+
+
+
diff --git a/src/web_app/js/appcontroller.js b/src/web_app/js/appcontroller.js
index 9d7e74b40..c399259a8 100644
--- a/src/web_app/js/appcontroller.js
+++ b/src/web_app/js/appcontroller.js
@@ -8,7 +8,7 @@
/* More information about these options at jshint.com/docs/options */
-/* globals trace, InfoBox, setUpFullScreen, isFullScreen,
+/* globals trace, InfoBox, setUpFullScreen, isFullScreen, LibWebP,
RoomSelection, isChromeApp, $ */
/* exported AppController, remoteVideo */
@@ -28,12 +28,14 @@ var UI_CONSTANTS = {
icons: '#icons',
infoDiv: '#info-div',
localVideo: '#local-video',
+ miniCanvas: '#mini-canvas',
miniVideo: '#mini-video',
muteAudioSvg: '#mute-audio',
muteVideoSvg: '#mute-video',
newRoomButton: '#new-room-button',
newRoomLink: '#new-room-link',
privacyLinks: '#privacy',
+ remoteCanvas: '#remote-canvas',
remoteVideo: '#remote-video',
rejoinButton: '#rejoin-button',
rejoinDiv: '#rejoin-div',
@@ -51,16 +53,18 @@ var UI_CONSTANTS = {
};
// The controller that connects the Call with the UI.
-var AppController = function(loadingParams) {
+var AppController = function (loadingParams) {
trace('Initializing; server= ' + loadingParams.roomServer + '.');
trace('Initializing; room=' + loadingParams.roomId + '.');
this.hangupSvg_ = $(UI_CONSTANTS.hangupSvg);
this.icons_ = $(UI_CONSTANTS.icons);
this.localVideo_ = $(UI_CONSTANTS.localVideo);
+ this.miniCanvas_ = $(UI_CONSTANTS.miniCanvas);
this.miniVideo_ = $(UI_CONSTANTS.miniVideo);
this.sharingDiv_ = $(UI_CONSTANTS.sharingDiv);
this.statusDiv_ = $(UI_CONSTANTS.statusDiv);
+ this.remoteCanvas_ = $(UI_CONSTANTS.remoteCanvas);
this.remoteVideo_ = $(UI_CONSTANTS.remoteVideo);
this.videosDiv_ = $(UI_CONSTANTS.videosDiv);
this.roomLinkHref_ = $(UI_CONSTANTS.roomLinkHref);
@@ -70,21 +74,54 @@ var AppController = function(loadingParams) {
this.rejoinButton_ = $(UI_CONSTANTS.rejoinButton);
this.newRoomButton_ = $(UI_CONSTANTS.newRoomButton);
+ this.deactivate_(this.miniCanvas_);
+ this.deactivate_(this.remoteCanvas_);
+
this.newRoomButton_.addEventListener('click',
- this.onNewRoomClick_.bind(this), false);
+ this.onNewRoomClick_.bind(this), false);
this.rejoinButton_.addEventListener('click',
- this.onRejoinClick_.bind(this), false);
+ this.onRejoinClick_.bind(this), false);
this.muteAudioIconSet_ =
- new AppController.IconSet_(UI_CONSTANTS.muteAudioSvg);
+ new AppController.IconSet_(UI_CONSTANTS.muteAudioSvg);
this.muteVideoIconSet_ =
- new AppController.IconSet_(UI_CONSTANTS.muteVideoSvg);
+ new AppController.IconSet_(UI_CONSTANTS.muteVideoSvg);
this.fullscreenIconSet_ =
- new AppController.IconSet_(UI_CONSTANTS.fullscreenSvg);
+ new AppController.IconSet_(UI_CONSTANTS.fullscreenSvg);
this.loadingParams_ = loadingParams;
this.loadUrlParams_();
+ if (this.loadingParams_.libvpx) {
+ this.libvpx_ = new LibVPX();
+
+ console.log([
+ 'Default VPX params:',
+ '',
+ ' ?codec=vp8 Can also use vp9.',
+ ' ?width=640',
+ ' ?height=480',
+ ' ?vsbr=200 Video bitrate in kilobits per second.',
+ ' ?fps=0 Can use 30 to send frames on timer.',
+ '',
+ 'For example, to encode 720p video with VP9 use:',
+ '',
+ ' ?libvpx=1&codec=vp9&width=1280&height=720',
+ ].join('\n'));
+
+ this.libvpx_.codec = (this.loadingParams_.videoCodec || 'vp8').toUpperCase();
+ this.libvpx_.width = +(this.loadingParams_.videoWidth || '640');
+ this.libvpx_.height = +(this.loadingParams_.videoHeight || '480');
+ this.libvpx_.fps = +(this.loadingParams_.videoFps || '0');
+ this.libvpx_.bitrate = +(this.loadingParams_.videoSendBitrate || '200');
+ } else if (this.loadingParams_.webrtc) {
+ console.log("Loading webrtc");
+ this.webrtc_ = new WebRTC();
+ this.installWebRtc_();
+ } else {
+ this.libwebp_ = new LibWebP();
+ }
+
var paramsPromise = Promise.resolve({});
if (this.loadingParams_.paramsFunction) {
// If we have a paramsFunction value, we need to call it
@@ -94,14 +131,16 @@ var AppController = function(loadingParams) {
paramsPromise = this.loadingParams_.paramsFunction();
}
- Promise.resolve(paramsPromise).then(function(newParams) {
+ Promise.resolve(paramsPromise).then(function (newParams) {
// Merge newly retrieved params with loadingParams.
if (newParams) {
- Object.keys(newParams).forEach(function(key) {
+ Object.keys(newParams).forEach(function (key) {
this.loadingParams_[key] = newParams[key];
}.bind(this));
}
+ console.log('Config:', this.loadingParams_);
+
this.roomLink_ = '';
this.roomSelection_ = null;
this.localStream_ = null;
@@ -116,12 +155,12 @@ var AppController = function(loadingParams) {
if (!RoomSelection.matchRandomRoomPattern(this.loadingParams_.roomId)) {
// Show the room name only if it does not match the random room pattern.
$(UI_CONSTANTS.confirmJoinRoomSpan).textContent = ' "' +
- this.loadingParams_.roomId + '"';
+ this.loadingParams_.roomId + '"';
}
var confirmJoinDiv = $(UI_CONSTANTS.confirmJoinDiv);
this.show_(confirmJoinDiv);
- $(UI_CONSTANTS.confirmJoinButton).onclick = function() {
+ $(UI_CONSTANTS.confirmJoinButton).onclick = function () {
this.hide_(confirmJoinDiv);
// Record this room in the recently used list.
@@ -137,17 +176,17 @@ var AppController = function(loadingParams) {
// Display the room selection UI.
this.showRoomSelection_();
}
- }.bind(this)).catch(function(error) {
+ }.bind(this)).catch(function (error) {
trace('Error initializing: ' + error.message);
}.bind(this));
};
-AppController.prototype.createCall_ = function() {
+AppController.prototype.createCall_ = function () {
var privacyLinks = $(UI_CONSTANTS.privacyLinks);
this.hide_(privacyLinks);
this.call_ = new Call(this.loadingParams_);
this.infoBox_ = new InfoBox($(UI_CONSTANTS.infoDiv), this.call_,
- this.loadingParams_.versionInfo);
+ this.loadingParams_.versionInfo);
var roomErrors = this.loadingParams_.errorMessages;
var roomWarnings = this.loadingParams_.warningMessages;
@@ -169,23 +208,23 @@ AppController.prototype.createCall_ = function() {
this.call_.onlocalstreamadded = this.onLocalStreamAdded_.bind(this);
this.call_.onsignalingstatechange =
- this.infoBox_.updateInfoDiv.bind(this.infoBox_);
+ this.infoBox_.updateInfoDiv.bind(this.infoBox_);
this.call_.oniceconnectionstatechange =
- this.infoBox_.updateInfoDiv.bind(this.infoBox_);
+ this.infoBox_.updateInfoDiv.bind(this.infoBox_);
this.call_.onnewicecandidate =
- this.infoBox_.recordIceCandidateTypes.bind(this.infoBox_);
+ this.infoBox_.recordIceCandidateTypes.bind(this.infoBox_);
this.call_.onerror = this.displayError_.bind(this);
this.call_.onstatusmessage = this.displayStatus_.bind(this);
this.call_.oncallerstarted = this.displaySharingInfo_.bind(this);
};
-AppController.prototype.showRoomSelection_ = function() {
+AppController.prototype.showRoomSelection_ = function () {
var roomSelectionDiv = $(UI_CONSTANTS.roomSelectionDiv);
this.roomSelection_ = new RoomSelection(roomSelectionDiv, UI_CONSTANTS);
this.show_(roomSelectionDiv);
- this.roomSelection_.onRoomSelected = function(roomName) {
+ this.roomSelection_.onRoomSelected = function (roomName) {
this.hide_(roomSelectionDiv);
this.createCall_();
this.finishCallSetup_(roomName);
@@ -198,7 +237,7 @@ AppController.prototype.showRoomSelection_ = function() {
}.bind(this);
};
-AppController.prototype.setupUi_ = function() {
+AppController.prototype.setupUi_ = function () {
this.iconEventSetup_();
document.onkeypress = this.onKeyPress_.bind(this);
window.onmousemove = this.showIcons_.bind(this);
@@ -211,7 +250,7 @@ AppController.prototype.setupUi_ = function() {
setUpFullScreen();
};
-AppController.prototype.finishCallSetup_ = function(roomId) {
+AppController.prototype.finishCallSetup_ = function (roomId) {
this.call_.start(roomId);
this.setupUi_();
@@ -219,11 +258,11 @@ AppController.prototype.finishCallSetup_ = function(roomId) {
// Call hangup with async = false. Required to complete multiple
// clean up steps before page is closed.
// Chrome apps can't use onbeforeunload.
- window.onbeforeunload = function() {
+ window.onbeforeunload = function () {
this.call_.hangup(false);
}.bind(this);
- window.onpopstate = function(event) {
+ window.onpopstate = function (event) {
if (!event.state) {
// TODO (chuckhays) : Resetting back to room selection page not
// yet supported, reload the initial page instead.
@@ -239,7 +278,7 @@ AppController.prototype.finishCallSetup_ = function(roomId) {
}
};
-AppController.prototype.hangup_ = function() {
+AppController.prototype.hangup_ = function () {
trace('Hanging up.');
this.hide_(this.icons_);
this.displayStatus_('Hanging up');
@@ -252,37 +291,37 @@ AppController.prototype.hangup_ = function() {
window.onmousemove = null;
};
-AppController.prototype.onRemoteHangup_ = function() {
+AppController.prototype.onRemoteHangup_ = function () {
this.displayStatus_('The remote side hung up.');
this.transitionToWaiting_();
this.call_.onRemoteHangup();
};
-AppController.prototype.onRemoteSdpSet_ = function(hasRemoteVideo) {
- if (hasRemoteVideo) {
- trace('Waiting for remote video.');
- this.waitForRemoteVideo_();
+AppController.prototype.onRemoteSdpSet_ = function (hasRemoteVideo) {
+ if(window.dc === undefined) {
+ assert(window.pc);
+ window.pc.addEventListener("datachannel", event => { this.transitionToActive_(); });
} else {
- trace('No remote video stream; not waiting for media to arrive.');
// TODO(juberti): Make this wait for ICE connection before transitioning.
+ // TODO(psla): Make this wait for Data Channel when wartc is used.
this.transitionToActive_();
}
};
-AppController.prototype.waitForRemoteVideo_ = function() {
+AppController.prototype.waitForRemoteVideo_ = function () {
// Wait for the actual video to start arriving before moving to the active
// call state.
if (this.remoteVideo_.readyState >= 2) { // i.e. can play
trace('Remote video started; currentTime: ' +
- this.remoteVideo_.currentTime);
+ this.remoteVideo_.currentTime);
this.transitionToActive_();
} else {
this.remoteVideo_.oncanplay = this.waitForRemoteVideo_.bind(this);
}
};
-AppController.prototype.onRemoteStreamAdded_ = function(stream) {
+AppController.prototype.onRemoteStreamAdded_ = function (stream) {
this.deactivate_(this.sharingDiv_);
trace('Remote stream added.');
this.remoteVideo_.srcObject = stream;
@@ -295,7 +334,7 @@ AppController.prototype.onRemoteStreamAdded_ = function(stream) {
}
};
-AppController.prototype.onLocalStreamAdded_ = function(stream) {
+AppController.prototype.onLocalStreamAdded_ = function (stream) {
trace('User has granted access to local media.');
this.localStream_ = stream;
this.infoBox_.getLocalTrackIds(this.localStream_);
@@ -305,7 +344,7 @@ AppController.prototype.onLocalStreamAdded_ = function(stream) {
}
};
-AppController.prototype.attachLocalStream_ = function() {
+AppController.prototype.attachLocalStream_ = function () {
trace('Attaching local stream.');
this.localVideo_.srcObject = this.localStream_;
@@ -320,14 +359,14 @@ AppController.prototype.attachLocalStream_ = function() {
}
};
-AppController.prototype.transitionToActive_ = function() {
+AppController.prototype.transitionToActive_ = function () {
// Stop waiting for remote video.
this.remoteVideo_.oncanplay = undefined;
var connectTime = window.performance.now();
this.infoBox_.setSetupTimes(this.call_.startTime, connectTime);
this.infoBox_.updateInfoDiv();
trace('Call setup time: ' + (connectTime - this.call_.startTime).toFixed(0) +
- 'ms.');
+ 'ms.');
// Prepare the remote video and PIP elements.
trace('reattachMediaStream: ' + this.localVideo_.srcObject);
@@ -343,9 +382,107 @@ AppController.prototype.transitionToActive_ = function() {
this.activate_(this.videosDiv_);
this.show_(this.hangupSvg_);
this.displayStatus_('');
+
+ // this.deactivate_(this.miniVideo_);
+ this.deactivate_(this.remoteVideo_);
+ // this.activate_(this.miniCanvas_);
+ this.activate_(this.remoteCanvas_);
+
+ if (!this.listenersAdded_) {
+ this.listenersAdded_ = true;
+
+ if (this.libwebp_) {
+ this.installWebP_();
+ } else if (this.libvpx_) {
+ this.installVPX_();
+ }
+ }
};
-AppController.prototype.transitionToWaiting_ = function() {
+AppController.prototype.installWebRtc_ = function () {
+ console.log('Click the button to start the WebRTC stuff.');
+ const button = document.createElement('button');
+ button.setAttribute('style', 'position:fixed;left:10px;top:10px');
+ button.textContent = 'Start WebRTC';
+ document.body.append(button);
+ button.addEventListener('click', () => this.webrtc_.start());
+};
+
+AppController.prototype.installWebP_ = function () {
+ const {width, height} = this.miniCanvas_;
+
+ const miniCtx2d = this.miniCanvas_.getContext('2d');
+ const remoteCtx2d = this.remoteCanvas_.getContext('2d');
+
+ setInterval(() => {
+ miniCtx2d.drawImage(this.miniVideo_, 0, 0, width, height);
+ const frame = miniCtx2d.getImageData(0, 0, width, height);
+ console.warn('video frame', frame);
+ const encoded = this.libwebp_.encode(frame);
+ console.warn('encoded', encoded.length);
+ dc.send(encoded); // 64 KB max
+ }, 1500);
+
+ dc.onmessage = event => {
+ const encoded = new Uint8Array(event.data);
+ console.warn('encoded remote frame:', encoded);
+ const {data, width, height} = this.libwebp_.decode(encoded);
+ console.warn('decoded remote frame:', width, height, data);
+ const frame = remoteCtx2d.createImageData(width, height);
+ frame.data.set(data, 0);
+ remoteCtx2d.putImageData(frame, 0, 0);
+ };
+};
+
+AppController.prototype.installVPX_ = function () {
+ const {width, height, fps} = this.libvpx_;
+
+ this.remoteCanvas_.width = width;
+ this.remoteCanvas_.height = height;
+
+ const remoteContext2d = this.remoteCanvas_.getContext('2d');
+ const remoteRgbaData = remoteContext2d.getImageData(0, 0, width, height);
+
+ const localCanvas = document.createElement('canvas');
+ localCanvas.width = width;
+ localCanvas.height = height;
+ const localContext2d = localCanvas.getContext('2d');
+
+ const sendFrame = () => {
+ if (dc === undefined || dc.readyState != 'open')
+ return;
+ const time = Date.now();
+ localContext2d.drawImage(this.miniVideo_, 0, 0, width, height);
+ const {data: rgba} = localContext2d.getImageData(0, 0, width, height);
+ const packets = this.libvpx_.encode(rgba);
+ uistats.rgbFrame.set(Date.now() - time);
+ uistats.sentSize.set(packets.length);
+ dc.send(packets); // 64 KB max
+ };
+
+ if (fps > 0) {
+ setInterval(sendFrame, 1000 / fps);
+ } else {
+ const button = document.createElement('button');
+ button.setAttribute('style', 'position:fixed;left:10px;top:10px');
+ button.textContent = 'Send Frame';
+ document.body.append(button);
+ button.addEventListener('click', () => sendFrame());
+ }
+
+ dc.onmessage = event => {
+ const time = Date.now();
+ const packets = new Uint8Array(event.data);
+ // console.warn('Got IVF packets from remote:', packets.length, 'bytes');
+ const rgba = this.libvpx_.decode(packets);
+ remoteRgbaData.data.set(rgba);
+ remoteContext2d.putImageData(remoteRgbaData, 0, 0);
+ uistats.yuvFrame.set(Date.now() - time);
+ uistats.recvSize.set(packets.length);
+ };
+};
+
+AppController.prototype.transitionToWaiting_ = function () {
// Stop waiting for remote video.
this.remoteVideo_.oncanplay = undefined;
@@ -354,7 +491,7 @@ AppController.prototype.transitionToWaiting_ = function() {
this.deactivate_(this.videosDiv_);
if (!this.remoteVideoResetTimer_) {
- this.remoteVideoResetTimer_ = setTimeout(function() {
+ this.remoteVideoResetTimer_ = setTimeout(function () {
this.remoteVideoResetTimer_ = null;
trace('Resetting remoteVideo src after transitioning to waiting.');
this.remoteVideo_.srcObject = null;
@@ -372,7 +509,7 @@ AppController.prototype.transitionToWaiting_ = function() {
this.deactivate_(this.miniVideo_);
};
-AppController.prototype.transitionToDone_ = function() {
+AppController.prototype.transitionToDone_ = function () {
// Stop waiting for remote video.
this.remoteVideo_.oncanplay = undefined;
this.deactivate_(this.localVideo_);
@@ -384,14 +521,14 @@ AppController.prototype.transitionToDone_ = function() {
this.displayStatus_('');
};
-AppController.prototype.onRejoinClick_ = function() {
+AppController.prototype.onRejoinClick_ = function () {
this.deactivate_(this.rejoinDiv_);
this.hide_(this.rejoinDiv_);
this.call_.restart();
this.setupUi_();
};
-AppController.prototype.onNewRoomClick_ = function() {
+AppController.prototype.onNewRoomClick_ = function () {
this.deactivate_(this.rejoinDiv_);
this.hide_(this.rejoinDiv_);
this.showRoomSelection_();
@@ -403,7 +540,7 @@ AppController.prototype.onNewRoomClick_ = function() {
// i: toggle info panel.
// q: quit (hangup)
// Return false to screen out original Chrome shortcuts.
-AppController.prototype.onKeyPress_ = function(event) {
+AppController.prototype.onKeyPress_ = function (event) {
switch (String.fromCharCode(event.charCode)) {
case ' ':
case 'm':
@@ -435,14 +572,14 @@ AppController.prototype.onKeyPress_ = function(event) {
}
};
-AppController.prototype.pushCallNavigation_ = function(roomId, roomLink) {
+AppController.prototype.pushCallNavigation_ = function (roomId, roomLink) {
if (!isChromeApp()) {
window.history.pushState({'roomId': roomId, 'roomLink': roomLink}, roomId,
- roomLink);
+ roomLink);
}
};
-AppController.prototype.displaySharingInfo_ = function(roomId, roomLink) {
+AppController.prototype.displaySharingInfo_ = function (roomId, roomLink) {
this.roomLinkHref_.href = roomLink;
this.roomLinkHref_.text = roomLink;
this.roomLink_ = roomLink;
@@ -450,7 +587,7 @@ AppController.prototype.displaySharingInfo_ = function(roomId, roomLink) {
this.activate_(this.sharingDiv_);
};
-AppController.prototype.displayStatus_ = function(status) {
+AppController.prototype.displayStatus_ = function (status) {
if (status === '') {
this.deactivate_(this.statusDiv_);
} else {
@@ -459,37 +596,37 @@ AppController.prototype.displayStatus_ = function(status) {
this.statusDiv_.innerHTML = status;
};
-AppController.prototype.displayError_ = function(error) {
+AppController.prototype.displayError_ = function (error) {
trace(error);
this.infoBox_.pushErrorMessage(error);
};
-AppController.prototype.toggleAudioMute_ = function() {
+AppController.prototype.toggleAudioMute_ = function () {
this.call_.toggleAudioMute();
this.muteAudioIconSet_.toggle();
};
-AppController.prototype.toggleVideoMute_ = function() {
+AppController.prototype.toggleVideoMute_ = function () {
this.call_.toggleVideoMute();
this.muteVideoIconSet_.toggle();
};
-AppController.prototype.toggleFullScreen_ = function() {
+AppController.prototype.toggleFullScreen_ = function () {
if (isFullScreen()) {
trace('Exiting fullscreen.');
document.querySelector('svg#fullscreen title').textContent =
- 'Enter fullscreen';
+ 'Enter fullscreen';
document.cancelFullScreen();
} else {
trace('Entering fullscreen.');
document.querySelector('svg#fullscreen title').textContent =
- 'Exit fullscreen';
+ 'Exit fullscreen';
document.body.requestFullScreen();
}
this.fullscreenIconSet_.toggle();
};
-AppController.prototype.toggleMiniVideo_ = function() {
+AppController.prototype.toggleMiniVideo_ = function () {
if (this.miniVideo_.classList.contains('active')) {
this.deactivate_(this.miniVideo_);
} else {
@@ -497,55 +634,55 @@ AppController.prototype.toggleMiniVideo_ = function() {
}
};
-AppController.prototype.hide_ = function(element) {
+AppController.prototype.hide_ = function (element) {
element.classList.add('hidden');
};
-AppController.prototype.show_ = function(element) {
+AppController.prototype.show_ = function (element) {
element.classList.remove('hidden');
};
-AppController.prototype.activate_ = function(element) {
+AppController.prototype.activate_ = function (element) {
element.classList.add('active');
};
-AppController.prototype.deactivate_ = function(element) {
+AppController.prototype.deactivate_ = function (element) {
element.classList.remove('active');
};
-AppController.prototype.showIcons_ = function() {
+AppController.prototype.showIcons_ = function () {
if (!this.icons_.classList.contains('active')) {
this.activate_(this.icons_);
this.setIconTimeout_();
}
};
-AppController.prototype.hideIcons_ = function() {
+AppController.prototype.hideIcons_ = function () {
if (this.icons_.classList.contains('active')) {
this.deactivate_(this.icons_);
}
};
-AppController.prototype.setIconTimeout_ = function() {
+AppController.prototype.setIconTimeout_ = function () {
if (this.hideIconsAfterTimeout) {
window.clearTimeout.bind(this, this.hideIconsAfterTimeout);
}
- this.hideIconsAfterTimeout = window.setTimeout(function() {
+ this.hideIconsAfterTimeout = window.setTimeout(function () {
this.hideIcons_();
}.bind(this), 5000);
};
-AppController.prototype.iconEventSetup_ = function() {
- this.icons_.onmouseenter = function() {
+AppController.prototype.iconEventSetup_ = function () {
+ this.icons_.onmouseenter = function () {
window.clearTimeout(this.hideIconsAfterTimeout);
}.bind(this);
- this.icons_.onmouseleave = function() {
+ this.icons_.onmouseleave = function () {
this.setIconTimeout_();
}.bind(this);
};
-AppController.prototype.loadUrlParams_ = function() {
+AppController.prototype.loadUrlParams_ = function () {
/* eslint-disable dot-notation */
// Suppressing eslint warns about using urlParams['KEY'] instead of
// urlParams.KEY, since we'd like to use string literals to avoid the Closure
@@ -566,14 +703,21 @@ AppController.prototype.loadUrlParams_ = function() {
this.loadingParams_.videoRecvBitrate = urlParams['vrbr'];
this.loadingParams_.videoRecvCodec = urlParams['vrc'] || DEFAULT_VIDEO_CODEC;
this.loadingParams_.videoFec = urlParams['videofec'];
+
+ this.loadingParams_.libvpx = urlParams['libvpx'];
+ this.loadingParams_.videoCodec = urlParams['codec']; // vp8, vp9, etc.
+ this.loadingParams_.videoWidth = urlParams['width']; // 640
+ this.loadingParams_.videoHeight = urlParams['height']; // 480
+ this.loadingParams_.videoFps = urlParams['fps']; // 30
+ this.loadingParams_.webrtc = urlParams['webrtc'];
/* eslint-enable dot-notation */
};
-AppController.IconSet_ = function(iconSelector) {
+AppController.IconSet_ = function (iconSelector) {
this.iconElement = document.querySelector(iconSelector);
};
-AppController.IconSet_.prototype.toggle = function() {
+AppController.IconSet_.prototype.toggle = function () {
if (this.iconElement.classList.contains('on')) {
this.iconElement.classList.remove('on');
// turn it off: CSS hides `svg path.on` and displays `svg path.off`
diff --git a/src/web_app/js/libvpx.js b/src/web_app/js/libvpx.js
new file mode 100644
index 000000000..f5c9027f1
--- /dev/null
+++ b/src/web_app/js/libvpx.js
@@ -0,0 +1,160 @@
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+
+/* More information about these options at jshint.com/docs/options */
+
+/* exported LibVPX */
+
+'use strict';
+
+const Codecs = {
+ VP8: 0x30385056,
+ VP9: 0x30395056,
+};
+
+const ENC_IVF_FILE = "/vpx-enc-ivf"; // vpx encoder writes here
+const ENC_YUV_FILE = "/vpx-enc-yuv"; // vpx encoder read here
+const DEC_IVF_FILE = "/vpx-dec-ivf"; // vpx decoder reads here
+const DEC_YUV_FILE = "/vpx-dec-yuv"; // vpx decoder writes here
+
+class LibVPX {
+ constructor() {
+ this.codec = 'vp8';
+ this.width = 640;
+ this.height = 480;
+ this.fps = 10;
+ this.bitrate = 1000; // kbit/s, ivf packet size = bitrate/fps
+
+ this._encInitialized = false;
+ this._decInitialized = false;
+ this._lastIvfSize = 0;
+ this._rgbPtr = 0;
+ this._yuvPtr = 0;
+ this._yuvFrame = null; // UInt8Array
+ this._ivfFrame = null; // UInt8Array, dynamic
+
+ this._loadWasm('/wasm/libvpx/libvpx.js');
+ }
+
+ _loadWasm(src) {
+ console.warn('loading wasm module:', src);
+ loadScript(src).then(() => {
+ Module.onRuntimeInitialized = () => {
+ console.warn('libvpx.wasm loaded');
+ console.log('wasm module:', Module);
+ };
+ });
+ }
+
+ _allocIvfFrame(size) {
+ if (!this._ivfFrame || this._ivfFrame.length < size)
+ this._ivfFrame = new Uint8Array(size);
+ return new Uint8Array(this._ivfFrame.buffer, 0, size);
+ }
+
+ encode(rgbaData, keyframe = false) {
+ const codec = this.codec;
+ const width = this.width;
+ const height = this.height;
+ const fourcc = Codecs[codec];
+ const rgbaSize = width * height * 4;
+ const yuvSize = width * height * 3 / 2; // 48 bits per 4 pixels
+
+ if (rgbaData.length != rgbaSize)
+ console.warn('Wrong RGBA data size:', rgbaData.length);
+
+ // console.log(`Encoding ${width}x${height} with ${codec} fourcc:${fourcc}`);
+
+ if (!this._encInitialized) {
+ console.warn('initializing vpx encoder');
+ _vpx_js_encoder_open(fourcc, width, height, this.fps || 30,
+ this.bitrate || 200);
+ this._encInitialized = true;
+ }
+
+ // - Copy RGBA data to the WASM memory.
+ // - Convert RGBA to YUV.
+ // - Copy YUV data to the in-memory /vpx-yuv file.
+ this._rgbPtr = this._rgbPtr || _malloc(rgbaSize);
+ this._yuvPtr = this._yuvPtr || _malloc(yuvSize);
+ HEAP8.set(rgbaData, this._rgbPtr);
+ _vpx_js_rgba_to_yuv420(this._yuvPtr, this._rgbPtr, width, height);
+ const yuvData = new Uint8Array(HEAP8.buffer, this._yuvPtr, yuvSize);
+ FS.writeFile(ENC_YUV_FILE, yuvData); // in-memory memfs emscripten file
+
+ // more keyframes = better video quality
+ _vpx_js_encoder_run(keyframe ? 1 : 0);
+
+ const ivfSize = FS.stat(ENC_IVF_FILE).size;
+ const ivfFile = FS.open(ENC_IVF_FILE, 'r');
+ const ivfData = this._allocIvfFrame(ivfSize - this._lastIvfSize);
+ FS.read(ivfFile, ivfData, 0, ivfData.length, this._lastIvfSize);
+ FS.close(ivfFile);
+ this._lastIvfSize = ivfSize;
+ uistats.encIvfFileSize.set(ivfSize);
+
+ return ivfData; // it's a temp buffer, but it's small
+ }
+
+ decode(ivfData) {
+ const width = this.width;
+ const height = this.height;
+ const rgbaSize = width * height * 4;
+ const yuvSize = width * height * 3 / 2; // 48 bits per 4 pixels
+
+ // Append new IVF data to the /vpx-ivf file.
+
+ const ivfFile = FS.open(DEC_IVF_FILE, 'a');
+ const ivfSize = FS.stat(DEC_IVF_FILE).size;
+ FS.write(ivfFile, ivfData, 0, ivfData.length, ivfSize);
+ FS.close(ivfFile);
+ uistats.decIvfFileSize.set(ivfSize);
+
+ if (!this._decInitialized) {
+ console.warn('initializing vpx decoder');
+ _vpx_js_decoder_open();
+ this._decInitialized = true;
+ }
+
+ // Run the VPX decoder.
+
+ _vpx_js_decoder_run();
+
+ // Read the new YUV frames written by the decoder.
+
+ const yuvFile = FS.open(DEC_YUV_FILE, 'r');
+ const yuvFileSize = FS.stat(DEC_YUV_FILE).size;
+
+ // Only 1 YUV frame is expected. Multiple frames not supported by this demo.
+ if (yuvFileSize != yuvSize)
+ throw new Error(`Unexpected YUV file size: ${yuvFileSize} vs ${yuvSize}`);
+
+ // Convert YUV frames to RGB frames.
+
+ this._rgbPtr = this._rgbaPtr || _malloc(rgbaSize);
+ this._yuvPtr = this._yuvPtr || _malloc(yuvSize);
+ this._yuvFrame = this._yuvFrame || new Uint8Array(yuvSize);
+ FS.read(yuvFile, this._yuvFrame, 0, yuvSize);
+ HEAP8.set(this._yuvFrame, this._yuvPtr);
+ _vpx_js_yuv420_to_rgba(this._rgbPtr, this._yuvPtr, width, height);
+ const rgbaData = new Uint8Array(HEAP8.buffer, this._rgbPtr, rgbaSize);
+ FS.close(yuvFile);
+
+ return rgbaData; // it's a view into HEAP8.buffer, not a copy
+ }
+}
+
+function loadScript(src) {
+ return new Promise((resolve, reject) => {
+ const script = document.createElement('script');
+ script.src = src;
+ script.onerror = reject;
+ script.onload = resolve;
+ document.body.appendChild(script);
+ });
+}
diff --git a/src/web_app/js/libwebp.js b/src/web_app/js/libwebp.js
new file mode 100644
index 000000000..8af282683
--- /dev/null
+++ b/src/web_app/js/libwebp.js
@@ -0,0 +1,72 @@
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+
+/* More information about these options at jshint.com/docs/options */
+
+/* globals trace, mergeConstraints, parseJSON */
+
+/* exported LibWebP */
+
+'use strict';
+
+var LibWebP = function() {
+ const src = '/wasm/libwebp/a.out.js';
+ console.warn('loading wasm module:', src);
+ const script = document.createElement('script');
+ script.src = src;
+
+ script.onerror = () => {
+ console.warn('failed to load the script');
+ };
+
+ script.onload = () => {
+ console.log('script loaded, waiting for wasm...');
+
+ Module.onRuntimeInitialized = () => {
+ console.warn('libwebp.version', '0x' + _version().toString(16));
+ };
+ };
+
+ document.body.appendChild(script);
+};
+
+LibWebP.prototype.encode = function(image) {
+ const sourcePtr = Module._create_buffer(image.width, image.height);
+ Module.HEAP8.set(image.data, sourcePtr);
+
+ const quality = 100;
+ Module._encode(sourcePtr, image.width, image.height, quality);
+ Module._destroy_buffer(sourcePtr);
+
+ const resultPtr = Module._get_result_pointer();
+ const resultSize = Module._get_result_size();
+ const resultView = new Uint8Array(Module.HEAP8.buffer, resultPtr, resultSize);
+ const result = new Uint8Array(resultView);
+ Module._free_result(resultPtr);
+
+ return result;
+};
+
+LibWebP.prototype.decode = function(buffer) {
+ const size = buffer.length;
+ const sourcePtr = Module._create_buffer(size, 1);
+ Module.HEAP8.set(buffer, sourcePtr);
+ Module._decode(sourcePtr, size);
+ Module._destroy_buffer(sourcePtr);
+
+ const resultPtr = Module._get_result_pointer();
+ if (!resultPtr) throw new Error('Invalid LibWebP image.');
+
+ const width = Module._get_result_width();
+ const height = Module._get_result_height();
+ const resultView = new Uint8Array(Module.HEAP8.buffer, resultPtr, width*height*4);
+ const result = new Uint8Array(resultView);
+ Module._free_result(resultPtr);
+
+ return {data:result, width, height};
+};
diff --git a/src/web_app/js/peerconnectionclient.js b/src/web_app/js/peerconnectionclient.js
index b054c71c9..6538786cf 100644
--- a/src/web_app/js/peerconnectionclient.js
+++ b/src/web_app/js/peerconnectionclient.js
@@ -36,6 +36,9 @@ var PeerConnectionClient = function(params, startTime) {
// Create an RTCPeerConnection via the polyfill (adapter.js).
this.pc_ = new RTCPeerConnection(
params.peerConnectionConfig, params.peerConnectionConstraints);
+ window.pc = this.pc_;
+ console.warn('window.pc = RTCPeerConnection');
+
this.pc_.onicecandidate = this.onIceCandidate_.bind(this);
this.pc_.ontrack = this.onRemoteStreamAdded_.bind(this);
this.pc_.onremovestream = trace.bind(null, 'Remote stream removed.');
@@ -80,7 +83,12 @@ PeerConnectionClient.prototype.addStream = function(stream) {
if (!this.pc_) {
return;
}
- this.pc_.addStream(stream);
+ // this.pc_.addStream(stream);
+};
+
+PeerConnectionClient.prototype.setupDataChannel_ = function() {
+ this.dataChannel_.onopen = event => console.warn('dc:open ->', event);
+ this.dataChannel_.onmessage = event => console.warn('dc:message ->', event);
};
PeerConnectionClient.prototype.startAsCaller = function(offerOptions) {
@@ -94,6 +102,12 @@ PeerConnectionClient.prototype.startAsCaller = function(offerOptions) {
this.isInitiator_ = true;
this.started_ = true;
+
+ this.dataChannel_ = this.pc_.createDataChannel('wartc');
+ window.dc = this.dataChannel_;
+ console.warn('window.dc = pc.createDataChannel(...)');
+ this.setupDataChannel_();
+
var constraints = mergeConstraints(
PeerConnectionClient.DEFAULT_SDP_OFFER_OPTIONS_, offerOptions);
trace('Sending offer to peer, with constraints: \n\'' +
@@ -117,6 +131,14 @@ PeerConnectionClient.prototype.startAsCallee = function(initialMessages) {
this.isInitiator_ = false;
this.started_ = true;
+ this.pc_.ondatachannel = event => {
+ console.warn('pc:datachannel ->', event);
+ this.dataChannel_ = event.channel;
+ window.dc = this.dataChannel_;
+ console.warn('window.dc = event.channel');
+ this.setupDataChannel_();
+ };
+
if (initialMessages && initialMessages.length > 0) {
// Convert received messages to JSON objects and add them to the message
// queue.
diff --git a/src/web_app/js/ui-stats.js b/src/web_app/js/ui-stats.js
new file mode 100644
index 000000000..bd32e93d0
--- /dev/null
+++ b/src/web_app/js/ui-stats.js
@@ -0,0 +1,115 @@
+/*
+ * Copyright (c) 2016 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+
+/* More information about these options at jshint.com/docs/options */
+
+/* exported uistats */
+
+'use strict';
+
+class MovingAverage {
+ constructor(length) {
+ this.length = length;
+ this.buffer = [];
+ this.head = 0;
+ this.sum = 0;
+ }
+
+ push(value) {
+ this.sum += value;
+
+ if (this.buffer.length == this.length)
+ this.sum -= this.buffer[this.head];
+
+ this.buffer[this.head++] = value;
+ this.head %= this.length;
+ }
+
+ get() {
+ return this.sum / this.buffer.length;
+ }
+}
+
+class Prop {
+ constructor(label, {title, format, malen}) {
+ this.label = label;
+ this.title = title;
+ this._format = format || (x => x);
+ this._valueEl = null; //
+ this._ma = new MovingAverage(malen || 30);
+ }
+
+ _getValueElement() {
+ if (this._valueEl)
+ return this._valueEl;
+
+ const container = $('#wasm-stats');
+ const row = document.createElement('div');
+ const label = document.createElement('div');
+ const value = document.createElement('div');
+
+ row.append(label);
+ row.append(value);
+ container.append(row);
+
+ label.textContent = this.label;
+ row.title = this.title;
+
+ return this._valueEl = value;
+ }
+
+ set(value) {
+ const el = this._getValueElement();
+ this._ma.push(value);
+ // Just el.textContent would create a new HTML element.
+ (el.firstChild || el).textContent = this._format(this._ma.get());
+ }
+}
+
+class TimeProp {
+ constructor(text, args) {
+ args.format = x => (x | 0) + ' ms';
+ return new Prop(text, args);
+ }
+}
+
+class SizeProp {
+ constructor(text, args) {
+ args.format = x => x < 1024 ?
+ (x | 0) + ' B' :
+ (x / 1024 | 0) + ' KB';
+ return new Prop(text, args);
+ }
+}
+
+const uistats = {
+ rgbFrame: new TimeProp('RGB Frame', {
+ title: 'Time to encode RGB frame.',
+ }),
+ yuvFrame: new TimeProp('IVF Frame', {
+ title: 'Time to decode IVF frame.',
+ }),
+ sentSize: new SizeProp('Sent Packet', {
+ title: 'Size of the sent key-frame or delta-frame.'
+ }),
+ recvSize: new SizeProp('Recv Packet', {
+ title: 'Size of the received key-frame or delta-frame.'
+ }),
+ encIvfFileSize: new SizeProp('IVF encoder file size', {
+ title: 'Size of the /vpx-enc-ivf'
+ }),
+ decIvfFileSize: new SizeProp('IVF decoder file size', {
+ title: 'Size of the /vpx-dec-ivf'
+ }),
+ rtpSendSize: new SizeProp('RTP packet send', {
+ title: 'Size of the sent RTP packets.'
+ }),
+ rtpRecvSize: new SizeProp('RTP packet recv', {
+ title: 'Size of the received RTP packets.'
+ }),
+};
diff --git a/src/web_app/js/wasm-worklet-processor.js b/src/web_app/js/wasm-worklet-processor.js
new file mode 100644
index 000000000..ff3e56b14
--- /dev/null
+++ b/src/web_app/js/wasm-worklet-processor.js
@@ -0,0 +1,57 @@
+class WASMWorkletProcessor extends AudioWorkletProcessor {
+ /**
+ * @constructor
+ */
+ constructor() {
+ super();
+
+ // Allocate the buffer for the heap access. Start with stereo, but it can
+ // be expanded up to 32 channels.
+ this._heapInputBuffer = new HeapAudioBuffer(Module, RENDER_QUANTUM_FRAMES,
+ 1, MAX_CHANNEL_COUNT);
+ this._heapOutputBuffer = new HeapAudioBuffer(Module, RENDER_QUANTUM_FRAMES,
+ 1, MAX_CHANNEL_COUNT);
+
+ this._kernel = new Module.PeerConnectionAudioBuffer();
+ }
+
+ /**
+ * System-invoked process callback function.
+ * @param {Array} inputs Incoming audio stream.
+ * @param {Array} outputs Outgoing audio stream.
+ * @param {Object} parameters AudioParam data.
+ * @return {Boolean} Active source flag.
+ */
+ process(inputs, outputs, parameters) {
+ // Use the 1st input and output only to make the example simpler. |input|
+ // and |output| here have the similar structure with the AudioBuffer
+ // interface. (i.e. An array of Float32Array)
+ let input = inputs[0];
+ let output = outputs[0];
+
+ // For this given render quantum, the channel count of the node is fixed
+ // and identical for the input and the output.
+ let channelCount = input.length;
+
+ // Prepare HeapAudioBuffer for the channel count change in the current
+ // render quantum.
+ this._heapInputBuffer.adaptChannel(channelCount);
+ this._heapOutputBuffer.adaptChannel(channelCount);
+
+ // Copy-in, process and copy-out.
+ for (let channel = 0; channel < channelCount; ++channel) {
+ this._heapInputBuffer.getChannelData(channel).set(input[channel]);
+ }
+ this._kernel.process(this._heapInputBuffer.getHeapAddress(),
+ this._heapOutputBuffer.getHeapAddress(),
+ channelCount);
+ for (let channel = 0; channel < channelCount; ++channel) {
+ output[channel].set(this._heapOutputBuffer.getChannelData(channel));
+ }
+
+ return true;
+ }
+}
+
+registerProcessor("wasm-processor", WASMWorkletProcessor);
+
diff --git a/src/web_app/js/webrtc.js b/src/web_app/js/webrtc.js
new file mode 100644
index 000000000..c8bb73348
--- /dev/null
+++ b/src/web_app/js/webrtc.js
@@ -0,0 +1,198 @@
+/*
+ * Copyright (c) 2018 The WebRTC project authors. All Rights Reserved.
+ *
+ * Use of this source code is governed by a BSD-style license
+ * that can be found in the LICENSE file in the root of the source
+ * tree.
+ */
+
+/* More information about these options at jshint.com/docs/options */
+
+/* exported WebRTC */
+
+'use strict';
+
+class WebRTC {
+ constructor() {
+ this._loadWasm('/wasm/webrtc/webrtc.js');
+ }
+
+ _loadWasm(src) {
+ console.warn('loading wasm module:', src);
+ const script = document.createElement('script');
+ script.src = src;
+
+ script.onerror = () => {
+ console.warn('failed to load the script');
+ };
+
+ script.onload = () => {
+ console.log('script loaded, waiting for wasm...');
+
+ Module.onRuntimeInitialized = () => {
+ console.warn('webrtc.wasm loaded');
+ console.log('wasm module:', Module);
+ };
+ };
+
+ document.body.appendChild(script);
+ }
+
+ start() {
+ const Transport = Module.Transport.extend("Transport", {
+ __construct: function () {
+ this.__parent.__construct.call(this);
+
+ if (window.dc) {
+ dc.onmessage = event => {
+ const packet = new Uint8Array(event.data);
+ uistats.rtpRecvSize.set(packet.length);
+ console.log('Received a RTP packet:', packet.length, 'bytes');
+ // TODO: Do something with it.
+ };
+ } else {
+ console.warn(`window.dc:RTCDataChannel doesn't exist yet`);
+ }
+ },
+ __destruct: function () {
+ this.__parent.__destruct.call(this);
+ },
+ sendPacket: function (payload) {
+ console.log('sendPacket');
+ // console.log(payload);
+ console.log('Sending a RTP packet:', payload.length, 'bytes');
+ if (window.dc) {
+ uistats.rtpSendSize.set(payload.length);
+ const payloadCopy = new Uint8Array(payload);
+ dc.send(payloadCopy);
+ } else {
+ console.warn(`window.dc:RTCDataChannel doesn't exist yet`);
+ // TODO: Do we need this?
+ let payloadCopy = new Module.VectorUint8();
+ for (let i = 0; i < payload.length; i++) {
+ payloadCopy.push_back(payload[i]);
+ }
+ call.deliverPacket(payloadCopy);
+ }
+ return true;
+ },
+ });
+ var call = new Module.Call(new Transport());
+ let sendStream = call.createAudioSendStream({
+ ssrc: 123,
+ cname: 'cname',
+ payloadType: 42,
+ codecName: 'opus',
+ clockrateHz: 48000,
+ numChannels: 2,
+ });
+ sendStream.start();
+
+ function floatToInt(floatSample) {
+ s = Math.max(-1, Math.min(1, floatSample));
+ return s < 0 ? s * 0x8000 : s * 0x7FFF;
+ }
+
+ function sendAudio(floatBufferChannel1, floatBufferChannel2) {
+ // buffer in
+ console.log("sending audio");
+ assert(floatBufferChannel1.length == floatBufferChannel2.length);
+ assert(floatBufferChannel1.length >= 480);
+
+ let sendBuffer = new Module.VectorInt16();
+ for (let i = 0; i < 480; i++) {
+ sendBuffer[i * 2] = floatToInt(floatBufferChannel1[i]);
+ sendBuffer[i * 2 + 1] = floatToInt(floatBufferChannel2[i]);
+ }
+ // ignores the rest of the buffer for now!
+ // TODO
+
+ sendStream.sendAudioData({
+ data: sendBuffer,
+ numChannels: 2,
+ sampleRateHz: 48000,
+ samplesPerChannel: 480,
+ timestamp: 0,
+ });
+ }
+
+ function sendSomeAudio(offset) {
+ let sendBuffer = new Module.VectorInt16();
+ for (let i = 0; i < 480 * 2; i++) {
+ sendBuffer.push_back(offset + i);
+ }
+ console.log('sending audio');
+ sendStream.sendAudioData({
+ data: sendBuffer,
+ numChannels: 2,
+ sampleRateHz: 48000,
+ samplesPerChannel: 480,
+ timestamp: 0,
+ });
+ }
+
+ const AudioSink =
+ Module.AudioReceiveStreamSink.extend("AudioReceiveStreamSink", {
+ __construct: function () {
+ this.__parent.__construct.call(this);
+ },
+ __destruct: function () {
+ this.__parent.__destruct.call(this);
+ },
+ onAudioFrame: function (audioFrame) {
+ console.log('onAudioFrame');
+ console.log(audioFrame);
+ },
+ });
+
+ let receiveAudioCodecs = new Module.VectorAudioCodec();
+ receiveAudioCodecs.push_back({
+ payloadType: 42,
+ name: 'opus',
+ clockrateHz: 48000,
+ numChannels: 2,
+ });
+ let receiveStream = call.createAudioReceiveStream({
+ localSsrc: 345,
+ remoteSsrc: 123,
+ codecs: receiveAudioCodecs,
+ });
+
+ receiveStream.setSink(new AudioSink());
+ receiveStream.start();
+
+ function startSending() {
+ console.warn('Activating webrtc audio');
+ if (navigator.mediaDevices) {
+ console.warn('Activating webrtc audio');
+
+ console.log('getUserMedia supported.');
+ navigator.mediaDevices.getUserMedia({audio: true, video: false})
+ .then(function (stream) {
+ /*
+ var audioCtx = new AudioContext();
+ audioCtx.audioWorklet.addModule("js/wasm-worklet-processor.js");
+ var source = audioCtx.createMediaStreamSource(stream);
+ const processor = new AudioWorkletNode(context, 'wasm-processor');
+ source.connect(processor).connect(context.destination);
+ source.start();
+ */
+ console.log("created stream!");
+ var audioCtx = new AudioContext();
+ var source = audioCtx.createMediaStreamSource(stream);
+ var processor = audioCtx.createScriptProcessor(0, 2, 2);
+ // var processor = stream.context.createScriptProcessor(0, 1, 1);
+ source.connect(processor).connect(audioCtx.destination);
+ processor.onaudioprocess = function (e) {
+ var channelData = e.inputBuffer.getChannelData(0);
+ var channelData2 = e.inputBuffer.getChannelData(0);
+ // console.log('captured audio ' + channelData.length);
+ // console.log(channelData);
+ sendAudio(channelData, channelData2);
+ }
+ });
+ }
+ }
+ startSending();
+ };
+}
diff --git a/src/web_app/wasm/libvpx/libvpx.js b/src/web_app/wasm/libvpx/libvpx.js
new file mode 100644
index 000000000..b095e32b9
--- /dev/null
+++ b/src/web_app/wasm/libvpx/libvpx.js
@@ -0,0 +1,5829 @@
+// Copyright 2010 The Emscripten Authors. All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License. Both these licenses can be
+// found in the LICENSE file.
+
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = typeof Module !== 'undefined' ? Module : {};
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+// {{PRE_JSES}}
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = {};
+var key;
+for (key in Module) {
+ if (Module.hasOwnProperty(key)) {
+ moduleOverrides[key] = Module[key];
+ }
+}
+
+Module['arguments'] = [];
+Module['thisProgram'] = './this.program';
+Module['quit'] = function(status, toThrow) {
+ throw toThrow;
+};
+Module['preRun'] = [];
+Module['postRun'] = [];
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = false;
+var ENVIRONMENT_IS_SHELL = false;
+ENVIRONMENT_IS_WEB = typeof window === 'object';
+ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
+ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
+ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+ if (Module['locateFile']) {
+ return Module['locateFile'](path, scriptDirectory);
+ } else {
+ return scriptDirectory + path;
+ }
+}
+
+if (ENVIRONMENT_IS_NODE) {
+ scriptDirectory = __dirname + '/';
+
+ // Expose functionality in the same simple way that the shells work
+ // Note that we pollute the global namespace here, otherwise we break in node
+ var nodeFS;
+ var nodePath;
+
+ Module['read'] = function shell_read(filename, binary) {
+ var ret;
+ if (!nodeFS) nodeFS = require('fs');
+ if (!nodePath) nodePath = require('path');
+ filename = nodePath['normalize'](filename);
+ ret = nodeFS['readFileSync'](filename);
+ return binary ? ret : ret.toString();
+ };
+
+ Module['readBinary'] = function readBinary(filename) {
+ var ret = Module['read'](filename, true);
+ if (!ret.buffer) {
+ ret = new Uint8Array(ret);
+ }
+ assert(ret.buffer);
+ return ret;
+ };
+
+ if (process['argv'].length > 1) {
+ Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
+ }
+
+ Module['arguments'] = process['argv'].slice(2);
+
+ if (typeof module !== 'undefined') {
+ module['exports'] = Module;
+ }
+
+ process['on']('uncaughtException', function(ex) {
+ // suppress ExitStatus exceptions from showing an error
+ if (!(ex instanceof ExitStatus)) {
+ throw ex;
+ }
+ });
+ // Currently node will swallow unhandled rejections, but this behavior is
+ // deprecated, and in the future it will exit with error status.
+ process['on']('unhandledRejection', abort);
+
+ Module['quit'] = function(status) {
+ process['exit'](status);
+ };
+
+ Module['inspect'] = function () { return '[Emscripten Module object]'; };
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+
+ if (typeof read != 'undefined') {
+ Module['read'] = function shell_read(f) {
+ return read(f);
+ };
+ }
+
+ Module['readBinary'] = function readBinary(f) {
+ var data;
+ if (typeof readbuffer === 'function') {
+ return new Uint8Array(readbuffer(f));
+ }
+ data = read(f, 'binary');
+ assert(typeof data === 'object');
+ return data;
+ };
+
+ if (typeof scriptArgs != 'undefined') {
+ Module['arguments'] = scriptArgs;
+ } else if (typeof arguments != 'undefined') {
+ Module['arguments'] = arguments;
+ }
+
+ if (typeof quit === 'function') {
+ Module['quit'] = function(status) {
+ quit(status);
+ }
+ }
+} else
+if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled
+ scriptDirectory = self.location.href;
+ } else if (document.currentScript) { // web
+ scriptDirectory = document.currentScript.src;
+ }
+ // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+ // otherwise, slice off the final part of the url to find the script directory.
+ // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
+ // and scriptDirectory will correctly be replaced with an empty string.
+ if (scriptDirectory.indexOf('blob:') !== 0) {
+ scriptDirectory = scriptDirectory.substr(0, scriptDirectory.lastIndexOf('/')+1);
+ } else {
+ scriptDirectory = '';
+ }
+
+
+ Module['read'] = function shell_read(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.send(null);
+ return xhr.responseText;
+ };
+
+ if (ENVIRONMENT_IS_WORKER) {
+ Module['readBinary'] = function readBinary(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.responseType = 'arraybuffer';
+ xhr.send(null);
+ return new Uint8Array(xhr.response);
+ };
+ }
+
+ Module['readAsync'] = function readAsync(url, onload, onerror) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onload = function xhr_onload() {
+ if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+ onload(xhr.response);
+ return;
+ }
+ onerror();
+ };
+ xhr.onerror = onerror;
+ xhr.send(null);
+ };
+
+ Module['setWindowTitle'] = function(title) { document.title = title };
+} else
+{
+}
+
+// Set up the out() and err() hooks, which are how we can print to stdout or
+// stderr, respectively.
+// If the user provided Module.print or printErr, use that. Otherwise,
+// console.log is checked first, as 'print' on the web will open a print dialogue
+// printErr is preferable to console.warn (works better in shells)
+// bind(console) is necessary to fix IE/Edge closed dev tools panel behavior.
+var out = Module['print'] || (typeof console !== 'undefined' ? console.log.bind(console) : (typeof print !== 'undefined' ? print : null));
+var err = Module['printErr'] || (typeof printErr !== 'undefined' ? printErr : ((typeof console !== 'undefined' && console.warn.bind(console)) || out));
+
+// Merge back in the overrides
+for (key in moduleOverrides) {
+ if (moduleOverrides.hasOwnProperty(key)) {
+ Module[key] = moduleOverrides[key];
+ }
+}
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = undefined;
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+
+
+
+// Copyright 2017 The Emscripten Authors. All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License. Both these licenses can be
+// found in the LICENSE file.
+
+// {{PREAMBLE_ADDITIONS}}
+
+var STACK_ALIGN = 16;
+
+
+function staticAlloc(size) {
+ var ret = STATICTOP;
+ STATICTOP = (STATICTOP + size + 15) & -16;
+ return ret;
+}
+
+function dynamicAlloc(size) {
+ var ret = HEAP32[DYNAMICTOP_PTR>>2];
+ var end = (ret + size + 15) & -16;
+ HEAP32[DYNAMICTOP_PTR>>2] = end;
+ if (end >= TOTAL_MEMORY) {
+ var success = enlargeMemory();
+ if (!success) {
+ HEAP32[DYNAMICTOP_PTR>>2] = ret;
+ return 0;
+ }
+ }
+ return ret;
+}
+
+function alignMemory(size, factor) {
+ if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default
+ var ret = size = Math.ceil(size / factor) * factor;
+ return ret;
+}
+
+function getNativeTypeSize(type) {
+ switch (type) {
+ case 'i1': case 'i8': return 1;
+ case 'i16': return 2;
+ case 'i32': return 4;
+ case 'i64': return 8;
+ case 'float': return 4;
+ case 'double': return 8;
+ default: {
+ if (type[type.length-1] === '*') {
+ return 4; // A pointer
+ } else if (type[0] === 'i') {
+ var bits = parseInt(type.substr(1));
+ assert(bits % 8 === 0);
+ return bits / 8;
+ } else {
+ return 0;
+ }
+ }
+ }
+}
+
+function warnOnce(text) {
+ if (!warnOnce.shown) warnOnce.shown = {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ err(text);
+ }
+}
+
+var asm2wasmImports = { // special asm2wasm imports
+ "f64-rem": function(x, y) {
+ return x % y;
+ },
+ "debugger": function() {
+ debugger;
+ }
+};
+
+
+
+var jsCallStartIndex = 1;
+var functionPointers = new Array(0);
+
+// 'sig' parameter is only used on LLVM wasm backend
+function addFunction(func, sig) {
+ var base = 0;
+ for (var i = base; i < base + 0; i++) {
+ if (!functionPointers[i]) {
+ functionPointers[i] = func;
+ return jsCallStartIndex + i;
+ }
+ }
+ throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
+}
+
+function removeFunction(index) {
+ functionPointers[index-jsCallStartIndex] = null;
+}
+
+var funcWrappers = {};
+
+function getFuncWrapper(func, sig) {
+ if (!func) return; // on null pointer, return undefined
+ assert(sig);
+ if (!funcWrappers[sig]) {
+ funcWrappers[sig] = {};
+ }
+ var sigCache = funcWrappers[sig];
+ if (!sigCache[func]) {
+ // optimize away arguments usage in common cases
+ if (sig.length === 1) {
+ sigCache[func] = function dynCall_wrapper() {
+ return dynCall(sig, func);
+ };
+ } else if (sig.length === 2) {
+ sigCache[func] = function dynCall_wrapper(arg) {
+ return dynCall(sig, func, [arg]);
+ };
+ } else {
+ // general case
+ sigCache[func] = function dynCall_wrapper() {
+ return dynCall(sig, func, Array.prototype.slice.call(arguments));
+ };
+ }
+ }
+ return sigCache[func];
+}
+
+
+function makeBigInt(low, high, unsigned) {
+ return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0));
+}
+
+function dynCall(sig, ptr, args) {
+ if (args && args.length) {
+ return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
+ } else {
+ return Module['dynCall_' + sig].call(null, ptr);
+ }
+}
+
+var tempRet0 = 0;
+
+var setTempRet0 = function(value) {
+ tempRet0 = value;
+}
+
+var getTempRet0 = function() {
+ return tempRet0;
+}
+
+
+var Runtime = {
+ // FIXME backwards compatibility layer for ports. Support some Runtime.*
+ // for now, fix it there, then remove it from here. That way we
+ // can minimize any period of breakage.
+ dynCall: dynCall, // for SDL2 port
+};
+
+// The address globals begin at. Very low in memory, for code size and optimization opportunities.
+// Above 0 is static memory, starting with globals.
+// Then the stack.
+// Then 'dynamic' memory for sbrk.
+var GLOBAL_BASE = 1024;
+
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+
+
+//========================================
+// Runtime essentials
+//========================================
+
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort(). Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS = 0;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+ if (!condition) {
+ abort('Assertion failed: ' + text);
+ }
+}
+
+var globalScope = this;
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+ var func = Module['_' + ident]; // closure exported function
+ assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
+ return func;
+}
+
+var JSfuncs = {
+ // Helpers for cwrap -- it can't refer to Runtime directly because it might
+ // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
+ // out what the minified function name is.
+ 'stackSave': function() {
+ stackSave()
+ },
+ 'stackRestore': function() {
+ stackRestore()
+ },
+ // type conversion from js to c
+ 'arrayToC' : function(arr) {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ },
+ 'stringToC' : function(str) {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) { // null string
+ // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+ var len = (str.length << 2) + 1;
+ ret = stackAlloc(len);
+ stringToUTF8(str, ret, len);
+ }
+ return ret;
+ }
+};
+
+// For fast lookup of conversion functions
+var toC = {
+ 'string': JSfuncs['stringToC'], 'array': JSfuncs['arrayToC']
+};
+
+
+// C calling interface.
+function ccall(ident, returnType, argTypes, args, opts) {
+ function convertReturnValue(ret) {
+ if (returnType === 'string') return Pointer_stringify(ret);
+ if (returnType === 'boolean') return Boolean(ret);
+ return ret;
+ }
+
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ ret = convertReturnValue(ret);
+ if (stack !== 0) stackRestore(stack);
+ return ret;
+}
+
+function cwrap(ident, returnType, argTypes, opts) {
+ argTypes = argTypes || [];
+ // When the function takes numbers and returns a number, we can just return
+ // the original function
+ var numericArgs = argTypes.every(function(type){ return type === 'number'});
+ var numericRet = returnType !== 'string';
+ if (numericRet && numericArgs && !opts) {
+ return getCFunc(ident);
+ }
+ return function() {
+ return ccall(ident, returnType, argTypes, arguments, opts);
+ }
+}
+
+/** @type {function(number, number, string, boolean=)} */
+function setValue(ptr, value, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': HEAP8[((ptr)>>0)]=value; break;
+ case 'i8': HEAP8[((ptr)>>0)]=value; break;
+ case 'i16': HEAP16[((ptr)>>1)]=value; break;
+ case 'i32': HEAP32[((ptr)>>2)]=value; break;
+ case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
+ case 'float': HEAPF32[((ptr)>>2)]=value; break;
+ case 'double': HEAPF64[((ptr)>>3)]=value; break;
+ default: abort('invalid type for setValue: ' + type);
+ }
+}
+
+/** @type {function(number, string, boolean=)} */
+function getValue(ptr, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': return HEAP8[((ptr)>>0)];
+ case 'i8': return HEAP8[((ptr)>>0)];
+ case 'i16': return HEAP16[((ptr)>>1)];
+ case 'i32': return HEAP32[((ptr)>>2)];
+ case 'i64': return HEAP32[((ptr)>>2)];
+ case 'float': return HEAPF32[((ptr)>>2)];
+ case 'double': return HEAPF64[((ptr)>>3)];
+ default: abort('invalid type for getValue: ' + type);
+ }
+ return null;
+}
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+var ALLOC_STATIC = 2; // Cannot be freed
+var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
+var ALLOC_NONE = 4; // Do not allocate
+
+// allocate(): This is for internal use. You can use it yourself as well, but the interface
+// is a little tricky (see docs right below). The reason is that it is optimized
+// for multiple syntaxes to save space in generated code. So you should
+// normally not use allocate(), and instead allocate memory using _malloc(),
+// initialize it with setValue(), and so forth.
+// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
+// in *bytes* (note that this is sometimes confusing: the next parameter does not
+// affect this!)
+// @types: Either an array of types, one for each byte (or 0 if no type at that position),
+// or a single type which is used for the entire block. This only matters if there
+// is initial data - if @slab is a number, then this does not matter at all and is
+// ignored.
+// @allocator: How to allocate memory, see ALLOC_*
+/** @type {function((TypedArray|Array
|number), string, number, number=)} */
+function allocate(slab, types, allocator, ptr) {
+ var zeroinit, size;
+ if (typeof slab === 'number') {
+ zeroinit = true;
+ size = slab;
+ } else {
+ zeroinit = false;
+ size = slab.length;
+ }
+
+ var singleType = typeof types === 'string' ? types : null;
+
+ var ret;
+ if (allocator == ALLOC_NONE) {
+ ret = ptr;
+ } else {
+ ret = [typeof _malloc === 'function' ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
+ }
+
+ if (zeroinit) {
+ var stop;
+ ptr = ret;
+ assert((ret & 3) == 0);
+ stop = ret + (size & ~3);
+ for (; ptr < stop; ptr += 4) {
+ HEAP32[((ptr)>>2)]=0;
+ }
+ stop = ret + size;
+ while (ptr < stop) {
+ HEAP8[((ptr++)>>0)]=0;
+ }
+ return ret;
+ }
+
+ if (singleType === 'i8') {
+ if (slab.subarray || slab.slice) {
+ HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret);
+ } else {
+ HEAPU8.set(new Uint8Array(slab), ret);
+ }
+ return ret;
+ }
+
+ var i = 0, type, typeSize, previousType;
+ while (i < size) {
+ var curr = slab[i];
+
+ type = singleType || types[i];
+ if (type === 0) {
+ i++;
+ continue;
+ }
+
+ if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
+
+ setValue(ret+i, curr, type);
+
+ // no need to look up size unless type changes, so cache it
+ if (previousType !== type) {
+ typeSize = getNativeTypeSize(type);
+ previousType = type;
+ }
+ i += typeSize;
+ }
+
+ return ret;
+}
+
+// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
+function getMemory(size) {
+ if (!staticSealed) return staticAlloc(size);
+ if (!runtimeInitialized) return dynamicAlloc(size);
+ return _malloc(size);
+}
+
+/** @type {function(number, number=)} */
+function Pointer_stringify(ptr, length) {
+ if (length === 0 || !ptr) return '';
+ // Find the length, and check for UTF while doing so
+ var hasUtf = 0;
+ var t;
+ var i = 0;
+ while (1) {
+ t = HEAPU8[(((ptr)+(i))>>0)];
+ hasUtf |= t;
+ if (t == 0 && !length) break;
+ i++;
+ if (length && i == length) break;
+ }
+ if (!length) length = i;
+
+ var ret = '';
+
+ if (hasUtf < 128) {
+ var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
+ var curr;
+ while (length > 0) {
+ curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
+ ret = ret ? ret + curr : curr;
+ ptr += MAX_CHUNK;
+ length -= MAX_CHUNK;
+ }
+ return ret;
+ }
+ return UTF8ToString(ptr);
+}
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+ var str = '';
+ while (1) {
+ var ch = HEAP8[((ptr++)>>0)];
+ if (!ch) return str;
+ str += String.fromCharCode(ch);
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+ return writeAsciiToMemory(str, outPtr, false);
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+
+var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
+function UTF8ArrayToString(u8Array, idx) {
+ var endPtr = idx;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+ // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+ while (u8Array[endPtr]) ++endPtr;
+
+ if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
+ return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
+ } else {
+ var u0, u1, u2, u3, u4, u5;
+
+ var str = '';
+ while (1) {
+ // For UTF8 byte structure, see:
+ // http://en.wikipedia.org/wiki/UTF-8#Description
+ // https://www.ietf.org/rfc/rfc2279.txt
+ // https://tools.ietf.org/html/rfc3629
+ u0 = u8Array[idx++];
+ if (!u0) return str;
+ if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+ u1 = u8Array[idx++] & 63;
+ if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+ u2 = u8Array[idx++] & 63;
+ if ((u0 & 0xF0) == 0xE0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ u3 = u8Array[idx++] & 63;
+ if ((u0 & 0xF8) == 0xF0) {
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
+ } else {
+ u4 = u8Array[idx++] & 63;
+ if ((u0 & 0xFC) == 0xF8) {
+ u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
+ } else {
+ u5 = u8Array[idx++] & 63;
+ u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
+ }
+ }
+ }
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ }
+ }
+ }
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ToString(ptr) {
+ return UTF8ArrayToString(HEAPU8,ptr);
+}
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+// outIdx: The starting offset in the array to begin the copying.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array.
+// This count should include the null terminator,
+// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
+ if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+ return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) {
+ var u1 = str.charCodeAt(++i);
+ u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+ }
+ if (u <= 0x7F) {
+ if (outIdx >= endIdx) break;
+ outU8Array[outIdx++] = u;
+ } else if (u <= 0x7FF) {
+ if (outIdx + 1 >= endIdx) break;
+ outU8Array[outIdx++] = 0xC0 | (u >> 6);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xFFFF) {
+ if (outIdx + 2 >= endIdx) break;
+ outU8Array[outIdx++] = 0xE0 | (u >> 12);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x1FFFFF) {
+ if (outIdx + 3 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF0 | (u >> 18);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x3FFFFFF) {
+ if (outIdx + 4 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF8 | (u >> 24);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 5 >= endIdx) break;
+ outU8Array[outIdx++] = 0xFC | (u >> 30);
+ outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ outU8Array[outIdx] = 0;
+ return outIdx - startIdx;
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+ return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF8(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) {
+ ++len;
+ } else if (u <= 0x7FF) {
+ len += 2;
+ } else if (u <= 0xFFFF) {
+ len += 3;
+ } else if (u <= 0x1FFFFF) {
+ len += 4;
+ } else if (u <= 0x3FFFFFF) {
+ len += 5;
+ } else {
+ len += 6;
+ }
+ }
+ return len;
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
+function UTF16ToString(ptr) {
+ var endPtr = ptr;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+ // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+ var idx = endPtr >> 1;
+ while (HEAP16[idx]) ++idx;
+ endPtr = idx << 1;
+
+ if (endPtr - ptr > 32 && UTF16Decoder) {
+ return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
+ } else {
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+ if (codeUnit == 0) return str;
+ ++i;
+ // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+ str += String.fromCharCode(codeUnit);
+ }
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 2) return 0;
+ maxBytesToWrite -= 2; // Null terminator.
+ var startPtr = outPtr;
+ var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+ for (var i = 0; i < numCharsToWrite; ++i) {
+ // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ HEAP16[((outPtr)>>1)]=codeUnit;
+ outPtr += 2;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP16[((outPtr)>>1)]=0;
+ return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+ return str.length*2;
+}
+
+function UTF32ToString(ptr) {
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+ if (utf32 == 0)
+ return str;
+ ++i;
+ // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ if (utf32 >= 0x10000) {
+ var ch = utf32 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ } else {
+ str += String.fromCharCode(utf32);
+ }
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 4) return 0;
+ var startPtr = outPtr;
+ var endPtr = startPtr + maxBytesToWrite - 4;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+ var trailSurrogate = str.charCodeAt(++i);
+ codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+ }
+ HEAP32[((outPtr)>>2)]=codeUnit;
+ outPtr += 4;
+ if (outPtr + 4 > endPtr) break;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP32[((outPtr)>>2)]=0;
+ return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i);
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+ len += 4;
+ }
+
+ return len;
+}
+
+// Allocate heap space for a JS string, and write it there.
+// It is the responsibility of the caller to free() that memory.
+function allocateUTF8(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = _malloc(size);
+ if (ret) stringToUTF8Array(str, HEAP8, ret, size);
+ return ret;
+}
+
+// Allocate stack space for a JS string, and write it there.
+function allocateUTF8OnStack(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8Array(str, HEAP8, ret, size);
+ return ret;
+}
+
+function demangle(func) {
+ return func;
+}
+
+function demangleAll(text) {
+ var regex =
+ /__Z[\w\d_]+/g;
+ return text.replace(regex,
+ function(x) {
+ var y = demangle(x);
+ return x === y ? x : (y + ' [' + x + ']');
+ });
+}
+
+function jsStackTrace() {
+ var err = new Error();
+ if (!err.stack) {
+ // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
+ // so try that as a special-case.
+ try {
+ throw new Error(0);
+ } catch(e) {
+ err = e;
+ }
+ if (!err.stack) {
+ return '(no stack trace available)';
+ }
+ }
+ return err.stack.toString();
+}
+
+function stackTrace() {
+ var js = jsStackTrace();
+ if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
+ return demangleAll(js);
+}
+
+// Memory management
+
+var PAGE_SIZE = 16384;
+var WASM_PAGE_SIZE = 65536;
+var ASMJS_PAGE_SIZE = 16777216;
+var MIN_TOTAL_MEMORY = 16777216;
+
+function alignUp(x, multiple) {
+ if (x % multiple > 0) {
+ x += multiple - (x % multiple);
+ }
+ return x;
+}
+
+var HEAP,
+/** @type {ArrayBuffer} */
+ buffer,
+/** @type {Int8Array} */
+ HEAP8,
+/** @type {Uint8Array} */
+ HEAPU8,
+/** @type {Int16Array} */
+ HEAP16,
+/** @type {Uint16Array} */
+ HEAPU16,
+/** @type {Int32Array} */
+ HEAP32,
+/** @type {Uint32Array} */
+ HEAPU32,
+/** @type {Float32Array} */
+ HEAPF32,
+/** @type {Float64Array} */
+ HEAPF64;
+
+function updateGlobalBuffer(buf) {
+ Module['buffer'] = buffer = buf;
+}
+
+function updateGlobalBufferViews() {
+ Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
+ Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
+ Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
+ Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
+ Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
+ Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
+ Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
+ Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
+}
+
+var STATIC_BASE, STATICTOP, staticSealed; // static area
+var STACK_BASE, STACKTOP, STACK_MAX; // stack area
+var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk
+
+ STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
+ staticSealed = false;
+
+
+
+
+function abortOnCannotGrowMemory() {
+ abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
+}
+
+if (!Module['reallocBuffer']) Module['reallocBuffer'] = function(size) {
+ var ret;
+ try {
+ var oldHEAP8 = HEAP8;
+ ret = new ArrayBuffer(size);
+ var temp = new Int8Array(ret);
+ temp.set(oldHEAP8);
+ } catch(e) {
+ return false;
+ }
+ var success = _emscripten_replace_memory(ret);
+ if (!success) return false;
+ return ret;
+};
+
+function enlargeMemory() {
+ // TOTAL_MEMORY is the current size of the actual array, and DYNAMICTOP is the new top.
+
+
+ var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB.
+ var LIMIT = 2147483648 - PAGE_MULTIPLE; // We can do one page short of 2GB as theoretical maximum.
+
+ if (HEAP32[DYNAMICTOP_PTR>>2] > LIMIT) {
+ return false;
+ }
+
+ var OLD_TOTAL_MEMORY = TOTAL_MEMORY;
+ TOTAL_MEMORY = Math.max(TOTAL_MEMORY, MIN_TOTAL_MEMORY); // So the loop below will not be infinite, and minimum asm.js memory size is 16MB.
+
+ while (TOTAL_MEMORY < HEAP32[DYNAMICTOP_PTR>>2]) { // Keep incrementing the heap size as long as it's less than what is requested.
+ if (TOTAL_MEMORY <= 536870912) {
+ TOTAL_MEMORY = alignUp(2 * TOTAL_MEMORY, PAGE_MULTIPLE); // Simple heuristic: double until 1GB...
+ } else {
+ // ..., but after that, add smaller increments towards 2GB, which we cannot reach
+ TOTAL_MEMORY = Math.min(alignUp((3 * TOTAL_MEMORY + 2147483648) / 4, PAGE_MULTIPLE), LIMIT);
+ }
+ }
+
+
+
+ var replacement = Module['reallocBuffer'](TOTAL_MEMORY);
+ if (!replacement || replacement.byteLength != TOTAL_MEMORY) {
+ // restore the state to before this call, we failed
+ TOTAL_MEMORY = OLD_TOTAL_MEMORY;
+ return false;
+ }
+
+ // everything worked
+
+ updateGlobalBuffer(replacement);
+ updateGlobalBufferViews();
+
+
+
+ return true;
+}
+
+var byteLength;
+try {
+ byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, 'byteLength').get);
+ byteLength(new ArrayBuffer(4)); // can fail on older ie
+} catch(e) { // can fail on older node/v8
+ byteLength = function(buffer) { return buffer.byteLength; };
+}
+
+var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
+var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
+if (TOTAL_MEMORY < TOTAL_STACK) err('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
+
+// Initialize the runtime's memory
+
+
+
+// Use a provided buffer, if there is one, or else allocate a new one
+if (Module['buffer']) {
+ buffer = Module['buffer'];
+} else {
+ // Use a WebAssembly memory where available
+ if (typeof WebAssembly === 'object' && typeof WebAssembly.Memory === 'function') {
+ Module['wasmMemory'] = new WebAssembly.Memory({ 'initial': TOTAL_MEMORY / WASM_PAGE_SIZE });
+ buffer = Module['wasmMemory'].buffer;
+ } else
+ {
+ buffer = new ArrayBuffer(TOTAL_MEMORY);
+ }
+ Module['buffer'] = buffer;
+}
+updateGlobalBufferViews();
+
+
+function getTotalMemory() {
+ return TOTAL_MEMORY;
+}
+
+// Endianness check (note: assumes compiler arch was little-endian)
+
+function callRuntimeCallbacks(callbacks) {
+ while(callbacks.length > 0) {
+ var callback = callbacks.shift();
+ if (typeof callback == 'function') {
+ callback();
+ continue;
+ }
+ var func = callback.func;
+ if (typeof func === 'number') {
+ if (callback.arg === undefined) {
+ Module['dynCall_v'](func);
+ } else {
+ Module['dynCall_vi'](func, callback.arg);
+ }
+ } else {
+ func(callback.arg === undefined ? null : callback.arg);
+ }
+ }
+}
+
+var __ATPRERUN__ = []; // functions called before the runtime is initialized
+var __ATINIT__ = []; // functions called during startup
+var __ATMAIN__ = []; // functions called when main() is to be run
+var __ATEXIT__ = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+var runtimeExited = false;
+
+
+function preRun() {
+ // compatibility - merge in anything from Module['preRun'] at this time
+ if (Module['preRun']) {
+ if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+ while (Module['preRun'].length) {
+ addOnPreRun(Module['preRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function ensureInitRuntime() {
+ if (runtimeInitialized) return;
+ runtimeInitialized = true;
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+ callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+ callRuntimeCallbacks(__ATEXIT__);
+ runtimeExited = true;
+}
+
+function postRun() {
+ // compatibility - merge in anything from Module['postRun'] at this time
+ if (Module['postRun']) {
+ if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+ while (Module['postRun'].length) {
+ addOnPostRun(Module['postRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+
+function addOnPreMain(cb) {
+ __ATMAIN__.unshift(cb);
+}
+
+function addOnExit(cb) {
+ __ATEXIT__.unshift(cb);
+}
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+
+// Deprecated: This function should not be called because it is unsafe and does not provide
+// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
+// function stringToUTF8Array() instead, which takes in a maximum length that can be used
+// to be secure from out of bounds writes.
+/** @deprecated */
+function writeStringToMemory(string, buffer, dontAddNull) {
+ warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
+
+ var /** @type {number} */ lastChar, /** @type {number} */ end;
+ if (dontAddNull) {
+ // stringToUTF8Array always appends null. If we don't want to do that, remember the
+ // character that existed at the location where the null will be placed, and restore
+ // that after the write (below).
+ end = buffer + lengthBytesUTF8(string);
+ lastChar = HEAP8[end];
+ }
+ stringToUTF8(string, buffer, Infinity);
+ if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
+}
+
+function writeArrayToMemory(array, buffer) {
+ HEAP8.set(array, buffer);
+}
+
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+ for (var i = 0; i < str.length; ++i) {
+ HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
+ }
+ // Null-terminate the pointer to the HEAP.
+ if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
+}
+
+function unSign(value, bits, ignore) {
+ if (value >= 0) {
+ return value;
+ }
+ return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
+ : Math.pow(2, bits) + value;
+}
+function reSign(value, bits, ignore) {
+ if (value <= 0) {
+ return value;
+ }
+ var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
+ : Math.pow(2, bits-1);
+ if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
+ // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
+ // TODO: In i64 mode 1, resign the two parts separately and safely
+ value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
+ }
+ return value;
+}
+
+
+var Math_abs = Math.abs;
+var Math_cos = Math.cos;
+var Math_sin = Math.sin;
+var Math_tan = Math.tan;
+var Math_acos = Math.acos;
+var Math_asin = Math.asin;
+var Math_atan = Math.atan;
+var Math_atan2 = Math.atan2;
+var Math_exp = Math.exp;
+var Math_log = Math.log;
+var Math_sqrt = Math.sqrt;
+var Math_ceil = Math.ceil;
+var Math_floor = Math.floor;
+var Math_pow = Math.pow;
+var Math_imul = Math.imul;
+var Math_fround = Math.fround;
+var Math_round = Math.round;
+var Math_min = Math.min;
+var Math_max = Math.max;
+var Math_clz32 = Math.clz32;
+var Math_trunc = Math.trunc;
+
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+
+function getUniqueRunDependency(id) {
+ return id;
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+}
+
+function removeRunDependency(id) {
+ runDependencies--;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+}
+
+Module["preloadedImages"] = {}; // maps url to image data
+Module["preloadedAudios"] = {}; // maps url to audio data
+
+
+
+var memoryInitializer = null;
+
+
+
+
+
+
+// Copyright 2017 The Emscripten Authors. All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License. Both these licenses can be
+// found in the LICENSE file.
+
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+ return String.prototype.startsWith ?
+ filename.startsWith(dataURIPrefix) :
+ filename.indexOf(dataURIPrefix) === 0;
+}
+
+
+
+
+function integrateWasmJS() {
+ // wasm.js has several methods for creating the compiled code module here:
+ // * 'native-wasm' : use native WebAssembly support in the browser
+ // * 'interpret-s-expr': load s-expression code from a .wast and interpret
+ // * 'interpret-binary': load binary wasm and interpret
+ // * 'interpret-asm2wasm': load asm.js code, translate to wasm, and interpret
+ // * 'asmjs': no wasm, just load the asm.js code and use that (good for testing)
+ // The method is set at compile time (BINARYEN_METHOD)
+ // The method can be a comma-separated list, in which case, we will try the
+ // options one by one. Some of them can fail gracefully, and then we can try
+ // the next.
+
+ // inputs
+
+ var method = 'native-wasm';
+
+ var wasmTextFile = 'libvpx.wast';
+ var wasmBinaryFile = 'libvpx.wasm';
+ var asmjsCodeFile = 'libvpx.temp.asm.js';
+
+ if (!isDataURI(wasmTextFile)) {
+ wasmTextFile = locateFile(wasmTextFile);
+ }
+ if (!isDataURI(wasmBinaryFile)) {
+ wasmBinaryFile = locateFile(wasmBinaryFile);
+ }
+ if (!isDataURI(asmjsCodeFile)) {
+ asmjsCodeFile = locateFile(asmjsCodeFile);
+ }
+
+ // utilities
+
+ var wasmPageSize = 64*1024;
+
+ var info = {
+ 'global': null,
+ 'env': null,
+ 'asm2wasm': asm2wasmImports,
+ 'parent': Module // Module inside wasm-js.cpp refers to wasm-js.cpp; this allows access to the outside program.
+ };
+
+ var exports = null;
+
+
+ function mergeMemory(newBuffer) {
+ // The wasm instance creates its memory. But static init code might have written to
+ // buffer already, including the mem init file, and we must copy it over in a proper merge.
+ // TODO: avoid this copy, by avoiding such static init writes
+ // TODO: in shorter term, just copy up to the last static init write
+ var oldBuffer = Module['buffer'];
+ if (newBuffer.byteLength < oldBuffer.byteLength) {
+ err('the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here');
+ }
+ var oldView = new Int8Array(oldBuffer);
+ var newView = new Int8Array(newBuffer);
+
+
+ newView.set(oldView);
+ updateGlobalBuffer(newBuffer);
+ updateGlobalBufferViews();
+ }
+
+ function getBinary() {
+ try {
+ if (Module['wasmBinary']) {
+ return new Uint8Array(Module['wasmBinary']);
+ }
+ if (Module['readBinary']) {
+ return Module['readBinary'](wasmBinaryFile);
+ } else {
+ throw "both async and sync fetching of the wasm failed";
+ }
+ }
+ catch (err) {
+ abort(err);
+ }
+ }
+
+ function getBinaryPromise() {
+ // if we don't have the binary yet, and have the Fetch api, use that
+ // in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web
+ if (!Module['wasmBinary'] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function') {
+ return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) {
+ if (!response['ok']) {
+ throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
+ }
+ return response['arrayBuffer']();
+ }).catch(function () {
+ return getBinary();
+ });
+ }
+ // Otherwise, getBinary should be able to get it synchronously
+ return new Promise(function(resolve, reject) {
+ resolve(getBinary());
+ });
+ }
+
+ // do-method functions
+
+
+ function doNativeWasm(global, env, providedBuffer) {
+ if (typeof WebAssembly !== 'object') {
+ err('no native wasm support detected');
+ return false;
+ }
+ // prepare memory import
+ if (!(Module['wasmMemory'] instanceof WebAssembly.Memory)) {
+ err('no native wasm Memory in use');
+ return false;
+ }
+ env['memory'] = Module['wasmMemory'];
+ // Load the wasm module and create an instance of using native support in the JS engine.
+ info['global'] = {
+ 'NaN': NaN,
+ 'Infinity': Infinity
+ };
+ info['global.Math'] = Math;
+ info['env'] = env;
+ // handle a generated wasm instance, receiving its exports and
+ // performing other necessary setup
+ function receiveInstance(instance, module) {
+ exports = instance.exports;
+ if (exports.memory) mergeMemory(exports.memory);
+ Module['asm'] = exports;
+ Module["usingWasm"] = true;
+ removeRunDependency('wasm-instantiate');
+ }
+ addRunDependency('wasm-instantiate');
+
+ // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+ // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel
+ // to any other async startup actions they are performing.
+ if (Module['instantiateWasm']) {
+ try {
+ return Module['instantiateWasm'](info, receiveInstance);
+ } catch(e) {
+ err('Module.instantiateWasm callback failed with error: ' + e);
+ return false;
+ }
+ }
+
+ function receiveInstantiatedSource(output) {
+ // 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance.
+ // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+ receiveInstance(output['instance'], output['module']);
+ }
+ function instantiateArrayBuffer(receiver) {
+ getBinaryPromise().then(function(binary) {
+ return WebAssembly.instantiate(binary, info);
+ }).then(receiver, function(reason) {
+ err('failed to asynchronously prepare wasm: ' + reason);
+ abort(reason);
+ });
+ }
+ // Prefer streaming instantiation if available.
+ if (!Module['wasmBinary'] &&
+ typeof WebAssembly.instantiateStreaming === 'function' &&
+ !isDataURI(wasmBinaryFile) &&
+ typeof fetch === 'function') {
+ WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: 'same-origin' }), info)
+ .then(receiveInstantiatedSource, function(reason) {
+ // We expect the most common failure cause to be a bad MIME type for the binary,
+ // in which case falling back to ArrayBuffer instantiation should work.
+ err('wasm streaming compile failed: ' + reason);
+ err('falling back to ArrayBuffer instantiation');
+ instantiateArrayBuffer(receiveInstantiatedSource);
+ });
+ } else {
+ instantiateArrayBuffer(receiveInstantiatedSource);
+ }
+ return {}; // no exports yet; we'll fill them in later
+ }
+
+
+ // We may have a preloaded value in Module.asm, save it
+ Module['asmPreload'] = Module['asm'];
+
+ // Memory growth integration code
+
+ var asmjsReallocBuffer = Module['reallocBuffer'];
+
+ var wasmReallocBuffer = function(size) {
+ var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB.
+ size = alignUp(size, PAGE_MULTIPLE); // round up to wasm page size
+ var old = Module['buffer'];
+ var oldSize = old.byteLength;
+ if (Module["usingWasm"]) {
+ // native wasm support
+ try {
+ var result = Module['wasmMemory'].grow((size - oldSize) / wasmPageSize); // .grow() takes a delta compared to the previous size
+ if (result !== (-1 | 0)) {
+ // success in native wasm memory growth, get the buffer from the memory
+ return Module['buffer'] = Module['wasmMemory'].buffer;
+ } else {
+ return null;
+ }
+ } catch(e) {
+ return null;
+ }
+ }
+ };
+
+ Module['reallocBuffer'] = function(size) {
+ if (finalMethod === 'asmjs') {
+ return asmjsReallocBuffer(size);
+ } else {
+ return wasmReallocBuffer(size);
+ }
+ };
+
+ // we may try more than one; this is the final one, that worked and we are using
+ var finalMethod = '';
+
+ // Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate
+ // the wasm module at that time, and it receives imports and provides exports and so forth, the app
+ // doesn't need to care that it is wasm or polyfilled wasm or asm.js.
+
+ Module['asm'] = function(global, env, providedBuffer) {
+ // import table
+ if (!env['table']) {
+ var TABLE_SIZE = Module['wasmTableSize'];
+ if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; // works in binaryen interpreter at least
+ var MAX_TABLE_SIZE = Module['wasmMaxTableSize'];
+ if (typeof WebAssembly === 'object' && typeof WebAssembly.Table === 'function') {
+ if (MAX_TABLE_SIZE !== undefined) {
+ env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, 'maximum': MAX_TABLE_SIZE, 'element': 'anyfunc' });
+ } else {
+ env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, element: 'anyfunc' });
+ }
+ } else {
+ env['table'] = new Array(TABLE_SIZE); // works in binaryen interpreter at least
+ }
+ Module['wasmTable'] = env['table'];
+ }
+
+ if (!env['__memory_base']) {
+ env['__memory_base'] = Module['STATIC_BASE']; // tell the memory segments where to place themselves
+ }
+ if (!env['__table_base']) {
+ env['__table_base'] = 0; // table starts at 0 by default, in dynamic linking this will change
+ }
+
+ // try the methods. each should return the exports if it succeeded
+
+ var exports;
+ exports = doNativeWasm(global, env, providedBuffer);
+
+ assert(exports, 'no binaryen method succeeded.');
+
+
+ return exports;
+ };
+
+ var methodHandler = Module['asm']; // note our method handler, as we may modify Module['asm'] later
+}
+
+integrateWasmJS();
+
+// === Body ===
+
+var ASM_CONSTS = [];
+
+
+
+
+
+STATIC_BASE = GLOBAL_BASE;
+
+STATICTOP = STATIC_BASE + 127056;
+/* global initializers */ __ATINIT__.push();
+
+
+
+
+
+
+
+var STATIC_BUMP = 127056;
+Module["STATIC_BASE"] = STATIC_BASE;
+Module["STATIC_BUMP"] = STATIC_BUMP;
+
+/* no memory initializer */
+var tempDoublePtr = STATICTOP; STATICTOP += 16;
+
+function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+}
+
+function copyTempDouble(ptr) {
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+ HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
+ HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
+ HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
+ HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
+}
+
+// {{PRE_LIBRARY}}
+
+
+ function ___lock() {}
+
+
+
+
+ var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
+
+ var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
+
+ function ___setErrNo(value) {
+ if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
+ return value;
+ }
+
+ var PATH={splitPath:function (filename) {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },normalizeArray:function (parts, allowAboveRoot) {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === '.') {
+ parts.splice(i, 1);
+ } else if (last === '..') {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up; up--) {
+ parts.unshift('..');
+ }
+ }
+ return parts;
+ },normalize:function (path) {
+ var isAbsolute = path.charAt(0) === '/',
+ trailingSlash = path.substr(-1) === '/';
+ // Normalize the path
+ path = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), !isAbsolute).join('/');
+ if (!path && !isAbsolute) {
+ path = '.';
+ }
+ if (path && trailingSlash) {
+ path += '/';
+ }
+ return (isAbsolute ? '/' : '') + path;
+ },dirname:function (path) {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return '.';
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },basename:function (path) {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === '/') return '/';
+ var lastSlash = path.lastIndexOf('/');
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash+1);
+ },extname:function (path) {
+ return PATH.splitPath(path)[3];
+ },join:function () {
+ var paths = Array.prototype.slice.call(arguments, 0);
+ return PATH.normalize(paths.join('/'));
+ },join2:function (l, r) {
+ return PATH.normalize(l + '/' + r);
+ },resolve:function () {
+ var resolvedPath = '',
+ resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? arguments[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path !== 'string') {
+ throw new TypeError('Arguments to path.resolve must be strings');
+ } else if (!path) {
+ return ''; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + '/' + resolvedPath;
+ resolvedAbsolute = path.charAt(0) === '/';
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
+ return !!p;
+ }), !resolvedAbsolute).join('/');
+ return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+ },relative:function (from, to) {
+ from = PATH.resolve(from).substr(1);
+ to = PATH.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== '') break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== '') break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split('/'));
+ var toParts = trim(to.split('/'));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push('..');
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join('/');
+ }};
+
+ var TTY={ttys:[],init:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process['stdin']['setEncoding']('utf8');
+ // }
+ },shutdown:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process['stdin']['pause']();
+ // }
+ },register:function (dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },stream_ops:{open:function (stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },close:function (stream) {
+ // flush any pending line data
+ stream.tty.ops.flush(stream.tty);
+ },flush:function (stream) {
+ stream.tty.ops.flush(stream.tty);
+ },read:function (stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ var i = 0;
+ try {
+ if (offset === 0 && length === 0) {
+ // musl implements an fflush using a write of a NULL buffer of size 0
+ stream.tty.ops.flush(stream.tty);
+ } else {
+ while (i < length) {
+ stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+ i++;
+ }
+ }
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }},default_tty_ops:{get_char:function (tty) {
+ if (!tty.input.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = new Buffer(BUFSIZE);
+ var bytesRead = 0;
+
+ var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
+
+ var fd = process.stdin.fd;
+ if (isPosixPlatform) {
+ // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
+ var usingDevice = false;
+ try {
+ fd = fs.openSync('/dev/stdin', 'r');
+ usingDevice = true;
+ } catch (e) {}
+ }
+
+ try {
+ bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
+ } catch(e) {
+ // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+ // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+ if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
+ else throw e;
+ }
+
+ if (usingDevice) { fs.closeSync(fd); }
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString('utf-8');
+ } else {
+ result = null;
+ }
+
+ } else if (typeof window != 'undefined' &&
+ typeof window.prompt == 'function') {
+ // Browser.
+ result = window.prompt('Input: '); // returns null on cancel
+ if (result !== null) {
+ result += '\n';
+ }
+ } else if (typeof readline == 'function') {
+ // Command line.
+ result = readline();
+ if (result !== null) {
+ result += '\n';
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ tty.input = intArrayFromString(result, true);
+ }
+ return tty.input.shift();
+ },put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }},default_tty1_ops:{put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }}};
+
+ var MEMFS={ops_table:null,mount:function (mount) {
+ return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },getFileDataAsRegularArray:function (node) {
+ if (node.contents && node.contents.subarray) {
+ var arr = [];
+ for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
+ return arr; // Returns a copy of the original data.
+ }
+ return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
+ },getFileDataAsTypedArray:function (node) {
+ if (!node.contents) return new Uint8Array;
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },expandFileStorage:function (node, newCapacity) {
+ // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
+ // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
+ // increase the size.
+ if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
+ node.contents = MEMFS.getFileDataAsRegularArray(node);
+ node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
+ }
+
+ if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ return;
+ }
+ // Not using a typed array to back the file storage. Use a standard JS array instead.
+ if (!node.contents && newCapacity > 0) node.contents = [];
+ while (node.contents.length < newCapacity) node.contents.push(0);
+ },resizeFileStorage:function (node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ return;
+ }
+ if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ return;
+ }
+ // Backing with a JS array.
+ if (!node.contents) node.contents = [];
+ if (node.contents.length > newSize) node.contents.length = newSize;
+ else while (node.contents.length < newSize) node.contents.push(0);
+ node.usedBytes = newSize;
+ },node_ops:{getattr:function (node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },lookup:function (parent, name) {
+ throw FS.genericErrors[ERRNO_CODES.ENOENT];
+ },mknod:function (parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },rename:function (old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ }
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ old_node.parent = new_dir;
+ },unlink:function (parent, name) {
+ delete parent.contents[name];
+ },rmdir:function (parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ delete parent.contents[name];
+ },readdir:function (node) {
+ var entries = ['.', '..']
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },readlink:function (node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return node.link;
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) { // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ // If memory can grow, we don't want to hold on to references of
+ // the memory Buffer, as they may get invalidated. That means
+ // we need to do a copy here.
+ canOwn = false;
+
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+ if (canOwn) {
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position+length);
+ if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
+ else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position+length);
+ return length;
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ },allocate:function (stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if ( !(flags & 2) &&
+ (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
+ // We can't emulate MAP_SHARED when the file is not backed by the buffer
+ // we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < stream.node.usedBytes) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = _malloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
+ }
+ buffer.set(contents, ptr);
+ }
+ return { ptr: ptr, allocated: allocated };
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (mmapFlags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+
+ var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ }}};
+
+ var IDBFS={dbs:{},indexedDB:function () {
+ if (typeof indexedDB !== 'undefined') return indexedDB;
+ var ret = null;
+ if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ assert(ret, 'IDBFS used, but indexedDB not supported');
+ return ret;
+ },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
+ // reuse all of the core MEMFS functionality
+ return MEMFS.mount.apply(null, arguments);
+ },syncfs:function (mount, populate, callback) {
+ IDBFS.getLocalSet(mount, function(err, local) {
+ if (err) return callback(err);
+
+ IDBFS.getRemoteSet(mount, function(err, remote) {
+ if (err) return callback(err);
+
+ var src = populate ? remote : local;
+ var dst = populate ? local : remote;
+
+ IDBFS.reconcile(src, dst, callback);
+ });
+ });
+ },getDB:function (name, callback) {
+ // check the cache first
+ var db = IDBFS.dbs[name];
+ if (db) {
+ return callback(null, db);
+ }
+
+ var req;
+ try {
+ req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+ } catch (e) {
+ return callback(e);
+ }
+ if (!req) {
+ return callback("Unable to connect to IndexedDB");
+ }
+ req.onupgradeneeded = function(e) {
+ var db = e.target.result;
+ var transaction = e.target.transaction;
+
+ var fileStore;
+
+ if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+ fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ } else {
+ fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+ }
+
+ if (!fileStore.indexNames.contains('timestamp')) {
+ fileStore.createIndex('timestamp', 'timestamp', { unique: false });
+ }
+ };
+ req.onsuccess = function() {
+ db = req.result;
+
+ // add to the cache
+ IDBFS.dbs[name] = db;
+ callback(null, db);
+ };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },getLocalSet:function (mount, callback) {
+ var entries = {};
+
+ function isRealDir(p) {
+ return p !== '.' && p !== '..';
+ };
+ function toAbsolute(root) {
+ return function(p) {
+ return PATH.join2(root, p);
+ }
+ };
+
+ var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+
+ while (check.length) {
+ var path = check.pop();
+ var stat;
+
+ try {
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+ }
+
+ entries[path] = { timestamp: stat.mtime };
+ }
+
+ return callback(null, { type: 'local', entries: entries });
+ },getRemoteSet:function (mount, callback) {
+ var entries = {};
+
+ IDBFS.getDB(mount.mountpoint, function(err, db) {
+ if (err) return callback(err);
+
+ try {
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
+ transaction.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ var index = store.index('timestamp');
+
+ index.openKeyCursor().onsuccess = function(event) {
+ var cursor = event.target.result;
+
+ if (!cursor) {
+ return callback(null, { type: 'remote', db: db, entries: entries });
+ }
+
+ entries[cursor.primaryKey] = { timestamp: cursor.key };
+
+ cursor.continue();
+ };
+ } catch (e) {
+ return callback(e);
+ }
+ });
+ },loadLocalEntry:function (path, callback) {
+ var stat, node;
+
+ try {
+ var lookup = FS.lookupPath(path);
+ node = lookup.node;
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode });
+ } else if (FS.isFile(stat.mode)) {
+ // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+ // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+ node.contents = MEMFS.getFileDataAsTypedArray(node);
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+ },storeLocalEntry:function (path, entry, callback) {
+ try {
+ if (FS.isDir(entry.mode)) {
+ FS.mkdir(path, entry.mode);
+ } else if (FS.isFile(entry.mode)) {
+ FS.writeFile(path, entry.contents, { canOwn: true });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+
+ FS.chmod(path, entry.mode);
+ FS.utime(path, entry.timestamp, entry.timestamp);
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },removeLocalEntry:function (path, callback) {
+ try {
+ var lookup = FS.lookupPath(path);
+ var stat = FS.stat(path);
+
+ if (FS.isDir(stat.mode)) {
+ FS.rmdir(path);
+ } else if (FS.isFile(stat.mode)) {
+ FS.unlink(path);
+ }
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },loadRemoteEntry:function (store, path, callback) {
+ var req = store.get(path);
+ req.onsuccess = function(event) { callback(null, event.target.result); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },storeRemoteEntry:function (store, path, entry, callback) {
+ var req = store.put(entry, path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },removeRemoteEntry:function (store, path, callback) {
+ var req = store.delete(path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },reconcile:function (src, dst, callback) {
+ var total = 0;
+
+ var create = [];
+ Object.keys(src.entries).forEach(function (key) {
+ var e = src.entries[key];
+ var e2 = dst.entries[key];
+ if (!e2 || e.timestamp > e2.timestamp) {
+ create.push(key);
+ total++;
+ }
+ });
+
+ var remove = [];
+ Object.keys(dst.entries).forEach(function (key) {
+ var e = dst.entries[key];
+ var e2 = src.entries[key];
+ if (!e2) {
+ remove.push(key);
+ total++;
+ }
+ });
+
+ if (!total) {
+ return callback(null);
+ }
+
+ var errored = false;
+ var completed = 0;
+ var db = src.type === 'remote' ? src.db : dst.db;
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return callback(err);
+ }
+ return;
+ }
+ if (++completed >= total) {
+ return callback(null);
+ }
+ };
+
+ transaction.onerror = function(e) {
+ done(this.error);
+ e.preventDefault();
+ };
+
+ // sort paths in ascending order so directory entries are created
+ // before the files inside them
+ create.sort().forEach(function (path) {
+ if (dst.type === 'local') {
+ IDBFS.loadRemoteEntry(store, path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeLocalEntry(path, entry, done);
+ });
+ } else {
+ IDBFS.loadLocalEntry(path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeRemoteEntry(store, path, entry, done);
+ });
+ }
+ });
+
+ // sort paths in descending order so files are deleted before their
+ // parent directories
+ remove.sort().reverse().forEach(function(path) {
+ if (dst.type === 'local') {
+ IDBFS.removeLocalEntry(path, done);
+ } else {
+ IDBFS.removeRemoteEntry(store, path, done);
+ }
+ });
+ }};
+
+ var NODEFS={isWindows:false,staticInit:function () {
+ NODEFS.isWindows = !!process.platform.match(/^win/);
+ var flags = process["binding"]("constants");
+ // Node.js 4 compatibility: it has no namespaces for constants
+ if (flags["fs"]) {
+ flags = flags["fs"];
+ }
+ NODEFS.flagsForNodeMap = {
+ "1024": flags["O_APPEND"],
+ "64": flags["O_CREAT"],
+ "128": flags["O_EXCL"],
+ "0": flags["O_RDONLY"],
+ "2": flags["O_RDWR"],
+ "4096": flags["O_SYNC"],
+ "512": flags["O_TRUNC"],
+ "1": flags["O_WRONLY"]
+ };
+ },bufferFrom:function (arrayBuffer) {
+ // Node.js < 4.5 compatibility: Buffer.from does not support ArrayBuffer
+ // Buffer.from before 4.5 was just a method inherited from Uint8Array
+ // Buffer.alloc has been added with Buffer.from together, so check it instead
+ return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer);
+ },mount:function (mount) {
+ assert(ENVIRONMENT_IS_NODE);
+ return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node = FS.createNode(parent, name, mode);
+ node.node_ops = NODEFS.node_ops;
+ node.stream_ops = NODEFS.stream_ops;
+ return node;
+ },getMode:function (path) {
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ if (NODEFS.isWindows) {
+ // Node.js on Windows never represents permission bit 'x', so
+ // propagate read bits to execute bits
+ stat.mode = stat.mode | ((stat.mode & 292) >> 2);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return stat.mode;
+ },realPath:function (node) {
+ var parts = [];
+ while (node.parent !== node) {
+ parts.push(node.name);
+ node = node.parent;
+ }
+ parts.push(node.mount.opts.root);
+ parts.reverse();
+ return PATH.join.apply(null, parts);
+ },flagsForNode:function (flags) {
+ flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
+ var newFlags = 0;
+ for (var k in NODEFS.flagsForNodeMap) {
+ if (flags & k) {
+ newFlags |= NODEFS.flagsForNodeMap[k];
+ flags ^= k;
+ }
+ }
+
+ if (!flags) {
+ return newFlags;
+ } else {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ },node_ops:{getattr:function (node) {
+ var path = NODEFS.realPath(node);
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
+ // See http://support.microsoft.com/kb/140365
+ if (NODEFS.isWindows && !stat.blksize) {
+ stat.blksize = 4096;
+ }
+ if (NODEFS.isWindows && !stat.blocks) {
+ stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
+ }
+ return {
+ dev: stat.dev,
+ ino: stat.ino,
+ mode: stat.mode,
+ nlink: stat.nlink,
+ uid: stat.uid,
+ gid: stat.gid,
+ rdev: stat.rdev,
+ size: stat.size,
+ atime: stat.atime,
+ mtime: stat.mtime,
+ ctime: stat.ctime,
+ blksize: stat.blksize,
+ blocks: stat.blocks
+ };
+ },setattr:function (node, attr) {
+ var path = NODEFS.realPath(node);
+ try {
+ if (attr.mode !== undefined) {
+ fs.chmodSync(path, attr.mode);
+ // update the common node structure mode as well
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ var date = new Date(attr.timestamp);
+ fs.utimesSync(path, date, date);
+ }
+ if (attr.size !== undefined) {
+ fs.truncateSync(path, attr.size);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },lookup:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ var mode = NODEFS.getMode(path);
+ return NODEFS.createNode(parent, name, mode);
+ },mknod:function (parent, name, mode, dev) {
+ var node = NODEFS.createNode(parent, name, mode, dev);
+ // create the backing node for this in the fs root as well
+ var path = NODEFS.realPath(node);
+ try {
+ if (FS.isDir(node.mode)) {
+ fs.mkdirSync(path, node.mode);
+ } else {
+ fs.writeFileSync(path, '', { mode: node.mode });
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return node;
+ },rename:function (oldNode, newDir, newName) {
+ var oldPath = NODEFS.realPath(oldNode);
+ var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
+ try {
+ fs.renameSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },unlink:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.unlinkSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },rmdir:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.rmdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readdir:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ return fs.readdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },symlink:function (parent, newName, oldPath) {
+ var newPath = PATH.join2(NODEFS.realPath(parent), newName);
+ try {
+ fs.symlinkSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readlink:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ path = fs.readlinkSync(path);
+ path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
+ return path;
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }},stream_ops:{open:function (stream) {
+ var path = NODEFS.realPath(stream.node);
+ try {
+ if (FS.isFile(stream.node.mode)) {
+ stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags));
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },close:function (stream) {
+ try {
+ if (FS.isFile(stream.node.mode) && stream.nfd) {
+ fs.closeSync(stream.nfd);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },read:function (stream, buffer, offset, length, position) {
+ // Node.js < 6 compatibility: node errors on 0 length reads
+ if (length === 0) return 0;
+ try {
+ return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },write:function (stream, buffer, offset, length, position) {
+ try {
+ return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ try {
+ var stat = fs.fstatSync(stream.nfd);
+ position += stat.size;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }
+ }
+
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ return position;
+ }}};
+
+ var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
+ assert(ENVIRONMENT_IS_WORKER);
+ if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
+ var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
+ var createdParents = {};
+ function ensureParent(path) {
+ // return the parent node, creating subdirs as necessary
+ var parts = path.split('/');
+ var parent = root;
+ for (var i = 0; i < parts.length-1; i++) {
+ var curr = parts.slice(0, i+1).join('/');
+ // Issue 4254: Using curr as a node name will prevent the node
+ // from being found in FS.nameTable when FS.open is called on
+ // a path which holds a child of this node,
+ // given that all FS functions assume node names
+ // are just their corresponding parts within their given path,
+ // rather than incremental aggregates which include their parent's
+ // directories.
+ if (!createdParents[curr]) {
+ createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
+ }
+ parent = createdParents[curr];
+ }
+ return parent;
+ }
+ function base(path) {
+ var parts = path.split('/');
+ return parts[parts.length-1];
+ }
+ // We also accept FileList here, by using Array.prototype
+ Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
+ WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
+ });
+ (mount.opts["blobs"] || []).forEach(function(obj) {
+ WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
+ });
+ (mount.opts["packages"] || []).forEach(function(pack) {
+ pack['metadata'].files.forEach(function(file) {
+ var name = file.filename.substr(1); // remove initial slash
+ WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
+ });
+ });
+ return root;
+ },createNode:function (parent, name, mode, dev, contents, mtime) {
+ var node = FS.createNode(parent, name, mode);
+ node.mode = mode;
+ node.node_ops = WORKERFS.node_ops;
+ node.stream_ops = WORKERFS.stream_ops;
+ node.timestamp = (mtime || new Date).getTime();
+ assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
+ if (mode === WORKERFS.FILE_MODE) {
+ node.size = contents.size;
+ node.contents = contents;
+ } else {
+ node.size = 4096;
+ node.contents = {};
+ }
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },node_ops:{getattr:function (node) {
+ return {
+ dev: 1,
+ ino: undefined,
+ mode: node.mode,
+ nlink: 1,
+ uid: 0,
+ gid: 0,
+ rdev: undefined,
+ size: node.size,
+ atime: new Date(node.timestamp),
+ mtime: new Date(node.timestamp),
+ ctime: new Date(node.timestamp),
+ blksize: 4096,
+ blocks: Math.ceil(node.size / 4096),
+ };
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ },lookup:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ },mknod:function (parent, name, mode, dev) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rename:function (oldNode, newDir, newName) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },unlink:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rmdir:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readdir:function (node) {
+ var entries = ['.', '..'];
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newName, oldPath) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readlink:function (node) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ if (position >= stream.node.size) return 0;
+ var chunk = stream.node.contents.slice(position, position + length);
+ var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
+ buffer.set(new Uint8Array(ab), offset);
+ return chunk.size;
+ },write:function (stream, buffer, offset, length, position) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.size;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ }}};
+
+ var _stdin=STATICTOP; STATICTOP += 16;;
+
+ var _stdout=STATICTOP; STATICTOP += 16;;
+
+ var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
+ if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
+ return ___setErrNo(e.errno);
+ },lookupPath:function (path, opts) {
+ path = PATH.resolve(FS.cwd(), path);
+ opts = opts || {};
+
+ if (!path) return { path: '', node: null };
+
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ for (var key in defaults) {
+ if (opts[key] === undefined) {
+ opts[key] = defaults[key];
+ }
+ }
+
+ if (opts.recurse_count > 8) { // max recursive lookup of 8
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+
+ // split the path
+ var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), false);
+
+ // start at the root
+ var current = FS.root;
+ var current_path = '/';
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length-1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH.resolve(PATH.dirname(current_path), link);
+
+ var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
+ current = lookup.node;
+
+ if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+ }
+ }
+ }
+
+ return { path: current_path, node: current };
+ },getPath:function (node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+ }
+ path = path ? node.name + '/' + path : node.name;
+ node = node.parent;
+ }
+ },hashName:function (parentid, name) {
+ var hash = 0;
+
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },hashAddNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },hashRemoveNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },lookupNode:function (parent, name) {
+ var err = FS.mayLookup(parent);
+ if (err) {
+ throw new FS.ErrnoError(err, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },createNode:function (parent, name, mode, rdev) {
+ if (!FS.FSNode) {
+ FS.FSNode = function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+ };
+
+ FS.FSNode.prototype = {};
+
+ // compatibility
+ var readMode = 292 | 73;
+ var writeMode = 146;
+
+ // NOTE we must use Object.defineProperties instead of individual calls to
+ // Object.defineProperty in order to make closure compiler happy
+ Object.defineProperties(FS.FSNode.prototype, {
+ read: {
+ get: function() { return (this.mode & readMode) === readMode; },
+ set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
+ },
+ write: {
+ get: function() { return (this.mode & writeMode) === writeMode; },
+ set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
+ },
+ isFolder: {
+ get: function() { return FS.isDir(this.mode); }
+ },
+ isDevice: {
+ get: function() { return FS.isChrdev(this.mode); }
+ }
+ });
+ }
+
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },destroyNode:function (node) {
+ FS.hashRemoveNode(node);
+ },isRoot:function (node) {
+ return node === node.parent;
+ },isMountpoint:function (node) {
+ return !!node.mounted;
+ },isFile:function (mode) {
+ return (mode & 61440) === 32768;
+ },isDir:function (mode) {
+ return (mode & 61440) === 16384;
+ },isLink:function (mode) {
+ return (mode & 61440) === 40960;
+ },isChrdev:function (mode) {
+ return (mode & 61440) === 8192;
+ },isBlkdev:function (mode) {
+ return (mode & 61440) === 24576;
+ },isFIFO:function (mode) {
+ return (mode & 61440) === 4096;
+ },isSocket:function (mode) {
+ return (mode & 49152) === 49152;
+ },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
+ var flags = FS.flagModes[str];
+ if (typeof flags === 'undefined') {
+ throw new Error('Unknown file open mode: ' + str);
+ }
+ return flags;
+ },flagsToPermissionString:function (flag) {
+ var perms = ['r', 'w', 'rw'][flag & 3];
+ if ((flag & 512)) {
+ perms += 'w';
+ }
+ return perms;
+ },nodePermissions:function (node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
+ return ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },mayLookup:function (dir) {
+ var err = FS.nodePermissions(dir, 'x');
+ if (err) return err;
+ if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
+ return 0;
+ },mayCreate:function (dir, name) {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return ERRNO_CODES.EEXIST;
+ } catch (e) {
+ }
+ return FS.nodePermissions(dir, 'wx');
+ },mayDelete:function (dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var err = FS.nodePermissions(dir, 'wx');
+ if (err) {
+ return err;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return ERRNO_CODES.ENOTDIR;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return ERRNO_CODES.EBUSY;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return 0;
+ },mayOpen:function (node, flags) {
+ if (!node) {
+ return ERRNO_CODES.ENOENT;
+ }
+ if (FS.isLink(node.mode)) {
+ return ERRNO_CODES.ELOOP;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+ (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
+ fd_start = fd_start || 0;
+ fd_end = fd_end || FS.MAX_OPEN_FDS;
+ for (var fd = fd_start; fd <= fd_end; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
+ },getStream:function (fd) {
+ return FS.streams[fd];
+ },createStream:function (stream, fd_start, fd_end) {
+ if (!FS.FSStream) {
+ FS.FSStream = function(){};
+ FS.FSStream.prototype = {};
+ // compatibility
+ Object.defineProperties(FS.FSStream.prototype, {
+ object: {
+ get: function() { return this.node; },
+ set: function(val) { this.node = val; }
+ },
+ isRead: {
+ get: function() { return (this.flags & 2097155) !== 1; }
+ },
+ isWrite: {
+ get: function() { return (this.flags & 2097155) !== 0; }
+ },
+ isAppend: {
+ get: function() { return (this.flags & 1024); }
+ }
+ });
+ }
+ // clone it, so we can return an instance of FSStream
+ var newStream = new FS.FSStream();
+ for (var p in stream) {
+ newStream[p] = stream[p];
+ }
+ stream = newStream;
+ var fd = FS.nextfd(fd_start, fd_end);
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },closeStream:function (fd) {
+ FS.streams[fd] = null;
+ },chrdev_stream_ops:{open:function (stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },llseek:function () {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }},major:function (dev) {
+ return ((dev) >> 8);
+ },minor:function (dev) {
+ return ((dev) & 0xff);
+ },makedev:function (ma, mi) {
+ return ((ma) << 8 | (mi));
+ },registerDevice:function (dev, ops) {
+ FS.devices[dev] = { stream_ops: ops };
+ },getDevice:function (dev) {
+ return FS.devices[dev];
+ },getMounts:function (mount) {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push.apply(check, m.mounts);
+ }
+
+ return mounts;
+ },syncfs:function (populate, callback) {
+ if (typeof(populate) === 'function') {
+ callback = populate;
+ populate = false;
+ }
+
+ FS.syncFSRequests++;
+
+ if (FS.syncFSRequests > 1) {
+ console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function doCallback(err) {
+ assert(FS.syncFSRequests > 0);
+ FS.syncFSRequests--;
+ return callback(err);
+ }
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(err);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ };
+
+ // sync all mounts
+ mounts.forEach(function (mount) {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },mount:function (type, opts, mountpoint) {
+ var root = mountpoint === '/';
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ }
+
+ var mount = {
+ type: type,
+ opts: opts,
+ mountpoint: mountpoint,
+ mounts: []
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },unmount:function (mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach(function (hash) {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.indexOf(current.mount) !== -1) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },lookup:function (parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },mknod:function (path, mode, dev) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === '.' || name === '..') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.mayCreate(parent, name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },create:function (path, mode) {
+ mode = mode !== undefined ? mode : 438 /* 0666 */;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },mkdir:function (path, mode) {
+ mode = mode !== undefined ? mode : 511 /* 0777 */;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },mkdirTree:function (path, mode) {
+ var dirs = path.split('/');
+ var d = '';
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += '/' + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch(e) {
+ if (e.errno != ERRNO_CODES.EEXIST) throw e;
+ }
+ }
+ },mkdev:function (path, mode, dev) {
+ if (typeof(dev) === 'undefined') {
+ dev = mode;
+ mode = 438 /* 0666 */;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },symlink:function (oldpath, newpath) {
+ if (!PATH.resolve(oldpath)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var newname = PATH.basename(newpath);
+ var err = FS.mayCreate(parent, newname);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },rename:function (old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+ try {
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var err = FS.mayDelete(old_dir, old_name, isdir);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ err = new_node ?
+ FS.mayDelete(new_dir, new_name, isdir) :
+ FS.mayCreate(new_dir, new_name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ err = FS.nodePermissions(old_dir, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['willMovePath']) {
+ FS.trackingDelegate['willMovePath'](old_path, new_path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ try {
+ if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ },rmdir:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, true);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ return node.node_ops.readdir(node);
+ },unlink:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, false);
+ if (err) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readlink:function (path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },stat:function (path, dontFollow) {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return node.node_ops.getattr(node);
+ },lstat:function (path) {
+ return FS.stat(path, true);
+ },chmod:function (path, mode, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },lchmod:function (path, mode) {
+ FS.chmod(path, mode, true);
+ },fchmod:function (fd, mode) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chmod(stream.node, mode);
+ },chown:function (path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ // we ignore the uid / gid for now
+ });
+ },lchown:function (path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },fchown:function (fd, uid, gid) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chown(stream.node, uid, gid);
+ },truncate:function (path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.nodePermissions(node, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },ftruncate:function (fd, len) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ FS.truncate(stream.node, len);
+ },utime:function (path, atime, mtime) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },open:function (path, flags, mode, fd_start, fd_end) {
+ if (path === "") {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
+ mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path === 'object') {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {
+ // ignore
+ }
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var err = FS.mayOpen(node, flags);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512)) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node: node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags: flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ }, fd_start, fd_end);
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module['logReadFiles'] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ console.log("FS.trackingDelegate error on read file: " + path);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['onOpenFile']) {
+ var trackingFlags = 0;
+ if ((flags & 2097155) !== 1) {
+ trackingFlags |= FS.tracking.openFlags.READ;
+ }
+ if ((flags & 2097155) !== 0) {
+ trackingFlags |= FS.tracking.openFlags.WRITE;
+ }
+ FS.trackingDelegate['onOpenFile'](path, trackingFlags);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
+ }
+ return stream;
+ },close:function (stream) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },isClosed:function (stream) {
+ return stream.fd === null;
+ },llseek:function (stream, offset, whence) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },read:function (stream, buffer, offset, length, position) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var seeking = typeof position !== 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position !== 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ try {
+ if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
+ }
+ return bytesWritten;
+ },allocate:function (stream, offset, length) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ // TODO if PROT is PROT_WRITE, make sure we have write access
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EACCES);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!stream || !stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },munmap:function (stream) {
+ return 0;
+ },ioctl:function (stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },readFile:function (path, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'r';
+ opts.encoding = opts.encoding || 'binary';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === 'utf8') {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === 'binary') {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },writeFile:function (path, data, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'w';
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data === 'string') {
+ var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error('Unsupported data type');
+ }
+ FS.close(stream);
+ },cwd:function () {
+ return FS.currentPath;
+ },chdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ var err = FS.nodePermissions(lookup.node, 'x');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ FS.currentPath = lookup.path;
+ },createDefaultDirectories:function () {
+ FS.mkdir('/tmp');
+ FS.mkdir('/home');
+ FS.mkdir('/home/web_user');
+ },createDefaultDevices:function () {
+ // create /dev
+ FS.mkdir('/dev');
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: function() { return 0; },
+ write: function(stream, buffer, offset, length, pos) { return length; }
+ });
+ FS.mkdev('/dev/null', FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using Module['printErr']
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev('/dev/tty', FS.makedev(5, 0));
+ FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+ // setup /dev/[u]random
+ var random_device;
+ if (typeof crypto !== 'undefined') {
+ // for modern web browsers
+ var randomBuffer = new Uint8Array(1);
+ random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+ } else if (ENVIRONMENT_IS_NODE) {
+ // for nodejs
+ random_device = function() { return require('crypto')['randomBytes'](1)[0]; };
+ } else {
+ // default for ES5 platforms
+ random_device = function() { abort("random_device"); /*Math.random() is not safe for random number generation, so this fallback random_device implementation aborts... see kripken/emscripten/pull/7096 */ };
+ }
+ FS.createDevice('/dev', 'random', random_device);
+ FS.createDevice('/dev', 'urandom', random_device);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir('/dev/shm');
+ FS.mkdir('/dev/shm/tmp');
+ },createSpecialDirectories:function () {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir('/proc');
+ FS.mkdir('/proc/self');
+ FS.mkdir('/proc/self/fd');
+ FS.mount({
+ mount: function() {
+ var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
+ node.node_ops = {
+ lookup: function(parent, name) {
+ var fd = +name;
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: 'fake' },
+ node_ops: { readlink: function() { return stream.path } }
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, '/proc/self/fd');
+ },createStandardStreams:function () {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (Module['stdin']) {
+ FS.createDevice('/dev', 'stdin', Module['stdin']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdin');
+ }
+ if (Module['stdout']) {
+ FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdout');
+ }
+ if (Module['stderr']) {
+ FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+ } else {
+ FS.symlink('/dev/tty1', '/dev/stderr');
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open('/dev/stdin', 'r');
+ assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
+
+ var stdout = FS.open('/dev/stdout', 'w');
+ assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
+
+ var stderr = FS.open('/dev/stderr', 'w');
+ assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
+ },ensureErrnoError:function () {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = function ErrnoError(errno, node) {
+ this.node = node;
+ this.setErrno = function(errno) {
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ };
+ this.setErrno(errno);
+ this.message = ERRNO_MESSAGES[errno];
+ // Node.js compatibility: assigning on this.stack fails on Node 4 (but fixed on Node 8)
+ if (this.stack) Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+ [ERRNO_CODES.ENOENT].forEach(function(code) {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = '';
+ });
+ },staticInit:function () {
+ FS.ensureErrnoError();
+
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, '/');
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ 'MEMFS': MEMFS,
+ 'IDBFS': IDBFS,
+ 'NODEFS': NODEFS,
+ 'WORKERFS': WORKERFS,
+ };
+ },init:function (input, output, error) {
+ assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+ FS.init.initialized = true;
+
+ FS.ensureErrnoError();
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ Module['stdin'] = input || Module['stdin'];
+ Module['stdout'] = output || Module['stdout'];
+ Module['stderr'] = error || Module['stderr'];
+
+ FS.createStandardStreams();
+ },quit:function () {
+ FS.init.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ var fflush = Module['_fflush'];
+ if (fflush) fflush(0);
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },getMode:function (canRead, canWrite) {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ },joinPath:function (parts, forceRelative) {
+ var path = PATH.join.apply(null, parts);
+ if (forceRelative && path[0] == '/') path = path.substr(1);
+ return path;
+ },absolutePath:function (relative, base) {
+ return PATH.resolve(base, relative);
+ },standardizePath:function (path) {
+ return PATH.normalize(path);
+ },findObject:function (path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (ret.exists) {
+ return ret.object;
+ } else {
+ ___setErrNo(ret.error);
+ return null;
+ }
+ },analyzePath:function (path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {
+ }
+ var ret = {
+ isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+ parentExists: false, parentPath: null, parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === '/';
+ } catch (e) {
+ ret.error = e.errno;
+ };
+ return ret;
+ },createFolder:function (parent, name, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.mkdir(path, mode);
+ },createPath:function (parent, path, canRead, canWrite) {
+ parent = typeof parent === 'string' ? parent : FS.getPath(parent);
+ var parts = path.split('/').reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },createFile:function (parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
+ var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
+ var mode = FS.getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data === 'string') {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 'w');
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },createDevice:function (parent, name, input, output) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open: function(stream) {
+ stream.seekable = false;
+ },
+ close: function(stream) {
+ // flush any pending line data
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read: function(stream, buffer, offset, length, pos /* ignored */) {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: function(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },createLink:function (parent, name, target, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ return FS.symlink(target, path);
+ },forceLoadFile:function (obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ var success = true;
+ if (typeof XMLHttpRequest !== 'undefined') {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (Module['read']) {
+ // Command-line.
+ try {
+ // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+ // read() will try to parse UTF8.
+ obj.contents = intArrayFromString(Module['read'](obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ success = false;
+ }
+ } else {
+ throw new Error('Cannot load without read() or XMLHttpRequest.');
+ }
+ if (!success) ___setErrNo(ERRNO_CODES.EIO);
+ return success;
+ },createLazyFile:function (parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = []; // Loaded chunks. Index is the chunk number
+ }
+ LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+ if (idx > this.length-1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize)|0;
+ return this.getter(chunkNum)[chunkOffset];
+ }
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ }
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open('HEAD', url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+
+ var chunkSize = 1024*1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (function(from, to) {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType('text/plain; charset=x-user-defined');
+ }
+
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(xhr.response || []);
+ } else {
+ return intArrayFromString(xhr.responseText || '', true);
+ }
+ });
+ var lazyArray = this;
+ lazyArray.setDataGetter(function(chunkNum) {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum+1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ }
+ if (typeof XMLHttpRequest !== 'undefined') {
+ if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperties(lazyArray, {
+ length: {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ },
+ chunkSize: {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ });
+
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: function() { return this.contents.length; }
+ }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach(function(key) {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ return fn.apply(null, arguments);
+ };
+ });
+ // use a custom read function
+ stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ var contents = stream.node.contents;
+ if (position >= contents.length)
+ return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) { // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+ Browser.init(); // XXX perhaps this method should move onto Browser?
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ var handled = false;
+ Module['preloadPlugins'].forEach(function(plugin) {
+ if (handled) return;
+ if (plugin['canHandle'](fullname)) {
+ plugin['handle'](byteArray, fullname, finish, function() {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ });
+ handled = true;
+ }
+ });
+ if (!handled) finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == 'string') {
+ Browser.asyncLoad(url, function(byteArray) {
+ processData(byteArray);
+ }, onerror);
+ } else {
+ processData(url);
+ }
+ },indexedDB:function () {
+ return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ },DB_NAME:function () {
+ return 'EM_FS_' + window.location.pathname;
+ },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
+ console.log('creating db');
+ var db = openRequest.result;
+ db.createObjectStore(FS.DB_STORE_NAME);
+ };
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+ putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
+ putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ },loadFilesFromDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = onerror; // no database to load from
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ try {
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+ } catch(e) {
+ onerror(e);
+ return;
+ }
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var getRequest = files.get(path);
+ getRequest.onsuccess = function getRequest_onsuccess() {
+ if (FS.analyzePath(path).exists) {
+ FS.unlink(path);
+ }
+ FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+ ok++;
+ if (ok + fail == total) finish();
+ };
+ getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
+ if (path[0] !== '/') {
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = FS.getStream(dirfd);
+ if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ dir = dirstream.path;
+ }
+ path = PATH.join2(dir, path);
+ }
+ return path;
+ },doStat:function (func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ // an error occurred while trying to look up the path; we should just report ENOTDIR
+ return -ERRNO_CODES.ENOTDIR;
+ }
+ throw e;
+ }
+ HEAP32[((buf)>>2)]=stat.dev;
+ HEAP32[(((buf)+(4))>>2)]=0;
+ HEAP32[(((buf)+(8))>>2)]=stat.ino;
+ HEAP32[(((buf)+(12))>>2)]=stat.mode;
+ HEAP32[(((buf)+(16))>>2)]=stat.nlink;
+ HEAP32[(((buf)+(20))>>2)]=stat.uid;
+ HEAP32[(((buf)+(24))>>2)]=stat.gid;
+ HEAP32[(((buf)+(28))>>2)]=stat.rdev;
+ HEAP32[(((buf)+(32))>>2)]=0;
+ HEAP32[(((buf)+(36))>>2)]=stat.size;
+ HEAP32[(((buf)+(40))>>2)]=4096;
+ HEAP32[(((buf)+(44))>>2)]=stat.blocks;
+ HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(52))>>2)]=0;
+ HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(60))>>2)]=0;
+ HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(68))>>2)]=0;
+ HEAP32[(((buf)+(72))>>2)]=stat.ino;
+ return 0;
+ },doMsync:function (addr, stream, len, flags) {
+ var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
+ FS.msync(stream, buffer, 0, len, flags);
+ },doMkdir:function (path, mode) {
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ },doMknod:function (path, mode, dev) {
+ // we don't want this in the JS API as it uses mknod to create all nodes.
+ switch (mode & 61440) {
+ case 32768:
+ case 8192:
+ case 24576:
+ case 4096:
+ case 49152:
+ break;
+ default: return -ERRNO_CODES.EINVAL;
+ }
+ FS.mknod(path, mode, dev);
+ return 0;
+ },doReadlink:function (path, buf, bufsize) {
+ if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
+ var ret = FS.readlink(path);
+
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = HEAP8[buf+len];
+ stringToUTF8(ret, buf, bufsize+1);
+ // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+ // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+ HEAP8[buf+len] = endChar;
+
+ return len;
+ },doAccess:function (path, amode) {
+ if (amode & ~7) {
+ // need a valid mode
+ return -ERRNO_CODES.EINVAL;
+ }
+ var node;
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ var perms = '';
+ if (amode & 4) perms += 'r';
+ if (amode & 2) perms += 'w';
+ if (amode & 1) perms += 'x';
+ if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+ return -ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },doDup:function (path, flags, suggestFD) {
+ var suggest = FS.getStream(suggestFD);
+ if (suggest) FS.close(suggest);
+ return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
+ },doReadv:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.read(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ }
+ return ret;
+ },doWritev:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.write(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ }
+ return ret;
+ },varargs:0,get:function (varargs) {
+ SYSCALLS.varargs += 4;
+ var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+ return ret;
+ },getStr:function () {
+ var ret = Pointer_stringify(SYSCALLS.get());
+ return ret;
+ },getStreamFromFD:function () {
+ var stream = FS.getStream(SYSCALLS.get());
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return stream;
+ },getSocketFromFD:function () {
+ var socket = SOCKFS.getSocket(SYSCALLS.get());
+ if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return socket;
+ },getSocketAddress:function (allowNull) {
+ var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ if (allowNull && addrp === 0) return null;
+ var info = __read_sockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ },get64:function () {
+ var low = SYSCALLS.get(), high = SYSCALLS.get();
+ if (low >= 0) assert(high === 0);
+ else assert(high === -1);
+ return low;
+ },getZero:function () {
+ assert(SYSCALLS.get() === 0);
+ }};function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // llseek
+ var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
+ // NOTE: offset_high is unused - Emscripten's off_t is 32-bit
+ var offset = offset_low;
+ FS.llseek(stream, offset, whence);
+ HEAP32[((result)>>2)]=stream.position;
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // readv
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doReadv(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // writev
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doWritev(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // fcntl64
+ var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
+ switch (cmd) {
+ case 0: {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -ERRNO_CODES.EINVAL;
+ }
+ var newStream;
+ newStream = FS.open(stream.path, stream.flags, 0, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 12:
+ case 12: {
+ var arg = SYSCALLS.get();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(((arg)+(offset))>>1)]=2;
+ return 0;
+ }
+ case 13:
+ case 14:
+ case 13:
+ case 14:
+ return 0; // Pretend that the locking is successful.
+ case 16:
+ case 8:
+ return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
+ case 9:
+ // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ default: {
+ return -ERRNO_CODES.EINVAL;
+ }
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // open
+ var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
+ var stream = FS.open(pathname, flags, mode);
+ return stream.fd;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // ioctl
+ var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
+ switch (op) {
+ case 21509:
+ case 21505: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ case 21510:
+ case 21511:
+ case 21512:
+ case 21506:
+ case 21507:
+ case 21508: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ var argp = SYSCALLS.get();
+ HEAP32[((argp)>>2)]=0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return -ERRNO_CODES.EINVAL; // not supported
+ }
+ case 21531: {
+ var argp = SYSCALLS.get();
+ return FS.ioctl(stream, op, argp);
+ }
+ case 21523: {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ case 21524: {
+ // TODO: technically, this ioctl call should change the window size.
+ // but, since emscripten doesn't have any concept of a terminal window
+ // yet, we'll just silently throw it away as we do TIOCGWINSZ
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ default: abort('bad ioctl syscall ' + op);
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // close
+ var stream = SYSCALLS.getStreamFromFD();
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___unlock() {}
+
+ function _abort() {
+ Module['abort']();
+ }
+
+
+ function __exit(status) {
+ // void _exit(int status);
+ // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
+ exit(status);
+ }function _exit(status) {
+ __exit(status);
+ }
+
+ function _gettimeofday(ptr) {
+ var now = Date.now();
+ HEAP32[((ptr)>>2)]=(now/1000)|0; // seconds
+ HEAP32[(((ptr)+(4))>>2)]=((now % 1000)*1000)|0; // microseconds
+ return 0;
+ }
+
+
+
+
+ function _llvm_log10_f32(x) {
+ return Math.log(x) / Math.LN10; // TODO: Math.log10, when browser support is there
+ }function _llvm_log10_f64() {
+ return _llvm_log10_f32.apply(null, arguments)
+ }
+
+
+
+
+
+
+ function _longjmp(env, value) {
+ Module['setThrew'](env, value || 1);
+ throw 'longjmp';
+ }
+
+
+ function _emscripten_memcpy_big(dest, src, num) {
+ HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
+ return dest;
+ }
+
+
+
+
+
+
+
+ function _pthread_cond_destroy() { return 0; }
+
+ function _pthread_cond_init() { return 0; }
+
+ function _pthread_cond_signal() { return 0; }
+
+ function _pthread_cond_wait() { return 0; }
+
+ function _pthread_create() {
+ return 11;
+ }
+
+ function _pthread_join() {}
+
+ function _pthread_mutex_destroy() {}
+
+ function _pthread_mutex_init() {}
+
+
+
+
+
+
+
+ function _pthread_once(ptr, func) {
+ if (!_pthread_once.seen) _pthread_once.seen = {};
+ if (ptr in _pthread_once.seen) return;
+ Module['dynCall_v'](func);
+ _pthread_once.seen[ptr] = 1;
+ }
+
+
+
+
+ function _sched_yield() {
+ return 0;
+ }
+
+ function _sem_destroy() {}
+
+ function _sem_init() {}
+
+ function _sem_post() {}
+
+ function _sem_wait() {}
+
+ function _sysconf(name) {
+ // long sysconf(int name);
+ // http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html
+ switch(name) {
+ case 30: return PAGE_SIZE;
+ case 85:
+ var maxHeapSize = 2*1024*1024*1024 - 65536;
+ return maxHeapSize / PAGE_SIZE;
+ case 132:
+ case 133:
+ case 12:
+ case 137:
+ case 138:
+ case 15:
+ case 235:
+ case 16:
+ case 17:
+ case 18:
+ case 19:
+ case 20:
+ case 149:
+ case 13:
+ case 10:
+ case 236:
+ case 153:
+ case 9:
+ case 21:
+ case 22:
+ case 159:
+ case 154:
+ case 14:
+ case 77:
+ case 78:
+ case 139:
+ case 80:
+ case 81:
+ case 82:
+ case 68:
+ case 67:
+ case 164:
+ case 11:
+ case 29:
+ case 47:
+ case 48:
+ case 95:
+ case 52:
+ case 51:
+ case 46:
+ return 200809;
+ case 79:
+ return 0;
+ case 27:
+ case 246:
+ case 127:
+ case 128:
+ case 23:
+ case 24:
+ case 160:
+ case 161:
+ case 181:
+ case 182:
+ case 242:
+ case 183:
+ case 184:
+ case 243:
+ case 244:
+ case 245:
+ case 165:
+ case 178:
+ case 179:
+ case 49:
+ case 50:
+ case 168:
+ case 169:
+ case 175:
+ case 170:
+ case 171:
+ case 172:
+ case 97:
+ case 76:
+ case 32:
+ case 173:
+ case 35:
+ return -1;
+ case 176:
+ case 177:
+ case 7:
+ case 155:
+ case 8:
+ case 157:
+ case 125:
+ case 126:
+ case 92:
+ case 93:
+ case 129:
+ case 130:
+ case 131:
+ case 94:
+ case 91:
+ return 1;
+ case 74:
+ case 60:
+ case 69:
+ case 70:
+ case 4:
+ return 1024;
+ case 31:
+ case 42:
+ case 72:
+ return 32;
+ case 87:
+ case 26:
+ case 33:
+ return 2147483647;
+ case 34:
+ case 1:
+ return 47839;
+ case 38:
+ case 36:
+ return 99;
+ case 43:
+ case 37:
+ return 2048;
+ case 0: return 2097152;
+ case 3: return 65536;
+ case 28: return 32768;
+ case 44: return 32767;
+ case 75: return 16384;
+ case 39: return 1000;
+ case 89: return 700;
+ case 71: return 256;
+ case 40: return 255;
+ case 2: return 100;
+ case 180: return 64;
+ case 25: return 20;
+ case 5: return 16;
+ case 6: return 6;
+ case 73: return 4;
+ case 84: {
+ if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1;
+ return 1;
+ }
+ }
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ }
+
+FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });;
+__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
+if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
+DYNAMICTOP_PTR = staticAlloc(4);
+
+STACK_BASE = STACKTOP = alignMemory(STATICTOP);
+
+STACK_MAX = STACK_BASE + TOTAL_STACK;
+
+DYNAMIC_BASE = alignMemory(STACK_MAX);
+
+HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
+
+staticSealed = true; // seal the static portion of memory
+
+var ASSERTIONS = false;
+
+// Copyright 2017 The Emscripten Authors. All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License. Both these licenses can be
+// found in the LICENSE file.
+
+/** @type {function(string, boolean=, number=)} */
+function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+
+function intArrayToString(array) {
+ var ret = [];
+ for (var i = 0; i < array.length; i++) {
+ var chr = array[i];
+ if (chr > 0xFF) {
+ if (ASSERTIONS) {
+ assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.');
+ }
+ chr &= 0xFF;
+ }
+ ret.push(String.fromCharCode(chr));
+ }
+ return ret.join('');
+}
+
+
+
+Module['wasmTableSize'] = 764;
+
+Module['wasmMaxTableSize'] = 764;
+
+function invoke_dd(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_dd"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_dddd(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_dddd"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_i(index) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_i"](index);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_ii(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_ii"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iii"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiii"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiij(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiij"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiijj(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiijj"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_jiiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_jiiiiii"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vi(index,a1) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vi"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vii"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viii"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiii"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vijjjid(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vijjjid"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+Module.asmGlobalArg = {};
+
+Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "setTempRet0": setTempRet0, "getTempRet0": getTempRet0, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "invoke_dd": invoke_dd, "invoke_dddd": invoke_dddd, "invoke_i": invoke_i, "invoke_ii": invoke_ii, "invoke_iii": invoke_iii, "invoke_iiii": invoke_iiii, "invoke_iiiiii": invoke_iiiiii, "invoke_iiiiiiii": invoke_iiiiiiii, "invoke_iiiiiiiii": invoke_iiiiiiiii, "invoke_iiiij": invoke_iiiij, "invoke_iiiijj": invoke_iiiijj, "invoke_jiiiiii": invoke_jiiiiii, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_viii": invoke_viii, "invoke_viiii": invoke_viiii, "invoke_viiiii": invoke_viiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_vijjjid": invoke_vijjjid, "___lock": ___lock, "___setErrNo": ___setErrNo, "___syscall140": ___syscall140, "___syscall145": ___syscall145, "___syscall146": ___syscall146, "___syscall221": ___syscall221, "___syscall5": ___syscall5, "___syscall54": ___syscall54, "___syscall6": ___syscall6, "___unlock": ___unlock, "__exit": __exit, "_abort": _abort, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_exit": _exit, "_gettimeofday": _gettimeofday, "_llvm_log10_f32": _llvm_log10_f32, "_llvm_log10_f64": _llvm_log10_f64, "_longjmp": _longjmp, "_pthread_cond_destroy": _pthread_cond_destroy, "_pthread_cond_init": _pthread_cond_init, "_pthread_cond_signal": _pthread_cond_signal, "_pthread_cond_wait": _pthread_cond_wait, "_pthread_create": _pthread_create, "_pthread_join": _pthread_join, "_pthread_mutex_destroy": _pthread_mutex_destroy, "_pthread_mutex_init": _pthread_mutex_init, "_pthread_once": _pthread_once, "_sched_yield": _sched_yield, "_sem_destroy": _sem_destroy, "_sem_init": _sem_init, "_sem_post": _sem_post, "_sem_wait": _sem_wait, "_sysconf": _sysconf, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX };
+// EMSCRIPTEN_START_ASM
+var asm =Module["asm"]// EMSCRIPTEN_END_ASM
+(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
+
+Module["asm"] = asm;
+var ___errno_location = Module["___errno_location"] = function() { return Module["asm"]["___errno_location"].apply(null, arguments) };
+var _emscripten_replace_memory = Module["_emscripten_replace_memory"] = function() { return Module["asm"]["_emscripten_replace_memory"].apply(null, arguments) };
+var _free = Module["_free"] = function() { return Module["asm"]["_free"].apply(null, arguments) };
+var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = function() { return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments) };
+var _llvm_round_f64 = Module["_llvm_round_f64"] = function() { return Module["asm"]["_llvm_round_f64"].apply(null, arguments) };
+var _malloc = Module["_malloc"] = function() { return Module["asm"]["_malloc"].apply(null, arguments) };
+var _memcpy = Module["_memcpy"] = function() { return Module["asm"]["_memcpy"].apply(null, arguments) };
+var _memmove = Module["_memmove"] = function() { return Module["asm"]["_memmove"].apply(null, arguments) };
+var _memset = Module["_memset"] = function() { return Module["asm"]["_memset"].apply(null, arguments) };
+var _pthread_cond_broadcast = Module["_pthread_cond_broadcast"] = function() { return Module["asm"]["_pthread_cond_broadcast"].apply(null, arguments) };
+var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = function() { return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments) };
+var _pthread_mutex_trylock = Module["_pthread_mutex_trylock"] = function() { return Module["asm"]["_pthread_mutex_trylock"].apply(null, arguments) };
+var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = function() { return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments) };
+var _realloc = Module["_realloc"] = function() { return Module["asm"]["_realloc"].apply(null, arguments) };
+var _saveSetjmp = Module["_saveSetjmp"] = function() { return Module["asm"]["_saveSetjmp"].apply(null, arguments) };
+var _sbrk = Module["_sbrk"] = function() { return Module["asm"]["_sbrk"].apply(null, arguments) };
+var _testSetjmp = Module["_testSetjmp"] = function() { return Module["asm"]["_testSetjmp"].apply(null, arguments) };
+var _vpx_js_decoder_close = Module["_vpx_js_decoder_close"] = function() { return Module["asm"]["_vpx_js_decoder_close"].apply(null, arguments) };
+var _vpx_js_decoder_open = Module["_vpx_js_decoder_open"] = function() { return Module["asm"]["_vpx_js_decoder_open"].apply(null, arguments) };
+var _vpx_js_decoder_run = Module["_vpx_js_decoder_run"] = function() { return Module["asm"]["_vpx_js_decoder_run"].apply(null, arguments) };
+var _vpx_js_encoder_close = Module["_vpx_js_encoder_close"] = function() { return Module["asm"]["_vpx_js_encoder_close"].apply(null, arguments) };
+var _vpx_js_encoder_open = Module["_vpx_js_encoder_open"] = function() { return Module["asm"]["_vpx_js_encoder_open"].apply(null, arguments) };
+var _vpx_js_encoder_run = Module["_vpx_js_encoder_run"] = function() { return Module["asm"]["_vpx_js_encoder_run"].apply(null, arguments) };
+var _vpx_js_rgba_to_yuv420 = Module["_vpx_js_rgba_to_yuv420"] = function() { return Module["asm"]["_vpx_js_rgba_to_yuv420"].apply(null, arguments) };
+var _vpx_js_yuv420_to_rgba = Module["_vpx_js_yuv420_to_rgba"] = function() { return Module["asm"]["_vpx_js_yuv420_to_rgba"].apply(null, arguments) };
+var establishStackSpace = Module["establishStackSpace"] = function() { return Module["asm"]["establishStackSpace"].apply(null, arguments) };
+var runPostSets = Module["runPostSets"] = function() { return Module["asm"]["runPostSets"].apply(null, arguments) };
+var setThrew = Module["setThrew"] = function() { return Module["asm"]["setThrew"].apply(null, arguments) };
+var stackAlloc = Module["stackAlloc"] = function() { return Module["asm"]["stackAlloc"].apply(null, arguments) };
+var stackRestore = Module["stackRestore"] = function() { return Module["asm"]["stackRestore"].apply(null, arguments) };
+var stackSave = Module["stackSave"] = function() { return Module["asm"]["stackSave"].apply(null, arguments) };
+var dynCall_dd = Module["dynCall_dd"] = function() { return Module["asm"]["dynCall_dd"].apply(null, arguments) };
+var dynCall_dddd = Module["dynCall_dddd"] = function() { return Module["asm"]["dynCall_dddd"].apply(null, arguments) };
+var dynCall_i = Module["dynCall_i"] = function() { return Module["asm"]["dynCall_i"].apply(null, arguments) };
+var dynCall_ii = Module["dynCall_ii"] = function() { return Module["asm"]["dynCall_ii"].apply(null, arguments) };
+var dynCall_iii = Module["dynCall_iii"] = function() { return Module["asm"]["dynCall_iii"].apply(null, arguments) };
+var dynCall_iiii = Module["dynCall_iiii"] = function() { return Module["asm"]["dynCall_iiii"].apply(null, arguments) };
+var dynCall_iiiii = Module["dynCall_iiiii"] = function() { return Module["asm"]["dynCall_iiiii"].apply(null, arguments) };
+var dynCall_iiiiii = Module["dynCall_iiiiii"] = function() { return Module["asm"]["dynCall_iiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiiiii = Module["dynCall_iiiiiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiiiiii = Module["dynCall_iiiiiiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiiiiiii"] = function() { return Module["asm"]["dynCall_iiiiiiiiiiiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiij = Module["dynCall_iiiij"] = function() { return Module["asm"]["dynCall_iiiij"].apply(null, arguments) };
+var dynCall_iiiijj = Module["dynCall_iiiijj"] = function() { return Module["asm"]["dynCall_iiiijj"].apply(null, arguments) };
+var dynCall_iiijiii = Module["dynCall_iiijiii"] = function() { return Module["asm"]["dynCall_iiijiii"].apply(null, arguments) };
+var dynCall_jiiiiii = Module["dynCall_jiiiiii"] = function() { return Module["asm"]["dynCall_jiiiiii"].apply(null, arguments) };
+var dynCall_v = Module["dynCall_v"] = function() { return Module["asm"]["dynCall_v"].apply(null, arguments) };
+var dynCall_vi = Module["dynCall_vi"] = function() { return Module["asm"]["dynCall_vi"].apply(null, arguments) };
+var dynCall_vii = Module["dynCall_vii"] = function() { return Module["asm"]["dynCall_vii"].apply(null, arguments) };
+var dynCall_viii = Module["dynCall_viii"] = function() { return Module["asm"]["dynCall_viii"].apply(null, arguments) };
+var dynCall_viiii = Module["dynCall_viiii"] = function() { return Module["asm"]["dynCall_viiii"].apply(null, arguments) };
+var dynCall_viiiii = Module["dynCall_viiiii"] = function() { return Module["asm"]["dynCall_viiiii"].apply(null, arguments) };
+var dynCall_viiiiii = Module["dynCall_viiiiii"] = function() { return Module["asm"]["dynCall_viiiiii"].apply(null, arguments) };
+var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments) };
+var dynCall_vijjjid = Module["dynCall_vijjjid"] = function() { return Module["asm"]["dynCall_vijjjid"].apply(null, arguments) };
+;
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+Module['asm'] = asm;
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+/**
+ * @constructor
+ * @extends {Error}
+ * @this {ExitStatus}
+ */
+function ExitStatus(status) {
+ this.name = "ExitStatus";
+ this.message = "Program terminated with exit(" + status + ")";
+ this.status = status;
+};
+ExitStatus.prototype = new Error();
+ExitStatus.prototype.constructor = ExitStatus;
+
+var initialStackTop;
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!Module['calledRun']) run();
+ if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+}
+
+
+
+
+
+/** @type {function(Array=)} */
+function run(args) {
+ args = args || Module['arguments'];
+
+ if (runDependencies > 0) {
+ return;
+ }
+
+
+ preRun();
+
+ if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
+ if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
+
+ function doRun() {
+ if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
+ Module['calledRun'] = true;
+
+ if (ABORT) return;
+
+ ensureInitRuntime();
+
+ preMain();
+
+ if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+
+ postRun();
+ }
+
+ if (Module['setStatus']) {
+ Module['setStatus']('Running...');
+ setTimeout(function() {
+ setTimeout(function() {
+ Module['setStatus']('');
+ }, 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+}
+Module['run'] = run;
+
+
+function exit(status, implicit) {
+
+ // if this is just main exit-ing implicitly, and the status is 0, then we
+ // don't need to do anything here and can just leave. if the status is
+ // non-zero, though, then we need to report it.
+ // (we may have warned about this earlier, if a situation justifies doing so)
+ if (implicit && Module['noExitRuntime'] && status === 0) {
+ return;
+ }
+
+ if (Module['noExitRuntime']) {
+ } else {
+
+ ABORT = true;
+ EXITSTATUS = status;
+ STACKTOP = initialStackTop;
+
+ exitRuntime();
+
+ if (Module['onExit']) Module['onExit'](status);
+ }
+
+ Module['quit'](status, new ExitStatus(status));
+}
+
+var abortDecorators = [];
+
+function abort(what) {
+ if (Module['onAbort']) {
+ Module['onAbort'](what);
+ }
+
+ if (what !== undefined) {
+ out(what);
+ err(what);
+ what = JSON.stringify(what)
+ } else {
+ what = '';
+ }
+
+ ABORT = true;
+ EXITSTATUS = 1;
+
+ throw 'abort(' + what + '). Build with -s ASSERTIONS=1 for more info.';
+}
+Module['abort'] = abort;
+
+if (Module['preInit']) {
+ if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+ while (Module['preInit'].length > 0) {
+ Module['preInit'].pop()();
+ }
+}
+
+
+ Module["noExitRuntime"] = true;
+
+run();
+
+
+
+
+
+// {{MODULE_ADDITIONS}}
+
+
+
diff --git a/src/web_app/wasm/libvpx/libvpx.wasm b/src/web_app/wasm/libvpx/libvpx.wasm
new file mode 100644
index 000000000..c88b68a3f
Binary files /dev/null and b/src/web_app/wasm/libvpx/libvpx.wasm differ
diff --git a/src/web_app/wasm/libwebp/a.out.js b/src/web_app/wasm/libwebp/a.out.js
new file mode 100644
index 000000000..df407abb9
--- /dev/null
+++ b/src/web_app/wasm/libwebp/a.out.js
@@ -0,0 +1,4 @@
+var Module=typeof Module!=="undefined"?Module:{};var moduleOverrides={};var key;for(key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}Module["arguments"]=[];Module["thisProgram"]="./this.program";Module["quit"]=(function(status,toThrow){throw toThrow});Module["preRun"]=[];Module["postRun"]=[];var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_IS_SHELL=false;ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_IS_NODE=typeof process==="object"&&typeof require==="function"&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER;var scriptDirectory="";function locateFile(path){if(Module["locateFile"]){return Module["locateFile"](path,scriptDirectory)}else{return scriptDirectory+path}}if(ENVIRONMENT_IS_NODE){scriptDirectory=__dirname+"/";var nodeFS;var nodePath;Module["read"]=function shell_read(filename,binary){var ret;if(!nodeFS)nodeFS=require("fs");if(!nodePath)nodePath=require("path");filename=nodePath["normalize"](filename);ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};Module["readBinary"]=function readBinary(filename){var ret=Module["read"](filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};if(process["argv"].length>1){Module["thisProgram"]=process["argv"][1].replace(/\\/g,"/")}Module["arguments"]=process["argv"].slice(2);if(typeof module!=="undefined"){module["exports"]=Module}process["on"]("uncaughtException",(function(ex){if(!(ex instanceof ExitStatus)){throw ex}}));process["on"]("unhandledRejection",abort);Module["quit"]=(function(status){process["exit"](status)});Module["inspect"]=(function(){return"[Emscripten Module object]"})}else if(ENVIRONMENT_IS_SHELL){if(typeof read!="undefined"){Module["read"]=function shell_read(f){return read(f)}}Module["readBinary"]=function readBinary(f){var data;if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){Module["arguments"]=scriptArgs}else if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof quit==="function"){Module["quit"]=(function(status){quit(status)})}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){if(ENVIRONMENT_IS_WORKER){scriptDirectory=self.location.href}else if(document.currentScript){scriptDirectory=document.currentScript.src}if(scriptDirectory.indexOf("blob:")!==0){scriptDirectory=scriptDirectory.substr(0,scriptDirectory.lastIndexOf("/")+1)}else{scriptDirectory=""}Module["read"]=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){Module["readBinary"]=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}Module["readAsync"]=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response);return}onerror()};xhr.onerror=onerror;xhr.send(null)};Module["setWindowTitle"]=(function(title){document.title=title})}else{}var out=Module["print"]||(typeof console!=="undefined"?console.log.bind(console):typeof print!=="undefined"?print:null);var err=Module["printErr"]||(typeof printErr!=="undefined"?printErr:typeof console!=="undefined"&&console.warn.bind(console)||out);for(key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=undefined;var STACK_ALIGN=16;function staticAlloc(size){var ret=STATICTOP;STATICTOP=STATICTOP+size+15&-16;return ret}function alignMemory(size,factor){if(!factor)factor=STACK_ALIGN;var ret=size=Math.ceil(size/factor)*factor;return ret}var asm2wasmImports={"f64-rem":(function(x,y){return x%y}),"debugger":(function(){debugger})};var functionPointers=new Array(0);var GLOBAL_BASE=1024;var ABORT=false;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];assert(func,"Cannot call unknown function "+ident+", make sure it is exported");return func}var JSfuncs={"stackSave":(function(){stackSave()}),"stackRestore":(function(){stackRestore()}),"arrayToC":(function(arr){var ret=stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}),"stringToC":(function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=stackAlloc(len);stringToUTF8(str,ret,len)}return ret})};var toC={"string":JSfuncs["stringToC"],"array":JSfuncs["arrayToC"]};function ccall(ident,returnType,argTypes,args,opts){function convertReturnValue(ret){if(returnType==="string")return Pointer_stringify(ret);if(returnType==="boolean")return Boolean(ret);return ret}var func=getCFunc(ident);var cArgs=[];var stack=0;if(args){for(var i=0;i>0];hasUtf|=t;if(t==0&&!length)break;i++;if(length&&i==length)break}if(!length)length=i;var ret="";if(hasUtf<128){var MAX_CHUNK=1024;var curr;while(length>0){curr=String.fromCharCode.apply(String,HEAPU8.subarray(ptr,ptr+Math.min(length,MAX_CHUNK)));ret=ret?ret+curr:curr;ptr+=MAX_CHUNK;length-=MAX_CHUNK}return ret}return UTF8ToString(ptr)}var UTF8Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf8"):undefined;function UTF8ArrayToString(u8Array,idx){var endPtr=idx;while(u8Array[endPtr])++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var u0,u1,u2,u3,u4,u5;var str="";while(1){u0=u8Array[idx++];if(!u0)return str;if(!(u0&128)){str+=String.fromCharCode(u0);continue}u1=u8Array[idx++]&63;if((u0&224)==192){str+=String.fromCharCode((u0&31)<<6|u1);continue}u2=u8Array[idx++]&63;if((u0&240)==224){u0=(u0&15)<<12|u1<<6|u2}else{u3=u8Array[idx++]&63;if((u0&248)==240){u0=(u0&7)<<18|u1<<12|u2<<6|u3}else{u4=u8Array[idx++]&63;if((u0&252)==248){u0=(u0&3)<<24|u1<<18|u2<<12|u3<<6|u4}else{u5=u8Array[idx++]&63;u0=(u0&1)<<30|u1<<24|u2<<18|u3<<12|u4<<6|u5}}}if(u0<65536){str+=String.fromCharCode(u0)}else{var ch=u0-65536;str+=String.fromCharCode(55296|ch>>10,56320|ch&1023)}}}}function UTF8ToString(ptr){return UTF8ArrayToString(HEAPU8,ptr)}function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i=55296&&u<=57343){var u1=str.charCodeAt(++i);u=65536+((u&1023)<<10)|u1&1023}if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else if(u<=2097151){if(outIdx+3>=endIdx)break;outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else if(u<=67108863){if(outIdx+4>=endIdx)break;outU8Array[outIdx++]=248|u>>24;outU8Array[outIdx++]=128|u>>18&63;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+5>=endIdx)break;outU8Array[outIdx++]=252|u>>30;outU8Array[outIdx++]=128|u>>24&63;outU8Array[outIdx++]=128|u>>18&63;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}function stringToUTF8(str,outPtr,maxBytesToWrite){return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;var WASM_PAGE_SIZE=65536;var ASMJS_PAGE_SIZE=16777216;function alignUp(x,multiple){if(x%multiple>0){x+=multiple-x%multiple}return x}var buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBuffer(buf){Module["buffer"]=buffer=buf}function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var STATIC_BASE,STATICTOP,staticSealed;var STACK_BASE,STACKTOP,STACK_MAX;var DYNAMIC_BASE,DYNAMICTOP_PTR;STATIC_BASE=STATICTOP=STACK_BASE=STACKTOP=STACK_MAX=DYNAMIC_BASE=DYNAMICTOP_PTR=0;staticSealed=false;function abortOnCannotGrowMemory(){abort("Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value "+TOTAL_MEMORY+", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ")}function enlargeMemory(){abortOnCannotGrowMemory()}var TOTAL_STACK=Module["TOTAL_STACK"]||5242880;var TOTAL_MEMORY=Module["TOTAL_MEMORY"]||16777216;if(TOTAL_MEMORY0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function ensureInitRuntime(){if(runtimeInitialized)return;runtimeInitialized=true;callRuntimeCallbacks(__ATINIT__)}function preMain(){callRuntimeCallbacks(__ATMAIN__)}function postRun(){if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}function writeArrayToMemory(array,buffer){HEAP8.set(array,buffer)}var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}}function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["preloadedImages"]={};Module["preloadedAudios"]={};var dataURIPrefix="data:application/octet-stream;base64,";function isDataURI(filename){return String.prototype.startsWith?filename.startsWith(dataURIPrefix):filename.indexOf(dataURIPrefix)===0}function integrateWasmJS(){var wasmTextFile="a.out.wast";var wasmBinaryFile="a.out.wasm";var asmjsCodeFile="a.out.temp.asm.js";if(!isDataURI(wasmTextFile)){wasmTextFile=locateFile(wasmTextFile)}if(!isDataURI(wasmBinaryFile)){wasmBinaryFile=locateFile(wasmBinaryFile)}if(!isDataURI(asmjsCodeFile)){asmjsCodeFile=locateFile(asmjsCodeFile)}var wasmPageSize=64*1024;var info={"global":null,"env":null,"asm2wasm":asm2wasmImports,"parent":Module};var exports=null;function mergeMemory(newBuffer){var oldBuffer=Module["buffer"];if(newBuffer.byteLength>2]=value;return value}DYNAMICTOP_PTR=staticAlloc(4);STACK_BASE=STACKTOP=alignMemory(STATICTOP);STACK_MAX=STACK_BASE+TOTAL_STACK;DYNAMIC_BASE=alignMemory(STACK_MAX);HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;staticSealed=true;Module["wasmTableSize"]=170;Module["wasmMaxTableSize"]=170;Module.asmGlobalArg={};Module.asmLibraryArg={"d":abort,"j":enlargeMemory,"i":getTotalMemory,"h":abortOnCannotGrowMemory,"c":___assert_fail,"f":___setErrNo,"g":_emscripten_memcpy_big,"e":_llvm_log10_f64,"a":DYNAMICTOP_PTR,"b":STACKTOP};var asm=Module["asm"](Module.asmGlobalArg,Module.asmLibraryArg,buffer);Module["asm"]=asm;var ___errno_location=Module["___errno_location"]=(function(){return Module["asm"]["k"].apply(null,arguments)});var _create_buffer=Module["_create_buffer"]=(function(){return Module["asm"]["l"].apply(null,arguments)});var _decode=Module["_decode"]=(function(){return Module["asm"]["m"].apply(null,arguments)});var _destroy_buffer=Module["_destroy_buffer"]=(function(){return Module["asm"]["n"].apply(null,arguments)});var _encode=Module["_encode"]=(function(){return Module["asm"]["o"].apply(null,arguments)});var _free_result=Module["_free_result"]=(function(){return Module["asm"]["p"].apply(null,arguments)});var _get_result_height=Module["_get_result_height"]=(function(){return Module["asm"]["q"].apply(null,arguments)});var _get_result_pointer=Module["_get_result_pointer"]=(function(){return Module["asm"]["r"].apply(null,arguments)});var _get_result_size=Module["_get_result_size"]=(function(){return Module["asm"]["s"].apply(null,arguments)});var _get_result_width=Module["_get_result_width"]=(function(){return Module["asm"]["t"].apply(null,arguments)});var _version=Module["_version"]=(function(){return Module["asm"]["u"].apply(null,arguments)});var stackAlloc=Module["stackAlloc"]=(function(){return Module["asm"]["w"].apply(null,arguments)});var stackRestore=Module["stackRestore"]=(function(){return Module["asm"]["x"].apply(null,arguments)});var stackSave=Module["stackSave"]=(function(){return Module["asm"]["y"].apply(null,arguments)});var dynCall_vi=Module["dynCall_vi"]=(function(){return Module["asm"]["v"].apply(null,arguments)});Module["asm"]=asm;Module["cwrap"]=cwrap;function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}ExitStatus.prototype=new Error;ExitStatus.prototype.constructor=ExitStatus;dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};function run(args){args=args||Module["arguments"];if(runDependencies>0){return}preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;ensureInitRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout((function(){setTimeout((function(){Module["setStatus"]("")}),1);doRun()}),1)}else{doRun()}}Module["run"]=run;function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}if(what!==undefined){out(what);err(what);what=JSON.stringify(what)}else{what=""}ABORT=true;EXITSTATUS=1;throw"abort("+what+"). Build with -s ASSERTIONS=1 for more info."}Module["abort"]=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}Module["noExitRuntime"]=true;run()
+
+
+
diff --git a/src/web_app/wasm/libwebp/a.out.wasm b/src/web_app/wasm/libwebp/a.out.wasm
new file mode 100644
index 000000000..452c02031
Binary files /dev/null and b/src/web_app/wasm/libwebp/a.out.wasm differ
diff --git a/src/web_app/wasm/webrtc/fetch-worker.js b/src/web_app/wasm/webrtc/fetch-worker.js
new file mode 100644
index 000000000..e69de29bb
diff --git a/src/web_app/wasm/webrtc/pthread-main.js b/src/web_app/wasm/webrtc/pthread-main.js
new file mode 100644
index 000000000..b2b2dd527
--- /dev/null
+++ b/src/web_app/wasm/webrtc/pthread-main.js
@@ -0,0 +1,187 @@
+// Pthread Web Worker startup routine:
+// This is the entry point file that is loaded first by each Web Worker
+// that executes pthreads on the Emscripten application.
+
+// Thread-local:
+var threadInfoStruct = 0; // Info area for this thread in Emscripten HEAP (shared). If zero, this worker is not currently hosting an executing pthread.
+var selfThreadId = 0; // The ID of this thread. 0 if not hosting a pthread.
+var parentThreadId = 0; // The ID of the parent pthread that launched this thread.
+var tempDoublePtr = 0; // A temporary memory area for global float and double marshalling operations.
+
+// Thread-local: Each thread has its own allocated stack space.
+var STACK_BASE = 0;
+var STACKTOP = 0;
+var STACK_MAX = 0;
+
+// These are system-wide memory area parameters that are set at main runtime startup in main thread, and stay constant throughout the application.
+var buffer; // All pthreads share the same Emscripten HEAP as SharedArrayBuffer with the main execution thread.
+var DYNAMICTOP_PTR = 0;
+var TOTAL_MEMORY = 0;
+var STATICTOP = 0;
+var staticSealed = true; // When threads are being initialized, the static memory area has been already sealed a long time ago.
+var DYNAMIC_BASE = 0;
+
+var ENVIRONMENT_IS_PTHREAD = true;
+
+// performance.now() is specced to return a wallclock time in msecs since that Web Worker/main thread launched. However for pthreads this can cause
+// subtle problems in emscripten_get_now() as this essentially would measure time from pthread_create(), meaning that the clocks between each threads
+// would be wildly out of sync. Therefore sync all pthreads to the clock on the main browser thread, so that different threads see a somewhat
+// coherent clock across each of them (+/- 0.1msecs in testing)
+var __performance_now_clock_drift = 0;
+
+// Cannot use console.log or console.error in a web worker, since that would risk a browser deadlock! https://bugzilla.mozilla.org/show_bug.cgi?id=1049091
+// Therefore implement custom logging facility for threads running in a worker, which queue the messages to main thread to print.
+var Module = {};
+
+// When error objects propagate from Web Worker to main thread, they lose helpful call stack and thread ID information, so print out errors early here,
+// before that happens.
+this.addEventListener('error', function(e) {
+ if (e.message.indexOf('SimulateInfiniteLoop') != -1) return e.preventDefault();
+
+ var errorSource = ' in ' + e.filename + ':' + e.lineno + ':' + e.colno;
+ console.error('Pthread ' + selfThreadId + ' uncaught exception' + (e.filename || e.lineno || e.colno ? errorSource : '') + ': ' + e.message + '. Error object:');
+ console.error(e.error);
+});
+
+function threadPrint() {
+ var text = Array.prototype.slice.call(arguments).join(' ');
+ console.log(text);
+}
+function threadPrintErr() {
+ var text = Array.prototype.slice.call(arguments).join(' ');
+ console.error(text);
+ console.error(new Error().stack);
+}
+function threadAlert() {
+ var text = Array.prototype.slice.call(arguments).join(' ');
+ postMessage({cmd: 'alert', text: text, threadId: selfThreadId});
+}
+out = threadPrint;
+err = threadPrintErr;
+this.alert = threadAlert;
+
+// #if WASM
+Module['instantiateWasm'] = function(info, receiveInstance) {
+ // Instantiate from the module posted from the main thread.
+ // We can just use sync instantiation in the worker.
+ instance = new WebAssembly.Instance(Module['wasmModule'], info);
+ // We don't need the module anymore; new threads will be spawned from the main thread.
+ delete Module['wasmModule'];
+ receiveInstance(instance);
+ return instance.exports;
+}
+//#endif
+
+this.onmessage = function(e) {
+ try {
+ if (e.data.cmd === 'load') { // Preload command that is called once per worker to parse and load the Emscripten code.
+ // Initialize the thread-local field(s):
+ tempDoublePtr = e.data.tempDoublePtr;
+
+ // Initialize the global "process"-wide fields:
+ Module['TOTAL_MEMORY'] = TOTAL_MEMORY = e.data.TOTAL_MEMORY;
+ STATICTOP = e.data.STATICTOP;
+ DYNAMIC_BASE = e.data.DYNAMIC_BASE;
+ DYNAMICTOP_PTR = e.data.DYNAMICTOP_PTR;
+
+
+//#if WASM
+ if (e.data.wasmModule) {
+ // Module and memory were sent from main thread
+ Module['wasmModule'] = e.data.wasmModule;
+ Module['wasmMemory'] = e.data.wasmMemory;
+ buffer = Module['wasmMemory'].buffer;
+ } else {
+//#else
+ buffer = e.data.buffer;
+ }
+//#endif
+
+ PthreadWorkerInit = e.data.PthreadWorkerInit;
+ if (typeof e.data.urlOrBlob === 'string') {
+ importScripts(e.data.urlOrBlob);
+ } else {
+ var objectUrl = URL.createObjectURL(e.data.urlOrBlob);
+ importScripts(objectUrl);
+ URL.revokeObjectURL(objectUrl);
+ }
+//#if !ASMFS
+ if (typeof FS !== 'undefined' && typeof FS.createStandardStreams === 'function') FS.createStandardStreams();
+//#endif
+ postMessage({ cmd: 'loaded' });
+ } else if (e.data.cmd === 'objectTransfer') {
+ PThread.receiveObjectTransfer(e.data);
+ } else if (e.data.cmd === 'run') { // This worker was idle, and now should start executing its pthread entry point.
+ __performance_now_clock_drift = performance.now() - e.data.time; // Sync up to the clock of the main thread.
+ threadInfoStruct = e.data.threadInfoStruct;
+ __register_pthread_ptr(threadInfoStruct, /*isMainBrowserThread=*/0, /*isMainRuntimeThread=*/0); // Pass the thread address inside the asm.js scope to store it for fast access that avoids the need for a FFI out.
+ assert(threadInfoStruct);
+ selfThreadId = e.data.selfThreadId;
+ parentThreadId = e.data.parentThreadId;
+ assert(selfThreadId);
+ assert(parentThreadId);
+ // TODO: Emscripten runtime has these variables twice(!), once outside the asm.js module, and a second time inside the asm.js module.
+ // Review why that is? Can those get out of sync?
+ STACK_BASE = STACKTOP = e.data.stackBase;
+ STACK_MAX = STACK_BASE + e.data.stackSize;
+ assert(STACK_BASE != 0);
+ assert(STACK_MAX > STACK_BASE);
+ Module['establishStackSpace'](e.data.stackBase, e.data.stackBase + e.data.stackSize);
+ var result = 0;
+//#if STACK_OVERFLOW_CHECK
+ if (typeof writeStackCookie === 'function') writeStackCookie();
+//#endif
+
+ PThread.receiveObjectTransfer(e.data);
+ PThread.setThreadStatus(_pthread_self(), 1/*EM_THREAD_STATUS_RUNNING*/);
+
+ try {
+ // pthread entry points are always of signature 'void *ThreadMain(void *arg)'
+ // Native codebases sometimes spawn threads with other thread entry point signatures,
+ // such as void ThreadMain(void *arg), void *ThreadMain(), or void ThreadMain().
+ // That is not acceptable per C/C++ specification, but x86 compiler ABI extensions
+ // enable that to work. If you find the following line to crash, either change the signature
+ // to "proper" void *ThreadMain(void *arg) form, or try linking with the Emscripten linker
+ // flag -s EMULATE_FUNCTION_POINTER_CASTS=1 to add in emulation for this x86 ABI extension.
+ result = Module['dynCall_ii'](e.data.start_routine, e.data.arg);
+
+//#if STACK_OVERFLOW_CHECK
+ if (typeof checkStackCookie === 'function') checkStackCookie();
+//#endif
+
+ } catch(e) {
+ if (e === 'Canceled!') {
+ PThread.threadCancel();
+ return;
+ } else if (e === 'SimulateInfiniteLoop') {
+ return;
+ } else {
+ Atomics.store(HEAPU32, (threadInfoStruct + 4 /*{{{ C_STRUCTS.pthread.threadExitCode }}}*/ ) >> 2, (e instanceof ExitStatus) ? e.status : -2 /*A custom entry specific to Emscripten denoting that the thread crashed.*/);
+ Atomics.store(HEAPU32, (threadInfoStruct + 0 /*{{{ C_STRUCTS.pthread.threadStatus }}}*/ ) >> 2, 1); // Mark the thread as no longer running.
+ _emscripten_futex_wake(threadInfoStruct + 0 /*{{{ C_STRUCTS.pthread.threadStatus }}}*/, 0x7FFFFFFF/*INT_MAX*/); // Wake all threads waiting on this thread to finish.
+ if (!(e instanceof ExitStatus)) throw e;
+ }
+ }
+ // The thread might have finished without calling pthread_exit(). If so, then perform the exit operation ourselves.
+ // (This is a no-op if explicit pthread_exit() had been called prior.)
+ PThread.threadExit(result);
+ } else if (e.data.cmd === 'cancel') { // Main thread is asking for a pthread_cancel() on this thread.
+ if (threadInfoStruct && PThread.thisThreadCancelState == 0/*PTHREAD_CANCEL_ENABLE*/) {
+ PThread.threadCancel();
+ }
+ } else if (e.data.target === 'setimmediate') {
+ // no-op
+ } else if (e.data.cmd === 'processThreadQueue') {
+ if (threadInfoStruct) { // If this thread is actually running?
+ _emscripten_current_thread_process_queued_calls();
+ }
+ } else {
+ err('pthread-main.js received unknown command ' + e.data.cmd);
+ console.error(e.data);
+ }
+ } catch(e) {
+ console.error('pthread-main.js onmessage() captured an uncaught exception: ' + e);
+ console.error(e.stack);
+ throw e;
+ }
+}
diff --git a/src/web_app/wasm/webrtc/webrtc.js b/src/web_app/wasm/webrtc/webrtc.js
new file mode 100644
index 000000000..db14054ef
--- /dev/null
+++ b/src/web_app/wasm/webrtc/webrtc.js
@@ -0,0 +1,11610 @@
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = typeof Module !== 'undefined' ? Module : {};
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+// {{PRE_JSES}}
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = {};
+var key;
+for (key in Module) {
+ if (Module.hasOwnProperty(key)) {
+ moduleOverrides[key] = Module[key];
+ }
+}
+
+Module['arguments'] = [];
+Module['thisProgram'] = './this.program';
+Module['quit'] = function(status, toThrow) {
+ throw toThrow;
+};
+Module['preRun'] = [];
+Module['postRun'] = [];
+
+// The environment setup code below is customized to use Module.
+// *** Environment setup code ***
+
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = false;
+var ENVIRONMENT_IS_SHELL = false;
+ENVIRONMENT_IS_WEB = typeof window === 'object';
+ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
+ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
+ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+if (Module['ENVIRONMENT']) {
+ throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)');
+}
+
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+var ENVIRONMENT_IS_PTHREAD;
+if (!ENVIRONMENT_IS_PTHREAD) ENVIRONMENT_IS_PTHREAD = false; // ENVIRONMENT_IS_PTHREAD=true will have been preset in pthread-main.js. Make it false in the main runtime thread.
+var PthreadWorkerInit; // Collects together variables that are needed at initialization time for the web workers that host pthreads.
+if (!ENVIRONMENT_IS_PTHREAD) PthreadWorkerInit = {};
+var currentScriptUrl = (typeof document !== 'undefined' && document.currentScript) ? document.currentScript.src : undefined;
+
+assert(typeof Module['memoryInitializerPrefixURL'] === 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['pthreadMainPrefixURL'] === 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['cdInitializerPrefixURL'] === 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['filePackagePrefixURL'] === 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead');
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+ if (Module['locateFile']) {
+ return Module['locateFile'](path, scriptDirectory);
+ } else {
+ return scriptDirectory + path;
+ }
+}
+
+if (ENVIRONMENT_IS_NODE) {
+ scriptDirectory = __dirname + '/';
+
+ // Expose functionality in the same simple way that the shells work
+ // Note that we pollute the global namespace here, otherwise we break in node
+ var nodeFS;
+ var nodePath;
+
+ Module['read'] = function shell_read(filename, binary) {
+ var ret;
+ if (!nodeFS) nodeFS = require('fs');
+ if (!nodePath) nodePath = require('path');
+ filename = nodePath['normalize'](filename);
+ ret = nodeFS['readFileSync'](filename);
+ return binary ? ret : ret.toString();
+ };
+
+ Module['readBinary'] = function readBinary(filename) {
+ var ret = Module['read'](filename, true);
+ if (!ret.buffer) {
+ ret = new Uint8Array(ret);
+ }
+ assert(ret.buffer);
+ return ret;
+ };
+
+ if (process['argv'].length > 1) {
+ Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
+ }
+
+ Module['arguments'] = process['argv'].slice(2);
+
+ if (typeof module !== 'undefined') {
+ module['exports'] = Module;
+ }
+
+ process['on']('uncaughtException', function(ex) {
+ // suppress ExitStatus exceptions from showing an error
+ if (!(ex instanceof ExitStatus)) {
+ throw ex;
+ }
+ });
+ // Currently node will swallow unhandled rejections, but this behavior is
+ // deprecated, and in the future it will exit with error status.
+ process['on']('unhandledRejection', function(reason, p) {
+ err('node.js exiting due to unhandled promise rejection');
+ process['exit'](1);
+ });
+
+ Module['quit'] = function(status) {
+ process['exit'](status);
+ };
+
+ Module['inspect'] = function () { return '[Emscripten Module object]'; };
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+
+ if (typeof read != 'undefined') {
+ Module['read'] = function shell_read(f) {
+ return read(f);
+ };
+ }
+
+ Module['readBinary'] = function readBinary(f) {
+ var data;
+ if (typeof readbuffer === 'function') {
+ return new Uint8Array(readbuffer(f));
+ }
+ data = read(f, 'binary');
+ assert(typeof data === 'object');
+ return data;
+ };
+
+ if (typeof scriptArgs != 'undefined') {
+ Module['arguments'] = scriptArgs;
+ } else if (typeof arguments != 'undefined') {
+ Module['arguments'] = arguments;
+ }
+
+ if (typeof quit === 'function') {
+ Module['quit'] = function(status) {
+ quit(status);
+ }
+ }
+} else
+if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ if (ENVIRONMENT_IS_WEB) {
+ if (document.currentScript) {
+ scriptDirectory = document.currentScript.src;
+ }
+ } else { // worker
+ scriptDirectory = self.location.href;
+ }
+ // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+ // otherwise, slice off the final part of the url to find the script directory.
+ if (scriptDirectory.indexOf('blob:') !== 0) {
+ scriptDirectory = scriptDirectory.split('/').slice(0, -1).join('/') + '/';
+ } else {
+ scriptDirectory = '';
+ }
+
+
+ Module['read'] = function shell_read(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.send(null);
+ return xhr.responseText;
+ };
+
+ if (ENVIRONMENT_IS_WORKER) {
+ Module['readBinary'] = function readBinary(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.responseType = 'arraybuffer';
+ xhr.send(null);
+ return new Uint8Array(xhr.response);
+ };
+ }
+
+ Module['readAsync'] = function readAsync(url, onload, onerror) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onload = function xhr_onload() {
+ if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+ onload(xhr.response);
+ return;
+ }
+ onerror();
+ };
+ xhr.onerror = onerror;
+ xhr.send(null);
+ };
+
+ Module['setWindowTitle'] = function(title) { document.title = title };
+} else
+{
+ throw new Error('environment detection error');
+}
+
+// Set up the out() and err() hooks, which are how we can print to stdout or
+// stderr, respectively.
+// If the user provided Module.print or printErr, use that. Otherwise,
+// console.log is checked first, as 'print' on the web will open a print dialogue
+// printErr is preferable to console.warn (works better in shells)
+// bind(console) is necessary to fix IE/Edge closed dev tools panel behavior.
+var out = Module['print'] || (typeof console !== 'undefined' ? console.log.bind(console) : (typeof print !== 'undefined' ? print : null));
+var err = Module['printErr'] || (typeof printErr !== 'undefined' ? printErr : ((typeof console !== 'undefined' && console.warn.bind(console)) || out));
+
+// *** Environment setup code ***
+
+// Merge back in the overrides
+for (key in moduleOverrides) {
+ if (moduleOverrides.hasOwnProperty(key)) {
+ Module[key] = moduleOverrides[key];
+ }
+}
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = undefined;
+
+
+
+// {{PREAMBLE_ADDITIONS}}
+
+var STACK_ALIGN = 16;
+
+// stack management, and other functionality that is provided by the compiled code,
+// should not be used before it is ready
+stackSave = stackRestore = stackAlloc = setTempRet0 = getTempRet0 = function() {
+ abort('cannot use the stack before compiled code is ready to run, and has provided stack access');
+};
+
+function staticAlloc(size) {
+ assert(!staticSealed);
+ var ret = STATICTOP;
+ STATICTOP = (STATICTOP + size + 15) & -16;
+ assert(STATICTOP < TOTAL_MEMORY, 'not enough memory for static allocation - increase TOTAL_MEMORY');
+ return ret;
+}
+
+function dynamicAlloc(size) {
+ assert(DYNAMICTOP_PTR);
+ var ret = HEAP32[DYNAMICTOP_PTR>>2];
+ var end = (ret + size + 15) & -16;
+ HEAP32[DYNAMICTOP_PTR>>2] = end;
+ if (end >= TOTAL_MEMORY) {
+ var success = enlargeMemory();
+ if (!success) {
+ HEAP32[DYNAMICTOP_PTR>>2] = ret;
+ return 0;
+ }
+ }
+ return ret;
+}
+
+function alignMemory(size, factor) {
+ if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default
+ var ret = size = Math.ceil(size / factor) * factor;
+ return ret;
+}
+
+function getNativeTypeSize(type) {
+ switch (type) {
+ case 'i1': case 'i8': return 1;
+ case 'i16': return 2;
+ case 'i32': return 4;
+ case 'i64': return 8;
+ case 'float': return 4;
+ case 'double': return 8;
+ default: {
+ if (type[type.length-1] === '*') {
+ return 4; // A pointer
+ } else if (type[0] === 'i') {
+ var bits = parseInt(type.substr(1));
+ assert(bits % 8 === 0);
+ return bits / 8;
+ } else {
+ return 0;
+ }
+ }
+ }
+}
+
+function warnOnce(text) {
+ if (!warnOnce.shown) warnOnce.shown = {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ err(text);
+ }
+}
+
+var asm2wasmImports = { // special asm2wasm imports
+ "f64-rem": function(x, y) {
+ return x % y;
+ },
+ "debugger": function() {
+ debugger;
+ }
+};
+
+
+
+var jsCallStartIndex = 1;
+var functionPointers = new Array(0);
+
+// 'sig' parameter is only used on LLVM wasm backend
+function addFunction(func, sig) {
+ if (typeof sig === 'undefined') {
+ err('warning: addFunction(): You should provide a wasm function signature string as a second argument. This is not necessary for asm.js and asm2wasm, but is required for the LLVM wasm backend, so it is recommended for full portability.');
+ }
+ var base = 0;
+ for (var i = base; i < base + 0; i++) {
+ if (!functionPointers[i]) {
+ functionPointers[i] = func;
+ return jsCallStartIndex + i;
+ }
+ }
+ throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
+}
+
+function removeFunction(index) {
+ functionPointers[index-jsCallStartIndex] = null;
+}
+
+var funcWrappers = {};
+
+function getFuncWrapper(func, sig) {
+ if (!func) return; // on null pointer, return undefined
+ assert(sig);
+ if (!funcWrappers[sig]) {
+ funcWrappers[sig] = {};
+ }
+ var sigCache = funcWrappers[sig];
+ if (!sigCache[func]) {
+ // optimize away arguments usage in common cases
+ if (sig.length === 1) {
+ sigCache[func] = function dynCall_wrapper() {
+ return dynCall(sig, func);
+ };
+ } else if (sig.length === 2) {
+ sigCache[func] = function dynCall_wrapper(arg) {
+ return dynCall(sig, func, [arg]);
+ };
+ } else {
+ // general case
+ sigCache[func] = function dynCall_wrapper() {
+ return dynCall(sig, func, Array.prototype.slice.call(arguments));
+ };
+ }
+ }
+ return sigCache[func];
+}
+
+
+function makeBigInt(low, high, unsigned) {
+ return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0));
+}
+
+function dynCall(sig, ptr, args) {
+ if (args && args.length) {
+ assert(args.length == sig.length-1);
+ assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
+ return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
+ } else {
+ assert(sig.length == 1);
+ assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
+ return Module['dynCall_' + sig].call(null, ptr);
+ }
+}
+
+
+function getCompilerSetting(name) {
+ throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for getCompilerSetting or emscripten_get_compiler_setting to work';
+}
+
+var Runtime = {
+ // FIXME backwards compatibility layer for ports. Support some Runtime.*
+ // for now, fix it there, then remove it from here. That way we
+ // can minimize any period of breakage.
+ dynCall: dynCall, // for SDL2 port
+ // helpful errors
+ getTempRet0: function() { abort('getTempRet0() is now a top-level function, after removing the Runtime object. Remove "Runtime."') },
+ staticAlloc: function() { abort('staticAlloc() is now a top-level function, after removing the Runtime object. Remove "Runtime."') },
+ stackAlloc: function() { abort('stackAlloc() is now a top-level function, after removing the Runtime object. Remove "Runtime."') },
+};
+
+// The address globals begin at. Very low in memory, for code size and optimization opportunities.
+// Above 0 is static memory, starting with globals.
+// Then the stack.
+// Then 'dynamic' memory for sbrk.
+var GLOBAL_BASE = 1024;
+
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+
+
+//========================================
+// Runtime essentials
+//========================================
+
+var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
+var EXITSTATUS = 0;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+ if (!condition) {
+ abort('Assertion failed: ' + text);
+ }
+}
+
+var globalScope = this;
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+ var func = Module['_' + ident]; // closure exported function
+ assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
+ return func;
+}
+
+var JSfuncs = {
+ // Helpers for cwrap -- it can't refer to Runtime directly because it might
+ // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
+ // out what the minified function name is.
+ 'stackSave': function() {
+ stackSave()
+ },
+ 'stackRestore': function() {
+ stackRestore()
+ },
+ // type conversion from js to c
+ 'arrayToC' : function(arr) {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ },
+ 'stringToC' : function(str) {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) { // null string
+ // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+ var len = (str.length << 2) + 1;
+ ret = stackAlloc(len);
+ stringToUTF8(str, ret, len);
+ }
+ return ret;
+ }
+};
+
+// For fast lookup of conversion functions
+var toC = {
+ 'string': JSfuncs['stringToC'], 'array': JSfuncs['arrayToC']
+};
+
+
+// C calling interface.
+function ccall(ident, returnType, argTypes, args, opts) {
+ function convertReturnValue(ret) {
+ if (returnType === 'string') return Pointer_stringify(ret);
+ if (returnType === 'boolean') return Boolean(ret);
+ return ret;
+ }
+
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ assert(returnType !== 'array', 'Return type should not be "array".');
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ ret = convertReturnValue(ret);
+ if (stack !== 0) stackRestore(stack);
+ return ret;
+}
+
+function cwrap(ident, returnType, argTypes, opts) {
+ return function() {
+ return ccall(ident, returnType, argTypes, arguments, opts);
+ }
+}
+
+/** @type {function(number, number, string, boolean=)} */
+function setValue(ptr, value, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': HEAP8[((ptr)>>0)]=value; break;
+ case 'i8': HEAP8[((ptr)>>0)]=value; break;
+ case 'i16': HEAP16[((ptr)>>1)]=value; break;
+ case 'i32': HEAP32[((ptr)>>2)]=value; break;
+ case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
+ case 'float': HEAPF32[((ptr)>>2)]=value; break;
+ case 'double': HEAPF64[((ptr)>>3)]=value; break;
+ default: abort('invalid type for setValue: ' + type);
+ }
+}
+
+/** @type {function(number, string, boolean=)} */
+function getValue(ptr, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': return HEAP8[((ptr)>>0)];
+ case 'i8': return HEAP8[((ptr)>>0)];
+ case 'i16': return HEAP16[((ptr)>>1)];
+ case 'i32': return HEAP32[((ptr)>>2)];
+ case 'i64': return HEAP32[((ptr)>>2)];
+ case 'float': return HEAPF32[((ptr)>>2)];
+ case 'double': return HEAPF64[((ptr)>>3)];
+ default: abort('invalid type for getValue: ' + type);
+ }
+ return null;
+}
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+var ALLOC_STATIC = 2; // Cannot be freed
+var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
+var ALLOC_NONE = 4; // Do not allocate
+
+// allocate(): This is for internal use. You can use it yourself as well, but the interface
+// is a little tricky (see docs right below). The reason is that it is optimized
+// for multiple syntaxes to save space in generated code. So you should
+// normally not use allocate(), and instead allocate memory using _malloc(),
+// initialize it with setValue(), and so forth.
+// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
+// in *bytes* (note that this is sometimes confusing: the next parameter does not
+// affect this!)
+// @types: Either an array of types, one for each byte (or 0 if no type at that position),
+// or a single type which is used for the entire block. This only matters if there
+// is initial data - if @slab is a number, then this does not matter at all and is
+// ignored.
+// @allocator: How to allocate memory, see ALLOC_*
+/** @type {function((TypedArray|Array|number), string, number, number=)} */
+function allocate(slab, types, allocator, ptr) {
+ var zeroinit, size;
+ if (typeof slab === 'number') {
+ zeroinit = true;
+ size = slab;
+ } else {
+ zeroinit = false;
+ size = slab.length;
+ }
+
+ var singleType = typeof types === 'string' ? types : null;
+
+ var ret;
+ if (allocator == ALLOC_NONE) {
+ ret = ptr;
+ } else {
+ ret = [typeof _malloc === 'function' ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
+ }
+
+ if (zeroinit) {
+ var stop;
+ ptr = ret;
+ assert((ret & 3) == 0);
+ stop = ret + (size & ~3);
+ for (; ptr < stop; ptr += 4) {
+ HEAP32[((ptr)>>2)]=0;
+ }
+ stop = ret + size;
+ while (ptr < stop) {
+ HEAP8[((ptr++)>>0)]=0;
+ }
+ return ret;
+ }
+
+ if (singleType === 'i8') {
+ if (slab.subarray || slab.slice) {
+ HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret);
+ } else {
+ HEAPU8.set(new Uint8Array(slab), ret);
+ }
+ return ret;
+ }
+
+ var i = 0, type, typeSize, previousType;
+ while (i < size) {
+ var curr = slab[i];
+
+ type = singleType || types[i];
+ if (type === 0) {
+ i++;
+ continue;
+ }
+ assert(type, 'Must know what type to store in allocate!');
+
+ if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
+
+ setValue(ret+i, curr, type);
+
+ // no need to look up size unless type changes, so cache it
+ if (previousType !== type) {
+ typeSize = getNativeTypeSize(type);
+ previousType = type;
+ }
+ i += typeSize;
+ }
+
+ return ret;
+}
+
+// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
+function getMemory(size) {
+ if (!staticSealed) return staticAlloc(size);
+ if (!runtimeInitialized) return dynamicAlloc(size);
+ return _malloc(size);
+}
+
+/** @type {function(number, number=)} */
+function Pointer_stringify(ptr, length) {
+ if (length === 0 || !ptr) return '';
+ // Find the length, and check for UTF while doing so
+ var hasUtf = 0;
+ var t;
+ var i = 0;
+ while (1) {
+ assert(ptr + i < TOTAL_MEMORY);
+ t = HEAPU8[(((ptr)+(i))>>0)];
+ hasUtf |= t;
+ if (t == 0 && !length) break;
+ i++;
+ if (length && i == length) break;
+ }
+ if (!length) length = i;
+
+ var ret = '';
+
+ if (hasUtf < 128) {
+ var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
+ var curr;
+ while (length > 0) {
+ curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
+ ret = ret ? ret + curr : curr;
+ ptr += MAX_CHUNK;
+ length -= MAX_CHUNK;
+ }
+ return ret;
+ }
+ return UTF8ToString(ptr);
+}
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+ var str = '';
+ while (1) {
+ var ch = HEAP8[((ptr++)>>0)];
+ if (!ch) return str;
+ str += String.fromCharCode(ch);
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+ return writeAsciiToMemory(str, outPtr, false);
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ArrayToString(u8Array, idx) {
+ var u0, u1, u2, u3, u4, u5;
+
+ var str = '';
+ while (1) {
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ u0 = u8Array[idx++];
+ if (!u0) return str;
+ if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+ u1 = u8Array[idx++] & 63;
+ if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+ u2 = u8Array[idx++] & 63;
+ if ((u0 & 0xF0) == 0xE0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ u3 = u8Array[idx++] & 63;
+ if ((u0 & 0xF8) == 0xF0) {
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
+ } else {
+ u4 = u8Array[idx++] & 63;
+ if ((u0 & 0xFC) == 0xF8) {
+ u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
+ } else {
+ u5 = u8Array[idx++] & 63;
+ u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
+ }
+ }
+ }
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ }
+ }
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ToString(ptr) {
+ return UTF8ArrayToString(HEAPU8,ptr);
+}
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+// outIdx: The starting offset in the array to begin the copying.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array.
+// This count should include the null terminator,
+// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
+ if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+ return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) {
+ var u1 = str.charCodeAt(++i);
+ u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+ }
+ if (u <= 0x7F) {
+ if (outIdx >= endIdx) break;
+ outU8Array[outIdx++] = u;
+ } else if (u <= 0x7FF) {
+ if (outIdx + 1 >= endIdx) break;
+ outU8Array[outIdx++] = 0xC0 | (u >> 6);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xFFFF) {
+ if (outIdx + 2 >= endIdx) break;
+ outU8Array[outIdx++] = 0xE0 | (u >> 12);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x1FFFFF) {
+ if (outIdx + 3 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF0 | (u >> 18);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x3FFFFFF) {
+ if (outIdx + 4 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF8 | (u >> 24);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 5 >= endIdx) break;
+ outU8Array[outIdx++] = 0xFC | (u >> 30);
+ outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ outU8Array[outIdx] = 0;
+ return outIdx - startIdx;
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF8(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) {
+ ++len;
+ } else if (u <= 0x7FF) {
+ len += 2;
+ } else if (u <= 0xFFFF) {
+ len += 3;
+ } else if (u <= 0x1FFFFF) {
+ len += 4;
+ } else if (u <= 0x3FFFFFF) {
+ len += 5;
+ } else {
+ len += 6;
+ }
+ }
+ return len;
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
+function UTF16ToString(ptr) {
+ assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+ if (codeUnit == 0) return str;
+ ++i;
+ // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+ str += String.fromCharCode(codeUnit);
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+ assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 2) return 0;
+ maxBytesToWrite -= 2; // Null terminator.
+ var startPtr = outPtr;
+ var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+ for (var i = 0; i < numCharsToWrite; ++i) {
+ // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ HEAP16[((outPtr)>>1)]=codeUnit;
+ outPtr += 2;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP16[((outPtr)>>1)]=0;
+ return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+ return str.length*2;
+}
+
+function UTF32ToString(ptr) {
+ assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+ if (utf32 == 0)
+ return str;
+ ++i;
+ // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ if (utf32 >= 0x10000) {
+ var ch = utf32 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ } else {
+ str += String.fromCharCode(utf32);
+ }
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+ assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 4) return 0;
+ var startPtr = outPtr;
+ var endPtr = startPtr + maxBytesToWrite - 4;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+ var trailSurrogate = str.charCodeAt(++i);
+ codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+ }
+ HEAP32[((outPtr)>>2)]=codeUnit;
+ outPtr += 4;
+ if (outPtr + 4 > endPtr) break;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP32[((outPtr)>>2)]=0;
+ return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i);
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+ len += 4;
+ }
+
+ return len;
+}
+
+// Allocate heap space for a JS string, and write it there.
+// It is the responsibility of the caller to free() that memory.
+function allocateUTF8(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = _malloc(size);
+ if (ret) stringToUTF8Array(str, HEAP8, ret, size);
+ return ret;
+}
+
+// Allocate stack space for a JS string, and write it there.
+function allocateUTF8OnStack(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8Array(str, HEAP8, ret, size);
+ return ret;
+}
+
+function demangle(func) {
+ var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
+ assert(__cxa_demangle_func);
+ try {
+ var s =
+ func.substr(1);
+ var len = lengthBytesUTF8(s)+1;
+ var buf = _malloc(len);
+ stringToUTF8(s, buf, len);
+ var status = _malloc(4);
+ var ret = __cxa_demangle_func(buf, 0, 0, status);
+ if (HEAP32[((status)>>2)] === 0 && ret) {
+ return Pointer_stringify(ret);
+ }
+ // otherwise, libcxxabi failed
+ } catch(e) {
+ // ignore problems here
+ } finally {
+ if (buf) _free(buf);
+ if (status) _free(status);
+ if (ret) _free(ret);
+ }
+ // failure when using libcxxabi, don't demangle
+ return func;
+}
+
+function demangleAll(text) {
+ var regex =
+ /__Z[\w\d_]+/g;
+ return text.replace(regex,
+ function(x) {
+ var y = demangle(x);
+ return x === y ? x : (x + ' [' + y + ']');
+ });
+}
+
+function jsStackTrace() {
+ var err = new Error();
+ if (!err.stack) {
+ // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
+ // so try that as a special-case.
+ try {
+ throw new Error(0);
+ } catch(e) {
+ err = e;
+ }
+ if (!err.stack) {
+ return '(no stack trace available)';
+ }
+ }
+ return err.stack.toString();
+}
+
+function stackTrace() {
+ var js = jsStackTrace();
+ if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
+ return demangleAll(js);
+}
+
+// Memory management
+
+var PAGE_SIZE = 16384;
+var WASM_PAGE_SIZE = 65536;
+var ASMJS_PAGE_SIZE = 16777216;
+var MIN_TOTAL_MEMORY = 16777216;
+
+function alignUp(x, multiple) {
+ if (x % multiple > 0) {
+ x += multiple - (x % multiple);
+ }
+ return x;
+}
+
+var HEAP,
+/** @type {ArrayBuffer} */
+ buffer,
+/** @type {Int8Array} */
+ HEAP8,
+/** @type {Uint8Array} */
+ HEAPU8,
+/** @type {Int16Array} */
+ HEAP16,
+/** @type {Uint16Array} */
+ HEAPU16,
+/** @type {Int32Array} */
+ HEAP32,
+/** @type {Uint32Array} */
+ HEAPU32,
+/** @type {Float32Array} */
+ HEAPF32,
+/** @type {Float64Array} */
+ HEAPF64;
+
+function updateGlobalBuffer(buf) {
+ Module['buffer'] = buffer = buf;
+}
+
+function updateGlobalBufferViews() {
+ Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
+ Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
+ Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
+ Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
+ Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
+ Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
+ Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
+ Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
+}
+
+var STATIC_BASE, STATICTOP, staticSealed; // static area
+var STACK_BASE, STACKTOP, STACK_MAX; // stack area
+var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk
+
+if (!ENVIRONMENT_IS_PTHREAD) { // Pthreads have already initialized these variables in src/pthread-main.js, where they were passed to the thread worker at startup time
+ STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
+ staticSealed = false;
+}
+
+if (ENVIRONMENT_IS_PTHREAD) {
+ staticSealed = true; // The static memory area has been initialized already in the main thread, pthreads skip this.
+}
+
+// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
+function writeStackCookie() {
+ assert((STACK_MAX & 3) == 0);
+ HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
+ HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
+}
+
+function checkStackCookie() {
+ if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
+ abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
+ }
+ // Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own.
+ if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
+}
+
+function abortStackOverflow(allocSize) {
+ abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - stackSave() + allocSize) + ' bytes available!');
+}
+
+
+function abortOnCannotGrowMemory() {
+ abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
+}
+
+
+function enlargeMemory() {
+ abort('Cannot enlarge memory arrays, since compiling with pthreads support enabled (-s USE_PTHREADS=1).');
+}
+
+
+var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
+var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 268435456;
+if (TOTAL_MEMORY < TOTAL_STACK) err('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
+
+// Initialize the runtime's memory
+// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
+assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined,
+ 'JS engine does not provide full typed array support');
+
+
+if (!ENVIRONMENT_IS_PTHREAD) {
+ Module['wasmMemory'] = new WebAssembly.Memory({ 'initial': TOTAL_MEMORY / WASM_PAGE_SIZE , 'maximum': TOTAL_MEMORY / WASM_PAGE_SIZE, 'shared': true });
+ buffer = Module['wasmMemory'].buffer;
+}
+
+updateGlobalBufferViews();
+
+function getTotalMemory() {
+ return TOTAL_MEMORY;
+}
+
+// Endianness check (note: assumes compiler arch was little-endian)
+if (!ENVIRONMENT_IS_PTHREAD) {
+ HEAP32[0] = 0x63736d65; /* 'emsc' */
+} else {
+ if (HEAP32[0] !== 0x63736d65) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
+}
+HEAP16[1] = 0x6373;
+if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';
+
+function callRuntimeCallbacks(callbacks) {
+ while(callbacks.length > 0) {
+ var callback = callbacks.shift();
+ if (typeof callback == 'function') {
+ callback();
+ continue;
+ }
+ var func = callback.func;
+ if (typeof func === 'number') {
+ if (callback.arg === undefined) {
+ Module['dynCall_v'](func);
+ } else {
+ Module['dynCall_vi'](func, callback.arg);
+ }
+ } else {
+ func(callback.arg === undefined ? null : callback.arg);
+ }
+ }
+}
+
+var __ATPRERUN__ = []; // functions called before the runtime is initialized
+var __ATINIT__ = []; // functions called during startup
+var __ATMAIN__ = []; // functions called when main() is to be run
+var __ATEXIT__ = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+var runtimeExited = false;
+
+if (ENVIRONMENT_IS_PTHREAD) runtimeInitialized = true; // The runtime is hosted in the main thread, and bits shared to pthreads via SharedArrayBuffer. No need to init again in pthread.
+
+function preRun() {
+ if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
+ // compatibility - merge in anything from Module['preRun'] at this time
+ if (Module['preRun']) {
+ if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+ while (Module['preRun'].length) {
+ addOnPreRun(Module['preRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function ensureInitRuntime() {
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
+ if (runtimeInitialized) return;
+ runtimeInitialized = true;
+ // Pass the thread address inside the asm.js scope to store it for fast access that avoids the need for a FFI out.
+ __register_pthread_ptr(PThread.mainThreadBlock, /*isMainBrowserThread=*/!ENVIRONMENT_IS_WORKER, /*isMainRuntimeThread=*/1);
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
+ callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
+ callRuntimeCallbacks(__ATEXIT__);
+ runtimeExited = true;
+}
+
+function postRun() {
+ checkStackCookie();
+ if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
+ // compatibility - merge in anything from Module['postRun'] at this time
+ if (Module['postRun']) {
+ if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+ while (Module['postRun'].length) {
+ addOnPostRun(Module['postRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+
+function addOnPreMain(cb) {
+ __ATMAIN__.unshift(cb);
+}
+
+function addOnExit(cb) {
+ __ATEXIT__.unshift(cb);
+}
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+
+// Deprecated: This function should not be called because it is unsafe and does not provide
+// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
+// function stringToUTF8Array() instead, which takes in a maximum length that can be used
+// to be secure from out of bounds writes.
+/** @deprecated */
+function writeStringToMemory(string, buffer, dontAddNull) {
+ warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
+
+ var /** @type {number} */ lastChar, /** @type {number} */ end;
+ if (dontAddNull) {
+ // stringToUTF8Array always appends null. If we don't want to do that, remember the
+ // character that existed at the location where the null will be placed, and restore
+ // that after the write (below).
+ end = buffer + lengthBytesUTF8(string);
+ lastChar = HEAP8[end];
+ }
+ stringToUTF8(string, buffer, Infinity);
+ if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
+}
+
+function writeArrayToMemory(array, buffer) {
+ assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
+ HEAP8.set(array, buffer);
+}
+
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+ for (var i = 0; i < str.length; ++i) {
+ assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
+ HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
+ }
+ // Null-terminate the pointer to the HEAP.
+ if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
+}
+
+function unSign(value, bits, ignore) {
+ if (value >= 0) {
+ return value;
+ }
+ return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
+ : Math.pow(2, bits) + value;
+}
+function reSign(value, bits, ignore) {
+ if (value <= 0) {
+ return value;
+ }
+ var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
+ : Math.pow(2, bits-1);
+ if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
+ // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
+ // TODO: In i64 mode 1, resign the two parts separately and safely
+ value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
+ }
+ return value;
+}
+
+assert(Math['imul'] && Math['fround'] && Math['clz32'] && Math['trunc'], 'this is a legacy browser, build with LEGACY_VM_SUPPORT');
+
+var Math_abs = Math.abs;
+var Math_cos = Math.cos;
+var Math_sin = Math.sin;
+var Math_tan = Math.tan;
+var Math_acos = Math.acos;
+var Math_asin = Math.asin;
+var Math_atan = Math.atan;
+var Math_atan2 = Math.atan2;
+var Math_exp = Math.exp;
+var Math_log = Math.log;
+var Math_sqrt = Math.sqrt;
+var Math_ceil = Math.ceil;
+var Math_floor = Math.floor;
+var Math_pow = Math.pow;
+var Math_imul = Math.imul;
+var Math_fround = Math.fround;
+var Math_round = Math.round;
+var Math_min = Math.min;
+var Math_max = Math.max;
+var Math_clz32 = Math.clz32;
+var Math_trunc = Math.trunc;
+
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+var runDependencyTracking = {};
+
+function getUniqueRunDependency(id) {
+ var orig = id;
+ while (1) {
+ if (!runDependencyTracking[id]) return id;
+ id = orig + Math.random();
+ }
+ return id;
+}
+
+function addRunDependency(id) {
+ // We should never get here in pthreads (could no-op this out if called in pthreads, but that might indicate a bug in caller side,
+ // so good to be very explicit)
+ assert(!ENVIRONMENT_IS_PTHREAD);
+ runDependencies++;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+ if (id) {
+ assert(!runDependencyTracking[id]);
+ runDependencyTracking[id] = 1;
+ if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
+ // Check for missing dependencies every few seconds
+ runDependencyWatcher = setInterval(function() {
+ if (ABORT) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ return;
+ }
+ var shown = false;
+ for (var dep in runDependencyTracking) {
+ if (!shown) {
+ shown = true;
+ err('still waiting on run dependencies:');
+ }
+ err('dependency: ' + dep);
+ }
+ if (shown) {
+ err('(end of list)');
+ }
+ }, 10000);
+ }
+ } else {
+ err('warning: run dependency added without ID');
+ }
+}
+
+function removeRunDependency(id) {
+ runDependencies--;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+ if (id) {
+ assert(runDependencyTracking[id]);
+ delete runDependencyTracking[id];
+ } else {
+ err('warning: run dependency removed without ID');
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+}
+
+Module["preloadedImages"] = {}; // maps url to image data
+Module["preloadedAudios"] = {}; // maps url to audio data
+
+
+
+var memoryInitializer = null;
+
+
+// To work around https://bugzilla.mozilla.org/show_bug.cgi?id=1049079, warm up a worker pool before starting up the application.
+if (!ENVIRONMENT_IS_PTHREAD) addOnPreRun(function() { if (typeof SharedArrayBuffer !== 'undefined') { addRunDependency('pthreads'); PThread.allocateUnusedWorkers(4, function() { removeRunDependency('pthreads'); }); }});
+
+
+
+
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+ return String.prototype.startsWith ?
+ filename.startsWith(dataURIPrefix) :
+ filename.indexOf(dataURIPrefix) === 0;
+}
+
+
+
+
+function integrateWasmJS() {
+ // wasm.js has several methods for creating the compiled code module here:
+ // * 'native-wasm' : use native WebAssembly support in the browser
+ // * 'interpret-s-expr': load s-expression code from a .wast and interpret
+ // * 'interpret-binary': load binary wasm and interpret
+ // * 'interpret-asm2wasm': load asm.js code, translate to wasm, and interpret
+ // * 'asmjs': no wasm, just load the asm.js code and use that (good for testing)
+ // The method is set at compile time (BINARYEN_METHOD)
+ // The method can be a comma-separated list, in which case, we will try the
+ // options one by one. Some of them can fail gracefully, and then we can try
+ // the next.
+
+ // inputs
+
+ var method = 'native-wasm';
+
+ var wasmTextFile = 'webrtc.wast';
+ var wasmBinaryFile = 'webrtc.wasm';
+ var asmjsCodeFile = 'webrtc.temp.asm.js';
+
+ if (!isDataURI(wasmTextFile)) {
+ wasmTextFile = locateFile(wasmTextFile);
+ }
+ if (!isDataURI(wasmBinaryFile)) {
+ wasmBinaryFile = locateFile(wasmBinaryFile);
+ }
+ if (!isDataURI(asmjsCodeFile)) {
+ asmjsCodeFile = locateFile(asmjsCodeFile);
+ }
+
+ // utilities
+
+ var wasmPageSize = 64*1024;
+
+ var info = {
+ 'global': null,
+ 'env': null,
+ 'asm2wasm': asm2wasmImports,
+ 'parent': Module // Module inside wasm-js.cpp refers to wasm-js.cpp; this allows access to the outside program.
+ };
+
+ var exports = null;
+
+
+ function mergeMemory(newBuffer) {
+ // The wasm instance creates its memory. But static init code might have written to
+ // buffer already, including the mem init file, and we must copy it over in a proper merge.
+ // TODO: avoid this copy, by avoiding such static init writes
+ // TODO: in shorter term, just copy up to the last static init write
+ var oldBuffer = Module['buffer'];
+ if (newBuffer.byteLength < oldBuffer.byteLength) {
+ err('the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here');
+ }
+ var oldView = new Int8Array(oldBuffer);
+ var newView = new Int8Array(newBuffer);
+
+ // If we have a mem init file, do not trample it
+ if (!memoryInitializer) {
+ oldView.set(newView.subarray(Module['STATIC_BASE'], Module['STATIC_BASE'] + Module['STATIC_BUMP']), Module['STATIC_BASE']);
+ }
+
+ newView.set(oldView);
+ updateGlobalBuffer(newBuffer);
+ updateGlobalBufferViews();
+ }
+
+ function fixImports(imports) {
+ return imports;
+ }
+
+ function getBinary() {
+ try {
+ if (Module['wasmBinary']) {
+ return new Uint8Array(Module['wasmBinary']);
+ }
+ if (Module['readBinary']) {
+ return Module['readBinary'](wasmBinaryFile);
+ } else {
+ throw "both async and sync fetching of the wasm failed";
+ }
+ }
+ catch (err) {
+ abort(err);
+ }
+ }
+
+ function getBinaryPromise() {
+ // if we don't have the binary yet, and have the Fetch api, use that
+ // in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web
+ if (!Module['wasmBinary'] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function') {
+ return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) {
+ if (!response['ok']) {
+ throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
+ }
+ return response['arrayBuffer']();
+ }).catch(function () {
+ return getBinary();
+ });
+ }
+ // Otherwise, getBinary should be able to get it synchronously
+ return new Promise(function(resolve, reject) {
+ resolve(getBinary());
+ });
+ }
+
+ // do-method functions
+
+
+ function doNativeWasm(global, env, providedBuffer) {
+ if (typeof WebAssembly !== 'object') {
+ // when the method is just native-wasm, our error message can be very specific
+ abort('No WebAssembly support found. Build with -s WASM=0 to target JavaScript instead.');
+ err('no native wasm support detected');
+ return false;
+ }
+ // prepare memory import
+ if (!(Module['wasmMemory'] instanceof WebAssembly.Memory)) {
+ err('no native wasm Memory in use');
+ return false;
+ }
+ env['memory'] = Module['wasmMemory'];
+ // Load the wasm module and create an instance of using native support in the JS engine.
+ info['global'] = {
+ 'NaN': NaN,
+ 'Infinity': Infinity
+ };
+ info['global.Math'] = Math;
+ info['env'] = env;
+ // handle a generated wasm instance, receiving its exports and
+ // performing other necessary setup
+ function receiveInstance(instance, module) {
+ exports = instance.exports;
+ if (exports.memory) mergeMemory(exports.memory);
+ Module['asm'] = exports;
+ Module["usingWasm"] = true;
+ // Keep a reference to the compiled module so we can post it to the workers.
+ Module['wasmModule'] = module;
+ // Instantiation is synchronous in pthreads and we assert on run dependencies.
+ if(!ENVIRONMENT_IS_PTHREAD) removeRunDependency('wasm-instantiate');
+ }
+ if (!ENVIRONMENT_IS_PTHREAD) {
+ addRunDependency('wasm-instantiate'); // we can't run yet (except in a pthread, where we have a custom sync instantiator)
+ }
+
+ // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+ // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel
+ // to any other async startup actions they are performing.
+ if (Module['instantiateWasm']) {
+ try {
+ return Module['instantiateWasm'](info, receiveInstance);
+ } catch(e) {
+ err('Module.instantiateWasm callback failed with error: ' + e);
+ return false;
+ }
+ }
+
+ // Async compilation can be confusing when an error on the page overwrites Module
+ // (for example, if the order of elements is wrong, and the one defining Module is
+ // later), so we save Module and check it later.
+ var trueModule = Module;
+ function receiveInstantiatedSource(output) {
+ // 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance.
+ // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+ assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?');
+ trueModule = null;
+ receiveInstance(output['instance'], output['module']);
+ }
+ function instantiateArrayBuffer(receiver) {
+ getBinaryPromise().then(function(binary) {
+ return WebAssembly.instantiate(binary, info);
+ }).then(receiver).catch(function(reason) {
+ err('failed to asynchronously prepare wasm: ' + reason);
+ abort(reason);
+ });
+ }
+ // Prefer streaming instantiation if available.
+ if (!Module['wasmBinary'] &&
+ typeof WebAssembly.instantiateStreaming === 'function' &&
+ !isDataURI(wasmBinaryFile) &&
+ typeof fetch === 'function') {
+ WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: 'same-origin' }), info)
+ .then(receiveInstantiatedSource)
+ .catch(function(reason) {
+ // We expect the most common failure cause to be a bad MIME type for the binary,
+ // in which case falling back to ArrayBuffer instantiation should work.
+ err('wasm streaming compile failed: ' + reason);
+ err('falling back to ArrayBuffer instantiation');
+ instantiateArrayBuffer(receiveInstantiatedSource);
+ });
+ } else {
+ instantiateArrayBuffer(receiveInstantiatedSource);
+ }
+ return {}; // no exports yet; we'll fill them in later
+ }
+
+
+ // We may have a preloaded value in Module.asm, save it
+ Module['asmPreload'] = Module['asm'];
+
+ // Memory growth integration code
+
+ var asmjsReallocBuffer = Module['reallocBuffer'];
+
+ var wasmReallocBuffer = function(size) {
+ var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB.
+ size = alignUp(size, PAGE_MULTIPLE); // round up to wasm page size
+ var old = Module['buffer'];
+ var oldSize = old.byteLength;
+ if (Module["usingWasm"]) {
+ // native wasm support
+ try {
+ var result = Module['wasmMemory'].grow((size - oldSize) / wasmPageSize); // .grow() takes a delta compared to the previous size
+ if (result !== (-1 | 0)) {
+ // success in native wasm memory growth, get the buffer from the memory
+ return Module['buffer'] = Module['wasmMemory'].buffer;
+ } else {
+ return null;
+ }
+ } catch(e) {
+ console.error('Module.reallocBuffer: Attempted to grow from ' + oldSize + ' bytes to ' + size + ' bytes, but got error: ' + e);
+ return null;
+ }
+ }
+ };
+
+ Module['reallocBuffer'] = function(size) {
+ if (finalMethod === 'asmjs') {
+ return asmjsReallocBuffer(size);
+ } else {
+ return wasmReallocBuffer(size);
+ }
+ };
+
+ // we may try more than one; this is the final one, that worked and we are using
+ var finalMethod = '';
+
+ // Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate
+ // the wasm module at that time, and it receives imports and provides exports and so forth, the app
+ // doesn't need to care that it is wasm or olyfilled wasm or asm.js.
+
+ Module['asm'] = function(global, env, providedBuffer) {
+ env = fixImports(env);
+
+ // import table
+ if (!env['table']) {
+ var TABLE_SIZE = Module['wasmTableSize'];
+ if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; // works in binaryen interpreter at least
+ var MAX_TABLE_SIZE = Module['wasmMaxTableSize'];
+ if (typeof WebAssembly === 'object' && typeof WebAssembly.Table === 'function') {
+ if (MAX_TABLE_SIZE !== undefined) {
+ env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, 'maximum': MAX_TABLE_SIZE, 'element': 'anyfunc' });
+ } else {
+ env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, element: 'anyfunc' });
+ }
+ } else {
+ env['table'] = new Array(TABLE_SIZE); // works in binaryen interpreter at least
+ }
+ Module['wasmTable'] = env['table'];
+ }
+
+ if (!env['memoryBase']) {
+ env['memoryBase'] = Module['STATIC_BASE']; // tell the memory segments where to place themselves
+ }
+ if (!env['tableBase']) {
+ env['tableBase'] = 0; // table starts at 0 by default, in dynamic linking this will change
+ }
+
+ // try the methods. each should return the exports if it succeeded
+
+ var exports;
+ exports = doNativeWasm(global, env, providedBuffer);
+
+ assert(exports, 'no binaryen method succeeded. consider enabling more options, like interpreting, if you want that: https://github.com/kripken/emscripten/wiki/WebAssembly#binaryen-methods');
+
+
+ return exports;
+ };
+
+ var methodHandler = Module['asm']; // note our method handler, as we may modify Module['asm'] later
+}
+
+integrateWasmJS();
+
+// === Body ===
+
+var ASM_CONSTS = [function() { postMessage({ cmd: 'processQueuedMainThreadWork' }) },
+ function() { return !!(Module['canvas']) },
+ function() { Module['noExitRuntime'] = true },
+ function() { throw 'Canceled!' }];
+
+function _emscripten_asm_const_i(code) {
+ return ASM_CONSTS[code]();
+}
+
+
+
+
+STATIC_BASE = GLOBAL_BASE;
+
+STATICTOP = STATIC_BASE + 328032;
+/* global initializers */ if (!ENVIRONMENT_IS_PTHREAD) __ATINIT__.push({ func: function() { __GLOBAL__sub_I_embind_cc() } }, { func: function() { __GLOBAL__sub_I_status_cc() } }, { func: function() { __GLOBAL__sub_I_logging_cc() } }, { func: function() { __GLOBAL__sub_I_bind_cpp() } }, { func: function() { ___emscripten_pthread_data_constructor() } }, { func: function() { ___emscripten_environ_constructor() } });
+
+
+if (!ENVIRONMENT_IS_PTHREAD) {
+memoryInitializer = "webrtc.js.mem";
+}
+
+
+
+
+var STATIC_BUMP = 328032;
+Module["STATIC_BASE"] = STATIC_BASE;
+Module["STATIC_BUMP"] = STATIC_BUMP;
+
+/* no memory initializer */
+var tempDoublePtr;
+
+if (!ENVIRONMENT_IS_PTHREAD) tempDoublePtr = alignMemory(allocate(12, "i8", ALLOC_STATIC), 8);
+
+assert(tempDoublePtr % 8 == 0);
+
+function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
+
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+}
+
+function copyTempDouble(ptr) {
+
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+ HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
+
+ HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
+
+ HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
+
+ HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
+
+}
+
+// {{PRE_LIBRARY}}
+
+
+ function _WebRtcSpl_ComplexBitReverse() {
+ err('missing function: WebRtcSpl_ComplexBitReverse'); abort(-1);
+ }
+
+ function _WebRtcSpl_FilterARFastQ12() {
+ err('missing function: WebRtcSpl_FilterARFastQ12'); abort(-1);
+ }
+
+ function __ZN5wartc18AudioReceiveStream4Sink12OnAudioFrameENS_10AudioFrameE() {
+ err('missing function: _ZN5wartc18AudioReceiveStream4Sink12OnAudioFrameENS_10AudioFrameE'); abort(-1);
+ }
+
+ function ___assert_fail(condition, filename, line, func) {
+ abort('Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function']);
+ }
+
+
+ var ENV={};function ___buildEnvironment(environ) {
+ // WARNING: Arbitrary limit!
+ var MAX_ENV_VALUES = 64;
+ var TOTAL_ENV_SIZE = 1024;
+
+ // Statically allocate memory for the environment.
+ var poolPtr;
+ var envPtr;
+ if (!___buildEnvironment.called) {
+ ___buildEnvironment.called = true;
+ // Set default values. Use string keys for Closure Compiler compatibility.
+ ENV['USER'] = ENV['LOGNAME'] = 'web_user';
+ ENV['PATH'] = '/';
+ ENV['PWD'] = '/';
+ ENV['HOME'] = '/home/web_user';
+ ENV['LANG'] = 'C.UTF-8';
+ ENV['_'] = Module['thisProgram'];
+ // Allocate memory.
+ poolPtr = getMemory(TOTAL_ENV_SIZE);
+ envPtr = getMemory(MAX_ENV_VALUES * 4);
+ HEAP32[((envPtr)>>2)]=poolPtr;
+ HEAP32[((environ)>>2)]=envPtr;
+ } else {
+ envPtr = HEAP32[((environ)>>2)];
+ poolPtr = HEAP32[((envPtr)>>2)];
+ }
+
+ // Collect key=value lines.
+ var strings = [];
+ var totalSize = 0;
+ for (var key in ENV) {
+ if (typeof ENV[key] === 'string') {
+ var line = key + '=' + ENV[key];
+ strings.push(line);
+ totalSize += line.length;
+ }
+ }
+ if (totalSize > TOTAL_ENV_SIZE) {
+ throw new Error('Environment size exceeded TOTAL_ENV_SIZE!');
+ }
+
+ // Make new.
+ var ptrSize = 4;
+ for (var i = 0; i < strings.length; i++) {
+ var line = strings[i];
+ writeAsciiToMemory(line, poolPtr);
+ HEAP32[(((envPtr)+(i * ptrSize))>>2)]=poolPtr;
+ poolPtr += line.length + 1;
+ }
+ HEAP32[(((envPtr)+(strings.length * ptrSize))>>2)]=0;
+ }
+
+
+
+ var PROCINFO={ppid:1,pid:42,sid:42,pgid:42};
+
+
+ var __pthread_ptr=0;
+
+ var __pthread_is_main_runtime_thread=0;
+
+ var __pthread_is_main_browser_thread=0; var PThread={MAIN_THREAD_ID:1,mainThreadInfo:{schedPolicy:0,schedPrio:0},unusedWorkerPool:[],runningWorkers:[],initMainThreadBlock:function () {
+ if (ENVIRONMENT_IS_PTHREAD) return undefined;
+ PThread.mainThreadBlock = allocate(244, "i32*", ALLOC_STATIC);
+
+ for (var i = 0; i < 244/4; ++i) HEAPU32[PThread.mainThreadBlock/4+i] = 0;
+
+ // The pthread struct has a field that points to itself - this is used as a magic ID to detect whether the pthread_t
+ // structure is 'alive'.
+ HEAP32[(((PThread.mainThreadBlock)+(24))>>2)]=PThread.mainThreadBlock;
+
+ // pthread struct robust_list head should point to itself.
+ var headPtr = PThread.mainThreadBlock + 168;
+ HEAP32[((headPtr)>>2)]=headPtr;
+
+ // Allocate memory for thread-local storage.
+ var tlsMemory = allocate(128 * 4, "i32*", ALLOC_STATIC);
+ for (var i = 0; i < 128; ++i) HEAPU32[tlsMemory/4+i] = 0;
+ Atomics.store(HEAPU32, (PThread.mainThreadBlock + 116 ) >> 2, tlsMemory); // Init thread-local-storage memory array.
+ Atomics.store(HEAPU32, (PThread.mainThreadBlock + 52 ) >> 2, PThread.mainThreadBlock); // Main thread ID.
+ Atomics.store(HEAPU32, (PThread.mainThreadBlock + 56 ) >> 2, PROCINFO.pid); // Process ID.
+
+ },pthreads:{},pthreadIdCounter:2,exitHandlers:null,setThreadStatus:function () {},runExitHandlers:function () {
+ if (PThread.exitHandlers !== null) {
+ while (PThread.exitHandlers.length > 0) {
+ PThread.exitHandlers.pop()();
+ }
+ PThread.exitHandlers = null;
+ }
+
+ // Call into the musl function that runs destructors of all thread-specific data.
+ if (ENVIRONMENT_IS_PTHREAD && threadInfoStruct) ___pthread_tsd_run_dtors();
+ },threadExit:function (exitCode) {
+ var tb = _pthread_self();
+ if (tb) { // If we haven't yet exited?
+ Atomics.store(HEAPU32, (tb + 4 ) >> 2, exitCode);
+ // When we publish this, the main thread is free to deallocate the thread object and we are done.
+ // Therefore set threadInfoStruct = 0; above to 'release' the object in this worker thread.
+ Atomics.store(HEAPU32, (tb + 0 ) >> 2, 1);
+
+ // Disable all cancellation so that executing the cleanup handlers won't trigger another JS
+ // canceled exception to be thrown.
+ Atomics.store(HEAPU32, (tb + 72 ) >> 2, 1/*PTHREAD_CANCEL_DISABLE*/);
+ Atomics.store(HEAPU32, (tb + 76 ) >> 2, 0/*PTHREAD_CANCEL_DEFERRED*/);
+ PThread.runExitHandlers();
+
+ _emscripten_futex_wake(tb + 0, 2147483647);
+ __register_pthread_ptr(0, 0, 0); // Unregister the thread block also inside the asm.js scope.
+ threadInfoStruct = 0;
+ if (ENVIRONMENT_IS_PTHREAD) {
+ // This worker no longer owns any WebGL OffscreenCanvases, so transfer them back to parent thread.
+ var transferList = [];
+
+
+ postMessage({ cmd: 'exit' });
+ }
+ }
+ },threadCancel:function () {
+ PThread.runExitHandlers();
+ Atomics.store(HEAPU32, (threadInfoStruct + 4 ) >> 2, -1/*PTHREAD_CANCELED*/);
+ Atomics.store(HEAPU32, (threadInfoStruct + 0 ) >> 2, 1); // Mark the thread as no longer running.
+ _emscripten_futex_wake(threadInfoStruct + 0, 2147483647); // wake all threads
+ threadInfoStruct = selfThreadId = 0; // Not hosting a pthread anymore in this worker, reset the info structures to null.
+ __register_pthread_ptr(0, 0, 0); // Unregister the thread block also inside the asm.js scope.
+ postMessage({ cmd: 'cancelDone' });
+ },terminateAllThreads:function () {
+ for (var t in PThread.pthreads) {
+ var pthread = PThread.pthreads[t];
+ if (pthread) {
+ PThread.freeThreadData(pthread);
+ if (pthread.worker) pthread.worker.terminate();
+ }
+ }
+ PThread.pthreads = {};
+ for (var t in PThread.unusedWorkerPool) {
+ var pthread = PThread.unusedWorkerPool[t];
+ if (pthread) {
+ PThread.freeThreadData(pthread);
+ if (pthread.worker) pthread.worker.terminate();
+ }
+ }
+ PThread.unusedWorkerPool = [];
+ for (var t in PThread.runningWorkers) {
+ var pthread = PThread.runningWorkers[t];
+ if (pthread) {
+ PThread.freeThreadData(pthread);
+ if (pthread.worker) pthread.worker.terminate();
+ }
+ }
+ PThread.runningWorkers = [];
+ },freeThreadData:function (pthread) {
+ if (!pthread) return;
+ if (pthread.threadInfoStruct) {
+ var tlsMemory = HEAP32[(((pthread.threadInfoStruct)+(116))>>2)];
+ HEAP32[(((pthread.threadInfoStruct)+(116))>>2)]=0;
+ _free(pthread.tlsMemory);
+ _free(pthread.threadInfoStruct);
+ }
+ pthread.threadInfoStruct = 0;
+ if (pthread.allocatedOwnStack && pthread.stackBase) _free(pthread.stackBase);
+ pthread.stackBase = 0;
+ if (pthread.worker) pthread.worker.pthread = null;
+ },receiveObjectTransfer:function (data) {
+ },allocateUnusedWorkers:function (numWorkers, onFinishedLoading) {
+ if (typeof SharedArrayBuffer === 'undefined') return; // No multithreading support, no-op.
+ out('Preallocating ' + numWorkers + ' workers for a pthread spawn pool.');
+
+ var numWorkersLoaded = 0;
+ var pthreadMainJs = 'pthread-main.js';
+ // Allow HTML module to configure the location where the 'pthread-main.js' file will be loaded from,
+ // via Module.locateFile() function. If not specified, then the default URL 'pthread-main.js' relative
+ // to the main html file is loaded.
+ pthreadMainJs = locateFile(pthreadMainJs);
+
+ for (var i = 0; i < numWorkers; ++i) {
+ var worker = new Worker(pthreadMainJs);
+
+ (function(worker) {
+ worker.onmessage = function(e) {
+ var d = e.data;
+ // TODO: Move the proxied call mechanism into a queue inside heap.
+ if (d.proxiedCall) {
+ var returnValue;
+ var funcTable = (d.func >= 0) ? proxiedFunctionTable : ASM_CONSTS;
+ var funcIdx = (d.func >= 0) ? d.func : (-1 - d.func);
+ PThread.currentProxiedOperationCallerThread = worker.pthread.threadInfoStruct; // Sometimes we need to backproxy events to the calling thread (e.g. HTML5 DOM events handlers such as emscripten_set_mousemove_callback()), so keep track in a globally accessible variable about the thread that initiated the proxying.
+ switch(d.proxiedCall & 31) {
+ case 1: returnValue = funcTable[funcIdx](); break;
+ case 2: returnValue = funcTable[funcIdx](d.p0); break;
+ case 3: returnValue = funcTable[funcIdx](d.p0, d.p1); break;
+ case 4: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2); break;
+ case 5: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2, d.p3); break;
+ case 6: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2, d.p3, d.p4); break;
+ case 7: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2, d.p3, d.p4, d.p5); break;
+ case 8: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2, d.p3, d.p4, d.p5, d.p6); break;
+ case 9: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2, d.p3, d.p4, d.p5, d.p6, d.p7); break;
+ case 10: returnValue = funcTable[funcIdx](d.p0, d.p1, d.p2, d.p3, d.p4, d.p5, d.p6, d.p7, d.p8); break;
+ default:
+ if (d.proxiedCall) {
+ err("worker sent an unknown proxied call idx " + d.proxiedCall);
+ console.error(e.data);
+ }
+ break;
+ }
+ if (d.returnValue) {
+ if (d.proxiedCall < 32) HEAP32[d.returnValue >> 2] = returnValue;
+ else HEAPF64[d.returnValue >> 3] = returnValue;
+ }
+ var waitAddress = d.waitAddress;
+ if (waitAddress) {
+ Atomics.store(HEAP32, waitAddress >> 2, 1);
+ Atomics.wake(HEAP32, waitAddress >> 2, 1);
+ }
+ return;
+ }
+
+ // If this message is intended to a recipient that is not the main thread, forward it to the target thread.
+ if (d.targetThread && d.targetThread != _pthread_self()) {
+ var thread = PThread.pthreads[d.targetThread];
+ if (thread) {
+ thread.worker.postMessage(e.data, d.transferList);
+ } else {
+ console.error('Internal error! Worker sent a message "' + d.cmd + '" to target pthread ' + d.targetThread + ', but that thread no longer exists!');
+ }
+ return;
+ }
+
+ if (d.cmd === 'processQueuedMainThreadWork') {
+ // TODO: Must post message to main Emscripten thread in PROXY_TO_WORKER mode.
+ _emscripten_main_thread_process_queued_calls();
+ } else if (d.cmd === 'spawnThread') {
+ __spawn_thread(e.data);
+ } else if (d.cmd === 'cleanupThread') {
+ __cleanup_thread(d.thread);
+ } else if (d.cmd === 'killThread') {
+ __kill_thread(d.thread);
+ } else if (d.cmd === 'cancelThread') {
+ __cancel_thread(d.thread);
+ } else if (d.cmd === 'loaded') {
+ worker.loaded = true;
+ // If this Worker is already pending to start running a thread, launch the thread now
+ if (worker.runPthread) {
+ worker.runPthread();
+ delete worker.runPthread;
+ }
+ ++numWorkersLoaded;
+ if (numWorkersLoaded === numWorkers && onFinishedLoading) {
+ onFinishedLoading();
+ }
+ } else if (d.cmd === 'print') {
+ out('Thread ' + d.threadId + ': ' + d.text);
+ } else if (d.cmd === 'printErr') {
+ err('Thread ' + d.threadId + ': ' + d.text);
+ } else if (d.cmd === 'alert') {
+ alert('Thread ' + d.threadId + ': ' + d.text);
+ } else if (d.cmd === 'exit') {
+ // currently no-op
+ } else if (d.cmd === 'cancelDone') {
+ PThread.freeThreadData(worker.pthread);
+ worker.pthread = undefined; // Detach the worker from the pthread object, and return it to the worker pool as an unused worker.
+ PThread.unusedWorkerPool.push(worker);
+ // TODO: Free if detached.
+ PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker.pthread), 1); // Not a running Worker anymore.
+ } else if (d.cmd === 'objectTransfer') {
+ PThread.receiveObjectTransfer(e.data);
+ } else if (e.data.target === 'setimmediate') {
+ worker.postMessage(e.data); // Worker wants to postMessage() to itself to implement setImmediate() emulation.
+ } else {
+ err("worker sent an unknown command " + d.cmd);
+ }
+ };
+
+ worker.onerror = function(e) {
+ err('pthread sent an error! ' + e.filename + ':' + e.lineno + ': ' + e.message);
+ };
+ }(worker));
+
+ // Allocate tempDoublePtr for the worker. This is done here on the worker's behalf, since we may need to do this statically
+ // if the runtime has not been loaded yet, etc. - so we just use getMemory, which is main-thread only.
+ var tempDoublePtr = getMemory(8); // TODO: leaks. Cleanup after worker terminates.
+
+ // Ask the new worker to load up the Emscripten-compiled page. This is a heavy operation.
+ worker.postMessage({
+ cmd: 'load',
+ // If the application main .js file was loaded from a Blob, then it is not possible
+ // to access the URL of the current script that could be passed to a Web Worker so that
+ // it could load up the same file. In that case, developer must either deliver the Blob
+ // object in Module['mainScriptUrlOrBlob'], or a URL to it, so that pthread Workers can
+ // independently load up the same main application file.
+ urlOrBlob: Module['mainScriptUrlOrBlob'] || currentScriptUrl,
+ wasmMemory: Module['wasmMemory'],
+ wasmModule: Module['wasmModule'],
+ tempDoublePtr: tempDoublePtr,
+ TOTAL_MEMORY: TOTAL_MEMORY,
+ STATICTOP: STATICTOP,
+ DYNAMIC_BASE: DYNAMIC_BASE,
+ DYNAMICTOP_PTR: DYNAMICTOP_PTR,
+ PthreadWorkerInit: PthreadWorkerInit
+ });
+ PThread.unusedWorkerPool.push(worker);
+ }
+ },getNewWorker:function () {
+ if (PThread.unusedWorkerPool.length == 0) PThread.allocateUnusedWorkers(1);
+ if (PThread.unusedWorkerPool.length > 0) return PThread.unusedWorkerPool.pop();
+ else return null;
+ },busySpinWait:function (msecs) {
+ var t = performance.now() + msecs;
+ while(performance.now() < t) {
+ ;
+ }
+ }};function ___call_main(argc, argv) {
+ return _main(argc, argv);
+ }
+
+
+
+ function _emscripten_get_now() { abort() }
+
+ function _emscripten_get_now_is_monotonic() {
+ // return whether emscripten_get_now is guaranteed monotonic; the Date.now
+ // implementation is not :(
+ return ENVIRONMENT_IS_NODE || (typeof dateNow !== 'undefined') ||
+ ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']);
+ }
+
+ var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
+
+ function ___setErrNo(value) {
+ if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
+ else err('failed to set errno from JS');
+ return value;
+ }function _clock_gettime(clk_id, tp) {
+ // int clock_gettime(clockid_t clk_id, struct timespec *tp);
+ var now;
+ if (clk_id === 0) {
+ now = Date.now();
+ } else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
+ now = _emscripten_get_now();
+ } else {
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ }
+ HEAP32[((tp)>>2)]=(now/1000)|0; // seconds
+ HEAP32[(((tp)+(4))>>2)]=((now % 1000)*1000*1000)|0; // nanoseconds
+ return 0;
+ }function ___clock_gettime() {
+ return _clock_gettime.apply(null, arguments)
+ }
+
+ function ___cxa_allocate_exception(size) {
+ return _malloc(size);
+ }
+
+
+ function __ZSt18uncaught_exceptionv() { // std::uncaught_exception()
+ return !!__ZSt18uncaught_exceptionv.uncaught_exception;
+ }
+
+ var EXCEPTIONS={last:0,caught:[],infos:{},deAdjust:function (adjusted) {
+ if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted;
+ for (var key in EXCEPTIONS.infos) {
+ var ptr = +key; // the iteration key is a string, and if we throw this, it must be an integer as that is what we look for
+ var info = EXCEPTIONS.infos[ptr];
+ if (info.adjusted === adjusted) {
+ return ptr;
+ }
+ }
+ return adjusted;
+ },addRef:function (ptr) {
+ if (!ptr) return;
+ var info = EXCEPTIONS.infos[ptr];
+ info.refcount++;
+ },decRef:function (ptr) {
+ if (!ptr) return;
+ var info = EXCEPTIONS.infos[ptr];
+ assert(info.refcount > 0);
+ info.refcount--;
+ // A rethrown exception can reach refcount 0; it must not be discarded
+ // Its next handler will clear the rethrown flag and addRef it, prior to
+ // final decRef and destruction here
+ if (info.refcount === 0 && !info.rethrown) {
+ if (info.destructor) {
+ Module['dynCall_vi'](info.destructor, ptr);
+ }
+ delete EXCEPTIONS.infos[ptr];
+ ___cxa_free_exception(ptr);
+ }
+ },clearRef:function (ptr) {
+ if (!ptr) return;
+ var info = EXCEPTIONS.infos[ptr];
+ info.refcount = 0;
+ }};function ___cxa_begin_catch(ptr) {
+ var info = EXCEPTIONS.infos[ptr];
+ if (info && !info.caught) {
+ info.caught = true;
+ __ZSt18uncaught_exceptionv.uncaught_exception--;
+ }
+ if (info) info.rethrown = false;
+ EXCEPTIONS.caught.push(ptr);
+ EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr));
+ return ptr;
+ }
+
+
+ function ___cxa_free_exception(ptr) {
+ try {
+ return _free(ptr);
+ } catch(e) { // XXX FIXME
+ err('exception during cxa_free_exception: ' + e);
+ }
+ }function ___cxa_end_catch() {
+ // Clear state flag.
+ Module['setThrew'](0);
+ // Call destructor if one is registered then clear it.
+ var ptr = EXCEPTIONS.caught.pop();
+ if (ptr) {
+ EXCEPTIONS.decRef(EXCEPTIONS.deAdjust(ptr));
+ EXCEPTIONS.last = 0; // XXX in decRef?
+ }
+ }
+
+ function ___cxa_find_matching_catch_2() {
+ return ___cxa_find_matching_catch.apply(null, arguments);
+ }
+
+ function ___cxa_find_matching_catch_3() {
+ return ___cxa_find_matching_catch.apply(null, arguments);
+ }
+
+
+ function ___cxa_pure_virtual() {
+ ABORT = true;
+ throw 'Pure virtual function called!';
+ }
+
+
+
+ function ___resumeException(ptr) {
+ if (!EXCEPTIONS.last) { EXCEPTIONS.last = ptr; }
+ throw ptr;
+ }function ___cxa_find_matching_catch() {
+ var thrown = EXCEPTIONS.last;
+ if (!thrown) {
+ // just pass through the null ptr
+ return ((setTempRet0(0),0)|0);
+ }
+ var info = EXCEPTIONS.infos[thrown];
+ var throwntype = info.type;
+ if (!throwntype) {
+ // just pass through the thrown ptr
+ return ((setTempRet0(0),thrown)|0);
+ }
+ var typeArray = Array.prototype.slice.call(arguments);
+
+ var pointer = Module['___cxa_is_pointer_type'](throwntype);
+ // can_catch receives a **, add indirection
+ if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4);
+ HEAP32[((___cxa_find_matching_catch.buffer)>>2)]=thrown;
+ thrown = ___cxa_find_matching_catch.buffer;
+ // The different catch blocks are denoted by different types.
+ // Due to inheritance, those types may not precisely match the
+ // type of the thrown object. Find one which matches, and
+ // return the type of the catch block which should be called.
+ for (var i = 0; i < typeArray.length; i++) {
+ if (typeArray[i] && Module['___cxa_can_catch'](typeArray[i], throwntype, thrown)) {
+ thrown = HEAP32[((thrown)>>2)]; // undo indirection
+ info.adjusted = thrown;
+ return ((setTempRet0(typeArray[i]),thrown)|0);
+ }
+ }
+ // Shouldn't happen unless we have bogus data in typeArray
+ // or encounter a type for which emscripten doesn't have suitable
+ // typeinfo defined. Best-efforts match just in case.
+ thrown = HEAP32[((thrown)>>2)]; // undo indirection
+ return ((setTempRet0(throwntype),thrown)|0);
+ }function ___cxa_throw(ptr, type, destructor) {
+ EXCEPTIONS.infos[ptr] = {
+ ptr: ptr,
+ adjusted: ptr,
+ type: type,
+ destructor: destructor,
+ refcount: 0,
+ caught: false,
+ rethrown: false
+ };
+ EXCEPTIONS.last = ptr;
+ if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) {
+ __ZSt18uncaught_exceptionv.uncaught_exception = 1;
+ } else {
+ __ZSt18uncaught_exceptionv.uncaught_exception++;
+ }
+ throw ptr;
+ }
+
+ function ___gxx_personality_v0() {
+ }
+
+ function ___lock() {}
+
+
+
+
+
+ var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
+
+ var PATH={splitPath:function (filename) {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },normalizeArray:function (parts, allowAboveRoot) {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === '.') {
+ parts.splice(i, 1);
+ } else if (last === '..') {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up; up--) {
+ parts.unshift('..');
+ }
+ }
+ return parts;
+ },normalize:function (path) {
+ var isAbsolute = path.charAt(0) === '/',
+ trailingSlash = path.substr(-1) === '/';
+ // Normalize the path
+ path = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), !isAbsolute).join('/');
+ if (!path && !isAbsolute) {
+ path = '.';
+ }
+ if (path && trailingSlash) {
+ path += '/';
+ }
+ return (isAbsolute ? '/' : '') + path;
+ },dirname:function (path) {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return '.';
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },basename:function (path) {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === '/') return '/';
+ var lastSlash = path.lastIndexOf('/');
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash+1);
+ },extname:function (path) {
+ return PATH.splitPath(path)[3];
+ },join:function () {
+ var paths = Array.prototype.slice.call(arguments, 0);
+ return PATH.normalize(paths.join('/'));
+ },join2:function (l, r) {
+ return PATH.normalize(l + '/' + r);
+ },resolve:function () {
+ var resolvedPath = '',
+ resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? arguments[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path !== 'string') {
+ throw new TypeError('Arguments to path.resolve must be strings');
+ } else if (!path) {
+ return ''; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + '/' + resolvedPath;
+ resolvedAbsolute = path.charAt(0) === '/';
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
+ return !!p;
+ }), !resolvedAbsolute).join('/');
+ return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+ },relative:function (from, to) {
+ from = PATH.resolve(from).substr(1);
+ to = PATH.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== '') break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== '') break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split('/'));
+ var toParts = trim(to.split('/'));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push('..');
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join('/');
+ }};
+
+ var TTY={ttys:[],init:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process['stdin']['setEncoding']('utf8');
+ // }
+ },shutdown:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process['stdin']['pause']();
+ // }
+ },register:function (dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },stream_ops:{open:function (stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },close:function (stream) {
+ // flush any pending line data
+ stream.tty.ops.flush(stream.tty);
+ },flush:function (stream) {
+ stream.tty.ops.flush(stream.tty);
+ },read:function (stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ for (var i = 0; i < length; i++) {
+ try {
+ stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }},default_tty_ops:{get_char:function (tty) {
+ if (!tty.input.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = new Buffer(BUFSIZE);
+ var bytesRead = 0;
+
+ var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
+
+ var fd = process.stdin.fd;
+ if (isPosixPlatform) {
+ // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
+ var usingDevice = false;
+ try {
+ fd = fs.openSync('/dev/stdin', 'r');
+ usingDevice = true;
+ } catch (e) {}
+ }
+
+ try {
+ bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
+ } catch(e) {
+ // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+ // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+ if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
+ else throw e;
+ }
+
+ if (usingDevice) { fs.closeSync(fd); }
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString('utf-8');
+ } else {
+ result = null;
+ }
+
+ } else if (typeof window != 'undefined' &&
+ typeof window.prompt == 'function') {
+ // Browser.
+ result = window.prompt('Input: '); // returns null on cancel
+ if (result !== null) {
+ result += '\n';
+ }
+ } else if (typeof readline == 'function') {
+ // Command line.
+ result = readline();
+ if (result !== null) {
+ result += '\n';
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ tty.input = intArrayFromString(result, true);
+ }
+ return tty.input.shift();
+ },put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }},default_tty1_ops:{put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }}};
+
+ var MEMFS={ops_table:null,mount:function (mount) {
+ return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },getFileDataAsRegularArray:function (node) {
+ if (node.contents && node.contents.subarray) {
+ var arr = [];
+ for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
+ return arr; // Returns a copy of the original data.
+ }
+ return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
+ },getFileDataAsTypedArray:function (node) {
+ if (!node.contents) return new Uint8Array;
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },expandFileStorage:function (node, newCapacity) {
+ // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
+ // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
+ // increase the size.
+ if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
+ node.contents = MEMFS.getFileDataAsRegularArray(node);
+ node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
+ }
+
+ if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ return;
+ }
+ // Not using a typed array to back the file storage. Use a standard JS array instead.
+ if (!node.contents && newCapacity > 0) node.contents = [];
+ while (node.contents.length < newCapacity) node.contents.push(0);
+ },resizeFileStorage:function (node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ return;
+ }
+ if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ return;
+ }
+ // Backing with a JS array.
+ if (!node.contents) node.contents = [];
+ if (node.contents.length > newSize) node.contents.length = newSize;
+ else while (node.contents.length < newSize) node.contents.push(0);
+ node.usedBytes = newSize;
+ },node_ops:{getattr:function (node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },lookup:function (parent, name) {
+ throw FS.genericErrors[ERRNO_CODES.ENOENT];
+ },mknod:function (parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },rename:function (old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ }
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ old_node.parent = new_dir;
+ },unlink:function (parent, name) {
+ delete parent.contents[name];
+ },rmdir:function (parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ delete parent.contents[name];
+ },readdir:function (node) {
+ var entries = ['.', '..']
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },readlink:function (node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return node.link;
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) { // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+ if (canOwn) {
+ assert(position === 0, 'canOwn must imply no weird position inside the file');
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position+length);
+ if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
+ else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position+length);
+ return length;
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ },allocate:function (stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if ( !(flags & 2) &&
+ (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
+ // We can't emulate MAP_SHARED when the file is not backed by the buffer
+ // we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < stream.node.usedBytes) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = _malloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
+ }
+ buffer.set(contents, ptr);
+ }
+ return { ptr: ptr, allocated: allocated };
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (mmapFlags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+
+ var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ }}};
+
+ var IDBFS={dbs:{},indexedDB:function () {
+ if (typeof indexedDB !== 'undefined') return indexedDB;
+ var ret = null;
+ if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ assert(ret, 'IDBFS used, but indexedDB not supported');
+ return ret;
+ },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
+ // reuse all of the core MEMFS functionality
+ return MEMFS.mount.apply(null, arguments);
+ },syncfs:function (mount, populate, callback) {
+ IDBFS.getLocalSet(mount, function(err, local) {
+ if (err) return callback(err);
+
+ IDBFS.getRemoteSet(mount, function(err, remote) {
+ if (err) return callback(err);
+
+ var src = populate ? remote : local;
+ var dst = populate ? local : remote;
+
+ IDBFS.reconcile(src, dst, callback);
+ });
+ });
+ },getDB:function (name, callback) {
+ // check the cache first
+ var db = IDBFS.dbs[name];
+ if (db) {
+ return callback(null, db);
+ }
+
+ var req;
+ try {
+ req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+ } catch (e) {
+ return callback(e);
+ }
+ if (!req) {
+ return callback("Unable to connect to IndexedDB");
+ }
+ req.onupgradeneeded = function(e) {
+ var db = e.target.result;
+ var transaction = e.target.transaction;
+
+ var fileStore;
+
+ if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+ fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ } else {
+ fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+ }
+
+ if (!fileStore.indexNames.contains('timestamp')) {
+ fileStore.createIndex('timestamp', 'timestamp', { unique: false });
+ }
+ };
+ req.onsuccess = function() {
+ db = req.result;
+
+ // add to the cache
+ IDBFS.dbs[name] = db;
+ callback(null, db);
+ };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },getLocalSet:function (mount, callback) {
+ var entries = {};
+
+ function isRealDir(p) {
+ return p !== '.' && p !== '..';
+ };
+ function toAbsolute(root) {
+ return function(p) {
+ return PATH.join2(root, p);
+ }
+ };
+
+ var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+
+ while (check.length) {
+ var path = check.pop();
+ var stat;
+
+ try {
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+ }
+
+ entries[path] = { timestamp: stat.mtime };
+ }
+
+ return callback(null, { type: 'local', entries: entries });
+ },getRemoteSet:function (mount, callback) {
+ var entries = {};
+
+ IDBFS.getDB(mount.mountpoint, function(err, db) {
+ if (err) return callback(err);
+
+ try {
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
+ transaction.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ var index = store.index('timestamp');
+
+ index.openKeyCursor().onsuccess = function(event) {
+ var cursor = event.target.result;
+
+ if (!cursor) {
+ return callback(null, { type: 'remote', db: db, entries: entries });
+ }
+
+ entries[cursor.primaryKey] = { timestamp: cursor.key };
+
+ cursor.continue();
+ };
+ } catch (e) {
+ return callback(e);
+ }
+ });
+ },loadLocalEntry:function (path, callback) {
+ var stat, node;
+
+ try {
+ var lookup = FS.lookupPath(path);
+ node = lookup.node;
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode });
+ } else if (FS.isFile(stat.mode)) {
+ // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+ // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+ node.contents = MEMFS.getFileDataAsTypedArray(node);
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+ },storeLocalEntry:function (path, entry, callback) {
+ try {
+ if (FS.isDir(entry.mode)) {
+ FS.mkdir(path, entry.mode);
+ } else if (FS.isFile(entry.mode)) {
+ FS.writeFile(path, entry.contents, { canOwn: true });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+
+ FS.chmod(path, entry.mode);
+ FS.utime(path, entry.timestamp, entry.timestamp);
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },removeLocalEntry:function (path, callback) {
+ try {
+ var lookup = FS.lookupPath(path);
+ var stat = FS.stat(path);
+
+ if (FS.isDir(stat.mode)) {
+ FS.rmdir(path);
+ } else if (FS.isFile(stat.mode)) {
+ FS.unlink(path);
+ }
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },loadRemoteEntry:function (store, path, callback) {
+ var req = store.get(path);
+ req.onsuccess = function(event) { callback(null, event.target.result); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },storeRemoteEntry:function (store, path, entry, callback) {
+ var req = store.put(entry, path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },removeRemoteEntry:function (store, path, callback) {
+ var req = store.delete(path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },reconcile:function (src, dst, callback) {
+ var total = 0;
+
+ var create = [];
+ Object.keys(src.entries).forEach(function (key) {
+ var e = src.entries[key];
+ var e2 = dst.entries[key];
+ if (!e2 || e.timestamp > e2.timestamp) {
+ create.push(key);
+ total++;
+ }
+ });
+
+ var remove = [];
+ Object.keys(dst.entries).forEach(function (key) {
+ var e = dst.entries[key];
+ var e2 = src.entries[key];
+ if (!e2) {
+ remove.push(key);
+ total++;
+ }
+ });
+
+ if (!total) {
+ return callback(null);
+ }
+
+ var errored = false;
+ var completed = 0;
+ var db = src.type === 'remote' ? src.db : dst.db;
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return callback(err);
+ }
+ return;
+ }
+ if (++completed >= total) {
+ return callback(null);
+ }
+ };
+
+ transaction.onerror = function(e) {
+ done(this.error);
+ e.preventDefault();
+ };
+
+ // sort paths in ascending order so directory entries are created
+ // before the files inside them
+ create.sort().forEach(function (path) {
+ if (dst.type === 'local') {
+ IDBFS.loadRemoteEntry(store, path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeLocalEntry(path, entry, done);
+ });
+ } else {
+ IDBFS.loadLocalEntry(path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeRemoteEntry(store, path, entry, done);
+ });
+ }
+ });
+
+ // sort paths in descending order so files are deleted before their
+ // parent directories
+ remove.sort().reverse().forEach(function(path) {
+ if (dst.type === 'local') {
+ IDBFS.removeLocalEntry(path, done);
+ } else {
+ IDBFS.removeRemoteEntry(store, path, done);
+ }
+ });
+ }};
+
+ var NODEFS={isWindows:false,staticInit:function () {
+ NODEFS.isWindows = !!process.platform.match(/^win/);
+ var flags = process["binding"]("constants");
+ // Node.js 4 compatibility: it has no namespaces for constants
+ if (flags["fs"]) {
+ flags = flags["fs"];
+ }
+ NODEFS.flagsForNodeMap = {
+ "1024": flags["O_APPEND"],
+ "64": flags["O_CREAT"],
+ "128": flags["O_EXCL"],
+ "0": flags["O_RDONLY"],
+ "2": flags["O_RDWR"],
+ "4096": flags["O_SYNC"],
+ "512": flags["O_TRUNC"],
+ "1": flags["O_WRONLY"]
+ };
+ },bufferFrom:function (arrayBuffer) {
+ // Node.js < 4.5 compatibility: Buffer.from does not support ArrayBuffer
+ // Buffer.from before 4.5 was just a method inherited from Uint8Array
+ // Buffer.alloc has been added with Buffer.from together, so check it instead
+ return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer);
+ },mount:function (mount) {
+ assert(ENVIRONMENT_IS_NODE);
+ return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node = FS.createNode(parent, name, mode);
+ node.node_ops = NODEFS.node_ops;
+ node.stream_ops = NODEFS.stream_ops;
+ return node;
+ },getMode:function (path) {
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ if (NODEFS.isWindows) {
+ // Node.js on Windows never represents permission bit 'x', so
+ // propagate read bits to execute bits
+ stat.mode = stat.mode | ((stat.mode & 292) >> 2);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return stat.mode;
+ },realPath:function (node) {
+ var parts = [];
+ while (node.parent !== node) {
+ parts.push(node.name);
+ node = node.parent;
+ }
+ parts.push(node.mount.opts.root);
+ parts.reverse();
+ return PATH.join.apply(null, parts);
+ },flagsForNode:function (flags) {
+ flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
+ var newFlags = 0;
+ for (var k in NODEFS.flagsForNodeMap) {
+ if (flags & k) {
+ newFlags |= NODEFS.flagsForNodeMap[k];
+ flags ^= k;
+ }
+ }
+
+ if (!flags) {
+ return newFlags;
+ } else {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ },node_ops:{getattr:function (node) {
+ var path = NODEFS.realPath(node);
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
+ // See http://support.microsoft.com/kb/140365
+ if (NODEFS.isWindows && !stat.blksize) {
+ stat.blksize = 4096;
+ }
+ if (NODEFS.isWindows && !stat.blocks) {
+ stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
+ }
+ return {
+ dev: stat.dev,
+ ino: stat.ino,
+ mode: stat.mode,
+ nlink: stat.nlink,
+ uid: stat.uid,
+ gid: stat.gid,
+ rdev: stat.rdev,
+ size: stat.size,
+ atime: stat.atime,
+ mtime: stat.mtime,
+ ctime: stat.ctime,
+ blksize: stat.blksize,
+ blocks: stat.blocks
+ };
+ },setattr:function (node, attr) {
+ var path = NODEFS.realPath(node);
+ try {
+ if (attr.mode !== undefined) {
+ fs.chmodSync(path, attr.mode);
+ // update the common node structure mode as well
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ var date = new Date(attr.timestamp);
+ fs.utimesSync(path, date, date);
+ }
+ if (attr.size !== undefined) {
+ fs.truncateSync(path, attr.size);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },lookup:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ var mode = NODEFS.getMode(path);
+ return NODEFS.createNode(parent, name, mode);
+ },mknod:function (parent, name, mode, dev) {
+ var node = NODEFS.createNode(parent, name, mode, dev);
+ // create the backing node for this in the fs root as well
+ var path = NODEFS.realPath(node);
+ try {
+ if (FS.isDir(node.mode)) {
+ fs.mkdirSync(path, node.mode);
+ } else {
+ fs.writeFileSync(path, '', { mode: node.mode });
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return node;
+ },rename:function (oldNode, newDir, newName) {
+ var oldPath = NODEFS.realPath(oldNode);
+ var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
+ try {
+ fs.renameSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },unlink:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.unlinkSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },rmdir:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.rmdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readdir:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ return fs.readdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },symlink:function (parent, newName, oldPath) {
+ var newPath = PATH.join2(NODEFS.realPath(parent), newName);
+ try {
+ fs.symlinkSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readlink:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ path = fs.readlinkSync(path);
+ path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
+ return path;
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }},stream_ops:{open:function (stream) {
+ var path = NODEFS.realPath(stream.node);
+ try {
+ if (FS.isFile(stream.node.mode)) {
+ stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags));
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },close:function (stream) {
+ try {
+ if (FS.isFile(stream.node.mode) && stream.nfd) {
+ fs.closeSync(stream.nfd);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },read:function (stream, buffer, offset, length, position) {
+ // Node.js < 6 compatibility: node errors on 0 length reads
+ if (length === 0) return 0;
+ try {
+ return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },write:function (stream, buffer, offset, length, position) {
+ try {
+ return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ try {
+ var stat = fs.fstatSync(stream.nfd);
+ position += stat.size;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }
+ }
+
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ return position;
+ }}};
+
+ var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
+ assert(ENVIRONMENT_IS_WORKER);
+ if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
+ var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
+ var createdParents = {};
+ function ensureParent(path) {
+ // return the parent node, creating subdirs as necessary
+ var parts = path.split('/');
+ var parent = root;
+ for (var i = 0; i < parts.length-1; i++) {
+ var curr = parts.slice(0, i+1).join('/');
+ // Issue 4254: Using curr as a node name will prevent the node
+ // from being found in FS.nameTable when FS.open is called on
+ // a path which holds a child of this node,
+ // given that all FS functions assume node names
+ // are just their corresponding parts within their given path,
+ // rather than incremental aggregates which include their parent's
+ // directories.
+ if (!createdParents[curr]) {
+ createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
+ }
+ parent = createdParents[curr];
+ }
+ return parent;
+ }
+ function base(path) {
+ var parts = path.split('/');
+ return parts[parts.length-1];
+ }
+ // We also accept FileList here, by using Array.prototype
+ Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
+ WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
+ });
+ (mount.opts["blobs"] || []).forEach(function(obj) {
+ WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
+ });
+ (mount.opts["packages"] || []).forEach(function(pack) {
+ pack['metadata'].files.forEach(function(file) {
+ var name = file.filename.substr(1); // remove initial slash
+ WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
+ });
+ });
+ return root;
+ },createNode:function (parent, name, mode, dev, contents, mtime) {
+ var node = FS.createNode(parent, name, mode);
+ node.mode = mode;
+ node.node_ops = WORKERFS.node_ops;
+ node.stream_ops = WORKERFS.stream_ops;
+ node.timestamp = (mtime || new Date).getTime();
+ assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
+ if (mode === WORKERFS.FILE_MODE) {
+ node.size = contents.size;
+ node.contents = contents;
+ } else {
+ node.size = 4096;
+ node.contents = {};
+ }
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },node_ops:{getattr:function (node) {
+ return {
+ dev: 1,
+ ino: undefined,
+ mode: node.mode,
+ nlink: 1,
+ uid: 0,
+ gid: 0,
+ rdev: undefined,
+ size: node.size,
+ atime: new Date(node.timestamp),
+ mtime: new Date(node.timestamp),
+ ctime: new Date(node.timestamp),
+ blksize: 4096,
+ blocks: Math.ceil(node.size / 4096),
+ };
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ },lookup:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ },mknod:function (parent, name, mode, dev) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rename:function (oldNode, newDir, newName) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },unlink:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rmdir:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readdir:function (node) {
+ var entries = ['.', '..'];
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newName, oldPath) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readlink:function (node) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ if (position >= stream.node.size) return 0;
+ var chunk = stream.node.contents.slice(position, position + length);
+ var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
+ buffer.set(new Uint8Array(ab), offset);
+ return chunk.size;
+ },write:function (stream, buffer, offset, length, position) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.size;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ }}};
+
+ var _stdin; if (ENVIRONMENT_IS_PTHREAD) _stdin = PthreadWorkerInit._stdin; else PthreadWorkerInit._stdin = _stdin = allocate(1, "i32*", ALLOC_STATIC);
+
+ var _stdout; if (ENVIRONMENT_IS_PTHREAD) _stdout = PthreadWorkerInit._stdout; else PthreadWorkerInit._stdout = _stdout = allocate(1, "i32*", ALLOC_STATIC);
+
+ var _stderr; if (ENVIRONMENT_IS_PTHREAD) _stderr = PthreadWorkerInit._stderr; else PthreadWorkerInit._stderr = _stderr = allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
+ if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
+ return ___setErrNo(e.errno);
+ },lookupPath:function (path, opts) {
+ path = PATH.resolve(FS.cwd(), path);
+ opts = opts || {};
+
+ if (!path) return { path: '', node: null };
+
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ for (var key in defaults) {
+ if (opts[key] === undefined) {
+ opts[key] = defaults[key];
+ }
+ }
+
+ if (opts.recurse_count > 8) { // max recursive lookup of 8
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+
+ // split the path
+ var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), false);
+
+ // start at the root
+ var current = FS.root;
+ var current_path = '/';
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length-1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH.resolve(PATH.dirname(current_path), link);
+
+ var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
+ current = lookup.node;
+
+ if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+ }
+ }
+ }
+
+ return { path: current_path, node: current };
+ },getPath:function (node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+ }
+ path = path ? node.name + '/' + path : node.name;
+ node = node.parent;
+ }
+ },hashName:function (parentid, name) {
+ var hash = 0;
+
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },hashAddNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },hashRemoveNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },lookupNode:function (parent, name) {
+ var err = FS.mayLookup(parent);
+ if (err) {
+ throw new FS.ErrnoError(err, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },createNode:function (parent, name, mode, rdev) {
+ if (!FS.FSNode) {
+ FS.FSNode = function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+ };
+
+ FS.FSNode.prototype = {};
+
+ // compatibility
+ var readMode = 292 | 73;
+ var writeMode = 146;
+
+ // NOTE we must use Object.defineProperties instead of individual calls to
+ // Object.defineProperty in order to make closure compiler happy
+ Object.defineProperties(FS.FSNode.prototype, {
+ read: {
+ get: function() { return (this.mode & readMode) === readMode; },
+ set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
+ },
+ write: {
+ get: function() { return (this.mode & writeMode) === writeMode; },
+ set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
+ },
+ isFolder: {
+ get: function() { return FS.isDir(this.mode); }
+ },
+ isDevice: {
+ get: function() { return FS.isChrdev(this.mode); }
+ }
+ });
+ }
+
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },destroyNode:function (node) {
+ FS.hashRemoveNode(node);
+ },isRoot:function (node) {
+ return node === node.parent;
+ },isMountpoint:function (node) {
+ return !!node.mounted;
+ },isFile:function (mode) {
+ return (mode & 61440) === 32768;
+ },isDir:function (mode) {
+ return (mode & 61440) === 16384;
+ },isLink:function (mode) {
+ return (mode & 61440) === 40960;
+ },isChrdev:function (mode) {
+ return (mode & 61440) === 8192;
+ },isBlkdev:function (mode) {
+ return (mode & 61440) === 24576;
+ },isFIFO:function (mode) {
+ return (mode & 61440) === 4096;
+ },isSocket:function (mode) {
+ return (mode & 49152) === 49152;
+ },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
+ var flags = FS.flagModes[str];
+ if (typeof flags === 'undefined') {
+ throw new Error('Unknown file open mode: ' + str);
+ }
+ return flags;
+ },flagsToPermissionString:function (flag) {
+ var perms = ['r', 'w', 'rw'][flag & 3];
+ if ((flag & 512)) {
+ perms += 'w';
+ }
+ return perms;
+ },nodePermissions:function (node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
+ return ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },mayLookup:function (dir) {
+ var err = FS.nodePermissions(dir, 'x');
+ if (err) return err;
+ if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
+ return 0;
+ },mayCreate:function (dir, name) {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return ERRNO_CODES.EEXIST;
+ } catch (e) {
+ }
+ return FS.nodePermissions(dir, 'wx');
+ },mayDelete:function (dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var err = FS.nodePermissions(dir, 'wx');
+ if (err) {
+ return err;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return ERRNO_CODES.ENOTDIR;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return ERRNO_CODES.EBUSY;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return 0;
+ },mayOpen:function (node, flags) {
+ if (!node) {
+ return ERRNO_CODES.ENOENT;
+ }
+ if (FS.isLink(node.mode)) {
+ return ERRNO_CODES.ELOOP;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+ (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
+ fd_start = fd_start || 0;
+ fd_end = fd_end || FS.MAX_OPEN_FDS;
+ for (var fd = fd_start; fd <= fd_end; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
+ },getStream:function (fd) {
+ return FS.streams[fd];
+ },createStream:function (stream, fd_start, fd_end) {
+ if (!FS.FSStream) {
+ FS.FSStream = function(){};
+ FS.FSStream.prototype = {};
+ // compatibility
+ Object.defineProperties(FS.FSStream.prototype, {
+ object: {
+ get: function() { return this.node; },
+ set: function(val) { this.node = val; }
+ },
+ isRead: {
+ get: function() { return (this.flags & 2097155) !== 1; }
+ },
+ isWrite: {
+ get: function() { return (this.flags & 2097155) !== 0; }
+ },
+ isAppend: {
+ get: function() { return (this.flags & 1024); }
+ }
+ });
+ }
+ // clone it, so we can return an instance of FSStream
+ var newStream = new FS.FSStream();
+ for (var p in stream) {
+ newStream[p] = stream[p];
+ }
+ stream = newStream;
+ var fd = FS.nextfd(fd_start, fd_end);
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },closeStream:function (fd) {
+ FS.streams[fd] = null;
+ },chrdev_stream_ops:{open:function (stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },llseek:function () {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }},major:function (dev) {
+ return ((dev) >> 8);
+ },minor:function (dev) {
+ return ((dev) & 0xff);
+ },makedev:function (ma, mi) {
+ return ((ma) << 8 | (mi));
+ },registerDevice:function (dev, ops) {
+ FS.devices[dev] = { stream_ops: ops };
+ },getDevice:function (dev) {
+ return FS.devices[dev];
+ },getMounts:function (mount) {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push.apply(check, m.mounts);
+ }
+
+ return mounts;
+ },syncfs:function (populate, callback) {
+ if (typeof(populate) === 'function') {
+ callback = populate;
+ populate = false;
+ }
+
+ FS.syncFSRequests++;
+
+ if (FS.syncFSRequests > 1) {
+ console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function doCallback(err) {
+ assert(FS.syncFSRequests > 0);
+ FS.syncFSRequests--;
+ return callback(err);
+ }
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(err);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ };
+
+ // sync all mounts
+ mounts.forEach(function (mount) {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },mount:function (type, opts, mountpoint) {
+ var root = mountpoint === '/';
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ }
+
+ var mount = {
+ type: type,
+ opts: opts,
+ mountpoint: mountpoint,
+ mounts: []
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },unmount:function (mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach(function (hash) {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.indexOf(current.mount) !== -1) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },lookup:function (parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },mknod:function (path, mode, dev) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === '.' || name === '..') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.mayCreate(parent, name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },create:function (path, mode) {
+ mode = mode !== undefined ? mode : 438 /* 0666 */;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },mkdir:function (path, mode) {
+ mode = mode !== undefined ? mode : 511 /* 0777 */;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },mkdirTree:function (path, mode) {
+ var dirs = path.split('/');
+ var d = '';
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += '/' + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch(e) {
+ if (e.errno != ERRNO_CODES.EEXIST) throw e;
+ }
+ }
+ },mkdev:function (path, mode, dev) {
+ if (typeof(dev) === 'undefined') {
+ dev = mode;
+ mode = 438 /* 0666 */;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },symlink:function (oldpath, newpath) {
+ if (!PATH.resolve(oldpath)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var newname = PATH.basename(newpath);
+ var err = FS.mayCreate(parent, newname);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },rename:function (old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+ try {
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var err = FS.mayDelete(old_dir, old_name, isdir);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ err = new_node ?
+ FS.mayDelete(new_dir, new_name, isdir) :
+ FS.mayCreate(new_dir, new_name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ err = FS.nodePermissions(old_dir, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['willMovePath']) {
+ FS.trackingDelegate['willMovePath'](old_path, new_path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ try {
+ if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ },rmdir:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, true);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ return node.node_ops.readdir(node);
+ },unlink:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, false);
+ if (err) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readlink:function (path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },stat:function (path, dontFollow) {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return node.node_ops.getattr(node);
+ },lstat:function (path) {
+ return FS.stat(path, true);
+ },chmod:function (path, mode, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },lchmod:function (path, mode) {
+ FS.chmod(path, mode, true);
+ },fchmod:function (fd, mode) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chmod(stream.node, mode);
+ },chown:function (path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ // we ignore the uid / gid for now
+ });
+ },lchown:function (path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },fchown:function (fd, uid, gid) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chown(stream.node, uid, gid);
+ },truncate:function (path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.nodePermissions(node, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },ftruncate:function (fd, len) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ FS.truncate(stream.node, len);
+ },utime:function (path, atime, mtime) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },open:function (path, flags, mode, fd_start, fd_end) {
+ if (path === "") {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
+ mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path === 'object') {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {
+ // ignore
+ }
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var err = FS.mayOpen(node, flags);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512)) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node: node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags: flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ }, fd_start, fd_end);
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module['logReadFiles'] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ err('read file: ' + path);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['onOpenFile']) {
+ var trackingFlags = 0;
+ if ((flags & 2097155) !== 1) {
+ trackingFlags |= FS.tracking.openFlags.READ;
+ }
+ if ((flags & 2097155) !== 0) {
+ trackingFlags |= FS.tracking.openFlags.WRITE;
+ }
+ FS.trackingDelegate['onOpenFile'](path, trackingFlags);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
+ }
+ return stream;
+ },close:function (stream) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },isClosed:function (stream) {
+ return stream.fd === null;
+ },llseek:function (stream, offset, whence) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },read:function (stream, buffer, offset, length, position) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var seeking = typeof position !== 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position !== 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ try {
+ if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
+ }
+ return bytesWritten;
+ },allocate:function (stream, offset, length) {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ // TODO if PROT is PROT_WRITE, make sure we have write access
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EACCES);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!stream || !stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },munmap:function (stream) {
+ return 0;
+ },ioctl:function (stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },readFile:function (path, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'r';
+ opts.encoding = opts.encoding || 'binary';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === 'utf8') {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === 'binary') {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },writeFile:function (path, data, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'w';
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data === 'string') {
+ var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error('Unsupported data type');
+ }
+ FS.close(stream);
+ },cwd:function () {
+ return FS.currentPath;
+ },chdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ var err = FS.nodePermissions(lookup.node, 'x');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ FS.currentPath = lookup.path;
+ },createDefaultDirectories:function () {
+ FS.mkdir('/tmp');
+ FS.mkdir('/home');
+ FS.mkdir('/home/web_user');
+ },createDefaultDevices:function () {
+ // create /dev
+ FS.mkdir('/dev');
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: function() { return 0; },
+ write: function(stream, buffer, offset, length, pos) { return length; }
+ });
+ FS.mkdev('/dev/null', FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using Module['printErr']
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev('/dev/tty', FS.makedev(5, 0));
+ FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+ // setup /dev/[u]random
+ var random_device;
+ if (typeof crypto !== 'undefined') {
+ // for modern web browsers
+ var randomBuffer = new Uint8Array(1);
+ random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+ } else if (ENVIRONMENT_IS_NODE) {
+ // for nodejs
+ random_device = function() { return require('crypto')['randomBytes'](1)[0]; };
+ } else {
+ // default for ES5 platforms
+ random_device = function() { return (Math.random()*256)|0; };
+ }
+ FS.createDevice('/dev', 'random', random_device);
+ FS.createDevice('/dev', 'urandom', random_device);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir('/dev/shm');
+ FS.mkdir('/dev/shm/tmp');
+ },createSpecialDirectories:function () {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir('/proc');
+ FS.mkdir('/proc/self');
+ FS.mkdir('/proc/self/fd');
+ FS.mount({
+ mount: function() {
+ var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
+ node.node_ops = {
+ lookup: function(parent, name) {
+ var fd = +name;
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: 'fake' },
+ node_ops: { readlink: function() { return stream.path } }
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, '/proc/self/fd');
+ },createStandardStreams:function () {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (Module['stdin']) {
+ FS.createDevice('/dev', 'stdin', Module['stdin']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdin');
+ }
+ if (Module['stdout']) {
+ FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdout');
+ }
+ if (Module['stderr']) {
+ FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+ } else {
+ FS.symlink('/dev/tty1', '/dev/stderr');
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open('/dev/stdin', 'r');
+ assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
+
+ var stdout = FS.open('/dev/stdout', 'w');
+ assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
+
+ var stderr = FS.open('/dev/stderr', 'w');
+ assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
+ },ensureErrnoError:function () {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = function ErrnoError(errno, node) {
+ //err(stackTrace()); // useful for debugging
+ this.node = node;
+ this.setErrno = function(errno) {
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ };
+ this.setErrno(errno);
+ this.message = ERRNO_MESSAGES[errno];
+ // Node.js compatibility: assigning on this.stack fails on Node 4 (but fixed on Node 8)
+ if (this.stack) Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
+ if (this.stack) this.stack = demangleAll(this.stack);
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+ [ERRNO_CODES.ENOENT].forEach(function(code) {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = '';
+ });
+ },staticInit:function () {
+ FS.ensureErrnoError();
+
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, '/');
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ 'MEMFS': MEMFS,
+ 'IDBFS': IDBFS,
+ 'NODEFS': NODEFS,
+ 'WORKERFS': WORKERFS,
+ };
+ },init:function (input, output, error) {
+ assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+ FS.init.initialized = true;
+
+ FS.ensureErrnoError();
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ Module['stdin'] = input || Module['stdin'];
+ Module['stdout'] = output || Module['stdout'];
+ Module['stderr'] = error || Module['stderr'];
+
+ FS.createStandardStreams();
+ },quit:function () {
+ FS.init.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ var fflush = Module['_fflush'];
+ if (fflush) fflush(0);
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },getMode:function (canRead, canWrite) {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ },joinPath:function (parts, forceRelative) {
+ var path = PATH.join.apply(null, parts);
+ if (forceRelative && path[0] == '/') path = path.substr(1);
+ return path;
+ },absolutePath:function (relative, base) {
+ return PATH.resolve(base, relative);
+ },standardizePath:function (path) {
+ return PATH.normalize(path);
+ },findObject:function (path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (ret.exists) {
+ return ret.object;
+ } else {
+ ___setErrNo(ret.error);
+ return null;
+ }
+ },analyzePath:function (path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {
+ }
+ var ret = {
+ isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+ parentExists: false, parentPath: null, parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === '/';
+ } catch (e) {
+ ret.error = e.errno;
+ };
+ return ret;
+ },createFolder:function (parent, name, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.mkdir(path, mode);
+ },createPath:function (parent, path, canRead, canWrite) {
+ parent = typeof parent === 'string' ? parent : FS.getPath(parent);
+ var parts = path.split('/').reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },createFile:function (parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
+ var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
+ var mode = FS.getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data === 'string') {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 'w');
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },createDevice:function (parent, name, input, output) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open: function(stream) {
+ stream.seekable = false;
+ },
+ close: function(stream) {
+ // flush any pending line data
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read: function(stream, buffer, offset, length, pos /* ignored */) {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: function(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },createLink:function (parent, name, target, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ return FS.symlink(target, path);
+ },forceLoadFile:function (obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ var success = true;
+ if (typeof XMLHttpRequest !== 'undefined') {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (Module['read']) {
+ // Command-line.
+ try {
+ // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+ // read() will try to parse UTF8.
+ obj.contents = intArrayFromString(Module['read'](obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ success = false;
+ }
+ } else {
+ throw new Error('Cannot load without read() or XMLHttpRequest.');
+ }
+ if (!success) ___setErrNo(ERRNO_CODES.EIO);
+ return success;
+ },createLazyFile:function (parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = []; // Loaded chunks. Index is the chunk number
+ }
+ LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+ if (idx > this.length-1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize)|0;
+ return this.getter(chunkNum)[chunkOffset];
+ }
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ }
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open('HEAD', url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+
+ var chunkSize = 1024*1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (function(from, to) {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType('text/plain; charset=x-user-defined');
+ }
+
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(xhr.response || []);
+ } else {
+ return intArrayFromString(xhr.responseText || '', true);
+ }
+ });
+ var lazyArray = this;
+ lazyArray.setDataGetter(function(chunkNum) {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum+1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ }
+ if (typeof XMLHttpRequest !== 'undefined') {
+ if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperties(lazyArray, {
+ length: {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ },
+ chunkSize: {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ });
+
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: function() { return this.contents.length; }
+ }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach(function(key) {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ return fn.apply(null, arguments);
+ };
+ });
+ // use a custom read function
+ stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ var contents = stream.node.contents;
+ if (position >= contents.length)
+ return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) { // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+ Browser.init(); // XXX perhaps this method should move onto Browser?
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ var handled = false;
+ Module['preloadPlugins'].forEach(function(plugin) {
+ if (handled) return;
+ if (plugin['canHandle'](fullname)) {
+ plugin['handle'](byteArray, fullname, finish, function() {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ });
+ handled = true;
+ }
+ });
+ if (!handled) finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == 'string') {
+ Browser.asyncLoad(url, function(byteArray) {
+ processData(byteArray);
+ }, onerror);
+ } else {
+ processData(url);
+ }
+ },indexedDB:function () {
+ return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ },DB_NAME:function () {
+ return 'EM_FS_' + window.location.pathname;
+ },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
+ console.log('creating db');
+ var db = openRequest.result;
+ db.createObjectStore(FS.DB_STORE_NAME);
+ };
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+ putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
+ putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ },loadFilesFromDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = onerror; // no database to load from
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ try {
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+ } catch(e) {
+ onerror(e);
+ return;
+ }
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var getRequest = files.get(path);
+ getRequest.onsuccess = function getRequest_onsuccess() {
+ if (FS.analyzePath(path).exists) {
+ FS.unlink(path);
+ }
+ FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+ ok++;
+ if (ok + fail == total) finish();
+ };
+ getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ }};var SOCKFS={mount:function (mount) {
+ // If Module['websocket'] has already been defined (e.g. for configuring
+ // the subprotocol/url) use that, if not initialise it to a new object.
+ Module['websocket'] = (Module['websocket'] &&
+ ('object' === typeof Module['websocket'])) ? Module['websocket'] : {};
+
+ // Add the Event registration mechanism to the exported websocket configuration
+ // object so we can register network callbacks from native JavaScript too.
+ // For more documentation see system/include/emscripten/emscripten.h
+ Module['websocket']._callbacks = {};
+ Module['websocket']['on'] = function(event, callback) {
+ if ('function' === typeof callback) {
+ this._callbacks[event] = callback;
+ }
+ return this;
+ };
+
+ Module['websocket'].emit = function(event, param) {
+ if ('function' === typeof this._callbacks[event]) {
+ this._callbacks[event].call(this, param);
+ }
+ };
+
+ // If debug is enabled register simple default logging callbacks for each Event.
+
+ return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createSocket:function (family, type, protocol) {
+ var streaming = type == 1;
+ if (protocol) {
+ assert(streaming == (protocol == 6)); // if SOCK_STREAM, must be tcp
+ }
+
+ // create our internal socket structure
+ var sock = {
+ family: family,
+ type: type,
+ protocol: protocol,
+ server: null,
+ error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
+ peers: {},
+ pending: [],
+ recv_queue: [],
+ sock_ops: SOCKFS.websocket_sock_ops
+ };
+
+ // create the filesystem node to store the socket structure
+ var name = SOCKFS.nextname();
+ var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+ node.sock = sock;
+
+ // and the wrapping stream that enables library functions such
+ // as read and write to indirectly interact with the socket
+ var stream = FS.createStream({
+ path: name,
+ node: node,
+ flags: FS.modeStringToFlags('r+'),
+ seekable: false,
+ stream_ops: SOCKFS.stream_ops
+ });
+
+ // map the new stream to the socket structure (sockets have a 1:1
+ // relationship with a stream)
+ sock.stream = stream;
+
+ return sock;
+ },getSocket:function (fd) {
+ var stream = FS.getStream(fd);
+ if (!stream || !FS.isSocket(stream.node.mode)) {
+ return null;
+ }
+ return stream.node.sock;
+ },stream_ops:{poll:function (stream) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.poll(sock);
+ },ioctl:function (stream, request, varargs) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.ioctl(sock, request, varargs);
+ },read:function (stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ var msg = sock.sock_ops.recvmsg(sock, length);
+ if (!msg) {
+ // socket is closed
+ return 0;
+ }
+ buffer.set(msg.buffer, offset);
+ return msg.buffer.length;
+ },write:function (stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+ },close:function (stream) {
+ var sock = stream.node.sock;
+ sock.sock_ops.close(sock);
+ }},nextname:function () {
+ if (!SOCKFS.nextname.current) {
+ SOCKFS.nextname.current = 0;
+ }
+ return 'socket[' + (SOCKFS.nextname.current++) + ']';
+ },websocket_sock_ops:{createPeer:function (sock, addr, port) {
+ var ws;
+
+ if (typeof addr === 'object') {
+ ws = addr;
+ addr = null;
+ port = null;
+ }
+
+ if (ws) {
+ // for sockets that've already connected (e.g. we're the server)
+ // we can inspect the _socket property for the address
+ if (ws._socket) {
+ addr = ws._socket.remoteAddress;
+ port = ws._socket.remotePort;
+ }
+ // if we're just now initializing a connection to the remote,
+ // inspect the url property
+ else {
+ var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+ if (!result) {
+ throw new Error('WebSocket URL must be in the format ws(s)://address:port');
+ }
+ addr = result[1];
+ port = parseInt(result[2], 10);
+ }
+ } else {
+ // create the actual websocket object and connect
+ try {
+ // runtimeConfig gets set to true if WebSocket runtime configuration is available.
+ var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket']));
+
+ // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
+ // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
+ var url = 'ws:#'.replace('#', '//');
+
+ if (runtimeConfig) {
+ if ('string' === typeof Module['websocket']['url']) {
+ url = Module['websocket']['url']; // Fetch runtime WebSocket URL config.
+ }
+ }
+
+ if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it.
+ var parts = addr.split('/');
+ url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/');
+ }
+
+ // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
+ var subProtocols = 'binary'; // The default value is 'binary'
+
+ if (runtimeConfig) {
+ if ('string' === typeof Module['websocket']['subprotocol']) {
+ subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config.
+ }
+ }
+
+ // The regex trims the string (removes spaces at the beginning and end, then splits the string by
+ // , into an Array. Whitespace removal is important for Websockify and ws.
+ subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */);
+
+ // The node ws library API for specifying optional subprotocol is slightly different than the browser's.
+ var opts = ENVIRONMENT_IS_NODE ? {'protocol': subProtocols.toString()} : subProtocols;
+
+ // some webservers (azure) does not support subprotocol header
+ if (runtimeConfig && null === Module['websocket']['subprotocol']) {
+ subProtocols = 'null';
+ opts = undefined;
+ }
+
+ // If node we use the ws library.
+ var WebSocketConstructor;
+ if (ENVIRONMENT_IS_NODE) {
+ WebSocketConstructor = require('ws');
+ } else if (ENVIRONMENT_IS_WEB) {
+ WebSocketConstructor = window['WebSocket'];
+ } else {
+ WebSocketConstructor = WebSocket;
+ }
+ ws = new WebSocketConstructor(url, opts);
+ ws.binaryType = 'arraybuffer';
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EHOSTUNREACH);
+ }
+ }
+
+
+ var peer = {
+ addr: addr,
+ port: port,
+ socket: ws,
+ dgram_send_queue: []
+ };
+
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+
+ // if this is a bound dgram socket, send the port number first to allow
+ // us to override the ephemeral port reported to us by remotePort on the
+ // remote end.
+ if (sock.type === 2 && typeof sock.sport !== 'undefined') {
+ peer.dgram_send_queue.push(new Uint8Array([
+ 255, 255, 255, 255,
+ 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0),
+ ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff)
+ ]));
+ }
+
+ return peer;
+ },getPeer:function (sock, addr, port) {
+ return sock.peers[addr + ':' + port];
+ },addPeer:function (sock, peer) {
+ sock.peers[peer.addr + ':' + peer.port] = peer;
+ },removePeer:function (sock, peer) {
+ delete sock.peers[peer.addr + ':' + peer.port];
+ },handlePeerEvents:function (sock, peer) {
+ var first = true;
+
+ var handleOpen = function () {
+
+ Module['websocket'].emit('open', sock.stream.fd);
+
+ try {
+ var queued = peer.dgram_send_queue.shift();
+ while (queued) {
+ peer.socket.send(queued);
+ queued = peer.dgram_send_queue.shift();
+ }
+ } catch (e) {
+ // not much we can do here in the way of proper error handling as we've already
+ // lied and said this data was sent. shut it down.
+ peer.socket.close();
+ }
+ };
+
+ function handleMessage(data) {
+ assert(typeof data !== 'string' && data.byteLength !== undefined); // must receive an ArrayBuffer
+
+ // An empty ArrayBuffer will emit a pseudo disconnect event
+ // as recv/recvmsg will return zero which indicates that a socket
+ // has performed a shutdown although the connection has not been disconnected yet.
+ if (data.byteLength == 0) {
+ return;
+ }
+ data = new Uint8Array(data); // make a typed array view on the array buffer
+
+
+ // if this is the port message, override the peer's port with it
+ var wasfirst = first;
+ first = false;
+ if (wasfirst &&
+ data.length === 10 &&
+ data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 &&
+ data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) {
+ // update the peer's port and it's key in the peer map
+ var newport = ((data[8] << 8) | data[9]);
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ peer.port = newport;
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ return;
+ }
+
+ sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
+ Module['websocket'].emit('message', sock.stream.fd);
+ };
+
+ if (ENVIRONMENT_IS_NODE) {
+ peer.socket.on('open', handleOpen);
+ peer.socket.on('message', function(data, flags) {
+ if (!flags.binary) {
+ return;
+ }
+ handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer
+ });
+ peer.socket.on('close', function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ });
+ peer.socket.on('error', function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
+ // is still probably the most useful thing to do.
+ sock.error = ERRNO_CODES.ECONNREFUSED; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+ // don't throw
+ });
+ } else {
+ peer.socket.onopen = handleOpen;
+ peer.socket.onclose = function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ };
+ peer.socket.onmessage = function peer_socket_onmessage(event) {
+ handleMessage(event.data);
+ };
+ peer.socket.onerror = function(error) {
+ // The WebSocket spec only allows a 'simple event' to be thrown on error,
+ // so we only really know as much as ECONNREFUSED.
+ sock.error = ERRNO_CODES.ECONNREFUSED; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+ };
+ }
+ },poll:function (sock) {
+ if (sock.type === 1 && sock.server) {
+ // listen sockets should only say they're available for reading
+ // if there are pending clients.
+ return sock.pending.length ? (64 | 1) : 0;
+ }
+
+ var mask = 0;
+ var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets
+ SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) :
+ null;
+
+ if (sock.recv_queue.length ||
+ !dest || // connection-less sockets are always ready to read
+ (dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed
+ mask |= (64 | 1);
+ }
+
+ if (!dest || // connection-less sockets are always ready to write
+ (dest && dest.socket.readyState === dest.socket.OPEN)) {
+ mask |= 4;
+ }
+
+ if ((dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)) {
+ mask |= 16;
+ }
+
+ return mask;
+ },ioctl:function (sock, request, arg) {
+ switch (request) {
+ case 21531:
+ var bytes = 0;
+ if (sock.recv_queue.length) {
+ bytes = sock.recv_queue[0].data.length;
+ }
+ HEAP32[((arg)>>2)]=bytes;
+ return 0;
+ default:
+ return ERRNO_CODES.EINVAL;
+ }
+ },close:function (sock) {
+ // if we've spawned a listen server, close it
+ if (sock.server) {
+ try {
+ sock.server.close();
+ } catch (e) {
+ }
+ sock.server = null;
+ }
+ // close any peer connections
+ var peers = Object.keys(sock.peers);
+ for (var i = 0; i < peers.length; i++) {
+ var peer = sock.peers[peers[i]];
+ try {
+ peer.socket.close();
+ } catch (e) {
+ }
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ }
+ return 0;
+ },bind:function (sock, addr, port) {
+ if (typeof sock.saddr !== 'undefined' || typeof sock.sport !== 'undefined') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL); // already bound
+ }
+ sock.saddr = addr;
+ sock.sport = port;
+ // in order to emulate dgram sockets, we need to launch a listen server when
+ // binding on a connection-less socket
+ // note: this is only required on the server side
+ if (sock.type === 2) {
+ // close the existing server if it exists
+ if (sock.server) {
+ sock.server.close();
+ sock.server = null;
+ }
+ // swallow error operation not supported error that occurs when binding in the
+ // browser where this isn't supported
+ try {
+ sock.sock_ops.listen(sock, 0);
+ } catch (e) {
+ if (!(e instanceof FS.ErrnoError)) throw e;
+ if (e.errno !== ERRNO_CODES.EOPNOTSUPP) throw e;
+ }
+ }
+ },connect:function (sock, addr, port) {
+ if (sock.server) {
+ throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+ }
+
+ // TODO autobind
+ // if (!sock.addr && sock.type == 2) {
+ // }
+
+ // early out if we're already connected / in the middle of connecting
+ if (typeof sock.daddr !== 'undefined' && typeof sock.dport !== 'undefined') {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (dest) {
+ if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(ERRNO_CODES.EALREADY);
+ } else {
+ throw new FS.ErrnoError(ERRNO_CODES.EISCONN);
+ }
+ }
+ }
+
+ // add the socket to our peer list and set our
+ // destination address / port to match
+ var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ sock.daddr = peer.addr;
+ sock.dport = peer.port;
+
+ // always "fail" in non-blocking mode
+ throw new FS.ErrnoError(ERRNO_CODES.EINPROGRESS);
+ },listen:function (sock, backlog) {
+ if (!ENVIRONMENT_IS_NODE) {
+ throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+ }
+ if (sock.server) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL); // already listening
+ }
+ var WebSocketServer = require('ws').Server;
+ var host = sock.saddr;
+ sock.server = new WebSocketServer({
+ host: host,
+ port: sock.sport
+ // TODO support backlog
+ });
+ Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd.
+
+ sock.server.on('connection', function(ws) {
+ if (sock.type === 1) {
+ var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
+
+ // create a peer on the new socket
+ var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
+ newsock.daddr = peer.addr;
+ newsock.dport = peer.port;
+
+ // push to queue for accept to pick up
+ sock.pending.push(newsock);
+ Module['websocket'].emit('connection', newsock.stream.fd);
+ } else {
+ // create a peer on the listen socket so calling sendto
+ // with the listen socket and an address will resolve
+ // to the correct client
+ SOCKFS.websocket_sock_ops.createPeer(sock, ws);
+ Module['websocket'].emit('connection', sock.stream.fd);
+ }
+ });
+ sock.server.on('closed', function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ sock.server = null;
+ });
+ sock.server.on('error', function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH
+ // is still probably the most useful thing to do. This error shouldn't
+ // occur in a well written app as errors should get trapped in the compiled
+ // app's own getaddrinfo call.
+ sock.error = ERRNO_CODES.EHOSTUNREACH; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']);
+ // don't throw
+ });
+ },accept:function (listensock) {
+ if (!listensock.server) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var newsock = listensock.pending.shift();
+ newsock.stream.flags = listensock.stream.flags;
+ return newsock;
+ },getname:function (sock, peer) {
+ var addr, port;
+ if (peer) {
+ if (sock.daddr === undefined || sock.dport === undefined) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
+ }
+ addr = sock.daddr;
+ port = sock.dport;
+ } else {
+ // TODO saddr and sport will be set for bind()'d UDP sockets, but what
+ // should we be returning for TCP sockets that've been connect()'d?
+ addr = sock.saddr || 0;
+ port = sock.sport || 0;
+ }
+ return { addr: addr, port: port };
+ },sendmsg:function (sock, buffer, offset, length, addr, port) {
+ if (sock.type === 2) {
+ // connection-less sockets will honor the message address,
+ // and otherwise fall back to the bound destination address
+ if (addr === undefined || port === undefined) {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ // if there was no address to fall back to, error out
+ if (addr === undefined || port === undefined) {
+ throw new FS.ErrnoError(ERRNO_CODES.EDESTADDRREQ);
+ }
+ } else {
+ // connection-based sockets will only use the bound
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+
+ // find the peer for the destination address
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+
+ // early out if not connected with a connection-based socket
+ if (sock.type === 1) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
+ } else if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ }
+
+ // create a copy of the incoming data to send, as the WebSocket API
+ // doesn't work entirely with an ArrayBufferView, it'll just send
+ // the entire underlying buffer
+ if (ArrayBuffer.isView(buffer)) {
+ offset += buffer.byteOffset;
+ buffer = buffer.buffer;
+ }
+
+ var data;
+ // WebSockets .send() does not allow passing a SharedArrayBuffer, so clone the portion of the SharedArrayBuffer as a regular
+ // ArrayBuffer that we want to send.
+ if (buffer instanceof SharedArrayBuffer) {
+ data = new Uint8Array(new Uint8Array(buffer.slice(offset, offset + length))).buffer;
+ } else {
+ data = buffer.slice(offset, offset + length);
+ }
+
+ // if we're emulating a connection-less dgram socket and don't have
+ // a cached connection, queue the buffer to send upon connect and
+ // lie, saying the data was sent now.
+ if (sock.type === 2) {
+ if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+ // if we're not connected, open a new connection
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ }
+ dest.dgram_send_queue.push(data);
+ return length;
+ }
+ }
+
+ try {
+ // send the actual data
+ dest.socket.send(data);
+ return length;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ },recvmsg:function (sock, length) {
+ // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
+ if (sock.type === 1 && sock.server) {
+ // tcp servers should not be recv()'ing on the listen socket
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
+ }
+
+ var queued = sock.recv_queue.shift();
+ if (!queued) {
+ if (sock.type === 1) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+
+ if (!dest) {
+ // if we have a destination address but are not connected, error out
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN);
+ }
+ else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ // return null if the socket has closed
+ return null;
+ }
+ else {
+ // else, our socket is in a valid state but truly has nothing available
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ } else {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ }
+
+ // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
+ // requeued TCP data it'll be an ArrayBufferView
+ var queuedLength = queued.data.byteLength || queued.data.length;
+ var queuedOffset = queued.data.byteOffset || 0;
+ var queuedBuffer = queued.data.buffer || queued.data;
+ var bytesRead = Math.min(length, queuedLength);
+ var res = {
+ buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+ addr: queued.addr,
+ port: queued.port
+ };
+
+
+ // push back any unread data for TCP connections
+ if (sock.type === 1 && bytesRead < queuedLength) {
+ var bytesRemaining = queuedLength - bytesRead;
+ queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
+ sock.recv_queue.unshift(queued);
+ }
+
+ return res;
+ }}};
+
+
+ function __inet_pton4_raw(str) {
+ var b = str.split('.');
+ for (var i = 0; i < 4; i++) {
+ var tmp = Number(b[i]);
+ if (isNaN(tmp)) return null;
+ b[i] = tmp;
+ }
+ return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
+ }
+
+ function __inet_pton6_raw(str) {
+ var words;
+ var w, offset, z, i;
+ /* http://home.deds.nl/~aeron/regex/ */
+ var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i
+ var parts = [];
+ if (!valid6regx.test(str)) {
+ return null;
+ }
+ if (str === "::") {
+ return [0, 0, 0, 0, 0, 0, 0, 0];
+ }
+ // Z placeholder to keep track of zeros when splitting the string on ":"
+ if (str.indexOf("::") === 0) {
+ str = str.replace("::", "Z:"); // leading zeros case
+ } else {
+ str = str.replace("::", ":Z:");
+ }
+
+ if (str.indexOf(".") > 0) {
+ // parse IPv4 embedded stress
+ str = str.replace(new RegExp('[.]', 'g'), ":");
+ words = str.split(":");
+ words[words.length-4] = parseInt(words[words.length-4]) + parseInt(words[words.length-3])*256;
+ words[words.length-3] = parseInt(words[words.length-2]) + parseInt(words[words.length-1])*256;
+ words = words.slice(0, words.length-2);
+ } else {
+ words = str.split(":");
+ }
+
+ offset = 0; z = 0;
+ for (w=0; w < words.length; w++) {
+ if (typeof words[w] === 'string') {
+ if (words[w] === 'Z') {
+ // compressed zeros - write appropriate number of zero words
+ for (z = 0; z < (8 - words.length+1); z++) {
+ parts[w+z] = 0;
+ }
+ offset = z-1;
+ } else {
+ // parse hex to field to 16-bit value and write it in network byte-order
+ parts[w+offset] = _htons(parseInt(words[w],16));
+ }
+ } else {
+ // parsed IPv4 words
+ parts[w+offset] = words[w];
+ }
+ }
+ return [
+ (parts[1] << 16) | parts[0],
+ (parts[3] << 16) | parts[2],
+ (parts[5] << 16) | parts[4],
+ (parts[7] << 16) | parts[6]
+ ];
+ }var DNS={address_map:{id:1,addrs:{},names:{}},lookup_name:function (name) {
+ // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
+ var res = __inet_pton4_raw(name);
+ if (res !== null) {
+ return name;
+ }
+ res = __inet_pton6_raw(name);
+ if (res !== null) {
+ return name;
+ }
+
+ // See if this name is already mapped.
+ var addr;
+
+ if (DNS.address_map.addrs[name]) {
+ addr = DNS.address_map.addrs[name];
+ } else {
+ var id = DNS.address_map.id++;
+ assert(id < 65535, 'exceeded max address mappings of 65535');
+
+ addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00);
+
+ DNS.address_map.names[addr] = name;
+ DNS.address_map.addrs[name] = addr;
+ }
+
+ return addr;
+ },lookup_addr:function (addr) {
+ if (DNS.address_map.names[addr]) {
+ return DNS.address_map.names[addr];
+ }
+
+ return null;
+ }};
+
+
+ var Sockets={BUFFER_SIZE:10240,MAX_BUFFER_SIZE:10485760,nextFd:1,fds:{},nextport:1,maxport:65535,peer:null,connections:{},portmap:{},localAddr:4261412874,addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034]};
+
+ function __inet_ntop4_raw(addr) {
+ return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff)
+ }
+
+ function __inet_ntop6_raw(ints) {
+ // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
+ // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses
+ // 128-bits are split into eight 16-bit words
+ // stored in network byte order (big-endian)
+ // | 80 bits | 16 | 32 bits |
+ // +-----------------------------------------------------------------+
+ // | 10 bytes | 2 | 4 bytes |
+ // +--------------------------------------+--------------------------+
+ // + 5 words | 1 | 2 words |
+ // +--------------------------------------+--------------------------+
+ // |0000..............................0000|0000| IPv4 ADDRESS | (compatible)
+ // +--------------------------------------+----+---------------------+
+ // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped)
+ // +--------------------------------------+----+---------------------+
+ var str = "";
+ var word = 0;
+ var longest = 0;
+ var lastzero = 0;
+ var zstart = 0;
+ var len = 0;
+ var i = 0;
+ var parts = [
+ ints[0] & 0xffff,
+ (ints[0] >> 16),
+ ints[1] & 0xffff,
+ (ints[1] >> 16),
+ ints[2] & 0xffff,
+ (ints[2] >> 16),
+ ints[3] & 0xffff,
+ (ints[3] >> 16)
+ ];
+
+ // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
+
+ var hasipv4 = true;
+ var v4part = "";
+ // check if the 10 high-order bytes are all zeros (first 5 words)
+ for (i = 0; i < 5; i++) {
+ if (parts[i] !== 0) { hasipv4 = false; break; }
+ }
+
+ if (hasipv4) {
+ // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
+ v4part = __inet_ntop4_raw(parts[6] | (parts[7] << 16));
+ // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
+ if (parts[5] === -1) {
+ str = "::ffff:";
+ str += v4part;
+ return str;
+ }
+ // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
+ if (parts[5] === 0) {
+ str = "::";
+ //special case IPv6 addresses
+ if(v4part === "0.0.0.0") v4part = ""; // any/unspecified address
+ if(v4part === "0.0.0.1") v4part = "1";// loopback address
+ str += v4part;
+ return str;
+ }
+ }
+
+ // Handle all other IPv6 addresses
+
+ // first run to find the longest contiguous zero words
+ for (word = 0; word < 8; word++) {
+ if (parts[word] === 0) {
+ if (word - lastzero > 1) {
+ len = 0;
+ }
+ lastzero = word;
+ len++;
+ }
+ if (len > longest) {
+ longest = len;
+ zstart = word - longest + 1;
+ }
+ }
+
+ for (word = 0; word < 8; word++) {
+ if (longest > 1) {
+ // compress contiguous zeros - to produce "::"
+ if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) {
+ if (word === zstart) {
+ str += ":";
+ if (zstart === 0) str += ":"; //leading zeros case
+ }
+ continue;
+ }
+ }
+ // converts 16-bit words from big-endian to little-endian before converting to hex string
+ str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
+ str += word < 7 ? ":" : "";
+ }
+ return str;
+ }function __read_sockaddr(sa, salen) {
+ // family / port offsets are common to both sockaddr_in and sockaddr_in6
+ var family = HEAP16[((sa)>>1)];
+ var port = _ntohs(HEAP16[(((sa)+(2))>>1)]);
+ var addr;
+
+ switch (family) {
+ case 2:
+ if (salen !== 16) {
+ return { errno: ERRNO_CODES.EINVAL };
+ }
+ addr = HEAP32[(((sa)+(4))>>2)];
+ addr = __inet_ntop4_raw(addr);
+ break;
+ case 10:
+ if (salen !== 28) {
+ return { errno: ERRNO_CODES.EINVAL };
+ }
+ addr = [
+ HEAP32[(((sa)+(8))>>2)],
+ HEAP32[(((sa)+(12))>>2)],
+ HEAP32[(((sa)+(16))>>2)],
+ HEAP32[(((sa)+(20))>>2)]
+ ];
+ addr = __inet_ntop6_raw(addr);
+ break;
+ default:
+ return { errno: ERRNO_CODES.EAFNOSUPPORT };
+ }
+
+ return { family: family, addr: addr, port: port };
+ }
+
+ function __write_sockaddr(sa, family, addr, port) {
+ switch (family) {
+ case 2:
+ addr = __inet_pton4_raw(addr);
+ HEAP16[((sa)>>1)]=family;
+ HEAP32[(((sa)+(4))>>2)]=addr;
+ HEAP16[(((sa)+(2))>>1)]=_htons(port);
+ break;
+ case 10:
+ addr = __inet_pton6_raw(addr);
+ HEAP32[((sa)>>2)]=family;
+ HEAP32[(((sa)+(8))>>2)]=addr[0];
+ HEAP32[(((sa)+(12))>>2)]=addr[1];
+ HEAP32[(((sa)+(16))>>2)]=addr[2];
+ HEAP32[(((sa)+(20))>>2)]=addr[3];
+ HEAP16[(((sa)+(2))>>1)]=_htons(port);
+ HEAP32[(((sa)+(4))>>2)]=0;
+ HEAP32[(((sa)+(24))>>2)]=0;
+ break;
+ default:
+ return { errno: ERRNO_CODES.EAFNOSUPPORT };
+ }
+ // kind of lame, but let's match _read_sockaddr's interface
+ return {};
+ }
+
+ var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
+ if (path[0] !== '/') {
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = FS.getStream(dirfd);
+ if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ dir = dirstream.path;
+ }
+ path = PATH.join2(dir, path);
+ }
+ return path;
+ },doStat:function (func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ // an error occurred while trying to look up the path; we should just report ENOTDIR
+ return -ERRNO_CODES.ENOTDIR;
+ }
+ throw e;
+ }
+ HEAP32[((buf)>>2)]=stat.dev;
+ HEAP32[(((buf)+(4))>>2)]=0;
+ HEAP32[(((buf)+(8))>>2)]=stat.ino;
+ HEAP32[(((buf)+(12))>>2)]=stat.mode;
+ HEAP32[(((buf)+(16))>>2)]=stat.nlink;
+ HEAP32[(((buf)+(20))>>2)]=stat.uid;
+ HEAP32[(((buf)+(24))>>2)]=stat.gid;
+ HEAP32[(((buf)+(28))>>2)]=stat.rdev;
+ HEAP32[(((buf)+(32))>>2)]=0;
+ HEAP32[(((buf)+(36))>>2)]=stat.size;
+ HEAP32[(((buf)+(40))>>2)]=4096;
+ HEAP32[(((buf)+(44))>>2)]=stat.blocks;
+ HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(52))>>2)]=0;
+ HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(60))>>2)]=0;
+ HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(68))>>2)]=0;
+ HEAP32[(((buf)+(72))>>2)]=stat.ino;
+ return 0;
+ },doMsync:function (addr, stream, len, flags) {
+ var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
+ FS.msync(stream, buffer, 0, len, flags);
+ },doMkdir:function (path, mode) {
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ },doMknod:function (path, mode, dev) {
+ // we don't want this in the JS API as it uses mknod to create all nodes.
+ switch (mode & 61440) {
+ case 32768:
+ case 8192:
+ case 24576:
+ case 4096:
+ case 49152:
+ break;
+ default: return -ERRNO_CODES.EINVAL;
+ }
+ FS.mknod(path, mode, dev);
+ return 0;
+ },doReadlink:function (path, buf, bufsize) {
+ if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
+ var ret = FS.readlink(path);
+
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = HEAP8[buf+len];
+ stringToUTF8(ret, buf, bufsize+1);
+ // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+ // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+ HEAP8[buf+len] = endChar;
+
+ return len;
+ },doAccess:function (path, amode) {
+ if (amode & ~7) {
+ // need a valid mode
+ return -ERRNO_CODES.EINVAL;
+ }
+ var node;
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ var perms = '';
+ if (amode & 4) perms += 'r';
+ if (amode & 2) perms += 'w';
+ if (amode & 1) perms += 'x';
+ if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+ return -ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },doDup:function (path, flags, suggestFD) {
+ var suggest = FS.getStream(suggestFD);
+ if (suggest) FS.close(suggest);
+ return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
+ },doReadv:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.read(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ }
+ return ret;
+ },doWritev:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.write(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ }
+ return ret;
+ },varargs:0,get:function (varargs) {
+ SYSCALLS.varargs += 4;
+ var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+ return ret;
+ },getStr:function () {
+ var ret = Pointer_stringify(SYSCALLS.get());
+ return ret;
+ },getStreamFromFD:function () {
+ var stream = FS.getStream(SYSCALLS.get());
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return stream;
+ },getSocketFromFD:function () {
+ var socket = SOCKFS.getSocket(SYSCALLS.get());
+ if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return socket;
+ },getSocketAddress:function (allowNull) {
+ var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ if (allowNull && addrp === 0) return null;
+ var info = __read_sockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ },get64:function () {
+ var low = SYSCALLS.get(), high = SYSCALLS.get();
+ if (low >= 0) assert(high === 0);
+ else assert(high === -1);
+ return low;
+ },getZero:function () {
+ assert(SYSCALLS.get() === 0);
+ }};function ___syscall102(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 102, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // socketcall
+ var call = SYSCALLS.get(), socketvararg = SYSCALLS.get();
+ // socketcalls pass the rest of the arguments in a struct
+ SYSCALLS.varargs = socketvararg;
+ switch (call) {
+ case 1: { // socket
+ var domain = SYSCALLS.get(), type = SYSCALLS.get(), protocol = SYSCALLS.get();
+ var sock = SOCKFS.createSocket(domain, type, protocol);
+ assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63
+ return sock.stream.fd;
+ }
+ case 2: { // bind
+ var sock = SYSCALLS.getSocketFromFD(), info = SYSCALLS.getSocketAddress();
+ sock.sock_ops.bind(sock, info.addr, info.port);
+ return 0;
+ }
+ case 3: { // connect
+ var sock = SYSCALLS.getSocketFromFD(), info = SYSCALLS.getSocketAddress();
+ sock.sock_ops.connect(sock, info.addr, info.port);
+ return 0;
+ }
+ case 4: { // listen
+ var sock = SYSCALLS.getSocketFromFD(), backlog = SYSCALLS.get();
+ sock.sock_ops.listen(sock, backlog);
+ return 0;
+ }
+ case 5: { // accept
+ var sock = SYSCALLS.getSocketFromFD(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ var newsock = sock.sock_ops.accept(sock);
+ if (addr) {
+ var res = __write_sockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport);
+ assert(!res.errno);
+ }
+ return newsock.stream.fd;
+ }
+ case 6: { // getsockname
+ var sock = SYSCALLS.getSocketFromFD(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname
+ var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport);
+ assert(!res.errno);
+ return 0;
+ }
+ case 7: { // getpeername
+ var sock = SYSCALLS.getSocketFromFD(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ if (!sock.daddr) {
+ return -ERRNO_CODES.ENOTCONN; // The socket is not connected.
+ }
+ var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport);
+ assert(!res.errno);
+ return 0;
+ }
+ case 11: { // sendto
+ var sock = SYSCALLS.getSocketFromFD(), message = SYSCALLS.get(), length = SYSCALLS.get(), flags = SYSCALLS.get(), dest = SYSCALLS.getSocketAddress(true);
+ if (!dest) {
+ // send, no address provided
+ return FS.write(sock.stream, HEAP8,message, length);
+ } else {
+ // sendto an address
+ return sock.sock_ops.sendmsg(sock, HEAP8,message, length, dest.addr, dest.port);
+ }
+ }
+ case 12: { // recvfrom
+ var sock = SYSCALLS.getSocketFromFD(), buf = SYSCALLS.get(), len = SYSCALLS.get(), flags = SYSCALLS.get(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ var msg = sock.sock_ops.recvmsg(sock, len);
+ if (!msg) return 0; // socket is closed
+ if (addr) {
+ var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port);
+ assert(!res.errno);
+ }
+ HEAPU8.set(msg.buffer, buf);
+ return msg.buffer.byteLength;
+ }
+ case 14: { // setsockopt
+ return -ERRNO_CODES.ENOPROTOOPT; // The option is unknown at the level indicated.
+ }
+ case 15: { // getsockopt
+ var sock = SYSCALLS.getSocketFromFD(), level = SYSCALLS.get(), optname = SYSCALLS.get(), optval = SYSCALLS.get(), optlen = SYSCALLS.get();
+ // Minimal getsockopt aimed at resolving https://github.com/kripken/emscripten/issues/2211
+ // so only supports SOL_SOCKET with SO_ERROR.
+ if (level === 1) {
+ if (optname === 4) {
+ HEAP32[((optval)>>2)]=sock.error;
+ HEAP32[((optlen)>>2)]=4;
+ sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field).
+ return 0;
+ }
+ }
+ return -ERRNO_CODES.ENOPROTOOPT; // The option is unknown at the level indicated.
+ }
+ case 16: { // sendmsg
+ var sock = SYSCALLS.getSocketFromFD(), message = SYSCALLS.get(), flags = SYSCALLS.get();
+ var iov = HEAP32[(((message)+(8))>>2)];
+ var num = HEAP32[(((message)+(12))>>2)];
+ // read the address and port to send to
+ var addr, port;
+ var name = HEAP32[((message)>>2)];
+ var namelen = HEAP32[(((message)+(4))>>2)];
+ if (name) {
+ var info = __read_sockaddr(name, namelen);
+ if (info.errno) return -info.errno;
+ port = info.port;
+ addr = DNS.lookup_addr(info.addr) || info.addr;
+ }
+ // concatenate scatter-gather arrays into one message buffer
+ var total = 0;
+ for (var i = 0; i < num; i++) {
+ total += HEAP32[(((iov)+((8 * i) + 4))>>2)];
+ }
+ var view = new Uint8Array(total);
+ var offset = 0;
+ for (var i = 0; i < num; i++) {
+ var iovbase = HEAP32[(((iov)+((8 * i) + 0))>>2)];
+ var iovlen = HEAP32[(((iov)+((8 * i) + 4))>>2)];
+ for (var j = 0; j < iovlen; j++) {
+ view[offset++] = HEAP8[(((iovbase)+(j))>>0)];
+ }
+ }
+ // write the buffer
+ return sock.sock_ops.sendmsg(sock, view, 0, total, addr, port);
+ }
+ case 17: { // recvmsg
+ var sock = SYSCALLS.getSocketFromFD(), message = SYSCALLS.get(), flags = SYSCALLS.get();
+ var iov = HEAP32[(((message)+(8))>>2)];
+ var num = HEAP32[(((message)+(12))>>2)];
+ // get the total amount of data we can read across all arrays
+ var total = 0;
+ for (var i = 0; i < num; i++) {
+ total += HEAP32[(((iov)+((8 * i) + 4))>>2)];
+ }
+ // try to read total data
+ var msg = sock.sock_ops.recvmsg(sock, total);
+ if (!msg) return 0; // socket is closed
+
+ // TODO honor flags:
+ // MSG_OOB
+ // Requests out-of-band data. The significance and semantics of out-of-band data are protocol-specific.
+ // MSG_PEEK
+ // Peeks at the incoming message.
+ // MSG_WAITALL
+ // Requests that the function block until the full amount of data requested can be returned. The function may return a smaller amount of data if a signal is caught, if the connection is terminated, if MSG_PEEK was specified, or if an error is pending for the socket.
+
+ // write the source address out
+ var name = HEAP32[((message)>>2)];
+ if (name) {
+ var res = __write_sockaddr(name, sock.family, DNS.lookup_name(msg.addr), msg.port);
+ assert(!res.errno);
+ }
+ // write the buffer out to the scatter-gather arrays
+ var bytesRead = 0;
+ var bytesRemaining = msg.buffer.byteLength;
+ for (var i = 0; bytesRemaining > 0 && i < num; i++) {
+ var iovbase = HEAP32[(((iov)+((8 * i) + 0))>>2)];
+ var iovlen = HEAP32[(((iov)+((8 * i) + 4))>>2)];
+ if (!iovlen) {
+ continue;
+ }
+ var length = Math.min(iovlen, bytesRemaining);
+ var buf = msg.buffer.subarray(bytesRead, bytesRead + length);
+ HEAPU8.set(buf, iovbase + bytesRead);
+ bytesRead += length;
+ bytesRemaining -= length;
+ }
+
+ // TODO set msghdr.msg_flags
+ // MSG_EOR
+ // End of record was received (if supported by the protocol).
+ // MSG_OOB
+ // Out-of-band data was received.
+ // MSG_TRUNC
+ // Normal data was truncated.
+ // MSG_CTRUNC
+
+ return bytesRead;
+ }
+ default: abort('unsupported socketcall syscall ' + call);
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall140(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 140, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // llseek
+ var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
+ // NOTE: offset_high is unused - Emscripten's off_t is 32-bit
+ var offset = offset_low;
+ FS.llseek(stream, offset, whence);
+ HEAP32[((result)>>2)]=stream.position;
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall142(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 142, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // newselect
+ // readfds are supported,
+ // writefds checks socket open status
+ // exceptfds not supported
+ // timeout is always 0 - fully async
+ var nfds = SYSCALLS.get(), readfds = SYSCALLS.get(), writefds = SYSCALLS.get(), exceptfds = SYSCALLS.get(), timeout = SYSCALLS.get();
+
+ assert(nfds <= 64, 'nfds must be less than or equal to 64'); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers
+ assert(!exceptfds, 'exceptfds not supported');
+
+ var total = 0;
+
+ var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0),
+ srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0);
+ var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0),
+ srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0);
+ var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0),
+ srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
+
+ var dstReadLow = 0,
+ dstReadHigh = 0;
+ var dstWriteLow = 0,
+ dstWriteHigh = 0;
+ var dstExceptLow = 0,
+ dstExceptHigh = 0;
+
+ var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) |
+ (writefds ? HEAP32[((writefds)>>2)] : 0) |
+ (exceptfds ? HEAP32[((exceptfds)>>2)] : 0);
+ var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) |
+ (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) |
+ (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0);
+
+ function check(fd, low, high, val) {
+ return (fd < 32 ? (low & val) : (high & val));
+ }
+
+ for (var fd = 0; fd < nfds; fd++) {
+ var mask = 1 << (fd % 32);
+ if (!(check(fd, allLow, allHigh, mask))) {
+ continue; // index isn't in the set
+ }
+
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+
+ var flags = SYSCALLS.DEFAULT_POLLMASK;
+
+ if (stream.stream_ops.poll) {
+ flags = stream.stream_ops.poll(stream);
+ }
+
+ if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) {
+ fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask);
+ total++;
+ }
+ if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) {
+ fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask);
+ total++;
+ }
+ if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) {
+ fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask);
+ total++;
+ }
+ }
+
+ if (readfds) {
+ HEAP32[((readfds)>>2)]=dstReadLow;
+ HEAP32[(((readfds)+(4))>>2)]=dstReadHigh;
+ }
+ if (writefds) {
+ HEAP32[((writefds)>>2)]=dstWriteLow;
+ HEAP32[(((writefds)+(4))>>2)]=dstWriteHigh;
+ }
+ if (exceptfds) {
+ HEAP32[((exceptfds)>>2)]=dstExceptLow;
+ HEAP32[(((exceptfds)+(4))>>2)]=dstExceptHigh;
+ }
+
+ return total;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall146(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 146, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // writev
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doWritev(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall221(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 221, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // fcntl64
+ var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
+ switch (cmd) {
+ case 0: {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -ERRNO_CODES.EINVAL;
+ }
+ var newStream;
+ newStream = FS.open(stream.path, stream.flags, 0, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 12:
+ case 12: {
+ var arg = SYSCALLS.get();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(((arg)+(offset))>>1)]=2;
+ return 0;
+ }
+ case 13:
+ case 14:
+ case 13:
+ case 14:
+ return 0; // Pretend that the locking is successful.
+ case 16:
+ case 8:
+ return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
+ case 9:
+ // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ default: {
+ return -ERRNO_CODES.EINVAL;
+ }
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall3(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 3, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // read
+ var stream = SYSCALLS.getStreamFromFD(), buf = SYSCALLS.get(), count = SYSCALLS.get();
+ return FS.read(stream, HEAP8,buf, count);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall4(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 4, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // write
+ var stream = SYSCALLS.getStreamFromFD(), buf = SYSCALLS.get(), count = SYSCALLS.get();
+ return FS.write(stream, HEAP8,buf, count);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+
+ var PIPEFS={BUCKET_BUFFER_SIZE:8192,mount:function (mount) {
+ // Do not pollute the real root directory or its child nodes with pipes
+ // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way
+ return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createPipe:function () {
+ var pipe = {
+ buckets: []
+ };
+
+ pipe.buckets.push({
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0
+ });
+
+ var rName = PIPEFS.nextname();
+ var wName = PIPEFS.nextname();
+ var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0);
+ var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0);
+
+ rNode.pipe = pipe;
+ wNode.pipe = pipe;
+
+ var readableStream = FS.createStream({
+ path: rName,
+ node: rNode,
+ flags: FS.modeStringToFlags('r'),
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops
+ });
+ rNode.stream = readableStream;
+
+ var writableStream = FS.createStream({
+ path: wName,
+ node: wNode,
+ flags: FS.modeStringToFlags('w'),
+ seekable: false,
+ stream_ops: PIPEFS.stream_ops
+ });
+ wNode.stream = writableStream;
+
+ return {
+ readable_fd: readableStream.fd,
+ writable_fd: writableStream.fd
+ };
+ },stream_ops:{poll:function (stream) {
+ var pipe = stream.node.pipe;
+
+ if ((stream.flags & 2097155) === 1) {
+ return (256 | 4);
+ } else {
+ if (pipe.buckets.length > 0) {
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ if (bucket.offset - bucket.roffset > 0) {
+ return (64 | 1);
+ }
+ }
+ }
+ }
+
+ return 0;
+ },ioctl:function (stream, request, varargs) {
+ return ERRNO_CODES.EINVAL;
+ },read:function (stream, buffer, offset, length, position /* ignored */) {
+ var pipe = stream.node.pipe;
+ var currentLength = 0;
+
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var bucket = pipe.buckets[i];
+ currentLength += bucket.offset - bucket.roffset;
+ }
+
+ assert(buffer instanceof ArrayBuffer || buffer instanceof SharedArrayBuffer || ArrayBuffer.isView(buffer));
+ var data = buffer.subarray(offset, offset + length);
+
+ if (length <= 0) {
+ return 0;
+ }
+ if (currentLength == 0) {
+ // Behave as if the read end is always non-blocking
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ var toRead = Math.min(currentLength, length);
+
+ var totalRead = toRead;
+ var toRemove = 0;
+
+ for (var i = 0; i < pipe.buckets.length; i++) {
+ var currBucket = pipe.buckets[i];
+ var bucketSize = currBucket.offset - currBucket.roffset;
+
+ if (toRead <= bucketSize) {
+ var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+ if (toRead < bucketSize) {
+ tmpSlice = tmpSlice.subarray(0, toRead);
+ currBucket.roffset += toRead;
+ } else {
+ toRemove++;
+ }
+ data.set(tmpSlice);
+ break;
+ } else {
+ var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset);
+ data.set(tmpSlice);
+ data = data.subarray(tmpSlice.byteLength);
+ toRead -= tmpSlice.byteLength;
+ toRemove++;
+ }
+ }
+
+ if (toRemove && toRemove == pipe.buckets.length) {
+ // Do not generate excessive garbage in use cases such as
+ // write several bytes, read everything, write several bytes, read everything...
+ toRemove--;
+ pipe.buckets[toRemove].offset = 0;
+ pipe.buckets[toRemove].roffset = 0;
+ }
+
+ pipe.buckets.splice(0, toRemove);
+
+ return totalRead;
+ },write:function (stream, buffer, offset, length, position /* ignored */) {
+ var pipe = stream.node.pipe;
+
+ assert(buffer instanceof ArrayBuffer || buffer instanceof SharedArrayBuffer || ArrayBuffer.isView(buffer));
+ var data = buffer.subarray(offset, offset + length);
+
+ var dataLen = data.byteLength;
+ if (dataLen <= 0) {
+ return 0;
+ }
+
+ var currBucket = null;
+
+ if (pipe.buckets.length == 0) {
+ currBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: 0,
+ roffset: 0
+ };
+ pipe.buckets.push(currBucket);
+ } else {
+ currBucket = pipe.buckets[pipe.buckets.length - 1];
+ }
+
+ assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE);
+
+ var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset;
+ if (freeBytesInCurrBuffer >= dataLen) {
+ currBucket.buffer.set(data, currBucket.offset);
+ currBucket.offset += dataLen;
+ return dataLen;
+ } else if (freeBytesInCurrBuffer > 0) {
+ currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset);
+ currBucket.offset += freeBytesInCurrBuffer;
+ data = data.subarray(freeBytesInCurrBuffer, data.byteLength);
+ }
+
+ var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0;
+ var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE;
+
+ for (var i = 0; i < numBuckets; i++) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: PIPEFS.BUCKET_BUFFER_SIZE,
+ roffset: 0
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE));
+ data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength);
+ }
+
+ if (remElements > 0) {
+ var newBucket = {
+ buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE),
+ offset: data.byteLength,
+ roffset: 0
+ };
+ pipe.buckets.push(newBucket);
+ newBucket.buffer.set(data);
+ }
+
+ return dataLen;
+ },close:function (stream) {
+ var pipe = stream.node.pipe;
+ pipe.buckets = null;
+ }},nextname:function () {
+ if (!PIPEFS.nextname.current) {
+ PIPEFS.nextname.current = 0;
+ }
+ return 'pipe[' + (PIPEFS.nextname.current++) + ']';
+ }};function ___syscall42(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 42, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // pipe
+ var fdPtr = SYSCALLS.get();
+
+ if (fdPtr == 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EFAULT);
+ }
+
+ var res = PIPEFS.createPipe();
+
+ HEAP32[((fdPtr)>>2)]=res.readable_fd;
+ HEAP32[(((fdPtr)+(4))>>2)]=res.writable_fd;
+
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall5(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 5, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // open
+ var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
+ var stream = FS.open(pathname, flags, mode);
+ return stream.fd;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall54(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 54, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // ioctl
+ var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
+ switch (op) {
+ case 21509:
+ case 21505: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ case 21510:
+ case 21511:
+ case 21512:
+ case 21506:
+ case 21507:
+ case 21508: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ var argp = SYSCALLS.get();
+ HEAP32[((argp)>>2)]=0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return -ERRNO_CODES.EINVAL; // not supported
+ }
+ case 21531: {
+ var argp = SYSCALLS.get();
+ return FS.ioctl(stream, op, argp);
+ }
+ case 21523: {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ case 21524: {
+ // TODO: technically, this ioctl call should change the window size.
+ // but, since emscripten doesn't have any concept of a terminal window
+ // yet, we'll just silently throw it away as we do TIOCGWINSZ
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ default: abort('bad ioctl syscall ' + op);
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall6(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 6, varargs) }
+ SYSCALLS.varargs = varargs;
+ try {
+ // close
+ var stream = SYSCALLS.getStreamFromFD();
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___unlock() {}
+
+
+
+
+ var char_0=48;
+
+ var char_9=57;function makeLegalFunctionName(name) {
+ if (undefined === name) {
+ return '_unknown';
+ }
+ name = name.replace(/[^a-zA-Z0-9_]/g, '$');
+ var f = name.charCodeAt(0);
+ if (f >= char_0 && f <= char_9) {
+ return '_' + name;
+ } else {
+ return name;
+ }
+ }function createNamedFunction(name, body) {
+ name = makeLegalFunctionName(name);
+ return function() {
+ "use strict";
+ return body.apply(this, arguments);
+ };
+ }
+
+
+ var emval_free_list=[];
+
+ var emval_handle_array=[{},{value:undefined},{value:null},{value:true},{value:false}];
+
+
+ function count_emval_handles() {
+ var count = 0;
+ for (var i = 5; i < emval_handle_array.length; ++i) {
+ if (emval_handle_array[i] !== undefined) {
+ ++count;
+ }
+ }
+ return count;
+ }
+
+ function get_first_emval() {
+ for (var i = 5; i < emval_handle_array.length; ++i) {
+ if (emval_handle_array[i] !== undefined) {
+ return emval_handle_array[i];
+ }
+ }
+ return null;
+ }function init_emval() {
+ Module['count_emval_handles'] = count_emval_handles;
+ Module['get_first_emval'] = get_first_emval;
+ }function __emval_register(value) {
+
+ switch(value){
+ case undefined :{ return 1; }
+ case null :{ return 2; }
+ case true :{ return 3; }
+ case false :{ return 4; }
+ default:{
+ var handle = emval_free_list.length ?
+ emval_free_list.pop() :
+ emval_handle_array.length;
+
+ emval_handle_array[handle] = {refcount: 1, value: value};
+ return handle;
+ }
+ }
+ }
+
+
+ function extendError(baseErrorType, errorName) {
+ var errorClass = createNamedFunction(errorName, function(message) {
+ this.name = errorName;
+ this.message = message;
+
+ var stack = (new Error(message)).stack;
+ if (stack !== undefined) {
+ this.stack = this.toString() + '\n' +
+ stack.replace(/^Error(:[^\n]*)?\n/, '');
+ }
+ });
+ errorClass.prototype = Object.create(baseErrorType.prototype);
+ errorClass.prototype.constructor = errorClass;
+ errorClass.prototype.toString = function() {
+ if (this.message === undefined) {
+ return this.name;
+ } else {
+ return this.name + ': ' + this.message;
+ }
+ };
+
+ return errorClass;
+ }var PureVirtualError=undefined;
+
+
+
+ function embind_init_charCodes() {
+ var codes = new Array(256);
+ for (var i = 0; i < 256; ++i) {
+ codes[i] = String.fromCharCode(i);
+ }
+ embind_charCodes = codes;
+ }var embind_charCodes=undefined;function readLatin1String(ptr) {
+ var ret = "";
+ var c = ptr;
+ while (HEAPU8[c]) {
+ ret += embind_charCodes[HEAPU8[c++]];
+ }
+ return ret;
+ }
+
+
+
+
+ function getInheritedInstanceCount() {
+ return Object.keys(registeredInstances).length;
+ }
+
+ function getLiveInheritedInstances() {
+ var rv = [];
+ for (var k in registeredInstances) {
+ if (registeredInstances.hasOwnProperty(k)) {
+ rv.push(registeredInstances[k]);
+ }
+ }
+ return rv;
+ }
+
+
+ var deletionQueue=[];function flushPendingDeletes() {
+ while (deletionQueue.length) {
+ var obj = deletionQueue.pop();
+ obj.$$.deleteScheduled = false;
+ obj['delete']();
+ }
+ }
+
+
+ var delayFunction=undefined;function setDelayFunction(fn) {
+ delayFunction = fn;
+ if (deletionQueue.length && delayFunction) {
+ delayFunction(flushPendingDeletes);
+ }
+ }function init_embind() {
+ Module['getInheritedInstanceCount'] = getInheritedInstanceCount;
+ Module['getLiveInheritedInstances'] = getLiveInheritedInstances;
+ Module['flushPendingDeletes'] = flushPendingDeletes;
+ Module['setDelayFunction'] = setDelayFunction;
+ }var registeredInstances={};
+
+
+
+ var BindingError=undefined;function throwBindingError(message) {
+ throw new BindingError(message);
+ }function getBasestPointer(class_, ptr) {
+ if (ptr === undefined) {
+ throwBindingError('ptr should not be undefined');
+ }
+ while (class_.baseClass) {
+ ptr = class_.upcast(ptr);
+ class_ = class_.baseClass;
+ }
+ return ptr;
+ }function registerInheritedInstance(class_, ptr, instance) {
+ ptr = getBasestPointer(class_, ptr);
+ if (registeredInstances.hasOwnProperty(ptr)) {
+ throwBindingError('Tried to register registered instance: ' + ptr);
+ } else {
+ registeredInstances[ptr] = instance;
+ }
+ }
+
+ function requireHandle(handle) {
+ if (!handle) {
+ throwBindingError('Cannot use deleted val. handle = ' + handle);
+ }
+ return emval_handle_array[handle].value;
+ }
+
+
+ var registeredTypes={};
+
+ function getTypeName(type) {
+ var ptr = ___getTypeName(type);
+ var rv = readLatin1String(ptr);
+ _free(ptr);
+ return rv;
+ }function requireRegisteredType(rawType, humanName) {
+ var impl = registeredTypes[rawType];
+ if (undefined === impl) {
+ throwBindingError(humanName + " has unknown type " + getTypeName(rawType));
+ }
+ return impl;
+ }
+
+ function unregisterInheritedInstance(class_, ptr) {
+ ptr = getBasestPointer(class_, ptr);
+ if (registeredInstances.hasOwnProperty(ptr)) {
+ delete registeredInstances[ptr];
+ } else {
+ throwBindingError('Tried to unregister unregistered instance: ' + ptr);
+ }
+ }function __embind_create_inheriting_constructor(constructorName, wrapperType, properties) {
+ constructorName = readLatin1String(constructorName);
+ wrapperType = requireRegisteredType(wrapperType, 'wrapper');
+ properties = requireHandle(properties);
+
+ var arraySlice = [].slice;
+
+ var registeredClass = wrapperType.registeredClass;
+ var wrapperPrototype = registeredClass.instancePrototype;
+ var baseClass = registeredClass.baseClass;
+ var baseClassPrototype = baseClass.instancePrototype;
+ var baseConstructor = registeredClass.baseClass.constructor;
+ var ctor = createNamedFunction(constructorName, function() {
+ registeredClass.baseClass.pureVirtualFunctions.forEach(function(name) {
+ if (this[name] === baseClassPrototype[name]) {
+ throw new PureVirtualError('Pure virtual function ' + name + ' must be implemented in JavaScript');
+ }
+ }.bind(this));
+
+ Object.defineProperty(this, '__parent', {
+ value: wrapperPrototype
+ });
+ this["__construct"].apply(this, arraySlice.call(arguments));
+ });
+
+ // It's a little nasty that we're modifying the wrapper prototype here.
+
+ wrapperPrototype["__construct"] = function __construct() {
+ if (this === wrapperPrototype) {
+ throwBindingError("Pass correct 'this' to __construct");
+ }
+
+ var inner = baseConstructor["implement"].apply(
+ undefined,
+ [this].concat(arraySlice.call(arguments)));
+ var $$ = inner.$$;
+ inner["notifyOnDestruction"]();
+ $$.preservePointerOnDelete = true;
+ Object.defineProperties(this, { $$: {
+ value: $$
+ }});
+ registerInheritedInstance(registeredClass, $$.ptr, this);
+ };
+
+ wrapperPrototype["__destruct"] = function __destruct() {
+ if (this === wrapperPrototype) {
+ throwBindingError("Pass correct 'this' to __destruct");
+ }
+
+ unregisterInheritedInstance(registeredClass, this.$$.ptr);
+ };
+
+ ctor.prototype = Object.create(wrapperPrototype);
+ for (var p in properties) {
+ ctor.prototype[p] = properties[p];
+ }
+ return __emval_register(ctor);
+ }
+
+
+ var structRegistrations={};
+
+ function runDestructors(destructors) {
+ while (destructors.length) {
+ var ptr = destructors.pop();
+ var del = destructors.pop();
+ del(ptr);
+ }
+ }
+
+ function simpleReadValueFromPointer(pointer) {
+ return this['fromWireType'](HEAPU32[pointer >> 2]);
+ }
+
+
+ var awaitingDependencies={};
+
+ var typeDependencies={};
+
+
+ var InternalError=undefined;function throwInternalError(message) {
+ throw new InternalError(message);
+ }function whenDependentTypesAreResolved(myTypes, dependentTypes, getTypeConverters) {
+ myTypes.forEach(function(type) {
+ typeDependencies[type] = dependentTypes;
+ });
+
+ function onComplete(typeConverters) {
+ var myTypeConverters = getTypeConverters(typeConverters);
+ if (myTypeConverters.length !== myTypes.length) {
+ throwInternalError('Mismatched type converter count');
+ }
+ for (var i = 0; i < myTypes.length; ++i) {
+ registerType(myTypes[i], myTypeConverters[i]);
+ }
+ }
+
+ var typeConverters = new Array(dependentTypes.length);
+ var unregisteredTypes = [];
+ var registered = 0;
+ dependentTypes.forEach(function(dt, i) {
+ if (registeredTypes.hasOwnProperty(dt)) {
+ typeConverters[i] = registeredTypes[dt];
+ } else {
+ unregisteredTypes.push(dt);
+ if (!awaitingDependencies.hasOwnProperty(dt)) {
+ awaitingDependencies[dt] = [];
+ }
+ awaitingDependencies[dt].push(function() {
+ typeConverters[i] = registeredTypes[dt];
+ ++registered;
+ if (registered === unregisteredTypes.length) {
+ onComplete(typeConverters);
+ }
+ });
+ }
+ });
+ if (0 === unregisteredTypes.length) {
+ onComplete(typeConverters);
+ }
+ }function __embind_finalize_value_object(structType) {
+ var reg = structRegistrations[structType];
+ delete structRegistrations[structType];
+
+ var rawConstructor = reg.rawConstructor;
+ var rawDestructor = reg.rawDestructor;
+ var fieldRecords = reg.fields;
+ var fieldTypes = fieldRecords.map(function(field) { return field.getterReturnType; }).
+ concat(fieldRecords.map(function(field) { return field.setterArgumentType; }));
+ whenDependentTypesAreResolved([structType], fieldTypes, function(fieldTypes) {
+ var fields = {};
+ fieldRecords.forEach(function(field, i) {
+ var fieldName = field.fieldName;
+ var getterReturnType = fieldTypes[i];
+ var getter = field.getter;
+ var getterContext = field.getterContext;
+ var setterArgumentType = fieldTypes[i + fieldRecords.length];
+ var setter = field.setter;
+ var setterContext = field.setterContext;
+ fields[fieldName] = {
+ read: function(ptr) {
+ return getterReturnType['fromWireType'](
+ getter(getterContext, ptr));
+ },
+ write: function(ptr, o) {
+ var destructors = [];
+ setter(setterContext, ptr, setterArgumentType['toWireType'](destructors, o));
+ runDestructors(destructors);
+ }
+ };
+ });
+
+ return [{
+ name: reg.name,
+ 'fromWireType': function(ptr) {
+ var rv = {};
+ for (var i in fields) {
+ rv[i] = fields[i].read(ptr);
+ }
+ rawDestructor(ptr);
+ return rv;
+ },
+ 'toWireType': function(destructors, o) {
+ // todo: Here we have an opportunity for -O3 level "unsafe" optimizations:
+ // assume all fields are present without checking.
+ for (var fieldName in fields) {
+ if (!(fieldName in o)) {
+ throw new TypeError('Missing field');
+ }
+ }
+ var ptr = rawConstructor();
+ for (fieldName in fields) {
+ fields[fieldName].write(ptr, o[fieldName]);
+ }
+ if (destructors !== null) {
+ destructors.push(rawDestructor, ptr);
+ }
+ return ptr;
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': simpleReadValueFromPointer,
+ destructorFunction: rawDestructor,
+ }];
+ });
+ }
+
+
+ function getShiftFromSize(size) {
+ switch (size) {
+ case 1: return 0;
+ case 2: return 1;
+ case 4: return 2;
+ case 8: return 3;
+ default:
+ throw new TypeError('Unknown type size: ' + size);
+ }
+ }
+
+ function registerType(rawType, registeredInstance, options) {
+ options = options || {};
+
+ if (!('argPackAdvance' in registeredInstance)) {
+ throw new TypeError('registerType registeredInstance requires argPackAdvance');
+ }
+
+ var name = registeredInstance.name;
+ if (!rawType) {
+ throwBindingError('type "' + name + '" must have a positive integer typeid pointer');
+ }
+ if (registeredTypes.hasOwnProperty(rawType)) {
+ if (options.ignoreDuplicateRegistrations) {
+ return;
+ } else {
+ throwBindingError("Cannot register type '" + name + "' twice");
+ }
+ }
+
+ registeredTypes[rawType] = registeredInstance;
+ delete typeDependencies[rawType];
+
+ if (awaitingDependencies.hasOwnProperty(rawType)) {
+ var callbacks = awaitingDependencies[rawType];
+ delete awaitingDependencies[rawType];
+ callbacks.forEach(function(cb) {
+ cb();
+ });
+ }
+ }function __embind_register_bool(rawType, name, size, trueValue, falseValue) {
+ var shift = getShiftFromSize(size);
+
+ name = readLatin1String(name);
+ registerType(rawType, {
+ name: name,
+ 'fromWireType': function(wt) {
+ // ambiguous emscripten ABI: sometimes return values are
+ // true or false, and sometimes integers (0 or 1)
+ return !!wt;
+ },
+ 'toWireType': function(destructors, o) {
+ return o ? trueValue : falseValue;
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': function(pointer) {
+ // TODO: if heap is fixed (like in asm.js) this could be executed outside
+ var heap;
+ if (size === 1) {
+ heap = HEAP8;
+ } else if (size === 2) {
+ heap = HEAP16;
+ } else if (size === 4) {
+ heap = HEAP32;
+ } else {
+ throw new TypeError("Unknown boolean type size: " + name);
+ }
+ return this['fromWireType'](heap[pointer >> shift]);
+ },
+ destructorFunction: null, // This type does not need a destructor
+ });
+ }
+
+
+
+
+ function ClassHandle_isAliasOf(other) {
+ if (!(this instanceof ClassHandle)) {
+ return false;
+ }
+ if (!(other instanceof ClassHandle)) {
+ return false;
+ }
+
+ var leftClass = this.$$.ptrType.registeredClass;
+ var left = this.$$.ptr;
+ var rightClass = other.$$.ptrType.registeredClass;
+ var right = other.$$.ptr;
+
+ while (leftClass.baseClass) {
+ left = leftClass.upcast(left);
+ leftClass = leftClass.baseClass;
+ }
+
+ while (rightClass.baseClass) {
+ right = rightClass.upcast(right);
+ rightClass = rightClass.baseClass;
+ }
+
+ return leftClass === rightClass && left === right;
+ }
+
+
+ function shallowCopyInternalPointer(o) {
+ return {
+ count: o.count,
+ deleteScheduled: o.deleteScheduled,
+ preservePointerOnDelete: o.preservePointerOnDelete,
+ ptr: o.ptr,
+ ptrType: o.ptrType,
+ smartPtr: o.smartPtr,
+ smartPtrType: o.smartPtrType,
+ };
+ }
+
+ function throwInstanceAlreadyDeleted(obj) {
+ function getInstanceTypeName(handle) {
+ return handle.$$.ptrType.registeredClass.name;
+ }
+ throwBindingError(getInstanceTypeName(obj) + ' instance already deleted');
+ }function ClassHandle_clone() {
+ if (!this.$$.ptr) {
+ throwInstanceAlreadyDeleted(this);
+ }
+
+ if (this.$$.preservePointerOnDelete) {
+ this.$$.count.value += 1;
+ return this;
+ } else {
+ var clone = Object.create(Object.getPrototypeOf(this), {
+ $$: {
+ value: shallowCopyInternalPointer(this.$$),
+ }
+ });
+
+ clone.$$.count.value += 1;
+ clone.$$.deleteScheduled = false;
+ return clone;
+ }
+ }
+
+
+ function runDestructor(handle) {
+ var $$ = handle.$$;
+ if ($$.smartPtr) {
+ $$.smartPtrType.rawDestructor($$.smartPtr);
+ } else {
+ $$.ptrType.registeredClass.rawDestructor($$.ptr);
+ }
+ }function ClassHandle_delete() {
+ if (!this.$$.ptr) {
+ throwInstanceAlreadyDeleted(this);
+ }
+
+ if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) {
+ throwBindingError('Object already scheduled for deletion');
+ }
+
+ this.$$.count.value -= 1;
+ var toDelete = 0 === this.$$.count.value;
+ if (toDelete) {
+ runDestructor(this);
+ }
+ if (!this.$$.preservePointerOnDelete) {
+ this.$$.smartPtr = undefined;
+ this.$$.ptr = undefined;
+ }
+ }
+
+ function ClassHandle_isDeleted() {
+ return !this.$$.ptr;
+ }
+
+ function ClassHandle_deleteLater() {
+ if (!this.$$.ptr) {
+ throwInstanceAlreadyDeleted(this);
+ }
+ if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) {
+ throwBindingError('Object already scheduled for deletion');
+ }
+ deletionQueue.push(this);
+ if (deletionQueue.length === 1 && delayFunction) {
+ delayFunction(flushPendingDeletes);
+ }
+ this.$$.deleteScheduled = true;
+ return this;
+ }function init_ClassHandle() {
+ ClassHandle.prototype['isAliasOf'] = ClassHandle_isAliasOf;
+ ClassHandle.prototype['clone'] = ClassHandle_clone;
+ ClassHandle.prototype['delete'] = ClassHandle_delete;
+ ClassHandle.prototype['isDeleted'] = ClassHandle_isDeleted;
+ ClassHandle.prototype['deleteLater'] = ClassHandle_deleteLater;
+ }function ClassHandle() {
+ }
+
+ var registeredPointers={};
+
+
+ function ensureOverloadTable(proto, methodName, humanName) {
+ if (undefined === proto[methodName].overloadTable) {
+ var prevFunc = proto[methodName];
+ // Inject an overload resolver function that routes to the appropriate overload based on the number of arguments.
+ proto[methodName] = function() {
+ // TODO This check can be removed in -O3 level "unsafe" optimizations.
+ if (!proto[methodName].overloadTable.hasOwnProperty(arguments.length)) {
+ throwBindingError("Function '" + humanName + "' called with an invalid number of arguments (" + arguments.length + ") - expects one of (" + proto[methodName].overloadTable + ")!");
+ }
+ return proto[methodName].overloadTable[arguments.length].apply(this, arguments);
+ };
+ // Move the previous function into the overload table.
+ proto[methodName].overloadTable = [];
+ proto[methodName].overloadTable[prevFunc.argCount] = prevFunc;
+ }
+ }function exposePublicSymbol(name, value, numArguments) {
+ if (Module.hasOwnProperty(name)) {
+ if (undefined === numArguments || (undefined !== Module[name].overloadTable && undefined !== Module[name].overloadTable[numArguments])) {
+ throwBindingError("Cannot register public name '" + name + "' twice");
+ }
+
+ // We are exposing a function with the same name as an existing function. Create an overload table and a function selector
+ // that routes between the two.
+ ensureOverloadTable(Module, name, name);
+ if (Module.hasOwnProperty(numArguments)) {
+ throwBindingError("Cannot register multiple overloads of a function with the same number of arguments (" + numArguments + ")!");
+ }
+ // Add the new function into the overload table.
+ Module[name].overloadTable[numArguments] = value;
+ }
+ else {
+ Module[name] = value;
+ if (undefined !== numArguments) {
+ Module[name].numArguments = numArguments;
+ }
+ }
+ }
+
+ function RegisteredClass(
+ name,
+ constructor,
+ instancePrototype,
+ rawDestructor,
+ baseClass,
+ getActualType,
+ upcast,
+ downcast
+ ) {
+ this.name = name;
+ this.constructor = constructor;
+ this.instancePrototype = instancePrototype;
+ this.rawDestructor = rawDestructor;
+ this.baseClass = baseClass;
+ this.getActualType = getActualType;
+ this.upcast = upcast;
+ this.downcast = downcast;
+ this.pureVirtualFunctions = [];
+ }
+
+
+
+ function upcastPointer(ptr, ptrClass, desiredClass) {
+ while (ptrClass !== desiredClass) {
+ if (!ptrClass.upcast) {
+ throwBindingError("Expected null or instance of " + desiredClass.name + ", got an instance of " + ptrClass.name);
+ }
+ ptr = ptrClass.upcast(ptr);
+ ptrClass = ptrClass.baseClass;
+ }
+ return ptr;
+ }function constNoSmartPtrRawPointerToWireType(destructors, handle) {
+ if (handle === null) {
+ if (this.isReference) {
+ throwBindingError('null is not a valid ' + this.name);
+ }
+ return 0;
+ }
+
+ if (!handle.$$) {
+ throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name);
+ }
+ if (!handle.$$.ptr) {
+ throwBindingError('Cannot pass deleted object as a pointer of type ' + this.name);
+ }
+ var handleClass = handle.$$.ptrType.registeredClass;
+ var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
+ return ptr;
+ }
+
+ function genericPointerToWireType(destructors, handle) {
+ var ptr;
+ if (handle === null) {
+ if (this.isReference) {
+ throwBindingError('null is not a valid ' + this.name);
+ }
+
+ if (this.isSmartPointer) {
+ ptr = this.rawConstructor();
+ if (destructors !== null) {
+ destructors.push(this.rawDestructor, ptr);
+ }
+ return ptr;
+ } else {
+ return 0;
+ }
+ }
+
+ if (!handle.$$) {
+ throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name);
+ }
+ if (!handle.$$.ptr) {
+ throwBindingError('Cannot pass deleted object as a pointer of type ' + this.name);
+ }
+ if (!this.isConst && handle.$$.ptrType.isConst) {
+ throwBindingError('Cannot convert argument of type ' + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + ' to parameter type ' + this.name);
+ }
+ var handleClass = handle.$$.ptrType.registeredClass;
+ ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
+
+ if (this.isSmartPointer) {
+ // TODO: this is not strictly true
+ // We could support BY_EMVAL conversions from raw pointers to smart pointers
+ // because the smart pointer can hold a reference to the handle
+ if (undefined === handle.$$.smartPtr) {
+ throwBindingError('Passing raw pointer to smart pointer is illegal');
+ }
+
+ switch (this.sharingPolicy) {
+ case 0: // NONE
+ // no upcasting
+ if (handle.$$.smartPtrType === this) {
+ ptr = handle.$$.smartPtr;
+ } else {
+ throwBindingError('Cannot convert argument of type ' + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + ' to parameter type ' + this.name);
+ }
+ break;
+
+ case 1: // INTRUSIVE
+ ptr = handle.$$.smartPtr;
+ break;
+
+ case 2: // BY_EMVAL
+ if (handle.$$.smartPtrType === this) {
+ ptr = handle.$$.smartPtr;
+ } else {
+ var clonedHandle = handle['clone']();
+ ptr = this.rawShare(
+ ptr,
+ __emval_register(function() {
+ clonedHandle['delete']();
+ })
+ );
+ if (destructors !== null) {
+ destructors.push(this.rawDestructor, ptr);
+ }
+ }
+ break;
+
+ default:
+ throwBindingError('Unsupporting sharing policy');
+ }
+ }
+ return ptr;
+ }
+
+ function nonConstNoSmartPtrRawPointerToWireType(destructors, handle) {
+ if (handle === null) {
+ if (this.isReference) {
+ throwBindingError('null is not a valid ' + this.name);
+ }
+ return 0;
+ }
+
+ if (!handle.$$) {
+ throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name);
+ }
+ if (!handle.$$.ptr) {
+ throwBindingError('Cannot pass deleted object as a pointer of type ' + this.name);
+ }
+ if (handle.$$.ptrType.isConst) {
+ throwBindingError('Cannot convert argument of type ' + handle.$$.ptrType.name + ' to parameter type ' + this.name);
+ }
+ var handleClass = handle.$$.ptrType.registeredClass;
+ var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
+ return ptr;
+ }
+
+
+ function RegisteredPointer_getPointee(ptr) {
+ if (this.rawGetPointee) {
+ ptr = this.rawGetPointee(ptr);
+ }
+ return ptr;
+ }
+
+ function RegisteredPointer_destructor(ptr) {
+ if (this.rawDestructor) {
+ this.rawDestructor(ptr);
+ }
+ }
+
+ function RegisteredPointer_deleteObject(handle) {
+ if (handle !== null) {
+ handle['delete']();
+ }
+ }
+
+
+ function downcastPointer(ptr, ptrClass, desiredClass) {
+ if (ptrClass === desiredClass) {
+ return ptr;
+ }
+ if (undefined === desiredClass.baseClass) {
+ return null; // no conversion
+ }
+
+ var rv = downcastPointer(ptr, ptrClass, desiredClass.baseClass);
+ if (rv === null) {
+ return null;
+ }
+ return desiredClass.downcast(rv);
+ }
+
+ function getInheritedInstance(class_, ptr) {
+ ptr = getBasestPointer(class_, ptr);
+ return registeredInstances[ptr];
+ }
+
+ function makeClassHandle(prototype, record) {
+ if (!record.ptrType || !record.ptr) {
+ throwInternalError('makeClassHandle requires ptr and ptrType');
+ }
+ var hasSmartPtrType = !!record.smartPtrType;
+ var hasSmartPtr = !!record.smartPtr;
+ if (hasSmartPtrType !== hasSmartPtr) {
+ throwInternalError('Both smartPtrType and smartPtr must be specified');
+ }
+ record.count = { value: 1 };
+ return Object.create(prototype, {
+ $$: {
+ value: record,
+ },
+ });
+ }function RegisteredPointer_fromWireType(ptr) {
+ // ptr is a raw pointer (or a raw smartpointer)
+
+ // rawPointer is a maybe-null raw pointer
+ var rawPointer = this.getPointee(ptr);
+ if (!rawPointer) {
+ this.destructor(ptr);
+ return null;
+ }
+
+ var registeredInstance = getInheritedInstance(this.registeredClass, rawPointer);
+ if (undefined !== registeredInstance) {
+ // JS object has been neutered, time to repopulate it
+ if (0 === registeredInstance.$$.count.value) {
+ registeredInstance.$$.ptr = rawPointer;
+ registeredInstance.$$.smartPtr = ptr;
+ return registeredInstance['clone']();
+ } else {
+ // else, just increment reference count on existing object
+ // it already has a reference to the smart pointer
+ var rv = registeredInstance['clone']();
+ this.destructor(ptr);
+ return rv;
+ }
+ }
+
+ function makeDefaultHandle() {
+ if (this.isSmartPointer) {
+ return makeClassHandle(this.registeredClass.instancePrototype, {
+ ptrType: this.pointeeType,
+ ptr: rawPointer,
+ smartPtrType: this,
+ smartPtr: ptr,
+ });
+ } else {
+ return makeClassHandle(this.registeredClass.instancePrototype, {
+ ptrType: this,
+ ptr: ptr,
+ });
+ }
+ }
+
+ var actualType = this.registeredClass.getActualType(rawPointer);
+ var registeredPointerRecord = registeredPointers[actualType];
+ if (!registeredPointerRecord) {
+ return makeDefaultHandle.call(this);
+ }
+
+ var toType;
+ if (this.isConst) {
+ toType = registeredPointerRecord.constPointerType;
+ } else {
+ toType = registeredPointerRecord.pointerType;
+ }
+ var dp = downcastPointer(
+ rawPointer,
+ this.registeredClass,
+ toType.registeredClass);
+ if (dp === null) {
+ return makeDefaultHandle.call(this);
+ }
+ if (this.isSmartPointer) {
+ return makeClassHandle(toType.registeredClass.instancePrototype, {
+ ptrType: toType,
+ ptr: dp,
+ smartPtrType: this,
+ smartPtr: ptr,
+ });
+ } else {
+ return makeClassHandle(toType.registeredClass.instancePrototype, {
+ ptrType: toType,
+ ptr: dp,
+ });
+ }
+ }function init_RegisteredPointer() {
+ RegisteredPointer.prototype.getPointee = RegisteredPointer_getPointee;
+ RegisteredPointer.prototype.destructor = RegisteredPointer_destructor;
+ RegisteredPointer.prototype['argPackAdvance'] = 8;
+ RegisteredPointer.prototype['readValueFromPointer'] = simpleReadValueFromPointer;
+ RegisteredPointer.prototype['deleteObject'] = RegisteredPointer_deleteObject;
+ RegisteredPointer.prototype['fromWireType'] = RegisteredPointer_fromWireType;
+ }function RegisteredPointer(
+ name,
+ registeredClass,
+ isReference,
+ isConst,
+
+ // smart pointer properties
+ isSmartPointer,
+ pointeeType,
+ sharingPolicy,
+ rawGetPointee,
+ rawConstructor,
+ rawShare,
+ rawDestructor
+ ) {
+ this.name = name;
+ this.registeredClass = registeredClass;
+ this.isReference = isReference;
+ this.isConst = isConst;
+
+ // smart pointer properties
+ this.isSmartPointer = isSmartPointer;
+ this.pointeeType = pointeeType;
+ this.sharingPolicy = sharingPolicy;
+ this.rawGetPointee = rawGetPointee;
+ this.rawConstructor = rawConstructor;
+ this.rawShare = rawShare;
+ this.rawDestructor = rawDestructor;
+
+ if (!isSmartPointer && registeredClass.baseClass === undefined) {
+ if (isConst) {
+ this['toWireType'] = constNoSmartPtrRawPointerToWireType;
+ this.destructorFunction = null;
+ } else {
+ this['toWireType'] = nonConstNoSmartPtrRawPointerToWireType;
+ this.destructorFunction = null;
+ }
+ } else {
+ this['toWireType'] = genericPointerToWireType;
+ // Here we must leave this.destructorFunction undefined, since whether genericPointerToWireType returns
+ // a pointer that needs to be freed up is runtime-dependent, and cannot be evaluated at registration time.
+ // TODO: Create an alternative mechanism that allows removing the use of var destructors = []; array in
+ // craftInvokerFunction altogether.
+ }
+ }
+
+ function replacePublicSymbol(name, value, numArguments) {
+ if (!Module.hasOwnProperty(name)) {
+ throwInternalError('Replacing nonexistant public symbol');
+ }
+ // If there's an overload table for this symbol, replace the symbol in the overload table instead.
+ if (undefined !== Module[name].overloadTable && undefined !== numArguments) {
+ Module[name].overloadTable[numArguments] = value;
+ }
+ else {
+ Module[name] = value;
+ Module[name].argCount = numArguments;
+ }
+ }
+
+ function embind__requireFunction(signature, rawFunction) {
+ signature = readLatin1String(signature);
+
+ function makeDynCaller(dynCall) {
+ return function() {
+ var args = new Array(arguments.length + 1);
+ args[0] = rawFunction;
+ for (var i = 0; i < arguments.length; i++) {
+ args[i + 1] = arguments[i];
+ }
+ return dynCall.apply(null, args);
+ };
+ }
+
+ var fp;
+ if (Module['FUNCTION_TABLE_' + signature] !== undefined) {
+ fp = Module['FUNCTION_TABLE_' + signature][rawFunction];
+ } else if (typeof FUNCTION_TABLE !== "undefined") {
+ fp = FUNCTION_TABLE[rawFunction];
+ } else {
+ // asm.js does not give direct access to the function tables,
+ // and thus we must go through the dynCall interface which allows
+ // calling into a signature's function table by pointer value.
+ //
+ // https://github.com/dherman/asm.js/issues/83
+ //
+ // This has three main penalties:
+ // - dynCall is another function call in the path from JavaScript to C++.
+ // - JITs may not predict through the function table indirection at runtime.
+ var dc = Module["asm"]['dynCall_' + signature];
+ if (dc === undefined) {
+ // We will always enter this branch if the signature
+ // contains 'f' and PRECISE_F32 is not enabled.
+ //
+ // Try again, replacing 'f' with 'd'.
+ dc = Module["asm"]['dynCall_' + signature.replace(/f/g, 'd')];
+ if (dc === undefined) {
+ throwBindingError("No dynCall invoker for signature: " + signature);
+ }
+ }
+ fp = makeDynCaller(dc);
+ }
+
+ if (typeof fp !== "function") {
+ throwBindingError("unknown function pointer with signature " + signature + ": " + rawFunction);
+ }
+ return fp;
+ }
+
+
+ var UnboundTypeError=undefined;function throwUnboundTypeError(message, types) {
+ var unboundTypes = [];
+ var seen = {};
+ function visit(type) {
+ if (seen[type]) {
+ return;
+ }
+ if (registeredTypes[type]) {
+ return;
+ }
+ if (typeDependencies[type]) {
+ typeDependencies[type].forEach(visit);
+ return;
+ }
+ unboundTypes.push(type);
+ seen[type] = true;
+ }
+ types.forEach(visit);
+
+ throw new UnboundTypeError(message + ': ' + unboundTypes.map(getTypeName).join([', ']));
+ }function __embind_register_class(
+ rawType,
+ rawPointerType,
+ rawConstPointerType,
+ baseClassRawType,
+ getActualTypeSignature,
+ getActualType,
+ upcastSignature,
+ upcast,
+ downcastSignature,
+ downcast,
+ name,
+ destructorSignature,
+ rawDestructor
+ ) {
+ name = readLatin1String(name);
+ getActualType = embind__requireFunction(getActualTypeSignature, getActualType);
+ if (upcast) {
+ upcast = embind__requireFunction(upcastSignature, upcast);
+ }
+ if (downcast) {
+ downcast = embind__requireFunction(downcastSignature, downcast);
+ }
+ rawDestructor = embind__requireFunction(destructorSignature, rawDestructor);
+ var legalFunctionName = makeLegalFunctionName(name);
+
+ exposePublicSymbol(legalFunctionName, function() {
+ // this code cannot run if baseClassRawType is zero
+ throwUnboundTypeError('Cannot construct ' + name + ' due to unbound types', [baseClassRawType]);
+ });
+
+ whenDependentTypesAreResolved(
+ [rawType, rawPointerType, rawConstPointerType],
+ baseClassRawType ? [baseClassRawType] : [],
+ function(base) {
+ base = base[0];
+
+ var baseClass;
+ var basePrototype;
+ if (baseClassRawType) {
+ baseClass = base.registeredClass;
+ basePrototype = baseClass.instancePrototype;
+ } else {
+ basePrototype = ClassHandle.prototype;
+ }
+
+ var constructor = createNamedFunction(legalFunctionName, function() {
+ if (Object.getPrototypeOf(this) !== instancePrototype) {
+ throw new BindingError("Use 'new' to construct " + name);
+ }
+ if (undefined === registeredClass.constructor_body) {
+ throw new BindingError(name + " has no accessible constructor");
+ }
+ var body = registeredClass.constructor_body[arguments.length];
+ if (undefined === body) {
+ throw new BindingError("Tried to invoke ctor of " + name + " with invalid number of parameters (" + arguments.length + ") - expected (" + Object.keys(registeredClass.constructor_body).toString() + ") parameters instead!");
+ }
+ return body.apply(this, arguments);
+ });
+
+ var instancePrototype = Object.create(basePrototype, {
+ constructor: { value: constructor },
+ });
+
+ constructor.prototype = instancePrototype;
+
+ var registeredClass = new RegisteredClass(
+ name,
+ constructor,
+ instancePrototype,
+ rawDestructor,
+ baseClass,
+ getActualType,
+ upcast,
+ downcast);
+
+ var referenceConverter = new RegisteredPointer(
+ name,
+ registeredClass,
+ true,
+ false,
+ false);
+
+ var pointerConverter = new RegisteredPointer(
+ name + '*',
+ registeredClass,
+ false,
+ false,
+ false);
+
+ var constPointerConverter = new RegisteredPointer(
+ name + ' const*',
+ registeredClass,
+ false,
+ true,
+ false);
+
+ registeredPointers[rawType] = {
+ pointerType: pointerConverter,
+ constPointerType: constPointerConverter
+ };
+
+ replacePublicSymbol(legalFunctionName, constructor);
+
+ return [referenceConverter, pointerConverter, constPointerConverter];
+ }
+ );
+ }
+
+
+
+ function new_(constructor, argumentList) {
+ if (!(constructor instanceof Function)) {
+ throw new TypeError('new_ called with constructor type ' + typeof(constructor) + " which is not a function");
+ }
+ if (constructor === Function) {
+ throw new Error('new_ cannot create a new Function with NO_DYNAMIC_EXECUTION.');
+ }
+
+ /*
+ * Previously, the following line was just:
+
+ function dummy() {};
+
+ * Unfortunately, Chrome was preserving 'dummy' as the object's name, even though at creation, the 'dummy' has the
+ * correct constructor name. Thus, objects created with IMVU.new would show up in the debugger as 'dummy', which
+ * isn't very helpful. Using IMVU.createNamedFunction addresses the issue. Doublely-unfortunately, there's no way
+ * to write a test for this behavior. -NRD 2013.02.22
+ */
+ var dummy = createNamedFunction(constructor.name || 'unknownFunctionName', function(){});
+ dummy.prototype = constructor.prototype;
+ var obj = new dummy;
+
+ var r = constructor.apply(obj, argumentList);
+ return (r instanceof Object) ? r : obj;
+ }function craftInvokerFunction(humanName, argTypes, classType, cppInvokerFunc, cppTargetFunc) {
+ // humanName: a human-readable string name for the function to be generated.
+ // argTypes: An array that contains the embind type objects for all types in the function signature.
+ // argTypes[0] is the type object for the function return value.
+ // argTypes[1] is the type object for function this object/class type, or null if not crafting an invoker for a class method.
+ // argTypes[2...] are the actual function parameters.
+ // classType: The embind type object for the class to be bound, or null if this is not a method of a class.
+ // cppInvokerFunc: JS Function object to the C++-side function that interops into C++ code.
+ // cppTargetFunc: Function pointer (an integer to FUNCTION_TABLE) to the target C++ function the cppInvokerFunc will end up calling.
+ var argCount = argTypes.length;
+
+ if (argCount < 2) {
+ throwBindingError("argTypes array size mismatch! Must at least get return value and 'this' types!");
+ }
+
+ var isClassMethodFunc = (argTypes[1] !== null && classType !== null);
+
+ // Free functions with signature "void function()" do not need an invoker that marshalls between wire types.
+ // TODO: This omits argument count check - enable only at -O3 or similar.
+ // if (ENABLE_UNSAFE_OPTS && argCount == 2 && argTypes[0].name == "void" && !isClassMethodFunc) {
+ // return FUNCTION_TABLE[fn];
+ // }
+
+
+ // Determine if we need to use a dynamic stack to store the destructors for the function parameters.
+ // TODO: Remove this completely once all function invokers are being dynamically generated.
+ var needsDestructorStack = false;
+
+ for(var i = 1; i < argTypes.length; ++i) { // Skip return value at index 0 - it's not deleted here.
+ if (argTypes[i] !== null && argTypes[i].destructorFunction === undefined) { // The type does not define a destructor function - must use dynamic stack
+ needsDestructorStack = true;
+ break;
+ }
+ }
+
+ var returns = (argTypes[0].name !== "void");
+
+ var argsWired = new Array(argCount - 2);
+ return function() {
+ if (arguments.length !== argCount - 2) {
+ throwBindingError('function ' + humanName + ' called with ' + arguments.length + ' arguments, expected ' + (argCount - 2) + ' args!');
+ }
+ var destructors = needsDestructorStack ? [] : null;
+ var thisWired;
+ if (isClassMethodFunc) {
+ thisWired = argTypes[1].toWireType(destructors, this);
+ }
+ for (var i = 0; i < argCount - 2; ++i) {
+ argsWired[i] = argTypes[i + 2].toWireType(destructors, arguments[i]);
+ }
+
+ var invokerFuncArgs = isClassMethodFunc ?
+ [cppTargetFunc, thisWired] : [cppTargetFunc];
+
+ var rv = cppInvokerFunc.apply(null, invokerFuncArgs.concat(argsWired));
+
+ if (needsDestructorStack) {
+ runDestructors(destructors);
+ } else {
+ for (var i = isClassMethodFunc ? 1 : 2; i < argTypes.length; i++) {
+ var param = i === 1 ? thisWired : argsWired[i - 2];
+ if (argTypes[i].destructorFunction !== null) {
+ argTypes[i].destructorFunction(param);
+ }
+ }
+ }
+
+
+ if (returns) {
+ return argTypes[0].fromWireType(rv);
+ }
+ };
+ }
+
+ function heap32VectorToArray(count, firstElement) {
+ var array = [];
+ for (var i = 0; i < count; i++) {
+ array.push(HEAP32[(firstElement >> 2) + i]);
+ }
+ return array;
+ }function __embind_register_class_class_function(
+ rawClassType,
+ methodName,
+ argCount,
+ rawArgTypesAddr,
+ invokerSignature,
+ rawInvoker,
+ fn
+ ) {
+ var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
+ methodName = readLatin1String(methodName);
+ rawInvoker = embind__requireFunction(invokerSignature, rawInvoker);
+ whenDependentTypesAreResolved([], [rawClassType], function(classType) {
+ classType = classType[0];
+ var humanName = classType.name + '.' + methodName;
+
+ function unboundTypesHandler() {
+ throwUnboundTypeError('Cannot call ' + humanName + ' due to unbound types', rawArgTypes);
+ }
+
+ var proto = classType.registeredClass.constructor;
+ if (undefined === proto[methodName]) {
+ // This is the first function to be registered with this name.
+ unboundTypesHandler.argCount = argCount-1;
+ proto[methodName] = unboundTypesHandler;
+ } else {
+ // There was an existing function with the same name registered. Set up a function overload routing table.
+ ensureOverloadTable(proto, methodName, humanName);
+ proto[methodName].overloadTable[argCount-1] = unboundTypesHandler;
+ }
+
+ whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) {
+ // Replace the initial unbound-types-handler stub with the proper function. If multiple overloads are registered,
+ // the function handlers go into an overload table.
+ var invokerArgsArray = [argTypes[0] /* return value */, null /* no class 'this'*/].concat(argTypes.slice(1) /* actual params */);
+ var func = craftInvokerFunction(humanName, invokerArgsArray, null /* no class 'this'*/, rawInvoker, fn);
+ if (undefined === proto[methodName].overloadTable) {
+ func.argCount = argCount-1;
+ proto[methodName] = func;
+ } else {
+ proto[methodName].overloadTable[argCount-1] = func;
+ }
+ return [];
+ });
+ return [];
+ });
+ }
+
+ function __embind_register_class_constructor(
+ rawClassType,
+ argCount,
+ rawArgTypesAddr,
+ invokerSignature,
+ invoker,
+ rawConstructor
+ ) {
+ var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
+ invoker = embind__requireFunction(invokerSignature, invoker);
+
+ whenDependentTypesAreResolved([], [rawClassType], function(classType) {
+ classType = classType[0];
+ var humanName = 'constructor ' + classType.name;
+
+ if (undefined === classType.registeredClass.constructor_body) {
+ classType.registeredClass.constructor_body = [];
+ }
+ if (undefined !== classType.registeredClass.constructor_body[argCount - 1]) {
+ throw new BindingError("Cannot register multiple constructors with identical number of parameters (" + (argCount-1) + ") for class '" + classType.name + "'! Overload resolution is currently only performed using the parameter count, not actual type info!");
+ }
+ classType.registeredClass.constructor_body[argCount - 1] = function unboundTypeHandler() {
+ throwUnboundTypeError('Cannot construct ' + classType.name + ' due to unbound types', rawArgTypes);
+ };
+
+ whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) {
+ classType.registeredClass.constructor_body[argCount - 1] = function constructor_body() {
+ if (arguments.length !== argCount - 1) {
+ throwBindingError(humanName + ' called with ' + arguments.length + ' arguments, expected ' + (argCount-1));
+ }
+ var destructors = [];
+ var args = new Array(argCount);
+ args[0] = rawConstructor;
+ for (var i = 1; i < argCount; ++i) {
+ args[i] = argTypes[i]['toWireType'](destructors, arguments[i - 1]);
+ }
+
+ var ptr = invoker.apply(null, args);
+ runDestructors(destructors);
+
+ return argTypes[0]['fromWireType'](ptr);
+ };
+ return [];
+ });
+ return [];
+ });
+ }
+
+ function __embind_register_class_function(
+ rawClassType,
+ methodName,
+ argCount,
+ rawArgTypesAddr, // [ReturnType, ThisType, Args...]
+ invokerSignature,
+ rawInvoker,
+ context,
+ isPureVirtual
+ ) {
+ var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
+ methodName = readLatin1String(methodName);
+ rawInvoker = embind__requireFunction(invokerSignature, rawInvoker);
+
+ whenDependentTypesAreResolved([], [rawClassType], function(classType) {
+ classType = classType[0];
+ var humanName = classType.name + '.' + methodName;
+
+ if (isPureVirtual) {
+ classType.registeredClass.pureVirtualFunctions.push(methodName);
+ }
+
+ function unboundTypesHandler() {
+ throwUnboundTypeError('Cannot call ' + humanName + ' due to unbound types', rawArgTypes);
+ }
+
+ var proto = classType.registeredClass.instancePrototype;
+ var method = proto[methodName];
+ if (undefined === method || (undefined === method.overloadTable && method.className !== classType.name && method.argCount === argCount - 2)) {
+ // This is the first overload to be registered, OR we are replacing a function in the base class with a function in the derived class.
+ unboundTypesHandler.argCount = argCount - 2;
+ unboundTypesHandler.className = classType.name;
+ proto[methodName] = unboundTypesHandler;
+ } else {
+ // There was an existing function with the same name registered. Set up a function overload routing table.
+ ensureOverloadTable(proto, methodName, humanName);
+ proto[methodName].overloadTable[argCount - 2] = unboundTypesHandler;
+ }
+
+ whenDependentTypesAreResolved([], rawArgTypes, function(argTypes) {
+
+ var memberFunction = craftInvokerFunction(humanName, argTypes, classType, rawInvoker, context);
+
+ // Replace the initial unbound-handler-stub function with the appropriate member function, now that all types
+ // are resolved. If multiple overloads are registered for this function, the function goes into an overload table.
+ if (undefined === proto[methodName].overloadTable) {
+ // Set argCount in case an overload is registered later
+ memberFunction.argCount = argCount - 2;
+ proto[methodName] = memberFunction;
+ } else {
+ proto[methodName].overloadTable[argCount - 2] = memberFunction;
+ }
+
+ return [];
+ });
+ return [];
+ });
+ }
+
+
+ function __emval_decref(handle) {
+ if (handle > 4 && 0 === --emval_handle_array[handle].refcount) {
+ emval_handle_array[handle] = undefined;
+ emval_free_list.push(handle);
+ }
+ }function __embind_register_emval(rawType, name) {
+ name = readLatin1String(name);
+ registerType(rawType, {
+ name: name,
+ 'fromWireType': function(handle) {
+ var rv = emval_handle_array[handle].value;
+ __emval_decref(handle);
+ return rv;
+ },
+ 'toWireType': function(destructors, value) {
+ return __emval_register(value);
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': simpleReadValueFromPointer,
+ destructorFunction: null, // This type does not need a destructor
+
+ // TODO: do we need a deleteObject here? write a test where
+ // emval is passed into JS via an interface
+ });
+ }
+
+
+ function _embind_repr(v) {
+ if (v === null) {
+ return 'null';
+ }
+ var t = typeof v;
+ if (t === 'object' || t === 'array' || t === 'function') {
+ return v.toString();
+ } else {
+ return '' + v;
+ }
+ }
+
+ function floatReadValueFromPointer(name, shift) {
+ switch (shift) {
+ case 2: return function(pointer) {
+ return this['fromWireType'](HEAPF32[pointer >> 2]);
+ };
+ case 3: return function(pointer) {
+ return this['fromWireType'](HEAPF64[pointer >> 3]);
+ };
+ default:
+ throw new TypeError("Unknown float type: " + name);
+ }
+ }function __embind_register_float(rawType, name, size) {
+ var shift = getShiftFromSize(size);
+ name = readLatin1String(name);
+ registerType(rawType, {
+ name: name,
+ 'fromWireType': function(value) {
+ return value;
+ },
+ 'toWireType': function(destructors, value) {
+ // todo: Here we have an opportunity for -O3 level "unsafe" optimizations: we could
+ // avoid the following if() and assume value is of proper type.
+ if (typeof value !== "number" && typeof value !== "boolean") {
+ throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name);
+ }
+ return value;
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': floatReadValueFromPointer(name, shift),
+ destructorFunction: null, // This type does not need a destructor
+ });
+ }
+
+
+ function integerReadValueFromPointer(name, shift, signed) {
+ // integers are quite common, so generate very specialized functions
+ switch (shift) {
+ case 0: return signed ?
+ function readS8FromPointer(pointer) { return HEAP8[pointer]; } :
+ function readU8FromPointer(pointer) { return HEAPU8[pointer]; };
+ case 1: return signed ?
+ function readS16FromPointer(pointer) { return HEAP16[pointer >> 1]; } :
+ function readU16FromPointer(pointer) { return HEAPU16[pointer >> 1]; };
+ case 2: return signed ?
+ function readS32FromPointer(pointer) { return HEAP32[pointer >> 2]; } :
+ function readU32FromPointer(pointer) { return HEAPU32[pointer >> 2]; };
+ default:
+ throw new TypeError("Unknown integer type: " + name);
+ }
+ }function __embind_register_integer(primitiveType, name, size, minRange, maxRange) {
+ name = readLatin1String(name);
+ if (maxRange === -1) { // LLVM doesn't have signed and unsigned 32-bit types, so u32 literals come out as 'i32 -1'. Always treat those as max u32.
+ maxRange = 4294967295;
+ }
+
+ var shift = getShiftFromSize(size);
+
+ var fromWireType = function(value) {
+ return value;
+ };
+
+ if (minRange === 0) {
+ var bitshift = 32 - 8*size;
+ fromWireType = function(value) {
+ return (value << bitshift) >>> bitshift;
+ };
+ }
+
+ var isUnsignedType = (name.indexOf('unsigned') != -1);
+
+ registerType(primitiveType, {
+ name: name,
+ 'fromWireType': fromWireType,
+ 'toWireType': function(destructors, value) {
+ // todo: Here we have an opportunity for -O3 level "unsafe" optimizations: we could
+ // avoid the following two if()s and assume value is of proper type.
+ if (typeof value !== "number" && typeof value !== "boolean") {
+ throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name);
+ }
+ if (value < minRange || value > maxRange) {
+ throw new TypeError('Passing a number "' + _embind_repr(value) + '" from JS side to C/C++ side to an argument of type "' + name + '", which is outside the valid range [' + minRange + ', ' + maxRange + ']!');
+ }
+ return isUnsignedType ? (value >>> 0) : (value | 0);
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': integerReadValueFromPointer(name, shift, minRange !== 0),
+ destructorFunction: null, // This type does not need a destructor
+ });
+ }
+
+ function __embind_register_memory_view(rawType, dataTypeIndex, name) {
+ var typeMapping = [
+ Int8Array,
+ Uint8Array,
+ Int16Array,
+ Uint16Array,
+ Int32Array,
+ Uint32Array,
+ Float32Array,
+ Float64Array,
+ ];
+
+ var TA = typeMapping[dataTypeIndex];
+
+ function decodeMemoryView(handle) {
+ handle = handle >> 2;
+ var heap = HEAPU32;
+ var size = heap[handle]; // in elements
+ var data = heap[handle + 1]; // byte offset into emscripten heap
+ return new TA(heap['buffer'], data, size);
+ }
+
+ name = readLatin1String(name);
+ registerType(rawType, {
+ name: name,
+ 'fromWireType': decodeMemoryView,
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': decodeMemoryView,
+ }, {
+ ignoreDuplicateRegistrations: true,
+ });
+ }
+
+ function __embind_register_std_string(rawType, name) {
+ name = readLatin1String(name);
+ var stdStringIsUTF8
+ //process only std::string bindings with UTF8 support, in contrast to e.g. std::basic_string
+ = (name === "std::string");
+
+ registerType(rawType, {
+ name: name,
+ 'fromWireType': function(value) {
+ var length = HEAPU32[value >> 2];
+
+ var str;
+ if(stdStringIsUTF8) {
+ //ensure null termination at one-past-end byte if not present yet
+ var endChar = HEAPU8[value + 4 + length];
+ var endCharSwap = 0;
+ if(endChar != 0)
+ {
+ endCharSwap = endChar;
+ HEAPU8[value + 4 + length] = 0;
+ }
+
+ var decodeStartPtr = value + 4;
+ //looping here to support possible embedded '0' bytes
+ for (var i = 0; i <= length; ++i) {
+ var currentBytePtr = value + 4 + i;
+ if(HEAPU8[currentBytePtr] == 0)
+ {
+ var stringSegment = UTF8ToString(decodeStartPtr);
+ if(str === undefined)
+ str = stringSegment;
+ else
+ {
+ str += String.fromCharCode(0);
+ str += stringSegment;
+ }
+ decodeStartPtr = currentBytePtr + 1;
+ }
+ }
+
+ if(endCharSwap != 0)
+ HEAPU8[value + 4 + length] = endCharSwap;
+ } else {
+ var a = new Array(length);
+ for (var i = 0; i < length; ++i) {
+ a[i] = String.fromCharCode(HEAPU8[value + 4 + i]);
+ }
+ str = a.join('');
+ }
+
+ _free(value);
+
+ return str;
+ },
+ 'toWireType': function(destructors, value) {
+ if (value instanceof ArrayBuffer) {
+ value = new Uint8Array(value);
+ }
+
+ var getLength;
+ var valueIsOfTypeString = (typeof value === 'string');
+
+ if (!(valueIsOfTypeString || value instanceof Uint8Array || value instanceof Uint8ClampedArray || value instanceof Int8Array)) {
+ throwBindingError('Cannot pass non-string to std::string');
+ }
+ if (stdStringIsUTF8 && valueIsOfTypeString) {
+ getLength = function() {return lengthBytesUTF8(value);};
+ } else {
+ getLength = function() {return value.length;};
+ }
+
+ // assumes 4-byte alignment
+ var length = getLength();
+ var ptr = _malloc(4 + length + 1);
+ HEAPU32[ptr >> 2] = length;
+
+ if (stdStringIsUTF8 && valueIsOfTypeString) {
+ stringToUTF8(value, ptr + 4, length + 1);
+ } else {
+ if(valueIsOfTypeString) {
+ for (var i = 0; i < length; ++i) {
+ var charCode = value.charCodeAt(i);
+ if (charCode > 255) {
+ _free(ptr);
+ throwBindingError('String has UTF-16 code units that do not fit in 8 bits');
+ }
+ HEAPU8[ptr + 4 + i] = charCode;
+ }
+ } else {
+ for (var i = 0; i < length; ++i) {
+ HEAPU8[ptr + 4 + i] = value[i];
+ }
+ }
+ }
+
+ if (destructors !== null) {
+ destructors.push(_free, ptr);
+ }
+ return ptr;
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': simpleReadValueFromPointer,
+ destructorFunction: function(ptr) { _free(ptr); },
+ });
+ }
+
+ function __embind_register_std_wstring(rawType, charSize, name) {
+ // nb. do not cache HEAPU16 and HEAPU32, they may be destroyed by enlargeMemory().
+ name = readLatin1String(name);
+ var getHeap, shift;
+ if (charSize === 2) {
+ getHeap = function() { return HEAPU16; };
+ shift = 1;
+ } else if (charSize === 4) {
+ getHeap = function() { return HEAPU32; };
+ shift = 2;
+ }
+ registerType(rawType, {
+ name: name,
+ 'fromWireType': function(value) {
+ var HEAP = getHeap();
+ var length = HEAPU32[value >> 2];
+ var a = new Array(length);
+ var start = (value + 4) >> shift;
+ for (var i = 0; i < length; ++i) {
+ a[i] = String.fromCharCode(HEAP[start + i]);
+ }
+ _free(value);
+ return a.join('');
+ },
+ 'toWireType': function(destructors, value) {
+ // assumes 4-byte alignment
+ var HEAP = getHeap();
+ var length = value.length;
+ var ptr = _malloc(4 + length * charSize);
+ HEAPU32[ptr >> 2] = length;
+ var start = (ptr + 4) >> shift;
+ for (var i = 0; i < length; ++i) {
+ HEAP[start + i] = value.charCodeAt(i);
+ }
+ if (destructors !== null) {
+ destructors.push(_free, ptr);
+ }
+ return ptr;
+ },
+ 'argPackAdvance': 8,
+ 'readValueFromPointer': simpleReadValueFromPointer,
+ destructorFunction: function(ptr) { _free(ptr); },
+ });
+ }
+
+ function __embind_register_value_object(
+ rawType,
+ name,
+ constructorSignature,
+ rawConstructor,
+ destructorSignature,
+ rawDestructor
+ ) {
+ structRegistrations[rawType] = {
+ name: readLatin1String(name),
+ rawConstructor: embind__requireFunction(constructorSignature, rawConstructor),
+ rawDestructor: embind__requireFunction(destructorSignature, rawDestructor),
+ fields: [],
+ };
+ }
+
+ function __embind_register_value_object_field(
+ structType,
+ fieldName,
+ getterReturnType,
+ getterSignature,
+ getter,
+ getterContext,
+ setterArgumentType,
+ setterSignature,
+ setter,
+ setterContext
+ ) {
+ structRegistrations[structType].fields.push({
+ fieldName: readLatin1String(fieldName),
+ getterReturnType: getterReturnType,
+ getter: embind__requireFunction(getterSignature, getter),
+ getterContext: getterContext,
+ setterArgumentType: setterArgumentType,
+ setter: embind__requireFunction(setterSignature, setter),
+ setterContext: setterContext,
+ });
+ }
+
+ function __embind_register_void(rawType, name) {
+ name = readLatin1String(name);
+ registerType(rawType, {
+ isVoid: true, // void return values can be optimized out sometimes
+ name: name,
+ 'argPackAdvance': 0,
+ 'fromWireType': function() {
+ return undefined;
+ },
+ 'toWireType': function(destructors, o) {
+ // TODO: assert if anything else is given?
+ return undefined;
+ },
+ });
+ }
+
+
+ function __emval_allocateDestructors(destructorsRef) {
+ var destructors = [];
+ HEAP32[destructorsRef >> 2] = __emval_register(destructors);
+ return destructors;
+ }
+
+
+ var emval_symbols={};function getStringOrSymbol(address) {
+ var symbol = emval_symbols[address];
+ if (symbol === undefined) {
+ return readLatin1String(address);
+ } else {
+ return symbol;
+ }
+ }
+
+ var emval_methodCallers=[];function __emval_call_method(caller, handle, methodName, destructorsRef, args) {
+ caller = emval_methodCallers[caller];
+ handle = requireHandle(handle);
+ methodName = getStringOrSymbol(methodName);
+ return caller(handle, methodName, __emval_allocateDestructors(destructorsRef), args);
+ }
+
+ function __emval_call_void_method(caller, handle, methodName, args) {
+ caller = emval_methodCallers[caller];
+ handle = requireHandle(handle);
+ methodName = getStringOrSymbol(methodName);
+ caller(handle, methodName, null, args);
+ }
+
+
+
+ function __emval_addMethodCaller(caller) {
+ var id = emval_methodCallers.length;
+ emval_methodCallers.push(caller);
+ return id;
+ }
+
+ function __emval_lookupTypes(argCount, argTypes, argWireTypes) {
+ var a = new Array(argCount);
+ for (var i = 0; i < argCount; ++i) {
+ a[i] = requireRegisteredType(
+ HEAP32[(argTypes >> 2) + i],
+ "parameter " + i);
+ }
+ return a;
+ }function __emval_get_method_caller(argCount, argTypes) {
+ var types = __emval_lookupTypes(argCount, argTypes);
+
+ var retType = types[0];
+ var argN = new Array(argCount - 1);
+ var invokerFunction = function(handle, name, destructors, args) {
+ var offset = 0;
+ for (var i = 0; i < argCount - 1; ++i) {
+ argN[i] = types[i + 1].readValueFromPointer(args + offset);
+ offset += types[i + 1].argPackAdvance;
+ }
+ var rv = handle[name].apply(handle, argN);
+ for (var i = 0; i < argCount - 1; ++i) {
+ if (types[i + 1].deleteObject) {
+ types[i + 1].deleteObject(argN[i]);
+ }
+ }
+ if (!retType.isVoid) {
+ return retType.toWireType(destructors, rv);
+ }
+ };
+ return __emval_addMethodCaller(invokerFunction);
+ }
+
+ function __emval_incref(handle) {
+ if (handle > 4) {
+ emval_handle_array[handle].refcount += 1;
+ }
+ }
+
+ function __emval_run_destructors(handle) {
+ var destructors = emval_handle_array[handle].value;
+ runDestructors(destructors);
+ __emval_decref(handle);
+ }
+
+ function __emval_take_value(type, argv) {
+ type = requireRegisteredType(type, '_emval_take_value');
+ var v = type['readValueFromPointer'](argv);
+ return __emval_register(v);
+ }
+
+ function _abort() {
+ Module['abort']();
+ }
+
+
+ var _emscripten_asm_const_int=true;
+
+
+ function _emscripten_conditional_set_current_thread_status_js(expectedStatus, newStatus) {
+ }
+
+
+ var __main_thread_futex_wait_address; if (ENVIRONMENT_IS_PTHREAD) __main_thread_futex_wait_address = PthreadWorkerInit.__main_thread_futex_wait_address; else PthreadWorkerInit.__main_thread_futex_wait_address = __main_thread_futex_wait_address = allocate(1, "i32*", ALLOC_STATIC);function _emscripten_futex_wait(addr, val, timeout) {
+ if (addr <= 0 || addr > HEAP8.length || addr&3 != 0) return -22;
+ // dump('futex_wait addr:' + addr + ' by thread: ' + _pthread_self() + (ENVIRONMENT_IS_PTHREAD?'(pthread)':'') + '\n');
+ if (ENVIRONMENT_IS_WORKER) {
+ var ret = Atomics.wait(HEAP32, addr >> 2, val, timeout);
+ // dump('futex_wait done by thread: ' + _pthread_self() + (ENVIRONMENT_IS_PTHREAD?'(pthread)':'') + '\n');
+ if (ret === 'timed-out') return -110;
+ if (ret === 'not-equal') return -11;
+ if (ret === 'ok') return 0;
+ throw 'Atomics.wait returned an unexpected value ' + ret;
+ } else {
+ // Atomics.wait is not available in the main browser thread, so simulate it via busy spinning.
+ var loadedVal = Atomics.load(HEAP32, addr >> 2);
+ if (val != loadedVal) return -11;
+
+ var tNow = performance.now();
+ var tEnd = tNow + timeout;
+
+
+ // Register globally which address the main thread is simulating to be waiting on. When zero, main thread is not waiting on anything,
+ // and on nonzero, the contents of address pointed by __main_thread_futex_wait_address tell which address the main thread is simulating its wait on.
+ Atomics.store(HEAP32, __main_thread_futex_wait_address >> 2, addr);
+ var ourWaitAddress = addr; // We may recursively re-enter this function while processing queued calls, in which case we'll do a spurious wakeup of the older wait operation.
+ while (addr == ourWaitAddress) {
+ tNow = performance.now();
+ if (tNow > tEnd) {
+ return -110;
+ }
+ _emscripten_main_thread_process_queued_calls(); // We are performing a blocking loop here, so must pump any pthreads if they want to perform operations that are proxied.
+ addr = Atomics.load(HEAP32, __main_thread_futex_wait_address >> 2); // Look for a worker thread waking us up.
+ }
+ return 0;
+ }
+ }
+
+ function _emscripten_futex_wake(addr, count) {
+ if (addr <= 0 || addr > HEAP8.length || addr&3 != 0 || count < 0) return -22;
+ if (count == 0) return 0;
+ // dump('futex_wake addr:' + addr + ' by thread: ' + _pthread_self() + (ENVIRONMENT_IS_PTHREAD?'(pthread)':'') + '\n');
+
+ // See if main thread is waiting on this address? If so, wake it up by resetting its wake location to zero.
+ // Note that this is not a fair procedure, since we always wake main thread first before any workers, so
+ // this scheme does not adhere to real queue-based waiting.
+ var mainThreadWaitAddress = Atomics.load(HEAP32, __main_thread_futex_wait_address >> 2);
+ var mainThreadWoken = 0;
+ if (mainThreadWaitAddress == addr) {
+ var loadedAddr = Atomics.compareExchange(HEAP32, __main_thread_futex_wait_address >> 2, mainThreadWaitAddress, 0);
+ if (loadedAddr == mainThreadWaitAddress) {
+ --count;
+ mainThreadWoken = 1;
+ if (count <= 0) return 1;
+ }
+ }
+
+ // Wake any workers waiting on this address.
+ var ret = Atomics.wake(HEAP32, addr >> 2, count);
+ if (ret >= 0) return ret + mainThreadWoken;
+ throw 'Atomics.wake returned an unexpected value ' + ret;
+ }
+
+ function _emscripten_futex_wake_or_requeue(addr, count, addr2, cmpValue) {
+ if (addr <= 0 || addr2 <= 0 || addr >= HEAP8.length || addr2 >= HEAP8.length || count < 0
+ || addr&3 != 0 || addr2&3 != 0) {
+ return -22;
+ }
+
+ // See if main thread is waiting on this address? If so, wake it up by resetting its wake location to zero,
+ // or move it to wait on addr2. Note that this is not a fair procedure, since we always wake main thread first before
+ // any workers, so this scheme does not adhere to real queue-based waiting.
+ var mainThreadWaitAddress = Atomics.load(HEAP32, __main_thread_futex_wait_address >> 2);
+ var mainThreadWoken = 0;
+ if (mainThreadWaitAddress == addr) {
+ // Check cmpValue precondition before taking any action.
+ var val1 = Atomics.load(HEAP32, addr >> 2);
+ if (val1 != cmpValue) return -11;
+
+ // If we are actually waking any waiters, then new main thread wait location is reset, otherwise requeue it to wait on addr2.
+ var newMainThreadWaitAddress = (count > 0) ? 0 : addr2;
+ var loadedAddr = Atomics.compareExchange(HEAP32, __main_thread_futex_wait_address >> 2, mainThreadWaitAddress, newMainThreadWaitAddress);
+ if (loadedAddr == mainThreadWaitAddress && count > 0) {
+ --count; // Main thread was woken, so one less workers to wake up.
+ mainThreadWoken = 1;
+ }
+ }
+
+ // Wake any workers waiting on this address.
+ var ret = Atomics.wakeOrRequeue(HEAP32, addr >> 2, count, addr2 >> 2, cmpValue);
+ if (ret == Atomics.NOTEQUAL) return -11;
+ if (ret >= 0) return ret + mainThreadWoken;
+ throw 'Atomics.wakeOrRequeue returned an unexpected value ' + ret;
+ }
+
+
+ function _emscripten_has_threading_support() {
+ return typeof SharedArrayBuffer !== 'undefined';
+ }
+
+
+
+
+
+
+ function _emscripten_set_current_thread_status_js(newStatus) {
+ }
+
+
+ function _emscripten_set_thread_name_js(threadId, name) {
+ }
+
+ function _emscripten_syscall(which, varargs) {
+ switch (which) {
+ case 102: return ___syscall102(which, varargs);
+ case 140: return ___syscall140(which, varargs);
+ case 142: return ___syscall142(which, varargs);
+ case 146: return ___syscall146(which, varargs);
+ case 221: return ___syscall221(which, varargs);
+ case 3: return ___syscall3(which, varargs);
+ case 4: return ___syscall4(which, varargs);
+ case 42: return ___syscall42(which, varargs);
+ case 5: return ___syscall5(which, varargs);
+ case 54: return ___syscall54(which, varargs);
+ case 6: return ___syscall6(which, varargs);
+ default: throw "surprising proxied syscall: " + which;
+ }
+ }
+
+ function _getaddrinfo(node, service, hint, out) {
+ if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_browser_thread_iiiii(1, node, service, hint, out);
+ // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL
+ // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we
+ // really should provide a linked list of suitable addrinfo values.
+ var addrs = [];
+ var canon = null;
+ var addr = 0;
+ var port = 0;
+ var flags = 0;
+ var family = 0;
+ var type = 0;
+ var proto = 0;
+ var ai, last;
+
+ function allocaddrinfo(family, type, proto, canon, addr, port) {
+ var sa, salen, ai;
+ var res;
+
+ salen = family === 10 ?
+ 28 :
+ 16;
+ addr = family === 10 ?
+ __inet_ntop6_raw(addr) :
+ __inet_ntop4_raw(addr);
+ sa = _malloc(salen);
+ res = __write_sockaddr(sa, family, addr, port);
+ assert(!res.errno);
+
+ ai = _malloc(32);
+ HEAP32[(((ai)+(4))>>2)]=family;
+ HEAP32[(((ai)+(8))>>2)]=type;
+ HEAP32[(((ai)+(12))>>2)]=proto;
+ HEAP32[(((ai)+(24))>>2)]=canon;
+ HEAP32[(((ai)+(20))>>2)]=sa;
+ if (family === 10) {
+ HEAP32[(((ai)+(16))>>2)]=28;
+ } else {
+ HEAP32[(((ai)+(16))>>2)]=16;
+ }
+ HEAP32[(((ai)+(28))>>2)]=0;
+
+ return ai;
+ }
+
+ if (hint) {
+ flags = HEAP32[((hint)>>2)];
+ family = HEAP32[(((hint)+(4))>>2)];
+ type = HEAP32[(((hint)+(8))>>2)];
+ proto = HEAP32[(((hint)+(12))>>2)];
+ }
+ if (type && !proto) {
+ proto = type === 2 ? 17 : 6;
+ }
+ if (!type && proto) {
+ type = proto === 17 ? 2 : 1;
+ }
+
+ // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for
+ // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints.
+ if (proto === 0) {
+ proto = 6;
+ }
+ if (type === 0) {
+ type = 1;
+ }
+
+ if (!node && !service) {
+ return -2;
+ }
+ if (flags & ~(1|2|4|
+ 1024|8|16|32)) {
+ return -1;
+ }
+ if (hint !== 0 && (HEAP32[((hint)>>2)] & 2) && !node) {
+ return -1;
+ }
+ if (flags & 32) {
+ // TODO
+ return -2;
+ }
+ if (type !== 0 && type !== 1 && type !== 2) {
+ return -7;
+ }
+ if (family !== 0 && family !== 2 && family !== 10) {
+ return -6;
+ }
+
+ if (service) {
+ service = Pointer_stringify(service);
+ port = parseInt(service, 10);
+
+ if (isNaN(port)) {
+ if (flags & 1024) {
+ return -2;
+ }
+ // TODO support resolving well-known service names from:
+ // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt
+ return -8;
+ }
+ }
+
+ if (!node) {
+ if (family === 0) {
+ family = 2;
+ }
+ if ((flags & 1) === 0) {
+ if (family === 2) {
+ addr = _htonl(2130706433);
+ } else {
+ addr = [0, 0, 0, 1];
+ }
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ HEAP32[((out)>>2)]=ai;
+ return 0;
+ }
+
+ //
+ // try as a numeric address
+ //
+ node = Pointer_stringify(node);
+ addr = __inet_pton4_raw(node);
+ if (addr !== null) {
+ // incoming node is a valid ipv4 address
+ if (family === 0 || family === 2) {
+ family = 2;
+ }
+ else if (family === 10 && (flags & 8)) {
+ addr = [0, 0, _htonl(0xffff), addr];
+ family = 10;
+ } else {
+ return -2;
+ }
+ } else {
+ addr = __inet_pton6_raw(node);
+ if (addr !== null) {
+ // incoming node is a valid ipv6 address
+ if (family === 0 || family === 10) {
+ family = 10;
+ } else {
+ return -2;
+ }
+ }
+ }
+ if (addr != null) {
+ ai = allocaddrinfo(family, type, proto, node, addr, port);
+ HEAP32[((out)>>2)]=ai;
+ return 0;
+ }
+ if (flags & 4) {
+ return -2;
+ }
+
+ //
+ // try as a hostname
+ //
+ // resolve the hostname to a temporary fake address
+ node = DNS.lookup_name(node);
+ addr = __inet_pton4_raw(node);
+ if (family === 0) {
+ family = 2;
+ } else if (family === 10) {
+ addr = [0, 0, _htonl(0xffff), addr];
+ }
+ ai = allocaddrinfo(family, type, proto, null, addr, port);
+ HEAP32[((out)>>2)]=ai;
+ return 0;
+ }
+
+ function _gettimeofday(ptr) {
+ var now = Date.now();
+ HEAP32[((ptr)>>2)]=(now/1000)|0; // seconds
+ HEAP32[(((ptr)+(4))>>2)]=((now % 1000)*1000)|0; // microseconds
+ return 0;
+ }
+
+
+
+
+
+ var _llvm_ceil_f32=Math_ceil;
+
+ var _llvm_ceil_f64=Math_ceil;
+
+ function _llvm_copysign_f32(x, y) {
+ return y < 0 || (y === 0 && 1/y < 0) ? -Math_abs(x) : Math_abs(x);
+ }
+
+ var _llvm_cos_f32=Math_cos;
+
+ var _llvm_cos_f64=Math_cos;
+
+ var _llvm_ctlz_i32=true;
+
+ var _llvm_exp_f32=Math_exp;
+
+ var _llvm_exp_f64=Math_exp;
+
+ var _llvm_fabs_f32=Math_abs;
+
+ var _llvm_fabs_f64=Math_abs;
+
+ var _llvm_floor_f32=Math_floor;
+
+ var _llvm_floor_f64=Math_floor;
+
+ function _llvm_log10_f32(x) {
+ return Math.log(x) / Math.LN10; // TODO: Math.log10, when browser support is there
+ }
+
+ function _llvm_log10_f64() {
+ return _llvm_log10_f32.apply(null, arguments)
+ }
+
+ function _llvm_log2_f32(x) {
+ return Math.log(x) / Math.LN2; // TODO: Math.log2, when browser support is there
+ }
+
+ var _llvm_log_f32=Math_log;
+
+ var _llvm_log_f64=Math_log;
+
+ var _llvm_nacl_atomic_cmpxchg_i32=undefined;
+
+ var _llvm_pow_f32=Math_pow;
+
+ var _llvm_pow_f64=Math_pow;
+
+
+
+
+
+ var _llvm_sin_f32=Math_sin;
+
+ var _llvm_sin_f64=Math_sin;
+
+ var _llvm_sqrt_f32=Math_sqrt;
+
+ var _llvm_sqrt_f64=Math_sqrt;
+
+ function _llvm_stackrestore(p) {
+ var self = _llvm_stacksave;
+ var ret = self.LLVM_SAVEDSTACKS[p];
+ self.LLVM_SAVEDSTACKS.splice(p, 1);
+ stackRestore(ret);
+ }
+
+ function _llvm_stacksave() {
+ var self = _llvm_stacksave;
+ if (!self.LLVM_SAVEDSTACKS) {
+ self.LLVM_SAVEDSTACKS = [];
+ }
+ self.LLVM_SAVEDSTACKS.push(stackSave());
+ return self.LLVM_SAVEDSTACKS.length-1;
+ }
+
+ function _llvm_trap() {
+ abort('trap!');
+ }
+
+
+ function _emscripten_memcpy_big(dest, src, num) {
+ HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
+ return dest;
+ }
+
+
+
+
+
+ function _pthread_cleanup_pop(execute) {
+ var routine = PThread.exitHandlers.pop();
+ if (execute) routine();
+ }
+
+ function _pthread_cleanup_push(routine, arg) {
+ if (PThread.exitHandlers === null) {
+ PThread.exitHandlers = [];
+ if (!ENVIRONMENT_IS_PTHREAD) {
+ __ATEXIT__.push(function() { PThread.runExitHandlers(); });
+ }
+ }
+ PThread.exitHandlers.push(function() { Module['dynCall_vi'](routine, arg) });
+ }
+
+
+ function __spawn_thread(threadParams) {
+ if (ENVIRONMENT_IS_PTHREAD) throw 'Internal Error! _spawn_thread() can only ever be called from main application thread!';
+
+ var worker = PThread.getNewWorker();
+ if (worker.pthread !== undefined) throw 'Internal error!';
+ if (!threadParams.pthread_ptr) throw 'Internal error, no pthread ptr!';
+ PThread.runningWorkers.push(worker);
+
+ // Allocate memory for thread-local storage and initialize it to zero.
+ var tlsMemory = _malloc(128 * 4);
+ for (var i = 0; i < 128; ++i) {
+ HEAP32[(((tlsMemory)+(i*4))>>2)]=0;
+ }
+
+ var pthread = PThread.pthreads[threadParams.pthread_ptr] = { // Create a pthread info object to represent this thread.
+ worker: worker,
+ stackBase: threadParams.stackBase,
+ stackSize: threadParams.stackSize,
+ allocatedOwnStack: threadParams.allocatedOwnStack,
+ thread: threadParams.pthread_ptr,
+ threadInfoStruct: threadParams.pthread_ptr // Info area for this thread in Emscripten HEAP (shared)
+ };
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 0 ) >> 2, 0); // threadStatus <- 0, meaning not yet exited.
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 4 ) >> 2, 0); // threadExitCode <- 0.
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 20 ) >> 2, 0); // profilerBlock <- 0.
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 80 ) >> 2, threadParams.detached);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 116 ) >> 2, tlsMemory); // Init thread-local-storage memory array.
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 60 ) >> 2, 0); // Mark initial status to unused.
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 52 ) >> 2, pthread.threadInfoStruct); // Main thread ID.
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 56 ) >> 2, PROCINFO.pid); // Process ID.
+
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120) >> 2, threadParams.stackSize);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 96) >> 2, threadParams.stackSize);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 92) >> 2, threadParams.stackBase);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 8) >> 2, threadParams.stackBase);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 12) >> 2, threadParams.detached);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 20) >> 2, threadParams.schedPolicy);
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 24) >> 2, threadParams.schedPrio);
+
+ var global_libc = _emscripten_get_global_libc();
+ var global_locale = global_libc + 40;
+ Atomics.store(HEAPU32, (pthread.threadInfoStruct + 188) >> 2, global_locale);
+
+
+ worker.pthread = pthread;
+ var msg = {
+ cmd: 'run',
+ start_routine: threadParams.startRoutine,
+ arg: threadParams.arg,
+ threadInfoStruct: threadParams.pthread_ptr,
+ selfThreadId: threadParams.pthread_ptr, // TODO: Remove this since thread ID is now the same as the thread address.
+ parentThreadId: threadParams.parent_pthread_ptr,
+ stackBase: threadParams.stackBase,
+ stackSize: threadParams.stackSize,
+ };
+ worker.runPthread = function() {
+ // Ask the worker to start executing its pthread entry point function.
+ msg.time = performance.now();
+ worker.postMessage(msg, threadParams.transferList);
+ };
+ if (worker.loaded) {
+ worker.runPthread();
+ delete worker.runPthread;
+ }
+ }
+
+ function _pthread_getschedparam(thread, policy, schedparam) {
+ if (!policy && !schedparam) return ERRNO_CODES.EINVAL;
+
+ if (!thread) {
+ err('pthread_getschedparam called with a null thread pointer!');
+ return ERRNO_CODES.ESRCH;
+ }
+ var self = HEAP32[(((thread)+(24))>>2)];
+ if (self != thread) {
+ err('pthread_getschedparam attempted on thread ' + thread + ', which does not point to a valid thread, or does not exist anymore!');
+ return ERRNO_CODES.ESRCH;
+ }
+
+ var schedPolicy = Atomics.load(HEAPU32, (thread + 120 + 20 ) >> 2);
+ var schedPrio = Atomics.load(HEAPU32, (thread + 120 + 24 ) >> 2);
+
+ if (policy) HEAP32[((policy)>>2)]=schedPolicy;
+ if (schedparam) HEAP32[((schedparam)>>2)]=schedPrio;
+ return 0;
+ }
+
+ function _pthread_create(pthread_ptr, attr, start_routine, arg) {
+ if (typeof SharedArrayBuffer === 'undefined') {
+ err('Current environment does not support SharedArrayBuffer, pthreads are not available!');
+ return 11;
+ }
+ if (!pthread_ptr) {
+ err('pthread_create called with a null thread pointer!');
+ return 22;
+ }
+
+ var transferList = []; // List of JS objects that will transfer ownership to the Worker hosting the thread
+
+
+ // Synchronously proxy the thread creation to main thread if possible. If we need to transfer ownership of objects, then
+ // proxy asynchronously via postMessage.
+ if (ENVIRONMENT_IS_PTHREAD && transferList.length == 0) {
+ return _emscripten_sync_run_in_main_thread_4(137, pthread_ptr, attr, start_routine, arg);
+ }
+
+ var stackSize = 0;
+ var stackBase = 0;
+ var detached = 0; // Default thread attr is PTHREAD_CREATE_JOINABLE, i.e. start as not detached.
+ var schedPolicy = 0; /*SCHED_OTHER*/
+ var schedPrio = 0;
+ if (attr) {
+ stackSize = HEAP32[((attr)>>2)];
+ // Musl has a convention that the stack size that is stored to the pthread attribute structure is always musl's #define DEFAULT_STACK_SIZE
+ // smaller than the actual created stack size. That is, stored stack size of 0 would mean a stack of DEFAULT_STACK_SIZE in size. All musl
+ // functions hide this impl detail, and offset the size transparently, so pthread_*() API user does not see this offset when operating with
+ // the pthread API. When reading the structure directly on JS side however, we need to offset the size manually here.
+ stackSize += 81920 /*DEFAULT_STACK_SIZE*/;
+ stackBase = HEAP32[(((attr)+(8))>>2)];
+ detached = HEAP32[(((attr)+(12))>>2)] != 0/*PTHREAD_CREATE_JOINABLE*/;
+ var inheritSched = HEAP32[(((attr)+(16))>>2)] == 0/*PTHREAD_INHERIT_SCHED*/;
+ if (inheritSched) {
+ var prevSchedPolicy = HEAP32[(((attr)+(20))>>2)];
+ var prevSchedPrio = HEAP32[(((attr)+(24))>>2)];
+ _pthread_getschedparam(_pthread_self(), attr + 20, attr + 24);
+ schedPolicy = HEAP32[(((attr)+(20))>>2)];
+ schedPrio = HEAP32[(((attr)+(24))>>2)];
+ HEAP32[(((attr)+(20))>>2)]=prevSchedPolicy;
+ HEAP32[(((attr)+(24))>>2)]=prevSchedPrio;
+ } else {
+ schedPolicy = HEAP32[(((attr)+(20))>>2)];
+ schedPrio = HEAP32[(((attr)+(24))>>2)];
+ }
+ } else {
+ // According to http://man7.org/linux/man-pages/man3/pthread_create.3.html, default stack size if not specified is 2 MB, so follow that convention.
+ stackSize = 2097152;
+ }
+ var allocatedOwnStack = stackBase == 0; // If allocatedOwnStack == true, then the pthread impl maintains the stack allocation.
+ if (allocatedOwnStack) {
+ stackBase = _malloc(stackSize); // Allocate a stack if the user doesn't want to place the stack in a custom memory area.
+ } else {
+ // Musl stores the stack base address assuming stack grows downwards, so adjust it to Emscripten convention that the
+ // stack grows upwards instead.
+ stackBase -= stackSize;
+ assert(stackBase > 0);
+ }
+
+ // Allocate thread block (pthread_t structure).
+ var threadInfoStruct = _malloc(244);
+ for (var i = 0; i < 244 >> 2; ++i) HEAPU32[(threadInfoStruct>>2) + i] = 0; // zero-initialize thread structure.
+ HEAP32[((pthread_ptr)>>2)]=threadInfoStruct;
+
+ // The pthread struct has a field that points to itself - this is used as a magic ID to detect whether the pthread_t
+ // structure is 'alive'.
+ HEAP32[(((threadInfoStruct)+(24))>>2)]=threadInfoStruct;
+
+ // pthread struct robust_list head should point to itself.
+ var headPtr = threadInfoStruct + 168;
+ HEAP32[((headPtr)>>2)]=headPtr;
+
+ var threadParams = {
+ stackBase: stackBase,
+ stackSize: stackSize,
+ allocatedOwnStack: allocatedOwnStack,
+ schedPolicy: schedPolicy,
+ schedPrio: schedPrio,
+ detached: detached,
+ startRoutine: start_routine,
+ pthread_ptr: threadInfoStruct,
+ parent_pthread_ptr: _pthread_self(),
+ arg: arg,
+ transferList: transferList
+ };
+
+ if (ENVIRONMENT_IS_PTHREAD) {
+ // The prepopulated pool of web workers that can host pthreads is stored in the main JS thread. Therefore if a
+ // pthread is attempting to spawn a new thread, the thread creation must be deferred to the main JS thread.
+ threadParams.cmd = 'spawnThread';
+ postMessage(threadParams, transferList);
+ } else {
+ // We are the main thread, so we have the pthread warmup pool in this thread and can fire off JS thread creation
+ // directly ourselves.
+ __spawn_thread(threadParams);
+ }
+
+ return 0;
+ }
+
+
+ function __cleanup_thread(pthread_ptr) {
+ if (ENVIRONMENT_IS_PTHREAD) throw 'Internal Error! _cleanup_thread() can only ever be called from main application thread!';
+ if (!pthread_ptr) throw 'Internal Error! Null pthread_ptr in _cleanup_thread!';
+ HEAP32[(((pthread_ptr)+(24))>>2)]=0;
+ var pthread = PThread.pthreads[pthread_ptr];
+ var worker = pthread.worker;
+ PThread.freeThreadData(pthread);
+ worker.pthread = undefined; // Detach the worker from the pthread object, and return it to the worker pool as an unused worker.
+ PThread.unusedWorkerPool.push(worker);
+ PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker.pthread), 1); // Not a running Worker anymore.
+ }
+
+ function __pthread_testcancel_js() {
+ if (!ENVIRONMENT_IS_PTHREAD) return;
+ if (!threadInfoStruct) return;
+ var cancelDisabled = Atomics.load(HEAPU32, (threadInfoStruct + 72 ) >> 2);
+ if (cancelDisabled) return;
+ var canceled = Atomics.load(HEAPU32, (threadInfoStruct + 0 ) >> 2);
+ if (canceled == 2) throw 'Canceled!';
+ }function _pthread_join(thread, status) {
+ if (!thread) {
+ err('pthread_join attempted on a null thread pointer!');
+ return ERRNO_CODES.ESRCH;
+ }
+ if (ENVIRONMENT_IS_PTHREAD && selfThreadId == thread) {
+ err('PThread ' + thread + ' is attempting to join to itself!');
+ return ERRNO_CODES.EDEADLK;
+ }
+ else if (!ENVIRONMENT_IS_PTHREAD && PThread.mainThreadBlock == thread) {
+ err('Main thread ' + thread + ' is attempting to join to itself!');
+ return ERRNO_CODES.EDEADLK;
+ }
+ var self = HEAP32[(((thread)+(24))>>2)];
+ if (self != thread) {
+ err('pthread_join attempted on thread ' + thread + ', which does not point to a valid thread, or does not exist anymore!');
+ return ERRNO_CODES.ESRCH;
+ }
+
+ var detached = Atomics.load(HEAPU32, (thread + 80 ) >> 2);
+ if (detached) {
+ err('Attempted to join thread ' + thread + ', which was already detached!');
+ return ERRNO_CODES.EINVAL; // The thread is already detached, can no longer join it!
+ }
+ for (;;) {
+ var threadStatus = Atomics.load(HEAPU32, (thread + 0 ) >> 2);
+ if (threadStatus == 1) { // Exited?
+ var threadExitCode = Atomics.load(HEAPU32, (thread + 4 ) >> 2);
+ if (status) HEAP32[((status)>>2)]=threadExitCode;
+ Atomics.store(HEAPU32, (thread + 80 ) >> 2, 1); // Mark the thread as detached.
+
+ if (!ENVIRONMENT_IS_PTHREAD) __cleanup_thread(thread);
+ else postMessage({ cmd: 'cleanupThread', thread: thread});
+ return 0;
+ }
+ // TODO HACK! Replace the _js variant with just _pthread_testcancel:
+ //_pthread_testcancel();
+ __pthread_testcancel_js();
+ // In main runtime thread (the thread that initialized the Emscripten C runtime and launched main()), assist pthreads in performing operations
+ // that they need to access the Emscripten main runtime for.
+ if (!ENVIRONMENT_IS_PTHREAD) _emscripten_main_thread_process_queued_calls();
+ _emscripten_futex_wait(thread + 0, threadStatus, ENVIRONMENT_IS_PTHREAD ? 100 : 1);
+ }
+ }
+
+
+ function _pthread_setschedparam(thread, policy, schedparam) {
+ if (!thread) {
+ err('pthread_setschedparam called with a null thread pointer!');
+ return ERRNO_CODES.ESRCH;
+ }
+ var self = HEAP32[(((thread)+(24))>>2)];
+ if (self != thread) {
+ err('pthread_setschedparam attempted on thread ' + thread + ', which does not point to a valid thread, or does not exist anymore!');
+ return ERRNO_CODES.ESRCH;
+ }
+
+ if (!schedparam) return ERRNO_CODES.EINVAL;
+
+ var newSchedPrio = HEAP32[((schedparam)>>2)];
+ if (newSchedPrio < 0) return ERRNO_CODES.EINVAL;
+ if (policy == 1/*SCHED_FIFO*/ || policy == 2/*SCHED_RR*/) {
+ if (newSchedPrio > 99) return ERRNO_CODES.EINVAL;
+ } else {
+ if (newSchedPrio > 1) return ERRNO_CODES.EINVAL;
+ }
+
+ Atomics.store(HEAPU32, (thread + 120 + 20) >> 2, policy);
+ Atomics.store(HEAPU32, (thread + 120 + 24) >> 2, newSchedPrio);
+ return 0;
+ }
+
+
+
+
+
+
+ function _sigaction(signum, act, oldact) {
+ //int sigaction(int signum, const struct sigaction *act, struct sigaction *oldact);
+ err('Calling stub instead of sigaction()');
+ return 0;
+ }
+
+ function _sigemptyset(set) {
+ HEAP32[((set)>>2)]=0;
+ return 0;
+ }
+
+ function _time(ptr) {
+ var ret = (Date.now()/1000)|0;
+ if (ptr) {
+ HEAP32[((ptr)>>2)]=ret;
+ }
+ return ret;
+ }
+
+if (!ENVIRONMENT_IS_PTHREAD) PThread.initMainThreadBlock();;
+if (ENVIRONMENT_IS_NODE) {
+ _emscripten_get_now = function _emscripten_get_now_actual() {
+ var t = process['hrtime']();
+ return t[0] * 1e3 + t[1] / 1e6;
+ };
+ } else if (ENVIRONMENT_IS_PTHREAD) {
+ _emscripten_get_now = function() { return performance['now']() - __performance_now_clock_drift; };
+ } else if (typeof dateNow !== 'undefined') {
+ _emscripten_get_now = dateNow;
+ } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
+ _emscripten_get_now = function() { return self['performance']['now'](); };
+ } else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
+ _emscripten_get_now = function() { return performance['now'](); };
+ } else {
+ _emscripten_get_now = Date.now;
+ };
+__ATINIT__.push(function() { SOCKFS.root = FS.mount(SOCKFS, {}, null); });;
+FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
+__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
+if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
+__ATINIT__.push(function() { PIPEFS.root = FS.mount(PIPEFS, {}, null); });;
+init_emval();;
+PureVirtualError = Module['PureVirtualError'] = extendError(Error, 'PureVirtualError');;
+embind_init_charCodes();
+init_embind();;
+BindingError = Module['BindingError'] = extendError(Error, 'BindingError');;
+InternalError = Module['InternalError'] = extendError(Error, 'InternalError');;
+init_ClassHandle();
+init_RegisteredPointer();
+UnboundTypeError = Module['UnboundTypeError'] = extendError(Error, 'UnboundTypeError');;
+
+ // proxiedFunctionTable specifies the list of functions that can be called either synchronously or asynchronously from other threads in postMessage()d or internally queued events. This way a pthread in a Worker can synchronously access e.g. the DOM on the main thread.
+
+var proxiedFunctionTable = [null,_getaddrinfo];
+
+function _emscripten_sync_run_in_browser_thread_iiiii(func, p0, p1, p2, p3) {
+ var waitAddress = stackSave();
+ var returnValue = waitAddress + 4;
+ Atomics.store(HEAP32, waitAddress >> 2, 0);
+ postMessage({ proxiedCall: 5, func: func, waitAddress: waitAddress, returnValue: returnValue, p0: p0, p1: p1, p2: p2, p3: p3 });
+ Atomics.wait(HEAP32, waitAddress >> 2, 0);
+ return HEAP32[returnValue >> 2];
+}
+
+if (!ENVIRONMENT_IS_PTHREAD) {
+ // Only main thread initializes these, pthreads copy them over at thread worker init time (in pthread-main.js)
+DYNAMICTOP_PTR = staticAlloc(4);
+
+STACK_BASE = STACKTOP = alignMemory(STATICTOP);
+
+STACK_MAX = STACK_BASE + TOTAL_STACK;
+
+DYNAMIC_BASE = alignMemory(STACK_MAX);
+
+HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
+
+staticSealed = true; // seal the static portion of memory
+
+assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");
+
+}
+
+var ASSERTIONS = true;
+
+/** @type {function(string, boolean=, number=)} */
+function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+
+function intArrayToString(array) {
+ var ret = [];
+ for (var i = 0; i < array.length; i++) {
+ var chr = array[i];
+ if (chr > 0xFF) {
+ if (ASSERTIONS) {
+ assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.');
+ }
+ chr &= 0xFF;
+ }
+ ret.push(String.fromCharCode(chr));
+ }
+ return ret.join('');
+}
+
+
+
+function nullFunc_di(x) { err("Invalid function pointer called with signature 'di'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_ff(x) { err("Invalid function pointer called with signature 'ff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_fi(x) { err("Invalid function pointer called with signature 'fi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_fii(x) { err("Invalid function pointer called with signature 'fii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_fiii(x) { err("Invalid function pointer called with signature 'fiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_i(x) { err("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_ii(x) { err("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iid(x) { err("Invalid function pointer called with signature 'iid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iii(x) { err("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiii(x) { err("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiii(x) { err("Invalid function pointer called with signature 'iiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiii(x) { err("Invalid function pointer called with signature 'iiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiiii(x) { err("Invalid function pointer called with signature 'iiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiiiii(x) { err("Invalid function pointer called with signature 'iiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiiiiii(x) { err("Invalid function pointer called with signature 'iiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiiiiiii(x) { err("Invalid function pointer called with signature 'iiiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiiiiiiiii(x) { err("Invalid function pointer called with signature 'iiiiiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiiij(x) { err("Invalid function pointer called with signature 'iiiiiij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiij(x) { err("Invalid function pointer called with signature 'iiiiij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiijiiiii(x) { err("Invalid function pointer called with signature 'iiiiijiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiij(x) { err("Invalid function pointer called with signature 'iiiij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiijii(x) { err("Invalid function pointer called with signature 'iiiijii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiij(x) { err("Invalid function pointer called with signature 'iiij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iij(x) { err("Invalid function pointer called with signature 'iij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_ji(x) { err("Invalid function pointer called with signature 'ji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_jiij(x) { err("Invalid function pointer called with signature 'jiij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_jijj(x) { err("Invalid function pointer called with signature 'jijj'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_v(x) { err("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vi(x) { err("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viddj(x) { err("Invalid function pointer called with signature 'viddj'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vif(x) { err("Invalid function pointer called with signature 'vif'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vii(x) { err("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viii(x) { err("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiii(x) { err("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiii(x) { err("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiii(x) { err("Invalid function pointer called with signature 'viiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiii(x) { err("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiiii(x) { err("Invalid function pointer called with signature 'viiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiijii(x) { err("Invalid function pointer called with signature 'viiiijii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiij(x) { err("Invalid function pointer called with signature 'viiij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiji(x) { err("Invalid function pointer called with signature 'viiiji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiijj(x) { err("Invalid function pointer called with signature 'viiijj'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiijji(x) { err("Invalid function pointer called with signature 'viiijji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viij(x) { err("Invalid function pointer called with signature 'viij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiji(x) { err("Invalid function pointer called with signature 'viiji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viijiii(x) { err("Invalid function pointer called with signature 'viijiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viijj(x) { err("Invalid function pointer called with signature 'viijj'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vij(x) { err("Invalid function pointer called with signature 'vij'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viji(x) { err("Invalid function pointer called with signature 'viji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vijii(x) { err("Invalid function pointer called with signature 'vijii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vijj(x) { err("Invalid function pointer called with signature 'vijj'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vijjj(x) { err("Invalid function pointer called with signature 'vijjj'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+Module['wasmTableSize'] = 166912;
+
+Module['wasmMaxTableSize'] = 166912;
+
+function invoke_di(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_di"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_ff(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_ff"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_fi(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_fi"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_fii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_fii"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_fiii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_fiii"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_i(index) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_i"](index);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_ii(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_ii"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iid(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iid"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iii"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiii"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiii"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiii"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiiij(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiiij"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiij(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiij"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiiijiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiiijiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiij(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiij"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiiijii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiiijii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiij(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iiij"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iij(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_iij"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_ji(index,a1) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_ji"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_jiij(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_jiij"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_jijj(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return Module["dynCall_jijj"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_v(index) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_v"](index);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vi(index,a1) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vi"](index,a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viddj(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viddj"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vif(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vif"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vii"](index,a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viii"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiii"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiijii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiijii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiij(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiij"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiji(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiiji"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiijj(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiijj"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiijji(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiijji"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viij(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viij"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiji(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viiji"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viijiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viijiii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viijj(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viijj"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vij(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vij"](index,a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viji(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_viji"](index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vijii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vijii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vijj(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vijj"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vijjj(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ Module["dynCall_vijjj"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+Module.asmGlobalArg = {};
+
+Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_di": nullFunc_di, "nullFunc_ff": nullFunc_ff, "nullFunc_fi": nullFunc_fi, "nullFunc_fii": nullFunc_fii, "nullFunc_fiii": nullFunc_fiii, "nullFunc_i": nullFunc_i, "nullFunc_ii": nullFunc_ii, "nullFunc_iid": nullFunc_iid, "nullFunc_iii": nullFunc_iii, "nullFunc_iiii": nullFunc_iiii, "nullFunc_iiiii": nullFunc_iiiii, "nullFunc_iiiiii": nullFunc_iiiiii, "nullFunc_iiiiiii": nullFunc_iiiiiii, "nullFunc_iiiiiiii": nullFunc_iiiiiiii, "nullFunc_iiiiiiiii": nullFunc_iiiiiiiii, "nullFunc_iiiiiiiiii": nullFunc_iiiiiiiiii, "nullFunc_iiiiiiiiiiii": nullFunc_iiiiiiiiiiii, "nullFunc_iiiiiij": nullFunc_iiiiiij, "nullFunc_iiiiij": nullFunc_iiiiij, "nullFunc_iiiiijiiiii": nullFunc_iiiiijiiiii, "nullFunc_iiiij": nullFunc_iiiij, "nullFunc_iiiijii": nullFunc_iiiijii, "nullFunc_iiij": nullFunc_iiij, "nullFunc_iij": nullFunc_iij, "nullFunc_ji": nullFunc_ji, "nullFunc_jiij": nullFunc_jiij, "nullFunc_jijj": nullFunc_jijj, "nullFunc_v": nullFunc_v, "nullFunc_vi": nullFunc_vi, "nullFunc_viddj": nullFunc_viddj, "nullFunc_vif": nullFunc_vif, "nullFunc_vii": nullFunc_vii, "nullFunc_viii": nullFunc_viii, "nullFunc_viiii": nullFunc_viiii, "nullFunc_viiiii": nullFunc_viiiii, "nullFunc_viiiiii": nullFunc_viiiiii, "nullFunc_viiiiiii": nullFunc_viiiiiii, "nullFunc_viiiiiiii": nullFunc_viiiiiiii, "nullFunc_viiiijii": nullFunc_viiiijii, "nullFunc_viiij": nullFunc_viiij, "nullFunc_viiiji": nullFunc_viiiji, "nullFunc_viiijj": nullFunc_viiijj, "nullFunc_viiijji": nullFunc_viiijji, "nullFunc_viij": nullFunc_viij, "nullFunc_viiji": nullFunc_viiji, "nullFunc_viijiii": nullFunc_viijiii, "nullFunc_viijj": nullFunc_viijj, "nullFunc_vij": nullFunc_vij, "nullFunc_viji": nullFunc_viji, "nullFunc_vijii": nullFunc_vijii, "nullFunc_vijj": nullFunc_vijj, "nullFunc_vijjj": nullFunc_vijjj, "invoke_di": invoke_di, "invoke_ff": invoke_ff, "invoke_fi": invoke_fi, "invoke_fii": invoke_fii, "invoke_fiii": invoke_fiii, "invoke_i": invoke_i, "invoke_ii": invoke_ii, "invoke_iid": invoke_iid, "invoke_iii": invoke_iii, "invoke_iiii": invoke_iiii, "invoke_iiiii": invoke_iiiii, "invoke_iiiiii": invoke_iiiiii, "invoke_iiiiiii": invoke_iiiiiii, "invoke_iiiiiiii": invoke_iiiiiiii, "invoke_iiiiiiiii": invoke_iiiiiiiii, "invoke_iiiiiiiiii": invoke_iiiiiiiiii, "invoke_iiiiiiiiiiii": invoke_iiiiiiiiiiii, "invoke_iiiiiij": invoke_iiiiiij, "invoke_iiiiij": invoke_iiiiij, "invoke_iiiiijiiiii": invoke_iiiiijiiiii, "invoke_iiiij": invoke_iiiij, "invoke_iiiijii": invoke_iiiijii, "invoke_iiij": invoke_iiij, "invoke_iij": invoke_iij, "invoke_ji": invoke_ji, "invoke_jiij": invoke_jiij, "invoke_jijj": invoke_jijj, "invoke_v": invoke_v, "invoke_vi": invoke_vi, "invoke_viddj": invoke_viddj, "invoke_vif": invoke_vif, "invoke_vii": invoke_vii, "invoke_viii": invoke_viii, "invoke_viiii": invoke_viiii, "invoke_viiiii": invoke_viiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiijii": invoke_viiiijii, "invoke_viiij": invoke_viiij, "invoke_viiiji": invoke_viiiji, "invoke_viiijj": invoke_viiijj, "invoke_viiijji": invoke_viiijji, "invoke_viij": invoke_viij, "invoke_viiji": invoke_viiji, "invoke_viijiii": invoke_viijiii, "invoke_viijj": invoke_viijj, "invoke_vij": invoke_vij, "invoke_viji": invoke_viji, "invoke_vijii": invoke_vijii, "invoke_vijj": invoke_vijj, "invoke_vijjj": invoke_vijjj, "ClassHandle": ClassHandle, "ClassHandle_clone": ClassHandle_clone, "ClassHandle_delete": ClassHandle_delete, "ClassHandle_deleteLater": ClassHandle_deleteLater, "ClassHandle_isAliasOf": ClassHandle_isAliasOf, "ClassHandle_isDeleted": ClassHandle_isDeleted, "RegisteredClass": RegisteredClass, "RegisteredPointer": RegisteredPointer, "RegisteredPointer_deleteObject": RegisteredPointer_deleteObject, "RegisteredPointer_destructor": RegisteredPointer_destructor, "RegisteredPointer_fromWireType": RegisteredPointer_fromWireType, "RegisteredPointer_getPointee": RegisteredPointer_getPointee, "_WebRtcSpl_ComplexBitReverse": _WebRtcSpl_ComplexBitReverse, "_WebRtcSpl_FilterARFastQ12": _WebRtcSpl_FilterARFastQ12, "__ZN5wartc18AudioReceiveStream4Sink12OnAudioFrameENS_10AudioFrameE": __ZN5wartc18AudioReceiveStream4Sink12OnAudioFrameENS_10AudioFrameE, "__ZSt18uncaught_exceptionv": __ZSt18uncaught_exceptionv, "___assert_fail": ___assert_fail, "___buildEnvironment": ___buildEnvironment, "___call_main": ___call_main, "___clock_gettime": ___clock_gettime, "___cxa_allocate_exception": ___cxa_allocate_exception, "___cxa_begin_catch": ___cxa_begin_catch, "___cxa_end_catch": ___cxa_end_catch, "___cxa_find_matching_catch": ___cxa_find_matching_catch, "___cxa_find_matching_catch_2": ___cxa_find_matching_catch_2, "___cxa_find_matching_catch_3": ___cxa_find_matching_catch_3, "___cxa_free_exception": ___cxa_free_exception, "___cxa_pure_virtual": ___cxa_pure_virtual, "___cxa_throw": ___cxa_throw, "___gxx_personality_v0": ___gxx_personality_v0, "___lock": ___lock, "___resumeException": ___resumeException, "___setErrNo": ___setErrNo, "___syscall102": ___syscall102, "___syscall140": ___syscall140, "___syscall142": ___syscall142, "___syscall146": ___syscall146, "___syscall221": ___syscall221, "___syscall3": ___syscall3, "___syscall4": ___syscall4, "___syscall42": ___syscall42, "___syscall5": ___syscall5, "___syscall54": ___syscall54, "___syscall6": ___syscall6, "___unlock": ___unlock, "__cleanup_thread": __cleanup_thread, "__embind_create_inheriting_constructor": __embind_create_inheriting_constructor, "__embind_finalize_value_object": __embind_finalize_value_object, "__embind_register_bool": __embind_register_bool, "__embind_register_class": __embind_register_class, "__embind_register_class_class_function": __embind_register_class_class_function, "__embind_register_class_constructor": __embind_register_class_constructor, "__embind_register_class_function": __embind_register_class_function, "__embind_register_emval": __embind_register_emval, "__embind_register_float": __embind_register_float, "__embind_register_integer": __embind_register_integer, "__embind_register_memory_view": __embind_register_memory_view, "__embind_register_std_string": __embind_register_std_string, "__embind_register_std_wstring": __embind_register_std_wstring, "__embind_register_value_object": __embind_register_value_object, "__embind_register_value_object_field": __embind_register_value_object_field, "__embind_register_void": __embind_register_void, "__emval_addMethodCaller": __emval_addMethodCaller, "__emval_allocateDestructors": __emval_allocateDestructors, "__emval_call_method": __emval_call_method, "__emval_call_void_method": __emval_call_void_method, "__emval_decref": __emval_decref, "__emval_get_method_caller": __emval_get_method_caller, "__emval_incref": __emval_incref, "__emval_lookupTypes": __emval_lookupTypes, "__emval_register": __emval_register, "__emval_run_destructors": __emval_run_destructors, "__emval_take_value": __emval_take_value, "__inet_ntop4_raw": __inet_ntop4_raw, "__inet_ntop6_raw": __inet_ntop6_raw, "__inet_pton4_raw": __inet_pton4_raw, "__inet_pton6_raw": __inet_pton6_raw, "__pthread_testcancel_js": __pthread_testcancel_js, "__read_sockaddr": __read_sockaddr, "__spawn_thread": __spawn_thread, "__write_sockaddr": __write_sockaddr, "_abort": _abort, "_clock_gettime": _clock_gettime, "_embind_repr": _embind_repr, "_emscripten_asm_const_i": _emscripten_asm_const_i, "_emscripten_conditional_set_current_thread_status_js": _emscripten_conditional_set_current_thread_status_js, "_emscripten_futex_wait": _emscripten_futex_wait, "_emscripten_futex_wake": _emscripten_futex_wake, "_emscripten_futex_wake_or_requeue": _emscripten_futex_wake_or_requeue, "_emscripten_get_now": _emscripten_get_now, "_emscripten_get_now_is_monotonic": _emscripten_get_now_is_monotonic, "_emscripten_has_threading_support": _emscripten_has_threading_support, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_set_current_thread_status_js": _emscripten_set_current_thread_status_js, "_emscripten_set_thread_name_js": _emscripten_set_thread_name_js, "_emscripten_syscall": _emscripten_syscall, "_getaddrinfo": _getaddrinfo, "_gettimeofday": _gettimeofday, "_llvm_ceil_f32": _llvm_ceil_f32, "_llvm_ceil_f64": _llvm_ceil_f64, "_llvm_copysign_f32": _llvm_copysign_f32, "_llvm_cos_f32": _llvm_cos_f32, "_llvm_cos_f64": _llvm_cos_f64, "_llvm_exp_f32": _llvm_exp_f32, "_llvm_exp_f64": _llvm_exp_f64, "_llvm_fabs_f32": _llvm_fabs_f32, "_llvm_fabs_f64": _llvm_fabs_f64, "_llvm_floor_f32": _llvm_floor_f32, "_llvm_floor_f64": _llvm_floor_f64, "_llvm_log10_f32": _llvm_log10_f32, "_llvm_log10_f64": _llvm_log10_f64, "_llvm_log2_f32": _llvm_log2_f32, "_llvm_log_f32": _llvm_log_f32, "_llvm_log_f64": _llvm_log_f64, "_llvm_pow_f32": _llvm_pow_f32, "_llvm_pow_f64": _llvm_pow_f64, "_llvm_sin_f32": _llvm_sin_f32, "_llvm_sin_f64": _llvm_sin_f64, "_llvm_sqrt_f32": _llvm_sqrt_f32, "_llvm_sqrt_f64": _llvm_sqrt_f64, "_llvm_stackrestore": _llvm_stackrestore, "_llvm_stacksave": _llvm_stacksave, "_llvm_trap": _llvm_trap, "_pthread_cleanup_pop": _pthread_cleanup_pop, "_pthread_cleanup_push": _pthread_cleanup_push, "_pthread_create": _pthread_create, "_pthread_getschedparam": _pthread_getschedparam, "_pthread_join": _pthread_join, "_pthread_setschedparam": _pthread_setschedparam, "_sigaction": _sigaction, "_sigemptyset": _sigemptyset, "_time": _time, "constNoSmartPtrRawPointerToWireType": constNoSmartPtrRawPointerToWireType, "count_emval_handles": count_emval_handles, "craftInvokerFunction": craftInvokerFunction, "createNamedFunction": createNamedFunction, "downcastPointer": downcastPointer, "embind__requireFunction": embind__requireFunction, "embind_init_charCodes": embind_init_charCodes, "ensureOverloadTable": ensureOverloadTable, "exposePublicSymbol": exposePublicSymbol, "extendError": extendError, "floatReadValueFromPointer": floatReadValueFromPointer, "flushPendingDeletes": flushPendingDeletes, "genericPointerToWireType": genericPointerToWireType, "getBasestPointer": getBasestPointer, "getInheritedInstance": getInheritedInstance, "getInheritedInstanceCount": getInheritedInstanceCount, "getLiveInheritedInstances": getLiveInheritedInstances, "getShiftFromSize": getShiftFromSize, "getStringOrSymbol": getStringOrSymbol, "getTypeName": getTypeName, "get_first_emval": get_first_emval, "heap32VectorToArray": heap32VectorToArray, "init_ClassHandle": init_ClassHandle, "init_RegisteredPointer": init_RegisteredPointer, "init_embind": init_embind, "init_emval": init_emval, "integerReadValueFromPointer": integerReadValueFromPointer, "makeClassHandle": makeClassHandle, "makeLegalFunctionName": makeLegalFunctionName, "new_": new_, "nonConstNoSmartPtrRawPointerToWireType": nonConstNoSmartPtrRawPointerToWireType, "readLatin1String": readLatin1String, "registerInheritedInstance": registerInheritedInstance, "registerType": registerType, "replacePublicSymbol": replacePublicSymbol, "requireHandle": requireHandle, "requireRegisteredType": requireRegisteredType, "runDestructor": runDestructor, "runDestructors": runDestructors, "setDelayFunction": setDelayFunction, "shallowCopyInternalPointer": shallowCopyInternalPointer, "simpleReadValueFromPointer": simpleReadValueFromPointer, "throwBindingError": throwBindingError, "throwInstanceAlreadyDeleted": throwInstanceAlreadyDeleted, "throwInternalError": throwInternalError, "throwUnboundTypeError": throwUnboundTypeError, "unregisterInheritedInstance": unregisterInheritedInstance, "upcastPointer": upcastPointer, "whenDependentTypesAreResolved": whenDependentTypesAreResolved, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX };
+// EMSCRIPTEN_START_ASM
+var asm =Module["asm"]// EMSCRIPTEN_END_ASM
+(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
+
+var real___GLOBAL__sub_I_bind_cpp = asm["__GLOBAL__sub_I_bind_cpp"]; asm["__GLOBAL__sub_I_bind_cpp"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___GLOBAL__sub_I_bind_cpp.apply(null, arguments);
+};
+
+var real___GLOBAL__sub_I_embind_cc = asm["__GLOBAL__sub_I_embind_cc"]; asm["__GLOBAL__sub_I_embind_cc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___GLOBAL__sub_I_embind_cc.apply(null, arguments);
+};
+
+var real___GLOBAL__sub_I_logging_cc = asm["__GLOBAL__sub_I_logging_cc"]; asm["__GLOBAL__sub_I_logging_cc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___GLOBAL__sub_I_logging_cc.apply(null, arguments);
+};
+
+var real___GLOBAL__sub_I_status_cc = asm["__GLOBAL__sub_I_status_cc"]; asm["__GLOBAL__sub_I_status_cc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___GLOBAL__sub_I_status_cc.apply(null, arguments);
+};
+
+var real____cxa_demangle = asm["___cxa_demangle"]; asm["___cxa_demangle"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real____cxa_demangle.apply(null, arguments);
+};
+
+var real____emscripten_environ_constructor = asm["___emscripten_environ_constructor"]; asm["___emscripten_environ_constructor"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real____emscripten_environ_constructor.apply(null, arguments);
+};
+
+var real____emscripten_pthread_data_constructor = asm["___emscripten_pthread_data_constructor"]; asm["___emscripten_pthread_data_constructor"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real____emscripten_pthread_data_constructor.apply(null, arguments);
+};
+
+var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real____errno_location.apply(null, arguments);
+};
+
+var real____getTypeName = asm["___getTypeName"]; asm["___getTypeName"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real____getTypeName.apply(null, arguments);
+};
+
+var real____pthread_tsd_run_dtors = asm["___pthread_tsd_run_dtors"]; asm["___pthread_tsd_run_dtors"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real____pthread_tsd_run_dtors.apply(null, arguments);
+};
+
+var real___emscripten_atomic_fetch_and_add_u64 = asm["__emscripten_atomic_fetch_and_add_u64"]; asm["__emscripten_atomic_fetch_and_add_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___emscripten_atomic_fetch_and_add_u64.apply(null, arguments);
+};
+
+var real___emscripten_atomic_fetch_and_and_u64 = asm["__emscripten_atomic_fetch_and_and_u64"]; asm["__emscripten_atomic_fetch_and_and_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___emscripten_atomic_fetch_and_and_u64.apply(null, arguments);
+};
+
+var real___emscripten_atomic_fetch_and_or_u64 = asm["__emscripten_atomic_fetch_and_or_u64"]; asm["__emscripten_atomic_fetch_and_or_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___emscripten_atomic_fetch_and_or_u64.apply(null, arguments);
+};
+
+var real___emscripten_atomic_fetch_and_sub_u64 = asm["__emscripten_atomic_fetch_and_sub_u64"]; asm["__emscripten_atomic_fetch_and_sub_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___emscripten_atomic_fetch_and_sub_u64.apply(null, arguments);
+};
+
+var real___emscripten_atomic_fetch_and_xor_u64 = asm["__emscripten_atomic_fetch_and_xor_u64"]; asm["__emscripten_atomic_fetch_and_xor_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___emscripten_atomic_fetch_and_xor_u64.apply(null, arguments);
+};
+
+var real___get_environ = asm["__get_environ"]; asm["__get_environ"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___get_environ.apply(null, arguments);
+};
+
+var real___register_pthread_ptr = asm["__register_pthread_ptr"]; asm["__register_pthread_ptr"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real___register_pthread_ptr.apply(null, arguments);
+};
+
+var real__emscripten_async_run_in_main_thread = asm["_emscripten_async_run_in_main_thread"]; asm["_emscripten_async_run_in_main_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_async_run_in_main_thread.apply(null, arguments);
+};
+
+var real__emscripten_atomic_add_u64 = asm["_emscripten_atomic_add_u64"]; asm["_emscripten_atomic_add_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_add_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_and_u64 = asm["_emscripten_atomic_and_u64"]; asm["_emscripten_atomic_and_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_and_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_cas_u64 = asm["_emscripten_atomic_cas_u64"]; asm["_emscripten_atomic_cas_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_cas_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_exchange_u64 = asm["_emscripten_atomic_exchange_u64"]; asm["_emscripten_atomic_exchange_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_exchange_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_load_f32 = asm["_emscripten_atomic_load_f32"]; asm["_emscripten_atomic_load_f32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_load_f32.apply(null, arguments);
+};
+
+var real__emscripten_atomic_load_f64 = asm["_emscripten_atomic_load_f64"]; asm["_emscripten_atomic_load_f64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_load_f64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_load_u64 = asm["_emscripten_atomic_load_u64"]; asm["_emscripten_atomic_load_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_load_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_or_u64 = asm["_emscripten_atomic_or_u64"]; asm["_emscripten_atomic_or_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_or_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_store_f32 = asm["_emscripten_atomic_store_f32"]; asm["_emscripten_atomic_store_f32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_store_f32.apply(null, arguments);
+};
+
+var real__emscripten_atomic_store_f64 = asm["_emscripten_atomic_store_f64"]; asm["_emscripten_atomic_store_f64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_store_f64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_store_u64 = asm["_emscripten_atomic_store_u64"]; asm["_emscripten_atomic_store_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_store_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_sub_u64 = asm["_emscripten_atomic_sub_u64"]; asm["_emscripten_atomic_sub_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_sub_u64.apply(null, arguments);
+};
+
+var real__emscripten_atomic_xor_u64 = asm["_emscripten_atomic_xor_u64"]; asm["_emscripten_atomic_xor_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_atomic_xor_u64.apply(null, arguments);
+};
+
+var real__emscripten_conditional_set_current_thread_status = asm["_emscripten_conditional_set_current_thread_status"]; asm["_emscripten_conditional_set_current_thread_status"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_conditional_set_current_thread_status.apply(null, arguments);
+};
+
+var real__emscripten_get_global_libc = asm["_emscripten_get_global_libc"]; asm["_emscripten_get_global_libc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_get_global_libc.apply(null, arguments);
+};
+
+var real__emscripten_is_main_browser_thread = asm["_emscripten_is_main_browser_thread"]; asm["_emscripten_is_main_browser_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_is_main_browser_thread.apply(null, arguments);
+};
+
+var real__emscripten_is_main_runtime_thread = asm["_emscripten_is_main_runtime_thread"]; asm["_emscripten_is_main_runtime_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_is_main_runtime_thread.apply(null, arguments);
+};
+
+var real__emscripten_main_thread_process_queued_calls = asm["_emscripten_main_thread_process_queued_calls"]; asm["_emscripten_main_thread_process_queued_calls"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_main_thread_process_queued_calls.apply(null, arguments);
+};
+
+var real__emscripten_set_current_thread_status = asm["_emscripten_set_current_thread_status"]; asm["_emscripten_set_current_thread_status"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_set_current_thread_status.apply(null, arguments);
+};
+
+var real__emscripten_set_thread_name = asm["_emscripten_set_thread_name"]; asm["_emscripten_set_thread_name"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_set_thread_name.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread = asm["_emscripten_sync_run_in_main_thread"]; asm["_emscripten_sync_run_in_main_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_0 = asm["_emscripten_sync_run_in_main_thread_0"]; asm["_emscripten_sync_run_in_main_thread_0"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_0.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_1 = asm["_emscripten_sync_run_in_main_thread_1"]; asm["_emscripten_sync_run_in_main_thread_1"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_1.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_2 = asm["_emscripten_sync_run_in_main_thread_2"]; asm["_emscripten_sync_run_in_main_thread_2"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_2.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_3 = asm["_emscripten_sync_run_in_main_thread_3"]; asm["_emscripten_sync_run_in_main_thread_3"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_3.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_4 = asm["_emscripten_sync_run_in_main_thread_4"]; asm["_emscripten_sync_run_in_main_thread_4"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_4.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_5 = asm["_emscripten_sync_run_in_main_thread_5"]; asm["_emscripten_sync_run_in_main_thread_5"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_5.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_6 = asm["_emscripten_sync_run_in_main_thread_6"]; asm["_emscripten_sync_run_in_main_thread_6"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_6.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_7 = asm["_emscripten_sync_run_in_main_thread_7"]; asm["_emscripten_sync_run_in_main_thread_7"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_7.apply(null, arguments);
+};
+
+var real__emscripten_sync_run_in_main_thread_xprintf_varargs = asm["_emscripten_sync_run_in_main_thread_xprintf_varargs"]; asm["_emscripten_sync_run_in_main_thread_xprintf_varargs"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__emscripten_sync_run_in_main_thread_xprintf_varargs.apply(null, arguments);
+};
+
+var real__fflush = asm["_fflush"]; asm["_fflush"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__fflush.apply(null, arguments);
+};
+
+var real__free = asm["_free"]; asm["_free"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__free.apply(null, arguments);
+};
+
+var real__htonl = asm["_htonl"]; asm["_htonl"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__htonl.apply(null, arguments);
+};
+
+var real__htons = asm["_htons"]; asm["_htons"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__htons.apply(null, arguments);
+};
+
+var real__llvm_bswap_i16 = asm["_llvm_bswap_i16"]; asm["_llvm_bswap_i16"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__llvm_bswap_i16.apply(null, arguments);
+};
+
+var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__llvm_bswap_i32.apply(null, arguments);
+};
+
+var real__llvm_round_f32 = asm["_llvm_round_f32"]; asm["_llvm_round_f32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__llvm_round_f32.apply(null, arguments);
+};
+
+var real__llvm_round_f64 = asm["_llvm_round_f64"]; asm["_llvm_round_f64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__llvm_round_f64.apply(null, arguments);
+};
+
+var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__malloc.apply(null, arguments);
+};
+
+var real__memmove = asm["_memmove"]; asm["_memmove"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__memmove.apply(null, arguments);
+};
+
+var real__ntohs = asm["_ntohs"]; asm["_ntohs"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__ntohs.apply(null, arguments);
+};
+
+var real__proxy_main = asm["_proxy_main"]; asm["_proxy_main"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__proxy_main.apply(null, arguments);
+};
+
+var real__pthread_self = asm["_pthread_self"]; asm["_pthread_self"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__pthread_self.apply(null, arguments);
+};
+
+var real__rintf = asm["_rintf"]; asm["_rintf"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__rintf.apply(null, arguments);
+};
+
+var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real__sbrk.apply(null, arguments);
+};
+
+var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_establishStackSpace.apply(null, arguments);
+};
+
+var real_getTempRet0 = asm["getTempRet0"]; asm["getTempRet0"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_getTempRet0.apply(null, arguments);
+};
+
+var real_setTempRet0 = asm["setTempRet0"]; asm["setTempRet0"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_setTempRet0.apply(null, arguments);
+};
+
+var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_setThrew.apply(null, arguments);
+};
+
+var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_stackAlloc.apply(null, arguments);
+};
+
+var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_stackRestore.apply(null, arguments);
+};
+
+var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return real_stackSave.apply(null, arguments);
+};
+Module["asm"] = asm;
+var __GLOBAL__sub_I_bind_cpp = Module["__GLOBAL__sub_I_bind_cpp"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__GLOBAL__sub_I_bind_cpp"].apply(null, arguments) };
+var __GLOBAL__sub_I_embind_cc = Module["__GLOBAL__sub_I_embind_cc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__GLOBAL__sub_I_embind_cc"].apply(null, arguments) };
+var __GLOBAL__sub_I_logging_cc = Module["__GLOBAL__sub_I_logging_cc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__GLOBAL__sub_I_logging_cc"].apply(null, arguments) };
+var __GLOBAL__sub_I_status_cc = Module["__GLOBAL__sub_I_status_cc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__GLOBAL__sub_I_status_cc"].apply(null, arguments) };
+var ___cxa_demangle = Module["___cxa_demangle"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["___cxa_demangle"].apply(null, arguments) };
+var ___emscripten_environ_constructor = Module["___emscripten_environ_constructor"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["___emscripten_environ_constructor"].apply(null, arguments) };
+var ___emscripten_pthread_data_constructor = Module["___emscripten_pthread_data_constructor"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["___emscripten_pthread_data_constructor"].apply(null, arguments) };
+var ___errno_location = Module["___errno_location"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["___errno_location"].apply(null, arguments) };
+var ___getTypeName = Module["___getTypeName"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["___getTypeName"].apply(null, arguments) };
+var ___pthread_tsd_run_dtors = Module["___pthread_tsd_run_dtors"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["___pthread_tsd_run_dtors"].apply(null, arguments) };
+var __emscripten_atomic_fetch_and_add_u64 = Module["__emscripten_atomic_fetch_and_add_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__emscripten_atomic_fetch_and_add_u64"].apply(null, arguments) };
+var __emscripten_atomic_fetch_and_and_u64 = Module["__emscripten_atomic_fetch_and_and_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__emscripten_atomic_fetch_and_and_u64"].apply(null, arguments) };
+var __emscripten_atomic_fetch_and_or_u64 = Module["__emscripten_atomic_fetch_and_or_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__emscripten_atomic_fetch_and_or_u64"].apply(null, arguments) };
+var __emscripten_atomic_fetch_and_sub_u64 = Module["__emscripten_atomic_fetch_and_sub_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__emscripten_atomic_fetch_and_sub_u64"].apply(null, arguments) };
+var __emscripten_atomic_fetch_and_xor_u64 = Module["__emscripten_atomic_fetch_and_xor_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__emscripten_atomic_fetch_and_xor_u64"].apply(null, arguments) };
+var __get_environ = Module["__get_environ"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__get_environ"].apply(null, arguments) };
+var __register_pthread_ptr = Module["__register_pthread_ptr"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["__register_pthread_ptr"].apply(null, arguments) };
+var _emscripten_async_run_in_main_thread = Module["_emscripten_async_run_in_main_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_async_run_in_main_thread"].apply(null, arguments) };
+var _emscripten_atomic_add_u64 = Module["_emscripten_atomic_add_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_add_u64"].apply(null, arguments) };
+var _emscripten_atomic_and_u64 = Module["_emscripten_atomic_and_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_and_u64"].apply(null, arguments) };
+var _emscripten_atomic_cas_u64 = Module["_emscripten_atomic_cas_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_cas_u64"].apply(null, arguments) };
+var _emscripten_atomic_exchange_u64 = Module["_emscripten_atomic_exchange_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_exchange_u64"].apply(null, arguments) };
+var _emscripten_atomic_load_f32 = Module["_emscripten_atomic_load_f32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_load_f32"].apply(null, arguments) };
+var _emscripten_atomic_load_f64 = Module["_emscripten_atomic_load_f64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_load_f64"].apply(null, arguments) };
+var _emscripten_atomic_load_u64 = Module["_emscripten_atomic_load_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_load_u64"].apply(null, arguments) };
+var _emscripten_atomic_or_u64 = Module["_emscripten_atomic_or_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_or_u64"].apply(null, arguments) };
+var _emscripten_atomic_store_f32 = Module["_emscripten_atomic_store_f32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_store_f32"].apply(null, arguments) };
+var _emscripten_atomic_store_f64 = Module["_emscripten_atomic_store_f64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_store_f64"].apply(null, arguments) };
+var _emscripten_atomic_store_u64 = Module["_emscripten_atomic_store_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_store_u64"].apply(null, arguments) };
+var _emscripten_atomic_sub_u64 = Module["_emscripten_atomic_sub_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_sub_u64"].apply(null, arguments) };
+var _emscripten_atomic_xor_u64 = Module["_emscripten_atomic_xor_u64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_atomic_xor_u64"].apply(null, arguments) };
+var _emscripten_conditional_set_current_thread_status = Module["_emscripten_conditional_set_current_thread_status"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_conditional_set_current_thread_status"].apply(null, arguments) };
+var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_get_global_libc"].apply(null, arguments) };
+var _emscripten_is_main_browser_thread = Module["_emscripten_is_main_browser_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_is_main_browser_thread"].apply(null, arguments) };
+var _emscripten_is_main_runtime_thread = Module["_emscripten_is_main_runtime_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_is_main_runtime_thread"].apply(null, arguments) };
+var _emscripten_main_thread_process_queued_calls = Module["_emscripten_main_thread_process_queued_calls"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_main_thread_process_queued_calls"].apply(null, arguments) };
+var _emscripten_set_current_thread_status = Module["_emscripten_set_current_thread_status"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_set_current_thread_status"].apply(null, arguments) };
+var _emscripten_set_thread_name = Module["_emscripten_set_thread_name"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_set_thread_name"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread = Module["_emscripten_sync_run_in_main_thread"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_0 = Module["_emscripten_sync_run_in_main_thread_0"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_0"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_1 = Module["_emscripten_sync_run_in_main_thread_1"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_1"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_2 = Module["_emscripten_sync_run_in_main_thread_2"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_2"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_3 = Module["_emscripten_sync_run_in_main_thread_3"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_3"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_4 = Module["_emscripten_sync_run_in_main_thread_4"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_4"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_5 = Module["_emscripten_sync_run_in_main_thread_5"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_5"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_6 = Module["_emscripten_sync_run_in_main_thread_6"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_6"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_7 = Module["_emscripten_sync_run_in_main_thread_7"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_7"].apply(null, arguments) };
+var _emscripten_sync_run_in_main_thread_xprintf_varargs = Module["_emscripten_sync_run_in_main_thread_xprintf_varargs"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_emscripten_sync_run_in_main_thread_xprintf_varargs"].apply(null, arguments) };
+var _fflush = Module["_fflush"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_fflush"].apply(null, arguments) };
+var _free = Module["_free"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_free"].apply(null, arguments) };
+var _htonl = Module["_htonl"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_htonl"].apply(null, arguments) };
+var _htons = Module["_htons"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_htons"].apply(null, arguments) };
+var _llvm_bswap_i16 = Module["_llvm_bswap_i16"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_llvm_bswap_i16"].apply(null, arguments) };
+var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments) };
+var _llvm_round_f32 = Module["_llvm_round_f32"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_llvm_round_f32"].apply(null, arguments) };
+var _llvm_round_f64 = Module["_llvm_round_f64"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_llvm_round_f64"].apply(null, arguments) };
+var _malloc = Module["_malloc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_malloc"].apply(null, arguments) };
+var _memcpy = Module["_memcpy"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_memcpy"].apply(null, arguments) };
+var _memmove = Module["_memmove"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_memmove"].apply(null, arguments) };
+var _memset = Module["_memset"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_memset"].apply(null, arguments) };
+var _ntohs = Module["_ntohs"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_ntohs"].apply(null, arguments) };
+var _proxy_main = Module["_proxy_main"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_proxy_main"].apply(null, arguments) };
+var _pthread_self = Module["_pthread_self"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_pthread_self"].apply(null, arguments) };
+var _rintf = Module["_rintf"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_rintf"].apply(null, arguments) };
+var _sbrk = Module["_sbrk"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["_sbrk"].apply(null, arguments) };
+var establishStackSpace = Module["establishStackSpace"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["establishStackSpace"].apply(null, arguments) };
+var getTempRet0 = Module["getTempRet0"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["getTempRet0"].apply(null, arguments) };
+var runPostSets = Module["runPostSets"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["runPostSets"].apply(null, arguments) };
+var setTempRet0 = Module["setTempRet0"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["setTempRet0"].apply(null, arguments) };
+var setThrew = Module["setThrew"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["setThrew"].apply(null, arguments) };
+var stackAlloc = Module["stackAlloc"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["stackAlloc"].apply(null, arguments) };
+var stackRestore = Module["stackRestore"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["stackRestore"].apply(null, arguments) };
+var stackSave = Module["stackSave"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["stackSave"].apply(null, arguments) };
+var dynCall_di = Module["dynCall_di"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_di"].apply(null, arguments) };
+var dynCall_ff = Module["dynCall_ff"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_ff"].apply(null, arguments) };
+var dynCall_fi = Module["dynCall_fi"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_fi"].apply(null, arguments) };
+var dynCall_fii = Module["dynCall_fii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_fii"].apply(null, arguments) };
+var dynCall_fiii = Module["dynCall_fiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_fiii"].apply(null, arguments) };
+var dynCall_i = Module["dynCall_i"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_i"].apply(null, arguments) };
+var dynCall_ii = Module["dynCall_ii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_ii"].apply(null, arguments) };
+var dynCall_iid = Module["dynCall_iid"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iid"].apply(null, arguments) };
+var dynCall_iii = Module["dynCall_iii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iii"].apply(null, arguments) };
+var dynCall_iiii = Module["dynCall_iiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiii"].apply(null, arguments) };
+var dynCall_iiiii = Module["dynCall_iiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiii"].apply(null, arguments) };
+var dynCall_iiiiii = Module["dynCall_iiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiii"].apply(null, arguments) };
+var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiiiiiiii = Module["dynCall_iiiiiiiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiiiiiiiii"].apply(null, arguments) };
+var dynCall_iiiiiij = Module["dynCall_iiiiiij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiiij"].apply(null, arguments) };
+var dynCall_iiiiij = Module["dynCall_iiiiij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiij"].apply(null, arguments) };
+var dynCall_iiiiijiiiii = Module["dynCall_iiiiijiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiiijiiiii"].apply(null, arguments) };
+var dynCall_iiiij = Module["dynCall_iiiij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiij"].apply(null, arguments) };
+var dynCall_iiiijii = Module["dynCall_iiiijii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiiijii"].apply(null, arguments) };
+var dynCall_iiij = Module["dynCall_iiij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iiij"].apply(null, arguments) };
+var dynCall_iij = Module["dynCall_iij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_iij"].apply(null, arguments) };
+var dynCall_ji = Module["dynCall_ji"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_ji"].apply(null, arguments) };
+var dynCall_jiij = Module["dynCall_jiij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_jiij"].apply(null, arguments) };
+var dynCall_jijj = Module["dynCall_jijj"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_jijj"].apply(null, arguments) };
+var dynCall_v = Module["dynCall_v"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_v"].apply(null, arguments) };
+var dynCall_vi = Module["dynCall_vi"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vi"].apply(null, arguments) };
+var dynCall_viddj = Module["dynCall_viddj"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viddj"].apply(null, arguments) };
+var dynCall_vif = Module["dynCall_vif"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vif"].apply(null, arguments) };
+var dynCall_vii = Module["dynCall_vii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vii"].apply(null, arguments) };
+var dynCall_viii = Module["dynCall_viii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viii"].apply(null, arguments) };
+var dynCall_viiii = Module["dynCall_viiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiii"].apply(null, arguments) };
+var dynCall_viiiii = Module["dynCall_viiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiiii"].apply(null, arguments) };
+var dynCall_viiiiii = Module["dynCall_viiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiiiii"].apply(null, arguments) };
+var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments) };
+var dynCall_viiiijii = Module["dynCall_viiiijii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiiijii"].apply(null, arguments) };
+var dynCall_viiij = Module["dynCall_viiij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiij"].apply(null, arguments) };
+var dynCall_viiiji = Module["dynCall_viiiji"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiiji"].apply(null, arguments) };
+var dynCall_viiijj = Module["dynCall_viiijj"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiijj"].apply(null, arguments) };
+var dynCall_viiijji = Module["dynCall_viiijji"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiijji"].apply(null, arguments) };
+var dynCall_viij = Module["dynCall_viij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viij"].apply(null, arguments) };
+var dynCall_viiji = Module["dynCall_viiji"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viiji"].apply(null, arguments) };
+var dynCall_viijiii = Module["dynCall_viijiii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viijiii"].apply(null, arguments) };
+var dynCall_viijj = Module["dynCall_viijj"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viijj"].apply(null, arguments) };
+var dynCall_vij = Module["dynCall_vij"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vij"].apply(null, arguments) };
+var dynCall_viji = Module["dynCall_viji"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_viji"].apply(null, arguments) };
+var dynCall_vijii = Module["dynCall_vijii"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vijii"].apply(null, arguments) };
+var dynCall_vijj = Module["dynCall_vijj"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vijj"].apply(null, arguments) };
+var dynCall_vijjj = Module["dynCall_vijjj"] = function() {
+ assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+ assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+ return Module["asm"]["dynCall_vijjj"].apply(null, arguments) };
+;
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+Module['asm'] = asm;
+
+if (!Module["intArrayFromString"]) Module["intArrayFromString"] = function() { abort("'intArrayFromString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["intArrayToString"]) Module["intArrayToString"] = function() { abort("'intArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["ccall"]) Module["ccall"] = function() { abort("'ccall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["cwrap"]) Module["cwrap"] = function() { abort("'cwrap' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["setValue"]) Module["setValue"] = function() { abort("'setValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getValue"]) Module["getValue"] = function() { abort("'getValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["allocate"]) Module["allocate"] = function() { abort("'allocate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["getMemory"] = getMemory;
+if (!Module["Pointer_stringify"]) Module["Pointer_stringify"] = function() { abort("'Pointer_stringify' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["AsciiToString"]) Module["AsciiToString"] = function() { abort("'AsciiToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToAscii"]) Module["stringToAscii"] = function() { abort("'stringToAscii' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF8ArrayToString"]) Module["UTF8ArrayToString"] = function() { abort("'UTF8ArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF8ToString"]) Module["UTF8ToString"] = function() { abort("'UTF8ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF8Array"]) Module["stringToUTF8Array"] = function() { abort("'stringToUTF8Array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF8"]) Module["stringToUTF8"] = function() { abort("'stringToUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["lengthBytesUTF8"]) Module["lengthBytesUTF8"] = function() { abort("'lengthBytesUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF16ToString"]) Module["UTF16ToString"] = function() { abort("'UTF16ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF16"]) Module["stringToUTF16"] = function() { abort("'stringToUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["lengthBytesUTF16"]) Module["lengthBytesUTF16"] = function() { abort("'lengthBytesUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF32ToString"]) Module["UTF32ToString"] = function() { abort("'UTF32ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF32"]) Module["stringToUTF32"] = function() { abort("'stringToUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["lengthBytesUTF32"]) Module["lengthBytesUTF32"] = function() { abort("'lengthBytesUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["allocateUTF8"]) Module["allocateUTF8"] = function() { abort("'allocateUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackTrace"]) Module["stackTrace"] = function() { abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnPreRun"]) Module["addOnPreRun"] = function() { abort("'addOnPreRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnInit"]) Module["addOnInit"] = function() { abort("'addOnInit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnPreMain"]) Module["addOnPreMain"] = function() { abort("'addOnPreMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnExit"]) Module["addOnExit"] = function() { abort("'addOnExit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnPostRun"]) Module["addOnPostRun"] = function() { abort("'addOnPostRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["writeStringToMemory"]) Module["writeStringToMemory"] = function() { abort("'writeStringToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["writeArrayToMemory"]) Module["writeArrayToMemory"] = function() { abort("'writeArrayToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["writeAsciiToMemory"]) Module["writeAsciiToMemory"] = function() { abort("'writeAsciiToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["addRunDependency"] = addRunDependency;
+Module["removeRunDependency"] = removeRunDependency;
+if (!Module["ENV"]) Module["ENV"] = function() { abort("'ENV' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["FS"]) Module["FS"] = function() { abort("'FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["FS_createFolder"] = FS.createFolder;
+Module["FS_createPath"] = FS.createPath;
+Module["FS_createDataFile"] = FS.createDataFile;
+Module["FS_createPreloadedFile"] = FS.createPreloadedFile;
+Module["FS_createLazyFile"] = FS.createLazyFile;
+Module["FS_createLink"] = FS.createLink;
+Module["FS_createDevice"] = FS.createDevice;
+Module["FS_unlink"] = FS.unlink;
+if (!Module["GL"]) Module["GL"] = function() { abort("'GL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["staticAlloc"]) Module["staticAlloc"] = function() { abort("'staticAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["dynamicAlloc"]) Module["dynamicAlloc"] = function() { abort("'dynamicAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["warnOnce"]) Module["warnOnce"] = function() { abort("'warnOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["loadDynamicLibrary"]) Module["loadDynamicLibrary"] = function() { abort("'loadDynamicLibrary' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["loadWebAssemblyModule"]) Module["loadWebAssemblyModule"] = function() { abort("'loadWebAssemblyModule' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getLEB"]) Module["getLEB"] = function() { abort("'getLEB' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getFunctionTables"]) Module["getFunctionTables"] = function() { abort("'getFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["alignFunctionTables"]) Module["alignFunctionTables"] = function() { abort("'alignFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["registerFunctions"]) Module["registerFunctions"] = function() { abort("'registerFunctions' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addFunction"]) Module["addFunction"] = function() { abort("'addFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["removeFunction"]) Module["removeFunction"] = function() { abort("'removeFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getFuncWrapper"]) Module["getFuncWrapper"] = function() { abort("'getFuncWrapper' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["prettyPrint"]) Module["prettyPrint"] = function() { abort("'prettyPrint' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["makeBigInt"]) Module["makeBigInt"] = function() { abort("'makeBigInt' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["dynCall"]) Module["dynCall"] = function() { abort("'dynCall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getCompilerSetting"]) Module["getCompilerSetting"] = function() { abort("'getCompilerSetting' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackSave"]) Module["stackSave"] = function() { abort("'stackSave' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackRestore"]) Module["stackRestore"] = function() { abort("'stackRestore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackAlloc"]) Module["stackAlloc"] = function() { abort("'stackAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["establishStackSpace"] = establishStackSpace;
+if (!Module["print"]) Module["print"] = function() { abort("'print' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["printErr"]) Module["printErr"] = function() { abort("'printErr' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["dynCall_ii"] = dynCall_ii;if (!Module["ALLOC_NORMAL"]) Object.defineProperty(Module, "ALLOC_NORMAL", { get: function() { abort("'ALLOC_NORMAL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_STACK"]) Object.defineProperty(Module, "ALLOC_STACK", { get: function() { abort("'ALLOC_STACK' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_STATIC"]) Object.defineProperty(Module, "ALLOC_STATIC", { get: function() { abort("'ALLOC_STATIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_DYNAMIC"]) Object.defineProperty(Module, "ALLOC_DYNAMIC", { get: function() { abort("'ALLOC_DYNAMIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_NONE"]) Object.defineProperty(Module, "ALLOC_NONE", { get: function() { abort("'ALLOC_NONE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+
+if (memoryInitializer && !ENVIRONMENT_IS_PTHREAD) {
+ if (!isDataURI(memoryInitializer)) {
+ memoryInitializer = locateFile(memoryInitializer);
+ }
+ if (ENVIRONMENT_IS_NODE || ENVIRONMENT_IS_SHELL) {
+ var data = Module['readBinary'](memoryInitializer);
+ HEAPU8.set(data, GLOBAL_BASE);
+ } else {
+ addRunDependency('memory initializer');
+ var applyMemoryInitializer = function(data) {
+ if (data.byteLength) data = new Uint8Array(data);
+ for (var i = 0; i < data.length; i++) {
+ assert(HEAPU8[GLOBAL_BASE + i] === 0, "area for memory initializer should not have been touched before it's loaded");
+ }
+ HEAPU8.set(data, GLOBAL_BASE);
+ // Delete the typed array that contains the large blob of the memory initializer request response so that
+ // we won't keep unnecessary memory lying around. However, keep the XHR object itself alive so that e.g.
+ // its .status field can still be accessed later.
+ if (Module['memoryInitializerRequest']) delete Module['memoryInitializerRequest'].response;
+ removeRunDependency('memory initializer');
+ }
+ function doBrowserLoad() {
+ Module['readAsync'](memoryInitializer, applyMemoryInitializer, function() {
+ throw 'could not load memory initializer ' + memoryInitializer;
+ });
+ }
+ if (Module['memoryInitializerRequest']) {
+ // a network request has already been created, just use that
+ function useRequest() {
+ var request = Module['memoryInitializerRequest'];
+ var response = request.response;
+ if (request.status !== 200 && request.status !== 0) {
+ // If you see this warning, the issue may be that you are using locateFile and defining it in JS. That
+ // means that the HTML file doesn't know about it, and when it tries to create the mem init request early, does it to the wrong place.
+ // Look in your browser's devtools network console to see what's going on.
+ console.warn('a problem seems to have happened with Module.memoryInitializerRequest, status: ' + request.status + ', retrying ' + memoryInitializer);
+ doBrowserLoad();
+ return;
+ }
+ applyMemoryInitializer(response);
+ }
+ if (Module['memoryInitializerRequest'].response) {
+ setTimeout(useRequest, 0); // it's already here; but, apply it asynchronously
+ } else {
+ Module['memoryInitializerRequest'].addEventListener('load', useRequest); // wait for it
+ }
+ } else {
+ // fetch it from the network ourselves
+ doBrowserLoad();
+ }
+ }
+}
+
+
+
+/**
+ * @constructor
+ * @extends {Error}
+ * @this {ExitStatus}
+ */
+function ExitStatus(status) {
+ this.name = "ExitStatus";
+ this.message = "Program terminated with exit(" + status + ")";
+ this.status = status;
+};
+ExitStatus.prototype = new Error();
+ExitStatus.prototype.constructor = ExitStatus;
+
+var initialStackTop;
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!Module['calledRun']) run();
+ if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+}
+
+
+
+
+
+/** @type {function(Array=)} */
+function run(args) {
+ args = args || Module['arguments'];
+
+ if (runDependencies > 0) {
+ return;
+ }
+
+ writeStackCookie();
+
+ preRun();
+
+ if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
+ if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
+
+ function doRun() {
+ if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
+ Module['calledRun'] = true;
+
+ if (ABORT) return;
+
+ ensureInitRuntime();
+
+ preMain();
+
+ if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+ assert(!Module['_main'], 'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]');
+
+ postRun();
+ }
+
+ if (Module['setStatus']) {
+ Module['setStatus']('Running...');
+ setTimeout(function() {
+ setTimeout(function() {
+ Module['setStatus']('');
+ }, 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+ checkStackCookie();
+}
+Module['run'] = run;
+
+function checkUnflushedContent() {
+ // Compiler settings do not allow exiting the runtime, so flushing
+ // the streams is not possible. but in ASSERTIONS mode we check
+ // if there was something to flush, and if so tell the user they
+ // should request that the runtime be exitable.
+ // Normally we would not even include flush() at all, but in ASSERTIONS
+ // builds we do so just for this check, and here we see if there is any
+ // content to flush, that is, we check if there would have been
+ // something a non-ASSERTIONS build would have not seen.
+ // How we flush the streams depends on whether we are in NO_FILESYSTEM
+ // mode (which has its own special function for this; otherwise, all
+ // the code is inside libc)
+ var print = out;
+ var printErr = err;
+ var has = false;
+ out = err = function(x) {
+ has = true;
+ }
+ try { // it doesn't matter if it fails
+ var flush = Module['_fflush'];
+ if (flush) flush(0);
+ // also flush in the JS FS layer
+ var hasFS = true;
+ if (hasFS) {
+ ['stdout', 'stderr'].forEach(function(name) {
+ var info = FS.analyzePath('/dev/' + name);
+ if (!info) return;
+ var stream = info.object;
+ var rdev = stream.rdev;
+ var tty = TTY.ttys[rdev];
+ if (tty && tty.output && tty.output.length) {
+ has = true;
+ }
+ });
+ }
+ } catch(e) {}
+ out = print;
+ err = printErr;
+ if (has) {
+ warnOnce('stdio streams had content in them that was not flushed. you should set NO_EXIT_RUNTIME to 0 (see the FAQ), or make sure to emit a newline when you printf etc.');
+ }
+}
+
+function exit(status, implicit) {
+ checkUnflushedContent();
+
+ // if this is just main exit-ing implicitly, and the status is 0, then we
+ // don't need to do anything here and can just leave. if the status is
+ // non-zero, though, then we need to report it.
+ // (we may have warned about this earlier, if a situation justifies doing so)
+ if (implicit && Module['noExitRuntime'] && status === 0) {
+ return;
+ }
+
+ if (Module['noExitRuntime']) {
+ // if exit() was called, we may warn the user if the runtime isn't actually being shut down
+ if (!implicit) {
+ err('exit(' + status + ') called, but NO_EXIT_RUNTIME is set, so halting execution but not exiting the runtime or preventing further async execution (build with NO_EXIT_RUNTIME=0, if you want a true shutdown)');
+ }
+ } else {
+ PThread.terminateAllThreads();
+
+ ABORT = true;
+ EXITSTATUS = status;
+ STACKTOP = initialStackTop;
+
+ exitRuntime();
+
+ if (Module['onExit']) Module['onExit'](status);
+ }
+
+ Module['quit'](status, new ExitStatus(status));
+}
+
+var abortDecorators = [];
+
+function abort(what) {
+ if (Module['onAbort']) {
+ Module['onAbort'](what);
+ }
+
+ if (ENVIRONMENT_IS_PTHREAD) console.error('Pthread aborting at ' + new Error().stack);
+ if (what !== undefined) {
+ out(what);
+ err(what);
+ what = JSON.stringify(what)
+ } else {
+ what = '';
+ }
+
+ ABORT = true;
+ EXITSTATUS = 1;
+
+ var extra = '';
+ var output = 'abort(' + what + ') at ' + stackTrace() + extra;
+ if (abortDecorators) {
+ abortDecorators.forEach(function(decorator) {
+ output = decorator(output, what);
+ });
+ }
+ throw output;
+}
+Module['abort'] = abort;
+
+// {{PRE_RUN_ADDITIONS}}
+
+if (Module['preInit']) {
+ if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+ while (Module['preInit'].length > 0) {
+ Module['preInit'].pop()();
+ }
+}
+
+
+Module["noExitRuntime"] = true;
+
+if (!ENVIRONMENT_IS_PTHREAD) run();
+
+// {{POST_RUN_ADDITIONS}}
+
+
+
+
+
+// {{MODULE_ADDITIONS}}
+
+
+
diff --git a/src/web_app/wasm/webrtc/webrtc.js.mem b/src/web_app/wasm/webrtc/webrtc.js.mem
new file mode 100644
index 000000000..bfbf6bae0
Binary files /dev/null and b/src/web_app/wasm/webrtc/webrtc.js.mem differ
diff --git a/src/web_app/wasm/webrtc/webrtc.wasm b/src/web_app/wasm/webrtc/webrtc.wasm
new file mode 100644
index 000000000..5dbe0b777
Binary files /dev/null and b/src/web_app/wasm/webrtc/webrtc.wasm differ
diff --git a/src/web_app/wasm/webrtc/webrtc.wasm.map b/src/web_app/wasm/webrtc/webrtc.wasm.map
new file mode 100644
index 000000000..e69de29bb