msgid "open issue" +msgstr "atviras klausimas" + +msgid "Contents" +msgstr "Turinys" + +msgid "previous page" +msgstr "Ankstesnis puslapis" + +msgid "Download notebook file" +msgstr "Atsisiųsti nešiojamojo kompiuterio failą" + +msgid "Copyright" +msgstr "Autorių teisės" + +msgid "Download this page" +msgstr "Atsisiųskite šį puslapį" + +msgid "Source repository" +msgstr "Šaltinio saugykla" + +msgid "By" +msgstr "Iki" + +msgid "repository" +msgstr "saugykla" + +msgid "Last updated on" +msgstr "Paskutinį kartą atnaujinta" + +msgid "Toggle navigation" +msgstr "Perjungti naršymą" + +msgid "Sphinx Book Theme" +msgstr "Sfinkso knygos tema" + +msgid "suggest edit" +msgstr "pasiūlyti redaguoti" + +msgid "Open an issue" +msgstr "Atidarykite problemą" + +msgid "Launch" +msgstr "Paleiskite" + +msgid "Fullscreen mode" +msgstr "Pilno ekrano režimas" + +msgid "Edit this page" +msgstr "Redaguoti šį puslapį" + +msgid "By the" +msgstr "Prie" + +msgid "next page" +msgstr "Kitas puslapis" diff --git a/_static/locales/lv/LC_MESSAGES/booktheme.mo b/_static/locales/lv/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..74aa4d8 Binary files /dev/null and b/_static/locales/lv/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/lv/LC_MESSAGES/booktheme.po b/_static/locales/lv/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..ee1bd08 --- /dev/null +++ b/_static/locales/lv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Drukāt PDF formātā" + +msgid "Theme by the" +msgstr "Autora tēma" + +msgid "Download source file" +msgstr "Lejupielādēt avota failu" + +msgid "open issue" +msgstr "atklāts jautājums" + +msgid "Contents" +msgstr "Saturs" + +msgid "previous page" +msgstr "iepriekšējā lapa" + +msgid "Download notebook file" +msgstr "Lejupielādēt piezīmju grāmatiņu" + +msgid "Copyright" +msgstr "Autortiesības" + +msgid "Download this page" +msgstr "Lejupielādējiet šo lapu" + +msgid "Source repository" +msgstr "Avota krātuve" + +msgid "By" +msgstr "Autors" + +msgid "repository" +msgstr "krātuve" + +msgid "Last updated on" +msgstr "Pēdējoreiz atjaunināts" + +msgid "Toggle navigation" +msgstr "Pārslēgt navigāciju" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa grāmatas tēma" + +msgid "suggest edit" +msgstr "ieteikt rediģēt" + +msgid "Open an issue" +msgstr "Atveriet problēmu" + +msgid "Launch" +msgstr "Uzsākt" + +msgid "Fullscreen mode" +msgstr "Pilnekrāna režīms" + +msgid "Edit this page" +msgstr "Rediģēt šo lapu" + +msgid "By the" +msgstr "Ar" + +msgid "next page" +msgstr "nākamā lapaspuse" diff --git a/_static/locales/ml/LC_MESSAGES/booktheme.mo b/_static/locales/ml/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..2736e8f Binary files /dev/null and b/_static/locales/ml/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ml/LC_MESSAGES/booktheme.po b/_static/locales/ml/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..d471277 --- /dev/null +++ b/_static/locales/ml/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ml\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF- ലേക്ക് പ്രിന്റുചെയ്യുക" + +msgid "Theme by the" +msgstr "പ്രമേയം" + +msgid "Download source file" +msgstr "ഉറവിട ഫയൽ ഡൗൺലോഡുചെയ്യുക" + +msgid "open issue" +msgstr "തുറന്ന പ്രശ്നം" + +msgid "previous page" +msgstr "മുൻപത്തെ താൾ" + +msgid "Download notebook file" +msgstr "നോട്ട്ബുക്ക് ഫയൽ ഡൺലോഡ് ചെയ്യുക" + +msgid "Copyright" +msgstr "പകർപ്പവകാശം" + +msgid "Download this page" +msgstr "ഈ പേജ് ഡൗൺലോഡുചെയ്യുക" + +msgid "Source repository" +msgstr "ഉറവിട ശേഖരം" + +msgid "By" +msgstr "എഴുതിയത്" + +msgid "Last updated on" +msgstr "അവസാനം അപ്‌ഡേറ്റുചെയ്‌തത്" + +msgid "Toggle navigation" +msgstr "നാവിഗേഷൻ ടോഗിൾ ചെയ്യുക" + +msgid "Sphinx Book Theme" +msgstr "സ്ഫിങ്ക്സ് പുസ്തക തീം" + +msgid "suggest edit" +msgstr "എഡിറ്റുചെയ്യാൻ നിർദ്ദേശിക്കുക" + +msgid "Open an issue" +msgstr "ഒരു പ്രശ്നം തുറക്കുക" + +msgid "Launch" +msgstr "സമാരംഭിക്കുക" + +msgid "Edit this page" +msgstr "ഈ പേജ് എഡിറ്റുചെയ്യുക" + +msgid "By the" +msgstr "എഴുതിയത്" + +msgid "next page" +msgstr "അടുത്ത പേജ്" diff --git a/_static/locales/mr/LC_MESSAGES/booktheme.mo b/_static/locales/mr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..fe53010 Binary files /dev/null and b/_static/locales/mr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/mr/LC_MESSAGES/booktheme.po b/_static/locales/mr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..f3694ac --- /dev/null +++ b/_static/locales/mr/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: mr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "पीडीएफवर मुद्रित करा" + +msgid "Theme by the" +msgstr "द्वारा थीम" + +msgid "Download source file" +msgstr "स्त्रोत फाइल डाउनलोड करा" + +msgid "open issue" +msgstr "खुला मुद्दा" + +msgid "previous page" +msgstr "मागील पान" + +msgid "Download notebook file" +msgstr "नोटबुक फाईल डाउनलोड करा" + +msgid "Copyright" +msgstr "कॉपीराइट" + +msgid "Download this page" +msgstr "हे पृष्ठ डाउनलोड करा" + +msgid "Source repository" +msgstr "स्त्रोत भांडार" + +msgid "By" +msgstr "द्वारा" + +msgid "Last updated on" +msgstr "अखेरचे अद्यतनित" + +msgid "Toggle navigation" +msgstr "नेव्हिगेशन टॉगल करा" + +msgid "Sphinx Book Theme" +msgstr "स्फिंक्स बुक थीम" + +msgid "suggest edit" +msgstr "संपादन सुचवा" + +msgid "Open an issue" +msgstr "एक मुद्दा उघडा" + +msgid "Launch" +msgstr "लाँच करा" + +msgid "Edit this page" +msgstr "हे पृष्ठ संपादित करा" + +msgid "By the" +msgstr "द्वारा" + +msgid "next page" +msgstr "पुढील पृष्ठ" diff --git a/_static/locales/ms/LC_MESSAGES/booktheme.mo b/_static/locales/ms/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..f02603f Binary files /dev/null and b/_static/locales/ms/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ms/LC_MESSAGES/booktheme.po b/_static/locales/ms/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..65b7c60 --- /dev/null +++ b/_static/locales/ms/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ms\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Download source file" +msgstr "Muat turun fail sumber" + +msgid "open issue" +msgstr "isu terbuka" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "Download notebook file" +msgstr "Muat turun fail buku nota" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download this page" +msgstr "Muat turun halaman ini" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "By" +msgstr "Oleh" + +msgid "Last updated on" +msgstr "Terakhir dikemas kini pada" + +msgid "Toggle navigation" +msgstr "Togol navigasi" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "suggest edit" +msgstr "cadangkan edit" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Launch" +msgstr "Lancarkan" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "By the" +msgstr "Oleh" + +msgid "next page" +msgstr "muka surat seterusnya" diff --git a/_static/locales/nl/LC_MESSAGES/booktheme.mo b/_static/locales/nl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..e59e7ec Binary files /dev/null and b/_static/locales/nl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/nl/LC_MESSAGES/booktheme.po b/_static/locales/nl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..71bd1cd --- /dev/null +++ b/_static/locales/nl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: nl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Afdrukken naar pdf" + +msgid "Theme by the" +msgstr "Thema door de" + +msgid "Download source file" +msgstr "Download het bronbestand" + +msgid "open issue" +msgstr "open probleem" + +msgid "Contents" +msgstr "Inhoud" + +msgid "previous page" +msgstr "vorige pagina" + +msgid "Download notebook file" +msgstr "Download notebookbestand" + +msgid "Copyright" +msgstr "auteursrechten" + +msgid "Download this page" +msgstr "Download deze pagina" + +msgid "Source repository" +msgstr "Bronopslagplaats" + +msgid "By" +msgstr "Door" + +msgid "repository" +msgstr "repository" + +msgid "Last updated on" +msgstr "Laatst geupdate op" + +msgid "Toggle navigation" +msgstr "Schakel navigatie" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-boekthema" + +msgid "suggest edit" +msgstr "suggereren bewerken" + +msgid "Open an issue" +msgstr "Open een probleem" + +msgid "Launch" +msgstr "Lancering" + +msgid "Fullscreen mode" +msgstr "Volledig scherm" + +msgid "Edit this page" +msgstr "bewerk deze pagina" + +msgid "By the" +msgstr "Door de" + +msgid "next page" +msgstr "volgende bladzijde" diff --git a/_static/locales/no/LC_MESSAGES/booktheme.mo b/_static/locales/no/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..6cd15c8 Binary files /dev/null and b/_static/locales/no/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/no/LC_MESSAGES/booktheme.po b/_static/locales/no/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..b21346a --- /dev/null +++ b/_static/locales/no/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: no\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Skriv ut til PDF" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Download source file" +msgstr "Last ned kildefilen" + +msgid "open issue" +msgstr "åpent nummer" + +msgid "Contents" +msgstr "Innhold" + +msgid "previous page" +msgstr "forrige side" + +msgid "Download notebook file" +msgstr "Last ned notatbokfilen" + +msgid "Copyright" +msgstr "opphavsrett" + +msgid "Download this page" +msgstr "Last ned denne siden" + +msgid "Source repository" +msgstr "Kildedepot" + +msgid "By" +msgstr "Av" + +msgid "repository" +msgstr "oppbevaringssted" + +msgid "Last updated on" +msgstr "Sist oppdatert den" + +msgid "Toggle navigation" +msgstr "Bytt navigasjon" + +msgid "Sphinx Book Theme" +msgstr "Sphinx boktema" + +msgid "suggest edit" +msgstr "foreslå redigering" + +msgid "Open an issue" +msgstr "Åpne et problem" + +msgid "Launch" +msgstr "Start" + +msgid "Fullscreen mode" +msgstr "Fullskjerm-modus" + +msgid "Edit this page" +msgstr "Rediger denne siden" + +msgid "By the" +msgstr "Ved" + +msgid "next page" +msgstr "neste side" diff --git a/_static/locales/pl/LC_MESSAGES/booktheme.mo b/_static/locales/pl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..9ebb584 Binary files /dev/null and b/_static/locales/pl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/pl/LC_MESSAGES/booktheme.po b/_static/locales/pl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..1b7233f --- /dev/null +++ b/_static/locales/pl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Drukuj do PDF" + +msgid "Theme by the" +msgstr "Motyw autorstwa" + +msgid "Download source file" +msgstr "Pobierz plik źródłowy" + +msgid "open issue" +msgstr "otwarty problem" + +msgid "Contents" +msgstr "Zawartość" + +msgid "previous page" +msgstr "Poprzednia strona" + +msgid "Download notebook file" +msgstr "Pobierz plik notatnika" + +msgid "Copyright" +msgstr "prawa autorskie" + +msgid "Download this page" +msgstr "Pobierz tę stronę" + +msgid "Source repository" +msgstr "Repozytorium źródłowe" + +msgid "By" +msgstr "Przez" + +msgid "repository" +msgstr "magazyn" + +msgid "Last updated on" +msgstr "Ostatnia aktualizacja" + +msgid "Toggle navigation" +msgstr "Przełącz nawigację" + +msgid "Sphinx Book Theme" +msgstr "Motyw książki Sphinx" + +msgid "suggest edit" +msgstr "zaproponuj edycję" + +msgid "Open an issue" +msgstr "Otwórz problem" + +msgid "Launch" +msgstr "Uruchomić" + +msgid "Fullscreen mode" +msgstr "Pełny ekran" + +msgid "Edit this page" +msgstr "Edytuj tę strone" + +msgid "By the" +msgstr "Przez" + +msgid "next page" +msgstr "Następna strona" diff --git a/_static/locales/pt/LC_MESSAGES/booktheme.mo b/_static/locales/pt/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d0ddb87 Binary files /dev/null and b/_static/locales/pt/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/pt/LC_MESSAGES/booktheme.po b/_static/locales/pt/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..1b27314 --- /dev/null +++ b/_static/locales/pt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimir em PDF" + +msgid "Theme by the" +msgstr "Tema por" + +msgid "Download source file" +msgstr "Baixar arquivo fonte" + +msgid "open issue" +msgstr "questão aberta" + +msgid "Contents" +msgstr "Conteúdo" + +msgid "previous page" +msgstr "página anterior" + +msgid "Download notebook file" +msgstr "Baixar arquivo de notebook" + +msgid "Copyright" +msgstr "direito autoral" + +msgid "Download this page" +msgstr "Baixe esta página" + +msgid "Source repository" +msgstr "Repositório fonte" + +msgid "By" +msgstr "De" + +msgid "repository" +msgstr "repositório" + +msgid "Last updated on" +msgstr "Última atualização em" + +msgid "Toggle navigation" +msgstr "Alternar de navegação" + +msgid "Sphinx Book Theme" +msgstr "Tema do livro Sphinx" + +msgid "suggest edit" +msgstr "sugerir edição" + +msgid "Open an issue" +msgstr "Abra um problema" + +msgid "Launch" +msgstr "Lançamento" + +msgid "Fullscreen mode" +msgstr "Modo tela cheia" + +msgid "Edit this page" +msgstr "Edite essa página" + +msgid "By the" +msgstr "Pelo" + +msgid "next page" +msgstr "próxima página" diff --git a/_static/locales/ro/LC_MESSAGES/booktheme.mo b/_static/locales/ro/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..3c36ab1 Binary files /dev/null and b/_static/locales/ro/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ro/LC_MESSAGES/booktheme.po b/_static/locales/ro/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..1783ad2 --- /dev/null +++ b/_static/locales/ro/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ro\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimați în PDF" + +msgid "Theme by the" +msgstr "Tema de" + +msgid "Download source file" +msgstr "Descărcați fișierul sursă" + +msgid "open issue" +msgstr "problema deschisă" + +msgid "Contents" +msgstr "Cuprins" + +msgid "previous page" +msgstr "pagina anterioară" + +msgid "Download notebook file" +msgstr "Descărcați fișierul notebook" + +msgid "Copyright" +msgstr "Drepturi de autor" + +msgid "Download this page" +msgstr "Descarcă această pagină" + +msgid "Source repository" +msgstr "Depozit sursă" + +msgid "By" +msgstr "De" + +msgid "repository" +msgstr "repertoriu" + +msgid "Last updated on" +msgstr "Ultima actualizare la" + +msgid "Toggle navigation" +msgstr "Comutare navigare" + +msgid "Sphinx Book Theme" +msgstr "Tema Sphinx Book" + +msgid "suggest edit" +msgstr "sugerează editare" + +msgid "Open an issue" +msgstr "Deschideți o problemă" + +msgid "Launch" +msgstr "Lansa" + +msgid "Fullscreen mode" +msgstr "Modul ecran întreg" + +msgid "Edit this page" +msgstr "Editați această pagină" + +msgid "By the" +msgstr "Langa" + +msgid "next page" +msgstr "pagina următoare" diff --git a/_static/locales/ru/LC_MESSAGES/booktheme.mo b/_static/locales/ru/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..6b8ca41 Binary files /dev/null and b/_static/locales/ru/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ru/LC_MESSAGES/booktheme.po b/_static/locales/ru/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..b1176b7 --- /dev/null +++ b/_static/locales/ru/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ru\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Распечатать в PDF" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Download source file" +msgstr "Скачать исходный файл" + +msgid "open issue" +msgstr "открытый вопрос" + +msgid "Contents" +msgstr "Содержание" + +msgid "previous page" +msgstr "Предыдущая страница" + +msgid "Download notebook file" +msgstr "Скачать файл записной книжки" + +msgid "Copyright" +msgstr "авторское право" + +msgid "Download this page" +msgstr "Загрузите эту страницу" + +msgid "Source repository" +msgstr "Исходный репозиторий" + +msgid "By" +msgstr "По" + +msgid "repository" +msgstr "хранилище" + +msgid "Last updated on" +msgstr "Последнее обновление" + +msgid "Toggle navigation" +msgstr "Переключить навигацию" + +msgid "Sphinx Book Theme" +msgstr "Тема книги Сфинкс" + +msgid "suggest edit" +msgstr "предложить редактировать" + +msgid "Open an issue" +msgstr "Открыть вопрос" + +msgid "Launch" +msgstr "Запуск" + +msgid "Fullscreen mode" +msgstr "Полноэкранный режим" + +msgid "Edit this page" +msgstr "Редактировать эту страницу" + +msgid "By the" +msgstr "Посредством" + +msgid "next page" +msgstr "Следующая страница" diff --git a/_static/locales/sk/LC_MESSAGES/booktheme.mo b/_static/locales/sk/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..59bd0dd Binary files /dev/null and b/_static/locales/sk/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sk/LC_MESSAGES/booktheme.po b/_static/locales/sk/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..6501288 --- /dev/null +++ b/_static/locales/sk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Tlač do PDF" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Download source file" +msgstr "Stiahnite si zdrojový súbor" + +msgid "open issue" +msgstr "otvorené vydanie" + +msgid "Contents" +msgstr "Obsah" + +msgid "previous page" +msgstr "predchádzajúca strana" + +msgid "Download notebook file" +msgstr "Stiahnite si zošit" + +msgid "Copyright" +msgstr "Autorské práva" + +msgid "Download this page" +msgstr "Stiahnite si túto stránku" + +msgid "Source repository" +msgstr "Zdrojové úložisko" + +msgid "By" +msgstr "Autor:" + +msgid "repository" +msgstr "Úložisko" + +msgid "Last updated on" +msgstr "Posledná aktualizácia dňa" + +msgid "Toggle navigation" +msgstr "Prepnúť navigáciu" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "suggest edit" +msgstr "navrhnúť úpravu" + +msgid "Open an issue" +msgstr "Otvorte problém" + +msgid "Launch" +msgstr "Spustiť" + +msgid "Fullscreen mode" +msgstr "Režim celej obrazovky" + +msgid "Edit this page" +msgstr "Upraviť túto stránku" + +msgid "By the" +msgstr "Podľa" + +msgid "next page" +msgstr "ďalšia strana" diff --git a/_static/locales/sl/LC_MESSAGES/booktheme.mo b/_static/locales/sl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..87bf26d Binary files /dev/null and b/_static/locales/sl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sl/LC_MESSAGES/booktheme.po b/_static/locales/sl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..3c7e3a8 --- /dev/null +++ b/_static/locales/sl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Natisni v PDF" + +msgid "Theme by the" +msgstr "Tema avtorja" + +msgid "Download source file" +msgstr "Prenesite izvorno datoteko" + +msgid "open issue" +msgstr "odprto vprašanje" + +msgid "Contents" +msgstr "Vsebina" + +msgid "previous page" +msgstr "Prejšnja stran" + +msgid "Download notebook file" +msgstr "Prenesite datoteko zvezka" + +msgid "Copyright" +msgstr "avtorske pravice" + +msgid "Download this page" +msgstr "Prenesite to stran" + +msgid "Source repository" +msgstr "Izvorno skladišče" + +msgid "By" +msgstr "Avtor" + +msgid "repository" +msgstr "odlagališče" + +msgid "Last updated on" +msgstr "Nazadnje posodobljeno dne" + +msgid "Toggle navigation" +msgstr "Preklopi navigacijo" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "suggest edit" +msgstr "predlagajte urejanje" + +msgid "Open an issue" +msgstr "Odprite številko" + +msgid "Launch" +msgstr "Kosilo" + +msgid "Fullscreen mode" +msgstr "Celozaslonski način" + +msgid "Edit this page" +msgstr "Uredite to stran" + +msgid "By the" +msgstr "Avtor" + +msgid "next page" +msgstr "Naslednja stran" diff --git a/_static/locales/sr/LC_MESSAGES/booktheme.mo b/_static/locales/sr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..ec740f4 Binary files /dev/null and b/_static/locales/sr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sr/LC_MESSAGES/booktheme.po b/_static/locales/sr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..773b8ad --- /dev/null +++ b/_static/locales/sr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Испис у ПДФ" + +msgid "Theme by the" +msgstr "Тхеме би" + +msgid "Download source file" +msgstr "Преузми изворну датотеку" + +msgid "open issue" +msgstr "отворено издање" + +msgid "Contents" +msgstr "Садржај" + +msgid "previous page" +msgstr "Претходна страница" + +msgid "Download notebook file" +msgstr "Преузмите датотеку бележнице" + +msgid "Copyright" +msgstr "Ауторско право" + +msgid "Download this page" +msgstr "Преузмите ову страницу" + +msgid "Source repository" +msgstr "Изворно спремиште" + +msgid "By" +msgstr "Од стране" + +msgid "repository" +msgstr "спремиште" + +msgid "Last updated on" +msgstr "Последње ажурирање" + +msgid "Toggle navigation" +msgstr "Укључи / искључи навигацију" + +msgid "Sphinx Book Theme" +msgstr "Тема књиге Спхинк" + +msgid "suggest edit" +msgstr "предложи уређивање" + +msgid "Open an issue" +msgstr "Отворите издање" + +msgid "Launch" +msgstr "Лансирање" + +msgid "Fullscreen mode" +msgstr "Режим целог екрана" + +msgid "Edit this page" +msgstr "Уредите ову страницу" + +msgid "By the" +msgstr "Од" + +msgid "next page" +msgstr "Следећа страна" diff --git a/_static/locales/sv/LC_MESSAGES/booktheme.mo b/_static/locales/sv/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..b07dc76 Binary files /dev/null and b/_static/locales/sv/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sv/LC_MESSAGES/booktheme.po b/_static/locales/sv/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..bcac54c --- /dev/null +++ b/_static/locales/sv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Skriv ut till PDF" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Download source file" +msgstr "Ladda ner källfil" + +msgid "open issue" +msgstr "öppna problemrapport" + +msgid "Contents" +msgstr "Innehåll" + +msgid "previous page" +msgstr "föregående sida" + +msgid "Download notebook file" +msgstr "Ladda ner notebook-fil" + +msgid "Copyright" +msgstr "Upphovsrätt" + +msgid "Download this page" +msgstr "Ladda ner den här sidan" + +msgid "Source repository" +msgstr "Källkodsrepositorium" + +msgid "By" +msgstr "Av" + +msgid "repository" +msgstr "repositorium" + +msgid "Last updated on" +msgstr "Senast uppdaterad den" + +msgid "Toggle navigation" +msgstr "Växla navigering" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Boktema" + +msgid "suggest edit" +msgstr "föreslå ändring" + +msgid "Open an issue" +msgstr "Öppna en problemrapport" + +msgid "Launch" +msgstr "Öppna" + +msgid "Fullscreen mode" +msgstr "Fullskärmsläge" + +msgid "Edit this page" +msgstr "Redigera den här sidan" + +msgid "By the" +msgstr "Av den" + +msgid "next page" +msgstr "nästa sida" diff --git a/_static/locales/ta/LC_MESSAGES/booktheme.mo b/_static/locales/ta/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..29f52e1 Binary files /dev/null and b/_static/locales/ta/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ta/LC_MESSAGES/booktheme.po b/_static/locales/ta/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..b48bdfa --- /dev/null +++ b/_static/locales/ta/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ta\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF இல் அச்சிடுக" + +msgid "Theme by the" +msgstr "வழங்கிய தீம்" + +msgid "Download source file" +msgstr "மூல கோப்பைப் பதிவிறக்குக" + +msgid "open issue" +msgstr "திறந்த பிரச்சினை" + +msgid "previous page" +msgstr "முந்தைய பக்கம்" + +msgid "Download notebook file" +msgstr "நோட்புக் கோப்பைப் பதிவிறக்கவும்" + +msgid "Copyright" +msgstr "பதிப்புரிமை" + +msgid "Download this page" +msgstr "இந்தப் பக்கத்தைப் பதிவிறக்கவும்" + +msgid "Source repository" +msgstr "மூல களஞ்சியம்" + +msgid "By" +msgstr "வழங்கியவர்" + +msgid "Last updated on" +msgstr "கடைசியாக புதுப்பிக்கப்பட்டது" + +msgid "Toggle navigation" +msgstr "வழிசெலுத்தலை நிலைமாற்று" + +msgid "Sphinx Book Theme" +msgstr "ஸ்பிங்க்ஸ் புத்தக தீம்" + +msgid "suggest edit" +msgstr "திருத்த பரிந்துரைக்கவும்" + +msgid "Open an issue" +msgstr "சிக்கலைத் திறக்கவும்" + +msgid "Launch" +msgstr "தொடங்க" + +msgid "Edit this page" +msgstr "இந்தப் பக்கத்தைத் திருத்தவும்" + +msgid "By the" +msgstr "மூலம்" + +msgid "next page" +msgstr "அடுத்த பக்கம்" diff --git a/_static/locales/te/LC_MESSAGES/booktheme.mo b/_static/locales/te/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..0a5f4b4 Binary files /dev/null and b/_static/locales/te/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/te/LC_MESSAGES/booktheme.po b/_static/locales/te/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..952278f --- /dev/null +++ b/_static/locales/te/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: te\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF కి ముద్రించండి" + +msgid "Theme by the" +msgstr "ద్వారా థీమ్" + +msgid "Download source file" +msgstr "మూల ఫైల్‌ను డౌన్‌లోడ్ చేయండి" + +msgid "open issue" +msgstr "ఓపెన్ ఇష్యూ" + +msgid "previous page" +msgstr "ముందు పేజి" + +msgid "Download notebook file" +msgstr "నోట్బుక్ ఫైల్ను డౌన్లోడ్ చేయండి" + +msgid "Copyright" +msgstr "కాపీరైట్" + +msgid "Download this page" +msgstr "ఈ పేజీని డౌన్‌లోడ్ చేయండి" + +msgid "Source repository" +msgstr "మూల రిపోజిటరీ" + +msgid "By" +msgstr "ద్వారా" + +msgid "Last updated on" +msgstr "చివరిగా నవీకరించబడింది" + +msgid "Toggle navigation" +msgstr "నావిగేషన్‌ను టోగుల్ చేయండి" + +msgid "Sphinx Book Theme" +msgstr "సింహిక పుస్తక థీమ్" + +msgid "suggest edit" +msgstr "సవరించమని సూచించండి" + +msgid "Open an issue" +msgstr "సమస్యను తెరవండి" + +msgid "Launch" +msgstr "ప్రారంభించండి" + +msgid "Edit this page" +msgstr "ఈ పేజీని సవరించండి" + +msgid "By the" +msgstr "ద్వారా" + +msgid "next page" +msgstr "తరువాతి పేజీ" diff --git a/_static/locales/tg/LC_MESSAGES/booktheme.mo b/_static/locales/tg/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..b21c6c6 Binary files /dev/null and b/_static/locales/tg/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/tg/LC_MESSAGES/booktheme.po b/_static/locales/tg/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..c33dc42 --- /dev/null +++ b/_static/locales/tg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Чоп ба PDF" + +msgid "Theme by the" +msgstr "Мавзӯъи аз" + +msgid "Download source file" +msgstr "Файли манбаъро зеркашӣ кунед" + +msgid "open issue" +msgstr "барориши кушод" + +msgid "Contents" +msgstr "Мундариҷа" + +msgid "previous page" +msgstr "саҳифаи қаблӣ" + +msgid "Download notebook file" +msgstr "Файли дафтарро зеркашӣ кунед" + +msgid "Copyright" +msgstr "Ҳуқуқи муаллиф" + +msgid "Download this page" +msgstr "Ин саҳифаро зеркашӣ кунед" + +msgid "Source repository" +msgstr "Анбори манбаъ" + +msgid "By" +msgstr "Бо" + +msgid "repository" +msgstr "анбор" + +msgid "Last updated on" +msgstr "Last навсозӣ дар" + +msgid "Toggle navigation" +msgstr "Гузаришро иваз кунед" + +msgid "Sphinx Book Theme" +msgstr "Сфинкс Мавзӯи китоб" + +msgid "suggest edit" +msgstr "пешниҳод вироиш" + +msgid "Open an issue" +msgstr "Масъаларо кушоед" + +msgid "Launch" +msgstr "Оғоз" + +msgid "Fullscreen mode" +msgstr "Ҳолати экрани пурра" + +msgid "Edit this page" +msgstr "Ин саҳифаро таҳрир кунед" + +msgid "By the" +msgstr "Бо" + +msgid "next page" +msgstr "саҳифаи оянда" diff --git a/_static/locales/th/LC_MESSAGES/booktheme.mo b/_static/locales/th/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..abede98 Binary files /dev/null and b/_static/locales/th/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/th/LC_MESSAGES/booktheme.po b/_static/locales/th/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..9d24294 --- /dev/null +++ b/_static/locales/th/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: th\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "พิมพ์เป็น PDF" + +msgid "Theme by the" +msgstr "ธีมโดย" + +msgid "Download source file" +msgstr "ดาวน์โหลดไฟล์ต้นฉบับ" + +msgid "open issue" +msgstr "เปิดปัญหา" + +msgid "Contents" +msgstr "สารบัญ" + +msgid "previous page" +msgstr "หน้าที่แล้ว" + +msgid "Download notebook file" +msgstr "ดาวน์โหลดไฟล์สมุดบันทึก" + +msgid "Copyright" +msgstr "ลิขสิทธิ์" + +msgid "Download this page" +msgstr "ดาวน์โหลดหน้านี้" + +msgid "Source repository" +msgstr "ที่เก็บซอร์ส" + +msgid "By" +msgstr "โดย" + +msgid "repository" +msgstr "ที่เก็บ" + +msgid "Last updated on" +msgstr "ปรับปรุงล่าสุดเมื่อ" + +msgid "Toggle navigation" +msgstr "ไม่ต้องสลับช่องทาง" + +msgid "Sphinx Book Theme" +msgstr "ธีมหนังสือสฟิงซ์" + +msgid "suggest edit" +msgstr "แนะนำแก้ไข" + +msgid "Open an issue" +msgstr "เปิดปัญหา" + +msgid "Launch" +msgstr "เปิด" + +msgid "Fullscreen mode" +msgstr "โหมดเต็มหน้าจอ" + +msgid "Edit this page" +msgstr "แก้ไขหน้านี้" + +msgid "By the" +msgstr "โดย" + +msgid "next page" +msgstr "หน้าต่อไป" diff --git a/_static/locales/tl/LC_MESSAGES/booktheme.mo b/_static/locales/tl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..8df1b73 Binary files /dev/null and b/_static/locales/tl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/tl/LC_MESSAGES/booktheme.po b/_static/locales/tl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..20e0d07 --- /dev/null +++ b/_static/locales/tl/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "I-print sa PDF" + +msgid "Theme by the" +msgstr "Tema ng" + +msgid "Download source file" +msgstr "Mag-download ng file ng pinagmulan" + +msgid "open issue" +msgstr "bukas na isyu" + +msgid "previous page" +msgstr "Nakaraang pahina" + +msgid "Download notebook file" +msgstr "Mag-download ng file ng notebook" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "I-download ang pahinang ito" + +msgid "Source repository" +msgstr "Pinagmulan ng imbakan" + +msgid "By" +msgstr "Ni" + +msgid "Last updated on" +msgstr "Huling na-update noong" + +msgid "Toggle navigation" +msgstr "I-toggle ang pag-navigate" + +msgid "Sphinx Book Theme" +msgstr "Tema ng Sphinx Book" + +msgid "suggest edit" +msgstr "iminumungkahi i-edit" + +msgid "Open an issue" +msgstr "Magbukas ng isyu" + +msgid "Launch" +msgstr "Ilunsad" + +msgid "Edit this page" +msgstr "I-edit ang pahinang ito" + +msgid "By the" +msgstr "Sa pamamagitan ng" + +msgid "next page" +msgstr "Susunod na pahina" diff --git a/_static/locales/tr/LC_MESSAGES/booktheme.mo b/_static/locales/tr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..029ae18 Binary files /dev/null and b/_static/locales/tr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/tr/LC_MESSAGES/booktheme.po b/_static/locales/tr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..a77eb02 --- /dev/null +++ b/_static/locales/tr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF olarak yazdır" + +msgid "Theme by the" +msgstr "Tarafından tema" + +msgid "Download source file" +msgstr "Kaynak dosyayı indirin" + +msgid "open issue" +msgstr "Açık konu" + +msgid "Contents" +msgstr "İçindekiler" + +msgid "previous page" +msgstr "önceki sayfa" + +msgid "Download notebook file" +msgstr "Defter dosyasını indirin" + +msgid "Copyright" +msgstr "Telif hakkı" + +msgid "Download this page" +msgstr "Bu sayfayı indirin" + +msgid "Source repository" +msgstr "Kaynak kod deposu" + +msgid "By" +msgstr "Tarafından" + +msgid "repository" +msgstr "depo" + +msgid "Last updated on" +msgstr "Son güncelleme tarihi" + +msgid "Toggle navigation" +msgstr "Gezinmeyi değiştir" + +msgid "Sphinx Book Theme" +msgstr "Sfenks Kitap Teması" + +msgid "suggest edit" +msgstr "düzenleme öner" + +msgid "Open an issue" +msgstr "Bir sorunu açın" + +msgid "Launch" +msgstr "Başlatmak" + +msgid "Fullscreen mode" +msgstr "Tam ekran modu" + +msgid "Edit this page" +msgstr "Bu sayfayı düzenle" + +msgid "By the" +msgstr "Tarafından" + +msgid "next page" +msgstr "sonraki Sayfa" diff --git a/_static/locales/uk/LC_MESSAGES/booktheme.mo b/_static/locales/uk/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..16ab789 Binary files /dev/null and b/_static/locales/uk/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/uk/LC_MESSAGES/booktheme.po b/_static/locales/uk/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..993dd07 --- /dev/null +++ b/_static/locales/uk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: uk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Друк у форматі PDF" + +msgid "Theme by the" +msgstr "Тема від" + +msgid "Download source file" +msgstr "Завантажити вихідний файл" + +msgid "open issue" +msgstr "відкритий випуск" + +msgid "Contents" +msgstr "Зміст" + +msgid "previous page" +msgstr "Попередня сторінка" + +msgid "Download notebook file" +msgstr "Завантажте файл блокнота" + +msgid "Copyright" +msgstr "Авторське право" + +msgid "Download this page" +msgstr "Завантажте цю сторінку" + +msgid "Source repository" +msgstr "Джерело сховища" + +msgid "By" +msgstr "Автор" + +msgid "repository" +msgstr "сховище" + +msgid "Last updated on" +msgstr "Останнє оновлення:" + +msgid "Toggle navigation" +msgstr "Переключити навігацію" + +msgid "Sphinx Book Theme" +msgstr "Тема книги \"Сфінкс\"" + +msgid "suggest edit" +msgstr "запропонувати редагувати" + +msgid "Open an issue" +msgstr "Відкрийте випуск" + +msgid "Launch" +msgstr "Запуск" + +msgid "Fullscreen mode" +msgstr "Повноекранний режим" + +msgid "Edit this page" +msgstr "Редагувати цю сторінку" + +msgid "By the" +msgstr "По" + +msgid "next page" +msgstr "Наступна сторінка" diff --git a/_static/locales/ur/LC_MESSAGES/booktheme.mo b/_static/locales/ur/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..de8c84b Binary files /dev/null and b/_static/locales/ur/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ur/LC_MESSAGES/booktheme.po b/_static/locales/ur/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..2f77426 --- /dev/null +++ b/_static/locales/ur/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ur\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "پی ڈی ایف پرنٹ کریں" + +msgid "Theme by the" +msgstr "کے ذریعہ تھیم" + +msgid "Download source file" +msgstr "سورس فائل ڈاؤن لوڈ کریں" + +msgid "open issue" +msgstr "کھلا مسئلہ" + +msgid "previous page" +msgstr "سابقہ ​​صفحہ" + +msgid "Download notebook file" +msgstr "نوٹ بک فائل ڈاؤن لوڈ کریں" + +msgid "Copyright" +msgstr "کاپی رائٹ" + +msgid "Download this page" +msgstr "اس صفحے کو ڈاؤن لوڈ کریں" + +msgid "Source repository" +msgstr "ماخذ ذخیرہ" + +msgid "By" +msgstr "بذریعہ" + +msgid "Last updated on" +msgstr "آخری بار تازہ کاری ہوئی" + +msgid "Toggle navigation" +msgstr "نیویگیشن ٹوگل کریں" + +msgid "Sphinx Book Theme" +msgstr "سپنکس بک تھیم" + +msgid "suggest edit" +msgstr "ترمیم کی تجویز کریں" + +msgid "Open an issue" +msgstr "ایک مسئلہ کھولیں" + +msgid "Launch" +msgstr "لانچ کریں" + +msgid "Edit this page" +msgstr "اس صفحے میں ترمیم کریں" + +msgid "By the" +msgstr "کی طرف" + +msgid "next page" +msgstr "اگلا صفحہ" diff --git a/_static/locales/vi/LC_MESSAGES/booktheme.mo b/_static/locales/vi/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..2bb3255 Binary files /dev/null and b/_static/locales/vi/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/vi/LC_MESSAGES/booktheme.po b/_static/locales/vi/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..33159f3 --- /dev/null +++ b/_static/locales/vi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: vi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "In sang PDF" + +msgid "Theme by the" +msgstr "Chủ đề của" + +msgid "Download source file" +msgstr "Tải xuống tệp nguồn" + +msgid "open issue" +msgstr "vấn đề mở" + +msgid "Contents" +msgstr "Nội dung" + +msgid "previous page" +msgstr "trang trước" + +msgid "Download notebook file" +msgstr "Tải xuống tệp sổ tay" + +msgid "Copyright" +msgstr "Bản quyền" + +msgid "Download this page" +msgstr "Tải xuống trang này" + +msgid "Source repository" +msgstr "Kho nguồn" + +msgid "By" +msgstr "Bởi" + +msgid "repository" +msgstr "kho" + +msgid "Last updated on" +msgstr "Cập nhật lần cuối vào" + +msgid "Toggle navigation" +msgstr "Chuyển đổi điều hướng thành" + +msgid "Sphinx Book Theme" +msgstr "Chủ đề sách nhân sư" + +msgid "suggest edit" +msgstr "đề nghị chỉnh sửa" + +msgid "Open an issue" +msgstr "Mở một vấn đề" + +msgid "Launch" +msgstr "Phóng" + +msgid "Fullscreen mode" +msgstr "Chế độ toàn màn hình" + +msgid "Edit this page" +msgstr "chỉnh sửa trang này" + +msgid "By the" +msgstr "Bằng" + +msgid "next page" +msgstr "Trang tiếp theo" diff --git a/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo b/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..0e3235d Binary files /dev/null and b/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/zh_CN/LC_MESSAGES/booktheme.po b/_static/locales/zh_CN/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..2e519ef --- /dev/null +++ b/_static/locales/zh_CN/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_CN\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Theme by the" +msgstr "主题作者：" + +msgid "Download source file" +msgstr "下载源文件" + +msgid "open issue" +msgstr "创建议题" + +msgid "Contents" +msgstr "目录" + +msgid "previous page" +msgstr "上一页" + +msgid "Download notebook file" +msgstr "下载笔记本文件" + +msgid "Copyright" +msgstr "版权" + +msgid "Download this page" +msgstr "下载此页面" + +msgid "Source repository" +msgstr "源码库" + +msgid "By" +msgstr "作者：" + +msgid "repository" +msgstr "仓库" + +msgid "Last updated on" +msgstr "上次更新时间：" + +msgid "Toggle navigation" +msgstr "显示或隐藏导航栏" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 主题" + +msgid "suggest edit" +msgstr "提出修改建议" + +msgid "Open an issue" +msgstr "创建议题" + +msgid "Launch" +msgstr "启动" + +msgid "Fullscreen mode" +msgstr "全屏模式" + +msgid "Edit this page" +msgstr "编辑此页面" + +msgid "By the" +msgstr "作者：" + +msgid "next page" +msgstr "下一页" diff --git a/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo b/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..9116fa9 Binary files /dev/null and b/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/zh_TW/LC_MESSAGES/booktheme.po b/_static/locales/zh_TW/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..beecb07 --- /dev/null +++ b/_static/locales/zh_TW/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_TW\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Theme by the" +msgstr "佈景主題作者：" + +msgid "Download source file" +msgstr "下載原始檔" + +msgid "open issue" +msgstr "公開的問題" + +msgid "Contents" +msgstr "目錄" + +msgid "previous page" +msgstr "上一頁" + +msgid "Download notebook file" +msgstr "下載 Notebook 檔案" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "下載此頁面" + +msgid "Source repository" +msgstr "來源儲存庫" + +msgid "By" +msgstr "作者：" + +msgid "repository" +msgstr "儲存庫" + +msgid "Last updated on" +msgstr "最後更新時間：" + +msgid "Toggle navigation" +msgstr "顯示或隱藏導覽列" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 佈景主題" + +msgid "suggest edit" +msgstr "提出修改建議" + +msgid "Open an issue" +msgstr "開啟議題" + +msgid "Launch" +msgstr "啟動" + +msgid "Fullscreen mode" +msgstr "全螢幕模式" + +msgid "Edit this page" +msgstr "編輯此頁面" + +msgid "By the" +msgstr "作者：" + +msgid "next page" +msgstr "下一頁" diff --git a/_static/minus.png b/_static/minus.png new file mode 100644 index 0000000..d96755f Binary files /dev/null and b/_static/minus.png differ diff --git a/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css b/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css new file mode 100644 index 0000000..3356631 --- /dev/null +++ b/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css @@ -0,0 +1,2342 @@ +/* Variables */ +:root { + --mystnb-source-bg-color: #f7f7f7; + --mystnb-stdout-bg-color: #fcfcfc; + --mystnb-stderr-bg-color: #fdd; + --mystnb-traceback-bg-color: #fcfcfc; + --mystnb-source-border-color: #ccc; + --mystnb-source-margin-color: green; + --mystnb-stdout-border-color: #f7f7f7; + --mystnb-stderr-border-color: #f7f7f7; + --mystnb-traceback-border-color: #ffd6d6; + --mystnb-hide-prompt-opacity: 70%; + --mystnb-source-border-radius: .4em; + --mystnb-source-border-width: 1px; +} + +/* Whole cell */ +div.container.cell { + padding-left: 0; + margin-bottom: 1em; +} + +/* Removing all background formatting so we can control at the div level */ +.cell_input div.highlight, +.cell_output pre, +.cell_input pre, +.cell_output .output { + border: none; + box-shadow: none; +} + +.cell_output .output pre, +.cell_input pre { + margin: 0px; +} + +/* Input cells */ +div.cell div.cell_input, +div.cell details.above-input>summary { + padding-left: 0em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + background-color: var(--mystnb-source-bg-color); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; + border-radius: var(--mystnb-source-border-radius); +} + +div.cell_input>div, +div.cell_output div.output>div.highlight { + margin: 0em !important; + border: none !important; +} + +/* All cell outputs */ +.cell_output { + padding-left: 1em; + padding-right: 0em; + margin-top: 1em; +} + +/* Text outputs from cells */ +.cell_output .output.text_plain, +.cell_output .output.traceback, +.cell_output .output.stream, +.cell_output .output.stderr { + margin-top: 1em; + margin-bottom: 0em; + box-shadow: none; +} + +.cell_output .output.text_plain, +.cell_output .output.stream { + background: var(--mystnb-stdout-bg-color); + border: 1px solid var(--mystnb-stdout-border-color); +} + +.cell_output .output.stderr { + background: var(--mystnb-stderr-bg-color); + border: 1px solid var(--mystnb-stderr-border-color); +} + +.cell_output .output.traceback { + background: var(--mystnb-traceback-bg-color); + border: 1px solid var(--mystnb-traceback-border-color); +} + +/* Collapsible cell content */ +div.cell details.above-input div.cell_input { + border-top-left-radius: 0; + border-top-right-radius: 0; + border-top: var(--mystnb-source-border-width) var(--mystnb-source-border-color) dashed; +} + +div.cell div.cell_input.above-output-prompt { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +div.cell details.above-input>summary { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + border-bottom: var(--mystnb-source-border-width) var(--mystnb-source-border-color) dashed; + padding-left: 1em; + margin-bottom: 0; +} + +div.cell details.above-output>summary { + background-color: var(--mystnb-source-bg-color); + padding-left: 1em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + border-radius: var(--mystnb-source-border-radius); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; +} + +div.cell details.below-input>summary { + background-color: var(--mystnb-source-bg-color); + padding-left: 1em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + border-top: none; + border-bottom-left-radius: var(--mystnb-source-border-radius); + border-bottom-right-radius: var(--mystnb-source-border-radius); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; +} + +div.cell details.hide>summary>span { + opacity: var(--mystnb-hide-prompt-opacity); +} + +div.cell details.hide[open]>summary>span.collapsed { + display: none; +} + +div.cell details.hide:not([open])>summary>span.expanded { + display: none; +} + +@keyframes collapsed-fade-in { + 0% { + opacity: 0; + } + + 100% { + opacity: 1; + } +} +div.cell details.hide[open]>summary~* { + -moz-animation: collapsed-fade-in 0.3s ease-in-out; + -webkit-animation: collapsed-fade-in 0.3s ease-in-out; + animation: collapsed-fade-in 0.3s ease-in-out; +} + +/* Math align to the left */ +.cell_output .MathJax_Display { + text-align: left !important; +} + +/* Pandas tables. Pulled from the Jupyter / nbsphinx CSS */ +div.cell_output table { + border: none; + border-collapse: collapse; + border-spacing: 0; + color: black; + font-size: 1em; + table-layout: fixed; +} + +div.cell_output thead { + border-bottom: 1px solid black; + vertical-align: bottom; +} + +div.cell_output tr, +div.cell_output th, +div.cell_output td { + text-align: right; + vertical-align: middle; + padding: 0.5em 0.5em; + line-height: normal; + white-space: normal; + max-width: none; + border: none; +} + +div.cell_output th { + font-weight: bold; +} + +div.cell_output tbody tr:nth-child(odd) { + background: #f5f5f5; +} + +div.cell_output tbody tr:hover { + background: rgba(66, 165, 245, 0.2); +} + +/** source code line numbers **/ +span.linenos { + opacity: 0.5; +} + +/* Inline text from `paste` operation */ + +span.pasted-text { + font-weight: bold; +} + +span.pasted-inline img { + max-height: 2em; +} + +tbody span.pasted-inline img { + max-height: none; +} + +/* Font colors for translated ANSI escape sequences +Color values are copied from Jupyter Notebook +https://github.com/jupyter/notebook/blob/52581f8eda9b319eb0390ac77fe5903c38f81e3e/notebook/static/notebook/less/ansicolors.less#L14-L21 +Background colors from +https://nbsphinx.readthedocs.io/en/latest/code-cells.html#ANSI-Colors +*/ +div.highlight .-Color-Bold { + font-weight: bold; +} + +div.highlight .-Color[class*=-Black] { + color: #3E424D +} + +div.highlight .-Color[class*=-Red] { + color: #E75C58 +} + +div.highlight .-Color[class*=-Green] { + color: #00A250 +} + +div.highlight .-Color[class*=-Yellow] { + color: #DDB62B +} + +div.highlight .-Color[class*=-Blue] { + color: #208FFB +} + +div.highlight .-Color[class*=-Magenta] { + color: #D160C4 +} + +div.highlight .-Color[class*=-Cyan] { + color: #60C6C8 +} + +div.highlight .-Color[class*=-White] { + color: #C5C1B4 +} + +div.highlight .-Color[class*=-BGBlack] { + background-color: #3E424D +} + +div.highlight .-Color[class*=-BGRed] { + background-color: #E75C58 +} + +div.highlight .-Color[class*=-BGGreen] { + background-color: #00A250 +} + +div.highlight .-Color[class*=-BGYellow] { + background-color: #DDB62B +} + +div.highlight .-Color[class*=-BGBlue] { + background-color: #208FFB +} + +div.highlight .-Color[class*=-BGMagenta] { + background-color: #D160C4 +} + +div.highlight .-Color[class*=-BGCyan] { + background-color: #60C6C8 +} + +div.highlight .-Color[class*=-BGWhite] { + background-color: #C5C1B4 +} + +/* Font colors for 8-bit ANSI */ + +div.highlight .-Color[class*=-C0] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC0] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C1] { + color: #800000 +} + +div.highlight .-Color[class*=-BGC1] { + background-color: #800000 +} + +div.highlight .-Color[class*=-C2] { + color: #008000 +} + +div.highlight .-Color[class*=-BGC2] { + background-color: #008000 +} + +div.highlight .-Color[class*=-C3] { + color: #808000 +} + +div.highlight .-Color[class*=-BGC3] { + background-color: #808000 +} + +div.highlight .-Color[class*=-C4] { + color: #000080 +} + +div.highlight .-Color[class*=-BGC4] { + background-color: #000080 +} + +div.highlight .-Color[class*=-C5] { + color: #800080 +} + +div.highlight .-Color[class*=-BGC5] { + background-color: #800080 +} + +div.highlight .-Color[class*=-C6] { + color: #008080 +} + +div.highlight .-Color[class*=-BGC6] { + background-color: #008080 +} + +div.highlight .-Color[class*=-C7] { + color: #C0C0C0 +} + +div.highlight .-Color[class*=-BGC7] { + background-color: #C0C0C0 +} + +div.highlight .-Color[class*=-C8] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC8] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C9] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC9] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C10] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC10] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C11] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC11] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C12] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC12] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C13] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC13] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C14] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC14] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C15] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC15] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C16] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC16] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C17] { + color: #00005F +} + +div.highlight .-Color[class*=-BGC17] { + background-color: #00005F +} + +div.highlight .-Color[class*=-C18] { + color: #000087 +} + +div.highlight .-Color[class*=-BGC18] { + background-color: #000087 +} + +div.highlight .-Color[class*=-C19] { + color: #0000AF +} + +div.highlight .-Color[class*=-BGC19] { + background-color: #0000AF +} + +div.highlight .-Color[class*=-C20] { + color: #0000D7 +} + +div.highlight .-Color[class*=-BGC20] { + background-color: #0000D7 +} + +div.highlight .-Color[class*=-C21] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC21] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C22] { + color: #005F00 +} + +div.highlight .-Color[class*=-BGC22] { + background-color: #005F00 +} + +div.highlight .-Color[class*=-C23] { + color: #005F5F +} + +div.highlight .-Color[class*=-BGC23] { + background-color: #005F5F +} + +div.highlight .-Color[class*=-C24] { + color: #005F87 +} + +div.highlight .-Color[class*=-BGC24] { + background-color: #005F87 +} + +div.highlight .-Color[class*=-C25] { + color: #005FAF +} + +div.highlight .-Color[class*=-BGC25] { + background-color: #005FAF +} + +div.highlight .-Color[class*=-C26] { + color: #005FD7 +} + +div.highlight .-Color[class*=-BGC26] { + background-color: #005FD7 +} + +div.highlight .-Color[class*=-C27] { + color: #005FFF +} + +div.highlight .-Color[class*=-BGC27] { + background-color: #005FFF +} + +div.highlight .-Color[class*=-C28] { + color: #008700 +} + +div.highlight .-Color[class*=-BGC28] { + background-color: #008700 +} + +div.highlight .-Color[class*=-C29] { + color: #00875F +} + +div.highlight .-Color[class*=-BGC29] { + background-color: #00875F +} + +div.highlight .-Color[class*=-C30] { + color: #008787 +} + +div.highlight .-Color[class*=-BGC30] { + background-color: #008787 +} + +div.highlight .-Color[class*=-C31] { + color: #0087AF +} + +div.highlight .-Color[class*=-BGC31] { + background-color: #0087AF +} + +div.highlight .-Color[class*=-C32] { + color: #0087D7 +} + +div.highlight .-Color[class*=-BGC32] { + background-color: #0087D7 +} + +div.highlight .-Color[class*=-C33] { + color: #0087FF +} + +div.highlight .-Color[class*=-BGC33] { + background-color: #0087FF +} + +div.highlight .-Color[class*=-C34] { + color: #00AF00 +} + +div.highlight .-Color[class*=-BGC34] { + background-color: #00AF00 +} + +div.highlight .-Color[class*=-C35] { + color: #00AF5F +} + +div.highlight .-Color[class*=-BGC35] { + background-color: #00AF5F +} + +div.highlight .-Color[class*=-C36] { + color: #00AF87 +} + +div.highlight .-Color[class*=-BGC36] { + background-color: #00AF87 +} + +div.highlight .-Color[class*=-C37] { + color: #00AFAF +} + +div.highlight .-Color[class*=-BGC37] { + background-color: #00AFAF +} + +div.highlight .-Color[class*=-C38] { + color: #00AFD7 +} + +div.highlight .-Color[class*=-BGC38] { + background-color: #00AFD7 +} + +div.highlight .-Color[class*=-C39] { + color: #00AFFF +} + +div.highlight .-Color[class*=-BGC39] { + background-color: #00AFFF +} + +div.highlight .-Color[class*=-C40] { + color: #00D700 +} + +div.highlight .-Color[class*=-BGC40] { + background-color: #00D700 +} + +div.highlight .-Color[class*=-C41] { + color: #00D75F +} + +div.highlight .-Color[class*=-BGC41] { + background-color: #00D75F +} + +div.highlight .-Color[class*=-C42] { + color: #00D787 +} + +div.highlight .-Color[class*=-BGC42] { + background-color: #00D787 +} + +div.highlight .-Color[class*=-C43] { + color: #00D7AF +} + +div.highlight .-Color[class*=-BGC43] { + background-color: #00D7AF +} + +div.highlight .-Color[class*=-C44] { + color: #00D7D7 +} + +div.highlight .-Color[class*=-BGC44] { + background-color: #00D7D7 +} + +div.highlight .-Color[class*=-C45] { + color: #00D7FF +} + +div.highlight .-Color[class*=-BGC45] { + background-color: #00D7FF +} + +div.highlight .-Color[class*=-C46] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC46] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C47] { + color: #00FF5F +} + +div.highlight .-Color[class*=-BGC47] { + background-color: #00FF5F +} + +div.highlight .-Color[class*=-C48] { + color: #00FF87 +} + +div.highlight .-Color[class*=-BGC48] { + background-color: #00FF87 +} + +div.highlight .-Color[class*=-C49] { + color: #00FFAF +} + +div.highlight .-Color[class*=-BGC49] { + background-color: #00FFAF +} + +div.highlight .-Color[class*=-C50] { + color: #00FFD7 +} + +div.highlight .-Color[class*=-BGC50] { + background-color: #00FFD7 +} + +div.highlight .-Color[class*=-C51] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC51] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C52] { + color: #5F0000 +} + +div.highlight .-Color[class*=-BGC52] { + background-color: #5F0000 +} + +div.highlight .-Color[class*=-C53] { + color: #5F005F +} + +div.highlight .-Color[class*=-BGC53] { + background-color: #5F005F +} + +div.highlight .-Color[class*=-C54] { + color: #5F0087 +} + +div.highlight .-Color[class*=-BGC54] { + background-color: #5F0087 +} + +div.highlight .-Color[class*=-C55] { + color: #5F00AF +} + +div.highlight .-Color[class*=-BGC55] { + background-color: #5F00AF +} + +div.highlight .-Color[class*=-C56] { + color: #5F00D7 +} + +div.highlight .-Color[class*=-BGC56] { + background-color: #5F00D7 +} + +div.highlight .-Color[class*=-C57] { + color: #5F00FF +} + +div.highlight .-Color[class*=-BGC57] { + background-color: #5F00FF +} + +div.highlight .-Color[class*=-C58] { + color: #5F5F00 +} + +div.highlight .-Color[class*=-BGC58] { + background-color: #5F5F00 +} + +div.highlight .-Color[class*=-C59] { + color: #5F5F5F +} + +div.highlight .-Color[class*=-BGC59] { + background-color: #5F5F5F +} + +div.highlight .-Color[class*=-C60] { + color: #5F5F87 +} + +div.highlight .-Color[class*=-BGC60] { + background-color: #5F5F87 +} + +div.highlight .-Color[class*=-C61] { + color: #5F5FAF +} + +div.highlight .-Color[class*=-BGC61] { + background-color: #5F5FAF +} + +div.highlight .-Color[class*=-C62] { + color: #5F5FD7 +} + +div.highlight .-Color[class*=-BGC62] { + background-color: #5F5FD7 +} + +div.highlight .-Color[class*=-C63] { + color: #5F5FFF +} + +div.highlight .-Color[class*=-BGC63] { + background-color: #5F5FFF +} + +div.highlight .-Color[class*=-C64] { + color: #5F8700 +} + +div.highlight .-Color[class*=-BGC64] { + background-color: #5F8700 +} + +div.highlight .-Color[class*=-C65] { + color: #5F875F +} + +div.highlight .-Color[class*=-BGC65] { + background-color: #5F875F +} + +div.highlight .-Color[class*=-C66] { + color: #5F8787 +} + +div.highlight .-Color[class*=-BGC66] { + background-color: #5F8787 +} + +div.highlight .-Color[class*=-C67] { + color: #5F87AF +} + +div.highlight .-Color[class*=-BGC67] { + background-color: #5F87AF +} + +div.highlight .-Color[class*=-C68] { + color: #5F87D7 +} + +div.highlight .-Color[class*=-BGC68] { + background-color: #5F87D7 +} + +div.highlight .-Color[class*=-C69] { + color: #5F87FF +} + +div.highlight .-Color[class*=-BGC69] { + background-color: #5F87FF +} + +div.highlight .-Color[class*=-C70] { + color: #5FAF00 +} + +div.highlight .-Color[class*=-BGC70] { + background-color: #5FAF00 +} + +div.highlight .-Color[class*=-C71] { + color: #5FAF5F +} + +div.highlight .-Color[class*=-BGC71] { + background-color: #5FAF5F +} + +div.highlight .-Color[class*=-C72] { + color: #5FAF87 +} + +div.highlight .-Color[class*=-BGC72] { + background-color: #5FAF87 +} + +div.highlight .-Color[class*=-C73] { + color: #5FAFAF +} + +div.highlight .-Color[class*=-BGC73] { + background-color: #5FAFAF +} + +div.highlight .-Color[class*=-C74] { + color: #5FAFD7 +} + +div.highlight .-Color[class*=-BGC74] { + background-color: #5FAFD7 +} + +div.highlight .-Color[class*=-C75] { + color: #5FAFFF +} + +div.highlight .-Color[class*=-BGC75] { + background-color: #5FAFFF +} + +div.highlight .-Color[class*=-C76] { + color: #5FD700 +} + +div.highlight .-Color[class*=-BGC76] { + background-color: #5FD700 +} + +div.highlight .-Color[class*=-C77] { + color: #5FD75F +} + +div.highlight .-Color[class*=-BGC77] { + background-color: #5FD75F +} + +div.highlight .-Color[class*=-C78] { + color: #5FD787 +} + +div.highlight .-Color[class*=-BGC78] { + background-color: #5FD787 +} + +div.highlight .-Color[class*=-C79] { + color: #5FD7AF +} + +div.highlight .-Color[class*=-BGC79] { + background-color: #5FD7AF +} + +div.highlight .-Color[class*=-C80] { + color: #5FD7D7 +} + +div.highlight .-Color[class*=-BGC80] { + background-color: #5FD7D7 +} + +div.highlight .-Color[class*=-C81] { + color: #5FD7FF +} + +div.highlight .-Color[class*=-BGC81] { + background-color: #5FD7FF +} + +div.highlight .-Color[class*=-C82] { + color: #5FFF00 +} + +div.highlight .-Color[class*=-BGC82] { + background-color: #5FFF00 +} + +div.highlight .-Color[class*=-C83] { + color: #5FFF5F +} + +div.highlight .-Color[class*=-BGC83] { + background-color: #5FFF5F +} + +div.highlight .-Color[class*=-C84] { + color: #5FFF87 +} + +div.highlight .-Color[class*=-BGC84] { + background-color: #5FFF87 +} + +div.highlight .-Color[class*=-C85] { + color: #5FFFAF +} + +div.highlight .-Color[class*=-BGC85] { + background-color: #5FFFAF +} + +div.highlight .-Color[class*=-C86] { + color: #5FFFD7 +} + +div.highlight .-Color[class*=-BGC86] { + background-color: #5FFFD7 +} + +div.highlight .-Color[class*=-C87] { + color: #5FFFFF +} + +div.highlight .-Color[class*=-BGC87] { + background-color: #5FFFFF +} + +div.highlight .-Color[class*=-C88] { + color: #870000 +} + +div.highlight .-Color[class*=-BGC88] { + background-color: #870000 +} + +div.highlight .-Color[class*=-C89] { + color: #87005F +} + +div.highlight .-Color[class*=-BGC89] { + background-color: #87005F +} + +div.highlight .-Color[class*=-C90] { + color: #870087 +} + +div.highlight .-Color[class*=-BGC90] { + background-color: #870087 +} + +div.highlight .-Color[class*=-C91] { + color: #8700AF +} + +div.highlight .-Color[class*=-BGC91] { + background-color: #8700AF +} + +div.highlight .-Color[class*=-C92] { + color: #8700D7 +} + +div.highlight .-Color[class*=-BGC92] { + background-color: #8700D7 +} + +div.highlight .-Color[class*=-C93] { + color: #8700FF +} + +div.highlight .-Color[class*=-BGC93] { + background-color: #8700FF +} + +div.highlight .-Color[class*=-C94] { + color: #875F00 +} + +div.highlight .-Color[class*=-BGC94] { + background-color: #875F00 +} + +div.highlight .-Color[class*=-C95] { + color: #875F5F +} + +div.highlight .-Color[class*=-BGC95] { + background-color: #875F5F +} + +div.highlight .-Color[class*=-C96] { + color: #875F87 +} + +div.highlight .-Color[class*=-BGC96] { + background-color: #875F87 +} + +div.highlight .-Color[class*=-C97] { + color: #875FAF +} + +div.highlight .-Color[class*=-BGC97] { + background-color: #875FAF +} + +div.highlight .-Color[class*=-C98] { + color: #875FD7 +} + +div.highlight .-Color[class*=-BGC98] { + background-color: #875FD7 +} + +div.highlight .-Color[class*=-C99] { + color: #875FFF +} + +div.highlight .-Color[class*=-BGC99] { + background-color: #875FFF +} + +div.highlight .-Color[class*=-C100] { + color: #878700 +} + +div.highlight .-Color[class*=-BGC100] { + background-color: #878700 +} + +div.highlight .-Color[class*=-C101] { + color: #87875F +} + +div.highlight .-Color[class*=-BGC101] { + background-color: #87875F +} + +div.highlight .-Color[class*=-C102] { + color: #878787 +} + +div.highlight .-Color[class*=-BGC102] { + background-color: #878787 +} + +div.highlight .-Color[class*=-C103] { + color: #8787AF +} + +div.highlight .-Color[class*=-BGC103] { + background-color: #8787AF +} + +div.highlight .-Color[class*=-C104] { + color: #8787D7 +} + +div.highlight .-Color[class*=-BGC104] { + background-color: #8787D7 +} + +div.highlight .-Color[class*=-C105] { + color: #8787FF +} + +div.highlight .-Color[class*=-BGC105] { + background-color: #8787FF +} + +div.highlight .-Color[class*=-C106] { + color: #87AF00 +} + +div.highlight .-Color[class*=-BGC106] { + background-color: #87AF00 +} + +div.highlight .-Color[class*=-C107] { + color: #87AF5F +} + +div.highlight .-Color[class*=-BGC107] { + background-color: #87AF5F +} + +div.highlight .-Color[class*=-C108] { + color: #87AF87 +} + +div.highlight .-Color[class*=-BGC108] { + background-color: #87AF87 +} + +div.highlight .-Color[class*=-C109] { + color: #87AFAF +} + +div.highlight .-Color[class*=-BGC109] { + background-color: #87AFAF +} + +div.highlight .-Color[class*=-C110] { + color: #87AFD7 +} + +div.highlight .-Color[class*=-BGC110] { + background-color: #87AFD7 +} + +div.highlight .-Color[class*=-C111] { + color: #87AFFF +} + +div.highlight .-Color[class*=-BGC111] { + background-color: #87AFFF +} + +div.highlight .-Color[class*=-C112] { + color: #87D700 +} + +div.highlight .-Color[class*=-BGC112] { + background-color: #87D700 +} + +div.highlight .-Color[class*=-C113] { + color: #87D75F +} + +div.highlight .-Color[class*=-BGC113] { + background-color: #87D75F +} + +div.highlight .-Color[class*=-C114] { + color: #87D787 +} + +div.highlight .-Color[class*=-BGC114] { + background-color: #87D787 +} + +div.highlight .-Color[class*=-C115] { + color: #87D7AF +} + +div.highlight .-Color[class*=-BGC115] { + background-color: #87D7AF +} + +div.highlight .-Color[class*=-C116] { + color: #87D7D7 +} + +div.highlight .-Color[class*=-BGC116] { + background-color: #87D7D7 +} + +div.highlight .-Color[class*=-C117] { + color: #87D7FF +} + +div.highlight .-Color[class*=-BGC117] { + background-color: #87D7FF +} + +div.highlight .-Color[class*=-C118] { + color: #87FF00 +} + +div.highlight .-Color[class*=-BGC118] { + background-color: #87FF00 +} + +div.highlight .-Color[class*=-C119] { + color: #87FF5F +} + +div.highlight .-Color[class*=-BGC119] { + background-color: #87FF5F +} + +div.highlight .-Color[class*=-C120] { + color: #87FF87 +} + +div.highlight .-Color[class*=-BGC120] { + background-color: #87FF87 +} + +div.highlight .-Color[class*=-C121] { + color: #87FFAF +} + +div.highlight .-Color[class*=-BGC121] { + background-color: #87FFAF +} + +div.highlight .-Color[class*=-C122] { + color: #87FFD7 +} + +div.highlight .-Color[class*=-BGC122] { + background-color: #87FFD7 +} + +div.highlight .-Color[class*=-C123] { + color: #87FFFF +} + +div.highlight .-Color[class*=-BGC123] { + background-color: #87FFFF +} + +div.highlight .-Color[class*=-C124] { + color: #AF0000 +} + +div.highlight .-Color[class*=-BGC124] { + background-color: #AF0000 +} + +div.highlight .-Color[class*=-C125] { + color: #AF005F +} + +div.highlight .-Color[class*=-BGC125] { + background-color: #AF005F +} + +div.highlight .-Color[class*=-C126] { + color: #AF0087 +} + +div.highlight .-Color[class*=-BGC126] { + background-color: #AF0087 +} + +div.highlight .-Color[class*=-C127] { + color: #AF00AF +} + +div.highlight .-Color[class*=-BGC127] { + background-color: #AF00AF +} + +div.highlight .-Color[class*=-C128] { + color: #AF00D7 +} + +div.highlight .-Color[class*=-BGC128] { + background-color: #AF00D7 +} + +div.highlight .-Color[class*=-C129] { + color: #AF00FF +} + +div.highlight .-Color[class*=-BGC129] { + background-color: #AF00FF +} + +div.highlight .-Color[class*=-C130] { + color: #AF5F00 +} + +div.highlight .-Color[class*=-BGC130] { + background-color: #AF5F00 +} + +div.highlight .-Color[class*=-C131] { + color: #AF5F5F +} + +div.highlight .-Color[class*=-BGC131] { + background-color: #AF5F5F +} + +div.highlight .-Color[class*=-C132] { + color: #AF5F87 +} + +div.highlight .-Color[class*=-BGC132] { + background-color: #AF5F87 +} + +div.highlight .-Color[class*=-C133] { + color: #AF5FAF +} + +div.highlight .-Color[class*=-BGC133] { + background-color: #AF5FAF +} + +div.highlight .-Color[class*=-C134] { + color: #AF5FD7 +} + +div.highlight .-Color[class*=-BGC134] { + background-color: #AF5FD7 +} + +div.highlight .-Color[class*=-C135] { + color: #AF5FFF +} + +div.highlight .-Color[class*=-BGC135] { + background-color: #AF5FFF +} + +div.highlight .-Color[class*=-C136] { + color: #AF8700 +} + +div.highlight .-Color[class*=-BGC136] { + background-color: #AF8700 +} + +div.highlight .-Color[class*=-C137] { + color: #AF875F +} + +div.highlight .-Color[class*=-BGC137] { + background-color: #AF875F +} + +div.highlight .-Color[class*=-C138] { + color: #AF8787 +} + +div.highlight .-Color[class*=-BGC138] { + background-color: #AF8787 +} + +div.highlight .-Color[class*=-C139] { + color: #AF87AF +} + +div.highlight .-Color[class*=-BGC139] { + background-color: #AF87AF +} + +div.highlight .-Color[class*=-C140] { + color: #AF87D7 +} + +div.highlight .-Color[class*=-BGC140] { + background-color: #AF87D7 +} + +div.highlight .-Color[class*=-C141] { + color: #AF87FF +} + +div.highlight .-Color[class*=-BGC141] { + background-color: #AF87FF +} + +div.highlight .-Color[class*=-C142] { + color: #AFAF00 +} + +div.highlight .-Color[class*=-BGC142] { + background-color: #AFAF00 +} + +div.highlight .-Color[class*=-C143] { + color: #AFAF5F +} + +div.highlight .-Color[class*=-BGC143] { + background-color: #AFAF5F +} + +div.highlight .-Color[class*=-C144] { + color: #AFAF87 +} + +div.highlight .-Color[class*=-BGC144] { + background-color: #AFAF87 +} + +div.highlight .-Color[class*=-C145] { + color: #AFAFAF +} + +div.highlight .-Color[class*=-BGC145] { + background-color: #AFAFAF +} + +div.highlight .-Color[class*=-C146] { + color: #AFAFD7 +} + +div.highlight .-Color[class*=-BGC146] { + background-color: #AFAFD7 +} + +div.highlight .-Color[class*=-C147] { + color: #AFAFFF +} + +div.highlight .-Color[class*=-BGC147] { + background-color: #AFAFFF +} + +div.highlight .-Color[class*=-C148] { + color: #AFD700 +} + +div.highlight .-Color[class*=-BGC148] { + background-color: #AFD700 +} + +div.highlight .-Color[class*=-C149] { + color: #AFD75F +} + +div.highlight .-Color[class*=-BGC149] { + background-color: #AFD75F +} + +div.highlight .-Color[class*=-C150] { + color: #AFD787 +} + +div.highlight .-Color[class*=-BGC150] { + background-color: #AFD787 +} + +div.highlight .-Color[class*=-C151] { + color: #AFD7AF +} + +div.highlight .-Color[class*=-BGC151] { + background-color: #AFD7AF +} + +div.highlight .-Color[class*=-C152] { + color: #AFD7D7 +} + +div.highlight .-Color[class*=-BGC152] { + background-color: #AFD7D7 +} + +div.highlight .-Color[class*=-C153] { + color: #AFD7FF +} + +div.highlight .-Color[class*=-BGC153] { + background-color: #AFD7FF +} + +div.highlight .-Color[class*=-C154] { + color: #AFFF00 +} + +div.highlight .-Color[class*=-BGC154] { + background-color: #AFFF00 +} + +div.highlight .-Color[class*=-C155] { + color: #AFFF5F +} + +div.highlight .-Color[class*=-BGC155] { + background-color: #AFFF5F +} + +div.highlight .-Color[class*=-C156] { + color: #AFFF87 +} + +div.highlight .-Color[class*=-BGC156] { + background-color: #AFFF87 +} + +div.highlight .-Color[class*=-C157] { + color: #AFFFAF +} + +div.highlight .-Color[class*=-BGC157] { + background-color: #AFFFAF +} + +div.highlight .-Color[class*=-C158] { + color: #AFFFD7 +} + +div.highlight .-Color[class*=-BGC158] { + background-color: #AFFFD7 +} + +div.highlight .-Color[class*=-C159] { + color: #AFFFFF +} + +div.highlight .-Color[class*=-BGC159] { + background-color: #AFFFFF +} + +div.highlight .-Color[class*=-C160] { + color: #D70000 +} + +div.highlight .-Color[class*=-BGC160] { + background-color: #D70000 +} + +div.highlight .-Color[class*=-C161] { + color: #D7005F +} + +div.highlight .-Color[class*=-BGC161] { + background-color: #D7005F +} + +div.highlight .-Color[class*=-C162] { + color: #D70087 +} + +div.highlight .-Color[class*=-BGC162] { + background-color: #D70087 +} + +div.highlight .-Color[class*=-C163] { + color: #D700AF +} + +div.highlight .-Color[class*=-BGC163] { + background-color: #D700AF +} + +div.highlight .-Color[class*=-C164] { + color: #D700D7 +} + +div.highlight .-Color[class*=-BGC164] { + background-color: #D700D7 +} + +div.highlight .-Color[class*=-C165] { + color: #D700FF +} + +div.highlight .-Color[class*=-BGC165] { + background-color: #D700FF +} + +div.highlight .-Color[class*=-C166] { + color: #D75F00 +} + +div.highlight .-Color[class*=-BGC166] { + background-color: #D75F00 +} + +div.highlight .-Color[class*=-C167] { + color: #D75F5F +} + +div.highlight .-Color[class*=-BGC167] { + background-color: #D75F5F +} + +div.highlight .-Color[class*=-C168] { + color: #D75F87 +} + +div.highlight .-Color[class*=-BGC168] { + background-color: #D75F87 +} + +div.highlight .-Color[class*=-C169] { + color: #D75FAF +} + +div.highlight .-Color[class*=-BGC169] { + background-color: #D75FAF +} + +div.highlight .-Color[class*=-C170] { + color: #D75FD7 +} + +div.highlight .-Color[class*=-BGC170] { + background-color: #D75FD7 +} + +div.highlight .-Color[class*=-C171] { + color: #D75FFF +} + +div.highlight .-Color[class*=-BGC171] { + background-color: #D75FFF +} + +div.highlight .-Color[class*=-C172] { + color: #D78700 +} + +div.highlight .-Color[class*=-BGC172] { + background-color: #D78700 +} + +div.highlight .-Color[class*=-C173] { + color: #D7875F +} + +div.highlight .-Color[class*=-BGC173] { + background-color: #D7875F +} + +div.highlight .-Color[class*=-C174] { + color: #D78787 +} + +div.highlight .-Color[class*=-BGC174] { + background-color: #D78787 +} + +div.highlight .-Color[class*=-C175] { + color: #D787AF +} + +div.highlight .-Color[class*=-BGC175] { + background-color: #D787AF +} + +div.highlight .-Color[class*=-C176] { + color: #D787D7 +} + +div.highlight .-Color[class*=-BGC176] { + background-color: #D787D7 +} + +div.highlight .-Color[class*=-C177] { + color: #D787FF +} + +div.highlight .-Color[class*=-BGC177] { + background-color: #D787FF +} + +div.highlight .-Color[class*=-C178] { + color: #D7AF00 +} + +div.highlight .-Color[class*=-BGC178] { + background-color: #D7AF00 +} + +div.highlight .-Color[class*=-C179] { + color: #D7AF5F +} + +div.highlight .-Color[class*=-BGC179] { + background-color: #D7AF5F +} + +div.highlight .-Color[class*=-C180] { + color: #D7AF87 +} + +div.highlight .-Color[class*=-BGC180] { + background-color: #D7AF87 +} + +div.highlight .-Color[class*=-C181] { + color: #D7AFAF +} + +div.highlight .-Color[class*=-BGC181] { + background-color: #D7AFAF +} + +div.highlight .-Color[class*=-C182] { + color: #D7AFD7 +} + +div.highlight .-Color[class*=-BGC182] { + background-color: #D7AFD7 +} + +div.highlight .-Color[class*=-C183] { + color: #D7AFFF +} + +div.highlight .-Color[class*=-BGC183] { + background-color: #D7AFFF +} + +div.highlight .-Color[class*=-C184] { + color: #D7D700 +} + +div.highlight .-Color[class*=-BGC184] { + background-color: #D7D700 +} + +div.highlight .-Color[class*=-C185] { + color: #D7D75F +} + +div.highlight .-Color[class*=-BGC185] { + background-color: #D7D75F +} + +div.highlight .-Color[class*=-C186] { + color: #D7D787 +} + +div.highlight .-Color[class*=-BGC186] { + background-color: #D7D787 +} + +div.highlight .-Color[class*=-C187] { + color: #D7D7AF +} + +div.highlight .-Color[class*=-BGC187] { + background-color: #D7D7AF +} + +div.highlight .-Color[class*=-C188] { + color: #D7D7D7 +} + +div.highlight .-Color[class*=-BGC188] { + background-color: #D7D7D7 +} + +div.highlight .-Color[class*=-C189] { + color: #D7D7FF +} + +div.highlight .-Color[class*=-BGC189] { + background-color: #D7D7FF +} + +div.highlight .-Color[class*=-C190] { + color: #D7FF00 +} + +div.highlight .-Color[class*=-BGC190] { + background-color: #D7FF00 +} + +div.highlight .-Color[class*=-C191] { + color: #D7FF5F +} + +div.highlight .-Color[class*=-BGC191] { + background-color: #D7FF5F +} + +div.highlight .-Color[class*=-C192] { + color: #D7FF87 +} + +div.highlight .-Color[class*=-BGC192] { + background-color: #D7FF87 +} + +div.highlight .-Color[class*=-C193] { + color: #D7FFAF +} + +div.highlight .-Color[class*=-BGC193] { + background-color: #D7FFAF +} + +div.highlight .-Color[class*=-C194] { + color: #D7FFD7 +} + +div.highlight .-Color[class*=-BGC194] { + background-color: #D7FFD7 +} + +div.highlight .-Color[class*=-C195] { + color: #D7FFFF +} + +div.highlight .-Color[class*=-BGC195] { + background-color: #D7FFFF +} + +div.highlight .-Color[class*=-C196] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC196] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C197] { + color: #FF005F +} + +div.highlight .-Color[class*=-BGC197] { + background-color: #FF005F +} + +div.highlight .-Color[class*=-C198] { + color: #FF0087 +} + +div.highlight .-Color[class*=-BGC198] { + background-color: #FF0087 +} + +div.highlight .-Color[class*=-C199] { + color: #FF00AF +} + +div.highlight .-Color[class*=-BGC199] { + background-color: #FF00AF +} + +div.highlight .-Color[class*=-C200] { + color: #FF00D7 +} + +div.highlight .-Color[class*=-BGC200] { + background-color: #FF00D7 +} + +div.highlight .-Color[class*=-C201] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC201] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C202] { + color: #FF5F00 +} + +div.highlight .-Color[class*=-BGC202] { + background-color: #FF5F00 +} + +div.highlight .-Color[class*=-C203] { + color: #FF5F5F +} + +div.highlight .-Color[class*=-BGC203] { + background-color: #FF5F5F +} + +div.highlight .-Color[class*=-C204] { + color: #FF5F87 +} + +div.highlight .-Color[class*=-BGC204] { + background-color: #FF5F87 +} + +div.highlight .-Color[class*=-C205] { + color: #FF5FAF +} + +div.highlight .-Color[class*=-BGC205] { + background-color: #FF5FAF +} + +div.highlight .-Color[class*=-C206] { + color: #FF5FD7 +} + +div.highlight .-Color[class*=-BGC206] { + background-color: #FF5FD7 +} + +div.highlight .-Color[class*=-C207] { + color: #FF5FFF +} + +div.highlight .-Color[class*=-BGC207] { + background-color: #FF5FFF +} + +div.highlight .-Color[class*=-C208] { + color: #FF8700 +} + +div.highlight .-Color[class*=-BGC208] { + background-color: #FF8700 +} + +div.highlight .-Color[class*=-C209] { + color: #FF875F +} + +div.highlight .-Color[class*=-BGC209] { + background-color: #FF875F +} + +div.highlight .-Color[class*=-C210] { + color: #FF8787 +} + +div.highlight .-Color[class*=-BGC210] { + background-color: #FF8787 +} + +div.highlight .-Color[class*=-C211] { + color: #FF87AF +} + +div.highlight .-Color[class*=-BGC211] { + background-color: #FF87AF +} + +div.highlight .-Color[class*=-C212] { + color: #FF87D7 +} + +div.highlight .-Color[class*=-BGC212] { + background-color: #FF87D7 +} + +div.highlight .-Color[class*=-C213] { + color: #FF87FF +} + +div.highlight .-Color[class*=-BGC213] { + background-color: #FF87FF +} + +div.highlight .-Color[class*=-C214] { + color: #FFAF00 +} + +div.highlight .-Color[class*=-BGC214] { + background-color: #FFAF00 +} + +div.highlight .-Color[class*=-C215] { + color: #FFAF5F +} + +div.highlight .-Color[class*=-BGC215] { + background-color: #FFAF5F +} + +div.highlight .-Color[class*=-C216] { + color: #FFAF87 +} + +div.highlight .-Color[class*=-BGC216] { + background-color: #FFAF87 +} + +div.highlight .-Color[class*=-C217] { + color: #FFAFAF +} + +div.highlight .-Color[class*=-BGC217] { + background-color: #FFAFAF +} + +div.highlight .-Color[class*=-C218] { + color: #FFAFD7 +} + +div.highlight .-Color[class*=-BGC218] { + background-color: #FFAFD7 +} + +div.highlight .-Color[class*=-C219] { + color: #FFAFFF +} + +div.highlight .-Color[class*=-BGC219] { + background-color: #FFAFFF +} + +div.highlight .-Color[class*=-C220] { + color: #FFD700 +} + +div.highlight .-Color[class*=-BGC220] { + background-color: #FFD700 +} + +div.highlight .-Color[class*=-C221] { + color: #FFD75F +} + +div.highlight .-Color[class*=-BGC221] { + background-color: #FFD75F +} + +div.highlight .-Color[class*=-C222] { + color: #FFD787 +} + +div.highlight .-Color[class*=-BGC222] { + background-color: #FFD787 +} + +div.highlight .-Color[class*=-C223] { + color: #FFD7AF +} + +div.highlight .-Color[class*=-BGC223] { + background-color: #FFD7AF +} + +div.highlight .-Color[class*=-C224] { + color: #FFD7D7 +} + +div.highlight .-Color[class*=-BGC224] { + background-color: #FFD7D7 +} + +div.highlight .-Color[class*=-C225] { + color: #FFD7FF +} + +div.highlight .-Color[class*=-BGC225] { + background-color: #FFD7FF +} + +div.highlight .-Color[class*=-C226] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC226] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C227] { + color: #FFFF5F +} + +div.highlight .-Color[class*=-BGC227] { + background-color: #FFFF5F +} + +div.highlight .-Color[class*=-C228] { + color: #FFFF87 +} + +div.highlight .-Color[class*=-BGC228] { + background-color: #FFFF87 +} + +div.highlight .-Color[class*=-C229] { + color: #FFFFAF +} + +div.highlight .-Color[class*=-BGC229] { + background-color: #FFFFAF +} + +div.highlight .-Color[class*=-C230] { + color: #FFFFD7 +} + +div.highlight .-Color[class*=-BGC230] { + background-color: #FFFFD7 +} + +div.highlight .-Color[class*=-C231] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC231] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C232] { + color: #080808 +} + +div.highlight .-Color[class*=-BGC232] { + background-color: #080808 +} + +div.highlight .-Color[class*=-C233] { + color: #121212 +} + +div.highlight .-Color[class*=-BGC233] { + background-color: #121212 +} + +div.highlight .-Color[class*=-C234] { + color: #1C1C1C +} + +div.highlight .-Color[class*=-BGC234] { + background-color: #1C1C1C +} + +div.highlight .-Color[class*=-C235] { + color: #262626 +} + +div.highlight .-Color[class*=-BGC235] { + background-color: #262626 +} + +div.highlight .-Color[class*=-C236] { + color: #303030 +} + +div.highlight .-Color[class*=-BGC236] { + background-color: #303030 +} + +div.highlight .-Color[class*=-C237] { + color: #3A3A3A +} + +div.highlight .-Color[class*=-BGC237] { + background-color: #3A3A3A +} + +div.highlight .-Color[class*=-C238] { + color: #444444 +} + +div.highlight .-Color[class*=-BGC238] { + background-color: #444444 +} + +div.highlight .-Color[class*=-C239] { + color: #4E4E4E +} + +div.highlight .-Color[class*=-BGC239] { + background-color: #4E4E4E +} + +div.highlight .-Color[class*=-C240] { + color: #585858 +} + +div.highlight .-Color[class*=-BGC240] { + background-color: #585858 +} + +div.highlight .-Color[class*=-C241] { + color: #626262 +} + +div.highlight .-Color[class*=-BGC241] { + background-color: #626262 +} + +div.highlight .-Color[class*=-C242] { + color: #6C6C6C +} + +div.highlight .-Color[class*=-BGC242] { + background-color: #6C6C6C +} + +div.highlight .-Color[class*=-C243] { + color: #767676 +} + +div.highlight .-Color[class*=-BGC243] { + background-color: #767676 +} + +div.highlight .-Color[class*=-C244] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC244] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C245] { + color: #8A8A8A +} + +div.highlight .-Color[class*=-BGC245] { + background-color: #8A8A8A +} + +div.highlight .-Color[class*=-C246] { + color: #949494 +} + +div.highlight .-Color[class*=-BGC246] { + background-color: #949494 +} + +div.highlight .-Color[class*=-C247] { + color: #9E9E9E +} + +div.highlight .-Color[class*=-BGC247] { + background-color: #9E9E9E +} + +div.highlight .-Color[class*=-C248] { + color: #A8A8A8 +} + +div.highlight .-Color[class*=-BGC248] { + background-color: #A8A8A8 +} + +div.highlight .-Color[class*=-C249] { + color: #B2B2B2 +} + +div.highlight .-Color[class*=-BGC249] { + background-color: #B2B2B2 +} + +div.highlight .-Color[class*=-C250] { + color: #BCBCBC +} + +div.highlight .-Color[class*=-BGC250] { + background-color: #BCBCBC +} + +div.highlight .-Color[class*=-C251] { + color: #C6C6C6 +} + +div.highlight .-Color[class*=-BGC251] { + background-color: #C6C6C6 +} + +div.highlight .-Color[class*=-C252] { + color: #D0D0D0 +} + +div.highlight .-Color[class*=-BGC252] { + background-color: #D0D0D0 +} + +div.highlight .-Color[class*=-C253] { + color: #DADADA +} + +div.highlight .-Color[class*=-BGC253] { + background-color: #DADADA +} + +div.highlight .-Color[class*=-C254] { + color: #E4E4E4 +} + +div.highlight .-Color[class*=-BGC254] { + background-color: #E4E4E4 +} + +div.highlight .-Color[class*=-C255] { + color: #EEEEEE +} + +div.highlight .-Color[class*=-BGC255] { + background-color: #EEEEEE +} diff --git a/_static/play-solid.svg b/_static/play-solid.svg new file mode 100644 index 0000000..bcd81f7 --- /dev/null +++ b/_static/play-solid.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/_static/plus.png b/_static/plus.png new file mode 100644 index 0000000..7107cec Binary files /dev/null and b/_static/plus.png differ diff --git a/_static/pygments.css b/_static/pygments.css new file mode 100644 index 0000000..012e6a0 --- /dev/null +++ b/_static/pygments.css @@ -0,0 +1,152 @@ +html[data-theme="light"] .highlight pre { line-height: 125%; } +html[data-theme="light"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight .hll { background-color: #fae4c2 } +html[data-theme="light"] .highlight { background: #fefefe; color: #080808 } +html[data-theme="light"] .highlight .c { color: #515151 } /* Comment */ +html[data-theme="light"] .highlight .err { color: #a12236 } /* Error */ +html[data-theme="light"] .highlight .k { color: #6730c5 } /* Keyword */ +html[data-theme="light"] .highlight .l { color: #7f4707 } /* Literal */ +html[data-theme="light"] .highlight .n { color: #080808 } /* Name */ +html[data-theme="light"] .highlight .o { color: #00622f } /* Operator */ +html[data-theme="light"] .highlight .p { color: #080808 } /* Punctuation */ +html[data-theme="light"] .highlight .ch { color: #515151 } /* Comment.Hashbang */ +html[data-theme="light"] .highlight .cm { color: #515151 } /* Comment.Multiline */ +html[data-theme="light"] .highlight .cp { color: #515151 } /* Comment.Preproc */ +html[data-theme="light"] .highlight .cpf { color: #515151 } /* Comment.PreprocFile */ +html[data-theme="light"] .highlight .c1 { color: #515151 } /* Comment.Single */ +html[data-theme="light"] .highlight .cs { color: #515151 } /* Comment.Special */ +html[data-theme="light"] .highlight .gd { color: #005b82 } /* Generic.Deleted */ +html[data-theme="light"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="light"] .highlight .gh { color: #005b82 } /* Generic.Heading */ +html[data-theme="light"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="light"] .highlight .gu { color: #005b82 } /* Generic.Subheading */ +html[data-theme="light"] .highlight .kc { color: #6730c5 } /* Keyword.Constant */ +html[data-theme="light"] .highlight .kd { color: #6730c5 } /* Keyword.Declaration */ +html[data-theme="light"] .highlight .kn { color: #6730c5 } /* Keyword.Namespace */ +html[data-theme="light"] .highlight .kp { color: #6730c5 } /* Keyword.Pseudo */ +html[data-theme="light"] .highlight .kr { color: #6730c5 } /* Keyword.Reserved */ +html[data-theme="light"] .highlight .kt { color: #7f4707 } /* Keyword.Type */ +html[data-theme="light"] .highlight .ld { color: #7f4707 } /* Literal.Date */ +html[data-theme="light"] .highlight .m { color: #7f4707 } /* Literal.Number */ +html[data-theme="light"] .highlight .s { color: #00622f } /* Literal.String */ +html[data-theme="light"] .highlight .na { color: #912583 } /* Name.Attribute */ +html[data-theme="light"] .highlight .nb { color: #7f4707 } /* Name.Builtin */ +html[data-theme="light"] .highlight .nc { color: #005b82 } /* Name.Class */ +html[data-theme="light"] .highlight .no { color: #005b82 } /* Name.Constant */ +html[data-theme="light"] .highlight .nd { color: #7f4707 } /* Name.Decorator */ +html[data-theme="light"] .highlight .ni { color: #00622f } /* Name.Entity */ +html[data-theme="light"] .highlight .ne { color: #6730c5 } /* Name.Exception */ +html[data-theme="light"] .highlight .nf { color: #005b82 } /* Name.Function */ +html[data-theme="light"] .highlight .nl { color: #7f4707 } /* Name.Label */ +html[data-theme="light"] .highlight .nn { color: #080808 } /* Name.Namespace */ +html[data-theme="light"] .highlight .nx { color: #080808 } /* Name.Other */ +html[data-theme="light"] .highlight .py { color: #005b82 } /* Name.Property */ +html[data-theme="light"] .highlight .nt { color: #005b82 } /* Name.Tag */ +html[data-theme="light"] .highlight .nv { color: #a12236 } /* Name.Variable */ +html[data-theme="light"] .highlight .ow { color: #6730c5 } /* Operator.Word */ +html[data-theme="light"] .highlight .pm { color: #080808 } /* Punctuation.Marker */ +html[data-theme="light"] .highlight .w { color: #080808 } /* Text.Whitespace */ +html[data-theme="light"] .highlight .mb { color: #7f4707 } /* Literal.Number.Bin */ +html[data-theme="light"] .highlight .mf { color: #7f4707 } /* Literal.Number.Float */ +html[data-theme="light"] .highlight .mh { color: #7f4707 } /* Literal.Number.Hex */ +html[data-theme="light"] .highlight .mi { color: #7f4707 } /* Literal.Number.Integer */ +html[data-theme="light"] .highlight .mo { color: #7f4707 } /* Literal.Number.Oct */ +html[data-theme="light"] .highlight .sa { color: #00622f } /* Literal.String.Affix */ +html[data-theme="light"] .highlight .sb { color: #00622f } /* Literal.String.Backtick */ +html[data-theme="light"] .highlight .sc { color: #00622f } /* Literal.String.Char */ +html[data-theme="light"] .highlight .dl { color: #00622f } /* Literal.String.Delimiter */ +html[data-theme="light"] .highlight .sd { color: #00622f } /* Literal.String.Doc */ +html[data-theme="light"] .highlight .s2 { color: #00622f } /* Literal.String.Double */ +html[data-theme="light"] .highlight .se { color: #00622f } /* Literal.String.Escape */ +html[data-theme="light"] .highlight .sh { color: #00622f } /* Literal.String.Heredoc */ +html[data-theme="light"] .highlight .si { color: #00622f } /* Literal.String.Interpol */ +html[data-theme="light"] .highlight .sx { color: #00622f } /* Literal.String.Other */ +html[data-theme="light"] .highlight .sr { color: #a12236 } /* Literal.String.Regex */ +html[data-theme="light"] .highlight .s1 { color: #00622f } /* Literal.String.Single */ +html[data-theme="light"] .highlight .ss { color: #005b82 } /* Literal.String.Symbol */ +html[data-theme="light"] .highlight .bp { color: #7f4707 } /* Name.Builtin.Pseudo */ +html[data-theme="light"] .highlight .fm { color: #005b82 } /* Name.Function.Magic */ +html[data-theme="light"] .highlight .vc { color: #a12236 } /* Name.Variable.Class */ +html[data-theme="light"] .highlight .vg { color: #a12236 } /* Name.Variable.Global */ +html[data-theme="light"] .highlight .vi { color: #a12236 } /* Name.Variable.Instance */ +html[data-theme="light"] .highlight .vm { color: #7f4707 } /* Name.Variable.Magic */ +html[data-theme="light"] .highlight .il { color: #7f4707 } /* Literal.Number.Integer.Long */ +html[data-theme="dark"] .highlight pre { line-height: 125%; } +html[data-theme="dark"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight .hll { background-color: #ffd9002e } +html[data-theme="dark"] .highlight { background: #2b2b2b; color: #f8f8f2 } +html[data-theme="dark"] .highlight .c { color: #ffd900 } /* Comment */ +html[data-theme="dark"] .highlight .err { color: #ffa07a } /* Error */ +html[data-theme="dark"] .highlight .k { color: #dcc6e0 } /* Keyword */ +html[data-theme="dark"] .highlight .l { color: #ffd900 } /* Literal */ +html[data-theme="dark"] .highlight .n { color: #f8f8f2 } /* Name */ +html[data-theme="dark"] .highlight .o { color: #abe338 } /* Operator */ +html[data-theme="dark"] .highlight .p { color: #f8f8f2 } /* Punctuation */ +html[data-theme="dark"] .highlight .ch { color: #ffd900 } /* Comment.Hashbang */ +html[data-theme="dark"] .highlight .cm { color: #ffd900 } /* Comment.Multiline */ +html[data-theme="dark"] .highlight .cp { color: #ffd900 } /* Comment.Preproc */ +html[data-theme="dark"] .highlight .cpf { color: #ffd900 } /* Comment.PreprocFile */ +html[data-theme="dark"] .highlight .c1 { color: #ffd900 } /* Comment.Single */ +html[data-theme="dark"] .highlight .cs { color: #ffd900 } /* Comment.Special */ +html[data-theme="dark"] .highlight .gd { color: #00e0e0 } /* Generic.Deleted */ +html[data-theme="dark"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="dark"] .highlight .gh { color: #00e0e0 } /* Generic.Heading */ +html[data-theme="dark"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="dark"] .highlight .gu { color: #00e0e0 } /* Generic.Subheading */ +html[data-theme="dark"] .highlight .kc { color: #dcc6e0 } /* Keyword.Constant */ +html[data-theme="dark"] .highlight .kd { color: #dcc6e0 } /* Keyword.Declaration */ +html[data-theme="dark"] .highlight .kn { color: #dcc6e0 } /* Keyword.Namespace */ +html[data-theme="dark"] .highlight .kp { color: #dcc6e0 } /* Keyword.Pseudo */ +html[data-theme="dark"] .highlight .kr { color: #dcc6e0 } /* Keyword.Reserved */ +html[data-theme="dark"] .highlight .kt { color: #ffd900 } /* Keyword.Type */ +html[data-theme="dark"] .highlight .ld { color: #ffd900 } /* Literal.Date */ +html[data-theme="dark"] .highlight .m { color: #ffd900 } /* Literal.Number */ +html[data-theme="dark"] .highlight .s { color: #abe338 } /* Literal.String */ +html[data-theme="dark"] .highlight .na { color: #ffd900 } /* Name.Attribute */ +html[data-theme="dark"] .highlight .nb { color: #ffd900 } /* Name.Builtin */ +html[data-theme="dark"] .highlight .nc { color: #00e0e0 } /* Name.Class */ +html[data-theme="dark"] .highlight .no { color: #00e0e0 } /* Name.Constant */ +html[data-theme="dark"] .highlight .nd { color: #ffd900 } /* Name.Decorator */ +html[data-theme="dark"] .highlight .ni { color: #abe338 } /* Name.Entity */ +html[data-theme="dark"] .highlight .ne { color: #dcc6e0 } /* Name.Exception */ +html[data-theme="dark"] .highlight .nf { color: #00e0e0 } /* Name.Function */ +html[data-theme="dark"] .highlight .nl { color: #ffd900 } /* Name.Label */ +html[data-theme="dark"] .highlight .nn { color: #f8f8f2 } /* Name.Namespace */ +html[data-theme="dark"] .highlight .nx { color: #f8f8f2 } /* Name.Other */ +html[data-theme="dark"] .highlight .py { color: #00e0e0 } /* Name.Property */ +html[data-theme="dark"] .highlight .nt { color: #00e0e0 } /* Name.Tag */ +html[data-theme="dark"] .highlight .nv { color: #ffa07a } /* Name.Variable */ +html[data-theme="dark"] .highlight .ow { color: #dcc6e0 } /* Operator.Word */ +html[data-theme="dark"] .highlight .pm { color: #f8f8f2 } /* Punctuation.Marker */ +html[data-theme="dark"] .highlight .w { color: #f8f8f2 } /* Text.Whitespace */ +html[data-theme="dark"] .highlight .mb { color: #ffd900 } /* Literal.Number.Bin */ +html[data-theme="dark"] .highlight .mf { color: #ffd900 } /* Literal.Number.Float */ +html[data-theme="dark"] .highlight .mh { color: #ffd900 } /* Literal.Number.Hex */ +html[data-theme="dark"] .highlight .mi { color: #ffd900 } /* Literal.Number.Integer */ +html[data-theme="dark"] .highlight .mo { color: #ffd900 } /* Literal.Number.Oct */ +html[data-theme="dark"] .highlight .sa { color: #abe338 } /* Literal.String.Affix */ +html[data-theme="dark"] .highlight .sb { color: #abe338 } /* Literal.String.Backtick */ +html[data-theme="dark"] .highlight .sc { color: #abe338 } /* Literal.String.Char */ +html[data-theme="dark"] .highlight .dl { color: #abe338 } /* Literal.String.Delimiter */ +html[data-theme="dark"] .highlight .sd { color: #abe338 } /* Literal.String.Doc */ +html[data-theme="dark"] .highlight .s2 { color: #abe338 } /* Literal.String.Double */ +html[data-theme="dark"] .highlight .se { color: #abe338 } /* Literal.String.Escape */ +html[data-theme="dark"] .highlight .sh { color: #abe338 } /* Literal.String.Heredoc */ +html[data-theme="dark"] .highlight .si { color: #abe338 } /* Literal.String.Interpol */ +html[data-theme="dark"] .highlight .sx { color: #abe338 } /* Literal.String.Other */ +html[data-theme="dark"] .highlight .sr { color: #ffa07a } /* Literal.String.Regex */ +html[data-theme="dark"] .highlight .s1 { color: #abe338 } /* Literal.String.Single */ +html[data-theme="dark"] .highlight .ss { color: #00e0e0 } /* Literal.String.Symbol */ +html[data-theme="dark"] .highlight .bp { color: #ffd900 } /* Name.Builtin.Pseudo */ +html[data-theme="dark"] .highlight .fm { color: #00e0e0 } /* Name.Function.Magic */ +html[data-theme="dark"] .highlight .vc { color: #ffa07a } /* Name.Variable.Class */ +html[data-theme="dark"] .highlight .vg { color: #ffa07a } /* Name.Variable.Global */ +html[data-theme="dark"] .highlight .vi { color: #ffa07a } /* Name.Variable.Instance */ +html[data-theme="dark"] .highlight .vm { color: #ffd900 } /* Name.Variable.Magic */ +html[data-theme="dark"] .highlight .il { color: #ffd900 } /* Literal.Number.Integer.Long */ \ No newline at end of file diff --git a/_static/sbt-webpack-macros.html b/_static/sbt-webpack-macros.html new file mode 100644 index 0000000..6cbf559 --- /dev/null +++ b/_static/sbt-webpack-macros.html @@ -0,0 +1,11 @@ + +{% macro head_pre_bootstrap() %} + +{% endmacro %} + +{% macro body_post() %} + +{% endmacro %} diff --git a/_static/scripts/bootstrap.js b/_static/scripts/bootstrap.js new file mode 100644 index 0000000..c8178de --- /dev/null +++ b/_static/scripts/bootstrap.js @@ -0,0 +1,3 @@ +/*! For license information please see bootstrap.js.LICENSE.txt */ +(()=>{"use strict";var t={d:(e,i)=>{for(var n in i)t.o(i,n)&&!t.o(e,n)&&Object.defineProperty(e,n,{enumerable:!0,get:i[n]})},o:(t,e)=>Object.prototype.hasOwnProperty.call(t,e),r:t=>{"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})}},e={};t.r(e),t.d(e,{afterMain:()=>E,afterRead:()=>v,afterWrite:()=>C,applyStyles:()=>$,arrow:()=>J,auto:()=>a,basePlacements:()=>l,beforeMain:()=>y,beforeRead:()=>_,beforeWrite:()=>A,bottom:()=>s,clippingParents:()=>d,computeStyles:()=>it,createPopper:()=>Dt,createPopperBase:()=>St,createPopperLite:()=>$t,detectOverflow:()=>_t,end:()=>h,eventListeners:()=>st,flip:()=>bt,hide:()=>wt,left:()=>r,main:()=>w,modifierPhases:()=>O,offset:()=>Et,placements:()=>g,popper:()=>f,popperGenerator:()=>Lt,popperOffsets:()=>At,preventOverflow:()=>Tt,read:()=>b,reference:()=>p,right:()=>o,start:()=>c,top:()=>n,variationPlacements:()=>m,viewport:()=>u,write:()=>T});var i={};t.r(i),t.d(i,{Alert:()=>Oe,Button:()=>ke,Carousel:()=>li,Collapse:()=>Ei,Dropdown:()=>Ki,Modal:()=>Ln,Offcanvas:()=>Kn,Popover:()=>bs,ScrollSpy:()=>Ls,Tab:()=>Js,Toast:()=>po,Tooltip:()=>fs});var n="top",s="bottom",o="right",r="left",a="auto",l=[n,s,o,r],c="start",h="end",d="clippingParents",u="viewport",f="popper",p="reference",m=l.reduce((function(t,e){return t.concat([e+"-"+c,e+"-"+h])}),[]),g=[].concat(l,[a]).reduce((function(t,e){return t.concat([e,e+"-"+c,e+"-"+h])}),[]),_="beforeRead",b="read",v="afterRead",y="beforeMain",w="main",E="afterMain",A="beforeWrite",T="write",C="afterWrite",O=[_,b,v,y,w,E,A,T,C];function x(t){return t?(t.nodeName||"").toLowerCase():null}function k(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function L(t){return t instanceof k(t).Element||t instanceof Element}function S(t){return t instanceof k(t).HTMLElement||t instanceof HTMLElement}function D(t){return"undefined"!=typeof ShadowRoot&&(t instanceof k(t).ShadowRoot||t instanceof ShadowRoot)}const $={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];S(s)&&x(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});S(n)&&x(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function I(t){return t.split("-")[0]}var N=Math.max,P=Math.min,M=Math.round;function j(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function F(){return!/^((?!chrome|android).)*safari/i.test(j())}function H(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&S(t)&&(s=t.offsetWidth>0&&M(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&M(n.height)/t.offsetHeight||1);var r=(L(t)?k(t):window).visualViewport,a=!F()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function B(t){var e=H(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function W(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&D(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function z(t){return k(t).getComputedStyle(t)}function R(t){return["table","td","th"].indexOf(x(t))>=0}function q(t){return((L(t)?t.ownerDocument:t.document)||window.document).documentElement}function V(t){return"html"===x(t)?t:t.assignedSlot||t.parentNode||(D(t)?t.host:null)||q(t)}function Y(t){return S(t)&&"fixed"!==z(t).position?t.offsetParent:null}function K(t){for(var e=k(t),i=Y(t);i&&R(i)&&"static"===z(i).position;)i=Y(i);return i&&("html"===x(i)||"body"===x(i)&&"static"===z(i).position)?e:i||function(t){var e=/firefox/i.test(j());if(/Trident/i.test(j())&&S(t)&&"fixed"===z(t).position)return null;var i=V(t);for(D(i)&&(i=i.host);S(i)&&["html","body"].indexOf(x(i))<0;){var n=z(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Q(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function X(t,e,i){return N(t,P(e,i))}function U(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function G(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const J={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,a=t.name,c=t.options,h=i.elements.arrow,d=i.modifiersData.popperOffsets,u=I(i.placement),f=Q(u),p=[r,o].indexOf(u)>=0?"height":"width";if(h&&d){var m=function(t,e){return U("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:G(t,l))}(c.padding,i),g=B(h),_="y"===f?n:r,b="y"===f?s:o,v=i.rects.reference[p]+i.rects.reference[f]-d[f]-i.rects.popper[p],y=d[f]-i.rects.reference[f],w=K(h),E=w?"y"===f?w.clientHeight||0:w.clientWidth||0:0,A=v/2-y/2,T=m[_],C=E-g[p]-m[b],O=E/2-g[p]/2+A,x=X(T,O,C),k=f;i.modifiersData[a]=((e={})[k]=x,e.centerOffset=x-O,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&W(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Z(t){return t.split("-")[1]}var tt={top:"auto",right:"auto",bottom:"auto",left:"auto"};function et(t){var e,i=t.popper,a=t.popperRect,l=t.placement,c=t.variation,d=t.offsets,u=t.position,f=t.gpuAcceleration,p=t.adaptive,m=t.roundOffsets,g=t.isFixed,_=d.x,b=void 0===_?0:_,v=d.y,y=void 0===v?0:v,w="function"==typeof m?m({x:b,y}):{x:b,y};b=w.x,y=w.y;var E=d.hasOwnProperty("x"),A=d.hasOwnProperty("y"),T=r,C=n,O=window;if(p){var x=K(i),L="clientHeight",S="clientWidth";x===k(i)&&"static"!==z(x=q(i)).position&&"absolute"===u&&(L="scrollHeight",S="scrollWidth"),(l===n||(l===r||l===o)&&c===h)&&(C=s,y-=(g&&x===O&&O.visualViewport?O.visualViewport.height:x[L])-a.height,y*=f?1:-1),l!==r&&(l!==n&&l!==s||c!==h)||(T=o,b-=(g&&x===O&&O.visualViewport?O.visualViewport.width:x[S])-a.width,b*=f?1:-1)}var D,$=Object.assign({position:u},p&&tt),I=!0===m?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:M(i*s)/s||0,y:M(n*s)/s||0}}({x:b,y},k(i)):{x:b,y};return b=I.x,y=I.y,f?Object.assign({},$,((D={})[C]=A?"0":"",D[T]=E?"0":"",D.transform=(O.devicePixelRatio||1)<=1?"translate("+b+"px, "+y+"px)":"translate3d("+b+"px, "+y+"px, 0)",D)):Object.assign({},$,((e={})[C]=A?y+"px":"",e[T]=E?b+"px":"",e.transform="",e))}const it={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:I(e.placement),variation:Z(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,et(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,et(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var nt={passive:!0};const st={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=k(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,nt)})),a&&l.addEventListener("resize",i.update,nt),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,nt)})),a&&l.removeEventListener("resize",i.update,nt)}},data:{}};var ot={left:"right",right:"left",bottom:"top",top:"bottom"};function rt(t){return t.replace(/left|right|bottom|top/g,(function(t){return ot[t]}))}var at={start:"end",end:"start"};function lt(t){return t.replace(/start|end/g,(function(t){return at[t]}))}function ct(t){var e=k(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function ht(t){return H(q(t)).left+ct(t).scrollLeft}function dt(t){var e=z(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function ut(t){return["html","body","#document"].indexOf(x(t))>=0?t.ownerDocument.body:S(t)&&dt(t)?t:ut(V(t))}function ft(t,e){var i;void 0===e&&(e=[]);var n=ut(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=k(n),r=s?[o].concat(o.visualViewport||[],dt(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(ft(V(r)))}function pt(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function mt(t,e,i){return e===u?pt(function(t,e){var i=k(t),n=q(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=F();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+ht(t),y:l}}(t,i)):L(e)?function(t,e){var i=H(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):pt(function(t){var e,i=q(t),n=ct(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=N(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=N(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+ht(t),l=-n.scrollTop;return"rtl"===z(s||i).direction&&(a+=N(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(q(t)))}function gt(t){var e,i=t.reference,a=t.element,l=t.placement,d=l?I(l):null,u=l?Z(l):null,f=i.x+i.width/2-a.width/2,p=i.y+i.height/2-a.height/2;switch(d){case n:e={x:f,y:i.y-a.height};break;case s:e={x:f,y:i.y+i.height};break;case o:e={x:i.x+i.width,y:p};break;case r:e={x:i.x-a.width,y:p};break;default:e={x:i.x,y:i.y}}var m=d?Q(d):null;if(null!=m){var g="y"===m?"height":"width";switch(u){case c:e[m]=e[m]-(i[g]/2-a[g]/2);break;case h:e[m]=e[m]+(i[g]/2-a[g]/2)}}return e}function _t(t,e){void 0===e&&(e={});var i=e,r=i.placement,a=void 0===r?t.placement:r,c=i.strategy,h=void 0===c?t.strategy:c,m=i.boundary,g=void 0===m?d:m,_=i.rootBoundary,b=void 0===_?u:_,v=i.elementContext,y=void 0===v?f:v,w=i.altBoundary,E=void 0!==w&&w,A=i.padding,T=void 0===A?0:A,C=U("number"!=typeof T?T:G(T,l)),O=y===f?p:f,k=t.rects.popper,D=t.elements[E?O:y],$=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=ft(V(t)),i=["absolute","fixed"].indexOf(z(t).position)>=0&&S(t)?K(t):t;return L(i)?e.filter((function(t){return L(t)&&W(t,i)&&"body"!==x(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=mt(t,i,n);return e.top=N(s.top,e.top),e.right=P(s.right,e.right),e.bottom=P(s.bottom,e.bottom),e.left=N(s.left,e.left),e}),mt(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(L(D)?D:D.contextElement||q(t.elements.popper),g,b,h),I=H(t.elements.reference),M=gt({reference:I,element:k,strategy:"absolute",placement:a}),j=pt(Object.assign({},k,M)),F=y===f?j:I,B={top:$.top-F.top+C.top,bottom:F.bottom-$.bottom+C.bottom,left:$.left-F.left+C.left,right:F.right-$.right+C.right},R=t.modifiersData.offset;if(y===f&&R){var Y=R[a];Object.keys(B).forEach((function(t){var e=[o,s].indexOf(t)>=0?1:-1,i=[n,s].indexOf(t)>=0?"y":"x";B[t]+=Y[i]*e}))}return B}const bt={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,h=t.name;if(!e.modifiersData[h]._skip){for(var d=i.mainAxis,u=void 0===d||d,f=i.altAxis,p=void 0===f||f,_=i.fallbackPlacements,b=i.padding,v=i.boundary,y=i.rootBoundary,w=i.altBoundary,E=i.flipVariations,A=void 0===E||E,T=i.allowedAutoPlacements,C=e.options.placement,O=I(C),x=_||(O!==C&&A?function(t){if(I(t)===a)return[];var e=rt(t);return[lt(t),e,lt(e)]}(C):[rt(C)]),k=[C].concat(x).reduce((function(t,i){return t.concat(I(i)===a?function(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,c=i.allowedAutoPlacements,h=void 0===c?g:c,d=Z(n),u=d?a?m:m.filter((function(t){return Z(t)===d})):l,f=u.filter((function(t){return h.indexOf(t)>=0}));0===f.length&&(f=u);var p=f.reduce((function(e,i){return e[i]=_t(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[I(i)],e}),{});return Object.keys(p).sort((function(t,e){return p[t]-p[e]}))}(e,{placement:i,boundary:v,rootBoundary:y,padding:b,flipVariations:A,allowedAutoPlacements:T}):i)}),[]),L=e.rects.reference,S=e.rects.popper,D=new Map,$=!0,N=k[0],P=0;P=0,B=H?"width":"height",W=_t(e,{placement:M,boundary:v,rootBoundary:y,altBoundary:w,padding:b}),z=H?F?o:r:F?s:n;L[B]>S[B]&&(z=rt(z));var R=rt(z),q=[];if(u&&q.push(W[j]<=0),p&&q.push(W[z]<=0,W[R]<=0),q.every((function(t){return t}))){N=M,$=!1;break}D.set(M,q)}if($)for(var V=function(t){var e=k.find((function(e){var i=D.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return N=e,"break"},Y=A?3:1;Y>0&&"break"!==V(Y);Y--);e.placement!==N&&(e.modifiersData[h]._skip=!0,e.placement=N,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function vt(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function yt(t){return[n,o,s,r].some((function(e){return t[e]>=0}))}const wt={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=_t(e,{elementContext:"reference"}),a=_t(e,{altBoundary:!0}),l=vt(r,n),c=vt(a,s,o),h=yt(l),d=yt(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},Et={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,s=t.name,a=i.offset,l=void 0===a?[0,0]:a,c=g.reduce((function(t,i){return t[i]=function(t,e,i){var s=I(t),a=[r,n].indexOf(s)>=0?-1:1,l="function"==typeof i?i(Object.assign({},e,{placement:t})):i,c=l[0],h=l[1];return c=c||0,h=(h||0)*a,[r,o].indexOf(s)>=0?{x:h,y:c}:{x:c,y:h}}(i,e.rects,l),t}),{}),h=c[e.placement],d=h.x,u=h.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=d,e.modifiersData.popperOffsets.y+=u),e.modifiersData[s]=c}},At={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=gt({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},Tt={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,a=t.name,l=i.mainAxis,h=void 0===l||l,d=i.altAxis,u=void 0!==d&&d,f=i.boundary,p=i.rootBoundary,m=i.altBoundary,g=i.padding,_=i.tether,b=void 0===_||_,v=i.tetherOffset,y=void 0===v?0:v,w=_t(e,{boundary:f,rootBoundary:p,padding:g,altBoundary:m}),E=I(e.placement),A=Z(e.placement),T=!A,C=Q(E),O="x"===C?"y":"x",x=e.modifiersData.popperOffsets,k=e.rects.reference,L=e.rects.popper,S="function"==typeof y?y(Object.assign({},e.rects,{placement:e.placement})):y,D="number"==typeof S?{mainAxis:S,altAxis:S}:Object.assign({mainAxis:0,altAxis:0},S),$=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,M={x:0,y:0};if(x){if(h){var j,F="y"===C?n:r,H="y"===C?s:o,W="y"===C?"height":"width",z=x[C],R=z+w[F],q=z-w[H],V=b?-L[W]/2:0,Y=A===c?k[W]:L[W],U=A===c?-L[W]:-k[W],G=e.elements.arrow,J=b&&G?B(G):{width:0,height:0},tt=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},et=tt[F],it=tt[H],nt=X(0,k[W],J[W]),st=T?k[W]/2-V-nt-et-D.mainAxis:Y-nt-et-D.mainAxis,ot=T?-k[W]/2+V+nt+it+D.mainAxis:U+nt+it+D.mainAxis,rt=e.elements.arrow&&K(e.elements.arrow),at=rt?"y"===C?rt.clientTop||0:rt.clientLeft||0:0,lt=null!=(j=null==$?void 0:$[C])?j:0,ct=z+ot-lt,ht=X(b?P(R,z+st-lt-at):R,z,b?N(q,ct):q);x[C]=ht,M[C]=ht-z}if(u){var dt,ut="x"===C?n:r,ft="x"===C?s:o,pt=x[O],mt="y"===O?"height":"width",gt=pt+w[ut],bt=pt-w[ft],vt=-1!==[n,r].indexOf(E),yt=null!=(dt=null==$?void 0:$[O])?dt:0,wt=vt?gt:pt-k[mt]-L[mt]-yt+D.altAxis,Et=vt?pt+k[mt]+L[mt]-yt-D.altAxis:bt,At=b&&vt?function(t,e,i){var n=X(t,e,i);return n>i?i:n}(wt,pt,Et):X(b?wt:gt,pt,b?Et:bt);x[O]=At,M[O]=At-pt}e.modifiersData[a]=M}},requiresIfExists:["offset"]};function Ct(t,e,i){void 0===i&&(i=!1);var n,s,o=S(e),r=S(e)&&function(t){var e=t.getBoundingClientRect(),i=M(e.width)/t.offsetWidth||1,n=M(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=q(e),l=H(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==x(e)||dt(a))&&(c=(n=e)!==k(n)&&S(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:ct(n)),S(e)?((h=H(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=ht(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function Ot(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var xt={placement:"bottom",modifiers:[],strategy:"absolute"};function kt(){for(var t=arguments.length,e=new Array(t),i=0;iIt.has(t)&&It.get(t).get(e)||null,remove(t,e){if(!It.has(t))return;const i=It.get(t);i.delete(e),0===i.size&&It.delete(t)}},Pt="transitionend",Mt=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),jt=t=>{t.dispatchEvent(new Event(Pt))},Ft=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),Ht=t=>Ft(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(Mt(t)):null,Bt=t=>{if(!Ft(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},Wt=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),zt=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?zt(t.parentNode):null},Rt=()=>{},qt=t=>{t.offsetHeight},Vt=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,Yt=[],Kt=()=>"rtl"===document.documentElement.dir,Qt=t=>{var e;e=()=>{const e=Vt();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(Yt.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of Yt)t()})),Yt.push(e)):e()},Xt=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,Ut=(t,e,i=!0)=>{if(!i)return void Xt(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let s=!1;const o=({target:i})=>{i===e&&(s=!0,e.removeEventListener(Pt,o),Xt(t))};e.addEventListener(Pt,o),setTimeout((()=>{s||jt(e)}),n)},Gt=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},Jt=/[^.]*(?=\..*)\.|.*/,Zt=/\..*/,te=/::\d+$/,ee={};let ie=1;const ne={mouseenter:"mouseover",mouseleave:"mouseout"},se=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function oe(t,e){return e&&`${e}::${ie++}`||t.uidEvent||ie++}function re(t){const e=oe(t);return t.uidEvent=e,ee[e]=ee[e]||{},ee[e]}function ae(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function le(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=ue(t);return se.has(o)||(o=t),[n,s,o]}function ce(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=le(e,i,n);if(e in ne){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=re(t),c=l[a]||(l[a]={}),h=ae(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=oe(r,e.replace(Jt,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return pe(s,{delegateTarget:r}),n.oneOff&&fe.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return pe(n,{delegateTarget:t}),i.oneOff&&fe.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function he(t,e,i,n,s){const o=ae(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function de(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&he(t,e,i,r.callable,r.delegationSelector)}function ue(t){return t=t.replace(Zt,""),ne[t]||t}const fe={on(t,e,i,n){ce(t,e,i,n,!1)},one(t,e,i,n){ce(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=le(e,i,n),a=r!==e,l=re(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))de(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(te,"");a&&!e.includes(s)||he(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;he(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=Vt();let s=null,o=!0,r=!0,a=!1;e!==ue(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=pe(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function pe(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function me(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function ge(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const _e={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${ge(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${ge(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=me(t.dataset[n])}return e},getDataAttribute:(t,e)=>me(t.getAttribute(`data-bs-${ge(e)}`))};class be{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=Ft(e)?_e.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...Ft(e)?_e.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],o=Ft(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(o))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${o}" but expected type "${s}".`)}var i}}class ve extends be{constructor(t,e){super(),(t=Ht(t))&&(this._element=t,this._config=this._getConfig(e),Nt.set(this._element,this.constructor.DATA_KEY,this))}dispose(){Nt.remove(this._element,this.constructor.DATA_KEY),fe.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){Ut(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return Nt.get(Ht(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const ye=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>Mt(t))).join(","):null},we={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!Wt(t)&&Bt(t)))},getSelectorFromElement(t){const e=ye(t);return e&&we.findOne(e)?e:null},getElementFromSelector(t){const e=ye(t);return e?we.findOne(e):null},getMultipleElementsFromSelector(t){const e=ye(t);return e?we.find(e):[]}},Ee=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;fe.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),Wt(this))return;const s=we.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},Ae=".bs.alert",Te=`close${Ae}`,Ce=`closed${Ae}`;class Oe extends ve{static get NAME(){return"alert"}close(){if(fe.trigger(this._element,Te).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),fe.trigger(this._element,Ce),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Oe.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}Ee(Oe,"close"),Qt(Oe);const xe='[data-bs-toggle="button"]';class ke extends ve{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=ke.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}fe.on(document,"click.bs.button.data-api",xe,(t=>{t.preventDefault();const e=t.target.closest(xe);ke.getOrCreateInstance(e).toggle()})),Qt(ke);const Le=".bs.swipe",Se=`touchstart${Le}`,De=`touchmove${Le}`,$e=`touchend${Le}`,Ie=`pointerdown${Le}`,Ne=`pointerup${Le}`,Pe={endCallback:null,leftCallback:null,rightCallback:null},Me={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class je extends be{constructor(t,e){super(),this._element=t,t&&je.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return Pe}static get DefaultType(){return Me}static get NAME(){return"swipe"}dispose(){fe.off(this._element,Le)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),Xt(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&Xt(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(fe.on(this._element,Ie,(t=>this._start(t))),fe.on(this._element,Ne,(t=>this._end(t))),this._element.classList.add("pointer-event")):(fe.on(this._element,Se,(t=>this._start(t))),fe.on(this._element,De,(t=>this._move(t))),fe.on(this._element,$e,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const Fe=".bs.carousel",He=".data-api",Be="ArrowLeft",We="ArrowRight",ze="next",Re="prev",qe="left",Ve="right",Ye=`slide${Fe}`,Ke=`slid${Fe}`,Qe=`keydown${Fe}`,Xe=`mouseenter${Fe}`,Ue=`mouseleave${Fe}`,Ge=`dragstart${Fe}`,Je=`load${Fe}${He}`,Ze=`click${Fe}${He}`,ti="carousel",ei="active",ii=".active",ni=".carousel-item",si=ii+ni,oi={[Be]:Ve,[We]:qe},ri={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},ai={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class li extends ve{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=we.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===ti&&this.cycle()}static get Default(){return ri}static get DefaultType(){return ai}static get NAME(){return"carousel"}next(){this._slide(ze)}nextWhenVisible(){!document.hidden&&Bt(this._element)&&this.next()}prev(){this._slide(Re)}pause(){this._isSliding&&jt(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?fe.one(this._element,Ke,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void fe.one(this._element,Ke,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?ze:Re;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&fe.on(this._element,Qe,(t=>this._keydown(t))),"hover"===this._config.pause&&(fe.on(this._element,Xe,(()=>this.pause())),fe.on(this._element,Ue,(()=>this._maybeEnableCycle()))),this._config.touch&&je.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of we.find(".carousel-item img",this._element))fe.on(t,Ge,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(qe)),rightCallback:()=>this._slide(this._directionToOrder(Ve)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new je(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=oi[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=we.findOne(ii,this._indicatorsElement);e.classList.remove(ei),e.removeAttribute("aria-current");const i=we.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(ei),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===ze,s=e||Gt(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>fe.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(Ye).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),qt(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(ei),i.classList.remove(ei,c,l),this._isSliding=!1,r(Ke)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return we.findOne(si,this._element)}_getItems(){return we.find(ni,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return Kt()?t===qe?Re:ze:t===qe?ze:Re}_orderToDirection(t){return Kt()?t===Re?qe:Ve:t===Re?Ve:qe}static jQueryInterface(t){return this.each((function(){const e=li.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}fe.on(document,Ze,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=we.getElementFromSelector(this);if(!e||!e.classList.contains(ti))return;t.preventDefault();const i=li.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===_e.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),fe.on(window,Je,(()=>{const t=we.find('[data-bs-ride="carousel"]');for(const e of t)li.getOrCreateInstance(e)})),Qt(li);const ci=".bs.collapse",hi=`show${ci}`,di=`shown${ci}`,ui=`hide${ci}`,fi=`hidden${ci}`,pi=`click${ci}.data-api`,mi="show",gi="collapse",_i="collapsing",bi=`:scope .${gi} .${gi}`,vi='[data-bs-toggle="collapse"]',yi={parent:null,toggle:!0},wi={parent:"(null|element)",toggle:"boolean"};class Ei extends ve{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=we.find(vi);for(const t of i){const e=we.getSelectorFromElement(t),i=we.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return yi}static get DefaultType(){return wi}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Ei.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(fe.trigger(this._element,hi).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(gi),this._element.classList.add(_i),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi,mi),this._element.style[e]="",fe.trigger(this._element,di)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(fe.trigger(this._element,ui).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,qt(this._element),this._element.classList.add(_i),this._element.classList.remove(gi,mi);for(const t of this._triggerArray){const e=we.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi),fe.trigger(this._element,fi)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(mi)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=Ht(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(vi);for(const e of t){const t=we.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=we.find(bi,this._config.parent);return we.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Ei.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}fe.on(document,pi,vi,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of we.getMultipleElementsFromSelector(this))Ei.getOrCreateInstance(t,{toggle:!1}).toggle()})),Qt(Ei);const Ai="dropdown",Ti=".bs.dropdown",Ci=".data-api",Oi="ArrowUp",xi="ArrowDown",ki=`hide${Ti}`,Li=`hidden${Ti}`,Si=`show${Ti}`,Di=`shown${Ti}`,$i=`click${Ti}${Ci}`,Ii=`keydown${Ti}${Ci}`,Ni=`keyup${Ti}${Ci}`,Pi="show",Mi='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',ji=`${Mi}.${Pi}`,Fi=".dropdown-menu",Hi=Kt()?"top-end":"top-start",Bi=Kt()?"top-start":"top-end",Wi=Kt()?"bottom-end":"bottom-start",zi=Kt()?"bottom-start":"bottom-end",Ri=Kt()?"left-start":"right-start",qi=Kt()?"right-start":"left-start",Vi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Yi={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Ki extends ve{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=we.next(this._element,Fi)[0]||we.prev(this._element,Fi)[0]||we.findOne(Fi,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return Vi}static get DefaultType(){return Yi}static get NAME(){return Ai}toggle(){return this._isShown()?this.hide():this.show()}show(){if(Wt(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!fe.trigger(this._element,Si,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Pi),this._element.classList.add(Pi),fe.trigger(this._element,Di,t)}}hide(){if(Wt(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!fe.trigger(this._element,ki,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._popper&&this._popper.destroy(),this._menu.classList.remove(Pi),this._element.classList.remove(Pi),this._element.setAttribute("aria-expanded","false"),_e.removeDataAttribute(this._menu,"popper"),fe.trigger(this._element,Li,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!Ft(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${Ai.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===e)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:Ft(this._config.reference)?t=Ht(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const i=this._getPopperConfig();this._popper=Dt(t,this._menu,i)}_isShown(){return this._menu.classList.contains(Pi)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Ri;if(t.classList.contains("dropstart"))return qi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Bi:Hi:e?zi:Wi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(_e.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...Xt(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=we.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>Bt(t)));i.length&&Gt(i,e,t===xi,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Ki.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=we.find(ji);for(const i of e){const e=Ki.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Oi,xi].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Mi)?this:we.prev(this,Mi)[0]||we.next(this,Mi)[0]||we.findOne(Mi,t.delegateTarget.parentNode),o=Ki.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}fe.on(document,Ii,Mi,Ki.dataApiKeydownHandler),fe.on(document,Ii,Fi,Ki.dataApiKeydownHandler),fe.on(document,$i,Ki.clearMenus),fe.on(document,Ni,Ki.clearMenus),fe.on(document,$i,Mi,(function(t){t.preventDefault(),Ki.getOrCreateInstance(this).toggle()})),Qt(Ki);const Qi="backdrop",Xi="show",Ui=`mousedown.bs.${Qi}`,Gi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Ji={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Zi extends be{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Gi}static get DefaultType(){return Ji}static get NAME(){return Qi}show(t){if(!this._config.isVisible)return void Xt(t);this._append();const e=this._getElement();this._config.isAnimated&&qt(e),e.classList.add(Xi),this._emulateAnimation((()=>{Xt(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Xi),this._emulateAnimation((()=>{this.dispose(),Xt(t)}))):Xt(t)}dispose(){this._isAppended&&(fe.off(this._element,Ui),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=Ht(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),fe.on(t,Ui,(()=>{Xt(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){Ut(t,this._getElement(),this._config.isAnimated)}}const tn=".bs.focustrap",en=`focusin${tn}`,nn=`keydown.tab${tn}`,sn="backward",on={autofocus:!0,trapElement:null},rn={autofocus:"boolean",trapElement:"element"};class an extends be{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return on}static get DefaultType(){return rn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),fe.off(document,tn),fe.on(document,en,(t=>this._handleFocusin(t))),fe.on(document,nn,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,fe.off(document,tn))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=we.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===sn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?sn:"forward")}}const ln=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",cn=".sticky-top",hn="padding-right",dn="margin-right";class un{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,hn,(e=>e+t)),this._setElementAttributes(ln,hn,(e=>e+t)),this._setElementAttributes(cn,dn,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,hn),this._resetElementAttributes(ln,hn),this._resetElementAttributes(cn,dn)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&_e.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=_e.getDataAttribute(t,e);null!==i?(_e.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(Ft(t))e(t);else for(const i of we.find(t,this._element))e(i)}}const fn=".bs.modal",pn=`hide${fn}`,mn=`hidePrevented${fn}`,gn=`hidden${fn}`,_n=`show${fn}`,bn=`shown${fn}`,vn=`resize${fn}`,yn=`click.dismiss${fn}`,wn=`mousedown.dismiss${fn}`,En=`keydown.dismiss${fn}`,An=`click${fn}.data-api`,Tn="modal-open",Cn="show",On="modal-static",xn={backdrop:!0,focus:!0,keyboard:!0},kn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class Ln extends ve{constructor(t,e){super(t,e),this._dialog=we.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new un,this._addEventListeners()}static get Default(){return xn}static get DefaultType(){return kn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||fe.trigger(this._element,_n,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(Tn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(fe.trigger(this._element,pn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(Cn),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){fe.off(window,fn),fe.off(this._dialog,fn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Zi({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new an({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=we.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),qt(this._element),this._element.classList.add(Cn),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,fe.trigger(this._element,bn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){fe.on(this._element,En,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),fe.on(window,vn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),fe.on(this._element,wn,(t=>{fe.one(this._element,yn,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(Tn),this._resetAdjustments(),this._scrollBar.reset(),fe.trigger(this._element,gn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(fe.trigger(this._element,mn).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(On)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(On),this._queueCallback((()=>{this._element.classList.remove(On),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=Kt()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=Kt()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=Ln.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}fe.on(document,An,'[data-bs-toggle="modal"]',(function(t){const e=we.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),fe.one(e,_n,(t=>{t.defaultPrevented||fe.one(e,gn,(()=>{Bt(this)&&this.focus()}))}));const i=we.findOne(".modal.show");i&&Ln.getInstance(i).hide(),Ln.getOrCreateInstance(e).toggle(this)})),Ee(Ln),Qt(Ln);const Sn=".bs.offcanvas",Dn=".data-api",$n=`load${Sn}${Dn}`,In="show",Nn="showing",Pn="hiding",Mn=".offcanvas.show",jn=`show${Sn}`,Fn=`shown${Sn}`,Hn=`hide${Sn}`,Bn=`hidePrevented${Sn}`,Wn=`hidden${Sn}`,zn=`resize${Sn}`,Rn=`click${Sn}${Dn}`,qn=`keydown.dismiss${Sn}`,Vn={backdrop:!0,keyboard:!0,scroll:!1},Yn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class Kn extends ve{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return Vn}static get DefaultType(){return Yn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||fe.trigger(this._element,jn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new un).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Nn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(In),this._element.classList.remove(Nn),fe.trigger(this._element,Fn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(fe.trigger(this._element,Hn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(Pn),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(In,Pn),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new un).reset(),fe.trigger(this._element,Wn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Zi({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():fe.trigger(this._element,Bn)}:null})}_initializeFocusTrap(){return new an({trapElement:this._element})}_addEventListeners(){fe.on(this._element,qn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():fe.trigger(this._element,Bn))}))}static jQueryInterface(t){return this.each((function(){const e=Kn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}fe.on(document,Rn,'[data-bs-toggle="offcanvas"]',(function(t){const e=we.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this))return;fe.one(e,Wn,(()=>{Bt(this)&&this.focus()}));const i=we.findOne(Mn);i&&i!==e&&Kn.getInstance(i).hide(),Kn.getOrCreateInstance(e).toggle(this)})),fe.on(window,$n,(()=>{for(const t of we.find(Mn))Kn.getOrCreateInstance(t).show()})),fe.on(window,zn,(()=>{for(const t of we.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&Kn.getOrCreateInstance(t).hide()})),Ee(Kn),Qt(Kn);const Qn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Xn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Un=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Gn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Xn.has(i)||Boolean(Un.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Jn={allowList:Qn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Zn={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},ts={entry:"(string|element|function|null)",selector:"(string|element)"};class es extends be{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Jn}static get DefaultType(){return Zn}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},ts)}_setContent(t,e,i){const n=we.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?Ft(e)?this._putElementInTemplate(Ht(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Gn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return Xt(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const is=new Set(["sanitize","allowList","sanitizeFn"]),ns="fade",ss="show",os=".tooltip-inner",rs=".modal",as="hide.bs.modal",ls="hover",cs="focus",hs={AUTO:"auto",TOP:"top",RIGHT:Kt()?"left":"right",BOTTOM:"bottom",LEFT:Kt()?"right":"left"},ds={allowList:Qn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},us={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class fs extends ve{constructor(t,i){if(void 0===e)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,i),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return ds}static get DefaultType(){return us}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),fe.off(this._element.closest(rs),as,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=fe.trigger(this._element,this.constructor.eventName("show")),e=(zt(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),fe.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._queueCallback((()=>{fe.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!fe.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._activeTrigger.click=!1,this._activeTrigger[cs]=!1,this._activeTrigger[ls]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),fe.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ns,ss),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ns),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new es({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{[os]:this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ns)}_isShown(){return this.tip&&this.tip.classList.contains(ss)}_createPopper(t){const e=Xt(this._config.placement,[this,t,this._element]),i=hs[e.toUpperCase()];return Dt(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return Xt(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...Xt(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)fe.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ls?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ls?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");fe.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?cs:ls]=!0,e._enter()})),fe.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?cs:ls]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},fe.on(this._element.closest(rs),as,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=_e.getDataAttributes(this._element);for(const t of Object.keys(e))is.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:Ht(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=fs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(fs);const ps=".popover-header",ms=".popover-body",gs={...fs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},_s={...fs.DefaultType,content:"(null|string|element|function)"};class bs extends fs{static get Default(){return gs}static get DefaultType(){return _s}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{[ps]:this._getTitle(),[ms]:this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=bs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(bs);const vs=".bs.scrollspy",ys=`activate${vs}`,ws=`click${vs}`,Es=`load${vs}.data-api`,As="active",Ts="[href]",Cs=".nav-link",Os=`${Cs}, .nav-item > ${Cs}, .list-group-item`,xs={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},ks={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Ls extends ve{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return xs}static get DefaultType(){return ks}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=Ht(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(fe.off(this._config.target,ws),fe.on(this._config.target,ws,Ts,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=we.find(Ts,this._config.target);for(const e of t){if(!e.hash||Wt(e))continue;const t=we.findOne(decodeURI(e.hash),this._element);Bt(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(As),this._activateParents(t),fe.trigger(this._element,ys,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))we.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(As);else for(const e of we.parents(t,".nav, .list-group"))for(const t of we.prev(e,Os))t.classList.add(As)}_clearActiveClass(t){t.classList.remove(As);const e=we.find(`${Ts}.${As}`,t);for(const t of e)t.classList.remove(As)}static jQueryInterface(t){return this.each((function(){const e=Ls.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(window,Es,(()=>{for(const t of we.find('[data-bs-spy="scroll"]'))Ls.getOrCreateInstance(t)})),Qt(Ls);const Ss=".bs.tab",Ds=`hide${Ss}`,$s=`hidden${Ss}`,Is=`show${Ss}`,Ns=`shown${Ss}`,Ps=`click${Ss}`,Ms=`keydown${Ss}`,js=`load${Ss}`,Fs="ArrowLeft",Hs="ArrowRight",Bs="ArrowUp",Ws="ArrowDown",zs="Home",Rs="End",qs="active",Vs="fade",Ys="show",Ks=".dropdown-toggle",Qs=`:not(${Ks})`,Xs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Us=`.nav-link${Qs}, .list-group-item${Qs}, [role="tab"]${Qs}, ${Xs}`,Gs=`.${qs}[data-bs-toggle="tab"], .${qs}[data-bs-toggle="pill"], .${qs}[data-bs-toggle="list"]`;class Js extends ve{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),fe.on(this._element,Ms,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?fe.trigger(e,Ds,{relatedTarget:t}):null;fe.trigger(t,Is,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(qs),this._activate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),fe.trigger(t,Ns,{relatedTarget:e})):t.classList.add(Ys)}),t,t.classList.contains(Vs)))}_deactivate(t,e){t&&(t.classList.remove(qs),t.blur(),this._deactivate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),fe.trigger(t,$s,{relatedTarget:e})):t.classList.remove(Ys)}),t,t.classList.contains(Vs)))}_keydown(t){if(![Fs,Hs,Bs,Ws,zs,Rs].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!Wt(t)));let i;if([zs,Rs].includes(t.key))i=e[t.key===zs?0:e.length-1];else{const n=[Hs,Ws].includes(t.key);i=Gt(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Js.getOrCreateInstance(i).show())}_getChildren(){return we.find(Us,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=we.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=we.findOne(t,i);s&&s.classList.toggle(n,e)};n(Ks,qs),n(".dropdown-menu",Ys),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(qs)}_getInnerElement(t){return t.matches(Us)?t:we.findOne(Us,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Js.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(document,Ps,Xs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this)||Js.getOrCreateInstance(this).show()})),fe.on(window,js,(()=>{for(const t of we.find(Gs))Js.getOrCreateInstance(t)})),Qt(Js);const Zs=".bs.toast",to=`mouseover${Zs}`,eo=`mouseout${Zs}`,io=`focusin${Zs}`,no=`focusout${Zs}`,so=`hide${Zs}`,oo=`hidden${Zs}`,ro=`show${Zs}`,ao=`shown${Zs}`,lo="hide",co="show",ho="showing",uo={animation:"boolean",autohide:"boolean",delay:"number"},fo={animation:!0,autohide:!0,delay:5e3};class po extends ve{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return fo}static get DefaultType(){return uo}static get NAME(){return"toast"}show(){fe.trigger(this._element,ro).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(lo),qt(this._element),this._element.classList.add(co,ho),this._queueCallback((()=>{this._element.classList.remove(ho),fe.trigger(this._element,ao),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(fe.trigger(this._element,so).defaultPrevented||(this._element.classList.add(ho),this._queueCallback((()=>{this._element.classList.add(lo),this._element.classList.remove(ho,co),fe.trigger(this._element,oo)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(co),super.dispose()}isShown(){return this._element.classList.contains(co)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){fe.on(this._element,to,(t=>this._onInteraction(t,!0))),fe.on(this._element,eo,(t=>this._onInteraction(t,!1))),fe.on(this._element,io,(t=>this._onInteraction(t,!0))),fe.on(this._element,no,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=po.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}function mo(t){"loading"!=document.readyState?t():document.addEventListener("DOMContentLoaded",t)}Ee(po),Qt(po),mo((function(){[].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map((function(t){return new fs(t,{delay:{show:500,hide:100}})}))})),mo((function(){document.getElementById("pst-back-to-top").addEventListener("click",(function(){document.body.scrollTop=0,document.documentElement.scrollTop=0}))})),mo((function(){var t=document.getElementById("pst-back-to-top"),e=document.getElementsByClassName("bd-header")[0].getBoundingClientRect();window.addEventListener("scroll",(function(){this.oldScroll>this.scrollY&&this.scrollY>e.bottom?t.style.display="block":t.style.display="none",this.oldScroll=this.scrollY}))})),window.bootstrap=i})(); +//# sourceMappingURL=bootstrap.js.map \ No newline at end of file diff --git a/_static/scripts/bootstrap.js.LICENSE.txt b/_static/scripts/bootstrap.js.LICENSE.txt new file mode 100644 index 0000000..28755c2 --- /dev/null +++ b/_static/scripts/bootstrap.js.LICENSE.txt @@ -0,0 +1,5 @@ +/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ diff --git a/_static/scripts/bootstrap.js.map b/_static/scripts/bootstrap.js.map new file mode 100644 index 0000000..4a3502a --- /dev/null +++ b/_static/scripts/bootstrap.js.map @@ -0,0 +1 @@ +{"version":3,"file":"scripts/bootstrap.js","mappings":";mBACA,IAAIA,EAAsB,CCA1BA,EAAwB,CAACC,EAASC,KACjC,IAAI,IAAIC,KAAOD,EACXF,EAAoBI,EAAEF,EAAYC,KAASH,EAAoBI,EAAEH,EAASE,IAC5EE,OAAOC,eAAeL,EAASE,EAAK,CAAEI,YAAY,EAAMC,IAAKN,EAAWC,IAE1E,ECNDH,EAAwB,CAACS,EAAKC,IAAUL,OAAOM,UAAUC,eAAeC,KAAKJ,EAAKC,GCClFV,EAAyBC,IACH,oBAAXa,QAA0BA,OAAOC,aAC1CV,OAAOC,eAAeL,EAASa,OAAOC,YAAa,CAAEC,MAAO,WAE7DX,OAAOC,eAAeL,EAAS,aAAc,CAAEe,OAAO,GAAO,01BCLvD,IAAI,EAAM,MACNC,EAAS,SACTC,EAAQ,QACRC,EAAO,OACPC,EAAO,OACPC,EAAiB,CAAC,EAAKJ,EAAQC,EAAOC,GACtCG,EAAQ,QACRC,EAAM,MACNC,EAAkB,kBAClBC,EAAW,WACXC,EAAS,SACTC,EAAY,YACZC,EAAmCP,EAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAIE,OAAO,CAACD,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAChE,GAAG,IACQ,EAA0B,GAAGS,OAAOX,EAAgB,CAACD,IAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAIE,OAAO,CAACD,EAAWA,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAC3E,GAAG,IAEQU,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAc,cACdC,EAAQ,QACRC,EAAa,aACbC,EAAiB,CAACT,EAAYC,EAAMC,EAAWC,EAAYC,EAAMC,EAAWC,EAAaC,EAAOC,GC9B5F,SAASE,EAAYC,GAClC,OAAOA,GAAWA,EAAQC,UAAY,IAAIC,cAAgB,IAC5D,CCFe,SAASC,EAAUC,GAChC,GAAY,MAARA,EACF,OAAOC,OAGT,GAAwB,oBAApBD,EAAKE,WAAkC,CACzC,IAAIC,EAAgBH,EAAKG,cACzB,OAAOA,GAAgBA,EAAcC,aAAwBH,MAC/D,CAEA,OAAOD,CACT,CCTA,SAASK,EAAUL,GAEjB,OAAOA,aADUD,EAAUC,GAAMM,SACIN,aAAgBM,OACvD,CAEA,SAASC,EAAcP,GAErB,OAAOA,aADUD,EAAUC,GAAMQ,aACIR,aAAgBQ,WACvD,CAEA,SAASC,EAAaT,GAEpB,MAA0B,oBAAfU,aAKJV,aADUD,EAAUC,GAAMU,YACIV,aAAgBU,WACvD,CCwDA,SACEC,KAAM,cACNC,SAAS,EACTC,MAAO,QACPC,GA5EF,SAAqBC,GACnB,IAAIC,EAAQD,EAAKC,MACjB3D,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIS,EAAQJ,EAAMK,OAAOV,IAAS,CAAC,EAC/BW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EACxCf,EAAUoB,EAAME,SAASP,GAExBJ,EAAcX,IAAaD,EAAYC,KAO5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUR,GACxC,IAAI3C,EAAQsD,EAAWX,IAET,IAAV3C,EACF4B,EAAQ4B,gBAAgBb,GAExBf,EAAQ6B,aAAad,GAAgB,IAAV3C,EAAiB,GAAKA,EAErD,IACF,GACF,EAoDE0D,OAlDF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MACdY,EAAgB,CAClBlD,OAAQ,CACNmD,SAAUb,EAAMc,QAAQC,SACxB5D,KAAM,IACN6D,IAAK,IACLC,OAAQ,KAEVC,MAAO,CACLL,SAAU,YAEZlD,UAAW,CAAC,GASd,OAPAtB,OAAOkE,OAAOP,EAAME,SAASxC,OAAO0C,MAAOQ,EAAclD,QACzDsC,EAAMK,OAASO,EAEXZ,EAAME,SAASgB,OACjB7E,OAAOkE,OAAOP,EAAME,SAASgB,MAAMd,MAAOQ,EAAcM,OAGnD,WACL7E,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIf,EAAUoB,EAAME,SAASP,GACzBW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EAGxCS,EAFkB/D,OAAO4D,KAAKD,EAAMK,OAAOzD,eAAe+C,GAAQK,EAAMK,OAAOV,GAAQiB,EAAcjB,IAE7E9B,QAAO,SAAUuC,EAAOe,GAElD,OADAf,EAAMe,GAAY,GACXf,CACT,GAAG,CAAC,GAECb,EAAcX,IAAaD,EAAYC,KAI5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUiB,GACxCxC,EAAQ4B,gBAAgBY,EAC1B,IACF,GACF,CACF,EASEC,SAAU,CAAC,kBCjFE,SAASC,EAAiBvD,GACvC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCHO,IAAI,EAAMC,KAAKC,IACX,EAAMD,KAAKE,IACXC,EAAQH,KAAKG,MCFT,SAASC,IACtB,IAAIC,EAASC,UAAUC,cAEvB,OAAc,MAAVF,GAAkBA,EAAOG,QAAUC,MAAMC,QAAQL,EAAOG,QACnDH,EAAOG,OAAOG,KAAI,SAAUC,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACjC,IAAGC,KAAK,KAGHT,UAAUU,SACnB,CCTe,SAASC,IACtB,OAAQ,iCAAiCC,KAAKd,IAChD,CCCe,SAASe,EAAsB/D,EAASgE,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAalE,EAAQ+D,wBACrBI,EAAS,EACTC,EAAS,EAETJ,GAAgBrD,EAAcX,KAChCmE,EAASnE,EAAQqE,YAAc,GAAItB,EAAMmB,EAAWI,OAAStE,EAAQqE,aAAmB,EACxFD,EAASpE,EAAQuE,aAAe,GAAIxB,EAAMmB,EAAWM,QAAUxE,EAAQuE,cAAoB,GAG7F,IACIE,GADOhE,EAAUT,GAAWG,EAAUH,GAAWK,QAC3BoE,eAEtBC,GAAoBb,KAAsBI,EAC1CU,GAAKT,EAAW3F,MAAQmG,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMT,EAC/FU,GAAKX,EAAW9B,KAAOsC,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMV,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BK,EAASN,EAAWM,OAASJ,EACjC,MAAO,CACLE,MAAOA,EACPE,OAAQA,EACRpC,IAAKyC,EACLvG,MAAOqG,EAAIL,EACXjG,OAAQwG,EAAIL,EACZjG,KAAMoG,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,EAAc/E,GACpC,IAAIkE,EAAaH,EAAsB/D,GAGnCsE,EAAQtE,EAAQqE,YAChBG,EAASxE,EAAQuE,aAUrB,OARI3B,KAAKoC,IAAId,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjB1B,KAAKoC,IAAId,EAAWM,OAASA,IAAW,IAC1CA,EAASN,EAAWM,QAGf,CACLG,EAAG3E,EAAQ4E,WACXC,EAAG7E,EAAQ8E,UACXR,MAAOA,EACPE,OAAQA,EAEZ,CCvBe,SAASS,EAASC,EAAQC,GACvC,IAAIC,EAAWD,EAAME,aAAeF,EAAME,cAE1C,GAAIH,EAAOD,SAASE,GAClB,OAAO,EAEJ,GAAIC,GAAYvE,EAAauE,GAAW,CACzC,IAAIE,EAAOH,EAEX,EAAG,CACD,GAAIG,GAAQJ,EAAOK,WAAWD,GAC5B,OAAO,EAITA,EAAOA,EAAKE,YAAcF,EAAKG,IACjC,OAASH,EACX,CAGF,OAAO,CACT,CCrBe,SAAS,EAAiBtF,GACvC,OAAOG,EAAUH,GAAS0F,iBAAiB1F,EAC7C,CCFe,SAAS2F,EAAe3F,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4F,QAAQ7F,EAAYC,KAAa,CAChE,CCFe,SAAS6F,EAAmB7F,GAEzC,QAASS,EAAUT,GAAWA,EAAQO,cACtCP,EAAQ8F,WAAazF,OAAOyF,UAAUC,eACxC,CCFe,SAASC,EAAchG,GACpC,MAA6B,SAAzBD,EAAYC,GACPA,EAMPA,EAAQiG,cACRjG,EAAQwF,aACR3E,EAAab,GAAWA,EAAQyF,KAAO,OAEvCI,EAAmB7F,EAGvB,CCVA,SAASkG,EAAoBlG,GAC3B,OAAKW,EAAcX,IACoB,UAAvC,EAAiBA,GAASiC,SAInBjC,EAAQmG,aAHN,IAIX,CAwCe,SAASC,EAAgBpG,GAItC,IAHA,IAAIK,EAASF,EAAUH,GACnBmG,EAAeD,EAAoBlG,GAEhCmG,GAAgBR,EAAeQ,IAA6D,WAA5C,EAAiBA,GAAclE,UACpFkE,EAAeD,EAAoBC,GAGrC,OAAIA,IAA+C,SAA9BpG,EAAYoG,IAA0D,SAA9BpG,EAAYoG,IAAwE,WAA5C,EAAiBA,GAAclE,UAC3H5B,EAGF8F,GAhDT,SAA4BnG,GAC1B,IAAIqG,EAAY,WAAWvC,KAAKd,KAGhC,GAFW,WAAWc,KAAKd,MAEfrC,EAAcX,IAII,UAFX,EAAiBA,GAEnBiC,SACb,OAAO,KAIX,IAAIqE,EAAcN,EAAchG,GAMhC,IAJIa,EAAayF,KACfA,EAAcA,EAAYb,MAGrB9E,EAAc2F,IAAgB,CAAC,OAAQ,QAAQV,QAAQ7F,EAAYuG,IAAgB,GAAG,CAC3F,IAAIC,EAAM,EAAiBD,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAed,QAAQW,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAIK,QAAyB,SAAfL,EAAIK,OACjO,OAAON,EAEPA,EAAcA,EAAYd,UAE9B,CAEA,OAAO,IACT,CAgByBqB,CAAmB7G,IAAYK,CACxD,CCpEe,SAASyG,EAAyB3H,GAC/C,MAAO,CAAC,MAAO,UAAUyG,QAAQzG,IAAc,EAAI,IAAM,GAC3D,CCDO,SAAS4H,EAAOjE,EAAK1E,EAAOyE,GACjC,OAAO,EAAQC,EAAK,EAAQ1E,EAAOyE,GACrC,CCFe,SAASmE,EAAmBC,GACzC,OAAOxJ,OAAOkE,OAAO,CAAC,ECDf,CACLS,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuC0I,EACjD,CEHe,SAASC,EAAgB9I,EAAOiD,GAC7C,OAAOA,EAAKpC,QAAO,SAAUkI,EAAS5J,GAEpC,OADA4J,EAAQ5J,GAAOa,EACR+I,CACT,GAAG,CAAC,EACN,CC4EA,SACEpG,KAAM,QACNC,SAAS,EACTC,MAAO,OACPC,GApEF,SAAeC,GACb,IAAIiG,EAEAhG,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZmB,EAAUf,EAAKe,QACfmF,EAAejG,EAAME,SAASgB,MAC9BgF,EAAgBlG,EAAMmG,cAAcD,cACpCE,EAAgB9E,EAAiBtB,EAAMjC,WACvCsI,EAAOX,EAAyBU,GAEhCE,EADa,CAACnJ,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIL,EAxBgB,SAAyBU,EAASvG,GAItD,OAAO4F,EAAsC,iBAH7CW,EAA6B,mBAAZA,EAAyBA,EAAQlK,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CAC/EzI,UAAWiC,EAAMjC,aACbwI,GACkDA,EAAUT,EAAgBS,EAASlJ,GAC7F,CAmBsBoJ,CAAgB3F,EAAQyF,QAASvG,GACjD0G,EAAY/C,EAAcsC,GAC1BU,EAAmB,MAATN,EAAe,EAAMlJ,EAC/ByJ,EAAmB,MAATP,EAAepJ,EAASC,EAClC2J,EAAU7G,EAAMwG,MAAM7I,UAAU2I,GAAOtG,EAAMwG,MAAM7I,UAAU0I,GAAQH,EAAcG,GAAQrG,EAAMwG,MAAM9I,OAAO4I,GAC9GQ,EAAYZ,EAAcG,GAAQrG,EAAMwG,MAAM7I,UAAU0I,GACxDU,EAAoB/B,EAAgBiB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9CpF,EAAMmE,EAAcc,GACpBlF,EAAMuF,EAAaN,EAAUJ,GAAOT,EAAce,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS1B,EAAOjE,EAAK0F,EAAQ3F,GAE7B6F,EAAWjB,EACfrG,EAAMmG,cAAcxG,KAASqG,EAAwB,CAAC,GAAyBsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnBzJ,CAoBF,EAkCEtF,OAhCF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MAEdwH,EADU7G,EAAMG,QACWlC,QAC3BqH,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAejG,EAAME,SAASxC,OAAO+J,cAAcxB,MAOhDpC,EAAS7D,EAAME,SAASxC,OAAQuI,KAIrCjG,EAAME,SAASgB,MAAQ+E,EACzB,EASE5E,SAAU,CAAC,iBACXqG,iBAAkB,CAAC,oBCxFN,SAASC,EAAa5J,GACnC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCOA,IAAIqG,GAAa,CACf5G,IAAK,OACL9D,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAAS0K,GAAYlH,GAC1B,IAAImH,EAEApK,EAASiD,EAAMjD,OACfqK,EAAapH,EAAMoH,WACnBhK,EAAY4C,EAAM5C,UAClBiK,EAAYrH,EAAMqH,UAClBC,EAAUtH,EAAMsH,QAChBpH,EAAWF,EAAME,SACjBqH,EAAkBvH,EAAMuH,gBACxBC,EAAWxH,EAAMwH,SACjBC,EAAezH,EAAMyH,aACrBC,EAAU1H,EAAM0H,QAChBC,EAAaL,EAAQ1E,EACrBA,OAAmB,IAAf+E,EAAwB,EAAIA,EAChCC,EAAaN,EAAQxE,EACrBA,OAAmB,IAAf8E,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5D7E,EAAGA,EACHE,IACG,CACHF,EAAGA,EACHE,GAGFF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EACV,IAAIgF,EAAOR,EAAQrL,eAAe,KAC9B8L,EAAOT,EAAQrL,eAAe,KAC9B+L,EAAQxL,EACRyL,EAAQ,EACRC,EAAM5J,OAEV,GAAIkJ,EAAU,CACZ,IAAIpD,EAAeC,EAAgBtH,GAC/BoL,EAAa,eACbC,EAAY,cAEZhE,IAAiBhG,EAAUrB,IAGmB,WAA5C,EAFJqH,EAAeN,EAAmB/G,IAECmD,UAAsC,aAAbA,IAC1DiI,EAAa,eACbC,EAAY,gBAOZhL,IAAc,IAAQA,IAAcZ,GAAQY,IAAcb,IAAU8K,IAAczK,KACpFqL,EAAQ3L,EAGRwG,IAFc4E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeD,OACzF2B,EAAa+D,IACEf,EAAW3E,OAC1BK,GAAKyE,EAAkB,GAAK,GAG1BnK,IAAcZ,IAASY,IAAc,GAAOA,IAAcd,GAAW+K,IAAczK,KACrFoL,EAAQzL,EAGRqG,IAFc8E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeH,MACzF6B,EAAagE,IACEhB,EAAW7E,MAC1BK,GAAK2E,EAAkB,GAAK,EAEhC,CAEA,IAgBMc,EAhBFC,EAAe5M,OAAOkE,OAAO,CAC/BM,SAAUA,GACTsH,GAAYP,IAEXsB,GAAyB,IAAjBd,EAlFd,SAA2BrI,EAAM8I,GAC/B,IAAItF,EAAIxD,EAAKwD,EACTE,EAAI1D,EAAK0D,EACT0F,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACL7F,EAAG5B,EAAM4B,EAAI4F,GAAOA,GAAO,EAC3B1F,EAAG9B,EAAM8B,EAAI0F,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpD9F,EAAGA,EACHE,GACC1E,EAAUrB,IAAW,CACtB6F,EAAGA,EACHE,GAMF,OAHAF,EAAI2F,EAAM3F,EACVE,EAAIyF,EAAMzF,EAENyE,EAGK7L,OAAOkE,OAAO,CAAC,EAAG0I,IAAeD,EAAiB,CAAC,GAAkBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe5D,WAAayD,EAAIO,kBAAoB,IAAM,EAAI,aAAe7F,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAUuF,IAG5R3M,OAAOkE,OAAO,CAAC,EAAG0I,IAAenB,EAAkB,CAAC,GAAmBc,GAASF,EAAOjF,EAAI,KAAO,GAAIqE,EAAgBa,GAASF,EAAOlF,EAAI,KAAO,GAAIuE,EAAgB1C,UAAY,GAAI0C,GAC9L,CA4CA,UACEnI,KAAM,gBACNC,SAAS,EACTC,MAAO,cACPC,GA9CF,SAAuBwJ,GACrB,IAAItJ,EAAQsJ,EAAMtJ,MACdc,EAAUwI,EAAMxI,QAChByI,EAAwBzI,EAAQoH,gBAChCA,OAA4C,IAA1BqB,GAA0CA,EAC5DC,EAAoB1I,EAAQqH,SAC5BA,OAAiC,IAAtBqB,GAAsCA,EACjDC,EAAwB3I,EAAQsH,aAChCA,OAAyC,IAA1BqB,GAA0CA,EACzDR,EAAe,CACjBlL,UAAWuD,EAAiBtB,EAAMjC,WAClCiK,UAAWL,EAAa3H,EAAMjC,WAC9BL,OAAQsC,EAAME,SAASxC,OACvBqK,WAAY/H,EAAMwG,MAAM9I,OACxBwK,gBAAiBA,EACjBG,QAAoC,UAA3BrI,EAAMc,QAAQC,UAGgB,MAArCf,EAAMmG,cAAcD,gBACtBlG,EAAMK,OAAO3C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAO3C,OAAQmK,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACvGhB,QAASjI,EAAMmG,cAAcD,cAC7BrF,SAAUb,EAAMc,QAAQC,SACxBoH,SAAUA,EACVC,aAAcA,OAIe,MAA7BpI,EAAMmG,cAAcjF,QACtBlB,EAAMK,OAAOa,MAAQ7E,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAOa,MAAO2G,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACrGhB,QAASjI,EAAMmG,cAAcjF,MAC7BL,SAAU,WACVsH,UAAU,EACVC,aAAcA,OAIlBpI,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,wBAAyBsC,EAAMjC,WAEnC,EAQE2L,KAAM,CAAC,GCrKT,IAAIC,GAAU,CACZA,SAAS,GAsCX,UACEhK,KAAM,iBACNC,SAAS,EACTC,MAAO,QACPC,GAAI,WAAe,EACnBY,OAxCF,SAAgBX,GACd,IAAIC,EAAQD,EAAKC,MACb4J,EAAW7J,EAAK6J,SAChB9I,EAAUf,EAAKe,QACf+I,EAAkB/I,EAAQgJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkBjJ,EAAQkJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7C9K,EAASF,EAAUiB,EAAME,SAASxC,QAClCuM,EAAgB,GAAGjM,OAAOgC,EAAMiK,cAActM,UAAWqC,EAAMiK,cAAcvM,QAYjF,OAVIoM,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaC,iBAAiB,SAAUP,EAASQ,OAAQT,GAC3D,IAGEK,GACF/K,EAAOkL,iBAAiB,SAAUP,EAASQ,OAAQT,IAG9C,WACDG,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaG,oBAAoB,SAAUT,EAASQ,OAAQT,GAC9D,IAGEK,GACF/K,EAAOoL,oBAAoB,SAAUT,EAASQ,OAAQT,GAE1D,CACF,EASED,KAAM,CAAC,GC/CT,IAAIY,GAAO,CACTnN,KAAM,QACND,MAAO,OACPD,OAAQ,MACR+D,IAAK,UAEQ,SAASuJ,GAAqBxM,GAC3C,OAAOA,EAAUyM,QAAQ,0BAA0B,SAAUC,GAC3D,OAAOH,GAAKG,EACd,GACF,CCVA,IAAI,GAAO,CACTnN,MAAO,MACPC,IAAK,SAEQ,SAASmN,GAA8B3M,GACpD,OAAOA,EAAUyM,QAAQ,cAAc,SAAUC,GAC/C,OAAO,GAAKA,EACd,GACF,CCPe,SAASE,GAAgB3L,GACtC,IAAI6J,EAAM9J,EAAUC,GAGpB,MAAO,CACL4L,WAHe/B,EAAIgC,YAInBC,UAHcjC,EAAIkC,YAKtB,CCNe,SAASC,GAAoBpM,GAQ1C,OAAO+D,EAAsB8B,EAAmB7F,IAAUzB,KAAOwN,GAAgB/L,GAASgM,UAC5F,CCXe,SAASK,GAAerM,GAErC,IAAIsM,EAAoB,EAAiBtM,GACrCuM,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6B3I,KAAKyI,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBtM,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAawF,QAAQ7F,EAAYK,KAAU,EAEvDA,EAAKG,cAAcoM,KAGxBhM,EAAcP,IAASiM,GAAejM,GACjCA,EAGFsM,GAAgB1G,EAAc5F,GACvC,CCJe,SAASwM,GAAkB5M,EAAS6M,GACjD,IAAIC,OAES,IAATD,IACFA,EAAO,IAGT,IAAIvB,EAAeoB,GAAgB1M,GAC/B+M,EAASzB,KAAqE,OAAlDwB,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,MACpH1C,EAAM9J,EAAUmL,GAChB0B,EAASD,EAAS,CAAC9C,GAAK7K,OAAO6K,EAAIxF,gBAAkB,GAAI4H,GAAef,GAAgBA,EAAe,IAAMA,EAC7G2B,EAAcJ,EAAKzN,OAAO4N,GAC9B,OAAOD,EAASE,EAChBA,EAAY7N,OAAOwN,GAAkB5G,EAAcgH,IACrD,CCzBe,SAASE,GAAiBC,GACvC,OAAO1P,OAAOkE,OAAO,CAAC,EAAGwL,EAAM,CAC7B5O,KAAM4O,EAAKxI,EACXvC,IAAK+K,EAAKtI,EACVvG,MAAO6O,EAAKxI,EAAIwI,EAAK7I,MACrBjG,OAAQ8O,EAAKtI,EAAIsI,EAAK3I,QAE1B,CCqBA,SAAS4I,GAA2BpN,EAASqN,EAAgBlL,GAC3D,OAAOkL,IAAmBxO,EAAWqO,GCzBxB,SAAyBlN,EAASmC,GAC/C,IAAI8H,EAAM9J,EAAUH,GAChBsN,EAAOzH,EAAmB7F,GAC1ByE,EAAiBwF,EAAIxF,eACrBH,EAAQgJ,EAAKhF,YACb9D,EAAS8I,EAAKjF,aACd1D,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBH,EAAQG,EAAeH,MACvBE,EAASC,EAAeD,OACxB,IAAI+I,EAAiB1J,KAEjB0J,IAAmBA,GAA+B,UAAbpL,KACvCwC,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEvB,CAEA,MAAO,CACLR,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EAAIyH,GAAoBpM,GAC3B6E,EAAGA,EAEP,CDDwD2I,CAAgBxN,EAASmC,IAAa1B,EAAU4M,GAdxG,SAAoCrN,EAASmC,GAC3C,IAAIgL,EAAOpJ,EAAsB/D,GAAS,EAAoB,UAAbmC,GASjD,OARAgL,EAAK/K,IAAM+K,EAAK/K,IAAMpC,EAAQyN,UAC9BN,EAAK5O,KAAO4O,EAAK5O,KAAOyB,EAAQ0N,WAChCP,EAAK9O,OAAS8O,EAAK/K,IAAMpC,EAAQqI,aACjC8E,EAAK7O,MAAQ6O,EAAK5O,KAAOyB,EAAQsI,YACjC6E,EAAK7I,MAAQtE,EAAQsI,YACrB6E,EAAK3I,OAASxE,EAAQqI,aACtB8E,EAAKxI,EAAIwI,EAAK5O,KACd4O,EAAKtI,EAAIsI,EAAK/K,IACP+K,CACT,CAG0HQ,CAA2BN,EAAgBlL,GAAY+K,GEtBlK,SAAyBlN,GACtC,IAAI8M,EAEAQ,EAAOzH,EAAmB7F,GAC1B4N,EAAY7B,GAAgB/L,GAC5B2M,EAA0D,OAAlDG,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,KAChGrI,EAAQ,EAAIgJ,EAAKO,YAAaP,EAAKhF,YAAaqE,EAAOA,EAAKkB,YAAc,EAAGlB,EAAOA,EAAKrE,YAAc,GACvG9D,EAAS,EAAI8I,EAAKQ,aAAcR,EAAKjF,aAAcsE,EAAOA,EAAKmB,aAAe,EAAGnB,EAAOA,EAAKtE,aAAe,GAC5G1D,GAAKiJ,EAAU5B,WAAaI,GAAoBpM,GAChD6E,GAAK+I,EAAU1B,UAMnB,MAJiD,QAA7C,EAAiBS,GAAQW,GAAMS,YACjCpJ,GAAK,EAAI2I,EAAKhF,YAAaqE,EAAOA,EAAKrE,YAAc,GAAKhE,GAGrD,CACLA,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMmJ,CAAgBnI,EAAmB7F,IACrO,CG1Be,SAASiO,GAAe9M,GACrC,IAOIkI,EAPAtK,EAAYoC,EAAKpC,UACjBiB,EAAUmB,EAAKnB,QACfb,EAAYgC,EAAKhC,UACjBqI,EAAgBrI,EAAYuD,EAAiBvD,GAAa,KAC1DiK,EAAYjK,EAAY4J,EAAa5J,GAAa,KAClD+O,EAAUnP,EAAU4F,EAAI5F,EAAUuF,MAAQ,EAAItE,EAAQsE,MAAQ,EAC9D6J,EAAUpP,EAAU8F,EAAI9F,EAAUyF,OAAS,EAAIxE,EAAQwE,OAAS,EAGpE,OAAQgD,GACN,KAAK,EACH6B,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI7E,EAAQwE,QAE3B,MAEF,KAAKnG,EACHgL,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI9F,EAAUyF,QAE7B,MAEF,KAAKlG,EACH+K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI5F,EAAUuF,MAC3BO,EAAGsJ,GAEL,MAEF,KAAK5P,EACH8K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI3E,EAAQsE,MACzBO,EAAGsJ,GAEL,MAEF,QACE9E,EAAU,CACR1E,EAAG5F,EAAU4F,EACbE,EAAG9F,EAAU8F,GAInB,IAAIuJ,EAAW5G,EAAgBV,EAAyBU,GAAiB,KAEzE,GAAgB,MAAZ4G,EAAkB,CACpB,IAAI1G,EAAmB,MAAb0G,EAAmB,SAAW,QAExC,OAAQhF,GACN,KAAK1K,EACH2K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAC7E,MAEF,KAAK/I,EACH0K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAKnF,CAEA,OAAO2B,CACT,CC3De,SAASgF,GAAejN,EAAOc,QAC5B,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACXqM,EAAqBD,EAASnP,UAC9BA,OAAmC,IAAvBoP,EAAgCnN,EAAMjC,UAAYoP,EAC9DC,EAAoBF,EAASnM,SAC7BA,OAAiC,IAAtBqM,EAA+BpN,EAAMe,SAAWqM,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+B7P,EAAkB6P,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmC9P,EAAW8P,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmC/P,EAAS+P,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAAS3G,QAC5BA,OAA+B,IAArBsH,EAA8B,EAAIA,EAC5ChI,EAAgBD,EAAsC,iBAAZW,EAAuBA,EAAUT,EAAgBS,EAASlJ,IACpGyQ,EAAaJ,IAAmBhQ,EAASC,EAAYD,EACrDqK,EAAa/H,EAAMwG,MAAM9I,OACzBkB,EAAUoB,EAAME,SAAS0N,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBnP,EAAS0O,EAAUE,EAAczM,GACvE,IAAIiN,EAAmC,oBAAbV,EAlB5B,SAA4B1O,GAC1B,IAAIpB,EAAkBgO,GAAkB5G,EAAchG,IAElDqP,EADoB,CAAC,WAAY,SAASzJ,QAAQ,EAAiB5F,GAASiC,WAAa,GACnDtB,EAAcX,GAAWoG,EAAgBpG,GAAWA,EAE9F,OAAKS,EAAU4O,GAKRzQ,EAAgBgI,QAAO,SAAUyG,GACtC,OAAO5M,EAAU4M,IAAmBpI,EAASoI,EAAgBgC,IAAmD,SAAhCtP,EAAYsN,EAC9F,IANS,EAOX,CAK6DiC,CAAmBtP,GAAW,GAAGZ,OAAOsP,GAC/F9P,EAAkB,GAAGQ,OAAOgQ,EAAqB,CAACR,IAClDW,EAAsB3Q,EAAgB,GACtC4Q,EAAe5Q,EAAgBK,QAAO,SAAUwQ,EAASpC,GAC3D,IAAIF,EAAOC,GAA2BpN,EAASqN,EAAgBlL,GAK/D,OAJAsN,EAAQrN,IAAM,EAAI+K,EAAK/K,IAAKqN,EAAQrN,KACpCqN,EAAQnR,MAAQ,EAAI6O,EAAK7O,MAAOmR,EAAQnR,OACxCmR,EAAQpR,OAAS,EAAI8O,EAAK9O,OAAQoR,EAAQpR,QAC1CoR,EAAQlR,KAAO,EAAI4O,EAAK5O,KAAMkR,EAAQlR,MAC/BkR,CACT,GAAGrC,GAA2BpN,EAASuP,EAAqBpN,IAK5D,OAJAqN,EAAalL,MAAQkL,EAAalR,MAAQkR,EAAajR,KACvDiR,EAAahL,OAASgL,EAAanR,OAASmR,EAAapN,IACzDoN,EAAa7K,EAAI6K,EAAajR,KAC9BiR,EAAa3K,EAAI2K,EAAapN,IACvBoN,CACT,CInC2BE,CAAgBjP,EAAUT,GAAWA,EAAUA,EAAQ2P,gBAAkB9J,EAAmBzE,EAAME,SAASxC,QAAS4P,EAAUE,EAAczM,GACjKyN,EAAsB7L,EAAsB3C,EAAME,SAASvC,WAC3DuI,EAAgB2G,GAAe,CACjClP,UAAW6Q,EACX5P,QAASmJ,EACThH,SAAU,WACVhD,UAAWA,IAET0Q,EAAmB3C,GAAiBzP,OAAOkE,OAAO,CAAC,EAAGwH,EAAY7B,IAClEwI,EAAoBhB,IAAmBhQ,EAAS+Q,EAAmBD,EAGnEG,EAAkB,CACpB3N,IAAK+M,EAAmB/M,IAAM0N,EAAkB1N,IAAM6E,EAAc7E,IACpE/D,OAAQyR,EAAkBzR,OAAS8Q,EAAmB9Q,OAAS4I,EAAc5I,OAC7EE,KAAM4Q,EAAmB5Q,KAAOuR,EAAkBvR,KAAO0I,EAAc1I,KACvED,MAAOwR,EAAkBxR,MAAQ6Q,EAAmB7Q,MAAQ2I,EAAc3I,OAExE0R,EAAa5O,EAAMmG,cAAckB,OAErC,GAAIqG,IAAmBhQ,GAAUkR,EAAY,CAC3C,IAAIvH,EAASuH,EAAW7Q,GACxB1B,OAAO4D,KAAK0O,GAAiBxO,SAAQ,SAAUhE,GAC7C,IAAI0S,EAAW,CAAC3R,EAAOD,GAAQuH,QAAQrI,IAAQ,EAAI,GAAK,EACpDkK,EAAO,CAAC,EAAKpJ,GAAQuH,QAAQrI,IAAQ,EAAI,IAAM,IACnDwS,EAAgBxS,IAAQkL,EAAOhB,GAAQwI,CACzC,GACF,CAEA,OAAOF,CACT,CCyEA,UACEhP,KAAM,OACNC,SAAS,EACTC,MAAO,OACPC,GA5HF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KAEhB,IAAIK,EAAMmG,cAAcxG,GAAMmP,MAA9B,CAoCA,IAhCA,IAAIC,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BtO,EAAQuO,mBACtC9I,EAAUzF,EAAQyF,QAClB+G,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtB0B,EAAwBxO,EAAQyO,eAChCA,OAA2C,IAA1BD,GAA0CA,EAC3DE,EAAwB1O,EAAQ0O,sBAChCC,EAAqBzP,EAAMc,QAAQ/C,UACnCqI,EAAgB9E,EAAiBmO,GAEjCJ,EAAqBD,IADHhJ,IAAkBqJ,GACqCF,EAjC/E,SAAuCxR,GACrC,GAAIuD,EAAiBvD,KAAeX,EAClC,MAAO,GAGT,IAAIsS,EAAoBnF,GAAqBxM,GAC7C,MAAO,CAAC2M,GAA8B3M,GAAY2R,EAAmBhF,GAA8BgF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAAClF,GAAqBkF,KAChHG,EAAa,CAACH,GAAoBzR,OAAOqR,GAAoBxR,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAIE,OAAOsD,EAAiBvD,KAAeX,ECvCvC,SAA8B4C,EAAOc,QAClC,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACX/C,EAAYmP,EAASnP,UACrBuP,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBjH,EAAU2G,EAAS3G,QACnBgJ,EAAiBrC,EAASqC,eAC1BM,EAAwB3C,EAASsC,sBACjCA,OAAkD,IAA1BK,EAAmC,EAAgBA,EAC3E7H,EAAYL,EAAa5J,GACzB6R,EAAa5H,EAAYuH,EAAiB3R,EAAsBA,EAAoB4H,QAAO,SAAUzH,GACvG,OAAO4J,EAAa5J,KAAeiK,CACrC,IAAK3K,EACDyS,EAAoBF,EAAWpK,QAAO,SAAUzH,GAClD,OAAOyR,EAAsBhL,QAAQzG,IAAc,CACrD,IAEiC,IAA7B+R,EAAkBC,SACpBD,EAAoBF,GAItB,IAAII,EAAYF,EAAkBjS,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAakP,GAAejN,EAAO,CACrCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,IACRjF,EAAiBvD,IACbD,CACT,GAAG,CAAC,GACJ,OAAOzB,OAAO4D,KAAK+P,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EAClC,GACF,CDC6DC,CAAqBpQ,EAAO,CACnFjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTgJ,eAAgBA,EAChBC,sBAAuBA,IACpBzR,EACP,GAAG,IACCsS,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzB4S,EAAY,IAAIC,IAChBC,GAAqB,EACrBC,EAAwBb,EAAW,GAE9Bc,EAAI,EAAGA,EAAId,EAAWG,OAAQW,IAAK,CAC1C,IAAI3S,EAAY6R,EAAWc,GAEvBC,EAAiBrP,EAAiBvD,GAElC6S,EAAmBjJ,EAAa5J,KAAeT,EAC/CuT,EAAa,CAAC,EAAK5T,GAAQuH,QAAQmM,IAAmB,EACtDrK,EAAMuK,EAAa,QAAU,SAC7B1F,EAAW8B,GAAejN,EAAO,CACnCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACbrH,QAASA,IAEPuK,EAAoBD,EAAaD,EAAmB1T,EAAQC,EAAOyT,EAAmB3T,EAAS,EAE/FoT,EAAc/J,GAAOyB,EAAWzB,KAClCwK,EAAoBvG,GAAqBuG,IAG3C,IAAIC,EAAmBxG,GAAqBuG,GACxCE,EAAS,GAUb,GARIhC,GACFgC,EAAOC,KAAK9F,EAASwF,IAAmB,GAGtCxB,GACF6B,EAAOC,KAAK9F,EAAS2F,IAAsB,EAAG3F,EAAS4F,IAAqB,GAG1EC,EAAOE,OAAM,SAAUC,GACzB,OAAOA,CACT,IAAI,CACFV,EAAwB1S,EACxByS,GAAqB,EACrB,KACF,CAEAF,EAAUc,IAAIrT,EAAWiT,EAC3B,CAEA,GAAIR,EAqBF,IAnBA,IAEIa,EAAQ,SAAeC,GACzB,IAAIC,EAAmB3B,EAAW4B,MAAK,SAAUzT,GAC/C,IAAIiT,EAASV,EAAU9T,IAAIuB,GAE3B,GAAIiT,EACF,OAAOA,EAAOS,MAAM,EAAGH,GAAIJ,OAAM,SAAUC,GACzC,OAAOA,CACT,GAEJ,IAEA,GAAII,EAEF,OADAd,EAAwBc,EACjB,OAEX,EAESD,EAnBY/B,EAAiB,EAAI,EAmBZ+B,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCtR,EAAMjC,YAAc0S,IACtBzQ,EAAMmG,cAAcxG,GAAMmP,OAAQ,EAClC9O,EAAMjC,UAAY0S,EAClBzQ,EAAM0R,OAAQ,EA5GhB,CA8GF,EAQEhK,iBAAkB,CAAC,UACnBgC,KAAM,CACJoF,OAAO,IE7IX,SAAS6C,GAAexG,EAAUY,EAAM6F,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjBrO,EAAG,EACHE,EAAG,IAIA,CACLzC,IAAKmK,EAASnK,IAAM+K,EAAK3I,OAASwO,EAAiBnO,EACnDvG,MAAOiO,EAASjO,MAAQ6O,EAAK7I,MAAQ0O,EAAiBrO,EACtDtG,OAAQkO,EAASlO,OAAS8O,EAAK3I,OAASwO,EAAiBnO,EACzDtG,KAAMgO,EAAShO,KAAO4O,EAAK7I,MAAQ0O,EAAiBrO,EAExD,CAEA,SAASsO,GAAsB1G,GAC7B,MAAO,CAAC,EAAKjO,EAAOD,EAAQE,GAAM2U,MAAK,SAAUC,GAC/C,OAAO5G,EAAS4G,IAAS,CAC3B,GACF,CA+BA,UACEpS,KAAM,OACNC,SAAS,EACTC,MAAO,OACP6H,iBAAkB,CAAC,mBACnB5H,GAlCF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZ0Q,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBkU,EAAmB5R,EAAMmG,cAAc6L,gBACvCC,EAAoBhF,GAAejN,EAAO,CAC5C0N,eAAgB,cAEdwE,EAAoBjF,GAAejN,EAAO,CAC5C4N,aAAa,IAEXuE,EAA2BR,GAAeM,EAAmB5B,GAC7D+B,EAAsBT,GAAeO,EAAmBnK,EAAY6J,GACpES,EAAoBR,GAAsBM,GAC1CG,EAAmBT,GAAsBO,GAC7CpS,EAAMmG,cAAcxG,GAAQ,CAC1BwS,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBtS,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,+BAAgC2U,EAChC,sBAAuBC,GAE3B,GCJA,IACE3S,KAAM,SACNC,SAAS,EACTC,MAAO,OACPwB,SAAU,CAAC,iBACXvB,GA5BF,SAAgBa,GACd,IAAIX,EAAQW,EAAMX,MACdc,EAAUH,EAAMG,QAChBnB,EAAOgB,EAAMhB,KACb4S,EAAkBzR,EAAQuG,OAC1BA,OAA6B,IAApBkL,EAA6B,CAAC,EAAG,GAAKA,EAC/C7I,EAAO,EAAW7L,QAAO,SAAUC,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWyI,EAAOa,GACxD,IAAIjB,EAAgB9E,EAAiBvD,GACjCyU,EAAiB,CAACrV,EAAM,GAAKqH,QAAQ4B,IAAkB,GAAK,EAAI,EAEhErG,EAAyB,mBAAXsH,EAAwBA,EAAOhL,OAAOkE,OAAO,CAAC,EAAGiG,EAAO,CACxEzI,UAAWA,KACPsJ,EACFoL,EAAW1S,EAAK,GAChB2S,EAAW3S,EAAK,GAIpB,OAFA0S,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACrV,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAAI,CACjD7C,EAAGmP,EACHjP,EAAGgP,GACD,CACFlP,EAAGkP,EACHhP,EAAGiP,EAEP,CASqBC,CAAwB5U,EAAWiC,EAAMwG,MAAOa,GAC1DvJ,CACT,GAAG,CAAC,GACA8U,EAAwBlJ,EAAK1J,EAAMjC,WACnCwF,EAAIqP,EAAsBrP,EAC1BE,EAAImP,EAAsBnP,EAEW,MAArCzD,EAAMmG,cAAcD,gBACtBlG,EAAMmG,cAAcD,cAAc3C,GAAKA,EACvCvD,EAAMmG,cAAcD,cAAczC,GAAKA,GAGzCzD,EAAMmG,cAAcxG,GAAQ+J,CAC9B,GC1BA,IACE/J,KAAM,gBACNC,SAAS,EACTC,MAAO,OACPC,GApBF,SAAuBC,GACrB,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KAKhBK,EAAMmG,cAAcxG,GAAQkN,GAAe,CACzClP,UAAWqC,EAAMwG,MAAM7I,UACvBiB,QAASoB,EAAMwG,MAAM9I,OACrBqD,SAAU,WACVhD,UAAWiC,EAAMjC,WAErB,EAQE2L,KAAM,CAAC,GCgHT,IACE/J,KAAM,kBACNC,SAAS,EACTC,MAAO,OACPC,GA/HF,SAAyBC,GACvB,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KACZoP,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrD3B,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtBrH,EAAUzF,EAAQyF,QAClBsM,EAAkB/R,EAAQgS,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBjS,EAAQkS,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtD5H,EAAW8B,GAAejN,EAAO,CACnCsN,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTqH,YAAaA,IAEXxH,EAAgB9E,EAAiBtB,EAAMjC,WACvCiK,EAAYL,EAAa3H,EAAMjC,WAC/BkV,GAAmBjL,EACnBgF,EAAWtH,EAAyBU,GACpC8I,ECrCY,MDqCSlC,ECrCH,IAAM,IDsCxB9G,EAAgBlG,EAAMmG,cAAcD,cACpCmK,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBwV,EAA4C,mBAAjBF,EAA8BA,EAAa3W,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CACvGzI,UAAWiC,EAAMjC,aACbiV,EACFG,EAA2D,iBAAtBD,EAAiC,CACxElG,SAAUkG,EACVhE,QAASgE,GACP7W,OAAOkE,OAAO,CAChByM,SAAU,EACVkC,QAAS,GACRgE,GACCE,EAAsBpT,EAAMmG,cAAckB,OAASrH,EAAMmG,cAAckB,OAAOrH,EAAMjC,WAAa,KACjG2L,EAAO,CACTnG,EAAG,EACHE,EAAG,GAGL,GAAKyC,EAAL,CAIA,GAAI8I,EAAe,CACjB,IAAIqE,EAEAC,EAAwB,MAAbtG,EAAmB,EAAM7P,EACpCoW,EAAuB,MAAbvG,EAAmB/P,EAASC,EACtCoJ,EAAmB,MAAb0G,EAAmB,SAAW,QACpC3F,EAASnB,EAAc8G,GACvBtL,EAAM2F,EAAS8D,EAASmI,GACxB7R,EAAM4F,EAAS8D,EAASoI,GACxBC,EAAWV,GAAU/K,EAAWzB,GAAO,EAAI,EAC3CmN,EAASzL,IAAc1K,EAAQ+S,EAAc/J,GAAOyB,EAAWzB,GAC/DoN,EAAS1L,IAAc1K,GAASyK,EAAWzB,IAAQ+J,EAAc/J,GAGjEL,EAAejG,EAAME,SAASgB,MAC9BwF,EAAYoM,GAAU7M,EAAetC,EAAcsC,GAAgB,CACrE/C,MAAO,EACPE,OAAQ,GAENuQ,GAAqB3T,EAAMmG,cAAc,oBAAsBnG,EAAMmG,cAAc,oBAAoBI,QxBhFtG,CACLvF,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EFyW,GAAkBD,GAAmBL,GACrCO,GAAkBF,GAAmBJ,GAMrCO,GAAWnO,EAAO,EAAG0K,EAAc/J,GAAMI,EAAUJ,IACnDyN,GAAYd,EAAkB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWF,GAAkBT,EAA4BnG,SAAWyG,EAASK,GAAWF,GAAkBT,EAA4BnG,SACxMgH,GAAYf,GAAmB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWD,GAAkBV,EAA4BnG,SAAW0G,EAASI,GAAWD,GAAkBV,EAA4BnG,SACzMjG,GAAoB/G,EAAME,SAASgB,OAAS8D,EAAgBhF,EAAME,SAASgB,OAC3E+S,GAAelN,GAAiC,MAAbiG,EAAmBjG,GAAkBsF,WAAa,EAAItF,GAAkBuF,YAAc,EAAI,EAC7H4H,GAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBpG,IAAqBqG,EAAwB,EAEvJc,GAAY9M,EAAS2M,GAAYE,GACjCE,GAAkBzO,EAAOmN,EAAS,EAAQpR,EAF9B2F,EAAS0M,GAAYG,GAAsBD,IAEKvS,EAAK2F,EAAQyL,EAAS,EAAQrR,EAAK0S,IAAa1S,GAChHyE,EAAc8G,GAAYoH,GAC1B1K,EAAKsD,GAAYoH,GAAkB/M,CACrC,CAEA,GAAI8H,EAAc,CAChB,IAAIkF,GAEAC,GAAyB,MAAbtH,EAAmB,EAAM7P,EAErCoX,GAAwB,MAAbvH,EAAmB/P,EAASC,EAEvCsX,GAAUtO,EAAcgJ,GAExBuF,GAAmB,MAAZvF,EAAkB,SAAW,QAEpCwF,GAAOF,GAAUrJ,EAASmJ,IAE1BK,GAAOH,GAAUrJ,EAASoJ,IAE1BK,IAAuD,IAAxC,CAAC,EAAKzX,GAAMqH,QAAQ4B,GAEnCyO,GAAyH,OAAjGR,GAAgD,MAAvBjB,OAA8B,EAASA,EAAoBlE,IAAoBmF,GAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAEzI6F,GAAaH,GAAeJ,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAAUyF,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwBlT,EAAK1E,EAAOyE,GACzC,IAAIwT,EAAItP,EAAOjE,EAAK1E,EAAOyE,GAC3B,OAAOwT,EAAIxT,EAAMA,EAAMwT,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAcpP,EAAOmN,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKzO,EAAcgJ,GAAW8F,GACzBtL,EAAKwF,GAAW8F,GAAmBR,EACrC,CAEAxU,EAAMmG,cAAcxG,GAAQ+J,CAvE5B,CAwEF,EAQEhC,iBAAkB,CAAC,WE1HN,SAASyN,GAAiBC,EAAyBrQ,EAAcsD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCrJ,ECJOJ,EFuBvCyW,EAA0B9V,EAAcwF,GACxCuQ,EAAuB/V,EAAcwF,IAf3C,SAAyBnG,GACvB,IAAImN,EAAOnN,EAAQ+D,wBACfI,EAASpB,EAAMoK,EAAK7I,OAAStE,EAAQqE,aAAe,EACpDD,EAASrB,EAAMoK,EAAK3I,QAAUxE,EAAQuE,cAAgB,EAC1D,OAAkB,IAAXJ,GAA2B,IAAXC,CACzB,CAU4DuS,CAAgBxQ,GACtEJ,EAAkBF,EAAmBM,GACrCgH,EAAOpJ,EAAsByS,EAAyBE,EAAsBjN,GAC5EyB,EAAS,CACXc,WAAY,EACZE,UAAW,GAET7C,EAAU,CACZ1E,EAAG,EACHE,EAAG,GAkBL,OAfI4R,IAA4BA,IAA4BhN,MACxB,SAA9B1J,EAAYoG,IAChBkG,GAAetG,MACbmF,GCnCgC9K,EDmCT+F,KClCdhG,EAAUC,IAAUO,EAAcP,GCJxC,CACL4L,YAFyChM,EDQbI,GCNR4L,WACpBE,UAAWlM,EAAQkM,WDGZH,GAAgB3L,IDoCnBO,EAAcwF,KAChBkD,EAAUtF,EAAsBoC,GAAc,IACtCxB,GAAKwB,EAAauH,WAC1BrE,EAAQxE,GAAKsB,EAAasH,WACjB1H,IACTsD,EAAQ1E,EAAIyH,GAAoBrG,KAI7B,CACLpB,EAAGwI,EAAK5O,KAAO2M,EAAOc,WAAa3C,EAAQ1E,EAC3CE,EAAGsI,EAAK/K,IAAM8I,EAAOgB,UAAY7C,EAAQxE,EACzCP,MAAO6I,EAAK7I,MACZE,OAAQ2I,EAAK3I,OAEjB,CGvDA,SAASoS,GAAMC,GACb,IAAItT,EAAM,IAAIoO,IACVmF,EAAU,IAAIC,IACdC,EAAS,GAKb,SAAS3F,EAAK4F,GACZH,EAAQI,IAAID,EAASlW,MACN,GAAG3B,OAAO6X,EAASxU,UAAY,GAAIwU,EAASnO,kBAAoB,IACtEvH,SAAQ,SAAU4V,GACzB,IAAKL,EAAQM,IAAID,GAAM,CACrB,IAAIE,EAAc9T,EAAI3F,IAAIuZ,GAEtBE,GACFhG,EAAKgG,EAET,CACF,IACAL,EAAO3E,KAAK4E,EACd,CAQA,OAzBAJ,EAAUtV,SAAQ,SAAU0V,GAC1B1T,EAAIiP,IAAIyE,EAASlW,KAAMkW,EACzB,IAiBAJ,EAAUtV,SAAQ,SAAU0V,GACrBH,EAAQM,IAAIH,EAASlW,OAExBsQ,EAAK4F,EAET,IACOD,CACT,CCvBA,IAAIM,GAAkB,CACpBnY,UAAW,SACX0X,UAAW,GACX1U,SAAU,YAGZ,SAASoV,KACP,IAAK,IAAI1B,EAAO2B,UAAUrG,OAAQsG,EAAO,IAAIpU,MAAMwS,GAAO6B,EAAO,EAAGA,EAAO7B,EAAM6B,IAC/ED,EAAKC,GAAQF,UAAUE,GAGzB,OAAQD,EAAKvE,MAAK,SAAUlT,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQ+D,sBACrC,GACF,CAEO,SAAS4T,GAAgBC,QACL,IAArBA,IACFA,EAAmB,CAAC,GAGtB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCV,GAAkBU,EAC3E,OAAO,SAAsBjZ,EAAWD,EAAQoD,QAC9B,IAAZA,IACFA,EAAU+V,GAGZ,ICxC6B/W,EAC3BgX,EDuCE9W,EAAQ,CACVjC,UAAW,SACXgZ,iBAAkB,GAClBjW,QAASzE,OAAOkE,OAAO,CAAC,EAAG2V,GAAiBW,GAC5C1Q,cAAe,CAAC,EAChBjG,SAAU,CACRvC,UAAWA,EACXD,OAAQA,GAEV4C,WAAY,CAAC,EACbD,OAAQ,CAAC,GAEP2W,EAAmB,GACnBC,GAAc,EACdrN,EAAW,CACb5J,MAAOA,EACPkX,WAAY,SAAoBC,GAC9B,IAAIrW,EAAsC,mBAArBqW,EAAkCA,EAAiBnX,EAAMc,SAAWqW,EACzFC,IACApX,EAAMc,QAAUzE,OAAOkE,OAAO,CAAC,EAAGsW,EAAgB7W,EAAMc,QAASA,GACjEd,EAAMiK,cAAgB,CACpBtM,UAAW0B,EAAU1B,GAAa6N,GAAkB7N,GAAaA,EAAU4Q,eAAiB/C,GAAkB7N,EAAU4Q,gBAAkB,GAC1I7Q,OAAQ8N,GAAkB9N,IAI5B,IElE4B+X,EAC9B4B,EFiEMN,EDhCG,SAAwBtB,GAErC,IAAIsB,EAAmBvB,GAAMC,GAE7B,OAAO/W,EAAeb,QAAO,SAAUC,EAAK+B,GAC1C,OAAO/B,EAAIE,OAAO+Y,EAAiBvR,QAAO,SAAUqQ,GAClD,OAAOA,EAAShW,QAAUA,CAC5B,IACF,GAAG,GACL,CCuB+ByX,EElEK7B,EFkEsB,GAAGzX,OAAO2Y,EAAkB3W,EAAMc,QAAQ2U,WEjE9F4B,EAAS5B,EAAU5X,QAAO,SAAUwZ,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5X,MAK9B,OAJA0X,EAAOE,EAAQ5X,MAAQ6X,EAAWnb,OAAOkE,OAAO,CAAC,EAAGiX,EAAUD,EAAS,CACrEzW,QAASzE,OAAOkE,OAAO,CAAC,EAAGiX,EAAS1W,QAASyW,EAAQzW,SACrD4I,KAAMrN,OAAOkE,OAAO,CAAC,EAAGiX,EAAS9N,KAAM6N,EAAQ7N,QAC5C6N,EACEF,CACT,GAAG,CAAC,GAEGhb,OAAO4D,KAAKoX,GAAQlV,KAAI,SAAUhG,GACvC,OAAOkb,EAAOlb,EAChB,MF4DM,OAJA6D,EAAM+W,iBAAmBA,EAAiBvR,QAAO,SAAUiS,GACzD,OAAOA,EAAE7X,OACX,IA+FFI,EAAM+W,iBAAiB5W,SAAQ,SAAUJ,GACvC,IAAIJ,EAAOI,EAAKJ,KACZ+X,EAAe3X,EAAKe,QACpBA,OAA2B,IAAjB4W,EAA0B,CAAC,EAAIA,EACzChX,EAASX,EAAKW,OAElB,GAAsB,mBAAXA,EAAuB,CAChC,IAAIiX,EAAYjX,EAAO,CACrBV,MAAOA,EACPL,KAAMA,EACNiK,SAAUA,EACV9I,QAASA,IAKXkW,EAAiB/F,KAAK0G,GAFT,WAAmB,EAGlC,CACF,IA/GS/N,EAASQ,QAClB,EAMAwN,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkB7X,EAAME,SACxBvC,EAAYka,EAAgBla,UAC5BD,EAASma,EAAgBna,OAG7B,GAAKyY,GAAiBxY,EAAWD,GAAjC,CAKAsC,EAAMwG,MAAQ,CACZ7I,UAAWwX,GAAiBxX,EAAWqH,EAAgBtH,GAAoC,UAA3BsC,EAAMc,QAAQC,UAC9ErD,OAAQiG,EAAcjG,IAOxBsC,EAAM0R,OAAQ,EACd1R,EAAMjC,UAAYiC,EAAMc,QAAQ/C,UAKhCiC,EAAM+W,iBAAiB5W,SAAQ,SAAU0V,GACvC,OAAO7V,EAAMmG,cAAc0P,EAASlW,MAAQtD,OAAOkE,OAAO,CAAC,EAAGsV,EAASnM,KACzE,IAEA,IAAK,IAAIoO,EAAQ,EAAGA,EAAQ9X,EAAM+W,iBAAiBhH,OAAQ+H,IACzD,IAAoB,IAAhB9X,EAAM0R,MAAV,CAMA,IAAIqG,EAAwB/X,EAAM+W,iBAAiBe,GAC/ChY,EAAKiY,EAAsBjY,GAC3BkY,EAAyBD,EAAsBjX,QAC/CoM,OAAsC,IAA3B8K,EAAoC,CAAC,EAAIA,EACpDrY,EAAOoY,EAAsBpY,KAEf,mBAAPG,IACTE,EAAQF,EAAG,CACTE,MAAOA,EACPc,QAASoM,EACTvN,KAAMA,EACNiK,SAAUA,KACN5J,EAdR,MAHEA,EAAM0R,OAAQ,EACdoG,GAAS,CAzBb,CATA,CAqDF,EAGA1N,QC1I2BtK,ED0IV,WACf,OAAO,IAAImY,SAAQ,SAAUC,GAC3BtO,EAASgO,cACTM,EAAQlY,EACV,GACF,EC7IG,WAUL,OATK8W,IACHA,EAAU,IAAImB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBrB,OAAUsB,EACVF,EAAQpY,IACV,GACF,KAGKgX,CACT,GDmIIuB,QAAS,WACPjB,IACAH,GAAc,CAChB,GAGF,IAAKd,GAAiBxY,EAAWD,GAC/B,OAAOkM,EAmCT,SAASwN,IACPJ,EAAiB7W,SAAQ,SAAUL,GACjC,OAAOA,GACT,IACAkX,EAAmB,EACrB,CAEA,OAvCApN,EAASsN,WAAWpW,GAASqX,MAAK,SAAUnY,IACrCiX,GAAenW,EAAQwX,eAC1BxX,EAAQwX,cAActY,EAE1B,IAmCO4J,CACT,CACF,CACO,IAAI2O,GAA4BhC,KGzLnC,GAA4BA,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,EAAa,GAAQ,GAAM,GAAiB,EAAO,MCJrH,GAA4BjC,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,KCatE,MAAMC,GAAa,IAAIlI,IACjBmI,GAAO,CACX,GAAAtH,CAAIxS,EAASzC,EAAKyN,GACX6O,GAAWzC,IAAIpX,IAClB6Z,GAAWrH,IAAIxS,EAAS,IAAI2R,KAE9B,MAAMoI,EAAcF,GAAWjc,IAAIoC,GAI9B+Z,EAAY3C,IAAI7Z,IAA6B,IAArBwc,EAAYC,KAKzCD,EAAYvH,IAAIjV,EAAKyN,GAHnBiP,QAAQC,MAAM,+EAA+E7W,MAAM8W,KAAKJ,EAAY1Y,QAAQ,MAIhI,EACAzD,IAAG,CAACoC,EAASzC,IACPsc,GAAWzC,IAAIpX,IACV6Z,GAAWjc,IAAIoC,GAASpC,IAAIL,IAE9B,KAET,MAAA6c,CAAOpa,EAASzC,GACd,IAAKsc,GAAWzC,IAAIpX,GAClB,OAEF,MAAM+Z,EAAcF,GAAWjc,IAAIoC,GACnC+Z,EAAYM,OAAO9c,GAGM,IAArBwc,EAAYC,MACdH,GAAWQ,OAAOra,EAEtB,GAYIsa,GAAiB,gBAOjBC,GAAgBC,IAChBA,GAAYna,OAAOoa,KAAOpa,OAAOoa,IAAIC,SAEvCF,EAAWA,EAAS5O,QAAQ,iBAAiB,CAAC+O,EAAOC,IAAO,IAAIH,IAAIC,OAAOE,QAEtEJ,GA4CHK,GAAuB7a,IAC3BA,EAAQ8a,cAAc,IAAIC,MAAMT,IAAgB,EAE5C,GAAYU,MACXA,GAA4B,iBAAXA,UAGO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAEgB,IAApBA,EAAOE,UAEjBC,GAAaH,GAEb,GAAUA,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAEf,iBAAXA,GAAuBA,EAAO7J,OAAS,EACzCrL,SAAS+C,cAAc0R,GAAcS,IAEvC,KAEHI,GAAYpb,IAChB,IAAK,GAAUA,IAAgD,IAApCA,EAAQqb,iBAAiBlK,OAClD,OAAO,EAET,MAAMmK,EAAgF,YAA7D5V,iBAAiB1F,GAASub,iBAAiB,cAE9DC,EAAgBxb,EAAQyb,QAAQ,uBACtC,IAAKD,EACH,OAAOF,EAET,GAAIE,IAAkBxb,EAAS,CAC7B,MAAM0b,EAAU1b,EAAQyb,QAAQ,WAChC,GAAIC,GAAWA,EAAQlW,aAAegW,EACpC,OAAO,EAET,GAAgB,OAAZE,EACF,OAAO,CAEX,CACA,OAAOJ,CAAgB,EAEnBK,GAAa3b,IACZA,GAAWA,EAAQkb,WAAaU,KAAKC,gBAGtC7b,EAAQ8b,UAAU7W,SAAS,mBAGC,IAArBjF,EAAQ+b,SACV/b,EAAQ+b,SAEV/b,EAAQgc,aAAa,aAAoD,UAArChc,EAAQic,aAAa,aAE5DC,GAAiBlc,IACrB,IAAK8F,SAASC,gBAAgBoW,aAC5B,OAAO,KAIT,GAAmC,mBAAxBnc,EAAQqF,YAA4B,CAC7C,MAAM+W,EAAOpc,EAAQqF,cACrB,OAAO+W,aAAgBtb,WAAasb,EAAO,IAC7C,CACA,OAAIpc,aAAmBc,WACdd,EAIJA,EAAQwF,WAGN0W,GAAelc,EAAQwF,YAFrB,IAEgC,EAErC6W,GAAO,OAUPC,GAAStc,IACbA,EAAQuE,YAAY,EAEhBgY,GAAY,IACZlc,OAAOmc,SAAW1W,SAAS6G,KAAKqP,aAAa,qBACxC3b,OAAOmc,OAET,KAEHC,GAA4B,GAgB5BC,GAAQ,IAAuC,QAAjC5W,SAASC,gBAAgB4W,IACvCC,GAAqBC,IAhBAC,QAiBN,KACjB,MAAMC,EAAIR,KAEV,GAAIQ,EAAG,CACL,MAAMhc,EAAO8b,EAAOG,KACdC,EAAqBF,EAAE7b,GAAGH,GAChCgc,EAAE7b,GAAGH,GAAQ8b,EAAOK,gBACpBH,EAAE7b,GAAGH,GAAMoc,YAAcN,EACzBE,EAAE7b,GAAGH,GAAMqc,WAAa,KACtBL,EAAE7b,GAAGH,GAAQkc,EACNJ,EAAOK,gBAElB,GA5B0B,YAAxBpX,SAASuX,YAENZ,GAA0BtL,QAC7BrL,SAASyF,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMuR,KAAYL,GACrBK,GACF,IAGJL,GAA0BpK,KAAKyK,IAE/BA,GAkBA,EAEEQ,GAAU,CAACC,EAAkB9F,EAAO,GAAI+F,EAAeD,IACxB,mBAArBA,EAAkCA,KAAoB9F,GAAQ+F,EAExEC,GAAyB,CAACX,EAAUY,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAL,GAAQR,GAGV,MACMc,EA/JiC5d,KACvC,IAAKA,EACH,OAAO,EAIT,IAAI,mBACF6d,EAAkB,gBAClBC,GACEzd,OAAOqF,iBAAiB1F,GAC5B,MAAM+d,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAG/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBlb,MAAM,KAAK,GACnDmb,EAAkBA,EAAgBnb,MAAM,KAAK,GAtDf,KAuDtBqb,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KANzD,CAMoG,EA0IpFK,CAAiCT,GADlC,EAExB,IAAIU,GAAS,EACb,MAAMC,EAAU,EACdrR,aAEIA,IAAW0Q,IAGfU,GAAS,EACTV,EAAkBjS,oBAAoB6O,GAAgB+D,GACtDf,GAAQR,GAAS,EAEnBY,EAAkBnS,iBAAiB+O,GAAgB+D,GACnDC,YAAW,KACJF,GACHvD,GAAqB6C,EACvB,GACCE,EAAiB,EAYhBW,GAAuB,CAAC1R,EAAM2R,EAAeC,EAAeC,KAChE,MAAMC,EAAa9R,EAAKsE,OACxB,IAAI+H,EAAQrM,EAAKjH,QAAQ4Y,GAIzB,OAAe,IAAXtF,GACMuF,GAAiBC,EAAiB7R,EAAK8R,EAAa,GAAK9R,EAAK,IAExEqM,GAASuF,EAAgB,GAAK,EAC1BC,IACFxF,GAASA,EAAQyF,GAAcA,GAE1B9R,EAAKjK,KAAKC,IAAI,EAAGD,KAAKE,IAAIoW,EAAOyF,EAAa,KAAI,EAerDC,GAAiB,qBACjBC,GAAiB,OACjBC,GAAgB,SAChBC,GAAgB,CAAC,EACvB,IAAIC,GAAW,EACf,MAAMC,GAAe,CACnBC,WAAY,YACZC,WAAY,YAERC,GAAe,IAAIrI,IAAI,CAAC,QAAS,WAAY,UAAW,YAAa,cAAe,aAAc,iBAAkB,YAAa,WAAY,YAAa,cAAe,YAAa,UAAW,WAAY,QAAS,oBAAqB,aAAc,YAAa,WAAY,cAAe,cAAe,cAAe,YAAa,eAAgB,gBAAiB,eAAgB,gBAAiB,aAAc,QAAS,OAAQ,SAAU,QAAS,SAAU,SAAU,UAAW,WAAY,OAAQ,SAAU,eAAgB,SAAU,OAAQ,mBAAoB,mBAAoB,QAAS,QAAS,WAM/lB,SAASsI,GAAarf,EAASsf,GAC7B,OAAOA,GAAO,GAAGA,MAAQN,QAAgBhf,EAAQgf,UAAYA,IAC/D,CACA,SAASO,GAAiBvf,GACxB,MAAMsf,EAAMD,GAAarf,GAGzB,OAFAA,EAAQgf,SAAWM,EACnBP,GAAcO,GAAOP,GAAcO,IAAQ,CAAC,EACrCP,GAAcO,EACvB,CAiCA,SAASE,GAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOliB,OAAOmiB,OAAOH,GAAQ7M,MAAKiN,GAASA,EAAMH,WAAaA,GAAYG,EAAMF,qBAAuBA,GACzG,CACA,SAASG,GAAoBC,EAAmB1B,EAAS2B,GACvD,MAAMC,EAAiC,iBAAZ5B,EAErBqB,EAAWO,EAAcD,EAAqB3B,GAAW2B,EAC/D,IAAIE,EAAYC,GAAaJ,GAI7B,OAHKX,GAAahI,IAAI8I,KACpBA,EAAYH,GAEP,CAACE,EAAaP,EAAUQ,EACjC,CACA,SAASE,GAAWpgB,EAAS+f,EAAmB1B,EAAS2B,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmC/f,EAC5C,OAEF,IAAKigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GAIzF,GAAID,KAAqBd,GAAc,CACrC,MAAMqB,EAAepf,GACZ,SAAU2e,GACf,IAAKA,EAAMU,eAAiBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAevb,SAAS4a,EAAMU,eAC/G,OAAOrf,EAAGjD,KAAKwiB,KAAMZ,EAEzB,EAEFH,EAAWY,EAAaZ,EAC1B,CACA,MAAMD,EAASF,GAAiBvf,GAC1B0gB,EAAWjB,EAAOS,KAAeT,EAAOS,GAAa,CAAC,GACtDS,EAAmBnB,GAAYkB,EAAUhB,EAAUO,EAAc5B,EAAU,MACjF,GAAIsC,EAEF,YADAA,EAAiBN,OAASM,EAAiBN,QAAUA,GAGvD,MAAMf,EAAMD,GAAaK,EAAUK,EAAkBnU,QAAQgT,GAAgB,KACvE1d,EAAK+e,EA5Db,SAAoCjgB,EAASwa,EAAUtZ,GACrD,OAAO,SAASmd,EAAQwB,GACtB,MAAMe,EAAc5gB,EAAQ6gB,iBAAiBrG,GAC7C,IAAK,IAAI,OACPxN,GACE6S,EAAO7S,GAAUA,IAAWyT,KAAMzT,EAASA,EAAOxH,WACpD,IAAK,MAAMsb,KAAcF,EACvB,GAAIE,IAAe9T,EASnB,OANA+T,GAAWlB,EAAO,CAChBW,eAAgBxT,IAEdqR,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAM1G,EAAUtZ,GAE3CA,EAAGigB,MAAMnU,EAAQ,CAAC6S,GAG/B,CACF,CAwC2BuB,CAA2BphB,EAASqe,EAASqB,GAvExE,SAA0B1f,EAASkB,GACjC,OAAO,SAASmd,EAAQwB,GAOtB,OANAkB,GAAWlB,EAAO,CAChBW,eAAgBxgB,IAEdqe,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAMhgB,GAEjCA,EAAGigB,MAAMnhB,EAAS,CAAC6f,GAC5B,CACF,CA6DoFwB,CAAiBrhB,EAAS0f,GAC5Gxe,EAAGye,mBAAqBM,EAAc5B,EAAU,KAChDnd,EAAGwe,SAAWA,EACdxe,EAAGmf,OAASA,EACZnf,EAAG8d,SAAWM,EACdoB,EAASpB,GAAOpe,EAChBlB,EAAQuL,iBAAiB2U,EAAWhf,EAAI+e,EAC1C,CACA,SAASqB,GAActhB,EAASyf,EAAQS,EAAW7B,EAASsB,GAC1D,MAAMze,EAAKse,GAAYC,EAAOS,GAAY7B,EAASsB,GAC9Cze,IAGLlB,EAAQyL,oBAAoByU,EAAWhf,EAAIqgB,QAAQ5B,WAC5CF,EAAOS,GAAWhf,EAAG8d,UAC9B,CACA,SAASwC,GAAyBxhB,EAASyf,EAAQS,EAAWuB,GAC5D,MAAMC,EAAoBjC,EAAOS,IAAc,CAAC,EAChD,IAAK,MAAOyB,EAAY9B,KAAUpiB,OAAOmkB,QAAQF,GAC3CC,EAAWE,SAASJ,IACtBH,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAGtE,CACA,SAASQ,GAAaN,GAGpB,OADAA,EAAQA,EAAMjU,QAAQiT,GAAgB,IAC/BI,GAAaY,IAAUA,CAChC,CACA,MAAMmB,GAAe,CACnB,EAAAc,CAAG9hB,EAAS6f,EAAOxB,EAAS2B,GAC1BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAA+B,CAAI/hB,EAAS6f,EAAOxB,EAAS2B,GAC3BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAAiB,CAAIjhB,EAAS+f,EAAmB1B,EAAS2B,GACvC,GAAiC,iBAAtBD,IAAmC/f,EAC5C,OAEF,MAAOigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GACrFgC,EAAc9B,IAAcH,EAC5BN,EAASF,GAAiBvf,GAC1B0hB,EAAoBjC,EAAOS,IAAc,CAAC,EAC1C+B,EAAclC,EAAkBmC,WAAW,KACjD,QAAwB,IAAbxC,EAAX,CAQA,GAAIuC,EACF,IAAK,MAAME,KAAgB1kB,OAAO4D,KAAKoe,GACrC+B,GAAyBxhB,EAASyf,EAAQ0C,EAAcpC,EAAkBlN,MAAM,IAGpF,IAAK,MAAOuP,EAAavC,KAAUpiB,OAAOmkB,QAAQF,GAAoB,CACpE,MAAMC,EAAaS,EAAYxW,QAAQkT,GAAe,IACjDkD,IAAejC,EAAkB8B,SAASF,IAC7CL,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAEpE,CAXA,KAPA,CAEE,IAAKliB,OAAO4D,KAAKqgB,GAAmBvQ,OAClC,OAEFmQ,GAActhB,EAASyf,EAAQS,EAAWR,EAAUO,EAAc5B,EAAU,KAE9E,CAYF,EACA,OAAAgE,CAAQriB,EAAS6f,EAAOpI,GACtB,GAAqB,iBAAVoI,IAAuB7f,EAChC,OAAO,KAET,MAAM+c,EAAIR,KAGV,IAAI+F,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EAJH5C,IADFM,GAAaN,IAMZ9C,IACjBuF,EAAcvF,EAAEhC,MAAM8E,EAAOpI,GAC7BsF,EAAE/c,GAASqiB,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAEjC,MAAMC,EAAM9B,GAAW,IAAIhG,MAAM8E,EAAO,CACtC0C,UACAO,YAAY,IACVrL,GAUJ,OATIgL,GACFI,EAAIE,iBAEFP,GACFxiB,EAAQ8a,cAAc+H,GAEpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAEPF,CACT,GAEF,SAAS9B,GAAWljB,EAAKmlB,EAAO,CAAC,GAC/B,IAAK,MAAOzlB,EAAKa,KAAUX,OAAOmkB,QAAQoB,GACxC,IACEnlB,EAAIN,GAAOa,CACb,CAAE,MAAO6kB,GACPxlB,OAAOC,eAAeG,EAAKN,EAAK,CAC9B2lB,cAAc,EACdtlB,IAAG,IACMQ,GAGb,CAEF,OAAOP,CACT,CASA,SAASslB,GAAc/kB,GACrB,GAAc,SAAVA,EACF,OAAO,EAET,GAAc,UAAVA,EACF,OAAO,EAET,GAAIA,IAAU4f,OAAO5f,GAAOkC,WAC1B,OAAO0d,OAAO5f,GAEhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAET,GAAqB,iBAAVA,EACT,OAAOA,EAET,IACE,OAAOglB,KAAKC,MAAMC,mBAAmBllB,GACvC,CAAE,MAAO6kB,GACP,OAAO7kB,CACT,CACF,CACA,SAASmlB,GAAiBhmB,GACxB,OAAOA,EAAIqO,QAAQ,UAAU4X,GAAO,IAAIA,EAAItjB,iBAC9C,CACA,MAAMujB,GAAc,CAClB,gBAAAC,CAAiB1jB,EAASzC,EAAKa,GAC7B4B,EAAQ6B,aAAa,WAAW0hB,GAAiBhmB,KAAQa,EAC3D,EACA,mBAAAulB,CAAoB3jB,EAASzC,GAC3ByC,EAAQ4B,gBAAgB,WAAW2hB,GAAiBhmB,KACtD,EACA,iBAAAqmB,CAAkB5jB,GAChB,IAAKA,EACH,MAAO,CAAC,EAEV,MAAM0B,EAAa,CAAC,EACdmiB,EAASpmB,OAAO4D,KAAKrB,EAAQ8jB,SAASld,QAAOrJ,GAAOA,EAAI2kB,WAAW,QAAU3kB,EAAI2kB,WAAW,cAClG,IAAK,MAAM3kB,KAAOsmB,EAAQ,CACxB,IAAIE,EAAUxmB,EAAIqO,QAAQ,MAAO,IACjCmY,EAAUA,EAAQC,OAAO,GAAG9jB,cAAgB6jB,EAAQlR,MAAM,EAAGkR,EAAQ5S,QACrEzP,EAAWqiB,GAAWZ,GAAcnjB,EAAQ8jB,QAAQvmB,GACtD,CACA,OAAOmE,CACT,EACAuiB,iBAAgB,CAACjkB,EAASzC,IACjB4lB,GAAcnjB,EAAQic,aAAa,WAAWsH,GAAiBhmB,QAgB1E,MAAM2mB,GAEJ,kBAAWC,GACT,MAAO,CAAC,CACV,CACA,sBAAWC,GACT,MAAO,CAAC,CACV,CACA,eAAWpH,GACT,MAAM,IAAIqH,MAAM,sEAClB,CACA,UAAAC,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAChB,OAAOA,CACT,CACA,eAAAC,CAAgBD,EAAQvkB,GACtB,MAAM2kB,EAAa,GAAU3kB,GAAWyjB,GAAYQ,iBAAiBjkB,EAAS,UAAY,CAAC,EAE3F,MAAO,IACFygB,KAAKmE,YAAYT,WACM,iBAAfQ,EAA0BA,EAAa,CAAC,KAC/C,GAAU3kB,GAAWyjB,GAAYG,kBAAkB5jB,GAAW,CAAC,KAC7C,iBAAXukB,EAAsBA,EAAS,CAAC,EAE/C,CACA,gBAAAG,CAAiBH,EAAQM,EAAcpE,KAAKmE,YAAYR,aACtD,IAAK,MAAO7hB,EAAUuiB,KAAkBrnB,OAAOmkB,QAAQiD,GAAc,CACnE,MAAMzmB,EAAQmmB,EAAOhiB,GACfwiB,EAAY,GAAU3mB,GAAS,UAhiBrC4c,OADSA,EAiiB+C5c,GA/hBnD,GAAG4c,IAELvd,OAAOM,UAAUuC,SAASrC,KAAK+c,GAAQL,MAAM,eAAe,GAAGza,cA8hBlE,IAAK,IAAI8kB,OAAOF,GAAehhB,KAAKihB,GAClC,MAAM,IAAIE,UAAU,GAAGxE,KAAKmE,YAAY5H,KAAKkI,0BAA0B3iB,qBAA4BwiB,yBAAiCD,MAExI,CAriBW9J,KAsiBb,EAqBF,MAAMmK,WAAsBjB,GAC1B,WAAAU,CAAY5kB,EAASukB,GACnBa,SACAplB,EAAUmb,GAAWnb,MAIrBygB,KAAK4E,SAAWrlB,EAChBygB,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/BzK,GAAKtH,IAAIiO,KAAK4E,SAAU5E,KAAKmE,YAAYW,SAAU9E,MACrD,CAGA,OAAA+E,GACE1L,GAAKM,OAAOqG,KAAK4E,SAAU5E,KAAKmE,YAAYW,UAC5CvE,GAAaC,IAAIR,KAAK4E,SAAU5E,KAAKmE,YAAYa,WACjD,IAAK,MAAMC,KAAgBjoB,OAAOkoB,oBAAoBlF,MACpDA,KAAKiF,GAAgB,IAEzB,CACA,cAAAE,CAAe9I,EAAU9c,EAAS6lB,GAAa,GAC7CpI,GAAuBX,EAAU9c,EAAS6lB,EAC5C,CACA,UAAAvB,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,EAAQ9D,KAAK4E,UAC3Cd,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CAGA,kBAAOuB,CAAY9lB,GACjB,OAAO8Z,GAAKlc,IAAIud,GAAWnb,GAAUygB,KAAK8E,SAC5C,CACA,0BAAOQ,CAAoB/lB,EAASukB,EAAS,CAAC,GAC5C,OAAO9D,KAAKqF,YAAY9lB,IAAY,IAAIygB,KAAKzgB,EAA2B,iBAAXukB,EAAsBA,EAAS,KAC9F,CACA,kBAAWyB,GACT,MA5CY,OA6Cd,CACA,mBAAWT,GACT,MAAO,MAAM9E,KAAKzD,MACpB,CACA,oBAAWyI,GACT,MAAO,IAAIhF,KAAK8E,UAClB,CACA,gBAAOU,CAAUllB,GACf,MAAO,GAAGA,IAAO0f,KAAKgF,WACxB,EAUF,MAAMS,GAAclmB,IAClB,IAAIwa,EAAWxa,EAAQic,aAAa,kBACpC,IAAKzB,GAAyB,MAAbA,EAAkB,CACjC,IAAI2L,EAAgBnmB,EAAQic,aAAa,QAMzC,IAAKkK,IAAkBA,EAActE,SAAS,OAASsE,EAAcjE,WAAW,KAC9E,OAAO,KAILiE,EAActE,SAAS,OAASsE,EAAcjE,WAAW,OAC3DiE,EAAgB,IAAIA,EAAcxjB,MAAM,KAAK,MAE/C6X,EAAW2L,GAAmC,MAAlBA,EAAwBA,EAAcC,OAAS,IAC7E,CACA,OAAO5L,EAAWA,EAAS7X,MAAM,KAAKY,KAAI8iB,GAAO9L,GAAc8L,KAAM1iB,KAAK,KAAO,IAAI,EAEjF2iB,GAAiB,CACrB1T,KAAI,CAAC4H,EAAUxa,EAAU8F,SAASC,kBACzB,GAAG3G,UAAUsB,QAAQ3C,UAAU8iB,iBAAiB5iB,KAAK+B,EAASwa,IAEvE+L,QAAO,CAAC/L,EAAUxa,EAAU8F,SAASC,kBAC5BrF,QAAQ3C,UAAU8K,cAAc5K,KAAK+B,EAASwa,GAEvDgM,SAAQ,CAACxmB,EAASwa,IACT,GAAGpb,UAAUY,EAAQwmB,UAAU5f,QAAOzB,GAASA,EAAMshB,QAAQjM,KAEtE,OAAAkM,CAAQ1mB,EAASwa,GACf,MAAMkM,EAAU,GAChB,IAAIC,EAAW3mB,EAAQwF,WAAWiW,QAAQjB,GAC1C,KAAOmM,GACLD,EAAQrU,KAAKsU,GACbA,EAAWA,EAASnhB,WAAWiW,QAAQjB,GAEzC,OAAOkM,CACT,EACA,IAAAE,CAAK5mB,EAASwa,GACZ,IAAIqM,EAAW7mB,EAAQ8mB,uBACvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQjM,GACnB,MAAO,CAACqM,GAEVA,EAAWA,EAASC,sBACtB,CACA,MAAO,EACT,EAEA,IAAAxhB,CAAKtF,EAASwa,GACZ,IAAIlV,EAAOtF,EAAQ+mB,mBACnB,KAAOzhB,GAAM,CACX,GAAIA,EAAKmhB,QAAQjM,GACf,MAAO,CAAClV,GAEVA,EAAOA,EAAKyhB,kBACd,CACA,MAAO,EACT,EACA,iBAAAC,CAAkBhnB,GAChB,MAAMinB,EAAa,CAAC,IAAK,SAAU,QAAS,WAAY,SAAU,UAAW,aAAc,4BAA4B1jB,KAAIiX,GAAY,GAAGA,2BAAiC7W,KAAK,KAChL,OAAO8c,KAAK7N,KAAKqU,EAAYjnB,GAAS4G,QAAOsgB,IAAOvL,GAAWuL,IAAO9L,GAAU8L,IAClF,EACA,sBAAAC,CAAuBnnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAIwa,GACK8L,GAAeC,QAAQ/L,GAAYA,EAErC,IACT,EACA,sBAAA4M,CAAuBpnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAeC,QAAQ/L,GAAY,IACvD,EACA,+BAAA6M,CAAgCrnB,GAC9B,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAe1T,KAAK4H,GAAY,EACpD,GAUI8M,GAAuB,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAa,gBAAgBF,EAAU9B,YACvC1kB,EAAOwmB,EAAUvK,KACvBgE,GAAac,GAAGhc,SAAU2hB,EAAY,qBAAqB1mB,OAAU,SAAU8e,GAI7E,GAHI,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEF,MAAMzT,EAASsZ,GAAec,uBAAuB3G,OAASA,KAAKhF,QAAQ,IAAI1a,KAC9DwmB,EAAUxB,oBAAoB/Y,GAGtCwa,IACX,GAAE,EAiBEG,GAAc,YACdC,GAAc,QAAQD,KACtBE,GAAe,SAASF,KAQ9B,MAAMG,WAAc3C,GAElB,eAAWnI,GACT,MAfW,OAgBb,CAGA,KAAA+K,GAEE,GADmB/G,GAAaqB,QAAQ5B,KAAK4E,SAAUuC,IACxCnF,iBACb,OAEFhC,KAAK4E,SAASvJ,UAAU1B,OAlBF,QAmBtB,MAAMyL,EAAapF,KAAK4E,SAASvJ,UAAU7W,SApBrB,QAqBtBwb,KAAKmF,gBAAe,IAAMnF,KAAKuH,mBAAmBvH,KAAK4E,SAAUQ,EACnE,CAGA,eAAAmC,GACEvH,KAAK4E,SAASjL,SACd4G,GAAaqB,QAAQ5B,KAAK4E,SAAUwC,IACpCpH,KAAK+E,SACP,CAGA,sBAAOtI,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOgd,GAAM/B,oBAAoBtF,MACvC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOF6G,GAAqBQ,GAAO,SAM5BlL,GAAmBkL,IAcnB,MAKMI,GAAyB,4BAO/B,MAAMC,WAAehD,GAEnB,eAAWnI,GACT,MAfW,QAgBb,CAGA,MAAAoL,GAEE3H,KAAK4E,SAASxjB,aAAa,eAAgB4e,KAAK4E,SAASvJ,UAAUsM,OAjB3C,UAkB1B,CAGA,sBAAOlL,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOqd,GAAOpC,oBAAoBtF,MACzB,WAAX8D,GACFzZ,EAAKyZ,IAET,GACF,EAOFvD,GAAac,GAAGhc,SAjCe,2BAiCmBoiB,IAAwBrI,IACxEA,EAAMkD,iBACN,MAAMsF,EAASxI,EAAM7S,OAAOyO,QAAQyM,IACvBC,GAAOpC,oBAAoBsC,GACnCD,QAAQ,IAOfxL,GAAmBuL,IAcnB,MACMG,GAAc,YACdC,GAAmB,aAAaD,KAChCE,GAAkB,YAAYF,KAC9BG,GAAiB,WAAWH,KAC5BI,GAAoB,cAAcJ,KAClCK,GAAkB,YAAYL,KAK9BM,GAAY,CAChBC,YAAa,KACbC,aAAc,KACdC,cAAe,MAEXC,GAAgB,CACpBH,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAOjB,MAAME,WAAc/E,GAClB,WAAAU,CAAY5kB,EAASukB,GACnBa,QACA3E,KAAK4E,SAAWrlB,EACXA,GAAYipB,GAAMC,gBAGvBzI,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAK0I,QAAU,EACf1I,KAAK2I,sBAAwB7H,QAAQlhB,OAAOgpB,cAC5C5I,KAAK6I,cACP,CAGA,kBAAWnF,GACT,OAAOyE,EACT,CACA,sBAAWxE,GACT,OAAO4E,EACT,CACA,eAAWhM,GACT,MA/CW,OAgDb,CAGA,OAAAwI,GACExE,GAAaC,IAAIR,KAAK4E,SAAUiD,GAClC,CAGA,MAAAiB,CAAO1J,GACAY,KAAK2I,sBAIN3I,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,SAJrBhJ,KAAK0I,QAAUtJ,EAAM6J,QAAQ,GAAGD,OAMpC,CACA,IAAAE,CAAK9J,GACCY,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,QAAUhJ,KAAK0I,SAEtC1I,KAAKmJ,eACLtM,GAAQmD,KAAK6E,QAAQuD,YACvB,CACA,KAAAgB,CAAMhK,GACJY,KAAK0I,QAAUtJ,EAAM6J,SAAW7J,EAAM6J,QAAQvY,OAAS,EAAI,EAAI0O,EAAM6J,QAAQ,GAAGD,QAAUhJ,KAAK0I,OACjG,CACA,YAAAS,GACE,MAAME,EAAYlnB,KAAKoC,IAAIyb,KAAK0I,SAChC,GAAIW,GAnEgB,GAoElB,OAEF,MAAM/b,EAAY+b,EAAYrJ,KAAK0I,QACnC1I,KAAK0I,QAAU,EACVpb,GAGLuP,GAAQvP,EAAY,EAAI0S,KAAK6E,QAAQyD,cAAgBtI,KAAK6E,QAAQwD,aACpE,CACA,WAAAQ,GACM7I,KAAK2I,uBACPpI,GAAac,GAAGrB,KAAK4E,SAAUqD,IAAmB7I,GAASY,KAAK8I,OAAO1J,KACvEmB,GAAac,GAAGrB,KAAK4E,SAAUsD,IAAiB9I,GAASY,KAAKkJ,KAAK9J,KACnEY,KAAK4E,SAASvJ,UAAU5E,IAlFG,mBAoF3B8J,GAAac,GAAGrB,KAAK4E,SAAUkD,IAAkB1I,GAASY,KAAK8I,OAAO1J,KACtEmB,GAAac,GAAGrB,KAAK4E,SAAUmD,IAAiB3I,GAASY,KAAKoJ,MAAMhK,KACpEmB,GAAac,GAAGrB,KAAK4E,SAAUoD,IAAgB5I,GAASY,KAAKkJ,KAAK9J,KAEtE,CACA,uBAAA2J,CAAwB3J,GACtB,OAAOY,KAAK2I,wBA3FS,QA2FiBvJ,EAAMkK,aA5FrB,UA4FyDlK,EAAMkK,YACxF,CAGA,kBAAOb,GACL,MAAO,iBAAkBpjB,SAASC,iBAAmB7C,UAAU8mB,eAAiB,CAClF,EAeF,MAEMC,GAAc,eACdC,GAAiB,YACjBC,GAAmB,YACnBC,GAAoB,aAGpBC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAClBC,GAAc,QAAQR,KACtBS,GAAa,OAAOT,KACpBU,GAAkB,UAAUV,KAC5BW,GAAqB,aAAaX,KAClCY,GAAqB,aAAaZ,KAClCa,GAAmB,YAAYb,KAC/Bc,GAAwB,OAAOd,KAAcC,KAC7Cc,GAAyB,QAAQf,KAAcC,KAC/Ce,GAAsB,WACtBC,GAAsB,SAMtBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAKzCE,GAAmB,CACvB,CAACnB,IAAmBK,GACpB,CAACJ,IAAoBG,IAEjBgB,GAAY,CAChBC,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAEFC,GAAgB,CACpBN,SAAU,mBAEVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAOR,MAAME,WAAiB5G,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKuL,UAAY,KACjBvL,KAAKwL,eAAiB,KACtBxL,KAAKyL,YAAa,EAClBzL,KAAK0L,aAAe,KACpB1L,KAAK2L,aAAe,KACpB3L,KAAK4L,mBAAqB/F,GAAeC,QArCjB,uBAqC8C9F,KAAK4E,UAC3E5E,KAAK6L,qBACD7L,KAAK6E,QAAQqG,OAASV,IACxBxK,KAAK8L,OAET,CAGA,kBAAWpI,GACT,OAAOoH,EACT,CACA,sBAAWnH,GACT,OAAO0H,EACT,CACA,eAAW9O,GACT,MAnFW,UAoFb,CAGA,IAAA1X,GACEmb,KAAK+L,OAAOnC,GACd,CACA,eAAAoC,IAIO3mB,SAAS4mB,QAAUtR,GAAUqF,KAAK4E,WACrC5E,KAAKnb,MAET,CACA,IAAAshB,GACEnG,KAAK+L,OAAOlC,GACd,CACA,KAAAoB,GACMjL,KAAKyL,YACPrR,GAAqB4F,KAAK4E,UAE5B5E,KAAKkM,gBACP,CACA,KAAAJ,GACE9L,KAAKkM,iBACLlM,KAAKmM,kBACLnM,KAAKuL,UAAYa,aAAY,IAAMpM,KAAKgM,mBAAmBhM,KAAK6E,QAAQkG,SAC1E,CACA,iBAAAsB,GACOrM,KAAK6E,QAAQqG,OAGdlL,KAAKyL,WACPlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAK8L,UAGzD9L,KAAK8L,QACP,CACA,EAAAQ,CAAG7T,GACD,MAAM8T,EAAQvM,KAAKwM,YACnB,GAAI/T,EAAQ8T,EAAM7b,OAAS,GAAK+H,EAAQ,EACtC,OAEF,GAAIuH,KAAKyL,WAEP,YADAlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAKsM,GAAG7T,KAG5D,MAAMgU,EAAczM,KAAK0M,cAAc1M,KAAK2M,cAC5C,GAAIF,IAAgBhU,EAClB,OAEF,MAAMtC,EAAQsC,EAAQgU,EAAc7C,GAAaC,GACjD7J,KAAK+L,OAAO5V,EAAOoW,EAAM9T,GAC3B,CACA,OAAAsM,GACM/E,KAAK2L,cACP3L,KAAK2L,aAAa5G,UAEpBJ,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAEhB,OADAA,EAAO8I,gBAAkB9I,EAAOiH,SACzBjH,CACT,CACA,kBAAA+H,GACM7L,KAAK6E,QAAQmG,UACfzK,GAAac,GAAGrB,KAAK4E,SAAUsF,IAAiB9K,GAASY,KAAK6M,SAASzN,KAE9C,UAAvBY,KAAK6E,QAAQoG,QACf1K,GAAac,GAAGrB,KAAK4E,SAAUuF,IAAoB,IAAMnK,KAAKiL,UAC9D1K,GAAac,GAAGrB,KAAK4E,SAAUwF,IAAoB,IAAMpK,KAAKqM,uBAE5DrM,KAAK6E,QAAQsG,OAAS3C,GAAMC,eAC9BzI,KAAK8M,yBAET,CACA,uBAAAA,GACE,IAAK,MAAMC,KAAOlH,GAAe1T,KArIX,qBAqImC6N,KAAK4E,UAC5DrE,GAAac,GAAG0L,EAAK1C,IAAkBjL,GAASA,EAAMkD,mBAExD,MAmBM0K,EAAc,CAClB3E,aAAc,IAAMrI,KAAK+L,OAAO/L,KAAKiN,kBAAkBnD,KACvDxB,cAAe,IAAMtI,KAAK+L,OAAO/L,KAAKiN,kBAAkBlD,KACxD3B,YAtBkB,KACS,UAAvBpI,KAAK6E,QAAQoG,QAYjBjL,KAAKiL,QACDjL,KAAK0L,cACPwB,aAAalN,KAAK0L,cAEpB1L,KAAK0L,aAAe7N,YAAW,IAAMmC,KAAKqM,qBAjLjB,IAiL+DrM,KAAK6E,QAAQkG,UAAS,GAOhH/K,KAAK2L,aAAe,IAAInD,GAAMxI,KAAK4E,SAAUoI,EAC/C,CACA,QAAAH,CAASzN,GACP,GAAI,kBAAkB/b,KAAK+b,EAAM7S,OAAO0a,SACtC,OAEF,MAAM3Z,EAAYud,GAAiBzL,EAAMtiB,KACrCwQ,IACF8R,EAAMkD,iBACNtC,KAAK+L,OAAO/L,KAAKiN,kBAAkB3f,IAEvC,CACA,aAAAof,CAAcntB,GACZ,OAAOygB,KAAKwM,YAAYrnB,QAAQ5F,EAClC,CACA,0BAAA4tB,CAA2B1U,GACzB,IAAKuH,KAAK4L,mBACR,OAEF,MAAMwB,EAAkBvH,GAAeC,QAAQ4E,GAAiB1K,KAAK4L,oBACrEwB,EAAgB/R,UAAU1B,OAAO8Q,IACjC2C,EAAgBjsB,gBAAgB,gBAChC,MAAMksB,EAAqBxH,GAAeC,QAAQ,sBAAsBrN,MAAWuH,KAAK4L,oBACpFyB,IACFA,EAAmBhS,UAAU5E,IAAIgU,IACjC4C,EAAmBjsB,aAAa,eAAgB,QAEpD,CACA,eAAA+qB,GACE,MAAM5sB,EAAUygB,KAAKwL,gBAAkBxL,KAAK2M,aAC5C,IAAKptB,EACH,OAEF,MAAM+tB,EAAkB/P,OAAOgQ,SAAShuB,EAAQic,aAAa,oBAAqB,IAClFwE,KAAK6E,QAAQkG,SAAWuC,GAAmBtN,KAAK6E,QAAQ+H,eAC1D,CACA,MAAAb,CAAO5V,EAAO5W,EAAU,MACtB,GAAIygB,KAAKyL,WACP,OAEF,MAAM1N,EAAgBiC,KAAK2M,aACrBa,EAASrX,IAAUyT,GACnB6D,EAAcluB,GAAWue,GAAqBkC,KAAKwM,YAAazO,EAAeyP,EAAQxN,KAAK6E,QAAQuG,MAC1G,GAAIqC,IAAgB1P,EAClB,OAEF,MAAM2P,EAAmB1N,KAAK0M,cAAce,GACtCE,EAAenI,GACZjF,GAAaqB,QAAQ5B,KAAK4E,SAAUY,EAAW,CACpD1F,cAAe2N,EACfngB,UAAW0S,KAAK4N,kBAAkBzX,GAClCuD,KAAMsG,KAAK0M,cAAc3O,GACzBuO,GAAIoB,IAIR,GADmBC,EAAa3D,IACjBhI,iBACb,OAEF,IAAKjE,IAAkB0P,EAGrB,OAEF,MAAMI,EAAY/M,QAAQd,KAAKuL,WAC/BvL,KAAKiL,QACLjL,KAAKyL,YAAa,EAClBzL,KAAKmN,2BAA2BO,GAChC1N,KAAKwL,eAAiBiC,EACtB,MAAMK,EAAuBN,EA3OR,sBADF,oBA6ObO,EAAiBP,EA3OH,qBACA,qBA2OpBC,EAAYpS,UAAU5E,IAAIsX,GAC1BlS,GAAO4R,GACP1P,EAAc1C,UAAU5E,IAAIqX,GAC5BL,EAAYpS,UAAU5E,IAAIqX,GAQ1B9N,KAAKmF,gBAPoB,KACvBsI,EAAYpS,UAAU1B,OAAOmU,EAAsBC,GACnDN,EAAYpS,UAAU5E,IAAIgU,IAC1B1M,EAAc1C,UAAU1B,OAAO8Q,GAAqBsD,EAAgBD,GACpE9N,KAAKyL,YAAa,EAClBkC,EAAa1D,GAAW,GAEYlM,EAAeiC,KAAKgO,eACtDH,GACF7N,KAAK8L,OAET,CACA,WAAAkC,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAhQV,QAiQvB,CACA,UAAAmoB,GACE,OAAO9G,GAAeC,QAAQ8E,GAAsB5K,KAAK4E,SAC3D,CACA,SAAA4H,GACE,OAAO3G,GAAe1T,KAAKwY,GAAe3K,KAAK4E,SACjD,CACA,cAAAsH,GACMlM,KAAKuL,YACP0C,cAAcjO,KAAKuL,WACnBvL,KAAKuL,UAAY,KAErB,CACA,iBAAA0B,CAAkB3f,GAChB,OAAI2O,KACK3O,IAAcwc,GAAiBD,GAAaD,GAE9Ctc,IAAcwc,GAAiBF,GAAaC,EACrD,CACA,iBAAA+D,CAAkBzX,GAChB,OAAI8F,KACK9F,IAAU0T,GAAaC,GAAiBC,GAE1C5T,IAAU0T,GAAaE,GAAkBD,EAClD,CAGA,sBAAOrN,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOihB,GAAShG,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,GAIX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,OAREzZ,EAAKiiB,GAAGxI,EASZ,GACF,EAOFvD,GAAac,GAAGhc,SAAUklB,GAvSE,uCAuS2C,SAAUnL,GAC/E,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACrD,IAAKzT,IAAWA,EAAO8O,UAAU7W,SAASgmB,IACxC,OAEFpL,EAAMkD,iBACN,MAAM4L,EAAW5C,GAAShG,oBAAoB/Y,GACxC4hB,EAAanO,KAAKxE,aAAa,oBACrC,OAAI2S,GACFD,EAAS5B,GAAG6B,QACZD,EAAS7B,qBAGyC,SAAhDrJ,GAAYQ,iBAAiBxD,KAAM,UACrCkO,EAASrpB,YACTqpB,EAAS7B,sBAGX6B,EAAS/H,YACT+H,EAAS7B,oBACX,IACA9L,GAAac,GAAGzhB,OAAQ0qB,IAAuB,KAC7C,MAAM8D,EAAYvI,GAAe1T,KA5TR,6BA6TzB,IAAK,MAAM+b,KAAYE,EACrB9C,GAAShG,oBAAoB4I,EAC/B,IAOF/R,GAAmBmP,IAcnB,MAEM+C,GAAc,eAEdC,GAAe,OAAOD,KACtBE,GAAgB,QAAQF,KACxBG,GAAe,OAAOH,KACtBI,GAAiB,SAASJ,KAC1BK,GAAyB,QAAQL,cACjCM,GAAoB,OACpBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA6B,WAAWF,OAAwBA,KAKhEG,GAAyB,8BACzBC,GAAY,CAChBvqB,OAAQ,KACRkjB,QAAQ,GAEJsH,GAAgB,CACpBxqB,OAAQ,iBACRkjB,OAAQ,WAOV,MAAMuH,WAAiBxK,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmP,kBAAmB,EACxBnP,KAAKoP,cAAgB,GACrB,MAAMC,EAAaxJ,GAAe1T,KAAK4c,IACvC,IAAK,MAAMO,KAAQD,EAAY,CAC7B,MAAMtV,EAAW8L,GAAea,uBAAuB4I,GACjDC,EAAgB1J,GAAe1T,KAAK4H,GAAU5T,QAAOqpB,GAAgBA,IAAiBxP,KAAK4E,WAChF,OAAb7K,GAAqBwV,EAAc7e,QACrCsP,KAAKoP,cAAcxd,KAAK0d,EAE5B,CACAtP,KAAKyP,sBACAzP,KAAK6E,QAAQpgB,QAChBub,KAAK0P,0BAA0B1P,KAAKoP,cAAepP,KAAK2P,YAEtD3P,KAAK6E,QAAQ8C,QACf3H,KAAK2H,QAET,CAGA,kBAAWjE,GACT,OAAOsL,EACT,CACA,sBAAWrL,GACT,OAAOsL,EACT,CACA,eAAW1S,GACT,MA9DW,UA+Db,CAGA,MAAAoL,GACM3H,KAAK2P,WACP3P,KAAK4P,OAEL5P,KAAK6P,MAET,CACA,IAAAA,GACE,GAAI7P,KAAKmP,kBAAoBnP,KAAK2P,WAChC,OAEF,IAAIG,EAAiB,GAQrB,GALI9P,KAAK6E,QAAQpgB,SACfqrB,EAAiB9P,KAAK+P,uBAhEH,wCAgE4C5pB,QAAO5G,GAAWA,IAAYygB,KAAK4E,WAAU9hB,KAAIvD,GAAW2vB,GAAS5J,oBAAoB/lB,EAAS,CAC/JooB,QAAQ,OAGRmI,EAAepf,QAAUof,EAAe,GAAGX,iBAC7C,OAGF,GADmB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU0J,IACxCtM,iBACb,OAEF,IAAK,MAAMgO,KAAkBF,EAC3BE,EAAeJ,OAEjB,MAAMK,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAASvJ,UAAU1B,OAAOiV,IAC/B5O,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,EACjCjQ,KAAK0P,0BAA0B1P,KAAKoP,eAAe,GACnDpP,KAAKmP,kBAAmB,EACxB,MAQMgB,EAAa,SADUF,EAAU,GAAGxL,cAAgBwL,EAAU7d,MAAM,KAE1E4N,KAAKmF,gBATY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,GAAqBD,IACjD3O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjC1P,GAAaqB,QAAQ5B,KAAK4E,SAAU2J,GAAc,GAItBvO,KAAK4E,UAAU,GAC7C5E,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASuL,MACpD,CACA,IAAAP,GACE,GAAI5P,KAAKmP,mBAAqBnP,KAAK2P,WACjC,OAGF,GADmBpP,GAAaqB,QAAQ5B,KAAK4E,SAAU4J,IACxCxM,iBACb,OAEF,MAAMiO,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASthB,wBAAwB2sB,OAC1EpU,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAASvJ,UAAU1B,OAAOiV,GAAqBD,IACpD,IAAK,MAAM/M,KAAW5B,KAAKoP,cAAe,CACxC,MAAM7vB,EAAUsmB,GAAec,uBAAuB/E,GAClDriB,IAAYygB,KAAK2P,SAASpwB,IAC5BygB,KAAK0P,0BAA0B,CAAC9N,IAAU,EAE9C,CACA5B,KAAKmP,kBAAmB,EAOxBnP,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjCjQ,KAAKmF,gBAPY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,IAC5BrO,GAAaqB,QAAQ5B,KAAK4E,SAAU6J,GAAe,GAGvBzO,KAAK4E,UAAU,EAC/C,CACA,QAAA+K,CAASpwB,EAAUygB,KAAK4E,UACtB,OAAOrlB,EAAQ8b,UAAU7W,SAASmqB,GACpC,CAGA,iBAAA3K,CAAkBF,GAGhB,OAFAA,EAAO6D,OAAS7G,QAAQgD,EAAO6D,QAC/B7D,EAAOrf,OAASiW,GAAWoJ,EAAOrf,QAC3Bqf,CACT,CACA,aAAAoM,GACE,OAAOlQ,KAAK4E,SAASvJ,UAAU7W,SA3IL,uBAChB,QACC,QA0Ib,CACA,mBAAAirB,GACE,IAAKzP,KAAK6E,QAAQpgB,OAChB,OAEF,MAAMshB,EAAW/F,KAAK+P,uBAAuBhB,IAC7C,IAAK,MAAMxvB,KAAWwmB,EAAU,CAC9B,MAAMqK,EAAWvK,GAAec,uBAAuBpnB,GACnD6wB,GACFpQ,KAAK0P,0BAA0B,CAACnwB,GAAUygB,KAAK2P,SAASS,GAE5D,CACF,CACA,sBAAAL,CAAuBhW,GACrB,MAAMgM,EAAWF,GAAe1T,KAAK2c,GAA4B9O,KAAK6E,QAAQpgB,QAE9E,OAAOohB,GAAe1T,KAAK4H,EAAUiG,KAAK6E,QAAQpgB,QAAQ0B,QAAO5G,IAAYwmB,EAAS3E,SAAS7hB,IACjG,CACA,yBAAAmwB,CAA0BW,EAAcC,GACtC,GAAKD,EAAa3f,OAGlB,IAAK,MAAMnR,KAAW8wB,EACpB9wB,EAAQ8b,UAAUsM,OArKK,aAqKyB2I,GAChD/wB,EAAQ6B,aAAa,gBAAiBkvB,EAE1C,CAGA,sBAAO7T,CAAgBqH,GACrB,MAAMe,EAAU,CAAC,EAIjB,MAHsB,iBAAXf,GAAuB,YAAYzgB,KAAKygB,KACjDe,EAAQ8C,QAAS,GAEZ3H,KAAKwH,MAAK,WACf,MAAMnd,EAAO6kB,GAAS5J,oBAAoBtF,KAAM6E,GAChD,GAAsB,iBAAXf,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,CACF,GACF,EAOFvD,GAAac,GAAGhc,SAAUqpB,GAAwBK,IAAwB,SAAU3P,IAErD,MAAzBA,EAAM7S,OAAO0a,SAAmB7H,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAekH,UAC/E7H,EAAMkD,iBAER,IAAK,MAAM/iB,KAAWsmB,GAAee,gCAAgC5G,MACnEkP,GAAS5J,oBAAoB/lB,EAAS,CACpCooB,QAAQ,IACPA,QAEP,IAMAxL,GAAmB+S,IAcnB,MAAMqB,GAAS,WAETC,GAAc,eACdC,GAAiB,YAGjBC,GAAiB,UACjBC,GAAmB,YAGnBC,GAAe,OAAOJ,KACtBK,GAAiB,SAASL,KAC1BM,GAAe,OAAON,KACtBO,GAAgB,QAAQP,KACxBQ,GAAyB,QAAQR,KAAcC,KAC/CQ,GAAyB,UAAUT,KAAcC,KACjDS,GAAuB,QAAQV,KAAcC,KAC7CU,GAAoB,OAMpBC,GAAyB,4DACzBC,GAA6B,GAAGD,MAA0BD,KAC1DG,GAAgB,iBAIhBC,GAAgBtV,KAAU,UAAY,YACtCuV,GAAmBvV,KAAU,YAAc,UAC3CwV,GAAmBxV,KAAU,aAAe,eAC5CyV,GAAsBzV,KAAU,eAAiB,aACjD0V,GAAkB1V,KAAU,aAAe,cAC3C2V,GAAiB3V,KAAU,cAAgB,aAG3C4V,GAAY,CAChBC,WAAW,EACX7jB,SAAU,kBACV8jB,QAAS,UACT/pB,OAAQ,CAAC,EAAG,GACZgqB,aAAc,KACd1zB,UAAW,UAEP2zB,GAAgB,CACpBH,UAAW,mBACX7jB,SAAU,mBACV8jB,QAAS,SACT/pB,OAAQ,0BACRgqB,aAAc,yBACd1zB,UAAW,2BAOb,MAAM4zB,WAAiBxN,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmS,QAAU,KACfnS,KAAKoS,QAAUpS,KAAK4E,SAAS7f,WAE7Bib,KAAKqS,MAAQxM,GAAehhB,KAAKmb,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeM,KAAKnG,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeC,QAAQwL,GAAetR,KAAKoS,SACxKpS,KAAKsS,UAAYtS,KAAKuS,eACxB,CAGA,kBAAW7O,GACT,OAAOmO,EACT,CACA,sBAAWlO,GACT,OAAOsO,EACT,CACA,eAAW1V,GACT,OAAOgU,EACT,CAGA,MAAA5I,GACE,OAAO3H,KAAK2P,WAAa3P,KAAK4P,OAAS5P,KAAK6P,MAC9C,CACA,IAAAA,GACE,GAAI3U,GAAW8E,KAAK4E,WAAa5E,KAAK2P,WACpC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAGtB,IADkBrE,GAAaqB,QAAQ5B,KAAK4E,SAAUkM,GAAchR,GACtDkC,iBAAd,CASA,GANAhC,KAAKwS,gBAMD,iBAAkBntB,SAASC,kBAAoB0a,KAAKoS,QAAQpX,QAzExC,eA0EtB,IAAK,MAAMzb,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAG1CoE,KAAK4E,SAAS6N,QACdzS,KAAK4E,SAASxjB,aAAa,iBAAiB,GAC5C4e,KAAKqS,MAAMhX,UAAU5E,IAAI0a,IACzBnR,KAAK4E,SAASvJ,UAAU5E,IAAI0a,IAC5B5Q,GAAaqB,QAAQ5B,KAAK4E,SAAUmM,GAAejR,EAhBnD,CAiBF,CACA,IAAA8P,GACE,GAAI1U,GAAW8E,KAAK4E,YAAc5E,KAAK2P,WACrC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAEtB5E,KAAK0S,cAAc5S,EACrB,CACA,OAAAiF,GACM/E,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEf2L,MAAMI,SACR,CACA,MAAAha,GACEiV,KAAKsS,UAAYtS,KAAKuS,gBAClBvS,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,aAAA2nB,CAAc5S,GAEZ,IADkBS,GAAaqB,QAAQ5B,KAAK4E,SAAUgM,GAAc9Q,GACtDkC,iBAAd,CAMA,GAAI,iBAAkB3c,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAGvCoE,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEfgH,KAAKqS,MAAMhX,UAAU1B,OAAOwX,IAC5BnR,KAAK4E,SAASvJ,UAAU1B,OAAOwX,IAC/BnR,KAAK4E,SAASxjB,aAAa,gBAAiB,SAC5C4hB,GAAYE,oBAAoBlD,KAAKqS,MAAO,UAC5C9R,GAAaqB,QAAQ5B,KAAK4E,SAAUiM,GAAgB/Q,EAhBpD,CAiBF,CACA,UAAA+D,CAAWC,GAET,GAAgC,iBADhCA,EAASa,MAAMd,WAAWC,IACRxlB,YAA2B,GAAUwlB,EAAOxlB,YAAgE,mBAA3CwlB,EAAOxlB,UAAUgF,sBAElG,MAAM,IAAIkhB,UAAU,GAAG+L,GAAO9L,+GAEhC,OAAOX,CACT,CACA,aAAA0O,GACE,QAAsB,IAAX,EACT,MAAM,IAAIhO,UAAU,gEAEtB,IAAImO,EAAmB3S,KAAK4E,SACG,WAA3B5E,KAAK6E,QAAQvmB,UACfq0B,EAAmB3S,KAAKoS,QACf,GAAUpS,KAAK6E,QAAQvmB,WAChCq0B,EAAmBjY,GAAWsF,KAAK6E,QAAQvmB,WACA,iBAA3B0hB,KAAK6E,QAAQvmB,YAC7Bq0B,EAAmB3S,KAAK6E,QAAQvmB,WAElC,MAAM0zB,EAAehS,KAAK4S,mBAC1B5S,KAAKmS,QAAU,GAAoBQ,EAAkB3S,KAAKqS,MAAOL,EACnE,CACA,QAAArC,GACE,OAAO3P,KAAKqS,MAAMhX,UAAU7W,SAAS2sB,GACvC,CACA,aAAA0B,GACE,MAAMC,EAAiB9S,KAAKoS,QAC5B,GAAIU,EAAezX,UAAU7W,SArKN,WAsKrB,OAAOmtB,GAET,GAAImB,EAAezX,UAAU7W,SAvKJ,aAwKvB,OAAOotB,GAET,GAAIkB,EAAezX,UAAU7W,SAzKA,iBA0K3B,MA5JsB,MA8JxB,GAAIsuB,EAAezX,UAAU7W,SA3KE,mBA4K7B,MA9JyB,SAkK3B,MAAMuuB,EAAkF,QAA1E9tB,iBAAiB+a,KAAKqS,OAAOvX,iBAAiB,iBAAiB6K,OAC7E,OAAImN,EAAezX,UAAU7W,SArLP,UAsLbuuB,EAAQvB,GAAmBD,GAE7BwB,EAAQrB,GAAsBD,EACvC,CACA,aAAAc,GACE,OAAkD,OAA3CvS,KAAK4E,SAAS5J,QAnLD,UAoLtB,CACA,UAAAgY,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,gBAAA4qB,GACE,MAAMM,EAAwB,CAC5Bx0B,UAAWshB,KAAK6S,gBAChBzc,UAAW,CAAC,CACV9V,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,iBAanB,OAPIhT,KAAKsS,WAAsC,WAAzBtS,KAAK6E,QAAQkN,WACjC/O,GAAYC,iBAAiBjD,KAAKqS,MAAO,SAAU,UACnDa,EAAsB9c,UAAY,CAAC,CACjC9V,KAAM,cACNC,SAAS,KAGN,IACF2yB,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,eAAAC,EAAgB,IACdr2B,EAAG,OACHyP,IAEA,MAAMggB,EAAQ1G,GAAe1T,KAhOF,8DAgO+B6N,KAAKqS,OAAOlsB,QAAO5G,GAAWob,GAAUpb,KAC7FgtB,EAAM7b,QAMXoN,GAAqByO,EAAOhgB,EAAQzP,IAAQ6zB,IAAmBpE,EAAMnL,SAAS7U,IAASkmB,OACzF,CAGA,sBAAOhW,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6nB,GAAS5M,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,CACA,iBAAOsP,CAAWhU,GAChB,GA5QuB,IA4QnBA,EAAMwI,QAAgD,UAAfxI,EAAMqB,MA/QnC,QA+QuDrB,EAAMtiB,IACzE,OAEF,MAAMu2B,EAAcxN,GAAe1T,KAAKkf,IACxC,IAAK,MAAM1J,KAAU0L,EAAa,CAChC,MAAMC,EAAUpB,GAAS7M,YAAYsC,GACrC,IAAK2L,IAAyC,IAA9BA,EAAQzO,QAAQiN,UAC9B,SAEF,MAAMyB,EAAenU,EAAMmU,eACrBC,EAAeD,EAAanS,SAASkS,EAAQjB,OACnD,GAAIkB,EAAanS,SAASkS,EAAQ1O,WAA2C,WAA9B0O,EAAQzO,QAAQiN,YAA2B0B,GAA8C,YAA9BF,EAAQzO,QAAQiN,WAA2B0B,EACnJ,SAIF,GAAIF,EAAQjB,MAAM7tB,SAAS4a,EAAM7S,UAA2B,UAAf6S,EAAMqB,MA/RvC,QA+R2DrB,EAAMtiB,KAAqB,qCAAqCuG,KAAK+b,EAAM7S,OAAO0a,UACvJ,SAEF,MAAMnH,EAAgB,CACpBA,cAAewT,EAAQ1O,UAEN,UAAfxF,EAAMqB,OACRX,EAAckH,WAAa5H,GAE7BkU,EAAQZ,cAAc5S,EACxB,CACF,CACA,4BAAO2T,CAAsBrU,GAI3B,MAAMsU,EAAU,kBAAkBrwB,KAAK+b,EAAM7S,OAAO0a,SAC9C0M,EAjTW,WAiTKvU,EAAMtiB,IACtB82B,EAAkB,CAAClD,GAAgBC,IAAkBvP,SAAShC,EAAMtiB,KAC1E,IAAK82B,IAAoBD,EACvB,OAEF,GAAID,IAAYC,EACd,OAEFvU,EAAMkD,iBAGN,MAAMuR,EAAkB7T,KAAKgG,QAAQoL,IAA0BpR,KAAO6F,GAAeM,KAAKnG,KAAMoR,IAAwB,IAAMvL,GAAehhB,KAAKmb,KAAMoR,IAAwB,IAAMvL,GAAeC,QAAQsL,GAAwBhS,EAAMW,eAAehb,YACpPwF,EAAW2nB,GAAS5M,oBAAoBuO,GAC9C,GAAID,EAIF,OAHAxU,EAAM0U,kBACNvpB,EAASslB,YACTtlB,EAAS4oB,gBAAgB/T,GAGvB7U,EAASolB,aAEXvQ,EAAM0U,kBACNvpB,EAASqlB,OACTiE,EAAgBpB,QAEpB,EAOFlS,GAAac,GAAGhc,SAAU4rB,GAAwBG,GAAwBc,GAASuB,uBACnFlT,GAAac,GAAGhc,SAAU4rB,GAAwBK,GAAeY,GAASuB,uBAC1ElT,GAAac,GAAGhc,SAAU2rB,GAAwBkB,GAASkB,YAC3D7S,GAAac,GAAGhc,SAAU6rB,GAAsBgB,GAASkB,YACzD7S,GAAac,GAAGhc,SAAU2rB,GAAwBI,IAAwB,SAAUhS,GAClFA,EAAMkD,iBACN4P,GAAS5M,oBAAoBtF,MAAM2H,QACrC,IAMAxL,GAAmB+V,IAcnB,MAAM6B,GAAS,WAETC,GAAoB,OACpBC,GAAkB,gBAAgBF,KAClCG,GAAY,CAChBC,UAAW,iBACXC,cAAe,KACfhP,YAAY,EACZzK,WAAW,EAEX0Z,YAAa,QAETC,GAAgB,CACpBH,UAAW,SACXC,cAAe,kBACfhP,WAAY,UACZzK,UAAW,UACX0Z,YAAa,oBAOf,MAAME,WAAiB9Q,GACrB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwU,aAAc,EACnBxU,KAAK4E,SAAW,IAClB,CAGA,kBAAWlB,GACT,OAAOwQ,EACT,CACA,sBAAWvQ,GACT,OAAO2Q,EACT,CACA,eAAW/X,GACT,OAAOwX,EACT,CAGA,IAAAlE,CAAKxT,GACH,IAAK2D,KAAK6E,QAAQlK,UAEhB,YADAkC,GAAQR,GAGV2D,KAAKyU,UACL,MAAMl1B,EAAUygB,KAAK0U,cACjB1U,KAAK6E,QAAQO,YACfvJ,GAAOtc,GAETA,EAAQ8b,UAAU5E,IAAIud,IACtBhU,KAAK2U,mBAAkB,KACrB9X,GAAQR,EAAS,GAErB,CACA,IAAAuT,CAAKvT,GACE2D,KAAK6E,QAAQlK,WAIlBqF,KAAK0U,cAAcrZ,UAAU1B,OAAOqa,IACpChU,KAAK2U,mBAAkB,KACrB3U,KAAK+E,UACLlI,GAAQR,EAAS,KANjBQ,GAAQR,EAQZ,CACA,OAAA0I,GACO/E,KAAKwU,cAGVjU,GAAaC,IAAIR,KAAK4E,SAAUqP,IAChCjU,KAAK4E,SAASjL,SACdqG,KAAKwU,aAAc,EACrB,CAGA,WAAAE,GACE,IAAK1U,KAAK4E,SAAU,CAClB,MAAMgQ,EAAWvvB,SAASwvB,cAAc,OACxCD,EAAST,UAAYnU,KAAK6E,QAAQsP,UAC9BnU,KAAK6E,QAAQO,YACfwP,EAASvZ,UAAU5E,IApFD,QAsFpBuJ,KAAK4E,SAAWgQ,CAClB,CACA,OAAO5U,KAAK4E,QACd,CACA,iBAAAZ,CAAkBF,GAGhB,OADAA,EAAOuQ,YAAc3Z,GAAWoJ,EAAOuQ,aAChCvQ,CACT,CACA,OAAA2Q,GACE,GAAIzU,KAAKwU,YACP,OAEF,MAAMj1B,EAAUygB,KAAK0U,cACrB1U,KAAK6E,QAAQwP,YAAYS,OAAOv1B,GAChCghB,GAAac,GAAG9hB,EAAS00B,IAAiB,KACxCpX,GAAQmD,KAAK6E,QAAQuP,cAAc,IAErCpU,KAAKwU,aAAc,CACrB,CACA,iBAAAG,CAAkBtY,GAChBW,GAAuBX,EAAU2D,KAAK0U,cAAe1U,KAAK6E,QAAQO,WACpE,EAeF,MAEM2P,GAAc,gBACdC,GAAkB,UAAUD,KAC5BE,GAAoB,cAAcF,KAGlCG,GAAmB,WACnBC,GAAY,CAChBC,WAAW,EACXC,YAAa,MAETC,GAAgB,CACpBF,UAAW,UACXC,YAAa,WAOf,MAAME,WAAkB9R,GACtB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwV,WAAY,EACjBxV,KAAKyV,qBAAuB,IAC9B,CAGA,kBAAW/R,GACT,OAAOyR,EACT,CACA,sBAAWxR,GACT,OAAO2R,EACT,CACA,eAAW/Y,GACT,MArCW,WAsCb,CAGA,QAAAmZ,GACM1V,KAAKwV,YAGLxV,KAAK6E,QAAQuQ,WACfpV,KAAK6E,QAAQwQ,YAAY5C,QAE3BlS,GAAaC,IAAInb,SAAU0vB,IAC3BxU,GAAac,GAAGhc,SAAU2vB,IAAiB5V,GAASY,KAAK2V,eAAevW,KACxEmB,GAAac,GAAGhc,SAAU4vB,IAAmB7V,GAASY,KAAK4V,eAAexW,KAC1EY,KAAKwV,WAAY,EACnB,CACA,UAAAK,GACO7V,KAAKwV,YAGVxV,KAAKwV,WAAY,EACjBjV,GAAaC,IAAInb,SAAU0vB,IAC7B,CAGA,cAAAY,CAAevW,GACb,MAAM,YACJiW,GACErV,KAAK6E,QACT,GAAIzF,EAAM7S,SAAWlH,UAAY+Z,EAAM7S,SAAW8oB,GAAeA,EAAY7wB,SAAS4a,EAAM7S,QAC1F,OAEF,MAAM1L,EAAWglB,GAAeU,kBAAkB8O,GAC1B,IAApBx0B,EAAS6P,OACX2kB,EAAY5C,QACHzS,KAAKyV,uBAAyBP,GACvCr0B,EAASA,EAAS6P,OAAS,GAAG+hB,QAE9B5xB,EAAS,GAAG4xB,OAEhB,CACA,cAAAmD,CAAexW,GAzED,QA0ERA,EAAMtiB,MAGVkjB,KAAKyV,qBAAuBrW,EAAM0W,SAAWZ,GA5EzB,UA6EtB,EAeF,MAAMa,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAMxB,MAAMC,GACJ,WAAAhS,GACEnE,KAAK4E,SAAWvf,SAAS6G,IAC3B,CAGA,QAAAkqB,GAEE,MAAMC,EAAgBhxB,SAASC,gBAAgBuC,YAC/C,OAAO1F,KAAKoC,IAAI3E,OAAO02B,WAAaD,EACtC,CACA,IAAAzG,GACE,MAAM/rB,EAAQmc,KAAKoW,WACnBpW,KAAKuW,mBAELvW,KAAKwW,sBAAsBxW,KAAK4E,SAAUqR,IAAkBQ,GAAmBA,EAAkB5yB,IAEjGmc,KAAKwW,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkB5yB,IAC1Gmc,KAAKwW,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkB5yB,GAC5G,CACA,KAAAwO,GACE2N,KAAK0W,wBAAwB1W,KAAK4E,SAAU,YAC5C5E,KAAK0W,wBAAwB1W,KAAK4E,SAAUqR,IAC5CjW,KAAK0W,wBAAwBX,GAAwBE,IACrDjW,KAAK0W,wBAAwBV,GAAyBE,GACxD,CACA,aAAAS,GACE,OAAO3W,KAAKoW,WAAa,CAC3B,CAGA,gBAAAG,GACEvW,KAAK4W,sBAAsB5W,KAAK4E,SAAU,YAC1C5E,KAAK4E,SAAS7jB,MAAM+K,SAAW,QACjC,CACA,qBAAA0qB,CAAsBzc,EAAU8c,EAAexa,GAC7C,MAAMya,EAAiB9W,KAAKoW,WAS5BpW,KAAK+W,2BAA2Bhd,GARHxa,IAC3B,GAAIA,IAAYygB,KAAK4E,UAAYhlB,OAAO02B,WAAa/2B,EAAQsI,YAAcivB,EACzE,OAEF9W,KAAK4W,sBAAsBr3B,EAASs3B,GACpC,MAAMJ,EAAkB72B,OAAOqF,iBAAiB1F,GAASub,iBAAiB+b,GAC1Et3B,EAAQwB,MAAMi2B,YAAYH,EAAe,GAAGxa,EAASkB,OAAOC,WAAWiZ,QAAsB,GAGjG,CACA,qBAAAG,CAAsBr3B,EAASs3B,GAC7B,MAAMI,EAAc13B,EAAQwB,MAAM+Z,iBAAiB+b,GAC/CI,GACFjU,GAAYC,iBAAiB1jB,EAASs3B,EAAeI,EAEzD,CACA,uBAAAP,CAAwB3c,EAAU8c,GAWhC7W,KAAK+W,2BAA2Bhd,GAVHxa,IAC3B,MAAM5B,EAAQqlB,GAAYQ,iBAAiBjkB,EAASs3B,GAEtC,OAAVl5B,GAIJqlB,GAAYE,oBAAoB3jB,EAASs3B,GACzCt3B,EAAQwB,MAAMi2B,YAAYH,EAAel5B,IAJvC4B,EAAQwB,MAAMm2B,eAAeL,EAIgB,GAGnD,CACA,0BAAAE,CAA2Bhd,EAAUod,GACnC,GAAI,GAAUpd,GACZod,EAASpd,QAGX,IAAK,MAAM6L,KAAOC,GAAe1T,KAAK4H,EAAUiG,KAAK4E,UACnDuS,EAASvR,EAEb,EAeF,MAEMwR,GAAc,YAGdC,GAAe,OAAOD,KACtBE,GAAyB,gBAAgBF,KACzCG,GAAiB,SAASH,KAC1BI,GAAe,OAAOJ,KACtBK,GAAgB,QAAQL,KACxBM,GAAiB,SAASN,KAC1BO,GAAsB,gBAAgBP,KACtCQ,GAA0B,oBAAoBR,KAC9CS,GAA0B,kBAAkBT,KAC5CU,GAAyB,QAAQV,cACjCW,GAAkB,aAElBC,GAAoB,OACpBC,GAAoB,eAKpBC,GAAY,CAChBtD,UAAU,EACVnC,OAAO,EACPzH,UAAU,GAENmN,GAAgB,CACpBvD,SAAU,mBACVnC,MAAO,UACPzH,SAAU,WAOZ,MAAMoN,WAAc1T,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKqY,QAAUxS,GAAeC,QArBV,gBAqBmC9F,KAAK4E,UAC5D5E,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAa,IAAIvC,GACtBnW,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAOwU,EACT,CACA,sBAAWvU,GACT,OAAOwU,EACT,CACA,eAAW5b,GACT,MA1DW,OA2Db,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAAY3P,KAAKmP,kBAGR5O,GAAaqB,QAAQ5B,KAAK4E,SAAU4S,GAAc,CAClE1X,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAW9I,OAChBvqB,SAAS6G,KAAKmP,UAAU5E,IAAIshB,IAC5B/X,KAAK2Y,gBACL3Y,KAAKsY,UAAUzI,MAAK,IAAM7P,KAAK4Y,aAAa9Y,KAC9C,CACA,IAAA8P,GACO5P,KAAK2P,WAAY3P,KAAKmP,mBAGT5O,GAAaqB,QAAQ5B,KAAK4E,SAAUyS,IACxCrV,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASvJ,UAAU1B,OAAOqe,IAC/BhY,KAAKmF,gBAAe,IAAMnF,KAAK6Y,cAAc7Y,KAAK4E,SAAU5E,KAAKgO,gBACnE,CACA,OAAAjJ,GACExE,GAAaC,IAAI5gB,OAAQw3B,IACzB7W,GAAaC,IAAIR,KAAKqY,QAASjB,IAC/BpX,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CACA,YAAA+T,GACE9Y,KAAK2Y,eACP,CAGA,mBAAAJ,GACE,OAAO,IAAIhE,GAAS,CAClB5Z,UAAWmG,QAAQd,KAAK6E,QAAQ+P,UAEhCxP,WAAYpF,KAAKgO,eAErB,CACA,oBAAAyK,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,YAAAgU,CAAa9Y,GAENza,SAAS6G,KAAK1H,SAASwb,KAAK4E,WAC/Bvf,SAAS6G,KAAK4oB,OAAO9U,KAAK4E,UAE5B5E,KAAK4E,SAAS7jB,MAAMgxB,QAAU,QAC9B/R,KAAK4E,SAASzjB,gBAAgB,eAC9B6e,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASnZ,UAAY,EAC1B,MAAMstB,EAAYlT,GAAeC,QA7GT,cA6GsC9F,KAAKqY,SAC/DU,IACFA,EAAUttB,UAAY,GAExBoQ,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIuhB,IAU5BhY,KAAKmF,gBATsB,KACrBnF,KAAK6E,QAAQ4N,OACfzS,KAAKwY,WAAW9C,WAElB1V,KAAKmP,kBAAmB,EACxB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU6S,GAAe,CACjD3X,iBACA,GAEoCE,KAAKqY,QAASrY,KAAKgO,cAC7D,CACA,kBAAAnC,GACEtL,GAAac,GAAGrB,KAAK4E,SAAUiT,IAAyBzY,IAhJvC,WAiJXA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGP5P,KAAKgZ,6BAA4B,IAEnCzY,GAAac,GAAGzhB,OAAQ83B,IAAgB,KAClC1X,KAAK2P,WAAa3P,KAAKmP,kBACzBnP,KAAK2Y,eACP,IAEFpY,GAAac,GAAGrB,KAAK4E,SAAUgT,IAAyBxY,IAEtDmB,GAAae,IAAItB,KAAK4E,SAAU+S,IAAqBsB,IAC/CjZ,KAAK4E,WAAaxF,EAAM7S,QAAUyT,KAAK4E,WAAaqU,EAAO1sB,SAGjC,WAA1ByT,KAAK6E,QAAQ+P,SAIb5U,KAAK6E,QAAQ+P,UACf5U,KAAK4P,OAJL5P,KAAKgZ,6BAKP,GACA,GAEN,CACA,UAAAH,GACE7Y,KAAK4E,SAAS7jB,MAAMgxB,QAAU,OAC9B/R,KAAK4E,SAASxjB,aAAa,eAAe,GAC1C4e,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QAC9B6e,KAAKmP,kBAAmB,EACxBnP,KAAKsY,UAAU1I,MAAK,KAClBvqB,SAAS6G,KAAKmP,UAAU1B,OAAOoe,IAC/B/X,KAAKkZ,oBACLlZ,KAAK0Y,WAAWrmB,QAChBkO,GAAaqB,QAAQ5B,KAAK4E,SAAU2S,GAAe,GAEvD,CACA,WAAAvJ,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAjLT,OAkLxB,CACA,0BAAAw0B,GAEE,GADkBzY,GAAaqB,QAAQ5B,KAAK4E,SAAU0S,IACxCtV,iBACZ,OAEF,MAAMmX,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EwxB,EAAmBpZ,KAAK4E,SAAS7jB,MAAMiL,UAEpB,WAArBotB,GAAiCpZ,KAAK4E,SAASvJ,UAAU7W,SAASyzB,MAGjEkB,IACHnZ,KAAK4E,SAAS7jB,MAAMiL,UAAY,UAElCgU,KAAK4E,SAASvJ,UAAU5E,IAAIwhB,IAC5BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAASvJ,UAAU1B,OAAOse,IAC/BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAAS7jB,MAAMiL,UAAYotB,CAAgB,GAC/CpZ,KAAKqY,QAAQ,GACfrY,KAAKqY,SACRrY,KAAK4E,SAAS6N,QAChB,CAMA,aAAAkG,GACE,MAAMQ,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EkvB,EAAiB9W,KAAK0Y,WAAWtC,WACjCiD,EAAoBvC,EAAiB,EAC3C,GAAIuC,IAAsBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,cAAgB,eAC3C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACA,IAAKuC,GAAqBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,eAAiB,cAC5C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACF,CACA,iBAAAoC,GACElZ,KAAK4E,SAAS7jB,MAAMu4B,YAAc,GAClCtZ,KAAK4E,SAAS7jB,MAAMw4B,aAAe,EACrC,CAGA,sBAAO9c,CAAgBqH,EAAQhE,GAC7B,OAAOE,KAAKwH,MAAK,WACf,MAAMnd,EAAO+tB,GAAM9S,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQhE,EAJb,CAKF,GACF,EAOFS,GAAac,GAAGhc,SAAUyyB,GA9OK,4BA8O2C,SAAU1Y,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACjD,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAER/B,GAAae,IAAI/U,EAAQirB,IAAcgC,IACjCA,EAAUxX,kBAIdzB,GAAae,IAAI/U,EAAQgrB,IAAgB,KACnC5c,GAAUqF,OACZA,KAAKyS,OACP,GACA,IAIJ,MAAMgH,EAAc5T,GAAeC,QAnQb,eAoQlB2T,GACFrB,GAAM/S,YAAYoU,GAAa7J,OAEpBwI,GAAM9S,oBAAoB/Y,GAClCob,OAAO3H,KACd,IACA6G,GAAqBuR,IAMrBjc,GAAmBic,IAcnB,MAEMsB,GAAc,gBACdC,GAAiB,YACjBC,GAAwB,OAAOF,KAAcC,KAE7CE,GAAoB,OACpBC,GAAuB,UACvBC,GAAoB,SAEpBC,GAAgB,kBAChBC,GAAe,OAAOP,KACtBQ,GAAgB,QAAQR,KACxBS,GAAe,OAAOT,KACtBU,GAAuB,gBAAgBV,KACvCW,GAAiB,SAASX,KAC1BY,GAAe,SAASZ,KACxBa,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAwB,kBAAkBd,KAE1Ce,GAAY,CAChB7F,UAAU,EACV5J,UAAU,EACVvgB,QAAQ,GAEJiwB,GAAgB,CACpB9F,SAAU,mBACV5J,SAAU,UACVvgB,OAAQ,WAOV,MAAMkwB,WAAkBjW,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAO+W,EACT,CACA,sBAAW9W,GACT,OAAO+W,EACT,CACA,eAAWne,GACT,MApDW,WAqDb,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAGSpP,GAAaqB,QAAQ5B,KAAK4E,SAAUqV,GAAc,CAClEna,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAUzI,OACV7P,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkBvG,OAExB5P,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASvJ,UAAU5E,IAAIqjB,IAW5B9Z,KAAKmF,gBAVoB,KAClBnF,KAAK6E,QAAQpa,SAAUuV,KAAK6E,QAAQ+P,UACvC5U,KAAKwY,WAAW9C,WAElB1V,KAAK4E,SAASvJ,UAAU5E,IAAIojB,IAC5B7Z,KAAK4E,SAASvJ,UAAU1B,OAAOmgB,IAC/BvZ,GAAaqB,QAAQ5B,KAAK4E,SAAUsV,GAAe,CACjDpa,iBACA,GAEkCE,KAAK4E,UAAU,GACvD,CACA,IAAAgL,GACO5P,KAAK2P,WAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAUuV,IACxCnY,mBAGdhC,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASgW,OACd5a,KAAK2P,UAAW,EAChB3P,KAAK4E,SAASvJ,UAAU5E,IAAIsjB,IAC5B/Z,KAAKsY,UAAU1I,OAUf5P,KAAKmF,gBAToB,KACvBnF,KAAK4E,SAASvJ,UAAU1B,OAAOkgB,GAAmBE,IAClD/Z,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QACzB6e,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkB9jB,QAExBkO,GAAaqB,QAAQ5B,KAAK4E,SAAUyV,GAAe,GAEfra,KAAK4E,UAAU,IACvD,CACA,OAAAG,GACE/E,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CAGA,mBAAAwT,GACE,MASM5d,EAAYmG,QAAQd,KAAK6E,QAAQ+P,UACvC,OAAO,IAAIL,GAAS,CAClBJ,UA3HsB,qBA4HtBxZ,YACAyK,YAAY,EACZiP,YAAarU,KAAK4E,SAAS7f,WAC3BqvB,cAAezZ,EAfK,KACU,WAA1BqF,KAAK6E,QAAQ+P,SAIjB5U,KAAK4P,OAHHrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,GAG3B,EAUgC,MAE/C,CACA,oBAAA3B,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,kBAAAiH,GACEtL,GAAac,GAAGrB,KAAK4E,SAAU4V,IAAuBpb,IA5IvC,WA6ITA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGPrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,IAAqB,GAE7D,CAGA,sBAAO3d,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOswB,GAAUrV,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOFO,GAAac,GAAGhc,SAAUk1B,GA7JK,gCA6J2C,SAAUnb,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MAIrD,GAHI,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEFO,GAAae,IAAI/U,EAAQ8tB,IAAgB,KAEnC1f,GAAUqF,OACZA,KAAKyS,OACP,IAIF,MAAMgH,EAAc5T,GAAeC,QAAQkU,IACvCP,GAAeA,IAAgBltB,GACjCouB,GAAUtV,YAAYoU,GAAa7J,OAExB+K,GAAUrV,oBAAoB/Y,GACtCob,OAAO3H,KACd,IACAO,GAAac,GAAGzhB,OAAQg6B,IAAuB,KAC7C,IAAK,MAAM7f,KAAY8L,GAAe1T,KAAK6nB,IACzCW,GAAUrV,oBAAoBvL,GAAU8V,MAC1C,IAEFtP,GAAac,GAAGzhB,OAAQ06B,IAAc,KACpC,IAAK,MAAM/6B,KAAWsmB,GAAe1T,KAAK,gDACG,UAAvClN,iBAAiB1F,GAASiC,UAC5Bm5B,GAAUrV,oBAAoB/lB,GAASqwB,MAE3C,IAEF/I,GAAqB8T,IAMrBxe,GAAmBwe,IAUnB,MACME,GAAmB,CAEvB,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAHP,kBAI7BhqB,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/BiqB,KAAM,GACNhqB,EAAG,GACHiqB,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,GAAI,GACJC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJxqB,EAAG,GACH0b,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChD+O,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IAIAC,GAAgB,IAAIpmB,IAAI,CAAC,aAAc,OAAQ,OAAQ,WAAY,WAAY,SAAU,MAAO,eAShGqmB,GAAmB,0DACnBC,GAAmB,CAAC76B,EAAW86B,KACnC,MAAMC,EAAgB/6B,EAAUvC,SAASC,cACzC,OAAIo9B,EAAqBzb,SAAS0b,IAC5BJ,GAAc/lB,IAAImmB,IACbhc,QAAQ6b,GAAiBt5B,KAAKtB,EAAUg7B,YAM5CF,EAAqB12B,QAAO62B,GAAkBA,aAA0BzY,SAAQ9R,MAAKwqB,GAASA,EAAM55B,KAAKy5B,IAAe,EA0C3HI,GAAY,CAChBC,UAAWtC,GACXuC,QAAS,CAAC,EAEVC,WAAY,GACZxwB,MAAM,EACNywB,UAAU,EACVC,WAAY,KACZC,SAAU,eAENC,GAAgB,CACpBN,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZxwB,KAAM,UACNywB,SAAU,UACVC,WAAY,kBACZC,SAAU,UAENE,GAAqB,CACzBC,MAAO,iCACP5jB,SAAU,oBAOZ,MAAM6jB,WAAwBna,GAC5B,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,EACjC,CAGA,kBAAWJ,GACT,OAAOwZ,EACT,CACA,sBAAWvZ,GACT,OAAO8Z,EACT,CACA,eAAWlhB,GACT,MA3CW,iBA4Cb,CAGA,UAAAshB,GACE,OAAO7gC,OAAOmiB,OAAOa,KAAK6E,QAAQuY,SAASt6B,KAAIghB,GAAU9D,KAAK8d,yBAAyBha,KAAS3d,OAAO2a,QACzG,CACA,UAAAid,GACE,OAAO/d,KAAK6d,aAAantB,OAAS,CACpC,CACA,aAAAstB,CAAcZ,GAMZ,OALApd,KAAKie,cAAcb,GACnBpd,KAAK6E,QAAQuY,QAAU,IAClBpd,KAAK6E,QAAQuY,WACbA,GAEEpd,IACT,CACA,MAAAke,GACE,MAAMC,EAAkB94B,SAASwvB,cAAc,OAC/CsJ,EAAgBC,UAAYpe,KAAKqe,eAAere,KAAK6E,QAAQ2Y,UAC7D,IAAK,MAAOzjB,EAAUukB,KAASthC,OAAOmkB,QAAQnB,KAAK6E,QAAQuY,SACzDpd,KAAKue,YAAYJ,EAAiBG,EAAMvkB,GAE1C,MAAMyjB,EAAWW,EAAgBpY,SAAS,GACpCsX,EAAard,KAAK8d,yBAAyB9d,KAAK6E,QAAQwY,YAI9D,OAHIA,GACFG,EAASniB,UAAU5E,OAAO4mB,EAAWn7B,MAAM,MAEtCs7B,CACT,CAGA,gBAAAvZ,CAAiBH,GACfa,MAAMV,iBAAiBH,GACvB9D,KAAKie,cAAcna,EAAOsZ,QAC5B,CACA,aAAAa,CAAcO,GACZ,IAAK,MAAOzkB,EAAUqjB,KAAYpgC,OAAOmkB,QAAQqd,GAC/C7Z,MAAMV,iBAAiB,CACrBlK,WACA4jB,MAAOP,GACNM,GAEP,CACA,WAAAa,CAAYf,EAAUJ,EAASrjB,GAC7B,MAAM0kB,EAAkB5Y,GAAeC,QAAQ/L,EAAUyjB,GACpDiB,KAGLrB,EAAUpd,KAAK8d,yBAAyBV,IAKpC,GAAUA,GACZpd,KAAK0e,sBAAsBhkB,GAAW0iB,GAAUqB,GAG9Cze,KAAK6E,QAAQhY,KACf4xB,EAAgBL,UAAYpe,KAAKqe,eAAejB,GAGlDqB,EAAgBE,YAAcvB,EAX5BqB,EAAgB9kB,SAYpB,CACA,cAAA0kB,CAAeG,GACb,OAAOxe,KAAK6E,QAAQyY,SApJxB,SAAsBsB,EAAYzB,EAAW0B,GAC3C,IAAKD,EAAWluB,OACd,OAAOkuB,EAET,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAE1B,MACME,GADY,IAAIl/B,OAAOm/B,WACKC,gBAAgBJ,EAAY,aACxD/9B,EAAW,GAAGlC,UAAUmgC,EAAgB5yB,KAAKkU,iBAAiB,MACpE,IAAK,MAAM7gB,KAAWsB,EAAU,CAC9B,MAAMo+B,EAAc1/B,EAAQC,SAASC,cACrC,IAAKzC,OAAO4D,KAAKu8B,GAAW/b,SAAS6d,GAAc,CACjD1/B,EAAQoa,SACR,QACF,CACA,MAAMulB,EAAgB,GAAGvgC,UAAUY,EAAQ0B,YACrCk+B,EAAoB,GAAGxgC,OAAOw+B,EAAU,MAAQ,GAAIA,EAAU8B,IAAgB,IACpF,IAAK,MAAMl9B,KAAam9B,EACjBtC,GAAiB76B,EAAWo9B,IAC/B5/B,EAAQ4B,gBAAgBY,EAAUvC,SAGxC,CACA,OAAOs/B,EAAgB5yB,KAAKkyB,SAC9B,CA2HmCgB,CAAaZ,EAAKxe,KAAK6E,QAAQsY,UAAWnd,KAAK6E,QAAQ0Y,YAAciB,CACtG,CACA,wBAAAV,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,MACvB,CACA,qBAAA0e,CAAsBn/B,EAASk/B,GAC7B,GAAIze,KAAK6E,QAAQhY,KAGf,OAFA4xB,EAAgBL,UAAY,QAC5BK,EAAgB3J,OAAOv1B,GAGzBk/B,EAAgBE,YAAcp/B,EAAQo/B,WACxC,EAeF,MACMU,GAAwB,IAAI/oB,IAAI,CAAC,WAAY,YAAa,eAC1DgpB,GAAoB,OAEpBC,GAAoB,OACpBC,GAAyB,iBACzBC,GAAiB,SACjBC,GAAmB,gBACnBC,GAAgB,QAChBC,GAAgB,QAahBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAO/jB,KAAU,OAAS,QAC1BgkB,OAAQ,SACRC,KAAMjkB,KAAU,QAAU,QAEtBkkB,GAAY,CAChBhD,UAAWtC,GACXuF,WAAW,EACXnyB,SAAU,kBACVoyB,WAAW,EACXC,YAAa,GACbC,MAAO,EACPvwB,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/CnD,MAAM,EACN7E,OAAQ,CAAC,EAAG,GACZtJ,UAAW,MACXszB,aAAc,KACdsL,UAAU,EACVC,WAAY,KACZxjB,UAAU,EACVyjB,SAAU,+GACVgD,MAAO,GACP5e,QAAS,eAEL6e,GAAgB,CACpBtD,UAAW,SACXiD,UAAW,UACXnyB,SAAU,mBACVoyB,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACPvwB,mBAAoB,QACpBnD,KAAM,UACN7E,OAAQ,0BACRtJ,UAAW,oBACXszB,aAAc,yBACdsL,SAAU,UACVC,WAAY,kBACZxjB,SAAU,mBACVyjB,SAAU,SACVgD,MAAO,4BACP5e,QAAS,UAOX,MAAM8e,WAAgBhc,GACpB,WAAAP,CAAY5kB,EAASukB,GACnB,QAAsB,IAAX,EACT,MAAM,IAAIU,UAAU,+DAEtBG,MAAMplB,EAASukB,GAGf9D,KAAK2gB,YAAa,EAClB3gB,KAAK4gB,SAAW,EAChB5gB,KAAK6gB,WAAa,KAClB7gB,KAAK8gB,eAAiB,CAAC,EACvB9gB,KAAKmS,QAAU,KACfnS,KAAK+gB,iBAAmB,KACxB/gB,KAAKghB,YAAc,KAGnBhhB,KAAKihB,IAAM,KACXjhB,KAAKkhB,gBACAlhB,KAAK6E,QAAQ9K,UAChBiG,KAAKmhB,WAET,CAGA,kBAAWzd,GACT,OAAOyc,EACT,CACA,sBAAWxc,GACT,OAAO8c,EACT,CACA,eAAWlkB,GACT,MAxGW,SAyGb,CAGA,MAAA6kB,GACEphB,KAAK2gB,YAAa,CACpB,CACA,OAAAU,GACErhB,KAAK2gB,YAAa,CACpB,CACA,aAAAW,GACEthB,KAAK2gB,YAAc3gB,KAAK2gB,UAC1B,CACA,MAAAhZ,GACO3H,KAAK2gB,aAGV3gB,KAAK8gB,eAAeS,OAASvhB,KAAK8gB,eAAeS,MAC7CvhB,KAAK2P,WACP3P,KAAKwhB,SAGPxhB,KAAKyhB,SACP,CACA,OAAA1c,GACEmI,aAAalN,KAAK4gB,UAClBrgB,GAAaC,IAAIR,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,mBAC3E1hB,KAAK4E,SAASpJ,aAAa,2BAC7BwE,KAAK4E,SAASxjB,aAAa,QAAS4e,KAAK4E,SAASpJ,aAAa,2BAEjEwE,KAAK2hB,iBACLhd,MAAMI,SACR,CACA,IAAA8K,GACE,GAAoC,SAAhC7P,KAAK4E,SAAS7jB,MAAMgxB,QACtB,MAAM,IAAInO,MAAM,uCAElB,IAAM5D,KAAK4hB,mBAAoB5hB,KAAK2gB,WAClC,OAEF,MAAMnH,EAAYjZ,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAlItD,SAoIXqc,GADapmB,GAAeuE,KAAK4E,WACL5E,KAAK4E,SAAS9kB,cAAcwF,iBAAiBd,SAASwb,KAAK4E,UAC7F,GAAI4U,EAAUxX,mBAAqB6f,EACjC,OAIF7hB,KAAK2hB,iBACL,MAAMV,EAAMjhB,KAAK8hB,iBACjB9hB,KAAK4E,SAASxjB,aAAa,mBAAoB6/B,EAAIzlB,aAAa,OAChE,MAAM,UACJ6kB,GACErgB,KAAK6E,QAYT,GAXK7E,KAAK4E,SAAS9kB,cAAcwF,gBAAgBd,SAASwb,KAAKihB,OAC7DZ,EAAUvL,OAAOmM,GACjB1gB,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhJpC,cAkJnBxF,KAAKmS,QAAUnS,KAAKwS,cAAcyO,GAClCA,EAAI5lB,UAAU5E,IAAI8oB,IAMd,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAU1CoE,KAAKmF,gBAPY,KACf5E,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhKrC,WAiKQ,IAApBxF,KAAK6gB,YACP7gB,KAAKwhB,SAEPxhB,KAAK6gB,YAAa,CAAK,GAEK7gB,KAAKihB,IAAKjhB,KAAKgO,cAC/C,CACA,IAAA4B,GACE,GAAK5P,KAAK2P,aAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UA/KtD,SAgLHxD,iBAAd,CAQA,GALYhC,KAAK8hB,iBACbzmB,UAAU1B,OAAO4lB,IAIjB,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAG3CoE,KAAK8gB,eAA4B,OAAI,EACrC9gB,KAAK8gB,eAAelB,KAAiB,EACrC5f,KAAK8gB,eAAenB,KAAiB,EACrC3f,KAAK6gB,WAAa,KAYlB7gB,KAAKmF,gBAVY,KACXnF,KAAK+hB,yBAGJ/hB,KAAK6gB,YACR7gB,KAAK2hB,iBAEP3hB,KAAK4E,SAASzjB,gBAAgB,oBAC9Bof,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAzMpC,WAyM8D,GAEnDxF,KAAKihB,IAAKjhB,KAAKgO,cA1B7C,CA2BF,CACA,MAAAjjB,GACMiV,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,cAAA62B,GACE,OAAO9gB,QAAQd,KAAKgiB,YACtB,CACA,cAAAF,GAIE,OAHK9hB,KAAKihB,MACRjhB,KAAKihB,IAAMjhB,KAAKiiB,kBAAkBjiB,KAAKghB,aAAehhB,KAAKkiB,2BAEtDliB,KAAKihB,GACd,CACA,iBAAAgB,CAAkB7E,GAChB,MAAM6D,EAAMjhB,KAAKmiB,oBAAoB/E,GAASc,SAG9C,IAAK+C,EACH,OAAO,KAETA,EAAI5lB,UAAU1B,OAAO2lB,GAAmBC,IAExC0B,EAAI5lB,UAAU5E,IAAI,MAAMuJ,KAAKmE,YAAY5H,aACzC,MAAM6lB,EAvuGKC,KACb,GACEA,GAAUlgC,KAAKmgC,MA/BH,IA+BSngC,KAAKogC,gBACnBl9B,SAASm9B,eAAeH,IACjC,OAAOA,CAAM,EAmuGGI,CAAOziB,KAAKmE,YAAY5H,MAAM1c,WAK5C,OAJAohC,EAAI7/B,aAAa,KAAMghC,GACnBpiB,KAAKgO,eACPiT,EAAI5lB,UAAU5E,IAAI6oB,IAEb2B,CACT,CACA,UAAAyB,CAAWtF,GACTpd,KAAKghB,YAAc5D,EACfpd,KAAK2P,aACP3P,KAAK2hB,iBACL3hB,KAAK6P,OAET,CACA,mBAAAsS,CAAoB/E,GAYlB,OAXIpd,KAAK+gB,iBACP/gB,KAAK+gB,iBAAiB/C,cAAcZ,GAEpCpd,KAAK+gB,iBAAmB,IAAInD,GAAgB,IACvC5d,KAAK6E,QAGRuY,UACAC,WAAYrd,KAAK8d,yBAAyB9d,KAAK6E,QAAQyb,eAGpDtgB,KAAK+gB,gBACd,CACA,sBAAAmB,GACE,MAAO,CACL,CAAC1C,IAAyBxf,KAAKgiB,YAEnC,CACA,SAAAA,GACE,OAAOhiB,KAAK8d,yBAAyB9d,KAAK6E,QAAQ2b,QAAUxgB,KAAK4E,SAASpJ,aAAa,yBACzF,CAGA,4BAAAmnB,CAA6BvjB,GAC3B,OAAOY,KAAKmE,YAAYmB,oBAAoBlG,EAAMW,eAAgBC,KAAK4iB,qBACzE,CACA,WAAA5U,GACE,OAAOhO,KAAK6E,QAAQub,WAAapgB,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS86B,GAC3E,CACA,QAAA3P,GACE,OAAO3P,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS+6B,GACjD,CACA,aAAA/M,CAAcyO,GACZ,MAAMviC,EAAYme,GAAQmD,KAAK6E,QAAQnmB,UAAW,CAACshB,KAAMihB,EAAKjhB,KAAK4E,WAC7Die,EAAahD,GAAcnhC,EAAU+lB,eAC3C,OAAO,GAAoBzE,KAAK4E,SAAUqc,EAAKjhB,KAAK4S,iBAAiBiQ,GACvE,CACA,UAAA7P,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,wBAAA81B,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,KAAK4E,UAC5B,CACA,gBAAAgO,CAAiBiQ,GACf,MAAM3P,EAAwB,CAC5Bx0B,UAAWmkC,EACXzsB,UAAW,CAAC,CACV9V,KAAM,OACNmB,QAAS,CACPuO,mBAAoBgQ,KAAK6E,QAAQ7U,qBAElC,CACD1P,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,eAEd,CACD1yB,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,QACNmB,QAAS,CACPlC,QAAS,IAAIygB,KAAKmE,YAAY5H,eAE/B,CACDjc,KAAM,kBACNC,SAAS,EACTC,MAAO,aACPC,GAAI4J,IAGF2V,KAAK8hB,iBAAiB1gC,aAAa,wBAAyBiJ,EAAK1J,MAAMjC,UAAU,KAIvF,MAAO,IACFw0B,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,aAAAgO,GACE,MAAM4B,EAAW9iB,KAAK6E,QAAQjD,QAAQ1f,MAAM,KAC5C,IAAK,MAAM0f,KAAWkhB,EACpB,GAAgB,UAAZlhB,EACFrB,GAAac,GAAGrB,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAjVlC,SAiV4DxF,KAAK6E,QAAQ9K,UAAUqF,IAC/EY,KAAK2iB,6BAA6BvjB,GAC1CuI,QAAQ,SAEb,GA3VU,WA2VN/F,EAA4B,CACrC,MAAMmhB,EAAUnhB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV5C,cAmV0ExF,KAAKmE,YAAYqB,UArV5F,WAsVVwd,EAAWphB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV7C,cAmV2ExF,KAAKmE,YAAYqB,UArV5F,YAsVjBjF,GAAac,GAAGrB,KAAK4E,SAAUme,EAAS/iB,KAAK6E,QAAQ9K,UAAUqF,IAC7D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,YAAf1hB,EAAMqB,KAAqBmf,GAAgBD,KAAiB,EACnFrM,EAAQmO,QAAQ,IAElBlhB,GAAac,GAAGrB,KAAK4E,SAAUoe,EAAUhjB,KAAK6E,QAAQ9K,UAAUqF,IAC9D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,aAAf1hB,EAAMqB,KAAsBmf,GAAgBD,IAAiBrM,EAAQ1O,SAASpgB,SAAS4a,EAAMU,eACpHwT,EAAQkO,QAAQ,GAEpB,CAEFxhB,KAAK0hB,kBAAoB,KACnB1hB,KAAK4E,UACP5E,KAAK4P,MACP,EAEFrP,GAAac,GAAGrB,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,kBAChF,CACA,SAAAP,GACE,MAAMX,EAAQxgB,KAAK4E,SAASpJ,aAAa,SACpCglB,IAGAxgB,KAAK4E,SAASpJ,aAAa,eAAkBwE,KAAK4E,SAAS+Z,YAAYhZ,QAC1E3F,KAAK4E,SAASxjB,aAAa,aAAco/B,GAE3CxgB,KAAK4E,SAASxjB,aAAa,yBAA0Bo/B,GACrDxgB,KAAK4E,SAASzjB,gBAAgB,SAChC,CACA,MAAAsgC,GACMzhB,KAAK2P,YAAc3P,KAAK6gB,WAC1B7gB,KAAK6gB,YAAa,GAGpB7gB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACXjjB,KAAK6gB,YACP7gB,KAAK6P,MACP,GACC7P,KAAK6E,QAAQ0b,MAAM1Q,MACxB,CACA,MAAA2R,GACMxhB,KAAK+hB,yBAGT/hB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACVjjB,KAAK6gB,YACR7gB,KAAK4P,MACP,GACC5P,KAAK6E,QAAQ0b,MAAM3Q,MACxB,CACA,WAAAqT,CAAYrlB,EAASslB,GACnBhW,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW/iB,WAAWD,EAASslB,EACtC,CACA,oBAAAnB,GACE,OAAO/kC,OAAOmiB,OAAOa,KAAK8gB,gBAAgB1f,UAAS,EACrD,CACA,UAAAyC,CAAWC,GACT,MAAMqf,EAAiBngB,GAAYG,kBAAkBnD,KAAK4E,UAC1D,IAAK,MAAMwe,KAAiBpmC,OAAO4D,KAAKuiC,GAClC9D,GAAsB1oB,IAAIysB,WACrBD,EAAeC,GAU1B,OAPAtf,EAAS,IACJqf,KACmB,iBAAXrf,GAAuBA,EAASA,EAAS,CAAC,GAEvDA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAchB,OAbAA,EAAOuc,WAAiC,IAArBvc,EAAOuc,UAAsBh7B,SAAS6G,KAAOwO,GAAWoJ,EAAOuc,WACtD,iBAAjBvc,EAAOyc,QAChBzc,EAAOyc,MAAQ,CACb1Q,KAAM/L,EAAOyc,MACb3Q,KAAM9L,EAAOyc,QAGW,iBAAjBzc,EAAO0c,QAChB1c,EAAO0c,MAAQ1c,EAAO0c,MAAM3gC,YAEA,iBAAnBikB,EAAOsZ,UAChBtZ,EAAOsZ,QAAUtZ,EAAOsZ,QAAQv9B,YAE3BikB,CACT,CACA,kBAAA8e,GACE,MAAM9e,EAAS,CAAC,EAChB,IAAK,MAAOhnB,EAAKa,KAAUX,OAAOmkB,QAAQnB,KAAK6E,SACzC7E,KAAKmE,YAAYT,QAAQ5mB,KAASa,IACpCmmB,EAAOhnB,GAAOa,GASlB,OANAmmB,EAAO/J,UAAW,EAClB+J,EAAOlC,QAAU,SAKVkC,CACT,CACA,cAAA6d,GACM3hB,KAAKmS,UACPnS,KAAKmS,QAAQnZ,UACbgH,KAAKmS,QAAU,MAEbnS,KAAKihB,MACPjhB,KAAKihB,IAAItnB,SACTqG,KAAKihB,IAAM,KAEf,CAGA,sBAAOxkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOq2B,GAAQpb,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBukB,IAcnB,MACM2C,GAAiB,kBACjBC,GAAmB,gBACnBC,GAAY,IACb7C,GAAQhd,QACX0Z,QAAS,GACTp1B,OAAQ,CAAC,EAAG,GACZtJ,UAAW,QACX8+B,SAAU,8IACV5b,QAAS,SAEL4hB,GAAgB,IACjB9C,GAAQ/c,YACXyZ,QAAS,kCAOX,MAAMqG,WAAgB/C,GAEpB,kBAAWhd,GACT,OAAO6f,EACT,CACA,sBAAW5f,GACT,OAAO6f,EACT,CACA,eAAWjnB,GACT,MA7BW,SA8Bb,CAGA,cAAAqlB,GACE,OAAO5hB,KAAKgiB,aAAehiB,KAAK0jB,aAClC,CAGA,sBAAAxB,GACE,MAAO,CACL,CAACmB,IAAiBrjB,KAAKgiB,YACvB,CAACsB,IAAmBtjB,KAAK0jB,cAE7B,CACA,WAAAA,GACE,OAAO1jB,KAAK8d,yBAAyB9d,KAAK6E,QAAQuY,QACpD,CAGA,sBAAO3gB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOo5B,GAAQne,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBsnB,IAcnB,MAEME,GAAc,gBAEdC,GAAiB,WAAWD,KAC5BE,GAAc,QAAQF,KACtBG,GAAwB,OAAOH,cAE/BI,GAAsB,SAEtBC,GAAwB,SAExBC,GAAqB,YAGrBC,GAAsB,GAAGD,mBAA+CA,uBAGxEE,GAAY,CAChBn8B,OAAQ,KAERo8B,WAAY,eACZC,cAAc,EACd93B,OAAQ,KACR+3B,UAAW,CAAC,GAAK,GAAK,IAElBC,GAAgB,CACpBv8B,OAAQ,gBAERo8B,WAAY,SACZC,aAAc,UACd93B,OAAQ,UACR+3B,UAAW,SAOb,MAAME,WAAkB9f,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GAGf9D,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B8O,KAAK2kB,aAA6D,YAA9C1/B,iBAAiB+a,KAAK4E,UAAU5Y,UAA0B,KAAOgU,KAAK4E,SAC1F5E,KAAK4kB,cAAgB,KACrB5kB,KAAK6kB,UAAY,KACjB7kB,KAAK8kB,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnBhlB,KAAKilB,SACP,CAGA,kBAAWvhB,GACT,OAAOygB,EACT,CACA,sBAAWxgB,GACT,OAAO4gB,EACT,CACA,eAAWhoB,GACT,MAhEW,WAiEb,CAGA,OAAA0oB,GACEjlB,KAAKklB,mCACLllB,KAAKmlB,2BACDnlB,KAAK6kB,UACP7kB,KAAK6kB,UAAUO,aAEfplB,KAAK6kB,UAAY7kB,KAAKqlB,kBAExB,IAAK,MAAMC,KAAWtlB,KAAK0kB,oBAAoBvlB,SAC7Ca,KAAK6kB,UAAUU,QAAQD,EAE3B,CACA,OAAAvgB,GACE/E,KAAK6kB,UAAUO,aACfzgB,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAShB,OAPAA,EAAOvX,OAASmO,GAAWoJ,EAAOvX,SAAWlH,SAAS6G,KAGtD4X,EAAOsgB,WAAatgB,EAAO9b,OAAS,GAAG8b,EAAO9b,oBAAsB8b,EAAOsgB,WAC3C,iBAArBtgB,EAAOwgB,YAChBxgB,EAAOwgB,UAAYxgB,EAAOwgB,UAAUpiC,MAAM,KAAKY,KAAInF,GAAS4f,OAAOC,WAAW7f,MAEzEmmB,CACT,CACA,wBAAAqhB,GACOnlB,KAAK6E,QAAQwf,eAKlB9jB,GAAaC,IAAIR,KAAK6E,QAAQtY,OAAQs3B,IACtCtjB,GAAac,GAAGrB,KAAK6E,QAAQtY,OAAQs3B,GAAaG,IAAuB5kB,IACvE,MAAMomB,EAAoBxlB,KAAK0kB,oBAAoBvnC,IAAIiiB,EAAM7S,OAAOtB,MACpE,GAAIu6B,EAAmB,CACrBpmB,EAAMkD,iBACN,MAAM3G,EAAOqE,KAAK2kB,cAAgB/kC,OAC5BmE,EAASyhC,EAAkBnhC,UAAY2b,KAAK4E,SAASvgB,UAC3D,GAAIsX,EAAK8pB,SAKP,YAJA9pB,EAAK8pB,SAAS,CACZ9jC,IAAKoC,EACL2hC,SAAU,WAMd/pB,EAAKlQ,UAAY1H,CACnB,KAEJ,CACA,eAAAshC,GACE,MAAM5jC,EAAU,CACdka,KAAMqE,KAAK2kB,aACXL,UAAWtkB,KAAK6E,QAAQyf,UACxBF,WAAYpkB,KAAK6E,QAAQuf,YAE3B,OAAO,IAAIuB,sBAAqBxkB,GAAWnB,KAAK4lB,kBAAkBzkB,IAAU1f,EAC9E,CAGA,iBAAAmkC,CAAkBzkB,GAChB,MAAM0kB,EAAgBlI,GAAS3d,KAAKykB,aAAatnC,IAAI,IAAIwgC,EAAMpxB,OAAO4N,MAChEub,EAAWiI,IACf3d,KAAK8kB,oBAAoBC,gBAAkBpH,EAAMpxB,OAAOlI,UACxD2b,KAAK8lB,SAASD,EAAclI,GAAO,EAE/BqH,GAAmBhlB,KAAK2kB,cAAgBt/B,SAASC,iBAAiBmG,UAClEs6B,EAAkBf,GAAmBhlB,KAAK8kB,oBAAoBE,gBACpEhlB,KAAK8kB,oBAAoBE,gBAAkBA,EAC3C,IAAK,MAAMrH,KAASxc,EAAS,CAC3B,IAAKwc,EAAMqI,eAAgB,CACzBhmB,KAAK4kB,cAAgB,KACrB5kB,KAAKimB,kBAAkBJ,EAAclI,IACrC,QACF,CACA,MAAMuI,EAA2BvI,EAAMpxB,OAAOlI,WAAa2b,KAAK8kB,oBAAoBC,gBAEpF,GAAIgB,GAAmBG,GAGrB,GAFAxQ,EAASiI,IAEJqH,EACH,YAMCe,GAAoBG,GACvBxQ,EAASiI,EAEb,CACF,CACA,gCAAAuH,GACEllB,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B,MAAMi1B,EAActgB,GAAe1T,KAAK6xB,GAAuBhkB,KAAK6E,QAAQtY,QAC5E,IAAK,MAAM65B,KAAUD,EAAa,CAEhC,IAAKC,EAAOn7B,MAAQiQ,GAAWkrB,GAC7B,SAEF,MAAMZ,EAAoB3f,GAAeC,QAAQugB,UAAUD,EAAOn7B,MAAO+U,KAAK4E,UAG1EjK,GAAU6qB,KACZxlB,KAAKykB,aAAa1yB,IAAIs0B,UAAUD,EAAOn7B,MAAOm7B,GAC9CpmB,KAAK0kB,oBAAoB3yB,IAAIq0B,EAAOn7B,KAAMu6B,GAE9C,CACF,CACA,QAAAM,CAASv5B,GACHyT,KAAK4kB,gBAAkBr4B,IAG3ByT,KAAKimB,kBAAkBjmB,KAAK6E,QAAQtY,QACpCyT,KAAK4kB,cAAgBr4B,EACrBA,EAAO8O,UAAU5E,IAAIstB,IACrB/jB,KAAKsmB,iBAAiB/5B,GACtBgU,GAAaqB,QAAQ5B,KAAK4E,SAAUgf,GAAgB,CAClD9jB,cAAevT,IAEnB,CACA,gBAAA+5B,CAAiB/5B,GAEf,GAAIA,EAAO8O,UAAU7W,SA9LQ,iBA+L3BqhB,GAAeC,QArLc,mBAqLsBvZ,EAAOyO,QAtLtC,cAsLkEK,UAAU5E,IAAIstB,SAGtG,IAAK,MAAMwC,KAAa1gB,GAAeI,QAAQ1Z,EA9LnB,qBAiM1B,IAAK,MAAMxJ,KAAQ8iB,GAAeM,KAAKogB,EAAWrC,IAChDnhC,EAAKsY,UAAU5E,IAAIstB,GAGzB,CACA,iBAAAkC,CAAkBxhC,GAChBA,EAAO4W,UAAU1B,OAAOoqB,IACxB,MAAMyC,EAAc3gB,GAAe1T,KAAK,GAAG6xB,MAAyBD,KAAuBt/B,GAC3F,IAAK,MAAM9E,KAAQ6mC,EACjB7mC,EAAK0b,UAAU1B,OAAOoqB,GAE1B,CAGA,sBAAOtnB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOm6B,GAAUlf,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGzhB,OAAQkkC,IAAuB,KAC7C,IAAK,MAAM2C,KAAO5gB,GAAe1T,KApOT,0BAqOtBqyB,GAAUlf,oBAAoBmhB,EAChC,IAOFtqB,GAAmBqoB,IAcnB,MAEMkC,GAAc,UACdC,GAAe,OAAOD,KACtBE,GAAiB,SAASF,KAC1BG,GAAe,OAAOH,KACtBI,GAAgB,QAAQJ,KACxBK,GAAuB,QAAQL,KAC/BM,GAAgB,UAAUN,KAC1BO,GAAsB,OAAOP,KAC7BQ,GAAiB,YACjBC,GAAkB,aAClBC,GAAe,UACfC,GAAiB,YACjBC,GAAW,OACXC,GAAU,MACVC,GAAoB,SACpBC,GAAoB,OACpBC,GAAoB,OAEpBC,GAA2B,mBAE3BC,GAA+B,QAAQD,MAIvCE,GAAuB,2EACvBC,GAAsB,YAFOF,uBAAiDA,mBAA6CA,OAE/EC,KAC5CE,GAA8B,IAAIP,8BAA6CA,+BAA8CA,4BAMnI,MAAMQ,WAAYtjB,GAChB,WAAAP,CAAY5kB,GACVolB,MAAMplB,GACNygB,KAAKoS,QAAUpS,KAAK4E,SAAS5J,QAdN,uCAelBgF,KAAKoS,UAOVpS,KAAKioB,sBAAsBjoB,KAAKoS,QAASpS,KAAKkoB,gBAC9C3nB,GAAac,GAAGrB,KAAK4E,SAAUoiB,IAAe5nB,GAASY,KAAK6M,SAASzN,KACvE,CAGA,eAAW7C,GACT,MAnDW,KAoDb,CAGA,IAAAsT,GAEE,MAAMsY,EAAYnoB,KAAK4E,SACvB,GAAI5E,KAAKooB,cAAcD,GACrB,OAIF,MAAME,EAASroB,KAAKsoB,iBACdC,EAAYF,EAAS9nB,GAAaqB,QAAQymB,EAAQ1B,GAAc,CACpE7mB,cAAeqoB,IACZ,KACa5nB,GAAaqB,QAAQumB,EAAWtB,GAAc,CAC9D/mB,cAAeuoB,IAEHrmB,kBAAoBumB,GAAaA,EAAUvmB,mBAGzDhC,KAAKwoB,YAAYH,EAAQF,GACzBnoB,KAAKyoB,UAAUN,EAAWE,GAC5B,CAGA,SAAAI,CAAUlpC,EAASmpC,GACZnpC,IAGLA,EAAQ8b,UAAU5E,IAAI+wB,IACtBxnB,KAAKyoB,UAAU5iB,GAAec,uBAAuBpnB,IAcrDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ4B,gBAAgB,YACxB5B,EAAQ6B,aAAa,iBAAiB,GACtC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASunC,GAAe,CAC3ChnB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU5E,IAAIixB,GAQtB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,WAAAe,CAAYjpC,EAASmpC,GACdnpC,IAGLA,EAAQ8b,UAAU1B,OAAO6tB,IACzBjoC,EAAQq7B,OACR5a,KAAKwoB,YAAY3iB,GAAec,uBAAuBpnB,IAcvDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ6B,aAAa,iBAAiB,GACtC7B,EAAQ6B,aAAa,WAAY,MACjC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASqnC,GAAgB,CAC5C9mB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU1B,OAAO+tB,GAQzB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,QAAA5a,CAASzN,GACP,IAAK,CAAC8nB,GAAgBC,GAAiBC,GAAcC,GAAgBC,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrG,OAEFsiB,EAAM0U,kBACN1U,EAAMkD,iBACN,MAAMyD,EAAW/F,KAAKkoB,eAAe/hC,QAAO5G,IAAY2b,GAAW3b,KACnE,IAAIqpC,EACJ,GAAI,CAACtB,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrC8rC,EAAoB7iB,EAAS3G,EAAMtiB,MAAQwqC,GAAW,EAAIvhB,EAASrV,OAAS,OACvE,CACL,MAAM8c,EAAS,CAAC2Z,GAAiBE,IAAgBjmB,SAAShC,EAAMtiB,KAChE8rC,EAAoB9qB,GAAqBiI,EAAU3G,EAAM7S,OAAQihB,GAAQ,EAC3E,CACIob,IACFA,EAAkBnW,MAAM,CACtBoW,eAAe,IAEjBb,GAAI1iB,oBAAoBsjB,GAAmB/Y,OAE/C,CACA,YAAAqY,GAEE,OAAOriB,GAAe1T,KAAK21B,GAAqB9nB,KAAKoS,QACvD,CACA,cAAAkW,GACE,OAAOtoB,KAAKkoB,eAAe/1B,MAAKzN,GAASsb,KAAKooB,cAAc1jC,MAAW,IACzE,CACA,qBAAAujC,CAAsBxjC,EAAQshB,GAC5B/F,KAAK8oB,yBAAyBrkC,EAAQ,OAAQ,WAC9C,IAAK,MAAMC,KAASqhB,EAClB/F,KAAK+oB,6BAA6BrkC,EAEtC,CACA,4BAAAqkC,CAA6BrkC,GAC3BA,EAAQsb,KAAKgpB,iBAAiBtkC,GAC9B,MAAMukC,EAAWjpB,KAAKooB,cAAc1jC,GAC9BwkC,EAAYlpB,KAAKmpB,iBAAiBzkC,GACxCA,EAAMtD,aAAa,gBAAiB6nC,GAChCC,IAAcxkC,GAChBsb,KAAK8oB,yBAAyBI,EAAW,OAAQ,gBAE9CD,GACHvkC,EAAMtD,aAAa,WAAY,MAEjC4e,KAAK8oB,yBAAyBpkC,EAAO,OAAQ,OAG7Csb,KAAKopB,mCAAmC1kC,EAC1C,CACA,kCAAA0kC,CAAmC1kC,GACjC,MAAM6H,EAASsZ,GAAec,uBAAuBjiB,GAChD6H,IAGLyT,KAAK8oB,yBAAyBv8B,EAAQ,OAAQ,YAC1C7H,EAAMyV,IACR6F,KAAK8oB,yBAAyBv8B,EAAQ,kBAAmB,GAAG7H,EAAMyV,MAEtE,CACA,eAAAwuB,CAAgBppC,EAAS8pC,GACvB,MAAMH,EAAYlpB,KAAKmpB,iBAAiB5pC,GACxC,IAAK2pC,EAAU7tB,UAAU7W,SApKN,YAqKjB,OAEF,MAAMmjB,EAAS,CAAC5N,EAAUoa,KACxB,MAAM50B,EAAUsmB,GAAeC,QAAQ/L,EAAUmvB,GAC7C3pC,GACFA,EAAQ8b,UAAUsM,OAAOwM,EAAWkV,EACtC,EAEF1hB,EAAOggB,GAA0BH,IACjC7f,EA5K2B,iBA4KI+f,IAC/BwB,EAAU9nC,aAAa,gBAAiBioC,EAC1C,CACA,wBAAAP,CAAyBvpC,EAASwC,EAAWpE,GACtC4B,EAAQgc,aAAaxZ,IACxBxC,EAAQ6B,aAAaW,EAAWpE,EAEpC,CACA,aAAAyqC,CAAc9Y,GACZ,OAAOA,EAAKjU,UAAU7W,SAASgjC,GACjC,CAGA,gBAAAwB,CAAiB1Z,GACf,OAAOA,EAAKtJ,QAAQ8hB,IAAuBxY,EAAOzJ,GAAeC,QAAQgiB,GAAqBxY,EAChG,CAGA,gBAAA6Z,CAAiB7Z,GACf,OAAOA,EAAKtU,QA5LO,gCA4LoBsU,CACzC,CAGA,sBAAO7S,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO29B,GAAI1iB,oBAAoBtF,MACrC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGhc,SAAU0hC,GAAsBc,IAAsB,SAAUzoB,GAC1E,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,OAGfgoB,GAAI1iB,oBAAoBtF,MAAM6P,MAChC,IAKAtP,GAAac,GAAGzhB,OAAQqnC,IAAqB,KAC3C,IAAK,MAAM1nC,KAAWsmB,GAAe1T,KAAK41B,IACxCC,GAAI1iB,oBAAoB/lB,EAC1B,IAMF4c,GAAmB6rB,IAcnB,MAEMhjB,GAAY,YACZskB,GAAkB,YAAYtkB,KAC9BukB,GAAiB,WAAWvkB,KAC5BwkB,GAAgB,UAAUxkB,KAC1BykB,GAAiB,WAAWzkB,KAC5B0kB,GAAa,OAAO1kB,KACpB2kB,GAAe,SAAS3kB,KACxB4kB,GAAa,OAAO5kB,KACpB6kB,GAAc,QAAQ7kB,KAEtB8kB,GAAkB,OAClBC,GAAkB,OAClBC,GAAqB,UACrBrmB,GAAc,CAClByc,UAAW,UACX6J,SAAU,UACV1J,MAAO,UAEH7c,GAAU,CACd0c,WAAW,EACX6J,UAAU,EACV1J,MAAO,KAOT,MAAM2J,WAAcxlB,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK4gB,SAAW,KAChB5gB,KAAKmqB,sBAAuB,EAC5BnqB,KAAKoqB,yBAA0B,EAC/BpqB,KAAKkhB,eACP,CAGA,kBAAWxd,GACT,OAAOA,EACT,CACA,sBAAWC,GACT,OAAOA,EACT,CACA,eAAWpH,GACT,MA/CS,OAgDX,CAGA,IAAAsT,GACoBtP,GAAaqB,QAAQ5B,KAAK4E,SAAUglB,IACxC5nB,mBAGdhC,KAAKqqB,gBACDrqB,KAAK6E,QAAQub,WACfpgB,KAAK4E,SAASvJ,UAAU5E,IA/CN,QAsDpBuJ,KAAK4E,SAASvJ,UAAU1B,OAAOmwB,IAC/BjuB,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIszB,GAAiBC,IAC7ChqB,KAAKmF,gBARY,KACfnF,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,IAC/BzpB,GAAaqB,QAAQ5B,KAAK4E,SAAUilB,IACpC7pB,KAAKsqB,oBAAoB,GAKGtqB,KAAK4E,SAAU5E,KAAK6E,QAAQub,WAC5D,CACA,IAAAxQ,GACO5P,KAAKuqB,YAGQhqB,GAAaqB,QAAQ5B,KAAK4E,SAAU8kB,IACxC1nB,mBAQdhC,KAAK4E,SAASvJ,UAAU5E,IAAIuzB,IAC5BhqB,KAAKmF,gBANY,KACfnF,KAAK4E,SAASvJ,UAAU5E,IAAIqzB,IAC5B9pB,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,GAAoBD,IACnDxpB,GAAaqB,QAAQ5B,KAAK4E,SAAU+kB,GAAa,GAGrB3pB,KAAK4E,SAAU5E,KAAK6E,QAAQub,YAC5D,CACA,OAAArb,GACE/E,KAAKqqB,gBACDrqB,KAAKuqB,WACPvqB,KAAK4E,SAASvJ,UAAU1B,OAAOowB,IAEjCplB,MAAMI,SACR,CACA,OAAAwlB,GACE,OAAOvqB,KAAK4E,SAASvJ,UAAU7W,SAASulC,GAC1C,CAIA,kBAAAO,GACOtqB,KAAK6E,QAAQolB,WAGdjqB,KAAKmqB,sBAAwBnqB,KAAKoqB,0BAGtCpqB,KAAK4gB,SAAW/iB,YAAW,KACzBmC,KAAK4P,MAAM,GACV5P,KAAK6E,QAAQ0b,QAClB,CACA,cAAAiK,CAAeprB,EAAOqrB,GACpB,OAAQrrB,EAAMqB,MACZ,IAAK,YACL,IAAK,WAEDT,KAAKmqB,qBAAuBM,EAC5B,MAEJ,IAAK,UACL,IAAK,WAEDzqB,KAAKoqB,wBAA0BK,EAIrC,GAAIA,EAEF,YADAzqB,KAAKqqB,gBAGP,MAAM5c,EAAcrO,EAAMU,cACtBE,KAAK4E,WAAa6I,GAAezN,KAAK4E,SAASpgB,SAASipB,IAG5DzN,KAAKsqB,oBACP,CACA,aAAApJ,GACE3gB,GAAac,GAAGrB,KAAK4E,SAAU0kB,IAAiBlqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACpFmB,GAAac,GAAGrB,KAAK4E,SAAU2kB,IAAgBnqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACnFmB,GAAac,GAAGrB,KAAK4E,SAAU4kB,IAAepqB,GAASY,KAAKwqB,eAAeprB,GAAO,KAClFmB,GAAac,GAAGrB,KAAK4E,SAAU6kB,IAAgBrqB,GAASY,KAAKwqB,eAAeprB,GAAO,IACrF,CACA,aAAAirB,GACEnd,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW,IAClB,CAGA,sBAAOnkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6/B,GAAM5kB,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KACf,CACF,GACF,ECr0IK,SAAS0qB,GAAcruB,GACD,WAAvBhX,SAASuX,WAAyBP,IACjChX,SAASyF,iBAAiB,mBAAoBuR,EACrD,CDy0IAwK,GAAqBqjB,IAMrB/tB,GAAmB+tB,IEpyInBQ,IAzCA,WAC2B,GAAGt4B,MAAM5U,KAChC6H,SAAS+a,iBAAiB,+BAETtd,KAAI,SAAU6nC,GAC/B,OAAO,IAAI,GAAkBA,EAAkB,CAC7CpK,MAAO,CAAE1Q,KAAM,IAAKD,KAAM,MAE9B,GACF,IAiCA8a,IA5BA,WACYrlC,SAASm9B,eAAe,mBAC9B13B,iBAAiB,SAAS,WAC5BzF,SAAS6G,KAAKT,UAAY,EAC1BpG,SAASC,gBAAgBmG,UAAY,CACvC,GACF,IAuBAi/B,IArBA,WACE,IAAIE,EAAMvlC,SAASm9B,eAAe,mBAC9BqI,EAASxlC,SACVylC,uBAAuB,aAAa,GACpCxnC,wBACH1D,OAAOkL,iBAAiB,UAAU,WAC5BkV,KAAK+qB,UAAY/qB,KAAKgrB,SAAWhrB,KAAKgrB,QAAUH,EAAOjtC,OACzDgtC,EAAI7pC,MAAMgxB,QAAU,QAEpB6Y,EAAI7pC,MAAMgxB,QAAU,OAEtB/R,KAAK+qB,UAAY/qB,KAAKgrB,OACxB,GACF,IAUAprC,OAAOqrC,UAAY","sources":["webpack://pydata_sphinx_theme/webpack/bootstrap","webpack://pydata_sphinx_theme/webpack/runtime/define property getters","webpack://pydata_sphinx_theme/webpack/runtime/hasOwnProperty shorthand","webpack://pydata_sphinx_theme/webpack/runtime/make namespace object","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/enums.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/applyStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getBasePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/math.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/userAgent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/contains.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/within.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/expandToHashMap.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/arrow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getVariation.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/computeStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/eventListeners.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/rectToClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/detectOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/flip.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/hide.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/offset.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getAltAxis.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/orderModifiers.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/createPopper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/debounce.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergeByName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper-lite.js","webpack://pydata_sphinx_theme/./node_modules/bootstrap/dist/js/bootstrap.esm.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/mixin.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/bootstrap.js"],"sourcesContent":["// The require scope\nvar __webpack_require__ = {};\n\n","// define getter functions for harmony exports\n__webpack_require__.d = (exports, definition) => {\n\tfor(var key in definition) {\n\t\tif(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {\n\t\t\tObject.defineProperty(exports, key, { enumerable: true, get: definition[key] });\n\t\t}\n\t}\n};","__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))","// define __esModule on exports\n__webpack_require__.r = (exports) => {\n\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n\t}\n\tObject.defineProperty(exports, '__esModule', { value: true });\n};","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n });\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref) {\n var name = _ref.name,\n _ref$options = _ref.options,\n options = _ref$options === void 0 ? {} : _ref$options,\n effect = _ref.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","/*!\n * Bootstrap v5.3.3 (https://getbootstrap.com/)\n * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n */\nimport * as Popper from '@popperjs/core';\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\n\nconst elementMap = new Map();\nconst Data = {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map());\n }\n const instanceMap = elementMap.get(element);\n\n // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);\n return;\n }\n instanceMap.set(key, instance);\n },\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null;\n }\n return null;\n },\n remove(element, key) {\n if (!elementMap.has(element)) {\n return;\n }\n const instanceMap = elementMap.get(element);\n instanceMap.delete(key);\n\n // free up element references if there are no instances left for an element\n if (instanceMap.size === 0) {\n elementMap.delete(element);\n }\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst MAX_UID = 1000000;\nconst MILLISECONDS_MULTIPLIER = 1000;\nconst TRANSITION_END = 'transitionend';\n\n/**\n * Properly escape IDs selectors to handle weird IDs\n * @param {string} selector\n * @returns {string}\n */\nconst parseSelector = selector => {\n if (selector && window.CSS && window.CSS.escape) {\n // document.querySelector needs escaping to handle IDs (html5+) containing for instance /\n selector = selector.replace(/#([^\\s\"#']+)/g, (match, id) => `#${CSS.escape(id)}`);\n }\n return selector;\n};\n\n// Shout-out Angus Croll (https://goo.gl/pxwQGp)\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`;\n }\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase();\n};\n\n/**\n * Public Util API\n */\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID);\n } while (document.getElementById(prefix));\n return prefix;\n};\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0;\n }\n\n // Get transition-duration of the element\n let {\n transitionDuration,\n transitionDelay\n } = window.getComputedStyle(element);\n const floatTransitionDuration = Number.parseFloat(transitionDuration);\n const floatTransitionDelay = Number.parseFloat(transitionDelay);\n\n // Return 0 if element or transition duration is not found\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0;\n }\n\n // If multiple durations are defined, take the first\n transitionDuration = transitionDuration.split(',')[0];\n transitionDelay = transitionDelay.split(',')[0];\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;\n};\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END));\n};\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false;\n }\n if (typeof object.jquery !== 'undefined') {\n object = object[0];\n }\n return typeof object.nodeType !== 'undefined';\n};\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object;\n }\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(parseSelector(object));\n }\n return null;\n};\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false;\n }\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible';\n // Handle `details` element as its content may falsie appear visible when it is closed\n const closedDetails = element.closest('details:not([open])');\n if (!closedDetails) {\n return elementIsVisible;\n }\n if (closedDetails !== element) {\n const summary = element.closest('summary');\n if (summary && summary.parentNode !== closedDetails) {\n return false;\n }\n if (summary === null) {\n return false;\n }\n }\n return elementIsVisible;\n};\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true;\n }\n if (element.classList.contains('disabled')) {\n return true;\n }\n if (typeof element.disabled !== 'undefined') {\n return element.disabled;\n }\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';\n};\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null;\n }\n\n // Can find the shadow root otherwise it'll return the document\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode();\n return root instanceof ShadowRoot ? root : null;\n }\n if (element instanceof ShadowRoot) {\n return element;\n }\n\n // when we don't find a shadow root\n if (!element.parentNode) {\n return null;\n }\n return findShadowRoot(element.parentNode);\n};\nconst noop = () => {};\n\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\nconst reflow = element => {\n element.offsetHeight; // eslint-disable-line no-unused-expressions\n};\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery;\n }\n return null;\n};\nconst DOMContentLoadedCallbacks = [];\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback();\n }\n });\n }\n DOMContentLoadedCallbacks.push(callback);\n } else {\n callback();\n }\n};\nconst isRTL = () => document.documentElement.dir === 'rtl';\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery();\n /* istanbul ignore if */\n if ($) {\n const name = plugin.NAME;\n const JQUERY_NO_CONFLICT = $.fn[name];\n $.fn[name] = plugin.jQueryInterface;\n $.fn[name].Constructor = plugin;\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT;\n return plugin.jQueryInterface;\n };\n }\n });\n};\nconst execute = (possibleCallback, args = [], defaultValue = possibleCallback) => {\n return typeof possibleCallback === 'function' ? possibleCallback(...args) : defaultValue;\n};\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback);\n return;\n }\n const durationPadding = 5;\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;\n let called = false;\n const handler = ({\n target\n }) => {\n if (target !== transitionElement) {\n return;\n }\n called = true;\n transitionElement.removeEventListener(TRANSITION_END, handler);\n execute(callback);\n };\n transitionElement.addEventListener(TRANSITION_END, handler);\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement);\n }\n }, emulatedDuration);\n};\n\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length;\n let index = list.indexOf(activeElement);\n\n // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];\n }\n index += shouldGetNext ? 1 : -1;\n if (isCycleAllowed) {\n index = (index + listLength) % listLength;\n }\n return list[Math.max(0, Math.min(index, listLength - 1))];\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/;\nconst stripNameRegex = /\\..*/;\nconst stripUidRegex = /::\\d+$/;\nconst eventRegistry = {}; // Events storage\nlet uidEvent = 1;\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n};\nconst nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);\n\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;\n}\nfunction getElementEvents(element) {\n const uid = makeEventUid(element);\n element.uidEvent = uid;\n eventRegistry[uid] = eventRegistry[uid] || {};\n return eventRegistry[uid];\n}\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, {\n delegateTarget: element\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn);\n }\n return fn.apply(element, [event]);\n };\n}\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector);\n for (let {\n target\n } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue;\n }\n hydrateObj(event, {\n delegateTarget: target\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn);\n }\n return fn.apply(target, [event]);\n }\n }\n };\n}\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);\n}\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string';\n // TODO: tooltip passes `false` instead of selector, so we need to check\n const callable = isDelegated ? delegationFunction : handler || delegationFunction;\n let typeEvent = getTypeEvent(originalTypeEvent);\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent;\n }\n return [isDelegated, callable, typeEvent];\n}\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n\n // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {\n return fn.call(this, event);\n }\n };\n };\n callable = wrapFunction(callable);\n }\n const events = getElementEvents(element);\n const handlers = events[typeEvent] || (events[typeEvent] = {});\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff;\n return;\n }\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));\n const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);\n fn.delegationSelector = isDelegated ? handler : null;\n fn.callable = callable;\n fn.oneOff = oneOff;\n fn.uidEvent = uid;\n handlers[uid] = fn;\n element.addEventListener(typeEvent, fn, isDelegated);\n}\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector);\n if (!fn) {\n return;\n }\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));\n delete events[typeEvent][fn.uidEvent];\n}\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {};\n for (const [handlerKey, event] of Object.entries(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n}\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '');\n return customEvents[event] || event;\n}\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false);\n },\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true);\n },\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n const inNamespace = typeEvent !== originalTypeEvent;\n const events = getElementEvents(element);\n const storeElementEvent = events[typeEvent] || {};\n const isNamespace = originalTypeEvent.startsWith('.');\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return;\n }\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);\n return;\n }\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));\n }\n }\n for (const [keyHandlers, event] of Object.entries(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '');\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n },\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null;\n }\n const $ = getjQuery();\n const typeEvent = getTypeEvent(event);\n const inNamespace = event !== typeEvent;\n let jQueryEvent = null;\n let bubbles = true;\n let nativeDispatch = true;\n let defaultPrevented = false;\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args);\n $(element).trigger(jQueryEvent);\n bubbles = !jQueryEvent.isPropagationStopped();\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();\n defaultPrevented = jQueryEvent.isDefaultPrevented();\n }\n const evt = hydrateObj(new Event(event, {\n bubbles,\n cancelable: true\n }), args);\n if (defaultPrevented) {\n evt.preventDefault();\n }\n if (nativeDispatch) {\n element.dispatchEvent(evt);\n }\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault();\n }\n return evt;\n }\n};\nfunction hydrateObj(obj, meta = {}) {\n for (const [key, value] of Object.entries(meta)) {\n try {\n obj[key] = value;\n } catch (_unused) {\n Object.defineProperty(obj, key, {\n configurable: true,\n get() {\n return value;\n }\n });\n }\n }\n return obj;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nfunction normalizeData(value) {\n if (value === 'true') {\n return true;\n }\n if (value === 'false') {\n return false;\n }\n if (value === Number(value).toString()) {\n return Number(value);\n }\n if (value === '' || value === 'null') {\n return null;\n }\n if (typeof value !== 'string') {\n return value;\n }\n try {\n return JSON.parse(decodeURIComponent(value));\n } catch (_unused) {\n return value;\n }\n}\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);\n}\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);\n },\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);\n },\n getDataAttributes(element) {\n if (!element) {\n return {};\n }\n const attributes = {};\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '');\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);\n attributes[pureKey] = normalizeData(element.dataset[key]);\n }\n return attributes;\n },\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {};\n }\n static get DefaultType() {\n return {};\n }\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!');\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n return config;\n }\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse\n\n return {\n ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n };\n }\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const [property, expectedTypes] of Object.entries(configTypes)) {\n const value = config[property];\n const valueType = isElement(value) ? 'element' : toType(value);\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`);\n }\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst VERSION = '5.3.3';\n\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super();\n element = getElement(element);\n if (!element) {\n return;\n }\n this._element = element;\n this._config = this._getConfig(config);\n Data.set(this._element, this.constructor.DATA_KEY, this);\n }\n\n // Public\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY);\n EventHandler.off(this._element, this.constructor.EVENT_KEY);\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null;\n }\n }\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated);\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n\n // Static\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY);\n }\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);\n }\n static get VERSION() {\n return VERSION;\n }\n static get DATA_KEY() {\n return `bs.${this.NAME}`;\n }\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`;\n }\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target');\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href');\n\n // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {\n return null;\n }\n\n // Just in case some CMS puts out a full URL with the anchor appended\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`;\n }\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null;\n }\n return selector ? selector.split(',').map(sel => parseSelector(sel)).join(',') : null;\n};\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector));\n },\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector);\n },\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector));\n },\n parents(element, selector) {\n const parents = [];\n let ancestor = element.parentNode.closest(selector);\n while (ancestor) {\n parents.push(ancestor);\n ancestor = ancestor.parentNode.closest(selector);\n }\n return parents;\n },\n prev(element, selector) {\n let previous = element.previousElementSibling;\n while (previous) {\n if (previous.matches(selector)) {\n return [previous];\n }\n previous = previous.previousElementSibling;\n }\n return [];\n },\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling;\n while (next) {\n if (next.matches(selector)) {\n return [next];\n }\n next = next.nextElementSibling;\n }\n return [];\n },\n focusableChildren(element) {\n const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable=\"true\"]'].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',');\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));\n },\n getSelectorFromElement(element) {\n const selector = getSelector(element);\n if (selector) {\n return SelectorEngine.findOne(selector) ? selector : null;\n }\n return null;\n },\n getElementFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.findOne(selector) : null;\n },\n getMultipleElementsFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.find(selector) : [];\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`;\n const name = component.NAME;\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n const target = SelectorEngine.getElementFromSelector(this) || this.closest(`.${name}`);\n const instance = component.getOrCreateInstance(target);\n\n // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n instance[method]();\n });\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$f = 'alert';\nconst DATA_KEY$a = 'bs.alert';\nconst EVENT_KEY$b = `.${DATA_KEY$a}`;\nconst EVENT_CLOSE = `close${EVENT_KEY$b}`;\nconst EVENT_CLOSED = `closed${EVENT_KEY$b}`;\nconst CLASS_NAME_FADE$5 = 'fade';\nconst CLASS_NAME_SHOW$8 = 'show';\n\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$f;\n }\n\n // Public\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);\n if (closeEvent.defaultPrevented) {\n return;\n }\n this._element.classList.remove(CLASS_NAME_SHOW$8);\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated);\n }\n\n // Private\n _destroyElement() {\n this._element.remove();\n EventHandler.trigger(this._element, EVENT_CLOSED);\n this.dispose();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nenableDismissTrigger(Alert, 'close');\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$e = 'button';\nconst DATA_KEY$9 = 'bs.button';\nconst EVENT_KEY$a = `.${DATA_KEY$9}`;\nconst DATA_API_KEY$6 = '.data-api';\nconst CLASS_NAME_ACTIVE$3 = 'active';\nconst SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle=\"button\"]';\nconst EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;\n\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$e;\n }\n\n // Public\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this);\n if (config === 'toggle') {\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {\n event.preventDefault();\n const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);\n const data = Button.getOrCreateInstance(button);\n data.toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$d = 'swipe';\nconst EVENT_KEY$9 = '.bs.swipe';\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;\nconst POINTER_TYPE_TOUCH = 'touch';\nconst POINTER_TYPE_PEN = 'pen';\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event';\nconst SWIPE_THRESHOLD = 40;\nconst Default$c = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n};\nconst DefaultType$c = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n};\n\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super();\n this._element = element;\n if (!element || !Swipe.isSupported()) {\n return;\n }\n this._config = this._getConfig(config);\n this._deltaX = 0;\n this._supportPointerEvents = Boolean(window.PointerEvent);\n this._initEvents();\n }\n\n // Getters\n static get Default() {\n return Default$c;\n }\n static get DefaultType() {\n return DefaultType$c;\n }\n static get NAME() {\n return NAME$d;\n }\n\n // Public\n dispose() {\n EventHandler.off(this._element, EVENT_KEY$9);\n }\n\n // Private\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX;\n return;\n }\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX;\n }\n }\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX;\n }\n this._handleSwipe();\n execute(this._config.endCallback);\n }\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;\n }\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX);\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return;\n }\n const direction = absDeltaX / this._deltaX;\n this._deltaX = 0;\n if (!direction) {\n return;\n }\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);\n }\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));\n this._element.classList.add(CLASS_NAME_POINTER_EVENT);\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));\n }\n }\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);\n }\n\n // Static\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$c = 'carousel';\nconst DATA_KEY$8 = 'bs.carousel';\nconst EVENT_KEY$8 = `.${DATA_KEY$8}`;\nconst DATA_API_KEY$5 = '.data-api';\nconst ARROW_LEFT_KEY$1 = 'ArrowLeft';\nconst ARROW_RIGHT_KEY$1 = 'ArrowRight';\nconst TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next';\nconst ORDER_PREV = 'prev';\nconst DIRECTION_LEFT = 'left';\nconst DIRECTION_RIGHT = 'right';\nconst EVENT_SLIDE = `slide${EVENT_KEY$8}`;\nconst EVENT_SLID = `slid${EVENT_KEY$8}`;\nconst EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;\nconst EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;\nconst EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;\nconst EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst CLASS_NAME_CAROUSEL = 'carousel';\nconst CLASS_NAME_ACTIVE$2 = 'active';\nconst CLASS_NAME_SLIDE = 'slide';\nconst CLASS_NAME_END = 'carousel-item-end';\nconst CLASS_NAME_START = 'carousel-item-start';\nconst CLASS_NAME_NEXT = 'carousel-item-next';\nconst CLASS_NAME_PREV = 'carousel-item-prev';\nconst SELECTOR_ACTIVE = '.active';\nconst SELECTOR_ITEM = '.carousel-item';\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;\nconst SELECTOR_ITEM_IMG = '.carousel-item img';\nconst SELECTOR_INDICATORS = '.carousel-indicators';\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]';\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT\n};\nconst Default$b = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n};\nconst DefaultType$b = {\n interval: '(number|boolean)',\n // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._interval = null;\n this._activeElement = null;\n this._isSliding = false;\n this.touchTimeout = null;\n this._swipeHelper = null;\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);\n this._addEventListeners();\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$b;\n }\n static get DefaultType() {\n return DefaultType$b;\n }\n static get NAME() {\n return NAME$c;\n }\n\n // Public\n next() {\n this._slide(ORDER_NEXT);\n }\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next();\n }\n }\n prev() {\n this._slide(ORDER_PREV);\n }\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element);\n }\n this._clearInterval();\n }\n cycle() {\n this._clearInterval();\n this._updateInterval();\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);\n }\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle());\n return;\n }\n this.cycle();\n }\n to(index) {\n const items = this._getItems();\n if (index > items.length - 1 || index < 0) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index));\n return;\n }\n const activeIndex = this._getItemIndex(this._getActive());\n if (activeIndex === index) {\n return;\n }\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;\n this._slide(order, items[index]);\n }\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose();\n }\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n config.defaultInterval = config.interval;\n return config;\n }\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));\n }\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());\n EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());\n }\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners();\n }\n }\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());\n }\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return;\n }\n\n // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n this.pause();\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout);\n }\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);\n };\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n };\n this._swipeHelper = new Swipe(this._element, swipeConfig);\n }\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return;\n }\n const direction = KEY_TO_DIRECTION[event.key];\n if (direction) {\n event.preventDefault();\n this._slide(this._directionToOrder(direction));\n }\n }\n _getItemIndex(element) {\n return this._getItems().indexOf(element);\n }\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return;\n }\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);\n activeIndicator.removeAttribute('aria-current');\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement);\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);\n newActiveIndicator.setAttribute('aria-current', 'true');\n }\n }\n _updateInterval() {\n const element = this._activeElement || this._getActive();\n if (!element) {\n return;\n }\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);\n this._config.interval = elementInterval || this._config.defaultInterval;\n }\n _slide(order, element = null) {\n if (this._isSliding) {\n return;\n }\n const activeElement = this._getActive();\n const isNext = order === ORDER_NEXT;\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);\n if (nextElement === activeElement) {\n return;\n }\n const nextElementIndex = this._getItemIndex(nextElement);\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n });\n };\n const slideEvent = triggerEvent(EVENT_SLIDE);\n if (slideEvent.defaultPrevented) {\n return;\n }\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // TODO: change tests that use empty divs to avoid this check\n return;\n }\n const isCycling = Boolean(this._interval);\n this.pause();\n this._isSliding = true;\n this._setActiveIndicatorElement(nextElementIndex);\n this._activeElement = nextElement;\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;\n nextElement.classList.add(orderClassName);\n reflow(nextElement);\n activeElement.classList.add(directionalClassName);\n nextElement.classList.add(directionalClassName);\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName);\n nextElement.classList.add(CLASS_NAME_ACTIVE$2);\n activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);\n this._isSliding = false;\n triggerEvent(EVENT_SLID);\n };\n this._queueCallback(completeCallBack, activeElement, this._isAnimated());\n if (isCycling) {\n this.cycle();\n }\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE);\n }\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);\n }\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element);\n }\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval);\n this._interval = null;\n }\n }\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;\n }\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;\n }\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;\n }\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config);\n if (typeof config === 'number') {\n data.to(config);\n return;\n }\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return;\n }\n event.preventDefault();\n const carousel = Carousel.getOrCreateInstance(target);\n const slideIndex = this.getAttribute('data-bs-slide-to');\n if (slideIndex) {\n carousel.to(slideIndex);\n carousel._maybeEnableCycle();\n return;\n }\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next();\n carousel._maybeEnableCycle();\n return;\n }\n carousel.prev();\n carousel._maybeEnableCycle();\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel);\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$b = 'collapse';\nconst DATA_KEY$7 = 'bs.collapse';\nconst EVENT_KEY$7 = `.${DATA_KEY$7}`;\nconst DATA_API_KEY$4 = '.data-api';\nconst EVENT_SHOW$6 = `show${EVENT_KEY$7}`;\nconst EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;\nconst EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;\nconst EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;\nconst EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;\nconst CLASS_NAME_SHOW$7 = 'show';\nconst CLASS_NAME_COLLAPSE = 'collapse';\nconst CLASS_NAME_COLLAPSING = 'collapsing';\nconst CLASS_NAME_COLLAPSED = 'collapsed';\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal';\nconst WIDTH = 'width';\nconst HEIGHT = 'height';\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';\nconst SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle=\"collapse\"]';\nconst Default$a = {\n parent: null,\n toggle: true\n};\nconst DefaultType$a = {\n parent: '(null|element)',\n toggle: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isTransitioning = false;\n this._triggerArray = [];\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);\n for (const elem of toggleList) {\n const selector = SelectorEngine.getSelectorFromElement(elem);\n const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem);\n }\n }\n this._initializeChildren();\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());\n }\n if (this._config.toggle) {\n this.toggle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$a;\n }\n static get DefaultType() {\n return DefaultType$a;\n }\n static get NAME() {\n return NAME$b;\n }\n\n // Public\n toggle() {\n if (this._isShown()) {\n this.hide();\n } else {\n this.show();\n }\n }\n show() {\n if (this._isTransitioning || this._isShown()) {\n return;\n }\n let activeChildren = [];\n\n // find active children\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {\n toggle: false\n }));\n }\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n for (const activeInstance of activeChildren) {\n activeInstance.hide();\n }\n const dimension = this._getDimension();\n this._element.classList.remove(CLASS_NAME_COLLAPSE);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.style[dimension] = 0;\n this._addAriaAndCollapsedClass(this._triggerArray, true);\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n this._element.style[dimension] = '';\n EventHandler.trigger(this._element, EVENT_SHOWN$6);\n };\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);\n const scrollSize = `scroll${capitalizedDimension}`;\n this._queueCallback(complete, this._element, true);\n this._element.style[dimension] = `${this._element[scrollSize]}px`;\n }\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n const dimension = this._getDimension();\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n for (const trigger of this._triggerArray) {\n const element = SelectorEngine.getElementFromSelector(trigger);\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false);\n }\n }\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE);\n EventHandler.trigger(this._element, EVENT_HIDDEN$6);\n };\n this._element.style[dimension] = '';\n this._queueCallback(complete, this._element, true);\n }\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW$7);\n }\n\n // Private\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle); // Coerce string values\n config.parent = getElement(config.parent);\n return config;\n }\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;\n }\n _initializeChildren() {\n if (!this._config.parent) {\n return;\n }\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);\n for (const element of children) {\n const selected = SelectorEngine.getElementFromSelector(element);\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected));\n }\n }\n }\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent);\n // remove children if greater depth\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));\n }\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return;\n }\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);\n element.setAttribute('aria-expanded', isOpen);\n }\n }\n\n // Static\n static jQueryInterface(config) {\n const _config = {};\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false;\n }\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config);\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {\n event.preventDefault();\n }\n for (const element of SelectorEngine.getMultipleElementsFromSelector(this)) {\n Collapse.getOrCreateInstance(element, {\n toggle: false\n }).toggle();\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$a = 'dropdown';\nconst DATA_KEY$6 = 'bs.dropdown';\nconst EVENT_KEY$6 = `.${DATA_KEY$6}`;\nconst DATA_API_KEY$3 = '.data-api';\nconst ESCAPE_KEY$2 = 'Escape';\nconst TAB_KEY$1 = 'Tab';\nconst ARROW_UP_KEY$1 = 'ArrowUp';\nconst ARROW_DOWN_KEY$1 = 'ArrowDown';\nconst RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;\nconst EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;\nconst EVENT_SHOW$5 = `show${EVENT_KEY$6}`;\nconst EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;\nconst EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst CLASS_NAME_SHOW$6 = 'show';\nconst CLASS_NAME_DROPUP = 'dropup';\nconst CLASS_NAME_DROPEND = 'dropend';\nconst CLASS_NAME_DROPSTART = 'dropstart';\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center';\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';\nconst SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)';\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;\nconst SELECTOR_MENU = '.dropdown-menu';\nconst SELECTOR_NAVBAR = '.navbar';\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav';\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';\nconst PLACEMENT_TOPCENTER = 'top';\nconst PLACEMENT_BOTTOMCENTER = 'bottom';\nconst Default$9 = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n};\nconst DefaultType$9 = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n};\n\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._popper = null;\n this._parent = this._element.parentNode; // dropdown wrapper\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);\n this._inNavbar = this._detectNavbar();\n }\n\n // Getters\n static get Default() {\n return Default$9;\n }\n static get DefaultType() {\n return DefaultType$9;\n }\n static get NAME() {\n return NAME$a;\n }\n\n // Public\n toggle() {\n return this._isShown() ? this.hide() : this.show();\n }\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);\n if (showEvent.defaultPrevented) {\n return;\n }\n this._createPopper();\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n this._element.focus();\n this._element.setAttribute('aria-expanded', true);\n this._menu.classList.add(CLASS_NAME_SHOW$6);\n this._element.classList.add(CLASS_NAME_SHOW$6);\n EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);\n }\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n this._completeHide(relatedTarget);\n }\n dispose() {\n if (this._popper) {\n this._popper.destroy();\n }\n super.dispose();\n }\n update() {\n this._inNavbar = this._detectNavbar();\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Private\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n if (this._popper) {\n this._popper.destroy();\n }\n this._menu.classList.remove(CLASS_NAME_SHOW$6);\n this._element.classList.remove(CLASS_NAME_SHOW$6);\n this._element.setAttribute('aria-expanded', 'false');\n Manipulator.removeDataAttribute(this._menu, 'popper');\n EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);\n }\n _getConfig(config) {\n config = super._getConfig(config);\n if (typeof config.reference === 'object' && !isElement(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME$a.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`);\n }\n return config;\n }\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)');\n }\n let referenceElement = this._element;\n if (this._config.reference === 'parent') {\n referenceElement = this._parent;\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference);\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference;\n }\n const popperConfig = this._getPopperConfig();\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig);\n }\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW$6);\n }\n _getPlacement() {\n const parentDropdown = this._parent;\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER;\n }\n\n // We need to trim the value because custom properties can also include spaces\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;\n }\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;\n }\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null;\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n };\n\n // Disable Popper if we have a static display or Dropdown is in Navbar\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // TODO: v6 remove\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }];\n }\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _selectMenuItem({\n key,\n target\n }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));\n if (!items.length) {\n return;\n }\n\n // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {\n return;\n }\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle);\n if (!context || context._config.autoClose === false) {\n continue;\n }\n const composedPath = event.composedPath();\n const isMenuTarget = composedPath.includes(context._menu);\n if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {\n continue;\n }\n\n // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue;\n }\n const relatedTarget = {\n relatedTarget: context._element\n };\n if (event.type === 'click') {\n relatedTarget.clickEvent = event;\n }\n context._completeHide(relatedTarget);\n }\n }\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n\n const isInput = /input|textarea/i.test(event.target.tagName);\n const isEscapeEvent = event.key === ESCAPE_KEY$2;\n const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return;\n }\n if (isInput && !isEscapeEvent) {\n return;\n }\n event.preventDefault();\n\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);\n const instance = Dropdown.getOrCreateInstance(getToggleButton);\n if (isUpOrDownEvent) {\n event.stopPropagation();\n instance.show();\n instance._selectMenuItem(event);\n return;\n }\n if (instance._isShown()) {\n // else is escape and we check if it is shown\n event.stopPropagation();\n instance.hide();\n getToggleButton.focus();\n }\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {\n event.preventDefault();\n Dropdown.getOrCreateInstance(this).toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$9 = 'backdrop';\nconst CLASS_NAME_FADE$4 = 'fade';\nconst CLASS_NAME_SHOW$5 = 'show';\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;\nconst Default$8 = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true,\n // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n};\nconst DefaultType$8 = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n};\n\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isAppended = false;\n this._element = null;\n }\n\n // Getters\n static get Default() {\n return Default$8;\n }\n static get DefaultType() {\n return DefaultType$8;\n }\n static get NAME() {\n return NAME$9;\n }\n\n // Public\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._append();\n const element = this._getElement();\n if (this._config.isAnimated) {\n reflow(element);\n }\n element.classList.add(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n execute(callback);\n });\n }\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._getElement().classList.remove(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n this.dispose();\n execute(callback);\n });\n }\n dispose() {\n if (!this._isAppended) {\n return;\n }\n EventHandler.off(this._element, EVENT_MOUSEDOWN);\n this._element.remove();\n this._isAppended = false;\n }\n\n // Private\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div');\n backdrop.className = this._config.className;\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE$4);\n }\n this._element = backdrop;\n }\n return this._element;\n }\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement);\n return config;\n }\n _append() {\n if (this._isAppended) {\n return;\n }\n const element = this._getElement();\n this._config.rootElement.append(element);\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback);\n });\n this._isAppended = true;\n }\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated);\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$8 = 'focustrap';\nconst DATA_KEY$5 = 'bs.focustrap';\nconst EVENT_KEY$5 = `.${DATA_KEY$5}`;\nconst EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;\nconst TAB_KEY = 'Tab';\nconst TAB_NAV_FORWARD = 'forward';\nconst TAB_NAV_BACKWARD = 'backward';\nconst Default$7 = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n};\nconst DefaultType$7 = {\n autofocus: 'boolean',\n trapElement: 'element'\n};\n\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isActive = false;\n this._lastTabNavDirection = null;\n }\n\n // Getters\n static get Default() {\n return Default$7;\n }\n static get DefaultType() {\n return DefaultType$7;\n }\n static get NAME() {\n return NAME$8;\n }\n\n // Public\n activate() {\n if (this._isActive) {\n return;\n }\n if (this._config.autofocus) {\n this._config.trapElement.focus();\n }\n EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop\n EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));\n this._isActive = true;\n }\n deactivate() {\n if (!this._isActive) {\n return;\n }\n this._isActive = false;\n EventHandler.off(document, EVENT_KEY$5);\n }\n\n // Private\n _handleFocusin(event) {\n const {\n trapElement\n } = this._config;\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return;\n }\n const elements = SelectorEngine.focusableChildren(trapElement);\n if (elements.length === 0) {\n trapElement.focus();\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus();\n } else {\n elements[0].focus();\n }\n }\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return;\n }\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';\nconst SELECTOR_STICKY_CONTENT = '.sticky-top';\nconst PROPERTY_PADDING = 'padding-right';\nconst PROPERTY_MARGIN = 'margin-right';\n\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body;\n }\n\n // Public\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth;\n return Math.abs(window.innerWidth - documentWidth);\n }\n hide() {\n const width = this.getWidth();\n this._disableOverFlow();\n // give padding to element to balance the hidden scrollbar width\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);\n }\n reset() {\n this._resetElementAttributes(this._element, 'overflow');\n this._resetElementAttributes(this._element, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);\n }\n isOverflowing() {\n return this.getWidth() > 0;\n }\n\n // Private\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow');\n this._element.style.overflow = 'hidden';\n }\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth();\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return;\n }\n this._saveInitialAttribute(element, styleProperty);\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty);\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue);\n }\n }\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty);\n // We only want to remove the property if the value is `null`; the value can also be zero\n if (value === null) {\n element.style.removeProperty(styleProperty);\n return;\n }\n Manipulator.removeDataAttribute(element, styleProperty);\n element.style.setProperty(styleProperty, value);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector);\n return;\n }\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel);\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$7 = 'modal';\nconst DATA_KEY$4 = 'bs.modal';\nconst EVENT_KEY$4 = `.${DATA_KEY$4}`;\nconst DATA_API_KEY$2 = '.data-api';\nconst ESCAPE_KEY$1 = 'Escape';\nconst EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;\nconst EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;\nconst EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;\nconst EVENT_SHOW$4 = `show${EVENT_KEY$4}`;\nconst EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;\nconst EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;\nconst EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;\nconst EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;\nconst CLASS_NAME_OPEN = 'modal-open';\nconst CLASS_NAME_FADE$3 = 'fade';\nconst CLASS_NAME_SHOW$4 = 'show';\nconst CLASS_NAME_STATIC = 'modal-static';\nconst OPEN_SELECTOR$1 = '.modal.show';\nconst SELECTOR_DIALOG = '.modal-dialog';\nconst SELECTOR_MODAL_BODY = '.modal-body';\nconst SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle=\"modal\"]';\nconst Default$6 = {\n backdrop: true,\n focus: true,\n keyboard: true\n};\nconst DefaultType$6 = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._isShown = false;\n this._isTransitioning = false;\n this._scrollBar = new ScrollBarHelper();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$6;\n }\n static get DefaultType() {\n return DefaultType$6;\n }\n static get NAME() {\n return NAME$7;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._isTransitioning = true;\n this._scrollBar.hide();\n document.body.classList.add(CLASS_NAME_OPEN);\n this._adjustDialog();\n this._backdrop.show(() => this._showElement(relatedTarget));\n }\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._isShown = false;\n this._isTransitioning = true;\n this._focustrap.deactivate();\n this._element.classList.remove(CLASS_NAME_SHOW$4);\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());\n }\n dispose() {\n EventHandler.off(window, EVENT_KEY$4);\n EventHandler.off(this._dialog, EVENT_KEY$4);\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n handleUpdate() {\n this._adjustDialog();\n }\n\n // Private\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop),\n // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element);\n }\n this._element.style.display = 'block';\n this._element.removeAttribute('aria-hidden');\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.scrollTop = 0;\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);\n if (modalBody) {\n modalBody.scrollTop = 0;\n }\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_SHOW$4);\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate();\n }\n this._isTransitioning = false;\n EventHandler.trigger(this._element, EVENT_SHOWN$4, {\n relatedTarget\n });\n };\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated());\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {\n if (event.key !== ESCAPE_KEY$1) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n this._triggerBackdropTransition();\n });\n EventHandler.on(window, EVENT_RESIZE$1, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog();\n }\n });\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return;\n }\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition();\n return;\n }\n if (this._config.backdrop) {\n this.hide();\n }\n });\n });\n }\n _hideModal() {\n this._element.style.display = 'none';\n this._element.setAttribute('aria-hidden', true);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n this._isTransitioning = false;\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN);\n this._resetAdjustments();\n this._scrollBar.reset();\n EventHandler.trigger(this._element, EVENT_HIDDEN$4);\n });\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE$3);\n }\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);\n if (hideEvent.defaultPrevented) {\n return;\n }\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const initialOverflowY = this._element.style.overflowY;\n // return if the following background transition hasn't yet completed\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return;\n }\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden';\n }\n this._element.classList.add(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY;\n }, this._dialog);\n }, this._dialog);\n this._element.focus();\n }\n\n /**\n * The following methods are used to handle overflowing modals\n */\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const scrollbarWidth = this._scrollBar.getWidth();\n const isBodyOverflowing = scrollbarWidth > 0;\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n }\n _resetAdjustments() {\n this._element.style.paddingLeft = '';\n this._element.style.paddingRight = '';\n }\n\n // Static\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](relatedTarget);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n EventHandler.one(target, EVENT_SHOW$4, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$4, () => {\n if (isVisible(this)) {\n this.focus();\n }\n });\n });\n\n // avoid conflict when clicking modal toggler while another one is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide();\n }\n const data = Modal.getOrCreateInstance(target);\n data.toggle(this);\n});\nenableDismissTrigger(Modal);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$6 = 'offcanvas';\nconst DATA_KEY$3 = 'bs.offcanvas';\nconst EVENT_KEY$3 = `.${DATA_KEY$3}`;\nconst DATA_API_KEY$1 = '.data-api';\nconst EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst ESCAPE_KEY = 'Escape';\nconst CLASS_NAME_SHOW$3 = 'show';\nconst CLASS_NAME_SHOWING$1 = 'showing';\nconst CLASS_NAME_HIDING = 'hiding';\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop';\nconst OPEN_SELECTOR = '.offcanvas.show';\nconst EVENT_SHOW$3 = `show${EVENT_KEY$3}`;\nconst EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;\nconst EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;\nconst EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;\nconst EVENT_RESIZE = `resize${EVENT_KEY$3}`;\nconst EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;\nconst SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle=\"offcanvas\"]';\nconst Default$5 = {\n backdrop: true,\n keyboard: true,\n scroll: false\n};\nconst DefaultType$5 = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isShown = false;\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$5;\n }\n static get DefaultType() {\n return DefaultType$5;\n }\n static get NAME() {\n return NAME$6;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._backdrop.show();\n if (!this._config.scroll) {\n new ScrollBarHelper().hide();\n }\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.classList.add(CLASS_NAME_SHOWING$1);\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate();\n }\n this._element.classList.add(CLASS_NAME_SHOW$3);\n this._element.classList.remove(CLASS_NAME_SHOWING$1);\n EventHandler.trigger(this._element, EVENT_SHOWN$3, {\n relatedTarget\n });\n };\n this._queueCallback(completeCallBack, this._element, true);\n }\n hide() {\n if (!this._isShown) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._focustrap.deactivate();\n this._element.blur();\n this._isShown = false;\n this._element.classList.add(CLASS_NAME_HIDING);\n this._backdrop.hide();\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n if (!this._config.scroll) {\n new ScrollBarHelper().reset();\n }\n EventHandler.trigger(this._element, EVENT_HIDDEN$3);\n };\n this._queueCallback(completeCallback, this._element, true);\n }\n dispose() {\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n\n // Private\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n this.hide();\n };\n\n // 'static' option will be translated to true, and booleans will keep their value\n const isVisible = Boolean(this._config.backdrop);\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n });\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$3, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus();\n }\n });\n\n // avoid conflict when clicking a toggler of an offcanvas, while another is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide();\n }\n const data = Offcanvas.getOrCreateInstance(target);\n data.toggle(this);\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show();\n }\n});\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide();\n }\n }\n});\nenableDismissTrigger(Offcanvas);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n// js-docs-start allow-list\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i;\nconst DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n dd: [],\n div: [],\n dl: [],\n dt: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n};\n// js-docs-end allow-list\n\nconst uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);\n\n/**\n * A pattern that recognizes URLs that are safe wrt. XSS in URL navigation\n * contexts.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/15.2.8/packages/core/src/sanitization/url_sanitizer.ts#L38\n */\n// eslint-disable-next-line unicorn/better-regex\nconst SAFE_URL_PATTERN = /^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i;\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase();\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue));\n }\n return true;\n }\n\n // Check if a regular expression validates the attribute.\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));\n};\nfunction sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml;\n }\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml);\n }\n const domParser = new window.DOMParser();\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'));\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase();\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove();\n continue;\n }\n const attributeList = [].concat(...element.attributes);\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName);\n }\n }\n }\n return createdDocument.body.innerHTML;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$5 = 'TemplateFactory';\nconst Default$4 = {\n allowList: DefaultAllowlist,\n content: {},\n // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n};\nconst DefaultType$4 = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n};\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n};\n\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n }\n\n // Getters\n static get Default() {\n return Default$4;\n }\n static get DefaultType() {\n return DefaultType$4;\n }\n static get NAME() {\n return NAME$5;\n }\n\n // Public\n getContent() {\n return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);\n }\n hasContent() {\n return this.getContent().length > 0;\n }\n changeContent(content) {\n this._checkContent(content);\n this._config.content = {\n ...this._config.content,\n ...content\n };\n return this;\n }\n toHtml() {\n const templateWrapper = document.createElement('div');\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template);\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector);\n }\n const template = templateWrapper.children[0];\n const extraClass = this._resolvePossibleFunction(this._config.extraClass);\n if (extraClass) {\n template.classList.add(...extraClass.split(' '));\n }\n return template;\n }\n\n // Private\n _typeCheckConfig(config) {\n super._typeCheckConfig(config);\n this._checkContent(config.content);\n }\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({\n selector,\n entry: content\n }, DefaultContentType);\n }\n }\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template);\n if (!templateElement) {\n return;\n }\n content = this._resolvePossibleFunction(content);\n if (!content) {\n templateElement.remove();\n return;\n }\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement);\n return;\n }\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content);\n return;\n }\n templateElement.textContent = content;\n }\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this]);\n }\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = '';\n templateElement.append(element);\n return;\n }\n templateElement.textContent = element.textContent;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$4 = 'tooltip';\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);\nconst CLASS_NAME_FADE$2 = 'fade';\nconst CLASS_NAME_MODAL = 'modal';\nconst CLASS_NAME_SHOW$2 = 'show';\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner';\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;\nconst EVENT_MODAL_HIDE = 'hide.bs.modal';\nconst TRIGGER_HOVER = 'hover';\nconst TRIGGER_FOCUS = 'focus';\nconst TRIGGER_CLICK = 'click';\nconst TRIGGER_MANUAL = 'manual';\nconst EVENT_HIDE$2 = 'hide';\nconst EVENT_HIDDEN$2 = 'hidden';\nconst EVENT_SHOW$2 = 'show';\nconst EVENT_SHOWN$2 = 'shown';\nconst EVENT_INSERTED = 'inserted';\nconst EVENT_CLICK$1 = 'click';\nconst EVENT_FOCUSIN$1 = 'focusin';\nconst EVENT_FOCUSOUT$1 = 'focusout';\nconst EVENT_MOUSEENTER = 'mouseenter';\nconst EVENT_MOUSELEAVE = 'mouseleave';\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n};\nconst Default$3 = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 6],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '
' + '
' + '
' + '
',\n title: '',\n trigger: 'hover focus'\n};\nconst DefaultType$3 = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n};\n\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)');\n }\n super(element, config);\n\n // Private\n this._isEnabled = true;\n this._timeout = 0;\n this._isHovered = null;\n this._activeTrigger = {};\n this._popper = null;\n this._templateFactory = null;\n this._newContent = null;\n\n // Protected\n this.tip = null;\n this._setListeners();\n if (!this._config.selector) {\n this._fixTitle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$3;\n }\n static get DefaultType() {\n return DefaultType$3;\n }\n static get NAME() {\n return NAME$4;\n }\n\n // Public\n enable() {\n this._isEnabled = true;\n }\n disable() {\n this._isEnabled = false;\n }\n toggleEnabled() {\n this._isEnabled = !this._isEnabled;\n }\n toggle() {\n if (!this._isEnabled) {\n return;\n }\n this._activeTrigger.click = !this._activeTrigger.click;\n if (this._isShown()) {\n this._leave();\n return;\n }\n this._enter();\n }\n dispose() {\n clearTimeout(this._timeout);\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));\n }\n this._disposePopper();\n super.dispose();\n }\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements');\n }\n if (!(this._isWithContent() && this._isEnabled)) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));\n const shadowRoot = findShadowRoot(this._element);\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);\n if (showEvent.defaultPrevented || !isInTheDom) {\n return;\n }\n\n // TODO: v6 remove this or make it optional\n this._disposePopper();\n const tip = this._getTipElement();\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'));\n const {\n container\n } = this._config;\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip);\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));\n }\n this._popper = this._createPopper(tip);\n tip.classList.add(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));\n if (this._isHovered === false) {\n this._leave();\n }\n this._isHovered = false;\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n hide() {\n if (!this._isShown()) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));\n if (hideEvent.defaultPrevented) {\n return;\n }\n const tip = this._getTipElement();\n tip.classList.remove(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n this._activeTrigger[TRIGGER_CLICK] = false;\n this._activeTrigger[TRIGGER_FOCUS] = false;\n this._activeTrigger[TRIGGER_HOVER] = false;\n this._isHovered = null; // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return;\n }\n if (!this._isHovered) {\n this._disposePopper();\n }\n this._element.removeAttribute('aria-describedby');\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n update() {\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Protected\n _isWithContent() {\n return Boolean(this._getTitle());\n }\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());\n }\n return this.tip;\n }\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml();\n\n // TODO: remove this check in v6\n if (!tip) {\n return null;\n }\n tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2);\n // TODO: v6 the following can be achieved with CSS only\n tip.classList.add(`bs-${this.constructor.NAME}-auto`);\n const tipId = getUID(this.constructor.NAME).toString();\n tip.setAttribute('id', tipId);\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE$2);\n }\n return tip;\n }\n setContent(content) {\n this._newContent = content;\n if (this._isShown()) {\n this._disposePopper();\n this.show();\n }\n }\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content);\n } else {\n this._templateFactory = new TemplateFactory({\n ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n });\n }\n return this._templateFactory;\n }\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n };\n }\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');\n }\n\n // Private\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());\n }\n _isAnimated() {\n return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);\n }\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);\n }\n _createPopper(tip) {\n const placement = execute(this._config.placement, [this, tip, this._element]);\n const attachment = AttachmentMap[placement.toUpperCase()];\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment));\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this._element]);\n }\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [{\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }, {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n }, {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement);\n }\n }]\n };\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _setListeners() {\n const triggers = this._config.trigger.split(' ');\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context.toggle();\n });\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);\n const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;\n context._enter();\n });\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);\n context._leave();\n });\n }\n }\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide();\n }\n };\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n }\n _fixTitle() {\n const title = this._element.getAttribute('title');\n if (!title) {\n return;\n }\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title);\n }\n this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility\n this._element.removeAttribute('title');\n }\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true;\n return;\n }\n this._isHovered = true;\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show();\n }\n }, this._config.delay.show);\n }\n _leave() {\n if (this._isWithActiveTrigger()) {\n return;\n }\n this._isHovered = false;\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide();\n }\n }, this._config.delay.hide);\n }\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout);\n this._timeout = setTimeout(handler, timeout);\n }\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true);\n }\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element);\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute];\n }\n }\n config = {\n ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n };\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container);\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n }\n if (typeof config.title === 'number') {\n config.title = config.title.toString();\n }\n if (typeof config.content === 'number') {\n config.content = config.content.toString();\n }\n return config;\n }\n _getDelegateConfig() {\n const config = {};\n for (const [key, value] of Object.entries(this._config)) {\n if (this.constructor.Default[key] !== value) {\n config[key] = value;\n }\n }\n config.selector = false;\n config.trigger = 'manual';\n\n // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n return config;\n }\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy();\n this._popper = null;\n }\n if (this.tip) {\n this.tip.remove();\n this.tip = null;\n }\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Tooltip);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$3 = 'popover';\nconst SELECTOR_TITLE = '.popover-header';\nconst SELECTOR_CONTENT = '.popover-body';\nconst Default$2 = {\n ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '
' + '
' + '

' + '
' + '
',\n trigger: 'click'\n};\nconst DefaultType$2 = {\n ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n};\n\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default$2;\n }\n static get DefaultType() {\n return DefaultType$2;\n }\n static get NAME() {\n return NAME$3;\n }\n\n // Overrides\n _isWithContent() {\n return this._getTitle() || this._getContent();\n }\n\n // Private\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n };\n }\n _getContent() {\n return this._resolvePossibleFunction(this._config.content);\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Popover);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$2 = 'scrollspy';\nconst DATA_KEY$2 = 'bs.scrollspy';\nconst EVENT_KEY$2 = `.${DATA_KEY$2}`;\nconst DATA_API_KEY = '.data-api';\nconst EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;\nconst EVENT_CLICK = `click${EVENT_KEY$2}`;\nconst EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';\nconst CLASS_NAME_ACTIVE$1 = 'active';\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]';\nconst SELECTOR_TARGET_LINKS = '[href]';\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';\nconst SELECTOR_NAV_LINKS = '.nav-link';\nconst SELECTOR_NAV_ITEMS = '.nav-item';\nconst SELECTOR_LIST_ITEMS = '.list-group-item';\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;\nconst SELECTOR_DROPDOWN = '.dropdown';\nconst SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';\nconst Default$1 = {\n offset: null,\n // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n};\nconst DefaultType$1 = {\n offset: '(number|null)',\n // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n};\n\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n\n // this._element is the observablesContainer and config.target the menu links wrapper\n this._targetLinks = new Map();\n this._observableSections = new Map();\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;\n this._activeTarget = null;\n this._observer = null;\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n };\n this.refresh(); // initialize\n }\n\n // Getters\n static get Default() {\n return Default$1;\n }\n static get DefaultType() {\n return DefaultType$1;\n }\n static get NAME() {\n return NAME$2;\n }\n\n // Public\n refresh() {\n this._initializeTargetsAndObservables();\n this._maybeEnableSmoothScroll();\n if (this._observer) {\n this._observer.disconnect();\n } else {\n this._observer = this._getNewObserver();\n }\n for (const section of this._observableSections.values()) {\n this._observer.observe(section);\n }\n }\n dispose() {\n this._observer.disconnect();\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body;\n\n // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));\n }\n return config;\n }\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return;\n }\n\n // unregister any previous listeners\n EventHandler.off(this._config.target, EVENT_CLICK);\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash);\n if (observableSection) {\n event.preventDefault();\n const root = this._rootElement || window;\n const height = observableSection.offsetTop - this._element.offsetTop;\n if (root.scrollTo) {\n root.scrollTo({\n top: height,\n behavior: 'smooth'\n });\n return;\n }\n\n // Chrome 60 doesn't support `scrollTo`\n root.scrollTop = height;\n }\n });\n }\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n };\n return new IntersectionObserver(entries => this._observerCallback(entries), options);\n }\n\n // The logic of selection\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop;\n this._process(targetElement(entry));\n };\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;\n this._previousScrollData.parentScrollTop = parentScrollTop;\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null;\n this._clearActiveClass(targetElement(entry));\n continue;\n }\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop;\n // if we are scrolling down, pick the bigger offsetTop\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry);\n // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n if (!parentScrollTop) {\n return;\n }\n continue;\n }\n\n // if we are scrolling up, pick the smallest offsetTop\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry);\n }\n }\n }\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map();\n this._observableSections = new Map();\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue;\n }\n const observableSection = SelectorEngine.findOne(decodeURI(anchor.hash), this._element);\n\n // ensure that the observableSection exists & is visible\n if (isVisible(observableSection)) {\n this._targetLinks.set(decodeURI(anchor.hash), anchor);\n this._observableSections.set(anchor.hash, observableSection);\n }\n }\n }\n _process(target) {\n if (this._activeTarget === target) {\n return;\n }\n this._clearActiveClass(this._config.target);\n this._activeTarget = target;\n target.classList.add(CLASS_NAME_ACTIVE$1);\n this._activateParents(target);\n EventHandler.trigger(this._element, EVENT_ACTIVATE, {\n relatedTarget: target\n });\n }\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);\n return;\n }\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both