nerdamer.core.js

/*
 * Author : Martin Donk
 * Website : http://www.nerdamer.com
 * Email : martin.r.donk@gmail.com
 * Source : https://github.com/jiggzson/nerdamer
 */

/* global trig, trigh, Infinity, define, arguments2Array, NaN  */
//externals ====================================================================
/* BigInterger.js v1.6.40 https://github.com/peterolson/BigInteger.js/blob/master/LICENSE */
//var nerdamerBigInt = typeof nerdamerBigInt !== 'undefined' ? nerdamerBigInt : require("big-integer");
/* big.js v5.2.2 https://github.com/MikeMcl/big.js/LICENCE */
//var nerdamerBigDecimal = typeof nerdamerBigDecimal !== 'undefined' ? nerdamerBigDecimal : require('big.js');

var nerdamer = (function (imports) {
    "use strict"; 

//version ======================================================================
    var version = '1.1.16';

    

//inits ========================================================================
    var _ = new Parser(); //nerdamer's parser

    //import bigInt
    var bigInt = imports.bigInt;
    var bigDec = imports.bigDec;

    //set the precision to js precision
    bigDec.set({
        precision: 250
    });

    var Groups = {};

    //container of pregenerated primes
    var PRIMES = [2, 3, 5, 7, 11, 13, 17, 19, 23, 29, 31, 37, 41, 43, 47, 53, 59, 61, 67, 71, 73, 79, 83, 89, 97, 101, 103, 107, 109, 113
                , 127, 131, 137, 139, 149, 151, 157, 163, 167, 173, 179, 181, 191, 193, 197, 199, 211, 223, 227, 229, 233, 239, 241, 251,
        257, 263, 269, 271, 277, 281, 283, 293, 307, 311, 313, 317, 331, 337, 347, 349, 353, 359, 367, 373, 379, 383, 389, 397,
        401, 409, 419, 421, 431, 433, 439, 443, 449, 457, 461, 463, 467, 479, 487, 491, 499, 503, 509, 521, 523, 541, 547, 557,
        563, 569, 571, 577, 587, 593, 599, 601, 607, 613, 617, 619, 631, 641, 643, 647, 653, 659, 661, 673, 677, 683, 691, 701,
        709, 719, 727, 733, 739, 743, 751, 757, 761, 769, 773, 787, 797, 809, 811, 821, 823, 827, 829, 839, 853, 857, 859, 863,
        877, 881, 883, 887, 907, 911, 919, 929, 937, 941, 947, 953, 967, 971, 977, 983, 991, 997, 1009, 1013, 1019, 1021, 1031,
        1033, 1039, 1049, 1051, 1061, 1063, 1069, 1087, 1091, 1093, 1097, 1103, 1109, 1117, 1123, 1129, 1151, 1153, 1163, 1171,
        1181, 1187, 1193, 1201, 1213, 1217, 1223, 1229, 1231, 1237, 1249, 1259, 1277, 1279, 1283, 1289, 1291, 1297, 1301, 1303,
        1307, 1319, 1321, 1327, 1361, 1367, 1373, 1381, 1399, 1409, 1423, 1427, 1429, 1433, 1439, 1447, 1451, 1453, 1459, 1471,
        1481, 1483, 1487, 1489, 1493, 1499, 1511, 1523, 1531, 1543, 1549, 1553, 1559, 1567, 1571, 1579, 1583, 1597, 1601, 1607,
        1609, 1613, 1619, 1621, 1627, 1637, 1657, 1663, 1667, 1669, 1693, 1697, 1699, 1709, 1721, 1723, 1733, 1741, 1747, 1753,
        1759, 1777, 1783, 1787, 1789, 1801, 1811, 1823, 1831, 1847, 1861, 1867, 1871, 1873, 1877, 1879, 1889, 1901, 1907, 1913, 1931,
        1933, 1949, 1951, 1973, 1979, 1987, 1993, 1997, 1999, 2003, 2011, 2017, 2027, 2029, 2039, 2053, 2063, 2069, 2081, 2083];

//Settings =====================================================================
    var CUSTOM_OPERATORS = {};

    var Settings = {
        //Enables/Disables call peekers. False means callPeekers are disabled and true means callPeekers are enabled.
        callPeekers: false,

        //the max number up to which to cache primes. Making this too high causes performance issues
        init_primes: 1000,

        exclude: [],
        //If you don't care about division by zero for example then this can be set to true.
        //Has some nasty side effects so choose carefully.
        suppress_errors: false,
        //the global used to invoke the libary to parse to a number. Normally cos(9) for example returns
        //cos(9) for convenience but parse to number will always try to return a number if set to true.
        PARSE2NUMBER: false,
        //this flag forces the a clone to be returned when add, subtract, etc... is called
        SAFE: false,
        //the symbol to use for imaginary symbols
        IMAGINARY: 'i',
        //the modules used to link numeric function holders
        FUNCTION_MODULES: [Math],
        //Allow certain characters
        ALLOW_CHARS: ['π'],
        //Allow nerdamer to convert multi-character variables
        USE_MULTICHARACTER_VARS: true,
        //Allow changing of power operator
        POWER_OPERATOR: '^',
        // Function catch regex
        FUNCTION_REGEX: /^\s*([a-z_][a-z0-9_]*)\(([a-z0-9_,\s]*)\)\s*:?=\s*(.+)\s*$/i,
        //The variable validation regex
        //VALIDATION_REGEX: /^[a-z_][a-z\d\_]*$/i
        VALIDATION_REGEX: /^[a-z_αAβBγΓδΔϵEζZηHθΘιIκKλΛμMνNξΞoOπΠρPσΣτTυϒϕΦχXψΨωΩ∞][0-9a-z_αAβBγΓδΔϵEζZηHθΘιIκKλΛμMνNξΞoOπΠρPσΣτTυϒϕΦχXψΨωΩ]*$/i,
        // The regex used to determine which characters should be included in implied multiplication
        IMPLIED_MULTIPLICATION_REGEX: /([\+\-\/\*]*[0-9]+)([a-z_αAβBγΓδΔϵEζZηHθΘιIκKλΛμMνNξΞoOπΠρPσΣτTυϒϕΦχXψΨωΩ]+[\+\-\/\*]*)/gi,
        //Aliases
        ALIASES: {
            'π': 'pi',
            '∞': 'Infinity'
        },
        POSITIVE_MULTIPLIERS: false,
        //Cached items
        CACHE: {},
        //Print out warnings or not
        SILENCE_WARNINGS: false,
        // Precision
        PRECISION: 21,
        // The Expression defaults to this value for decimal places
        EXPRESSION_DECP: 19,
        // The text function defaults to this value for decimal places
        DEFAULT_DECP: 16,
        //function mappings
        VECTOR: 'vector',
        PARENTHESIS: 'parens',
        SQRT: 'sqrt',
        ABS: 'abs',
        FACTORIAL: 'factorial',
        DOUBLEFACTORIAL: 'dfactorial',
        //reference pi and e
        LONG_PI: '3.14159265358979323846264338327950288419716939937510582097494459230781640628620899862803482534211706798214' +
                '808651328230664709384460955058223172535940812848111745028410270193852110555964462294895493038196',
        LONG_E: '2.718281828459045235360287471352662497757247093699959574966967627724076630353547594571382178525166427427466' +
                '39193200305992181741359662904357290033429526059563073813232862794349076323382988075319525101901',
        PI: Math.PI,
        E: Math.E,
        LOG: 'log',
        LOG10: 'log10',
        LOG10_LATEX: 'log_{10}',
        MAX_EXP: 200000,
        //The number of scientific place to round to
        SCIENTIFIC_MAX_DECIMAL_PLACES: 14,
        //True if ints should not be converted to
        SCIENTIFIC_IGNORE_ZERO_EXPONENTS: true,
        // no simplify() or solveFor() should take more ms than this
        TIMEOUT: 500,
    };

    (function () {
        Settings.CACHE.roots = {};
        var x = 40,
                y = 40;
        for(var i = 2; i <= x; i++) {
            for(var j = 2; j <= y; j++) {
                var nthpow = bigInt(i).pow(j);
                Settings.CACHE.roots[nthpow + '-' + j] = i;
            }
        }
    })();

    var __starttime = 0
    var __timeout;

    function armTimeout() {
        if (console.global &&
            console.global.tsDebugChannels &&
            console.global.tsDebugChannels["notimeout"]) {
            disarmTimeout();
            return;
        }
        __starttime = Date.now();
        __timeout = Settings.TIMEOUT;
    }

    function disarmTimeout() {
       __starttime = 0;
    }

    function checkTimeout() {
        if ((__starttime !== 0) && (Date.now() > (__starttime+__timeout))) {
            throw new Error("timeout");
        }
    }

/**
 * Class used to collect arguments for functions
 * @returns {Parser.Collection}
 */
    function Collection() {
        this.elements = [];
    }
    Collection.prototype.append = function (e) {
        this.elements.push(e);
    };
    Collection.prototype.getItems = function () {
        return this.elements;
    };
    Collection.prototype.toString = function () {
        return _.pretty_print(this.elements);
    };
    Collection.prototype.dimensions = function () {
        return this.elements.length;
    };
    Collection.prototype.text = function (options) {
        return "("+this.elements.map((e)=>e.text(options)).join(",")+")";
    };
    Collection.create = function (e) {
        var collection = new Collection();
        if(e)
            collection.append(e);
        return collection;
    };
    Collection.prototype.clone = function (elements) {
        const c = Collection.create();
        c.elements = this.elements.map((e)=>e.clone());
        return c;
    };
    Collection.prototype.expand = function (options) {
        this.elements = this.elements.map((e)=>_.expand(e, options));
        return this;
    };

    Collection.prototype.evaluate = function () {
        this.elements = this.elements.map((e)=>_.evaluate(e, options));
        return this;
    };

    Collection.prototype.map = function (lambda) {
        const c2 = this.clone();
        c2.elements = c2.elements.map((x,i)=>lambda(x,i+1));
        return c2;
    };

     // Returns the result of adding the argument to the vector
     Collection.prototype.add = function (c2) {
        return block('SAFE', function () {
            var V = c2.elements || c2;
            if(this.elements.length !== V.length) {
                return null;
            }
            return this.map(function (x, i) {
                return _.add(x, V[i - 1]);
            });
        }, undefined, this);
    }

    // Returns the result of subtracting the argument from the vector
    Collection.prototype.subtract = function (vector) {
        return block('SAFE', function () {
            var V = vector.elements || vector;
            if(this.elements.length !== V.length) {
                return null;
            }
            return this.map(function (x, i) {
                return _.subtract(x, V[i - 1]);
            });
        }, undefined, this);
    }

    //Add the groups. These have been reorganized as of v0.5.1 to make CP the highest group
    //The groups that help with organizing during parsing. Note that for FN is still a function even
    //when it's raised to a symbol, which typically results in an EX
    var N = Groups.N = 1; // A number
    var P = Groups.P = 2; // A number with a rational power e.g. 2^(3/5).
    var S = Groups.S = 3; // A single variable e.g. x.
    var EX = Groups.EX = 4; // An exponential
    var FN = Groups.FN = 5; // A function
    var PL = Groups.PL = 6; // A symbol/expression having same name with different powers e.g. 1/x + x^2
    var CB = Groups.CB = 7; // A symbol/expression composed of one or more variables through multiplication e.g. x*y
    var CP = Groups.CP = 8; // A symbol/expression composed of one variable and any other symbol or number x+1 or x+y

    var CONST_HASH = Settings.CONST_HASH = '#';

    var PARENTHESIS = Settings.PARENTHESIS;

    var SQRT = Settings.SQRT;

    var ABS = Settings.ABS;

    var FACTORIAL = Settings.FACTORIAL;

    var DOUBLEFACTORIAL = Settings.DOUBLEFACTORIAL;

    //the storage container "memory" for parsed expressions
    var EXPRESSIONS = [];

    //variables
    var VARS = {};

    //the container used to store all the reserved functions
    var RESERVED = [];

    var WARNINGS = [];

    var USER_FUNCTIONS = [];

    /**
     * Use this when errors are suppressible
     * @param {String} msg
     * @param {object} ErrorObj
     */
    var err = function (msg, ErrorObj) {
        if(!Settings.suppress_errors) {
            if(ErrorObj)
                throw new ErrorObj(msg);
            else
                throw new Error(msg);
        }
    };

//Utils ========================================================================
    var customError = function (name) {
        var E = function (message) {
            this.name = name;
            this.message = message !== undefined ? message : '';
            var error = new Error(this.message);
            error.name = this.name;
            this.stack = error.stack;
        }; //create an empty error
        E.prototype = Object.create(Error.prototype);
        return E;
    };

    /**
     * Checks to see if value is one of nerdamer's reserved names
     * @param {String} value
     * @return boolean
     */
    var isReserved = function (value) {
        return RESERVED.indexOf(value) !== -1;
    };

    /**
     * Checks to see that all symbols in array are the same
     * @param {Symbol[]} arr
     * @returns {bool}
     */
    var allSame = function (arr) {
        var last = arr[0];
        for(var i = 1, l = arr.length; i < l; i++)
            if(!arr[i].equals(last))
                return false;
        return true;
    };

    /**
     * Used to pass warnings or low severity errors about the library
     * @param msg
     */
    var warn = function (msg) {
        WARNINGS.push(msg);
        if(Settings.SHOW_WARNINGS && console && console.warn) {
            console.warn(msg);
        }
    };

    /**
     * Enforces rule: "must start with a letter or underscore and
     * can have any number of underscores, letters, and numbers thereafter."
     * @param name The name of the symbol being checked
     * @param {String} typ - The type of symbols that's being validated
     * @throws {Exception}  - Throws an exception on fail
     */
    var validateName = function (name, typ) {
        typ = typ || 'variable';
        if(Settings.ALLOW_CHARS.indexOf(name) !== -1)
            return;
        var regex = Settings.VALIDATION_REGEX;
        if(!(regex.test(name))) {
            throw new InvalidVariableNameError(name + ' is not a valid ' + typ + ' name');
        }
    };

    /**
     * Convert number from scientific format to decimal format
     * @param {Number} num
     */
    var scientificToDecimal = function (num) {
        var nsign = Math.sign(num);
        //remove the sign
        num = Math.abs(num);
        //if the number is in scientific notation remove it
        if(/\d+\.?\d*e[\+\-]*\d+/i.test(num)) {
            var zero = '0',
                    parts = String(num).toLowerCase().split('e'), //split into coeff and exponent
                    e = parts.pop(), //store the exponential part
                    l = Math.abs(e), //get the number of zeros
                    sign = e / l,
                    coeff_array = parts[0].split('.');
            if(sign === -1) {
                l = l - coeff_array[0].length;
                if(l < 0) {
                    num = coeff_array[0].slice(0, l) + '.' + coeff_array[0].slice(l) + (coeff_array.length === 2 ? coeff_array[1] : '');
                }
                else {
                    num = zero + '.' + new Array(l + 1).join(zero) + coeff_array.join('');
                }
            }
            else {
                var dec = coeff_array[1];
                if(dec)
                    l = l - dec.length;
                if(l < 0) {
                    num = coeff_array[0] + dec.slice(0, l) + '.' + dec.slice(l);
                }
                else {
                    num = coeff_array.join('') + new Array(l + 1).join(zero);
                }
            }
        }

        return nsign < 0 ? '-' + num : num;
    };
    /**
     * Checks if number is a prime number
     * @param {Number} n - the number to be checked
     */
    var isPrime = function (n) {
        var q = Math.floor(Math.sqrt(n));
        for(var i = 2; i <= q; i++) {
            if(n % i === 0)
                return false;
        }
        return true;
    };

    /**
     * Generates an object with known variable value for evaluation
     * @param {String} variable
     * @param {any} value Any stringifyable object
     * @returns {Object} 
     */
    var knownVariable = function (variable, value) {
        var o = {};
        o[variable] = value;
        return o;
    };

    /**
     * Checks if n is a number
     * @param {any} n
     */
    var isNumber = function (n) {
        return /^\d+\.?\d*$/.test(n);
    };

    /**
     * Checks to see if an array contains only numeric values
     * @param {Array} arr
     */
    var allNumeric = function (arr) {
        for(var i = 0; i < arr.length; i++)
            if(!isNumber(arr[i]))
                return false;
        return true;
    };
    /**
     * Checks to see if a number or Symbol is a fraction
     * @param {Number|Symbol} num
     * @returns {boolean}
     */
    var isFraction = function (num) {
        if(isSymbol(num))
            return isFraction(num.multiplier.toDecimal());
        return (num % 1 !== 0);
    };

    /**
     * Checks to see if the object provided is a Symbol
     * @param {Object} obj
     */
    var isSymbol = function (obj) {
        return (obj instanceof Symbol);
    };

    /**
     * Checks to see if the object provided is an Expression
     * @param {Object} obj
     */
    var isExpression = function (obj) {
        return (obj instanceof Expression);
    };

    /**
     * This method traverses the symbol structure and grabs all the variables in a symbol. The variable
     * names are then returned in alphabetical order.
     * @param {Symbol} obj
     * @param {Boolean} poly
     * @param {Object} vars - An object containing the variables. Do not pass this in as it generated
     * automatically. In the future this will be a Collector object.
     * @returns {String[]} - An array containing variable names
     */
    var variables = function (obj, poly, vars) {
        vars = vars || {
            c: [],
            add: function (value) {
                if(this.c.indexOf(value) === -1 && isNaN(value))
                    this.c.push(value);
            }
        };

        if(isSymbol(obj)) {
            var group = obj.group,
                    prevgroup = obj.previousGroup;
            if(group === EX)
                variables(obj.power, poly, vars);

            if(group === CP || group === CB || prevgroup === CP || prevgroup === CB) {
                for(var x in obj.symbols) {
                    variables(obj.symbols[x], poly, vars);
                }
            }
            else if(group === S || prevgroup === S) {
                //very crude needs fixing. TODO
                if(!(obj.value === 'e' || obj.value === 'pi' || obj.value === Settings.IMAGINARY))
                    vars.add(obj.value);
            }
            else if(group === PL || prevgroup === PL) {
                variables(firstObject(obj.symbols), poly, vars);
            }
            else if(group === EX) {
                if(!isNaN(obj.value))
                    vars.add(obj.value);
                variables(obj.power, poly, vars);
            }
            else if(group === FN && !poly) {
                for(var i = 0; i < obj.args.length; i++) {
                    variables(obj.args[i], poly, vars);
                }
            }
        }

        return vars.c.sort();
    };

    /**
     * Returns the sum of an array
     * @param {Array} arr
     * @param {boolean} toNumber
     * @returns {Symbol}
     */
    var arraySum = function (arr, toNumber) {
        var sum = new Symbol(0);
        for(var i = 0; i < arr.length; i++) {
            var x = arr[i];
            // Convert to symbol if not
            sum = _.add(sum, !isSymbol(x) ? _.parse(x) : x);
        }

        return toNumber ? Number(sum) : sum;
    };

    /**
     * Separates out the variables into terms of variabls.
     * e.g. x+y+x*y+sqrt(2)+pi returns
     * {x: x, y: y, x y: x*y, constants: sqrt(2)+pi
     * @param {type} symbol
     * @param {type} o
     * @returns {undefined}
     * @throws {Error} for exponentials
     */
    var separate = function (symbol, o) {
        symbol = _.expand(symbol);
        o = o || {};
        var insert = function (key, sym) {
            if(!o[key])
                o[key] = new Symbol(0);
            o[key] = _.add(o[key], sym.clone());
        };
        symbol.each(function (x) {
            if(x.isConstant('all')) {
                insert('constants', x);
            }
            else if(x.group === S) {
                insert(x.value, x);
            }
            else if(x.group === FN && (x.fname === ABS || x.fname === '')) {
                separate(x.args[0]);
            }
            else if(x.group === EX || x.group === FN) {
                // todo: gm: this occurs with sqrt(a+1)
                return null;
            }
            else {
                insert(variables(x).join(' '), x);
            }
        });

        return o;
    };

    /**
     * Fills holes in an array with zero symbol or generates one with n zeroes
     * @param {Array} arr
     * @param {Number} n
     */
    var fillHoles = function (arr, n) {
        n = n || arr.length;
        for(var i = 0; i < n; i++) {
            var sym = arr[i];
            if(!sym)
                arr[i] = new Symbol(0);
        }
        return arr;
    };

    /**
     *
     * Checks to see if the object provided is a Vector
     * @param {Object} obj
     */
    var isVector = function (obj) {
        return (obj instanceof Vector);
    };

    var isCollection = function (obj) {
        return (obj instanceof Collection);
    };

    /**
     * Checks to see if the object provided is a Matrix
     * @param {Object} obj
     */
    var isMatrix = function (obj) {
        return (obj instanceof Matrix);
    };

    var isSet = function (obj) {
        return (obj instanceof Set);
    };

    /**
     * Checks to see if a symbol is in group N
     * @param {Symbol} symbol
     */
    var isNumericSymbol = function (symbol) {
        return symbol.group === N || symbol.group === P;
    };

    /**
     * Checks to see if a symbol is a variable with no multiplier nor power
     * @param {Symbol} symbol
     */
    var isVariableSymbol = function (symbol) {
        return symbol.group === S && symbol.multiplier.equals(1) && symbol.power.equals(1);
    };

    /**
     * Checks to see if the object provided is an Array
     * @param {Object} arr
     */
    var isArray = function (arr) {
        return Array.isArray(arr);
    };

    /**
     * Checks to see if a number is an integer
     * @param {Number} num
     */
    var isInt = function (num) {
        if (typeof num === "number") {
            return Number.isInteger(num);
        }
        return (typeof num !== "undefined") && /^[-+]?\d+e?\+?\d*$/gim.test(num.toString());
    };

    /**
     * @param {Number|Symbol} obj
     * @returns {boolean}
     */
    var isNegative = function (obj) {
        if(isSymbol(obj)) {
            obj = obj.multiplier;
        }
        return obj.lessThan(0);
    };
    /**
     * Safely stringify object
     * @param o
     */
    var stringify = function (o) {
        if(!o)
            return o;
        return String(o);
    };

    /**
     * @param {String} str
     * @returns {String} - returns a formatted string surrounded by brackets
     */
    var inBrackets = function (str) {
        return '(' + str + ')';
    };

    /**
     * A helper function to replace parts of string
     * @param {String} str - The original string
     * @param {Integer} from - The starting index
     * @param {Integer} to - The ending index
     * @param {String} with_str - The replacement string
     * @returns {String} - A formatted string
     */
    var stringReplace = function (str, from, to, with_str) {
        return str.substr(0, from) + with_str + str.substr(to, str.length);
    };

    /**
     * the Parser uses this to check if it's allowed to convert the obj to type Symbol
     * @param {Object} obj
     * @returns {boolean}
     */
    var customType = function (obj) {
        return obj !== undefined && obj.custom;
    };

    /**
     * Checks to see if numbers are both negative or are both positive
     * @param {Number} a
     * @param {Number} b
     * @returns {boolean}
     */
    var sameSign = function (a, b) {
        return (a < 0) === (b < 0);
    };

    /**
     * A helper function to replace multiple occurences in a string. Takes multiple arguments
     * @example format('{0} nice, {0} sweet', 'something')
     * //returns 'something nice, something sweet'
     */
    var format = function () {
        var args = [].slice.call(arguments),
                str = args.shift();
        var new_str = str.replace(/{(\d+)}/g, function (match, index) {
            var arg = args[index];
            return typeof arg === 'function' ? arg() : arg;
        });

        return new_str;
    };

    /**
     * Generates an array with values within a range. Multiplies by a step if provided
     * @param {Number} start
     * @param {Number} end
     * @param {Number} step
     */
    var range = function (start, end, step) {
        var arr = [];
        step = step || 1;
        for(var i = start; i <= end; i++)
            arr.push(i * step);
        return arr;
    };

    /**
     * Returns an array of all the keys in an array
     * @param {Object} obj
     * @returns {Array}
     */
    var keys = Object.keys;

    /**
     * Returns the first encountered item in an object. Items do not have a fixed order in objects
     * so only use if you need any first random or if there's only one item in the object
     * @param {Object} obj
     * @param {String} key Return this key as first object
     * @param {Boolean} both
     * @returns {*}
     */
    var firstObject = function (obj, key, both) {
        for(var x in obj)
            break;
        if(key)
            return x;
        if(both)
            return {
                key: x,
                obj: obj[x]
            };
        return obj[x];
    };

    /**
     * Substitutes out variables for two symbols, parses them to a number and them compares them numerically
     * @param {Symbol} sym1
     * @param {Symbol} sym2
     * @param {String[]} vars - an optional array of variables to use
     * @returns {bool}
     */
    var compare = function (sym1, sym2, vars) {
        var n = 5; //a random number between 1 and 5 is good enough
        var scope = {}; // scope object with random numbers generated using vars
        var comparison;
        for(var i = 0; i < vars.length; i++)
            scope[vars[i]] = new Symbol(Math.floor(Math.random() * n) + 1);
        block('PARSE2NUMBER', function () {
            comparison = _.parse(sym1, scope).equals(_.parse(sym2, scope));
        });
        return comparison;
    };

    /**
     * Is used to set a user defined function using the function assign operator and also
     * is used to set a user defined JavaScript function using the function assign operator
     * @param {string | Function} fnName
     * @param {string[]} [fnParams]
     * @param {string} [fnBody]
     * @returns {boolean}
     */
    var setFunction = function (fnName, fnParams, fnBody) {
        if (!fnParams) {
            var fnNameType = typeof fnName;

            // Option setFunction('f(x)=x^2+2'), setFunction('f(x):=x^2+2')
            if (fnNameType === 'string') {
                if (!/:?=/.test(fnName)) {
                    return false;
                }

                var match = Settings.FUNCTION_REGEX.exec(fnName);
                if (!match) {
                    return false;
                }
                var [, fName, fParams, fBody] = match;
                fnName = fName;
                fnParams = fParams.split(',').map(arg => arg.trim());
                fnBody = fBody;
            }

            // Option setFunction(function fox(x) { return x^2; })
            else if (fnNameType === 'function') {
                var jsFunction = fnName;
                var jsName = jsFunction.name;
                validateName(jsName);
                if (!isReserved(jsName)) {
                    C.Math2[jsName] = jsFunction;
                    _.functions[jsName] = [, jsFunction.length];

                    if (!USER_FUNCTIONS.includes(jsName)) {
                        USER_FUNCTIONS.push(jsName);
                    }
                    return true;
                }
                return false;
            } else {
                return false;
            }
        }

        fnName = fnName.trim();
        validateName(fnName);

        // Option setFunction('f(x)', ['x'], 'x^2+2') or setFunction('f(x)=x^2+2'), setFunction('f(x):=x^2+2')
        if(!isReserved(fnName)) {
            fnParams = fnParams || variables(_.parse(fnBody));
            fnParams = fnParams.map((p) => p.trim());
            // The function gets set to PARSER.mapped function which is just
            // a generic function call.
            _.functions[fnName] = [_.mapped_function, fnParams.length, {
                    name: fnName,
                    params: fnParams,
                    body: fnBody
                }];

            if (!USER_FUNCTIONS.includes(fnName)) {
                USER_FUNCTIONS.push(fnName);
            }

            return true;
        }
        return false;
    };

    /**
     * Clears all user defined functions
     */
    var clearFunctions = function () {
        for(var name of USER_FUNCTIONS) {
            delete C.Math2[name];
            delete _.functions[name];
        }
    }

    /**
     * Returns the minimum number in an array
     * @param {Array} arr
     * @returns {Number}
     */
    var arrayMax = function (arr) {
        return Math.max.apply(undefined, arr);
    };

    /**
     * Returns the maximum number in an array
     * @param {Array} arr
     * @returns {Number}
     */
    var arrayMin = function (arr) {
        return Math.min.apply(undefined, arr);
    };

    /**
     * Checks to see if two arrays are equal
     * @param {Array} arr1 
     * @param {Array} arr2 
     */
    var arrayEqual = function (arr1, arr2) {
        arr1.sort();
        arr2.sort();

        // The must be of the same length
        if(arr1.length === arr2.length) {
            for(var i = 0; i < arr1.length; i++) {
                // If any two items don't match we're done
                if(arr1[i] !== arr2[i]) {
                    return false;
                }
            }
            // Otherwise they're equal
            return true;
        }

        return false;
    };

    /**
     * Clones array with clonable items
     * @param {Array} arr
     * @returns {Array}
     */
    var arrayClone = function (arr) {
        var new_array = [], l = arr.length;
        for(var i = 0; i < l; i++)
            new_array[i] = arr[i].clone();
        return new_array;
    };

    /**
     * Fills numbers between array values
     * @param {Numbers[]} arr
     * @param {Integer} slices
     */
    var arrayAddSlices = function (arr, slices) {
        slices = slices || 20;
        var retval = [];
        var c, delta, e;
        retval.push(arr[0]); //push the beginning
        for(var i = 0; i < arr.length - 1; i++) {
            c = arr[i];
            delta = arr[i + 1] - c; //get the difference
            e = delta / slices; //chop it up in the desired number of slices
            for(var j = 0; j < slices; j++) {
                c += e; //add the mesh to the last slice
                retval.push(c);
            }
        }

        return retval;
    };

    /**
     * Gets nth roots of a number
     * @param {Symbol} symbol
     * @returns {Vector}
     */
    var nroots = function (symbol) {
        var a, b;

        if(symbol.group === FN && symbol.fname === '') {
            a = Symbol.unwrapPARENS(_.parse(symbol).toLinear());
            b = _.parse(symbol.power);
        }
        else if(symbol.group === P) {
            a = _.parse(symbol.value);
            b = _.parse(symbol.power);
        }

        if(a && b && (a.group === N) && b.group === N && a.multiplier.isNegative()) {
            var _roots = [];

            var parts = Symbol.toPolarFormArray(evaluate(symbol));
            var r = parts[0];

            //var r = _.parse(a).abs().toString();

            //https://en.wikipedia.org/wiki/De_Moivre%27s_formula
            var x = _.arg(a);
            var n = b.multiplier.den.toString();
            var p = b.multiplier.num.toString();

            var formula = '(({0})^({1})*(cos({3})+({2})*sin({3})))^({4})';

            for(var i = 0; i < n; i++) {
                var t = evaluate(_.parse(format("(({0})+2*pi*({1}))/({2})", x, i, n))).multiplier.toDecimal();
                _roots.push(evaluate(_.parse(format(formula, r, n, Settings.IMAGINARY, t, p))));
            }
            return Vector.fromArray(_roots);
        }
        else if(symbol.isConstant(true, true)) {
            var sign = symbol.sign();
            var x = evaluate(symbol.abs());
            var root = _.sqrt(x);

            var _roots = [root.clone(), root.negate()];

            if(sign < 0)
                _roots = _roots.map(function (x) {
                    return _.multiply(x, Symbol.imaginary());
                });

        }
        else {
            _roots = [_.parse(symbol)];
        }

        return Vector.fromArray(_roots);
    };

    /**
     * Sorts and array given 2 parameters
     * @param {String} a
     * @param {String} b
     */
    var comboSort = function (a, b) {
        var l = a.length,
                combined = []; //the linker
        for(var i = 0; i < a.length; i++) {
            combined.push([a[i], b[i]]); //create the map
        }

        combined.sort(function (x, y) {
            return x[0] - y[0];
        });

        var na = [], nb = [];

        for(i = 0; i < l; i++) {
            na.push(combined[i][0]);
            nb.push(combined[i][1]);
        }

        return [na, nb];
    };
    /**
     * TODO: Pick a more descriptive name and better description
     * Breaks a function down into it's parts wrt to a variable, mainly coefficients
     * Example a*x^2+b wrt x
     * @param {Symbol} fn
     * @param {String} wrt
     * @param {bool} as_obj
     */
    var decompose_fn = function (fn, wrt, as_obj) {
        wrt = String(wrt); //convert to string
        var ax, a, x, b;
        if(fn.group === CP) {
            var t = _.expand(fn.clone()).stripVar(wrt);
            ax = _.subtract(fn.clone(), t.clone());
            b = t;
        }
        else
            ax = fn.clone();
        a = ax.stripVar(wrt);
        x = _.divide(ax.clone(), a.clone());
        b = b || new Symbol(0);
        if(as_obj)
            return {
                a: a,
                x: x,
                ax: ax,
                b: b
            };
        return [a, x, ax, b];
    };
    /**
     * Rounds a number up to x decimal places
     * @param {Number} x
     * @param {Number} s
     */
    var nround = function (x, s) {
        if(isInt(x)) {
            if(x >= Number.MAX_VALUE)
                return x.toString();
            return Number(x);
        }

        s = typeof s === 'undefined' ? 14 : s;
        return Math.round(x * Math.pow(10, s)) / Math.pow(10, s);
    };

    /**
     * Is used for u-substitution. Gets a suitable u for substitution. If for
     * instance a is used in the symbol then it keeps going down the line until
     * one is found that's not in use. If all letters are taken then it
     * starts appending numbers.
     * IMPORTANT! It assumes that the substitution will be undone
     * beore the user gets to interact with the object again.
     * @param {Symbol} symbol
     */
    var getU = function (symbol) {
        //start with u
        var u = 'u', //start with u
                v = u, //init with u
                c = 0, //postfix number
                vars = variables(symbol);
        //make sure this variable isn't reserved and isn't in the variable list
        while(!(RESERVED.indexOf(v) === - 1 && vars.indexOf(v) === - 1))
            v = u + c++;
        //get an empty slot. It seems easier to just push but the
        //problem is that we may have some which are created by clearU
        for(var i = 0, l = RESERVED.length; i <= l; i++)
            //reserved cannot equals false or 0 so we can safely check for a falsy type
            if(!RESERVED[i]) {
                RESERVED[i] = v; //reserve the variable
                break;
            }
        return v;
    };

    /**
     * Clears the u variable so it's no longer reserved
     * @param {String} u
     */
    var clearU = function (u) {
        var indx = RESERVED.indexOf(u);
        if(indx !== -1)
            RESERVED[indx] = undefined;
    };

    /**
     * Loops through each item in object and calls function with item as param
     * @param {Object|Array} obj
     * @param {Function} fn
     */
    var each = function (obj, fn) {
        if(isArray(obj)) {
            var l = obj.length;
            for(var i = 0; i < l; i++)
                fn.call(obj, i);
        }
        else {
            for(var x in obj)
                if(obj.hasOwnProperty(x))
                    fn.call(obj, x);
        }
    };

    /**
     * Checks to see if a number is an even number
     * @param {Number} num
     * @returns {boolean}
     */
    var even = function (num) {
        return num % 2 === 0;
    };

    /**
     * Checks to see if a fraction is divisible by 2
     * @param {Number} num
     * @returns {boolean}
     */
    var evenFraction = function (num) {
        return 1 / (num % 1) % 2 === 0;
    };

    /**
     * Strips duplicates out of an array
     * @param {Array} arr
     */
    var arrayUnique = function (arr) {
        var l = arr.length, a = [];
        for(var i = 0; i < l; i++) {
            var item = arr[i];
            if(a.indexOf(item) === -1)
                a.push(item);
        }
        return a;
    };

    /**
     * Gets all the variables in an array of Symbols
     * @param {Symbol[]} arr 
     */
    var arrayGetVariables = function (arr) {
        var vars = variables(arr[0], null, null, true);

        //get all variables
        for(var i = 1, l = arr.length; i < l; i++)
            vars = vars.concat(variables(arr[i]));
        //remove duplicates
        vars = arrayUnique(vars).sort();

        //done
        return vars;
    };

    /**
     * Removes duplicates from an array. Returns a new array
     * @param {Array} arr
     * @param {Function} condition
     */
    var removeDuplicates = function (arr, condition) {
        var conditionType = typeof condition;

        if(conditionType !== 'function' || conditionType === 'undefined') {
            condition = function (a, b) {
                return a === b;
            };
        }

        var seen = [];

        while(arr.length) {
            var a = arr[0];
            //only one element left so we're done
            if(arr.length === 1) {
                seen.push(a);
                break;
            }
            var temp = [];
            seen.push(a); //we already scanned these
            for(var i = 1; i < arr.length; i++) {
                var b = arr[i];
                //if the number is outside the specified tolerance
                if(!condition(a, b))
                    temp.push(b);
            }
            //start over with the remainder
            arr = temp;
        }

        return seen;
    };

    /**
     * Reserves the names in an object so they cannot be used as function names
     * @param {Object} obj
     */
    var reserveNames = function (obj) {
        var add = function (item) {
            if(RESERVED.indexOf(item) === -1)
                RESERVED.push(item);
        };

        if(typeof obj === 'string')
            add(obj);
        else {
            each(obj, function (x) {
                add(x);
            });
        }
    };

    /**
     * Removes an item from either an array or an object. If the object is an array, the index must be
     * specified after the array. If it's an object then the key must be specified
     * @param {Object|Array} obj
     * @param {Integer} indexOrKey
     */
    var remove = function (obj, indexOrKey) {
        var result;
        if(isArray(obj)) {
            result = obj.splice(indexOrKey, 1)[0];
        }
        else {
            result = obj[indexOrKey];
            delete obj[indexOrKey];
        }
        return result;
    };

    /**
     * Creates a temporary block in which one of the global settings is temporarily modified while
     * the function is called. For instance if you want to parse directly to a number rather than have a symbolic
     * answer for a period you would set PARSE2NUMBER to true in the block.
     * @example block('PARSE2NUMBER', function(){//symbol being parsed to number}, true);
     * @param {String} setting - The setting being accessed
     * @param {Function} f
     * @param {boolean} opt - The value of the setting in the block
     * @param {String} obj - The obj of interest. Usually a Symbol but could be any object
     */
    var block = function (setting, f, opt, obj) {
        var current_setting = Settings[setting];
        Settings[setting] = opt === undefined ? true : !!opt;
        var retval = f.call(obj);
        Settings[setting] = current_setting;
        return retval;
    };

    /**
     * provide a mechanism for accessing functions directly. Not yet complete!!!
     * Some functions will return undefined. This can maybe just remove the
     * function object at some point when all functions are eventually
     * housed in the global function object. Returns ALL parser available
     * functions. Parser.functions may not contain all functions
     */
    var importFunctions = function () {
        var o = {};
        for(var x in _.functions)
            o[x] = _.functions[x][0];
        return o;
    };

    /**
     * Converts function arguments to an array. Now used by gcd and lcm in Algebra.js :)
     * @param {Array|object} obj
     */
    var arguments2Array = function (obj) {
        return [].slice.call(obj);
    };

    /**
     * Returns the coefficients of a symbol given a variable. Given ax^2+b^x+c, it divides
     * each nth term by x^n.
     * @param {Symbol} symbol
     * @param {Symbol} wrt
     */
    var getCoeffs = function (symbol, wrt, info) {
        var coeffs = [];
        //we loop through the symbols and stick them in their respective
        //containers e.g. y*x^2 goes to index 2
        symbol.each(function (term) {
            if(term.contains(wrt)) {
                //we want only the coefficient which in this case will be everything but the variable
                //e.g. a*b*x -> a*b if the variable to solve for is x
                var coeff = term.stripVar(wrt),
                        x = _.divide(term.clone(), coeff.clone()),
                        p = x.power.toDecimal();
            }
            else {
                coeff = term;
                p = 0;
            }
            var e = coeffs[p];
            //if it exists just add it to it
            coeffs[p] = e ? _.add(e, coeff) : coeff;

        }, true);

        for(var i = 0; i < coeffs.length; i++)
            if(!coeffs[i])
                coeffs[i] = new Symbol(0);
        //fill the holes
        return coeffs;
    };

    /**
     * As the name states. It forces evaluation of the expression
     * @param {Symbol} symbol
     * @param {Symbol} o
     */
    var evaluate = function (symbol, o) {
        return block('PARSE2NUMBER', function () {
            return _.parse(symbol, o);
        }, true);
    };

    /**
     * Converts an array to a vector. Consider moving this to Vector.fromArray
     * @param {String[]|String|Symbol|Number|Number[]} x
     */
    var convertToVector = function (x) {
        if(isArray(x)) {
            var vector = new Vector([]);
            for(var i = 0; i < x.length; i++)
                vector.elements.push(convertToVector(x[i]));
            return vector;
        }
        //Ensure that a nerdamer ready object is returned
        if(!isSymbol(x))
            return _.parse(x);
        return x;
    };

    /**
     * Generates prime numbers up to a specified number
     * @param {Number} upto
     */
    var generatePrimes = function (upto) {
        //get the last prime in the array
        var last_prime = PRIMES[PRIMES.length - 1] || 2;
        //no need to check if we've already encountered the number. Just check the cache.
        for(var i = last_prime; i < upto; i++) {
            if(isPrime(i))
                PRIMES.push(i);
        }
    };
    /**
     * Checks to see if all arguments are numbers
     * @param {object} args
     */
    var allNumbers = function (args) {
        for(var i = 0; i < args.length; i++)
            if(args[i].group !== N)
                return false;
        return true;
    };
    /*
     * Checks if all arguments aren't just all number but if they
     * are constants as well e.g. pi, e.
     * @param {object} args
     */
    var allConstants = function (args) {
        for(var i = 0; i < args.length; i++) {
            if(args[i].isPi() || args[i].isE())
                continue;
            if(!args[i].isConstant(true))
                return false;
        }
        return true;
    };

    /**
     * Used to multiply two expression in expanded form
     * @param {Symbol} a
     * @param {Symbol} b
     */
    var mix = function (a, b, opt) {
        // Flip them if b is a CP or PL and a is not
        if(b.isComposite() && !a.isComposite() || b.isLinear() && !a.isLinear()) {
            [a, b] = [b, a];
        }
        // A temporary variable to hold the expanded terms
        var t = new Symbol(0);
        if(a.isLinear()) {
            a.each(function (x) {
                // If b is not a PL or a CP then simply multiply it
                if(!b.isComposite()) {
                    var term = _.multiply(_.parse(x), _.parse(b));
                    t = _.add(t, _.expand(term, opt));
                }
                // Otherwise multiply out each term.
                else if(b.isLinear()) {
                    b.each(function (y) {
                        var term = _.multiply(_.parse(x), _.parse(y));
                        var expanded = _.expand(_.parse(term), opt);
                        t = _.add(t, expanded);
                    }, true);
                }
                else {
                    t = _.add(t, _.multiply(x, _.parse(b)));
                }
            }, true);
        }
        else {
            // Just multiply them together
            t = _.multiply(a, b);
        }

        // The expanded function is now t
        return t;
    };

//Exceptions ===================================================================
    //Is thrown for division by zero
    var DivisionByZero = customError('DivisionByZero');
    // Is throw if an error occured during parsing
    var ParseError = customError('ParseError');
    // Is thrown if the expression results in undefined
    var UndefinedError = customError('UndefinedError');
    // Is throw input is out of the function domain
    var OutOfFunctionDomainError = customError('OutOfFunctionDomainError');
    // Is throw if a function exceeds x amount of iterations
    var MaximumIterationsReached = customError('MaximumIterationsReached');
    // Is thrown if the parser receives an incorrect type
    var NerdamerTypeError = customError('NerdamerTypeError');
    // Is thrown if bracket parity is not correct
    var ParityError = customError('ParityError');
    // Is thrown if an unexpectd or incorrect operator is encountered
    var OperatorError = customError('OperatorError');
    // Is thrown if an index is out of range.
    var OutOfRangeError = customError('OutOfRangeError');
    // Is thrown if dimensions are incorrect. Mostly for matrices
    var DimensionError = customError('DimensionError');
    // Is thrown if variable name violates naming rule
    var InvalidVariableNameError = customError('InvalidVariableNameError');
    // Is thrown if the limits of the library are exceeded for a function
    // This can be that the function become unstable passed a value
    var ValueLimitExceededError = customError('ValueLimitExceededError');
    // Is throw if the value is an incorrect LH or RH value
    var NerdamerValueError = customError('NerdamerValueError');
    // Is thrown if the value is an incorrect LH or RH value
    var SolveError = customError('SolveError');
    // Is thrown for an infinite loop
    var InfiniteLoopError = customError('InfiniteLoopError');
    // Is thrown if an operator is found when there shouldn't be one
    var UnexpectedTokenError = customError('UnexpectedTokenError');

    var exceptions = {
        DivisionByZero: DivisionByZero,
        ParseError: ParseError,
        OutOfFunctionDomainError: OutOfFunctionDomainError,
        UndefinedError: UndefinedError,
        MaximumIterationsReached: MaximumIterationsReached,
        NerdamerTypeError: NerdamerTypeError,
        ParityError: ParityError,
        OperatorError: OperatorError,
        OutOfRangeError: OutOfRangeError,
        DimensionError: DimensionError,
        InvalidVariableNameError: InvalidVariableNameError,
        ValueLimitExceededError: ValueLimitExceededError,
        NerdamerValueError: NerdamerValueError,
        SolveError: SolveError,
        InfiniteLoopError: InfiniteLoopError,
        UnexpectedTokenError: UnexpectedTokenError
    };
//Math2 ========================================================================
    //This object holds additional functions for nerdamer. Think of it as an extension of the Math object.
    //I really don't like touching objects which aren't mine hence the reason for Math2. The names of the
    //functions within are pretty self-explanatory.
    //NOTE: DO NOT USE INLINE COMMENTS WITH THE MATH2 OBJECT! THIS BREAK DURING COMPILATION OF BUILDFUNCTION.
    var Math2 = {
        csc: function (x) {
            return 1 / Math.sin(x);
        },
        sec: function (x) {
            return 1 / Math.cos(x);
        },
        cot: function (x) {
            return 1 / Math.tan(x);
        },
        acsc: function (x) {
            return Math.asin(1 / x);
        },
        asec: function (x) {
            return Math.acos(1 / x);
        },
        acot: function (x) {
            return (Math.PI / 2) - Math.atan(x);
        },
        // https://gist.github.com/jiggzson/df0e9ae8b3b06ff3d8dc2aa062853bd8
        erf: function (x) {
            var t = 1 / (1 + 0.5 * Math.abs(x));
            var result = 1 - t * Math.exp(-x * x - 1.26551223 +
                    t * (1.00002368 +
                            t * (0.37409196 +
                                    t * (0.09678418 +
                                            t * (-0.18628806 +
                                                    t * (0.27886807 +
                                                            t * (-1.13520398 +
                                                                    t * (1.48851587 +
                                                                            t * (-0.82215223 +
                                                                                    t * (0.17087277)))))))))
                    );
            return x >= 0 ? result : -result;
        },
        diff: function (f) {
            var h = 0.001;

            var derivative = function (x) {
                return (f(x + h) - f(x - h)) / (2 * h);
            };

            return derivative;
        },
        median: function (...values) {
            values.sort(function (a, b) {
                return a - b;
            });

            var half = Math.floor(values.length / 2);

            if(values.length % 2)
                return values[half];

            return (values[half - 1] + values[half]) / 2.0;
        },
        /*
         * Reverses continued fraction calculation
         * @param {obj} contd
         * @returns {Number}
         */
        fromContinued: function (contd) {
            var arr = contd.fractions.slice();
            var e = 1 / arr.pop();
            for(var i = 0, l = arr.length; i < l; i++) {
                e = 1 / (arr.pop() + e);
            }
            return contd.sign * (contd.whole + e);
        },
        /*
         * Calculates continued fractions
         * @param {Number} n
         * @param {Number} x The number of places
         * @returns {Number}
         */
        continuedFraction: function (n, x) {
            x = x || 20;
            var sign = Math.sign(n); /*store the sign*/
            var absn = Math.abs(n); /*get the absolute value of the number*/
            var whole = Math.floor(absn); /*get the whole*/
            var ni = absn - whole; /*subtract the whole*/
            var c = 0; /*the counter to keep track of iterations*/
            var done = false;
            var epsilon = 1e-14;
            var max = 1e7;
            var e, w;
            var retval = {
                whole: whole,
                sign: sign,
                fractions: []
            };
            /*start calculating*/
            while(!done && ni !== 0) {
                /*invert and get the whole*/
                e = 1 / ni;
                w = Math.floor(e);
                if(w > max) {
                    /*this signals that we may have already gone too far*/
                    var d = Math2.fromContinued(retval) - n;
                    if(d <= Number.EPSILON)
                        break;
                }
                /*add to result*/
                retval.fractions.push(w);
                /*move the ni to the decimal*/
                ni = e - w;
                /*ni should always be a decimal. If we have a whole number then we're in the rounding errors*/
                if(ni <= epsilon || c >= x - 1)
                    done = true;
                c++;
            }
            /*cleanup 1/(n+1/1) = 1/(n+1) so just move the last digit one over if it's one*/
            var idx = retval.fractions.length - 1;
            if(retval.fractions[idx] === 1) {
                retval.fractions.pop();
                /*increase the last one by one*/
                retval.fractions[--idx]++;
            }
            return retval;
        },
        bigpow: function (n, p) {
            if(!(n instanceof Frac))
                n = Frac.create(n);
            if(!(p instanceof Frac))
                p = Frac.create(p);
            var retval = new Frac(0);
            if(p.isInteger()) {
                retval.num = n.num.pow(p.toString());
                retval.den = n.den.pow(p.toString());
            }
            else {
                var num = Frac.create(Math.pow(n.num, p.num));
                var den = Frac.create(Math.pow(n.den, p.num));

                retval.num = Math2.nthroot(num, p.den.toString());
                retval.den = Math2.nthroot(den, p.den);
            }
            return retval;
        },
        //http://stackoverflow.com/questions/15454183/how-to-make-a-function-that-computes-the-factorial-for-numbers-with-decimals
        gamma: function (z) {
            var g = 7;
            var C = [
                0.99999999999980993,
                676.5203681218851,
                -1259.1392167224028,
                771.32342877765313,
                -176.61502916214059,
                12.507343278686905,
                -0.13857109526572012,
                9.9843695780195716e-6,
                1.5056327351493116e-7]
                    ;

            if(z < 0.5)
                return Math.PI / (Math.sin(Math.PI * z) * Math2.gamma(1 - z));
            else {
                z -= 1;

                var x = C[0];
                for(var i = 1; i < g + 2; i++)
                    x += C[i] / (z + i);

                var t = z + g + 0.5;
                return Math.sqrt(2 * Math.PI) * Math.pow(t, (z + 0.5)) * Math.exp(-t) * x;
            }
        },
        //factorial
        bigfactorial: function (x) {
            var retval = new bigInt(1);
            for(var i = 2; i <= x; i++)
                retval = retval.times(i);
            return new Frac(retval);
        },
        //https://en.wikipedia.org/wiki/Logarithm#Calculation
        bigLog: function (x) {
            var CACHE = ["-253631954333118718762629409109262279926288908775918712466601196032/39970093576053625963957478139049824030906352922262642968060706375", "0", "24553090145869607172412918483124184864289170814122579923404694986469653261608528681589949629750677407356463601998534945057511664951799678336/35422621391945757431676178435630229283255250779216421054188228659061954317501699707236864189383591478024245495110561124597124995986978302375", "369017335340917140706044240090243368728616279239227943871048759140274862131699550043150713059889196223917527172547/335894053932612728969975338549993764554481173661218585876475837409922537622385232776657791604345125227005476864000", "24606853025626737903121303930100462245506322607985779603220820323211395607931699126390918477501325805513849611930008427268176602460462988972957593458726734897129954728102144/17750092415977639787139561330326170936321452137635322313122938207611787444311735251389066106937796085669460151963285086542745859461943369606018450213014148175716400146484375", "399073568781976806715759409052286641738926636328983929439450824555613704676637191564699164303012247386095942144825603522401740680808466858044/247958349743620302021733249049411604982786755454514947379317600613433680222511897950658049325685140346169718465773927872179874971908848116625", "1468102989495846944084741146947295378041808701256909016224309866143294556551407470861354311593351276612463858816796714569499021375899793849136855085849133702029337910502448189055357182595424959360/819363879309286303497217527375463120404739098260200279520788950777458900438307356738082930586032462601215802636320993648007907724899611296693997216938989854861043298494990214825163523387600982777", "5896704855274661767824574093605344871722790278354431422729640950821239030785642943033153793245906863203822369276271050164634206965056233097479117980782641839669/3030306850569309344013726745100070601277982132543905537366562638553198167007159067544789592089960911065181606283478843359856123992707598685058297067179343872000", "76631772943534985713873427262830314617912556928476573358548256872141516989538374761909611879922349479420014771499018155447198112155515453671128814488139633810493264352294560043912066253026059140653027326566801398784/36852092933388988649396042883218509607503204211148493545892849595498822817623842579026942621098851631842754395231561679671400197056377380063233740202370686144673585955581403046886083948450136247134308381940165804875", "3159076083816399509754948610929467278257473888282947311280653574634802580912280940686954763313882823327077171624015737719617373932318151594325834524000275847475866299387913048/1437757485694188822758304467756419845842037623148461107362957994816554782989250555362514354661961482939226272309026092009962414616417412938087494467254146002233028411865234375", "22266067259907364984531611601870291368272674573653403965630628996687370994139884833897773468149149664829922302484782423514167405397665098388400450149078982462318781750661005833037235183394221496186539779712428265837926417581952/9670030144664428565128962309657100138096047028794689249320859276197340398920725569428532293373676415359965773460364494998334259893079003125373872108770534788283842907318071170285038777091588292539102269617376180390982915567375", "14604654564989239958569331443385369522850975185358647132770022716433280072271007767111036877803328768910274400515590151934676819262085211828028638417329558229123989556376108454497813055/6090614019162516693013973409650613208227889078878781039105047015752493519149314227721984436973374032279421344818329285207124280297611253861173835238379831004010748379874393292231671808", "1901241885407696031217292877862925220917660047127261026827869027159993239567933534052663335498281439239753018507182016153657409777749792228538380379703411298411623469292891476969894084838876001545818141543890273256985768690847587711270930688/765116019778838839812655402103512685695769161212360553099732689795578904762091216998790589926057819838537805856579109910198553330075924857419395160755642371550113347465300208422126945265887065434116781678702741657275181694851670325469434625", "139459806786604751793737926146840623607010208216289543036026206208962059593900745886202214788747453279179283344350478734275973878932538430194363355795823581315329311220701640235653288975569812161436/54371368534412517053056101353618694718215711767266376573138772968257303578467926450212293233332401067673270853953399269852376592855992724934941173346260129257754416412476202526978443681584633116375", "1045669091124493070709683241190022970908640501171378776604126771144008324358233819560649021940145166254659028524319517244711645162132513416238958170819347361185944945680269442845829390112062101255500836072082817820950448463314034677353723256969344/396228259004446234921310936915931611736815598535963504660076315228798989932959459406702091180060429080345146735173591749448509810270759531977278642135591672189002006272326131885315743181289970885337574780897529347356567086535505950450897216796875", "9912919238915437302006264477931031611447467070103973106567538528951878797932559935860738745374437522819124347510590800370471910492338584284092534264608801221235029062881964101996762011296996851893455828946521/3660537472668264151218961634689665210933936249986285290553357254224360417386515311493310199319523687171757653216994741150377508234317025158302057758196429623723072084157928224798322861732880034847243894784000", "9263710175433181746575186369318246002919895649622127410824041370079225200282403368319370743363303164313395723904510539050157032684710468364067204876434546848634842333436957245275217583248805993142227630297924119330553308466662488683624783307023014909360640/3341177182697517248552428837661919299725031035849865632511882688786226888137634168024976033652753689210700218163621739078534353578510364301481093730054725078138658805025014615651043313990684347632166030359086885561104034510990826655289288319840595753002771", "5116082230713622171832327542439052727465114322479570603905499496221224653983960598946033081212909066917137546065542953865612718836914393275681318667667521726785633638189373998191090501201427906618075889744489190209584/1805752553736060443820406101277706970767657006346276183748749630179442318063568286372320188433843729960294965366346522303898609655762491623098453269916163621089005711823488749297418113474056676109581110715068124438875", "246569125619713282434448566970352231845414317018379160824176638351574938993535464763890962336882760882398479702237564384291290459961036068916857265499633061660562532011248501476114401629839742058389195725393702000011860799793778295606988057303225493814005789533570432/85307063020836305797178273029353623060860009152114361453434032434699636078115114412588719432277441055049132559782203988387794711585368296817222565434951256788867244687081233632650953850383220864394261763844194948389861147622944651546912394593164406926489862036343375", "133672026303452911046163998480860917119290576658330909785707604886881155606725822685088929236266583416708668502760907677019598002175122453170574729028452721476464728566191464897928696630979863154661704374206171469014225143/45398130975270785045482567762871405072140548998125471025451666500000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "6041693953360002800224091673336562508913199995987479264605216252220579740134601435770085920869376641180763419907442721705887169884230643795126568815123647603047739799302562095542459344811429882053086550900803768964612193941424128649976704727183797495759082741166938351872/2016766992122395667828553277997478570503475626107286343497917705446132017125079612756035254750822860815515899557855166824523851779156336235294914777307802256439645525835223691751931866188957324792276149549076500784191791380803500156776088683900346065830066370370083309875", "705868391597244582764749229356331441978820024796066870551110486625729826111158236686696326058778874201639006234449557592353247542995871491078308187261304930042019640830629526023972693107193897009168955674240659026247094657679060/231848642748474339277532000336338632910990823562381469441716922006107433404523316252618490265927265734670539384485699132080062215196462178933963957679882342083893417545858074378754089719547920901917516016346211301054206383643383", "101832160604157943093944673541651013907278188571533075311673249923948856034633446617630054761681006062910980371900782781226979391765818325065031889334563981235894369036439929651260587335544056975715076598739977065390678221999918899003881778449092038750712969437519295878491018112/32944277910571666002449086492515464541550138004002141571670657643770713783329063548790202120805341989608877739811787937782240802963962520261844114327432160788193314874913687387269408387417806176202979244637915812905426565263196954203487934225589622864145960079736633434831996625", "10655703119271468913597640479490594180964700448340778168715956712130636958373270202484276402718566314881119559090842449610957974112230306343486091910217340665146602598568991520563987490686996746558858366002301982443029430290679385551/3398412687366638541233365137084722368200311117891192348532156645374786104142009695796409107380345795998400850838706661851176885183144928701608654514812261697598380070746520197171576610572921007069104300695592751543563472456384512000", "1903039332876763837419920240543738799531131775028971323439870868730321221615515008394327723508670975623498588291298064320786970626232668956372004004897872810230178526101184611242511193415796638694370503100219710864543168952682617801833318493436174387568067811938490953495819438108686336/598806534367503338307287246320963280558134937382149405305466709787179429317914803617527827862441615350396864359976273212272586892074799651088317544101755361439294687323233086696182687664637422796995789967075271448560870681210580691574924544896656175563265378514188341796398162841796875", "525573915563826130963525826191411949262846916750432019596028344808298471293378917508549164993368392834023782480702893643486699787870059946429810070222126260200026332874480239090370088123833491499400991181659445914352500247596757005142623368/163278727324937389095822405034435687776345799835442022795533783889356344755225815267819508608559076191292900367982490827396869405536484846115955581043091229202052407483776587687967125885665493681707461345895999542381476164157058393971431375", "9263815657177858787273494705338516861045771674838057329170239610953039987023429736752079544014780707408666628475997291124805562998227296677616204140605356257712022384368492575381355563976330347792504605666631512343447560301417325154003481040250148561839861837778597346623630046623751094400/2843321709948499955095590862256744532227698001408929142548057792217790532624003190447363578048562448168721539177458065482170148482375585867230123873178100117094533143052886527452665480614620123764036974180917207421482431983407742154634391264619615289225747664532332469783301704643254076601", "407959339726114455622180187758753007349209016396248763075759257357925636039752474207685682218422721827857994768023399625060206708378433960993946156803948655098667156937949174400873748557248801874735834957795040139401560494087476967548060208243867/123780218751812156744401121690996305978134694678934447237402511116731459214498784497436358160964198336874043702652746834763131444030185151143987331404604087778514863973633941401826334750268416015224906056576641018962863645043976537664227639296000", "2547676391598917379516698439971914695230548782904479778605691338364453606537643088857116141939170899135026552016969320061900926954008522781162186995856580955090548471448276736878300717869625651893741316530109438876067419826217901657017506157997588944233677467357220316084583383623602865379325184/764562034757392298786420374672266498815021229519853724850874576419885380830752931701831256959159800764672605004880389358601658343203513177084389490286723240185146570925957286083025676875197029662038213216541352875570101363668917766225709569356861275434470568767077844675593176178611021135573625", "186545352286463730559933346565311535598243666022232037054735807289501173444103692309735768703898330430135399033529355360391658728987379385732098960609744313878477967971557204207043802935782878745271859468248704012618254203101767841517569443555143252/55399179641621656233589820996143825959365789093262978988289445625153099592463372579496245442338653053662134699646413817866770218574795378644415019944304868289119443774932782235638737888469746745621382139263856603239588594078668393194675445556640625", "664884440164786473344854955309049113269357314957985265728106924238588705533437169796551912202931185746193155801905841712503407258166135075966280435780812714252670362202091663287095423712596462690753468682634261029392794173636943978404002804413009590005984736612421172979101972556772005594499779860608/195485517776407145286424460448995460754674039560651791192647586550615878988380153730602665795647187884543361218962125172808792176382956599256188706636727418572541254480798303566840010217729386905041217793614214518363859058348249961790104618910877813067510758225302884815410347238200133693756493703875", "2614957283934314904315471338485451166053664494383241929385424599389309215073267052860464009981063483440201193771607520572077231889699858482582363845275452280606276949653970992719332472370351170732899676316967244504534154616036371979031399425846100527685/761493664432749089312665480773496290658029971027686543404885407644062485746072719559288231362060149626237939029641098328278650939665665969011529293869562636656650999759724704272743235210867676873525147820749560155294022488994426729939894753293900972032", "124843380518493746761140367283007507854364503961156704095198010255465940085534099747297600085903814014415830785663764373057896014399822131175202342399536439284123918855893825207202244831315575594886675813256448846863723093240955901916229136393454605455444105444987028391748121054399538064686074523506176/36022228212051654395480210378626648518430280334458144892889271272122662467638331091863215146548048144675657239846337165813938424387499358852301016926312083940212100001220180762189978024821166744964908871443681332664798940660421469519997746775275873085770018269706847741064037876137315001228315806659875", "827992369063043155578730871896750570951766628472810506926098505028264552046829097082095665194000002802661600196840639204300804225352337632259980703832713031790922485730615305441309917696044954289187837653933158950774246017223571461858939407386087081525130831392/236805932823686534991153393869288530368011574665859226704279685567723830696754821658770176385138917722808377962346690757191122309876922069867472518117628639913077442806147910884267694879089753138429767401700283014143248445966474839193628309668702223994071394625", "17347276886878323736540051321582548724378497839789943634071026331001588645519865992773157565595886250230140452154269197770615097377486013097979087647774513500701793885978192218455687078883766086309728287172567466406449372659680040183273634701092561727514713494914793425407149186041796935055187281744386432/4919325621804683623339606849970832094714371903709195539440424738973575902329797546592497378000858196173718145883783709223158260700365224756081275272021856393735663399552166737690038832550853145831185979094979556715294990257315369124065787473707136464772247917156232366320267601622617803514003753662109375", "137984231830526866236186357461458917020538108058615632801298091031540729111527734872044790487396302545910108285921421417358113055522725197998483383380192391312304647004240060970929072498293210057120617332323445379424867965764749534125081131327565507524502163460761/38810445792642817561168950890315210470940006613819790543653745327778579787694809782601777514116858514049585074667085399925278459138508514838268321349069481334967221455722811414399738756151414906092225265355449011152267068726417045644222323488445626292574879744000", "746567120547823334914136339633766098626636643449144032626270358619125402826113269699709721071135471625588981126637674402048519990010499180844665151971356149292818375448504122545400227696621572263621729512461528550588108384619064912224884465737417596190735966915167530332762203074440688676123756162572829692160/208334337057923929636884170505570363171441147899816815785150954417598643614152856767186132467069365605496210036171429712485182162940460120834349006784956522600679357307849981862006710239311750261522832996877712350330290831638640913932265004107623954913155144975252743257846945609734368518424172846119306643431", "64649371728330695076928013661001819989330953381731372450140483779536126948957993261299287753791770622512248630224724990234903928056275080682537641377393210728546364176267034339221558641084730052304770498929958838997239635790469536857863963589118888238069738647239076/17903951498200212327802847425913723358452100686246224008745414214690047078122925247086521362329833307849817944645647750649290248110509395628305970523384831671737569872597295947593410067364379687588919135621621162007748635920864926867870502568935739725312687094047375", "2454918942158003099688922026016393688092399295166304634317616773083386087532869193458590448918958337530406410803840837646465522656670050113548208618655070231274778592766244282964463702354872753657766121825196898916725498553882689210280080206627916046484942827487726300822318764058084323314109595329304407466188383616/674880185931325925966586583820010578979699141814417326552629206140252348822939845006845669570885271576698771404162512001549922909048916000017837898649100825976232784446638776021483802989797501705685620612986771521390439936066527738682396560462899753657942715306792783283782238662155922082005591512296007820682995125", "74018558041066162916454010680594042518462756234254788158141115244349044958441521749277686851928706433556285971088455226217644009628399441967508838553345152310730562224910795446341601049647392069373970101491741830623078126344928804029524181578945586663110848142571149861/20204153620006780689923328634586091101021423979622170579036140596085566172775051595588438592742563923428900864000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "2127032036758045513335690185608563023954009095206088224487365541995326714285119384743928987635752931664240752323937321097955456543854943206092931247498833001499955456190701695430459583885125382086777607021670447795321669948733328973350279846928613949120929250312666393359442423066212311060931469017737106028339882830848/576612418511902928757340062840968526862381326698309578771238715462180282212422302261044980131594522407066369222998903808960617461164985318633518680304995784614308979881735537678182134128319596636920719106506829571072447362052319438091347699720147003209417806230149598345068078717948025207635448205253184540936478445125", "35289653975561083576641954928762116897061274899517309102784750384002335187117263273488751066569234386120759866204372398611196356888479036949053282301027789530999737306501029700128744408015642211359442183943916106790666114870974212159410284751571905275610921784716184508440/9503006066880728386808143045924119024212377150217533250562188228062174064693375135306438120385877320162710918716613546077156389583384656340709638430674364232343609717735574035535102953482366914421205216675248471695111720986346092738728929878538430662191272737183832556131", "102633551023964794485575491065909467125458972250222581133681080524371507544152979467328048718122409841060527545925136196267751819689935599599321090571687632103850847605493223603751038996548520557330016046032671961857623066292962260173840972332108111505971231021442896036760967107060309991355545554631003681544611731245475968/27459658121882266328752886605529964804078316737648012166874496015808620265471203512606463219297059547428855195782384236337998738233668399173746663289852416697917397644234441300570212555870401420579737973722145663287124151049692290432756231390864184491891697469874600345958989433125942336757049639797225309327019275689074625", "10034393558388390065766795008210457368713365491566387292163814915435906649268119060550511145023450790393353937124495488860451123302412204483570913557762460385297770427946219119911920640306914453207097103853766023934602534502476962159682750262143380527529536498215384467975023/2667919902603322771586358077760621955455470781865624844984169443739075976572061827709528710108877015489050369589117491611045518221354793418884447632063538994046714401229510497599783726376490260140723032102883617341970952663947646017489439179953454964374887388652792446976000", "248528145263843375390386172800048509380966183384567983242213959113927668429802237067505890436957693495616107089384741585283620097982859345081736730899912519273262934785992235852866637878831878448348444611412764161078458068549719800733237024285525816723480868704742804077255242682077291713092790250511567621735004237450946304/65676865669148624809340872151906045781446981664561196686217551358486802274698228825404698950974939545099727242259547145392352658637333562345477931951890984276718673618736565926663528625796412420753961231404680876558659735251469326707567479071881966875336951133475135427640218972722939427821842173216282390058040618896484375", "7805448718805635696495809414501206964843262114470109146341305656318015059743127114324245035489577134938579856003956861881125856595981500593426840968087618241785931128978516340812066502964561231235073012672356530509663384739132686548934288703179479011016719045530855033205271548/2050525178024039744126592505352202216905491833360272553169520915020715464206141942151086176509423406413311520838568324134077402841030113427309725873344806030836314500267104070131451720947531994814710189000076651895520222646974590481497382830325485174899169093049299764813276375", "3355325071293197839434119105039673324264765809771192815982246040415580387729382404624613875653005261578877047405365032178619450963731719777167015959920645055600439987161800547901539269321100559393048973255388860193948274255340335876890491746900991668165565729269698196233805991206691196045182214641935483083662356666996922240/876402579119117579582569839757462461050855174353108858954282915644790659429341853404829661899850841645529640454766173209897510988090318303454542547519850473808789222552969933222203420847859171250332350076509996295844203965564448154484566493395403967626596213792922784509892086361572955175655987334882030766001799867659814117", "218871061991045868372866381545267589365410350294028138778572466235486397478028823720846191998825628156716190463263492304639890659254282445466806224943413446008645087186307985343574807361972238230520975439736199291019544576443791916302825193643774360055545186783819367378492631806297/56849560726416896431557940314760680962653658127458002233782028041537121216487790008085876994020812492987733987414743604239935223783349870516284048368761617736127892160849065895223288023531930411718807065209903593668117085505482007061969339237404945180379460053180570404846043136000", "5008685108365226931582937964451700746853986170633433728409171904803795018146152804690759530990140552460596075588463394200510044617816085275660078502126507209302951286606953039953843685800941558212440519542602092919776366067720586295390886070120828199562643208637974347390938772070049344991272621102622931576339988103674070876518912/1293888539680354282541277646947380627241979967611883341823378331667976045287311988103163380651334828012840330710760757271860219584371109472132211215957402251594055009937397184768184517621978947384029376766290498101728971145633139541827544539988344772578184316843734267915665730981857376872622787627370859411909330227080697966353375", "15388340113525711660227566446101909585796746979396093776960989868457211684028149502578116456785221720682202816140911944661051001675127262774824593420825587319436537346311831003212424497488485098543512314062112948777572038731823948224734505930748371522309451168088057190162878224801232/3954220582960831691377435160890656173654063611768428458807273708040518769541211737927975894584024448193835165167801976423275767590502552964407494549049777006346189436817215329891530811451811864579644894987864267389290848598289794977382504890216219362031324635609053075313568115234375", "5099039333987561374222193551155323470675617979816941646196895589439391685938046865391119484510329634015275893520725135141878751153360264368353595348921951280561029028912953500944814771064409611917475818956659775131751121312316084465321917769679881052144364834485866477379437705913911371481828140817759401117780199246301705600020671104/1303503600297679371136943454060319958680553228879031326679449263682048703103464872914972900105569835004878963701599765030590097739639045890060548760692125546754294514068052902543220382104483822438283040090444827980927544440984823535260277595466339403795403200720622852069244768910603820007632395190204569927612348189089161551951106625", "4902837141334073026145827027361937996261324349722726869116185158777439337041263482852376194988371853413467559557923410949898048139830183335197992754748294810838187068126867611615800383834975563313220497573778480109264178673389149671194149749735833378557143135481387904961537942569904075/1247045310545991266291285730016853118981099516935251861146038369985109288084420528171217942065832292739130145780833406014673689119563698528225048800794718789218267628507713621235056538202070171596177775095071513194885568843375526804796016261173388452184505503341132236719484809714335744", "38114743522716832107917466438257616720476488812538316101658139632867788464381862291240727309611460187159930652186486096300862388591521625093237019662273764387591494074792574929490381910446287947994150655077877204446864004067956087975012773988833339521775463977233068498404144221045837190392670308437391686081418318624745039402145439223552/9647001083383999453668111809775451078976046488746916070976218645431946648087171586252172936600115032316383427265217993193444199863138429602138841976586190525451324093772097241349417938578878934577091671046050326087898259692917931230974174799815198493279413438192301437068820185757869608523761456160341754512329264442115351926967120404125", "573695055225225727008803730767518906490704995929177617646275646884555707960986625481944101622708415415988844740028718027554452662358957933526173824325955904005404113684003841990198157072540659184995738719040024647370869010473254071681533880576462368600901824622431045529064651675640055917092/144509482511118816399089096021290587489594541280398871255876563615464628718527634679330291741479135415168539765887291789615790513527330600394937614433502341116068305347468133950204152174094704092402978083370792135432486240914953928188835819767755172666693219213868545854371103120604946200875", "23876960329653589647925126180903391687666378233201794403339630995420215267415575142266707357255726330536094448314199602616026935251126469221925945960901748679919435908556550271504767784553484434363646489174587463466333864577705745452492395785557425904735048180164697040313528831173448025400634629163795223739061661461986923675833880378496/5986312408594306954013526197465608559068621248896320652512228238115589875514604632230098997609482248000888567135685167138762172475788060284232459813998201719590208742091697294562538265829954186149162974972471533202880368317237508987477069872431064075005305838801862900501819963793062041081601844759452202282545840716920793056488037109375", "58168289917567723171226992383559866214094157894992327555495441698028867727845766488121900626912848698952863438654895252811583144479300382761129433911280049009362667380001406579175563745824368613319103673817094498117944856004415812877213722455299491145649879676787079744410765053845551958756701/14517067289347903655500020160671113450349743650636953726251191692074385521975132268313263723831804150872238173602847065423463131917373356798750100313145228608894881457107689499956903046984443545789053438946050974567665049237414588435796381674590098629779384355275820782532479708807512981504000", "728621890568281859295409481422447012528302594365693410763821707074444799793690738137592101239862736313347273167450056625929591960610208335290882047413011571781161008296084630072829079783328937418641417642857196346026366370059522990813537731394823630207433267854616768658990289454635793326766697884798538576055949457122067828153655416688640/181030730759516991863708593747964787874073354051675597050399087612142539517308720603687322924426591889179726492403913356461908748733972707460063017057809060190437917851790767968877215795679844983288935075688219234885360839984681619084834228226744165610073685719017596630302462070188937998558312507638434329299017584329479516410907786681093", "86855946923438322218622470067224691860808273886184997065663554841573982963995340977083049132518812923329423480393306918856650577072525633920456721265953575424233701929892019410099166322511413146891121248381648145391642571638857576890568882512129960291171866772665863159474602604647289052079991768/21485753507365901947528588896402264670781310878547726104482740647554738151100954835784115119035980523529677083504495839730499664052882400915208251594384038810917282207449860876251558307288700200910747338758723324686939379138206117634546981163355060740270734146780942696291669461182599512320099625", "2158989152301022938148680102142188531448821359505188055264665167313418619665693092337665573150374231484840948447637297247277576415460889296724813940128955070240137590073233263168835678714131062764247434144994737610229909964847568491446606012581370840699582055341626266533733744293929658949697805855362114229666626620766245630122333733703618176/531794915405164005613733454597931482878479882704956110685223892325074211694837836221759995948610212818642789132749082430059593652854659130217225506942675608692701447738732031302987802196501895840510235161825501235133794449421919927396142470196961877376701957829921152848178076410141813926924749057304222282687697297216661687583257901415465125", "139432548574396829074586704387656697097760057897628994548358619815052936481650396157428747411173567801047221928593253479330480454469358220685854351236980383914223693722868233819483137401339800304943891968050399345430243790898955416907228948287367356990263740207046902209563417267686591994743547621/34201151688775214071963206765436083445901621442002061707492082843232231754829227303539041286301398668437202547003300396162741375435703188500000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "11008517174872833286150985180322584448162884832099344969609291070844193524816852920942383850580217443209402836100467940651581092350600329145627967515818684442171571156446321228596914355704205623857871497315955269266498229823278800717909321269179839084452384509142712677235552103459737790674103994445173074670347080506698168482564009465276165824768/2689223396936080856855299215659204161946704205931885125148201643087176556822542895325191478283706585400237901215485150928036895428721912118467760766508162631903585126377676412573187912443878232521444786090510891599171741773242011017926658231638022943018461086517502584854390836347781674626615709751386455292026775663545470794167629144456268750125", "16108638074211260588800537540680707641986073914251424878121255234668558067988171568946079848860335948991834525552515669040163026131919804987340113244760738846884911038097907756220945883750502673899084880578229601870882631165510396775126850307838505063922101682333806284668762825609556049426829531780/3919363961344261777100658318137884299575193089462944554282218278496298610828757650104922583359642384253066896538203596057302203635134833545580869871333892935330950583664400555463557735723364497947986885146043017010159347046389604172186788902608216894094289769850517098027486468084407618748895626853", "34420755849180279597302103726180110022640946692592540634353734157479505420320000324260530767186132260970572450489530034440214259559325114511265075416512316229177952140217732655405289808326341696986755141965043719344169685611217958619102774617224847284122901023774956887687026904767714958090256282893003000752947427857703259704682455375442735857024/8342030311716679826889917494957593165464748884572298173556257652389845294530325764837124998293398445804458613956489096007564811101361266196542129764287084823604897187311540561857741285793447174119667215803837719660675298308873496219385226998078648428368061868944322478384684509466965129972030932418920415308276430355882329457342937549162000252625", "345888075261020004071220843714060353763382280664960929903544964118831237876694384053904571498830068831026644303797377762345709976595360421502594656308937649239978525713471393570536680412814805076323426256584504251728507416368609420882442293831684681071553766603478479006495757222912500012444787804577811/83505703731469734628961395063481893801938371516752417759131774530720075262459158384433785006689548434701904106312038822969658455364219435022841597243178757423598248565463985786213156556523685666430799283870548238467817226915680747412191245046634279766450629886904716776719219698922088211154187845632000", "1061717830619177527082296723099890392273896386613997004874669053445943252046748251883532634529759169500795452576392700472771365240996842610207274128102329096619028487369622001737128463631016494371635687841733644339636164570819431573829173533941056258744442930643735587780907310433371453992062647737259587563398111688659657406089003293576961475848704/255359631537215747979895955806995352799574790340218399351168178555478073997876110889483456972687438702262017800167048243754141722496276537685853311434069991222324039005160057724073156957530106623908696241268268096879569794431919729620178375212905203484165745866913773304319069321426245521467122472046370356725530914587807274074293673038482666015625", "274122944106300296738399632684955400761495830361663966466225652918683099779465438024846903286816813856490888796372134557295699980528187779624865098445756013563535339056233912394908544185885547842235097677765325396255649207317018754967666450708249125316192200151505568416495274671679500594656671785202496/65687592621976546250581560102201535533608158256953087745856906437400149205693427285162333502528793675585022025602144243543064185647792948495372442630333800126269123531636800213405254045262127593759539706750242430153456891792533267948231185296091297979933562727112487057234422009426868531651634706262125", "7842680480716516803148821198697967237136721860017131244266974996267074742248599085253569637183007740566941125452215834642683053334607896723447140851344501084122965014242091312411884985569341166545074688756440728922408743841592658677792796881188604773469108807869960161395759837407978596679911066586626885830991556090978327508459276025943279064965688960/1872528612245648675720382138045071131304652050696842872529163720558126655075937845539792108048310219395746259570506175902206215101518698490144716531697689534559827422735649881381597761684154409796315455445459537515308174919488497154409643876490472215352056502193150125644288086294418253309947229151074464928874881827227706992859640236086417889990541889", "5300824422251242070074569186825929119848111723012841627275830216301188228660779008353049603527567784119877706984722171178137272986345560485784907345500893648715341273841147320288851034078863843374665850852481747000237834238703248634174397792745914847774297223176674917912406659831206869442510948965571661/1261140476013707338477604677428573831791396352814802149994640617701773078174882455512668089072441176857892331468691160991310474734143842336092636848492066592397892638052212250229129355009939118431643425836944282456647571558383755315238500832868535816144280088644939696339160092963629012001958205063168000", "2220223718762215584659309059880106334425515875615107369399767892051551634000614327272260081056973863669004224981561870246078120862256383581012183852291444462730018546753183156982897386563561418424093883164027305254176874653780425452987066512563140531367766900610414277825262239199580925879453806414860409441845631158680721091621460775043562065815179617536/526383206607841251253861841374779803798480623722760367843070466043030228662340154304405180907941079883976168609082254331465595267209149963786388600028701073430773581228212441424400748220833542964971495005714483235359479470452593264280645360131482713147116366500300066771223383007216182988263355451923333319170174755334598973202740108032097242475554128875", "521891797109626296684891455959263713257353500867652268541535940159815152120871142196535233326890353914761242025931373491906127275561002910157909306979093246574207104081108188995072105948138299097848175016082947174156278439986705241571619793059501724269644447572323501261424770743329858038040685313621446524/123310256826873923765604825413207481739886340225713108649758575106598510022338480189649787216845041382860899099250547657534972156328080736149239332330143771138115695598493059325064119176038137294863053148618656356436332991079150723235214278848602671333076219529535123842212129829931654967367649078369140625", "66086044538329677372986118727999622900471937619891337714357792768200341519193500393739322894033303245376225584865369486696276607060432449792893028061817203932068085863800494054274423512956136695211796751845295921015953538329385253280866669403169919614982155350899648626481405781514434761541281229159396787287553493046927448595964103589100429722948913403008/15562137339474350565671240515273666798063901504051979980452491653975250630723677279081058884163396938548780856293034775459223871281049026140999055923743471466471830572672766633086347312178711643724485955576579988182546105048041649947277672869613992334541438784737993706482731696809943027528882927942967419447250586964258807454003775693567366165507144866375", "335377615394100148751647837967017467711612297170079949298328061159559939969228226474615711044891085626519877634842694983669611974807129333052471799687426665556738316626171408219730853872410792831871526174987402129691897433888027072807302411474690613948951673562473758814664346259109886876538510453475290967835/78715592752271462306588358880337347638000605031000575876214116610339827495261512281635361568951675037834544811575026718101166562072917855004822606752296233435017284127594847656529606648345533195437635894948829857913798336356647286032372695130461573940500785137424365840081503133157308796505622439791698116608", "20090879701618729602554170716780970848925039917987945471322994867171660307998603515745066411687983450400412739285577269751603921163835619296822801840348319742203974023505186187060251544248644338412667631232247108675504629538319425769464277309915502144443973397371136256151336255138506001292355330875114245901820438821732843540725116728866301271466614762497024/4700223519410528857298732096729483544820841497820611795617923063440946097326817340637303431283005509904481323205480729806879570430868897342398783028649633951362398196137429076844504529051072393709154483678349272930361110568616112723747726853614661953537957117231900032044221535502745676310313569997665352252492568100075191900969170979460298189170486601502625", "2904778979985524171206573028445379872240558084236464200857594814631031581387804621371822074061289363372523364167184697785570324832815972970658633551879143187709707164796663015180877412717910872234647704536817108676736661804878068078543241390828229923424191204586313620612539678930999769543756218765870513049986792/677408099044823641581658869221044375312077929976719183424865834811543737800956896926637625166844372424044003929341361734886232742770909683021563822987505236295727478159938135467975522336774471915167606673489722102077041330652185811196423400701795791669780695158730756241178262962515917389382302757366325768069625", "31270155809329751863885224732454397292230969002004953832354065319735530624996254695453061851449600345977646455072512400760539747054003851289540339425848681804190284451253462663731135337775088379954403740058084949675460445909826322297817535400604180338201322667139062500269285493417563095365899631360901732684124930296643108551710704785906431324876072470231424/7269578038000504017073007978844992319987411732848567116655821196644382777088703228960020894756722675887473977480537577509061256138261063926845643360849217556370868752909531088361229374467207196928745673402380473721018157327193509586295879051411183657185176812738231456253321187419224704301236205478184115996135940848503487199394612616742961108684539794921875", "432538822079707760382094121020421735679118830363764570640789368235407853152380328891350816400541189148550353337874309885334920995713154225799660601389784410911658967499100610376065640785585342035058364676314084595283850213942576431310823836792440218271879354669291052589804956435743500204185107215929849054782893113/100246574739326291035824954677502591279343311051719151327066341370995390423713403739043396503785261917771859220535505691760472395306543276314938287868734009582906895763073519374099272340577921671298878837400921045252035507925021904954445172372479744465666760762909731237634082051855588025732494461939980856983552000", "1914333673689206389116942789116917579088664511118582610293383428712902211612554212779880638065888518488492298586641997844141510832940409501694726851666478650414191249534733087933879981733561565249818572204932715347752949087800778646065986244657260832234479202201129845117955957242616947361016603702640821256099895469088229339240402478576285854783063612307200/442333801076281757298117784528962837115323835962460661601905131618341609371649347131724700192551574625400701487125984359494804828935577124602622582550626336986871791407398609915208114339012374456785705161994343348351473385887949809051796407340988735853810174589261300681030826392672282630613354461927208579993042968520650313621522933214063366558703422757071", "5704691626402072213006354545292364761246893919997531024861408248746241619817955824682639582830486790618668221530365426203424888737658778881721063941495350237419723855000515747725926735319471480027293210991869255971365522170749568996651406002311020883635577590045650037569906001924971041810547543163363976464780729932/1314240362076792592671773873754757443276256223533339004339330559325754574023619698171225777585408160438834449576526997055649849875516310105297894855264038450585295422343454458568152668980131977005808840141079502436391909349182185596381509091427752151860204235071122788499996991078935216686010888734471173124487937875", "451219364084386208718456142329444023337343409261545444643031014769484085278440612677813682892926852469540118625738238137458321112005189595703619178533263706811689687213128887082197330137502064260105387500552856851972124172206996205919556553246133218441769325133725631665593372188755090094541462474970525820334385058333756591222492801647110594428922046641945259392/103648250172203340865458115839764297558925693061798169434516001775068769911768281084188883278842546791612199025413573394167639925287068809631958006622842716869211374513136766899877504136929177267362862319748507372147243911522667591375015611312165464514308451222180272935398828092646393830572838772085366567154646425598388620105539619174837489536378605144891769625", "1591076564577634575701791393842535460875733974464805197283632670013516183281542903377750304419996681222758401497321278555686661981435637461350320471258386388843198706277657208526372100698700615835733712519332548607115875288787602084336341594576426630670911478276101702119972195558314357975365863803265163991961173/364433108410193393847203348728981296285742202617988970384277162225847256295865554341611171460436362780497179090329831885853324392923449579538286804729856000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "5307507148709435807261229345132535134848030343901300324623409721698217134932866488937772986386501538026693956121121771089740095760486362654754229904633476234090792827930433598453200536551779789049352131005222659995845427680686677324963223653949277037520711609343166926627713758990384011274777087968799793410506391884872456420041494598273703914689586637995139580794368/1212244290381524115082005575105703496583315188540177702780216570265159923654197746388568151706509243638302707511238539845531608313334248788980188054651601536067740709977678222790481348003085034888244447626347312094586389347535167903408519024105748523384932942441843118813819781347089702286481924493361058339731949844620763272778960860509570622673048786968660129650125", "3046577098843580578619955603029073328361298436129791931304665777036152915858575282362742008136721284817899542475666054101957899858138590963789072530710775790433466847100422875906866496318804986202089528198912098377828580031852152997907433335176267300286466072997014023120087988748396598176622765923059385876855303940720/693911859077752895978833241338902695755528613729508555938416419864772385336777924892434701804078893822446727762077537955240605927550548046309823051841326355655848406646248595628715185413852040295631448250459076043816328082561248420925930431777502622148019371383254316636979070731427737764160145097293260938978413488819", "155310926743873343426312607182060072939030765297630534544899230213054714482456829198485999782086944271490229412707980997432528653509945301574794242118433868747172279224118534460563400440670015323324602117517342201640016853927923976796453577048995243600967202462466681112804476672348206491490513419336308575442086511015101999847896197546900512764233674747415844045184/35278162986589659300679088538176070649273991865663041616088851923111175518405117391134863644540911005782372831496121355954470744169969774540892096320978686548284501139861783292226140413769665461494668479430833892857992401391262903582109993838728281915806394747833588629467613308837196269424421131934859079260185052081536487462257809987002198437182539441349474426375", "46729591025621874782758519074451728476386657576036360734358719976400940301493939192083339293779149127132651616972817165172116269307276487158069293114860391502484125554406945249728802484128756924044633825692779783425628292959170597009935305429239702926898931975023598456207165067568919757902764815108751735753431153581849/10585868084079030838651390738371141142245086465033459640458366146849314274285871375459898014414833295804139979016362796357043372316321872357817727821559232353993714062535883074661734509440994664726425399880995133711038483607773782532430879196405793694658185175583691180757783597895616920432527125993118171361116684288000", "3736372348124144720852190769710129461145889011598636925228657393934132828633132357232883470466940330848177425542748100211498184494252714616379450272611850068867816250209867530921278645286769418080018709947826876461419654782341309127709703626401211996255743831998918894661053669189312375159058718767082163156988766821194002596331826150321864927832618126580509732359424/844176851007504003627016945212023239308348428094023437269532743221937069345682900884618378849283002998220513307273333096775669556093005637615012750733216460458689282791632437851364674879152695438589692227159038555722539345972833161146108367329370564838671791241431125003401861887477969954740544092178721327724620450947646209914621007186497081420384347438812255859375", "1258774755828991281578968023382624723772927642002016270484090409043454336040857926581316994594109169123354553321469500848146015719851609220423736153365139804086413284787598253618361769125996755159571523632747129480387254164008968993734442164892486441152227433281625391753702577143985047832519062595123255569172968685060844/283659859661671181526547833415653453506477950678651675193210969173130116121017723360258249430884213011988678011357458727603413521688184521573094783291496368005697481333739504490647194454695504722542014845706216224432373442438242355188461951883454664693262684873988061018976711201351382163527093784753398257094429403691625", "84932063355292829988908961192574710493098897148701473172754949846455626381329456661808566365329266898990829247446356970454502007127269708487563279536825277374133681167235811080298134899629580318813382668399644553111080625918213250223197440426147821225593304993621451053135332451997633132772608233430131400186571793929377129211228689703376067763625568623535588709576320/19089978133324852910950469658566458037096027722326716800113107848115231563787455584278193954518442601810776347091253561956877155673550458955562102935555510392954425196165785410319126098393353878286400877305164869548380670204577544630353859009177051698096136470072137579698473017257397949994722015089768745013713383769765609613514021200888647472804720456494757423299627", "802638881530832431828249604040579750916118423833791608589560402449036920165704012070349537114920882938466635598602387718300074733476150548724726460209016834416094317724261857969955414000155807312852092720310159572547644569797512233899495300028159721348599816083166712365215075728968005941610056018023633235372936903015771583/179951197386119079732438617407921535065140503043429174394605652913879982486051627760652197484142547447000508189455126493868229565647284332735552462525598465192073558793335913005459266977086104359621022691931002488052727597513413492393525660272900161375677499228252863529934576881596384036401784035248649026076581302370304000", "25208742399375362881099811032135575360109715964024747212026245529087599633280142314962581193303683759605084995818253124445773115574470717199218828756449187055537877478033129862600982068782249943150019637186466260707552416433010545437321814115233841687700051830170191107127799355485920046505591193770164750886037885397478191534797655616745528343172318318678405576430544896/5637713398995569614196397857525646325234056219513202928587580534159596897880731043336790273040813044077153051260989730372846713618900145444802234629922717464041261370803598799826604841654608724727320798324006129524610666235998113655193642594744544226880944882342204407750193512869672849910003246504052298022468012594459974209940607450480609190841893267203392880360823875", "732332637178584560220688900268566130246820235956768724845747830959547501950765063982943061181526237061809052444110437930100210105274824607344902764184151030827266142225894655531497849161692760385938786736436977268616029862577293984376170905024712952813234949508186306774257035535805330366742322777611063402455261391021097128/163377988152179636922409938163005948596822656868040662831003991395905185823836089887990201522673196719628247106777881741843786365701135555917263285268753605514812568258179391272113405920369587922702002732667842511108732068683407168090725712401954314293193572654347237716691784386690948494003094992876867763698101043701171875", "22391374854299462107923583267570593886002658786775211597896252879708753450794332301142909715845151746786016535157797023153041007263258732991465037648536702217273897876864351559736449481285518249846264600935543582562018874574655740660800634883403597181876364712521253650744197321080655028374602772696770227741610874399454362583980465225235674816785988164157351243193265401728/4983275997188967758382167867656806681565521964135131710678447245984239733544941881418957694612909599261843693554043504855207170782744518943778096768859337980470219783210191765678908537645270392500777411134164918803949155037581108678968701961544979451081836872425574123683574475790997414488641534074873248802450108535183413970057319247033379016606809226547805269752123746375", "21252344995592269775107236774689012760750850598567799560343535731251766780016530978663079386453430272698006977668063208502408607227544322945446079708000304179073184745623740466334127867464883762843346619853325415963062181018736410570113171387891518398846617197097407612852037905687899800932343156979591740310928257766081697645/4718515378484509142377558412184183991357747235892194234377932213613746008373918923611236346330189287336493794499188640380975364991548794341177060325509698404571318037298112293926833877103554546466055612498927474225619680186119313129604319096374924037870803554153458104225741255753314955115645304948564151765516183663634546688", "76703085666560609319365659209445044957052359500745196718269665234646121134787807938680787341023203786904308047981099228357850016602203539979246579454229078497537148799349353250167621935384193502383187510928609818011142642954550330069991570983902841318203794113898871515702445720207144863877026526025447819537396146822201819435536435835285098485990260677737192230985069824/16989892821104122916312992616665764943723222199277412857053896319814438961475117951904867066845412639236790762432996309717924037467863024360211163971190006272168845197000304328480920483651558672879967350982199768255256753110375467976246339260326422891913564151453729285191351273342206198366624882195135056176502724912849575385576554208844814085228696838834665339811027625", "40153831166521391225489894857551838468150576827129133168972859441122728710165233865309084872159583787083130713473702296122465319276461991457173085312407612757280915853584698420083436946976844240063731333638150599017886937783470942007376523947840104246927580254612991191040951001539641947153847776050138532219595746056076776809812/8873576113581065493273519627544307418139908640325227196912114520903505426722086265723900326735989771660987609604507503750212298754414472822477243293638486047313990878348820573874809636084574108909615044524663712495422565151340037564156235745628465172219286664653343193162657374410926171153516871765680561505768223660055617934625", "200736374277835272485186523480177159453030082779872429648449412313247640312479214261681899286513818912991945046297334418102711629933437654377760028476767482162031641781499114859553677502002901248124750539270235098492377826240319766677856465093871367817683734079621359186477306173620331748496369122143019303740252461824523590096923561928354020960176605008889579578495073283712/44259440065125442964014453739391594153290923937737136823355312892557975399035370631521014554980129291582486968083228888083079118116286312583989433037097397252506140224404130371160608365777625538148303917306340620019882928744151294738308047800711028158277500317134537540772759486365658024194428796846364486187105343266398338060080611643110071184992193593643605709075927734375", "488459049325494693259159444507437983381645757291858092983371672334043029615965882574409808932509285079401239403272414271652617474184321852388397021836909585659327974611273820676128650810907598106588433939541654215766888212287311943387232664417347883717203611092450971786083806323404432266197250919880225892099146722474124874256523/107455855466267410923480140898552598306699341366032095904938430084768624148829473848763761936703072253841751966906142283640379336131083461646777390874405323298406517250231389493084918065243079819898691146841695350589992171102939046740169198394671965069747042621265775948217054519855346617967866614303497258042439052681849864192000", "8430374068596413768975326329313648683222744787097373111477788794692418932056901235174019333392845529821722488982447683794746518712070635063397464904489452840169472596494433874412726723065560358405027764015273789053064830528919091414531400589850704395887250756457780868677553068164933299802944396576360356896758745030955907258232257358056931680617626606715393885378887657377280/1850480358582748412767893656294669486390769246349349706200869446679212812264400876685764762211659843658541567071977813110496329850010288179702589501255367345935389050373021591572539260951149696801665953123597521983257852207280970577287472932167362521740230973547070264273850381896786822127290397075758780174083415923482640313277341120938690594859118603017930500014640169211239", "58273615882491925540881784328370957720539797010816130007322211512070634295154626813477498607761260613353633996451797686143131893884559909668805628269959901044961666535533876340116728982072626875010391195372759135469446048394835148654407846242721443845351855234347422256700864370273092971804207514736924787577569355949601385705517152/12763172138328432984573837529764902730448666594097466544652830703737195804747682450548488162227364538052585484418491914323658215406327363805353540266048943197822838925184942600367647278764952826664684839953902567694832690683467635727409976388280092262839126779730168889686628630302519063225007497707028600865624133968363921915016625", "2685278694947152969468407055109959900160804835228466214479525891103128459065131221736713585038130737099067040196326815283171857977706979990467444622550497565521863441617001097354649972660183038850033950647594754644997436624623325003537308428828750008305464174443210079059253920383411910911594636045517662796811001285984447671371943267419151220518726940455756833040934506414133888/586864816044968996825907488721678304211296267371936463272955488077666796280028127333229453342355554450708284934221461946991556216095213627059047984199091625921432110913096253352065238765240063555347292393427726758010888546427415276046238297382474708612526770055488323003698641493939145624184943388159614111350839555141202024991876221874110644879676602924730506882384603409121625", "27700345710264347957758638741952394530538598225904772664391173119594616680996031886665218221392453628824570256438960349220263575741495285780845399187013582169907518462437966962923592601721119258663490655013419675469864809004562272799012227293974254329929404036071055528766397079743200179924243479370594973626764330855493789112414191/6040997839051213541001279276287478343874107660287651711609067205111574718442229224212245187655300348484144001298428958025052162253854676210451657425437588244676589965820312500000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "80160269787574270953020489212619791839643207793889009503234879683494928396231769167082355143564723274576166638869430572977442020236299319718643894871736539109822173538266278165276591962215927816541165548699380129014840956895931285215480350321259054359835472320394089646764361802445068798451796525897304221529850133401768027469126408090577121172238802281079916258951770135485696/17444957084936455555074876721808241311651668802091828589911310253709517226715880722948267977560381436307152342821304525073651379763144281678911047276389231713860392794975453518107055568765009486973017341479560154792340888780337029481646046233967923289468141293699236815196553819373828280398488966665994092877680860643266914861837639322607761804740256920429518434353839878280875", "2352816897072623416220002134476921108405735955266703519252095150412419264317091785317803024028565851487861978477208755211589867803009700996828082850796103789009194767813611798769297617674631277847910238088040257037678126316866517601388289837575778165301828137259948173292658462765645645868094197736382683775415645307647043205988394700/510973411316690313485681833991645423802776865720580280058344111363363091616558230182669376841383375321912553771027107891991318313938505988903735114191313214327683449514676737796942389784957658395806951715454372568523597420866050825822028817422805046287798054682484158011143949412956697442991898914560191411624040490122951328364833797", "6403295584873165688372907494046202150046769667837790834896334486679541887567517050446119511695248926941383207478170182650927368177009669717288184903306689332746127845953193587519575304974203099873732502605739219028995266139383163062837007982999189114810534856227848568800302527760100163350814120545587074865568436789021082619398126713943637898657861949091545516403987546145915409024/1387794272010111535893205703999712437783041553900341112488641528986385462810448493444968969845352401058333929711237978223214186693177251566069419805757440174840170213159651962686467523533938145629444468366235554597245713128812532716616087753947246800626006504878203666972651384731498770435755225220796872155249202960801768048854869001310722927230237083418017482134588865244642658875", "82993247683514419570466529457059660634483860665557779709153549045427987672829778520201315148149878525274005978368939092115193636113741972236218502664881450367443614971109677363668874484696543982239492409231870942414193419634675024621942196087473557914167832058111113476295926250739099284241826553737074679953551191767148712684157318697/17950946423927357725787689855263532224005643859095168852729513034456208872420513601894508438640531171097082516559962755244698695622824386001219435651555513795509616906355363573638916895074349491513539093024980575852693293474288638209680085037286354050958859425647536735341886663074581909148323105020337857959651624760873736590065664000", "584891611376763781852144397260140844977346305541197362434227194779766612939978629636198589818106137319267243431810481928639442343946346034433828599323416877248326356345631611148749005937144684862502198147087702668524450709118588741606955966569427636630159793409544653944608958808602551061186799401212712216156799273254257486955348236914237644151956226336750212957092204830385441792/126256710861549838395499078249922986417488985866522660521294610280820007499099176190820291214370699289977888813109514854178180265382471972583921477022411657285850911270389720508719377071949050253246021921916685716353393018411683757067093259101151481189635423399611625009617884983318141463140199839724797412514785751549277231259345923662499623640886881048572831787168979644775390625", "4743054867460856425399742072925732465660626340183690464743217147109403130730445842673866624947360862438925194786600531200056131309608642363389833474026007798643235346104937733349791667694862514383520689594596660275306247615314272223660862212527346572811422915223417783887717426641317921972456913534338708745549252254865615725859881457906376/1021840037832289788284691535543138164288462770384961802287250236519983887262771944174557087207566030730743075334169628971336358708580124427857321953981475719503574867471090607795242192417162791762511940848493176847925838738242153177311649130718886794249673254183907621449520415060660496225939963471753122766421338241291756892571824984344625", "3784664074155769467702999785016514468281913375341134899878893061325465790589101335015569840325786070795267055386681356241209412947116340524588831510768864231937929260236754881829005065056310226407358204278658699999612596866156294195316867934035877283950841910726224355461522065773816109849107487214275801829843762482082803559183694631856772777313673086715631547326400170962722842240/813783281473223559981291694175087508812520505931454895884442580280342455516154674683217348039336712901850738745276445107477919518905155156380620466135946654952837573797479076027688866326359448543065305071605591497778941561986579230698384305536224430794233462949056326864499827444363206162251104552740175503996670997705423888382328014210171324376593090187604268086334796245552762333", "1946671258536842642381655747294621776070051525209940130115769153666368932042152311477746728678182920842238801763565726086459485050237860693394471644023999467670017470376746609892484192072297938254898880354014176373253875722410186683852253828299669530022166361304397631667133689128358365296701757782382475692465977794960109690362462330857/417774039698408581013003883929127512062321623871486379101498968145670269174833505080260389860863417408848209525427705249526516766731427603641806256289098209429110794311660844125377702016056984573671024035213045475132134896835814746425864304907974005950155657789157496389234919107772201305672421982198984613601511388413381215220924416000", "328578487723377153600821813410631465225159589727320893988991729306688663770697528156625398176929288628930496338036815910669579019719633124832162035588583242320537435554101841406566009219059042888412893352417446437227440076869427577701706713564212185163005644118869496869980925214424591264870388237079776503547314587137721633918824664946974571838634860386893404364499977966899068777016064/70382695927096628347637455030970644630942872888311870124896575877585692281624151103204551947776906510366521972834357031777287506848887607457751667816514216907338309372900327919413372044625602555866294337672022362865161523684052940126509854895320132828009551012639156341878073682501185688461720664801829933689280752623773789373199210473995823367199793407048741191786377993390965297664875", "2617201476921368517857942326432090876874414269689140439151907982631768946799200744678055980827789859579196832718849393046147656447672531861353456343821196812881882023188898815179947651274131166835133965629115749368441605680383605331300030886676081418867305170012032824011912531673468215561506423833911621270680104083533917562622600478548/559567121085534865189976875600841717161617153776904752351231210970240323460800785728739412474960421770806162360125774000625035522428160837855944215417821324758873127567654244465281354654299068546570789547691342609793050301258532586131013585959164719533123826201937801986942606844854123769532447570107525081084531848318874835968017578125", "636225736038986537559880265988431731529837451289737542395494683393492040808565905376235074534207026537145408562785279823547657299565440309510931336394031904920056464959974743525662459433889398003683078967642651812081450227654478095420306880762753401111260630654049389197602389949892636943971690212484981672010398108426002137114819838399222096538921225458913266993881960732663394566024064/135776510176793971074115131648637508758953050390591773574951317807919051619690313331192027871176160424663811116849856489187562728496099757910540362703888937768555824513740118941387831822900198029266206334350448626733139136083404404120210893986654422850183837974770675600952078956326317698998103770833069712616832650406225828969036781514645731022616236082175582937900731419575337473384125", "266695771933124633677367149389643417608461366874310588884377151539325854547826373711099517873721616543570605935954334944030816383858485296542260152894035979141266909050267414072982042090341712035518685997484257326212454742816979806460287972757626105526907510197321350895873473656215941034605746494172316089636216915825022339855304925515685/56811706665210352283362623728191218698295056176625217939528332247537278605113496147630185544004654583441448319260578659922931798845493756189402805173037491645434052737405379674607517658118427614090338938517963215812444779184193933749520313676564187507594274551791388039139409235056119788261689087831209441779870873305232021728002651979776", "3511806683161697708497547617957719390189982761002154386881580160856792742952365159764830433511949678304281539875366378131195670004345568047690216126001067194904446295336734931691743477531830892015690816210752795806120303198745685394015161323982229908105397857791180342330098240702332072396030780386362735967021055250450666535422528637737695053315137238368787607412459874094164027214953984/746741569878639983491390741637813989978804202898438708743258000150996080386381281307609038830698579358879333079215327202911977568726258527646560497079622703052765164031089590965199628534477381843079892123440214378949632707668935001371616475282883095939750704292616758568964786737752325652839226013335092148777788733453702438432279149298482004122593243860829060557386699231448957232420125", "499543951252504651717279461487337168721376180441322735807713499521878076780205427598086756686061009718016175215146305489885835839673419698751530207404115002383180054704927695269921072232395828258826213554806570423602966743337801741633869267620843626804016742412046844770601322513184123515405692795346790813502805238635003099976693786012816/106032986203682550514602969462803214831559442358811656484036951559991322084935692953211120289352600484987931812632505499612220494311324679562152078883141464406938524087376964935494245010636163705698220308243980789514815579319533341929989455211613890905485981353837321342730307819060825125980500975023479813757024395422041501208805339176375", "8540849722242122835873311629952985285477986765819584558233324868363310302206006773828897816547299245727087876984857726652932481899766510637403577175623031467933486823994040576431755172220921921877192006685053572215922347418846423419683723609799729359551828522978186208983138345476801247634773975311405913274552616037005854836040162212761099347518242200807692224460514057530656658616850816/1809694575992816440924165741094996511361288430727981159314194000585536832192004274726651828760263522962868944612215633976203596150606503849595633388319338251977160257979846235995654357082321611719654136058257458753105122024859078420173515189641515736029725847315662215778251370398007468665986604529263071981040014321717598469319370651877296085250322599247141397427185438573360443115234375", "51377057693118720457387330519321684810411289582445982078756989158447711080414032055843805733348558621949380554029375294451303430269197115810494758213980833379214402452992657502777067850631862453239349835215260705131864911194740832694498014048717871429797341104227759557199716944554347879767916801106279081864127192611546757627038037780244683/10867246748205139797826516105458406878398263495890048637741584969144406206902037615496936724683237700974333817527350121106320991054058406504571347680049945745432432384570515723033245430148177097144850158758462968940525568041926860856763884474605057056550146491001458649244094211354153171337463406192651150028767064600270112838159624568832000", "2517199821548153657910904242290029026229621935918771922146425373057248090467388430999870036608278542449661971830076845113363443421757278612394167195431759807908413353743377586893872930828548256216510734912027450642648789925142482023713336937258932978503310551945630359646777080073329099268529064437120002567758664419443374110941824106727218341795100740316967386497091058915066147604481280/531524260324016969370728057738851340792702640911631807178654723224511108065633433027773388768889035083734041289308124943130099580765995149865288328550751289346866467755881013217287175392101334538392596956248952430438673292186779006015549928829953979591250274457658042926539541422697852390294886719770034058916886894408015624288115732154492554105512936468520265305162358665491880968652687", "937159485027553069020805864547349554547661693803137696125140510201297417077233061462068930061915381468160677500445535971818609631674361074587732183297775728389124966713749450996643183965795829780345678634356741756033039293590264355732129789110416943789326482663579413229893878422643110852069225671783017610387570935863228248464396615988222968188/197552642195166614912991396771845374656891854357948006221100585931656016640982345159207601253599235265353060942313995345483862152489766993442419668492877390774016299878943454249209917002169480134131612530977452579520564400124908392339263545911443803619972765231094502745980083350567509014991735227390978850048088378721210219321877150756855372125", "5119346675109082499980756672052066247676641510661024682574296075659671743397880591881419516307292610449161239233139088348510165442597278965718490070997173182184417648987611422446347235659085092530927312760229499083348217392125906851921500360553758600756698605047197529446594606336369425040236883171542367713951500007600355406492128741649090501989105696576697387613035366083536629358444229248/1077349190930018641197987339365056771667455373500846354778079878558146320193384166982231171317419356136237346389570422332278447217033773023556383420372685049620361481309067017697564760747047839930422553324681218253359586320952896352245366885171583221864112040038531116947187482413031483309534553461613717398523132176948321964066833901215878133594739833910960843185464241840039390204295097875", "58469980853327028628854378052548435225264353747414624620847476036979290604604988637469977624105451959796142112200285366199247075503424204044884512269071061176877225315884188402954249683107639777479663275428465242905314418930053869461904934138752031124685541853599407727446896558064252696813370692668496452783003306386669962110734257851955001481/12284458784412533668960387046583440199646081362484321078872891438551639470826582933879934711861551014258493898870867541349962531447724393381011633785884743889445407749238183080941846528000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "632694338036291086868292541736272151517212971647680989553388199374739841494700315711180961760384484042159533979873604395621016272772109619401112452105475906812313548587880899058905419220497456502543971131226430775692744506047039958551641270070996110661036371362526401525207493270590999387476275629412687473362310414634469788979236895300129227082421021999210841384596617452097273320509348159488/132710874087075221626157136110978536488168313127228703025408943153782802265472978945703742152954881438058373686972477195846162708986982742647038014147903817539418442869011995988024638278746664230046452545499722614320284478925059527086663455478374200352375121910000967044366831275681254530914306064535110528723482282501358749001657608122307686482720926189537227492041135055090784059994118192625", "2022422468242151190347511883185841333968390991430363660248687284021524206079162212007263606819387821055183192871951076644707111802972354128011904720586729919826758651167984507804867954970064938022106484656560866447290934136610214175516487579122328055482392137619829739560923807880779865442016530712986750711199998190148885726144596663143651240/423528009127070458603837580844559347493775236970253513203186912091140251858605354218715508091394564000304400858761758838182654201653901408046974668599216804223721114331085507752600832390227068985693006017591304916519540245902645712532993889000048992026931475754508248265356181099817467608863068068953756055334213584649136541490530849577363647", "150542201776735231618709653388506394887777837646651406023174643241783006776019388336318216053045300417086929061565868663031237502137150880313922488106751241006715449458736723129545400133450376339156062387859536289694727635468338235084533552501618659272047966040838509286942825414463511175531001410923014751124732748099355476332649458471135027773371541572374016038525336728276024676601778299264/31475618522527975728853391146702172347290819252268551219771201846701658848754300838383637247014705706066050673096278897933831272607774110183488615338021656923433335661890414740664480671162459271850877855521869741833030384682549648626038314686632195158507693321505500888988183270276134667071014075017317692121986144742473139078857816578133693776368882596780120407949076129685719314703426278875", "162664351499283182546788129866259011542529017155637405328005084357078048074065548349602626724265307733005745244338982661090506394708170105916177679714664432754153795772811389612700051002336719842784098507498286260450939289109123759859710248621544296008356071415713931721102824434964336667980062728653562369697289761913925215639430496443820411811651/33956433298509232632327667206936379248172049619640091186698677954874297837764235300806836350019565970550533206216590639008637925266405524715041372407701947953283803854153876844320283735281209725651036513491246238622967031979233265136280687995181375582844780830517825595245506321879177965868747546127685256867456319112247572348416655367667187712000", "27228583713734183629451808889147559240254570554044667607519238865891084165382075658707675405673276615039702916443152954157535195508033284355580742761569101934821088036084480297442018005972653124248838420021440899368869744141698556359295489470499243402799483082406238128875386939389123336303631993557844565927960009744780823166462314116039469622216263221278402673028225214534859076857413557466368/5675134787340359276387085910732530678163604187009567576895331134521132071092293139167824957253050637085885426100206370974479279292804959049999647539684766632278449357893560561608633329561385765035738071726214510832066885156767060324427330401967034889966727638276371320401053302413136551142103678412692111973028587922399670456670380189570979581674699102934733563330382821732200682163238525390625", "1340937726818688387636018677960518622106989311577445614347061615417831160296369500704524022869612973331444242000788110133157689786976834913297544087249593601420972111789552905846168933014570399562460789075871112224533723259660967481288525220689577290386781169316008987012566216235876842757183233207943071523447855623001920854571597886491163165150556/279054368814522483241446594911968519760869180429079780837994812436395792594449929617293503975169489945136244602350941695478861584261665582123038340824700224583170270427163469762789603657025958695551448477050958557681299495041994050951692916032501884523150972841782658389836059236040091605838583126400660344344601879969354053137568588338096589095875", "8910951660339249479517731530773509037034977353457185453617569046885132434552771722727442649095007828468878374139001808825741829728375370140505088133244952288239619141544661695065318568074863317054989982620944602245967155400712702259180443238473885690297281525960618905625084639870407113029712510345262279507055197024677292523214467306898573956604928730377318210588837126450942086527893437954864000/1851573255256476362977604759655284263358595254392797078730401113550522214182030016660458780180636930591149034499142464357511158868625309442843792189394292787657774627425816694628839987456477799348874853555586931850788645677998004186437300173080088839930384424797706381282430208961565555953254145002318893188197561315855286173276564036402546798318351229978103276843822345004757661005876638005274037", "84997663352987536417038496128111159210386455419431137931308301989414462311135708114322046234708053448098538629166672456703651524480738219822858469100454933583774404032968304328859365484249897913676382909050450855222567147661842184538302991526635974158862033287154321908483007506326807469239745851379559259262425675035790574846229470041596801343087041/17634687575122715507915388096857069366146981156897230620371714518707518105157483283253374797127075689236298114335734874553183291806268149747826050838089931351158483980735336772879045027213982661634865556129548356487722537193914986994283729746578044621115589195066212043187229606921062007047940293972381121200723292297716621231320254309060321476608000", "1648849257486312935416274009474520589799750757877252390543329851029437452988499485179026845292068377957697884739052491455807688429630524210823560524122596610276957537756142278585091315141096146341773982302888007751632401090642472506538817998043326415693840862261701364114923327286462650797963969289743571514890723145251583881752876340628073395708716735192690808352188867334842743895738955762067968/341580411902962140529547622267381834425264893226447658723654120920549166416114849731588552578626041597847002946105459812230979900480135423787717825697955152193526724029890829615845314765605770060975538542976523177976182401820926854406945392167140347444433885786340415437006775075196031433365827874254477351374236932624514469241634422312990555534789607377023339236417434574755566856489013828206625", "4899626659231633406569362199187192352933567344960498139854460545644210119722856870634652562532083546344965166340063297647520613455037240144734014575196764021102614748218834054157165781057405100578668000290493431869797883155764963238760612333048336953434663867580862692267574574465371615023999531030446250351305046572267686566999209229202587258144318592/1013522377571209303732207048597964555261512342860326827024786500686692475697570284120359840724596444209277948648863014479460188496587721578075151793081823795161404110811480269106846359964436993190293615381593756076515012514100289406862487971220020752628653845345780766244842386136740768474703009091552043945843632199999007070800871588289737701416015625", "362903847358088423032098939589019598036593525722040887883164115981767777873860799955715587436566233010543937498922435963385091400670303956612881974450548904906949032005878241638546734597308786514086678561900713741746905742866635779432216761799371793260025549698865319760786921444505323758235164807966277024031605673481480590193724980659448692487108892154809490199414370023696404259691299614147712/74959603173756091922435708504751461448318819548943586676159545028063979695880930926805574951275602951047845904770828900645717477098988124553474616764040938121171776556999069351772286262529729056288451037717198273521810585868307402693261479298923209587143468206907278220909447483738730657438961435587752873879244136801168836767273934997417156543866722171766794171623224855358640156858606843576125", "8521348154958613550574095745596657249924328336262127244827955886474742319277424381360677655239017583606851483318951440691757875270001283229585075137091617073509041644097526047127618954293881264113694362598157456878784814696577083997902588926421675843291157049153701100218784481406086810264243143337016042301806376864424632290226377881206765051896745/1757584673254145109614914862134217345456065873908262753169404848658913774363650863904627183104777337461445063704655164325930891269843669860409763569362863600932267319335889540453302785099532688264425988677082044905948179153286276609910158854349711054144968131934713419772852663860893241364433872853338630216232313607969790083448433666334742108176384", "1802461420562646993856730082999823508145602238125054717836501201545920604020389361370931345491160549787411668288359013059160331370751496329806488246135100776263777863399096485894306306621852596694700845918608199329091852956315870664531614358379176680326508877329862713333336188556181470928613423972314983964578645688876556351433429494008513812136152576866650152623510296911708111085518974142728903424/371238439252064016214448115231139360835481920731625321084601566992497057371416121407293286027832357816257507287295719261141426130159269433199862002841433235955835172774430690352481806933860390015899973299268361513643524088242973968537595085600335021120523852420135081643310663869327371821064862449426404044951571585406092523478861879148545678639697679215289523234342337347529225543852787599016265125", "88795280670112240977945082069219541902481768504536167808816453021962616596410396813316064685579412429940019071114917828928080181638058444302439626425155946562362550070187433083541414569447612195370911498321149367969974762244140788494955146280201020345849385865084095189982291190135293114489407801749533448443222584092575861096946605418438181411489276/18262596223069549313969288693970246663726147886364354584825624311486557881239003216971630599389642752648815377795018130449384513824927138566203714891090017787258920529990523519479383032564209629983810866231367438270859421572641494420831435563580050954867101292568399107965982704216434467243223964964535464624988344342084084237484262612100980519602625", "752911409358158070688133336918078236438086521781731735123294741731669530734909563155732092406099003582749182967246236657021875488130304108082404134004381196925042617909108654109138702993903561036987511410396567636331465803949049946947888490287210013788802287247422993384874670368649616782837096233384279817294778916419067404863458318451722971117669642134894906235066332205740872938406767767019265664/154635332883086377656813458754577288834216641577439356891585125701020579768315520324293435008561626926046988056302745604248220408154454267643222328696606367409715369481567213640103076112146615938180089303294709009813772509602954514391675152597458428326644988225555987883250642389550531163153338541870029415077982539614784206119074702022117790679351778993541426110436276530890609137713909149169921875", "15286089077439918584953144558775765002061832952090847117286473868694909713791678395221438112006475047633028543501632631679316850512797978594476229228325228403849089079675681042224057234415951253954044235099139983386056610384489202589484570852048157272551098909455253037561994944665563291526597323199530997923272894119350512727802414680772513760081360291/3135161418037836259442831302977219750614726139657718770206960776514822107155928800694375522572523712277389679035632531727155957120566617736817225541673148354829212969778664144907503411589126111888917929495106029890532891919001138770210977012708107496187227751496980000137223047079127096028939624830654227758737339725345681745847598157538483308068864000", "17723482381737693269787076798246423310802126092500438681864673375704464394105734049099094818738115345706100191580982712146882034618103161268453808819471603805345990162762722549964406042295355916458624836894291267553138041035528315839108252422478610879301656207772491548742981990469454529537049123948604931661837539943536878260665617524824604291547373872716194154198824107266275716083848262625068958720/3630091565725887087605600771358216927099748013831912080380983545872077197366172619225751217619097657405660172801849926220948413919823038425519006413005998509677472226729295278652284861834178791332630676772284971762683579047508016687969040658592436230062049051143001484384767836353233324570686249824980508520186643477313941054900197268584495128610811273834192099099592687485176400539748616360799518357", "39160514032490258389003214587901781721548011632821053230881239001436341012396166857515197251499460842954863342641015306304854226194551189224721257664420778416733889030680295206179109679627522113592373938602737416822981698362363553492610842201005420727750505681358595340127099855823746410663750133019743170700888375554918213182862789028531284364877435896/8009919337434786244380818390213546866794958389603666737562053423775386173149395943310276429895991903753441584557917565343673605019989336264748588735390182130334278887642569515202100870042209261561001627386525182096090194076839370589780431326097965428311786635366819094633651297179987340498215947144870164066409654464551017761658775207392803825996394875", "18188388167811476762477659006849121912679763597132233588170406666718758511478154418948855160838212151370453213943784067796172102916618102024199200086478021533171984254799008541948973652219533819511807681148179806051835318645591102296256347927018942348574774821478499092054497390790734798143983945096982240517058861467440217558586822663985584775920517755909444876443211404222400335500608733284461685888/3715278241795087610941547133490827711133909145414878217965273061493740719983191775105550559905283733134189195190321643965858771461560130864714477448011225816210219450040558581571206711791272284197614810026220745160693898421068168630870850392739817340370146186703867097982858560347971281142766235850971837330222970900661653800041795020382847588362774677568059355238174402415384788280852059532958121625", "46353430636874284402376008361176880938798775506236714098123916668545331718677407145199311191108199195405139575147933283523305343027297808443653460575141799729554209181454676876263582758919969948546918471128299522715691694855904535448703118221685887195383025133924852224568922999317583667985459047407473419196367812949579858081181660610155317911318937349/9455890179897829052705408931064120820559254220394152447502395298827357144081378513080398823188243663943177539817982481713456798757563952162598464929784370305696420245648035222083207596797327498500000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "13607414211126412689435920170832779523235279308039712294681570127241403406455725064605210473923965685858012114332021572088551127762628892611459785625407107300355287623761046438724706918300976102581928643740596336865698485838431972050267114940079353996100620311097561405192365496385584164725035842307146351211183443267583872067352881387294766804298681841402861626441205037637282007810811602289501477350144/2772205947240095684743358245950494400934136973845543049938212403703005150954425087866758842625041409060217562878157900197951382737615822655863548356735553650755342108183641353142157728364469706919993519071329069805875834057743793434164720370026073143626055293058601124362130539040404491770346043977106988100969901297669523170508321703496903672333781306743488573086901583022550356345156457496396749797875", "23264350093315690507131500726914401771633259602904894387312742275462601574788485574913195967854009886824436237740789910851843045306673524324611130536719802717912615609109285261163220007241492964833933975789257681755002054890453747803418465119567389315754801791950553304034666399677630030683759466627797123971742061866928213780452325847848901682792886840980/4733430508316851445525799359992627142007028326865116523033957869609125212251136452396410236930025876982265915963089597825393317909648054808274488356887197933393799241941120691826916741647173843634076299630884655997401370400734954098249519111198509015387869462198674657171808841005212058822254513429836457539629035675822719720295352508916898476137111981397", "538960934807826161927564251064896730663918579817797131801326848839524373936888402762331254883505157846659830555799909822861853145306547699817986010353774500545305596630924815657016569444824389893996399550343022444937690798126189162954188680257730893424775303801562327757655350002001080811866451425665301674688928515041429654624970707803336800125648742168380676815769457467038849213225206824671025803392/109517448833211208909213522579666376007937648875042608355810687327424621469323788799169718267715808580775296460944943658428295481347915131091297305260674731651980547668762317138753250458639043477453950774629862540017034566407286963562574188172753764978963685535201028286359818524519980885827473904574840285411260037264057197155527809916623487144493019982419606308144576939532055057697567269576800542875", "24451481554350251656598350124163983489544445991992661049829014268366250968046589127810466483349378560701491445658725080497078590986743512397927747885285095846398852574219367580068049729894667374214861939897557930527646930793431512683750733092448862551580494245486308114129295467976874843852138144539250235632985676953662288536669286915983261820949386845806781/4962240683851186225340479316959605207278948397833849899236383273145853045488131674290332609876751222112917095096150531825255611911377071887145019702433883343849119017643117746273523770961304609989779231048095665388209125939879595509516490230961558353074751312876252070889983946768175488341370453053495319823381943793679003096504200440997908071027962806272000", "166591964685609920525429719961758335887941461052357297159523350448241484106515158310298216150030768812873781356326923214637847449893575074813991141092681107583183275003570804134461187213143832123628701876041315736048451374824101256980832991214945762266748755723551899001458245164317581617731332466039757786839492869211248064662857987111284518155462148044812626055842061283907063784492325693994911811072/33765943466859756347231737285768516240749714264564410814839966011490233598006227246396923594069488496368994857718734549787000213944990695920130591750377483911116845697231074543526982580529937081378303555262933800375576494067959129682770065443667091668104132884375840812635624862495548888467575848428463895756394050252457592540570490061561616914443009224917652440212112452400106121785938739776611328125", "142464729519206642943985715465196065680101634264787375740459792619754842396453535646509170066091478069799080172299369994438836484938378991283020978342879057271045033903518255546705211647900945143546293360496661466657600494787228476009216508124736254967761901224547269496682078470378676865981855568197705507111970901389105723589666709580851611656838285777566736/28839643075889294346635430272525349651555039807615358795334663734940126053968249608601725991946342449660829847322517564370606746964714098508298705743689729306507554363954348780144675937510900983622836770223945538844314468550644543502501484521561567788992156632892028591678742014134130878101553633195551605796158103033794695984958987367799607407626319024034625", "380457154857422076784416625436182734840012277442496600178664323821064977485271288502806124740204295811759917468598315932331219906040253463960961995849761235911145436552991677050565022181516596464968316292789048809559129516930574340710998611088996508613850407294743457197519091160170604426002924022923388338999324182261954685794522778833029950214443271526469607532589775916381786492089432407550224137344640/76922142291839859196033215395526448408989799722090330866256930898223012427332209054699494033511478050536463051459450844520020426942553107946282832072826069342120835351421637970462054707566481086202287686453371483126873188020538661871147778312986131920021929455276187425940666580158173676284545586944833678819622895550345083175685846944633982680908505900099388037050135210936852210263717185637166725605577", "79999800708369666670693340813609265988600461251844239982904928629083975986385235816587497657678297663151298709076884516168798694292862559083730259839524968813932151813233366175091317046758260934357096757322369138747731224414176608247605314668045838769433811781490030635374856042786947109101585097035794969502111354126773165391577217071956928171336060247633607/16154850265413610119312596299635391433380319311682208755390341659152160578366244774029302281068833963848811596545791104919556346810193385001196395489740571188884873246131813864782581356887110499639544662322008824704830818136660544673293865921754569356583698951612797219776290835161780326945625621758204931298948625885081325268123344406261740843197232316416000", "26517014004241498798848003208133111307300592620947908933072661812816683085261359696887064436611747292468717739609776825664344064024535028242737616786238200200498291226984541942836459188328346609549239724653950302145388877472274074665166631509490297630344351573245265440164082334092997307729007429218385933622623935704482371360985836659823269511115937443161532987660855490906546130131716829909388620539153152/5348257529530073524280989257577050878033239486885664777340947102417077875628238501791711336803418503616042922880218860266611595594400020206192599559925169589023339295256084579966533260861249529670141854632965231468533448709363477120437277477668173149958267956654411822360053335695956270719680086524322530514249891157439878407417971839744392044064720476417844056346174795601710447583861127956455406902139625", "71197348290771978405602732839537012310626009318133570890482364371056186523989330157966045289127980687764218363064941391483781008265266963537623770685390148810455244349859354857421474277963009857011653865476081389968122418691934354122230780300833008753686234433642072919923583176333668289998661499146617277981691372057042930131717336250309680764289256080895092/14342680993892886303954853579883363225921109635079605392320944523109187641283117181461662846411912306480691901515655220490850586434947504504317080144378185989596578890875561336496479576651516902048606328604696610314441229321219627021610788398730173161473456954861916116391687748151443335513249810808309201830214153565966339609616397865465842187404632568359375", "342401018754023891059352629509715357053454506037284788725127073168445189422181540408896452651232759821766616850264122591225331120588918865882061344322996688880669665450231982002597398732201789017495427566260651180470635467002453249479483900268320570004293679361696197905823690145326531180324429318916092471863347575533714871355651558610515931373080997536792242278529575700808878786732127630024064418468916608/68894647682461956089382461406499759613691148650738957016015844830333168307020284281532026442272618372290646283794122772122665531108484704223311663270836645399554940741928358317884620420886609705267248656765357348477857852684140561714900614303731786621656041881975328169543884661780531057279582784036689401206706069028229798913082362331334839997133771880514515972024899408556517159759907883793675672065360125", "190286571838805495686895463752492174798162827967490343625540320679760700551286395956241059969689020885714190883323266375067607282890063444652926151862650426323339187596278760962390404656342309737428214493422028545912504503974763216230927196187743439226243880933947417760147785405444976177822143722569696182520826218120595298059020305548681823408268556482981325/38242608291912408815838081993045123864617058390583394828737640036167893859507494091864963383596867701436244007905770284939991912884465101575490548813894148831966132970730263562113961685364216989999844961688441914455435934703797359360780356482629495214859917249465567846934284121032247250332634283689409883499295469118485912489058982596725212975311140618764288", "15345379701153714436938289567639102307887273898834051456693981514956329731572600026866162286097662958712922836383881840211072389867463987895894067288699955858337488812343674818565432780224654423872618380928462939482247900055572079914753652915184313685270722583926261499687728814560680092231526501970431280783177357735398580700300402036873780385926225005561766822479878280891130232036389707452005183370152749056/3080426623087819678602049171756961824196425548529619576972793653585089380165862889092832375934535464160425580449193072125955685099151500755278763306599307218302635233595329082702148677300945556130106197481236122437978375963261172524503625593066102601042060541617791008722569799735202779005407381267021641545644264334109052258081225159748043792288699674153722046659880085850980843460715080965607434114275256125", "36443601662144279337033484452272105547257065463167427418525882851507989449375452076227652634440476502702584889057376829320548464677623038648843251719168810701744338735202853412651160681259533015293997501525430222870696235141468274274064390273214484922080219643095978640300874086585386991338440415203863901714217818222666715642467237183267303214471854472286478344/7307237990148312451155090506264642657872224684879860008436735430879314349554023096366846856470375025555139219961666754780864835035902856314981482268319886395881809659368275720375576152008289949085453326722156553603358879420820012964006978808113307340321824660484441618487292138631579616351777191144073820686595597986548374588839763719082323114663844043046087375", "1575294930860663922843149113097927168024893739962464327016763741314068438447271326302129681931564068796631337571133444163024224071270063174829664848259482066723104251718808936762938249028582992557822551950212098797718627418782376027133576209718376784834456568694813577764300716139817031545408608110880973380162736536313173329973171844528083756524804574267826691156368696436273087171467254161930265910972517504/315498546654512047637461608750018349421492986465373840347519942494904200733840189483934245529561231604050629653992944140351106887747105945984325466452136415067807666316202346895657914393512001212656936450425268507235863153258769360296536050028695266363553141327896064944506216017933135251875087069031098099192325817395958019524956320840925176589616439477134480262100237057953933117460110224783420562744140625", "7692057599553133417225997786980128299372439542315125030077404519679450372805989755158000864378924877036225189784045171045139667691524763609840822628706422918926410377185494048355128046783294954373197082851501927410350313585640237550107070936498164597231431242858771457898152684298047446530220873884022213114819556822050178579707210264243087257050468000092842761/1538814487241112760739561704846381585063002784795057066438330325566843108114787083741788078680861495340026117682606689156065008672344707615420501964123121620401073675430690541617930520947170306763541251152854304975131871537939618684186766168376514664494488691311397307418298556185724993104760692216619178358268934740746932420562664234738576394742559349407744000", "15190836470550557926140012263310230378455340797095100474720776113765300081463960235506950799869073894127884189857505951314428810423734978025409205413789025720642609035117121385453856877706229778165533034683130064865256448444765902482146676668197546098809055341050873494446231793312407516463576380102073171090898973046611572020564659042146465345334273595086941562425006763960197801018796906114925005810069684480/3035556598829526968124942916297025416522606357010637652635799096498208643970273828496655227572100159414352020909846298817521082538898702393916708804775798552206401718323929157863173504795127180177622667376867235806208021329981136637175570409791442328468473111768140746895005561471574356889047981458002257872092408771959478275534098789982899056118498417649167444480913552548249005268380838457505944462494874581", "2923754549090941424546974281011770689534961442264350984393235983189168024079617848190236639328676436485460311093391982825027512234467853098757486086492333410753919927528867817406389678461354257841007722472106464785557179844602277350411593959136520732862935740433163383885526249897183805981219416420390137516812715245569037561966929572448247077578419534651990827044/583599691615378545100950777601104007812792435102945248411439102112424251478512952087517463400054567832353967731887062349496616445419782499817548928078665212077449420216892583997505908858360011413290038645573504472422610780073975450391707084016931661068694024023083417126286468909117254531307085545768412513447197205482285022417611018126886491416133665625891075125", "441922815213568908489589193556560586318864326425397702047965372289295962228254658331201274291697626694859414786292266008476137667843874780506886929181835469302142365772763129838217316953835831059616268288399119642314758261677639945004547833810080700127847214666763863338091523753898362699222880772298183760217731228628442782431573977490761665091005756534420789258276075174436091798475838370152192077494553263232/88113527373573049332749294663402406454524640221866407165839162576979477138694653404281889227416977618913249275712917582743426231744980461918772793673202077716234026090308791893409200158969108910565467273725064769890443408324386897017825489615600787634985397885230455168591240328585041836771921929567914891379235573982442311269392541694564675053636078990836491104116280492254795616055818375774141667319774630875", "91197133767962483852278456285591810579974783077874307589555559715577599604626819245000672929518645004771085106770784762994476973842713035791487204122653245797126906189270204029735872508462106527240320932458036231707311992868347221176460407003487373754014365881209649632547685657666691589606571865740595829983849941049450471212387808617247938941417000965198123059467/18163679611214677813643455199979098261849405189805364986036911945012016248297645596270602508015864371788974684317239728239847888960155365342460843559658233069613218442910226128113196984801126248862273503232000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "733396724434554481470656964167233690851279923085197144879644750437402627936723531635898542414136943003236478432848965516925891956615111678444586384493883113385335463639674699443808084827715994137410743992130712903997815471369201406683862985677774155704267039224546352414417632475628136460919900347977754644214725932476856018335195927604771408949980634142255497812566866795799230501026066145434755838336990365184/145912495644159810313026420025053989609942265686388630266226856650796088768164358961644113076809511566125145395699271530802891523741636707532676065833327082092521989958971154798465784847092870457944857590623097781956884297103961713362268264159015928554707158239398721416218953003215109202771651993622244788505649098445109438104466256408060944298437033058380804126574878377874459371251056800895394904459469832875", "167606423853658713615749101123336326908381619586838606922565378505211386185130407423587264776519589295420758009764678759213587906216543160801059029133457062067529468464636376639307690657945597847080706144898920305379653754920571797771178341550808041652360635584401789901525709166172283390177673009483341826911179861584213314395893323035527116283758445038413646757280/33310364848744488727470761889861069993071965180756187311178124887286133554324042422503263994717993129539448310743598138364172889305532401505890384806078790034557049074169245078416704866867380089103064821732673967120808611636618526737138435792818828990403374766228037003927569643972203993263329403469747342204808360947840103843317533210523853631711601450617095736473", "22466735478643771803624909352181817912387732117378538284107485621001246177152644141853604633676939694208131243081227668237716194316732125445041260568403752325416203858329469477774720998849334961751541191761521224644520742691981372782009394826739249604257098248751626957528543558542443122470657230835176462612530464044652140581367666271771882198747182114685116336512604038833327707163107207664705120728068987996560512/4460342260599110071819142535903990817893424192972341872394014748315090430999224107274777695306032783105944721337053156074851240201179902835353097683269298594190456286888326067932777720561181760369783486872666974623910515795208353605697065447942804414120030678603538761538385793829787734830129764152263691296719726909633580318897787729004972323599773548689272008712427926734258913271101899780538635213826239542884125", "1972862002066252798837977155272535342727415329632252213508267781390870646909686724955861608046325765650407340102472833428905279473185818898693854344138403744757857928883601637909604082588338869612221777263582365745419719805587946558326048087138197694016224613118304623864709183681172362693106460535117459192992832969130895829916210933710820035479169562970982784580861/391262854245936198649509275719624152305206807261382621390946060636032376057385723427601113233050260359684153963520782285097664628279596618521963444574543409076428660874564026651742234728997339844161514273669735686516761239076529088145208958938384732800586298943281728435207452253170935715239392534815683367114290676180839217919539381651841151674859715992309727232000", "25408691426286653276004556426513401767718328640048945917745783225459709487487356095164164652218100925888847689099153320777389381851598236046402124684511968385325107497047025485302333503075085562533472482645023963717347867696861885363417595298751490212495932766872748125111115039311507374363000062513977436921772096443948159289707996749061007112458126301618769295162649600673247799961118662602756889448152517364992/5033870770817104909025512331238419776407331281944565644457345507262881100618908405924951559853352841154730802006750688581603270849880756026262217651685813584900300357685874044482329601894134443542753690048962260914642678445058891387041919581376195543193199307524572671344323361282633828144708683536721118910549933336800461248338059209853766305058943888965279863852107507075916981165164543199352920055389404296875", "616565940481577765011174617619124841631603944267256178093555235591208387588894068005162766513720546626399308168923904625210748051788652328072241494243040185611373035059619136712559505023703153194815611268503291295059648269772663939137446253437248541496631852986499688052678961495116210133458596866684413931188348798244969797973846568160999564540652111599082181871436/122025682149627484528651507368051367620578469392233875493556828623437869650284356703295836998178256875766319508797903923638967073687991229708051285605187358616531926112736402511567721889845693991963610192161413692928378708223712791930113386840109729368772998347036090902364801014045328348830748307179590755723160142468563977011700764517880467116766150322736003147125", "979882056834583241477188686550561625289337025747787132773853690143359657519481397575561812727394470125172272246774578404543257210124412718725081536309818383310896102958167337333430555168671327992395916735022711297435263157670501117734412587691271084981140167017421900852550822579410636184333142944411060788723653596377015359036101170054828623669169047118551010102258802465554033173968468183492058271365801755986560/193732066620504775981759812703028757608600125742477178751189607602983198559778039141192492589734277739017909889924488699372940787977794555519474807920198944109549023547259912324279741006975129518191081373554817584214941629021088206977532599055014150433581544599721903881284581257812850697423350805715586436114842183295730680490110793225514602133304729484547181740290534056445482186430729398701311563285494964645419", "1138059441890428903336718712159907364975959482163004276901676063186939296217569849990951930955270849692775077813359573394435924934540269310629731801376134549169322946310756738187834128956671195358413024062230774111935109203207768898525882417078119314003162592087920755572050993355843681931139257303484526223461840939880759908449181135029327442039666513325916729112853/224777393704985303260433439401503507705148576727364388720387174977154204629336985298082893443205223017966145098064861566754244624732671470935725326043491911142467178027013112527668183783450932992534517827863293825061296257420183669383719043873666284378647952385401303733274771042385666436214517205678674213118374889121542369996042313879258622144464565403138392064000", "614262617634904509410555695398092190166323289787703954329113412647342230855826568873946233136303566178604275296873234926652080462259552775254755109931312516616838091852915397846984381183732773411263828600108443070778861986849272794442105107285234729077818614332155890946804257724112143631642663084660012362691100872465148864413343598067567142977134846266425075195546265101720326272502009234689388355365794889444257557504/121200854655310345878069155190734381476914416893031941761756379148622591310152793328910334357724762079139509813381997287954319983165971628429295803162563856219211627796200599196263868781937234015821367575512548522790158101892507996780675863234181700253545912643548466256938936835469646114659598727592390628209362096738343417775009361678599075671154405137663077798419897932404104579113056038271753988669813988076515476125", "106893445531995430131837569895703697604978445859412739331042151546083234373443601923983714252801103551874986033841637079479794895452077803182698291822629713500021995241940133037200268381793282318691568234728329378829301282121562652452936297422136961147432559766896143081059518238234777055931999714973999553456547746825617168005650221542417216291412324174772893635832/21070287546583154895102927029203125577385528350171457634203261197137238923923245382493868134869009844094435068284335909266152042903157700510534904847257436666980671067329084409346149729385625108233234542133838924281113454526471855573271066865534480974484196644173270141056470857666632902827625475719738076524047736123182255306429677688129231682978570461273193359375", "1112742798776748551928744983308584493817112400536084744850969025063360679785378789764875076529575583792571198510306186417773101346425704969671256564494135750783642910394213727189639661184379341961737135764570942961692159177189753139209638929302928699705042832922774012622017270172331722295881412111812933593370743210214549038212395941675257558442878012136484052827439007483777859391215222647499741572327725689840850048/219121905514652575155579185322367175400669386131891843382447432851122462422992147756333729893028362013318264155489537138133372703295804002840920402482110260590055749843170064921843460498824128274420925357547023876488939786863662801268798987685503391058250902634999352652063668663245829496836853509616873246554292796823779397317819134891873583857621623143253788854530146303641400986028503534408870194989478421253057625", "983995170259637497940121707857673268620603982844439610076334749792119502557380361624096960070148627663305171311646851566811683351232268240169848810658089698606409195744471343416197434926513684882439596141368794175162315633192028977211909698595778839497844847281262559899914504080092844816319298286511436690429175757804604673752838786852277255064434365401871903307643705/193579499709739777577893639665643417521924510242119561765932078835121983190401762561436208758210519231103767232899529457440602166918701550386152070813526760823513884391055054076485295945972185402977095815609448651316824455250005505410192101148149284756928250258632031981439345164037318129987999546683113483700660879431801728391911161900686707231543216283304182063038464", "30691013076836380319652884848585431917439358375118437035944950498156836885409110087616602043242747413728866747975631727566613593257623099549583001362246649928075859944695060947434885707102684568632559339383409378997568182445019183928058902445738702610436187907199482604867148445903921474846103586253320950728989228898324829144701782792767763794895137313050381112872972806712570559942583906619373159053654481250809168128/6031936190594376585238407905469035598668211679521553144958053099463931217856780171872253258738635531385711702176347575597387389685526098889278278029314982721284691198967204664771178761416891317672705719303088746953644978471289001577698554025410820041497108311270431130911021653860874238212040640737171103823631718483572464361276703378587106311153455557896527384426327053165214814954154328483257657424873929502112904625", "33633002641218571027682690377239300567277297301791434890431645909447040830457253186262970747405514897340315490970846553666201190386457221846694126637998462873786334837901001833771510353365825087187582807843940479192544772559118293851131234910638705258664901225494129023244916125545283621607920983287799648992632814461828998517949449887522866259724675318233522060729654796/6603800575190864815125307817934327053530311915572323544225173935830559756077637251538096164499112411672913910767032482188570876526606118068929913515497400397562722669603861813453418621246538114872330536044519242663538662076583511078523573320035084744399535581216815034837553165853576616422592790103728141443697362408727056813977234078214386771115586436985105038873998875", "9090550743395453237608373761422705922989356346696677314277463900103283296889488490217663400349361962695279888433677856471792856853109469433355422802663947305503479561493033851081993247556828544308258821557994512133708656174864544457143793106703578476914924328960109390350040954158797845288786321215010324565010420734044059968931558099077932776525974187717655105951506223649947806568984848883258144616897526257038550656/1783219994432430133950472014582130883873515063182143523712063859964133099770763874744121895885645346884371273930727450069430704145915261127061538288702855011220545530326588799412076879985026006593893648911637986337776174555198865379578424838210466703683642106934154603710587408512357351455891557594977191641529451749437270208258072920514602243985184744955476557012910446023911358037761232253615162335336208343505859375", "396226087129511787616470716244996965529391571019620342657409150252952330537366537352182763477820160355931003174946109480036915624974500187179367618457008802667089004678925595775249725629495848146669773574395699032785024522882892752987825063933573399691764866816284097232869198405981830106568826923407996367321353003569052419999880089180418759265274331299787468134974811/77651132902382550540201641628906752945078964002822585000619340261128555048628863996784740469908853602590877726845475670110127527874088625214912598995012971630852593597027649154487264595100300180591016581254965295280089902497540043916128232871685159131211213497239568483141031137909208031392464815187505714066235868748950184065923236670418822911614780061752905170944000", "1288523130900767412477856952035690867153496584747510253984686336382980221603917538996138294311274357713893956725672062832264871415025750136690143411884111580335458539824573239771267043414225271729141508235839982033182605445173050590151912297720800168687369852280323356691345317649445843078291369394324862039143247087442309135074453265658730028145500871559458519282433012494054724678302957276371418936282902434203225600/252284450515080370603949213084529993395050575951188044032908270470514999880554862449223347761507020354321422785760279154913310488296485989979706208254206974075438570521939826124860483842758137231373182496438568202110337751291106165654945352183167578675508602832478752400011567482434301614269579368882858973850914513870297071866544875650189106576672289734326492492059816669288907018095832842249738081022227281715919357", "559506782175368748187145067236900803925823792088293851453005882621173124590368101213652371965740365119375069053747415415684193092607523211636912074219215053809881814859129515591479780669511533619258835199715146655774919418434080807837587396115955105126806762961292429904380132116986984435528307613054828929294602185927322238461491059740342387266084431988727321711184308176/109446188216864405154936682374609448082436347600301765944233278303643744736544109262794383069197271409398615846380701459882784547857821831816863216080069944818453908760476475874319791512782445408136169878207358663250499628002971644430164185578966399908622640732411885568638054229180673755690889471388585521113862492432946110902070139679164884208988489955874131206343597375", "365842109776085256207829452385781129402656684569922320812625438296958174120084800064669048017227033185969596458778213306152397766619692644694641677223213185977626940193107608138827771259334379895020377700759789774994800008933137569543592829220611543060189849601828342989023692876182148818363689293009174358168826340010491728715549904988196347316703985894355217235339548078187164176255405596310602921647203428200269666176/71497266937783826306774367225149833789788300609530680399994804704196212252148324552193149332755057982662844988588678159610516634667597707204818296457616315484973288944637139939912166034691155272078609876888919170894915224022982785138928008133003473320018151370486895637936102520353951511525996197267572355782608352075229547764732602557133494648237258900273354364050662921889937355682486287799239363976556848320046933875", "59378684894605773397070783936113244261297966863668546282887298999811950599772732377979382620766180662159460666220894896896564357533604962977968843474062092083279165837424210591042655271577974272394203253875965589611493384384257117088518521598379301169916060951350650621757237206805037261878212424267780312614942173870651684587166691539909068452932891649554575072205080763/11593916877920131260484148322810317629326850763057953025674154928920977965095141485536566217873796019006709247938019404840440511433467040918770165456925609124166970862430104329357419669175323763143377917913760028500000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000", "440706629842402075137926797732405268015915199334341565218443748798479563505125605478061664327658137598204192554352688830679475840386882350034150077506804799859586772904929402683276898098601814091430598259347980573084686932949502809068565420937301632494387691284902026088950093888426872222813857928092871267130505744095697172494119689779474840037266295586359244899477781345249657455186847452249040895151288114085352974933708544/85971876318334010542313048056773419567285701852816309711738644074302467763075671531248793080425349570584102078764464196653843973936119037322000695949209283327606280423406302517302874806092835694196353778161663338667091195199032831587897410329509487165187753418615356836636352319310103639079123698118997500068644500893282438137614420288839230827096109835206605385673197123994357393257304049093683934224826006704198171592304125", "13220371178312284248107863849287558696210741535280184003301555188086761767176560823174196915070378763091889333203635784037294769747641959860810039816533609140662043493962707445564057197150603226797446933532133956054671103942520142568674339411250001585991743608723150284270101326419464088290151483823061613403673956918458456165552482913079283537536214967294211244361353060/2576683013797055224377707713704899315377379548630511095136568220145808780162671473907260623503552385384482723173913562423316997528913651044277418227616447815609873991028073011738113927961824632868956802271260292075825561646156680740323686126811928372672670917332613490241615850953660246271541592056143611581223295045062157404996958100136358649109693659623847024011265147", "1538372578072246705266078247950089219881197139399081643650271348770110178217959856819170325400476655944115553238940541695152110949081675985299189913515975242840473616169775880272489805123124548256666658584129873597192213080038937409046114908719298170078476325423466734429870048697383304265342125425087105698152643145531760853127801123272389134514333752173173161562273487752064850461823726948588221913540799816489566883798912/299566102446745552813544808169323270315327122249327394279467999308669285416179486075255023523726449428151807672528368606071047812907935426406886253284580296349349558797128593446316786243666290649442956134448480598303527795996222703837663605600624271807461605295956674925277658331760000117761013381199880905748188151556184620779667670278558839116983636972680749836497346863752662521197700717702790359162307617024566689271625", "281696937222363685333688097915539146272117417024070728031063821781398985795813333650547982965341298894634762289669256129805545549280355643122501181852136332529515756074502902204877664395456278205770206019663082511098956468724829475220996427130295010430751942126263620206886404244432409164651524408198286831329682605959881993845189585640874220032515465014097345759490750307207/54806274927935495596891312029173862473687610099325998583092091915101265393157631244775387832621032230434007486602816972765210205596482942091518459849775458089575743699797096697542306049628939919466378189656065461708686421130956996965004776108499273871055615413566043083634090083096967567965373203683231171594922347812966905149873265654962896456451681332216735396249206784000", "228506238533410805238253122961471637501498406104430046727793420497895852412513560203475440156216063574654372726194215013407325207763369075250819386897086702757125418327084312933061738392406321003231853349865003322697360659712771167066453430309997639548320673279964210730701373707765051246595806673865646607841876463608039111252607452843372970797479959213447237540830563469297144446069689149549515457318899981763489792/44418759813188470246596822974281932219088697005123285598909329328419879212164564561558656547678211265529803086702843380128457744445765859393426675396393053094588240457569380155526179040891009717323059641035189017918495485630657360525410506453554255734005459614858972904374739673834145083512160883402151636664208253116362089211658645312778404886460203600762546810897889629330022309705583438699250109493732452392578125", "2396110297187570506257836426251930521245117960980667897194680897478996322590925380310917400763581787981992131769075961259393685331523600287377841990678117113566991100720996059187144934569703045966210306282348527729533806882408323961336166190162075154579344185244957673138372347997134388801085788353482276257401005734929059700346687783400772331280644647089520646562669857652648/465370154262863030800729180763091967573522779260407615567563274096037297593764955820626213827962697601334935773802201919483657310282236100250543992334865461800976838791035335861420892967699843608855185710753433852279737724446294443337363478679601049432404435672469098850676302728116369979460222148206944323730586138087862719386327396334468302608499235112520318322763857676375", "1188272888075247520453568790651819187486389546755745961952033150576243575862120569399808467067800830890874391487822723879717525264875722720416173276963170672622214121308038530968291758445510982186014289745026439477197148445087614813262170975056866881909056450023324743409114115141145340480846088869807540798073417035168139476153897066325127540609756310068558610112731607522096096821938163134080426356894899245575410494080/230586762395914863625709048789913840511134004337945700368117795195769576856434588144361459740833007125516905017415184787078710001969815416281381427387949263792200577791644278234661952852149216540491852757174842146376788280677956350901082838474705227642420261641783722891948710833898248566893322144435457967452449965772543077421407816225704952270697016152452032506898311260979594550143344971416786595888053149375287120733", "1072184299258468249004114536023934869518152618369895613271618698908405514630154819453979477077738526673716264830106745031385951736108376866253955319711026042389282009348594845497252059906901748860111986811345742998968284077119165082435598381810306691078037018432766116865792677955520465319184311529667642995217214507658693259694586107847099911341219913576038605872218680562047/207882129535607118520818565811162643811811563516006836924341123976848022970024793004700710992938987476728640943834012473687892481059618823520721737479364352887178017866425027953255856440099446112508663603319745066750522936408781591578321031173620445865113295407603090322283539974563690157418931060565698315406021569491751612761888641141446406531645379264720684248398299136000", "158094023904374464057702010126993231151433474361820266584020400101533651587072432728050776506672527718975042616651177034635188178967462982926261516748842073587981953038445977514446838733557926696939591069712397947055261777416704028506441173540338327591514650398349069348381309688677335132100441905603664282735310299686268721634369502296867409514777359935022301425165750780988231639828675424239931533849896744198012747670272/30626384366513923671063955469537776291182594080083494737341604579575446319190916924682809546024369330706012653799783122328775875399363759308193432327358837772825609356553955350401725689682838701996446404559005896479618311357573203081153855961484398360670837599853294627153740224543175497655414585918231215639906924313779933211774291565425360415684556655021031131349317390382320286092667852173815259422737956767922154798375", "12216278924286401897470540169822542417611356797676160128176706721343511598951866107858729405615631246003458062949723290192242594609994613705183460814797527214549142043573863947658832694800184691222426521703728394203722420336773310908687071670107794543022567943478843065246011544888390757810534211554666736239506503613750756246364621509359804902243487113673014588325806249988332/2364584127734680580481708368927921125934330000162935118371174269642831409084634375654239735054363928748162229294829526339927907778510530444646754603322373712788147193691037688552857183116332292048731726305451516954679277320777955342295564000586923227775208580772868590742136150431152495718132142742153643081187691849828217592954519485869135930755646768375299870967864990234375", "578939195017447864385837341975558679292903716580114421030538728778491606282153588930983966100514147976321305616196463174070345884292672842497715966933722088536619333912687108737657068701352918582656105418491672377271304970407730786932913490869797471081081431072836814581099271832696990064828717287258860166842791984158634684078346453202928137987930328826212011774670396356151265781053547412633310327737900786639842674288716416/111966291649651600701875186827360807558960817589719096407887999108024557254221008849510152469119211567152616745769256123968832250104006560061907741567034087109512483357851919402017950812795426393415409198268246337542639470834168040295134130657073201020340432236723824670803498949071870597039309004562024033656488150406105175401372709011082725359382691270659245312133919518760328422827067578306005644825927050994860723405473375", "8041514821545833865350873212853873042112343327573364523948780030849543753072688526717886590013028227714585965095216381829914996539132359247488639692828639170075726301411777307168737667077730792892326979446426349813642680537699905651125068091362135055902152994216233622733424128982011248923051410141033146604688083721413402395290842738021365861670415833356403364696759583009635/1553937833499559104910551811592138833189892464446761247731330672284191313590708439680460540329836344767557599746234213006493842842879398684745864919973051635127080738612248150108793397855113122368507483429209127035263504194847798809612278864438287815470711036548695032421148125849669175729331459149833945183228413961985381338162155596008680906676498435954178226973272371625984", "12059659399309169167301353842123191409306995788633965680414620302285606896146667751472818541537183787935352700725982053536032930866708413010971856856768384974849695774437178790890015242323873769697407411558706626105140596160049735605389301414460825674631122462760014451298494875244754354054447697502521388381253293175367558014453865905104467382184997528879171136492277222127399012368677604910497789360212571238146627048080568400384/2328494054002703067219004484782931471919751585969487160602269605916676223315055450845942763690581877771159615428854802721943114463834992106300185328876910271612375509166975628540839858771078495267566008071532876816826751069408153323840515037497664871689085370699991860738368371510578076683395101062439493831773194498579620513073693022191702398601471237166387045790480861932005012807234071429628725981935147069738988682858417182625", "683009426705008850682549700382901603742691705123356866338951397347368059105140826655486518416578697931244347554322654428162554903861783227680935341690740579867651545205562690172425016836559678937794312287639193745517811234257062356826622207475918293015140472942579713388671782202262396642735640315948612572908444501108579457520714632371056288874351015666995549139003946314085696/131769214246522869780429817236150406548549044658474416909806179734873399109656411633488099249198882165279745627038984487365589625562901914030850178330133080409420340227179447548044572594184601425691821617928130423410997853384425373999967759499571890326740433081063424903098252502791477854302204200941376983295622430177445507316706609802292121282957519571162158620971952084486375", "1418116259749091420309271913909337143756589314597557128553117870573928055109322864794169592355058370891251425125187770724828108988587888087023982451205475980371440423992838481547236638456717520835668859093413956339261802305597694403381021863258753441889536361061407579332570493634254542013337999844407181346815549594836374497512447969751514466481466717590255369810506813543577735080228718660747940956248427356785784199073569408/273368882980516556922532339653303822104510203916024760371844491705599093435133738774975538364241630079468712981056336655766117378160822393876348755370711942273876284944422610974149712212944211513462921649872232656449940987552227525504529710373144228818606127541937831103642415534318303187393593236209298242574677293352798419428712873685798636474667204083938875672934235816396371477146089168375198141802684403955936431884765625", "546411077581845999248238069684194831621691193366466972898628141511422317954477211865167402284211971296286346492698354214043840080181702652132835681239302798339667835439189275457116051279366194551632712819028177402221815140045210690908631767786711675029194359998826252332434573121740830827417293557234891406021102083555472155479148332697839972702631641910213821827820374586459319/105246945889799140338072754365901705544530661781295362563214285953881890233987516230568663143342952799036341701952267011236663118111226623815975847494372076420199418712941018288738590264475520229651370015377608638075866459684692488079223686296541020897904588347083045723167762682959422858996673894180805702299907478685374065593161226849447131100462022089783265346597553176576000", "2398330640958841474772606439916070050977544535580605737383995160447105736276950196885906408317628083110923322157113892928963237845914017845444295040924101784423382681801754191301860383927129006953354739240926643562987838836997453985855576402628166875869041032631651591871962852884189548538272285387092843044669499688035134181859376665409767886188304314888753894905317929877238322615838524354191263502347881033855441181420399360/461588070868590122892265681879734295007029130965626060552783760068897000195207878227714842617470320231527222074701444349530952699708435668339712860464533455345665068841333232359698449088497137068713309811942968433868609329301082001752617420002377892756821532220676085014874112083615054550278903960627185675459015343606391094523511117705747842645927349130302549554534056269331809016770715819934970200483161548527932617036185253", "6041015879424725383006424536130409209607854044642113747266098198777011981328765528361630516108680392500990580908509403483891763219659726090675140672989657743882183951954294745396417829943469201306594018454995862321821016087416840247422350906412007336103086620396467456181771583200365740253389107968122850063607085957109965406634738740996318415514360956028575560979203447735121436/1161752799109428422288020947061281540989708937450568100764830251908850596717606701047413407636907934320789870175907792017513896999208892282137299070761467096211814586909598705615312819596495636017728313513520193786266452836805291464826226833593878504804389728477191170027729963773716267868284479768397603444919008915279522376004326398403851684761808785381609370767169521034383625", "13240077436443988749179508462267267187169441948722358165090554769250505713747934643200804819418670147225695324432684266924694524337920816452346599774452681831320005286326986675907899608537972384924882996757503264622991355949039882526389342174307168805166215838138277557052303430492669193939212362638263582899713198716541723383138016564027766560215944409353427176135895982596327685665844815618402881202645610620284792793420780517248/2544223084468158291883698813309541801455311468982232546872485444308211415529998472787377800559884210837213042932180479090277285630234238711851480232520137856848809986631784843528381778520727465146661792797924458540957133423665746229799675650290296217658444899605236550972043549278128087645211909479009099766619355677984218929672461506691980442071860591767266913041147587815452007726513853820116629482732060593116624596368806566625", "1953999166296955830935495158735359200362904181792947794529339487489730042568305997099959302322956898299616194932283060554261566410988618045107398092345476532371402134206635235570281738377188438407703089325315446371127042537576093536896282955524842632708645655481028161471313608974238110718242273935956977555610147714316158486553633871312187084618154014921190595222799283957140353/375191165084882521037046014569185165885459082629136124177286500000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"];
            if(CACHE[x]) {
                return Frac.quick.apply(null, CACHE[x].split('/'));
            }
            x = new Frac(x);
            var n = 80;
            var retval = new Frac(0);
            var a = x.subtract(new Frac(1));
            var b = x.add(new Frac(1));
            for(var i = 0; i < n; i++) {
                var t = new Frac(2 * i + 1);
                var k = Math2.bigpow(a.divide(b), t);
                var r = t.clone().invert().multiply(k);
                retval = retval.add(r);

            }
            return retval.multiply(new Frac(2));
        },
        //the factorial function but using the big library instead
        factorial: function (x) {
            var is_int = x % 1 === 0;

            /*factorial for negative integers is complex infinity according to Wolfram Alpha*/
            if(is_int && x < 0)
                return NaN;

            if(!is_int)
                return Math2.gamma(x + 1);

            var retval = 1;
            for(var i = 2; i <= x; i++)
                retval = retval * i;
            return retval;
        },
        //double factorial
        //http://mathworld.wolfram.com/DoubleFactorial.html
        dfactorial: function (x) {
            if(isInt(x)) {
                var even = x % 2 === 0;
                /* If x = even then n = x/2 else n = (x-1)/2*/
                var n = even ? x / 2 : (x + 1) / 2;
                /*the return value*/
                var r = new Frac(1);
                /*start the loop*/
                if(even)
                    for(var i = 1; i <= n; i++)
                        r = r.multiply(new Frac(2).multiply(new Frac(i)));
                else
                    for(var i = 1; i <= n; i++)
                        r = r.multiply(new Frac(2).multiply(new Frac(i)).subtract(new Frac(1)));
            }
            else {
                /*Not yet extended to bigNum*/
                r = Math.pow(2, (1 + 2 * x - Math.cos(Math.PI * x)) / 4) * Math.pow(Math.PI, (Math.cos(Math.PI * x) - 1) / 4) * Math2.gamma(1 + x / 2);
            }

            /*done*/
            return r;
        },
        GCD: function () {
            var args = arrayUnique([].slice.call(arguments)
                    .map(function (x) {
                        return Math.abs(x);
                    })).sort(),
                    a = Math.abs(args.shift()),
                    n = args.length;

            while(n-- > 0) {
                var b = Math.abs(args.shift());
                while(true) {
                    a %= b;
                    if(a === 0) {
                        a = b;
                        break;
                    }
                    b %= a;
                    if(b === 0)
                        break;
                    ;
                }
            }
            return a;
        },
        QGCD: function () {
            var args = [].slice.call(arguments);
            var a = args[0];
            for(var i = 1; i < args.length; i++) {
                var b = args[i];
                var sign = a.isNegative() && b.isNegative() ? -1 : 1;
                a = b.gcd(a);
                if(sign < 0)
                    a.negate();
            }
            return a;
        },
        LCM: function (a, b) {
            return (a * b) / Math2.GCD(a, b);
        },
        //pow but with the handling of negative numbers
        //http://stackoverflow.com/questions/12810765/calculating-cubic-root-for-negative-number
        pow: function (b, e) {
            if(b < 0) {
                if(Math.abs(e) < 1) {
                    /*nth root of a negative number is imaginary when n is even*/
                    if(1 / e % 2 === 0)
                        return NaN;
                    return -Math.pow(Math.abs(b), e);
                }
            }
            return Math.pow(b, e);
        },
        factor: function (n) {
            n = Number(n);
            var sign = Math.sign(n); /*store the sign*/
            /*move the number to absolute value*/
            n = Math.abs(n);
            var ifactors = Math2.ifactor(n);
            var factors = new Symbol();
            factors.symbols = {};
            factors.group = CB;
            for(var x in ifactors) {
                var factor = new Symbol(1);
                factor.group = P; /*cheat a little*/
                factor.value = x;
                factor.power = new Symbol(ifactors[x]);
                factors.symbols[x] = factor;
            }
            factors.updateHash();

            if(n === 1) {
                factors = new Symbol(n);
            }

            /*put back the sign*/
            if(sign < 0)
                factors.negate();

            return factors;
        },
        /**
         * Uses trial division
         * @param {Integer} n - the number being factored
         * @param {object} factors -  the factors object
         * @returns {object}
         */
        sfactor: function (n, factors) {
            factors = factors || {};
            var r = Math.floor(Math.sqrt(n));
            var lcprime = PRIMES[PRIMES.length - 1];
            /*a one-time cost... Hopefully ... And don't bother for more than a million*/
            /*takes too long*/
            if(r > lcprime && n < 1e6)
                generatePrimes(r);
            var l = PRIMES.length;
            for(var i = 0; i < l; i++) {
                var prime = PRIMES[i];
                /*trial division*/
                while(n % prime === 0) {
                    n = n / prime;
                    factors[prime] = (factors[prime] || 0) + 1;
                }
            }
            if(n > 1)
                factors[n] = 1;
            return factors;
        },
        /**
         * Pollard's rho
         * @param {Integer} n
         * @returns {object}
         */
        ifactor: function (n) {
            var input = new bigInt(n);

            n = String(n);

            if(n === '0')
                return {'0': 1};
            n = new bigInt(n); /*convert to bigInt for safety*/
            var sign = n.sign ? -1 : 1;
            n = n.abs();
            var factors = {}; /*factor object being returned.*/
            if(n.lt('65536')) { /*less than 2^16 just use trial division*/
                factors = Math2.sfactor(n, factors);
            }
            else {
                var add = function (e) {
                    if(!e.isPrime()) {
                        factors = Math2.sfactor(e, factors);
                    }
                    else
                        factors[e] = (factors[e] || 0) + 1;
                };

                try {
                    //set a safety
                    var max = 1e3;
                    var safety = 0;

                    while(!n.abs().equals(1)) {
                        if(n.isPrime()) {
                            add(n);
                            break;
                        }
                        else {
                            function rho(c) {
                                var xf = new bigInt(c),
                                        cz = 2,
                                        x = new bigInt(c),
                                        factor = new bigInt(1);

                                while(factor.equals(1)) {
                                    for(var i = 0; i <= cz && factor.equals(1); i++) {
                                        //trigger the safety
                                        if(safety++ > max)
                                            throw new Error('stopping');

                                        x = x.pow(2).add(1).mod(n);
                                        factor = bigInt.gcd(x.minus(xf).abs(), n);
                                    }

                                    cz = cz * 2;
                                    xf = x;
                                }
                                if(factor.equals(n)) {
                                    return rho(c + 1);
                                }
                                return factor;
                            }
                            var factor = rho(2);
                            add(factor);
                            /*divide out the factor*/
                            n = n.divide(factor);
                        }
                    }
                }
                catch(e) {
                    if (e.message === "timeout") throw e;
                    //reset factors
                    factors = {};
                    add(input);
                }

            }

            /*put the sign back*/
            if(sign === -1) {
                var sm = arrayMin(keys(factors)); /*/get the smallest number*/
                factors['-' + sm] = factors[sm];
                delete factors[sm];
            }

            return factors;
        },
        //factors a number into rectangular box. If sides are primes that this will be
        //their prime factors. e.g. 21 -> (7)(3), 133 -> (7)(19)
        boxfactor: function (n, max) {
            max = max || 200; //stop after this number of iterations
            var c, r,
                    d = Math.floor((5 / 12) * n), //the divisor
                    i = 0, //number of iterations
                    safety = false;
            while(true) {
                c = Math.floor(n / d);
                r = n % d;
                if(r === 0)
                    break; //we're done
                if(safety)
                    return [n, 1];
                d = Math.max(r, d - r);
                i++;
                safety = i > max;
            }
            return [c, d, i];
        },
        fib: function (n) {
            var sign = Math.sign(n);
            n = Math.abs(n);
            sign = even(n) ? sign : Math.abs(sign);
            var a = 0, b = 1, f = 1;
            for(var i = 2; i <= n; i++) {
                f = a + b;
                a = b;
                b = f;
            }
            return f * sign;
        },
        mod: function (x, y) {
            return x % y;
        },
        //http://mathworld.wolfram.com/IntegerPart.html
        integer_part: function (x) {
            var sign = Math.sign(x);
            return sign * Math.floor(Math.abs(x));
        },
        simpson: function (f, a, b, step) {
            var get_value = function (f, x, side) {
                var v = f(x);
                var d = 0.000000000001;
                if(isNaN(v)) {
                    v = f(side === 1 ? x + d : x - d);
                }
                return v;
            };

            step = step || 0.0001;
            //calculate the number of intervals
            var n = Math.abs(Math.floor((b - a) / step));
            //simpson's rule requires an even number of intervals. If it's not then add 1
            if(n % 2 !== 0)
                n++;
            //get the interval size
            var dx = (b - a) / n;
            //get x0
            var retval = get_value(f, a, 1);

            //get the middle part 4x1+2x2+4x3 ...
            //but first set a flag to see if it's even or odd.
            //The first one is odd so we start there
            var even = false;
            //get x1
            var xi = a + dx;
            //the coefficient
            var c, k;
            //https://en.wikipedia.org/wiki/Simpson%27s_rule
            for(var i = 1; i < n; i++) {
                c = even ? 2 : 4;
                k = c * get_value(f, xi, 1);
                retval += k;
                //flip the even flag
                even = !even;
                //increment xi
                xi += dx;
            }

            //add xn
            return (retval + get_value(f, xi, 2)) * (dx / 3);

        },
        /**
         * https://github.com/scijs/integrate-adaptive-simpson
         * @param {Function} f - the function being integrated
         * @param {Number} a - lower bound
         * @param {Number} b - upper bound
         * @param {Number} tol - step width
         * @param {Number} maxdepth
         * @returns {Number}
         */
        num_integrate: function (f, a, b, tol, maxdepth) {
            if(maxdepth < 0)
                throw new Error('max depth cannot be negative');

            /* This algorithm adapted from pseudocode in:*/
            /* http://www.math.utk.edu/~ccollins/refs/Handouts/rich.pdf*/
            function adsimp(f, a, b, fa, fm, fb, V0, tol, maxdepth, depth, state) {
                if(state.nanEncountered) {
                    return NaN;
                }
                var h, f1, f2, sl, sr, s2, m, V1, V2, err;
                h = b - a;
                f1 = f(a + h * 0.25);
                f2 = f(b - h * 0.25);
                /* Simple check for NaN:*/
                if(isNaN(f1)) {
                    state.nanEncountered = true;
                    return;
                }
                /* Simple check for NaN:*/
                if(isNaN(f2)) {
                    state.nanEncountered = true;
                    return;
                }

                sl = h * (fa + 4 * f1 + fm) / 12;
                sr = h * (fm + 4 * f2 + fb) / 12;
                s2 = sl + sr;
                err = (s2 - V0) / 15;

                if(state.maxDepthCount > 1000 * maxdepth) {
                    return;
                }


                if(depth > maxdepth) {
                    state.maxDepthCount++;
                    return s2 + err;
                }
                else if(Math.abs(err) < tol) {
                    return s2 + err;
                }
                else {
                    m = a + h * 0.5;
                    V1 = adsimp(f, a, m, fa, f1, fm, sl, tol * 0.5, maxdepth, depth + 1, state);
                    if(isNaN(V1)) {
                        state.nanEncountered = true;
                        return NaN;
                    }
                    V2 = adsimp(f, m, b, fm, f2, fb, sr, tol * 0.5, maxdepth, depth + 1, state);

                    if(isNaN(V2)) {
                        state.nanEncountered = true;
                        return NaN;
                    }

                    return V1 + V2;
                }
            }

            function integrate(f, a, b, tol, maxdepth) {
                var state = {
                    maxDepthCount: 0,
                    nanEncountered: false
                };

                if(tol === undefined) {
                    tol = 1e-9;
                }
                if(maxdepth === undefined) {
                    /*Issue #458 - This was lowered because of performance issues. */
                    /*This was suspected from before but is now confirmed with this issue*/
                    maxdepth = 45;
                }

                var fa = f(a);
                var fm = f(0.5 * (a + b));
                var fb = f(b);

                var V0 = (fa + 4 * fm + fb) * (b - a) / 6;

                var result = adsimp(f, a, b, fa, fm, fb, V0, tol, maxdepth, 1, state);

                if(state.maxDepthCount > 0) {
                    warn('integrate-adaptive-simpson: Warning: maximum recursion depth (' + maxdepth + ') reached ' + state.maxDepthCount + ' times');
                }

                if(state.nanEncountered) {
                    throw new Error('Function does not converge over interval!');
                }

                return result;
            }
            var retval;

            try {
                retval = integrate(f, a, b, tol, maxdepth);
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                /*fallback to non-adaptive*/
                return Math2.simpson(f, a, b);
            }
            return nround(retval, 12);
        },
        //https://en.wikipedia.org/wiki/Trigonometric_integral
        //CosineIntegral
        Ci: function (x) {
            var n = 20,
                    /*roughly Euler–Mascheroni*/
                    g = 0.5772156649015329,
                    sum = 0;
            for(var i = 1; i < n; i++) {
                /*cache 2n*/
                var n2 = 2 * i;
                sum += (Math.pow(-1, i) * Math.pow(x, n2)) / (n2 * Math2.factorial(n2));
            }
            return Math.log(x) + g + sum;
        },
        /*SineIntegral*/
        Si: function (x) {
            var n = 20,
                    sum = 0;
            for(var i = 0; i < n; i++) {
                var n2 = 2 * i;
                sum += (Math.pow(-1, i) * Math.pow(x, n2 + 1)) / ((n2 + 1) * Math2.factorial(n2 + 1));
            }
            return sum;
        },
        /*ExponentialIntegral*/
        Ei: function (x) {
            if(Number(x) === 0)
                return -Infinity;
            var n = 30,
                    g = 0.5772156649015328606, /*roughly Euler–Mascheroni*/
                    sum = 0;
            for(var i = 1; i < n; i++) {
                sum += Math.pow(x, i) / (i * Math2.factorial(i));
            }
            return g + Math.abs(Math.log(x)) + sum;
        },
        /*Hyperbolic Sine Integral*/
        /*http://mathworld.wolfram.com/Shi.html*/
        Shi: function (x) {
            var n = 30,
                    sum = 0,
                    k, t;
            for(var i = 0; i < n; i++) {
                k = 2 * i;
                t = k + 1;
                sum += Math.pow(x, t) / (t * t * Math2.factorial(k));
            }
            return sum;
        },
        /*the cosine integral function*/
        Chi: function (x) {
            var dx, g, f;
            dx = 0.001;
            g = 0.5772156649015328606;
            f = function (t) {
                return (Math.cosh(t) - 1) / t;
            };
            return Math.log(x) + g + Math2.num_integrate(f, 0.002, x, dx);
        },
        /*the log integral*/
        Li: function (x) {
            return Math2.Ei(Math2.bigLog(x));
        },
        /*the gamma incomplete function*/
        gamma_incomplete: function (n, x) {
            var t = n - 1,
                    sum = 0,
                    x = x || 0;
            for(var i = 0; i < t; i++) {
                sum += Math.pow(x, i) / Math2.factorial(i);
            }
            return Math2.factorial(t) * Math.exp(-x) * sum;
        },
        /*
         * Heaviside step function - Moved from Special.js (originally contributed by Brosnan Yuen)
         * Specification : http://mathworld.wolfram.com/HeavisideStepFunction.html
         * if x > 0 then 1
         * if x == 0 then 1/2
         * if x < 0 then 0
         */
        step: function (x) {
            if(x > 0)
                return 1;
            if(x < 0)
                return 0;
            return 0.5;
        },
        /*
         * Rectangle function - Moved from Special.js (originally contributed by Brosnan Yuen)
         * Specification : http://mathworld.wolfram.com/RectangleFunction.html
         * if |x| > 1/2 then 0
         * if |x| == 1/2 then 1/2
         * if |x| < 1/2 then 1
         */
        rect: function (x) {
            var x = Math.abs(x);
            if(x === 0.5)
                return x;
            if(x > 0.5)
                return 0;
            return 1;
        },
        /*
         * Sinc function - Moved from Special.js (originally contributed by Brosnan Yuen)
         * Specification : http://mathworld.wolfram.com/SincFunction.html
         * if x == 0 then 1
         * otherwise sin(x)/x
         */
        sinc: function (x) {
            if(x.equals(0))
                return 1;
            return Math.sin(x) / x;
        },
        /*
         * Triangle function - Moved from Special.js (originally contributed by Brosnan Yuen)
         * Specification : http://mathworld.wolfram.com/TriangleFunction.html
         * if |x| >= 1 then 0
         * if |x| < then 1-|x|
         */
        tri: function (x) {
            x = Math.abs(x);
            if(x >= 1)
                return 0;
            return 1 - x;
        },
        //https://en.wikipedia.org/wiki/Nth_root_algorithm
        nthroot: function (A, n) {
            /*make sure the input is of type Frac*/
            if(!(A instanceof Frac))
                A = new Frac(A.toString());
            if(!(n instanceof Frac))
                n = new Frac(n.toString());
            if(n.equals(1))
                return A;
            /*begin algorithm*/
            var xk = A.divide(new Frac(2)); /*x0*/
            var e = new Frac(1e-15);
            var dk, dk0, d0;
            var a = n.clone().invert(),
                    b = n.subtract(new Frac(1));
            do {
                var powb = Math2.bigpow(xk, b);
                var dk_dec = a.multiply(A.divide(powb).subtract(xk)).toDecimal(25);
                dk = Frac.create(dk_dec);
                if(d0)
                    break;

                xk = xk.add(dk);
                /*check to see if there's no change from the last xk*/
                var dk_dec = dk.toDecimal();
                d0 = dk0 ? dk0 === dk_dec : false;
                dk0 = dk_dec;
            }
            while(dk.abs().gte(e))

            return xk;
        },
        /*https://gist.github.com/jiggzson/0c5b33cbcd7b52b36132b1e96573285f*/
        /*Just the square root function but big :)*/
        sqrt: function (n) {
            if(!(n instanceof Frac))
                n = new Frac(n);
            var xn, d, ld, same_delta;
            var c = 0; /*counter*/
            var done = false;
            var delta = new Frac(1e-20);
            xn = n.divide(new Frac(2));
            var safety = 1000;
            do {
                /*break if we're not converging*/
                if(c > safety)
                    throw new Error('Unable to calculate square root for ' + n);
                xn = xn.add(n.divide(xn)).divide(new Frac(2));
                xn = new Frac(xn.decimal(30));
                /*get the difference from the true square*/
                d = n.subtract(xn.multiply(xn));
                /*if the square of the calculated number is close enough to the number*/
                /*we're getting the square root or the last delta was the same as the new delta*/
                /*then we're done*/
                same_delta = ld ? ld.equals(d) : false;
                if(d.clone().abs().lessThan(delta) || same_delta)
                    done = true;
                /*store the calculated delta*/
                ld = d;
                c++; /*increase the counter*/
            }
            while(!done)

            return xn;
        }
    };
    //link the Math2 object to Settings.FUNCTION_MODULES
    Settings.FUNCTION_MODULES.push(Math2);
    reserveNames(Math2); //reserve the names in Math2


//Polyfills ====================================================================
    //https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/
    Math.sign = Math.sign || function (x) {
        x = +x; // convert to a number
        if(x === 0 || isNaN(x)) {
            return x;
        }
        return x > 0 ? 1 : -1;
    };

    Math.cosh = Math.cosh || function (x) {
        var y = Math.exp(x);
        return (y + 1 / y) / 2;
    };

    Math.sech = Math.sech || function (x) {
        return 1 / Math.cosh(x);
    };

    Math.csch = Math.csch || function (x) {
        return 1 / Math.sinh(x);
    };

    Math.coth = Math.coth || function (x) {
        return 1 / Math.tanh(x);
    };

    Math.sinh = Math.sinh || function (x) {
        var y = Math.exp(x);
        return (y - 1 / y) / 2;
    };

    Math.tanh = Math.tanh || function (x) {
        if(x === Infinity) {
            return 1;
        }
        else if(x === -Infinity) {
            return -1;
        }
        else {
            var y = Math.exp(2 * x);
            return (y - 1) / (y + 1);
        }
    };

    Math.asinh = Math.asinh || function (x) {
        if(x === -Infinity) {
            return x;
        }
        else {
            return Math.log(x + Math.sqrt(x * x + 1));
        }
    };

    Math.acosh = Math.acosh || function (x) {
        return Math.log(x + Math.sqrt(x * x - 1));
    };

    Math.atanh = Math.atanh || function (x) {
        return Math.log((1 + x) / (1 - x)) / 2;
    };

    Math.log10 = Math.log10 || function (x) {
        return Math.log(x) * Math.LOG10E;
    };

    Math.trunc = Math.trunc || function (x) {
        if(isNaN(x)) {
            return NaN;
        }
        if(x > 0) {
            return Math.floor(x);
        }
        return Math.ceil(x);
    };

//Global functions =============================================================
    /**
     * This method will return a hash or a text representation of a Symbol, Matrix, or Vector.
     * If all else fails it *assumes* the object has a toString method and will call that.
     *
     * @param {Object} obj
     * @param {String} option get is as a hash
     * @param {int} useGroup
     * @returns {String}
     */
    function text(obj, option, useGroup, decp) { 
        var asHash = option === 'hash',
                //whether to wrap numbers in brackets
                wrapCondition = undefined,
                opt = asHash ? undefined : option,
                asDecimal = opt === 'decimal' || opt === 'decimals';

        if(asDecimal && typeof decp === 'undefined')
            decp = Settings.DEFAULT_DECP;

        function toString(obj) {
            switch(option)
            {
                case 'decimals':
                case 'decimal':
                    wrapCondition = wrapCondition || function (str) {
                        return false;
                    };
                    return obj.valueOf();
                case 'recurring':
                    wrapCondition = wrapCondition || function (str) {
                        return str.indexOf("'") !== -1;
                    };

                    var str = obj.toString();
                    //verify that the string is actually a fraction
                    var frac = /^-?\d+(?:\/\d+)?$/.exec(str);
                    if(frac.length === 0)
                        return str;

                    //split the fraction into the numerator and denominator
                    var parts = frac[0].split('/');
                    var negative = false;
                    var m = Number(parts[0]);
                    if(m < 0) {
                        m = -m;
                        negative = true;
                    }
                    var n = Number(parts[1]);
                    if(!n)
                        n = 1;

                    //https://softwareengineering.stackexchange.com/questions/192070/what-is-a-efficient-way-to-find-repeating-decimal#comment743574_192081
                    var quotient = Math.floor(m / n), c = 10 * (m - quotient * n);
                    quotient = quotient.toString() + ".";
                    while(c && c < n) {
                        c *= 10;
                        quotient += "0";
                    }
                    var digits = "", passed = [], i = 0;
                    while(true) {
                        if(typeof passed[c] !== 'undefined') {
                            var prefix = digits.slice(0, passed[c]),
                                    cycle = digits.slice(passed[c]),
                                    result = quotient + prefix + "'" + cycle + "'";
                            return (negative ? "-" : "") + result.replace("'0'", "").replace(/\.$/, "");
                        }
                        var q = Math.floor(c / n), r = c - q * n;
                        passed[c] = i;
                        digits += q.toString();
                        i += 1;
                        c = 10 * r;
                    }
                case 'mixed':
                    wrapCondition = wrapCondition || function (str) {
                        return str.indexOf('/') !== -1;
                    };

                    var str = obj.toString();
                    //verify that the string is actually a fraction
                    var frac = /^-?\d+(?:\/\d+)?$/.exec(str);
                    if(frac.length === 0)
                        return str;

                    //split the fraction into the numerator and denominator
                    var parts = frac[0].split('/');
                    var numer = new bigInt(parts[0]);
                    var denom = new bigInt(parts[1]);
                    if(denom.equals(0))
                        denom = new bigInt(1);

                    //return the quotient plus the remainder
                    var divmod = numer.divmod(denom);
                    var quotient = divmod.quotient;
                    var remainder = divmod.remainder;
                    var operator = parts[0][0] === '-' || quotient.equals(0) || remainder.equals(0) ? '' : '+';
                    return (quotient.equals(0) ? '' : quotient.toString()) + operator + (remainder.equals(0) ? '' : (remainder.toString() + '/' + parts[1]));
                case 'scientific':
                    wrapCondition = wrapCondition || function (str) {
                        return false;
                    };
                    return new Scientific(obj.valueOf()).toString(Settings.SCIENTIFIC_MAX_DECIMAL_PLACES);
                default:
                    wrapCondition = wrapCondition || function (str) {
                        return str.indexOf('/') !== -1;
                    };

                    return obj.toString();
            }
        }

        //if the object is a symbol
        if(isSymbol(obj)) {
            var multiplier = '',
                    power = '',
                    sign = '',
                    group = obj.group || useGroup,
                    value = obj.value;

            //if the value is to be used as a hash then the power and multiplier need to be suppressed
            if(!asHash) {
                //use asDecimal to get the object back as a decimal
                var om = toString(obj.multiplier);
                if(om == '-1' && String(obj.multiplier) === '-1') {
                    sign = '-';
                    om = '1';
                }
                //only add the multiplier if it's not 1
                if(om != '1')
                    multiplier = om;
                //use asDecimal to get the object back as a decimal
                var p = obj.power ? toString(obj.power) : '';
                //only add the multiplier
                if(p != '1') {
                    //is it a symbol
                    if(isSymbol(p)) {
                        power = text(p, opt);
                    }
                    else {
                        power = p;
                    }
                }
            }

            switch(group) {
                case N:
                    multiplier = '';
                    //round if requested
                    var m = decp && asDecimal ? obj.multiplier.toDecimal(decp) : toString(obj.multiplier);
                    //if it's numerical then all we need is the multiplier
                    value = String(obj.multiplier) == '-1' ? '1' : m;
                    power = '';
                    break;
                case PL:
                    value = obj.collectSymbols().map(function (x) {
                        var txt = text(x, opt, useGroup, decp);
                        if(txt == '0')
                            txt = '';
                        return txt;
                    }).sort().join('+').replace(/\+\-/g, '-');
                    break;
                case CP:
                    value = obj.collectSymbols().map(function (x) {
                        var txt = text(x, opt, useGroup, decp);
                        if(txt == '0')
                            txt = '';
                        return txt;
                    }).sort().join('+').replace(/\+\-/g, '-');
                    break;
                case CB:
                    value = obj.collectSymbols(function (symbol) {
                        var g = symbol.group;
                        //both groups will already be in brackets if their power is greater than 1
                        //so skip it.
                        if((g === PL || g === CP) && (symbol.power.equals(1) && symbol.multiplier.equals(1))) {
                            return inBrackets(text(symbol, opt));
                        }
                        return text(symbol, opt);
                    }).join('*');
                    break;
                case EX:
                    var pg = obj.previousGroup,
                            pwg = obj.power.group;

                    //PL are the exception. It's simpler to just collect and set the value
                    if(pg === PL)
                        value = obj.collectSymbols(text, opt).join('+').replace('+-', '-');
                    if(!(pg === N || pg === S || pg === FN) && !asHash) {
                        value = inBrackets(value);
                    }

                    if((pwg === CP || pwg === CB || pwg === PL || obj.power.multiplier.toString() != '1') && power) {
                        power = inBrackets(power);
                    }
                    break;
            }

            if(group === FN) {
                value = obj.fname + inBrackets(obj.args.map(function (symbol) {
                    return text(symbol, opt);
                }).join(','));
            }
            //TODO: Needs to be more efficient. Maybe.
            if(group === FN && obj.fname in CUSTOM_OPERATORS) {
                var a = text(obj.args[0]);
                var b = text(obj.args[1]);
                if(obj.args[0].isComposite()) //preserve the brackets
                    a = inBrackets(a);
                if(obj.args[1].isComposite()) //preserve the brackets
                    b = inBrackets(b);
                value = a + CUSTOM_OPERATORS[obj.fname] + b;
            }
            //wrap the power since / is less than ^
            //TODO: introduce method call isSimple
            if(power && group !== EX && wrapCondition(power)) {
                power = inBrackets(power);
            }

            //the following groups are held together by plus or minus. They can be raised to a power or multiplied
            //by a multiplier and have to be in brackets to preserve the order of precedence
            if(((group === CP || group === PL) && (multiplier && multiplier != '1' || sign === '-'))
                    || ((group === CB || group === CP || group === PL) && (power && power != '1'))
                    || !asHash && group === P && value == -1
                    || obj.fname === PARENTHESIS) {

                value = inBrackets(value);
            }

            if(decp && (option === 'decimal' || option === 'decimals' && multiplier)) {
                // scientific notation? regular rounding would be the wrong decision here
                if (multiplier.toString().includes('e')) {
                    // toPrecision can create extra digits, so we also
                    // convert it to string straight up and pick the shorter version
                    const m1 = multiplier.toExponential();
                    const m2 = multiplier.toPrecision(decp);
                    multiplier = m1.length < m2.length?m1:m2;
                } else {
                    multiplier = nround(multiplier, decp);
                }
            }


            //add the sign back
            var c = sign + multiplier;

            if(multiplier && wrapCondition(multiplier))
                c = inBrackets(c);

            if(power < 0)
                power = inBrackets(power);

            //add the multiplication back
            if(multiplier)
                c = c + '*';

            if(power) {
                if(value === 'e' && Settings.E_TO_EXP) {
                    return c + 'exp' + inBrackets(power);
                }
                power = Settings.POWER_OPERATOR + power;
            }

            //this needs serious rethinking. Must fix
            if(group === EX && value.charAt(0) === '-') {
                value = inBrackets(value);
            }

            var cv = c + value;

            if(obj.parens) {
                cv = inBrackets(cv);
            }

            return cv + power;
        }
        else if(isVector(obj)) {
            var l = obj.elements.length,
                    c = [];
            for(var i = 0; i < l; i++)
                c.push(obj.elements[i].text(option));
            return '[' + c.join(',') + ']';
        }
        else {
            try {
                return obj.toString();
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return '';
            }
        }
    }
    /**
     * Calculates prime factors for a number. It first checks if the number
     * is a prime number. If it's not then it will calculate all the primes 
     * for that number.
     * @param {int} num
     * @returns {Array}
     */

    function primeFactors(num) {
        checkTimeout();

        if(isPrime(num)) {
            return [num];
        }

        var l = num, i = 1, factors = [],
                epsilon = 2.2204460492503130808472633361816E-16;
        while(i < l) {
            checkTimeout();
            var quotient = num / i;
            var whole = Math.floor(quotient);
            var remainder = quotient - whole;

            if(remainder <= epsilon && i > 1) {
                // If the prime wasn't found but calculated then save it and
                // add it as a factor.
                if(isPrime(i)) {
                    if(PRIMES.indexOf(i) === -1) {
                        PRIMES.push(i);
                    }
                    factors.push(i);
                }

                // Check if the remainder is a prime
                if(isPrime(whole)) {
                    factors.push(whole);
                    break;
                }

                l = whole;
            }
            i++;
        }

        return factors.sort(function (a, b) {
            return a - b;
        });
    }
    ;
    // primeFactors(314146179365)
//Expression ===================================================================
    /**
     * This is what nerdamer returns. It's sort of a wrapper around the symbol class and
     * provides the user with some useful functions. If you want to provide the user with extra
     * library functions then add them to this class's prototype.
     * @param {Symbol} symbol
     * @returns {Expression} wraps around the Symbol class
     */
    function Expression(symbol) {
        //we don't want arrays wrapped
        this.symbol = symbol;
    }
    /**
     * Returns stored expression at index. For first index use 1 not 0.
     * @param {bool} asType
     * @param {Integer} expression_number
     */
    Expression.getExpression = function (expression_number, asType) {
        if(expression_number === 'last' || !expression_number)
            expression_number = EXPRESSIONS.length;
        if(expression_number === 'first')
            expression_number = 1;
        var index = expression_number - 1,
                expression = EXPRESSIONS[index],
                retval = expression ? new Expression(expression) : expression;
        return retval;
    };
    Expression.prototype = {
        /**
         * Returns the text representation of the expression
         * @param {String} opt - option of formatting numbers
         * @param {Number} n The number of significant figures
         * @returns {String}
         */
        text: function (opt, n) {
            n = n || Settings.EXPRESSION_DECP;
            opt = opt || 'decimals';
            if(this.symbol.text_)
                return this.symbol.text_(opt);

            return text(this.symbol, opt, undefined, n);
        },
        /**
         * Returns the latex representation of the expression
         * @param {String} option - option for formatting numbers
         * @returns {String}
         */
        latex: function (option) {
            if(this.symbol.latex)
                return this.symbol.latex(option);
            return LaTeX.latex(this.symbol, option);
        },
        valueOf: function () {
            return this.symbol.valueOf();
        },

        /**
         * Evaluates the expression and tries to reduce it to a number if possible.
         * If an argument is given in the form of %{integer} it will evaluate that expression.
         * Other than that it will just use it's own text and reparse
         * @returns {Expression}
         */
        evaluate: function () {

            // Don't evaluate an empty vector
            if(isVector(this.symbol) && this.symbol.dimensions() === 0) {
                return this;
            }

            var first_arg = arguments[0], expression, idx = 1;

            //Enable getting of expressions using the % so for example %1 should get the first expression
            if(typeof first_arg === 'string') {
                //TODO Replace substr with slice, and test it
                expression = (first_arg.charAt(0) === '%') ? Expression.getExpression(first_arg.substr(1)).text() : first_arg;
            }
            else if(first_arg instanceof Expression || isSymbol(first_arg)) {
                expression = first_arg.text();
            }
            else {
                expression = this.symbol.text();
                idx--;
            }

            var subs = arguments[idx] || {};

            var retval = new Expression(block('PARSE2NUMBER', function () {
                return _.parse(expression, subs);
            }, true));

            return retval;
        },
        /**
         * Converts a symbol to a JS function. Pass in an array of variables to use that order instead of
         * the default alphabetical order
         * @param vars {Array}
         */
        buildFunction: function (vars) {
            return Build.build(this.symbol, vars);
        },
        /**
         * Checks to see if the expression is just a plain old number
         * @returns {boolean}
         */
        isNumber: function () {
            return isNumericSymbol(this.symbol);
        },
        /**
         * Checks to see if the expression is infinity
         * @returns {boolean}
         */
        isInfinity: function () {
            return Math.abs(this.symbol.multiplier) === Infinity;
        },
        /**
         * Checks to see if the expression contains imaginary numbers
         * @returns {boolean}
         */
        isImaginary: function () {
            return evaluate(_.parse(this.symbol)).isImaginary();
        },
        /**
         * Returns all the variables in the expression
         * @returns {Array}
         */
        variables: function () {
            return variables(this.symbol);
        },

        toString: function () {
            try {
                if(isArray(this.symbol))
                    return '[' + this.symbol.toString() + ']';
                return this.symbol.toString();
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return '';
            }
        },
        //forces the symbol to be returned as a decimal
        toDecimal: function (prec) {
            Settings.precision = prec;
            var dec = text(this.symbol, 'decimals');
            Settings.precision = undefined;
            return dec;
        },
        //checks to see if the expression is a fraction
        isFraction: function () {
            return isFraction(this.symbol);
        },
        //checks to see if the symbol is a multivariate polynomial
        isPolynomial: function () {
            return this.symbol.isPoly();
        },
        //performs a substitution
        sub: function (symbol, for_symbol) {
            return new Expression(this.symbol.sub(_.parse(symbol), _.parse(for_symbol)));
        },
        operation: function (otype, symbol) {
            if(isExpression(symbol))
                symbol = symbol.symbol;
            else if(!isSymbol(symbol))
                symbol = _.parse(symbol);
            return new Expression(_[otype](this.symbol.clone(), symbol.clone()));
        },
        add: function (symbol) {
            return this.operation('add', symbol);
        },
        subtract: function (symbol) {
            return this.operation('subtract', symbol);
        },
        multiply: function (symbol) {
            return this.operation('multiply', symbol);
        },
        divide: function (symbol) {
            return this.operation('divide', symbol);
        },
        pow: function (symbol) {
            return this.operation('pow', symbol);
        },
        expand: function () {
            return new Expression(_.expand(this.symbol));
        },
        each: function (callback, i) {
            if(this.symbol.each)
                this.symbol.each(callback, i);
            else if(isArray(this.symbol)) {
                for(var i = 0; i < this.symbol.length; i++)
                    callback.call(this.symbol, this.symbol[i], i);
            }
            else
                callback.call(this.symbol);
        },
        eq: function (value) {
            if(!isSymbol(value))
                value = _.parse(value);
            try {
                var d = _.subtract(this.symbol.clone(), value);
                return d.equals(0);
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return false;
            }
            ;
        },
        lt: function (value) {
            if(!isSymbol(value))
                value = _.parse(value);
            try {
                var d = evaluate(_.subtract(this.symbol.clone(), value));
                return d.lessThan(0);
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return false;
            }
            ;
        },
        gt: function (value) {
            if(!isSymbol(value))
                value = _.parse(value);
            try {
                var d = evaluate(_.subtract(this.symbol.clone(), value));
                return d.greaterThan(0);
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return false;
            }
        },
        gte: function (value) {
            return this.gt(value) || this.eq(value);
        },
        lte: function (value) {
            return this.lt(value) || this.eq(value);
        },

        numerator: function () {
            return new Expression(this.symbol.getNum());
        },
        denominator: function () {
            return new Expression(this.symbol.getDenom());
        },
        hasFunction: function (f) {
            return this.symbol.containsFunction(f);
        },
        contains: function (variable) {
            return this.symbol.contains(variable);
        }
    };
    //Aliases
    Expression.prototype.toTeX = Expression.prototype.latex;

    
//Scientific ===================================================================
    /*
     * Javascript has the toExponential method but this allows you to work with string and therefore any number of digits of your choosing
     * For example Scientific('464589498449496467924197545625247695464569568959124568489548454');
     */

    function Scientific(num) {
        if(!(this instanceof Scientific))
            return new Scientific(num);

        num = String(typeof num === 'undefined' ? 0 : num); //convert to a string

        //remove the sign
        if(num.startsWith('-')) {
            this.sign = -1;
            //remove the sign
            num = num.substr(1, num.length);
        }
        else {
            this.sign = 1;
        }

        if(Scientific.isScientific(num)) {
            this.fromScientific(num);
        }
        else {
            this.convert(num);
        }
        return this;
    }

    Scientific.prototype = {
        fromScientific: function (num) {
            var parts = String(num).toLowerCase().split('e');
            this.coeff = parts[0];
            this.exponent = parts[1];

            return this;
        },
        convert: function (num) {
            //get wholes and decimals
            var parts = num.split('.');
            //make zero go away
            var w = parts[0] || '';
            var d = parts[1] || '';
            //convert zero to blank strings
            w = Scientific.removeLeadingZeroes(w);
            d = Scientific.removeTrailingZeroes(d);
            //find the location of the decimal place which is right after the wholes
            var dot_location = w.length;
            //add them together so we can move the dot
            var n = w + d;
            //find the next number
            var zeroes = Scientific.leadingZeroes(n).length;
            //set the exponent
            this.exponent = dot_location - (zeroes + 1);
            //set the coeff but first remove leading zeroes
            var coeff = Scientific.removeLeadingZeroes(n);
            this.coeff = coeff.charAt(0) + '.' + (coeff.substr(1, coeff.length) || '0');

            //the coeff decimal places
            var dec = this.coeff.split('.')[1] || ''; //if it's undefined or zero it's going to blank

            this.decp = dec === '0' ? 0 : dec.length;
            //decimals
            this.dec = d;
            //wholes
            this.wholes = w;

            return this;
        },
        round: function (num) {
            var n = this.copy();

            num = Number(num); //cast to number for safety
            //since we know it guaranteed to be in the format {digit}{optional dot}{optional digits}
            //we can round based on this
            if(num === 0)
                n.coeff = n.coeff.charAt(0);
            else {
                //get up to n-1 digits
                var rounded = this.coeff.substring(0, num + 1);
                //get the next two
                var next_two = this.coeff.substring(num + 1, num + 3);
                //the extra digit
                var ed = next_two.charAt(0);

                if(next_two.charAt(1) > 4)
                    ed++;

                n.coeff = rounded + ed;
            }

            return n;
        },
        copy: function () {
            var n = new Scientific(0);
            n.coeff = this.coeff;
            n.exponent = this.exponent;
            n.sign = this.sign;
            return n;
        },
        toString: function (n) {
            var retval;

            if(Settings.SCIENTIFIC_IGNORE_ZERO_EXPONENTS && this.exponent === 0 && this.decp < n) {
                if(this.decp === 0)
                    retval = this.wholes;
                else
                    retval = this.coeff;
            }
            else {
                var coeff = typeof n === 'undefined' ? this.coeff : Scientific.round(this.coeff, Math.min(n, this.decp || 1));
                retval = this.exponent === 0 ? coeff : coeff + 'e' + this.exponent;
            }

            return (this.sign === -1 ? '-' : '') + retval;
        }
    };

    Scientific.isScientific = function (num) {
        return /\d+\.?\d*e[\+\-]*\d+/i.test(num);
    };
    Scientific.leadingZeroes = function (num) {
        var match = num.match(/^(0*).*$/);
        return match ? match[1] : '';
    };
    Scientific.removeLeadingZeroes = function (num) {
        var match = num.match(/^0*(.*)$/);
        return match ? match[1] : '';
    };

    Scientific.removeTrailingZeroes = function (num) {
        var match = num.match(/0*$/);
        return match ? num.substring(0, num.length - match[0].length) : '';
    };

    Scientific.round = function (c, n) {
        var coeff = nround(c, n);
        var m = String(coeff).split('.').pop();
        var d = n - m.length;
        //if we're asking for more significant figures
        if(d > 0) {
            coeff = coeff + (new Array(d + 1).join(0));
        }
        return coeff;
    };

//Frac =========================================================================
    function Frac(n) {
        if(n instanceof Frac)
            return n;
        if(n === undefined)
            return this;
        try {
            if(isInt(n)) {
                try {
                    this.num = bigInt(n);
                    this.den = bigInt(1);
                }
                catch(e) {
                    if (e.message === "timeout") throw e;
                    return Frac.simple(n);
                }
            }
            else {
                var frac = n instanceof bigDec ? Fraction.quickConversion(n) : Fraction.convert(n);
                this.num = new bigInt(frac[0]);
                this.den = new bigInt(frac[1]);
            }
        }
        catch(e) {
            if (e.message === "timeout") throw e;
            return Frac.simple(n);
        }

    }
    //safe to use with negative numbers or other types
    Frac.create = function (n) {
        if(n instanceof Frac)
            return n;
        n = n.toString();
        var is_neg = n.charAt(0) === '-'; //check if it's negative
        if(is_neg)
            n = n.substr(1, n.length - 1); //remove the sign
        var frac = new Frac(n);
        //put the sign back
        if(is_neg)
            frac.negate();
        return frac;
    };
    Frac.isFrac = function (o) {
        return (o instanceof Frac);
    };
    Frac.quick = function (n, d) {
        var frac = new Frac();
        frac.num = new bigInt(n);
        frac.den = new bigInt(d);
        return frac;
    };
    Frac.simple = function (n) {
        var nstr = String(scientificToDecimal(n)),
                m_dc = nstr.split('.'),
                num = m_dc.join(''),
                den = 1,
                l = (m_dc[1] || '').length;
        for(var i = 0; i < l; i++)
            den += '0';
        var frac = Frac.quick(num, den);
        return frac.simplify();
    };
    Frac.prototype = {
        multiply: function (m) {
            if(this.isOne()) {
                return m.clone();
            }
            if(m.isOne()) {
                return this.clone();
            }

            var c = this.clone();
            c.num = c.num.multiply(m.num);
            c.den = c.den.multiply(m.den);

            return c.simplify();
        },
        divide: function (m) {
            if(m.equals(0))
                throw new DivisionByZero('Division by zero not allowed!');
            return this.clone().multiply(m.clone().invert()).simplify();
        },
        subtract: function (m) {
            return this.clone().add(m.clone().neg());
        },
        neg: function () {
            this.num = this.num.multiply(-1);
            return this;
        },
        add: function (m) {
            var n1 = this.den, n2 = m.den, c = this.clone();
            var a = c.num, b = m.num;
            if(n1.equals(n2)) {
                c.num = a.add(b);
            }
            else {
                c.num = a.multiply(n2).add(b.multiply(n1));
                c.den = n1.multiply(n2);
            }

            return c.simplify();
        },
        mod: function (m) {
            var a = this.clone(),
                    b = m.clone();
            //make their denominators even and return the mod of their numerators
            a.num = a.num.multiply(b.den);
            a.den = a.den.multiply(b.den);
            b.num = b.num.multiply(this.den);
            b.den = b.den.multiply(this.den);
            a.num = a.num.mod(b.num);
            return a.simplify();
        },
        simplify: function () {
            var gcd = bigInt.gcd(this.num, this.den);

            this.num = this.num.divide(gcd);
            this.den = this.den.divide(gcd);
            return this;
        },
        clone: function () {
            var m = new Frac();
            m.num = new bigInt(this.num);
            m.den = new bigInt(this.den);
            return m;
        },
        decimal: function (prec) {
            var sign = this.num.isNegative() ? '-' : '';
            if(this.num.equals(this.den)) {
                return '1';
            }
            //go plus one for rounding
            prec = prec || Settings.PRECISION;
            prec++;
            var narr = [],
                    n = this.num.abs(),
                    d = this.den;
            for(var i = 0; i < prec; i++) {
                var w = n.divide(d), //divide out whole
                        r = n.subtract(w.multiply(d)); //get remainder

                narr.push(w);
                if(r.equals(0))
                    break;
                n = r.times(10); //shift one dec place
            }
            var whole = narr.shift();
            if(narr.length === 0) {
                return sign + whole.toString();
            }

            if(i === prec) {
                var lt = [];
                //get the last two so we can round it
                for(var i = 0; i < 2; i++)
                    lt.unshift(narr.pop());
                //put the last digit back by rounding the last two
                narr.push(Math.round(lt.join('.')));
            }

            var dec = whole.toString() + '.' + narr.join('');
            return sign + dec;
        },
        toDecimal: function (prec) { 
            prec = prec || Settings.PRECISION;
            if(prec) {
                return this.decimal(prec);
            }
            else {
                return this.num / this.den;
            }
        },
        qcompare: function (n) {
            return [this.num.multiply(n.den), n.num.multiply(this.den)];
        },
        equals: function (n) {
            if(!isNaN(n))
                n = new Frac(n);
            var q = this.qcompare(n);

            return q[0].equals(q[1]);
        },
        absEquals: function (n) {
            if(!isNaN(n))
                n = new Frac(n);
            var q = this.qcompare(n);

            return q[0].abs().equals(q[1]);
        },
        //lazy check to be fixed. Sufficient for now but will cause future problems
        greaterThan: function (n) {
            if(!isNaN(n))
                n = new Frac(n);
            var q = this.qcompare(n);

            return q[0].gt(q[1]);
        },
        gte: function (n) {
            return this.greaterThan(n) || this.equals(n);
        },
        lte: function (n) {
            return this.lessThan(n) || this.equals(n);
        },
        lessThan: function (n) {
            if(!isNaN(n))
                n = new Frac(n);
            var q = this.qcompare(n);

            return q[0].lt(q[1]);
        },
        isInteger: function () {
            return this.den.equals(1);
        },
        negate: function () {
            this.num = this.num.multiply(-1);
            return this;
        },
        invert: function () {
            var t = this.den;
            //why invert 0/1? It'll become 1/0 and that's a lie.
            if(!this.num.equals(0)) {
                var isnegative = this.num.isNegative();
                this.den = this.num.abs();
                this.num = t;
                if(isnegative)
                    this.num = this.num.multiply(-1);
            }

            return this;
        },
        isOne: function () {
            return this.num.equals(1) && this.den.equals(1);
        },
        sign: function () {
            return this.num.isNegative() ? -1 : 1;
        },
        abs: function () {
            this.num = this.num.abs();
            return this;
        },
        gcd: function (f) {
            return Frac.quick(bigInt.gcd(f.num, this.num), bigInt.lcm(f.den, this.den));
        },
        toString: function () {
            return !this.den.equals(1) ? this.num.toString() + '/' + this.den.toString() : this.num.toString();
        },
        valueOf: function () {
//            if(this.num == 24) throw new Error(999)
            if(Settings.USE_BIG)
                return new bigDec(this.num.toString()).div(new bigDec(this.den.toString()));
            var retval = this.num / this.den;
            return retval;
        },
        isNegative: function () {
            return this.toDecimal() < 0;
        }
    };

//Symbol =======================================================================
    /**
     * All symbols e.g. x, y, z, etc or functions are wrapped in this class. All symbols have a multiplier and a group.
     * All symbols except for "numbers (group N)" have a power.
     * @class Primary data type for the Parser.
     * @param {String} obj
     * @returns {Symbol}
     */
    function Symbol(obj) {
        checkTimeout();

        var isInfinity = obj === 'Infinity';
        // This enables the class to be instantiated without the new operator
        if(!(this instanceof Symbol)) {
            return new Symbol(obj);
        }
        // Convert big numbers to a string
        if(obj instanceof bigDec) {
            obj = obj.toString();
        }
        //define numeric symbols
        if(/^(\-?\+?\d+)\.?\d*e?\-?\+?\d*/i.test(obj) || obj instanceof bigDec) {
            this.group = N;
            this.value = CONST_HASH;
            this.multiplier = new Frac(obj);
        }
        //define symbolic symbols
        else {
            this.group = S;
            validateName(obj);
            this.value = obj;
            this.multiplier = new Frac(1);
            this.imaginary = obj === Settings.IMAGINARY;
            this.isInfinity = isInfinity;
        }

        //As of 6.0.0 we switched to infinite precision so all objects have a power
        //Although this is still redundant in constants, it simplifies the logic in
        //other parts so we'll keep it
        this.power = new Frac(1);

        // Added to silence the strict warning.
        return this;
    }
    /**
     * Returns vanilla imaginary symbol
     * @returns {Symbol}
     */
    Symbol.imaginary = function () {
        var s = new Symbol(Settings.IMAGINARY);
        s.imaginary = true;
        return s;
    };
    /**
     * Return nerdamer's representation of Infinity
     * @param {int} negative -1 to return negative infinity
     * @returns {Symbol}
     */
    Symbol.infinity = function (negative) {
        var v = new Symbol('Infinity');
        if(negative === -1)
            v.negate();
        return v;
    };
    Symbol.shell = function (group, value) {
        var symbol = new Symbol(value);
        symbol.group = group;
        symbol.symbols = {};
        symbol.length = 0;
        return symbol;
    };
    //sqrt(x) -> x^(1/2)
    Symbol.unwrapSQRT = function (symbol, all) {
        var p = symbol.power;
        if(symbol.fname === SQRT && (symbol.isLinear() || all)) {
            var t = symbol.args[0].clone();
            t.power = t.power.multiply(new Frac(1 / 2));
            t.multiplier = t.multiplier.multiply(symbol.multiplier);
            symbol = t;
            if(all)
                symbol.power = p.multiply(new Frac(1 / 2));
        }

        return symbol;
    };
    Symbol.hyp = function (a, b) {
        a = a || new Symbol(0);
        b = b || new Symbol(0);
        return _.sqrt(_.add(_.pow(a.clone(), new Symbol(2)), _.pow(b.clone(), new Symbol(2))));
    };
    //converts to polar form array
    Symbol.toPolarFormArray = function (symbol) {
        var re, im, r, theta;
        re = symbol.realpart();
        im = symbol.imagpart();
        r = Symbol.hyp(re, im);
        theta = re.equals(0) ? _.parse('pi/2') : _.trig.atan(_.divide(im, re));
        return [r, theta];
    };
    //removes parentheses
    Symbol.unwrapPARENS = function (symbol) {
        if(symbol.fname === '') {
            var r = symbol.args[0];
            r.power = r.power.multiply(symbol.power);
            r.multiplier = r.multiplier.multiply(symbol.multiplier);
            if(symbol.fname === '')
                return Symbol.unwrapPARENS(r);
            return r;
        }
        return symbol;
    };
    //quickly creates a Symbol
    Symbol.create = function (value, power) {
        power = power === undefined ? 1 : power;
        return _.parse('(' + value + ')^(' + power + ')');
    };
    Symbol.prototype = {
        pushMinus: function() {
            let retval = this;
            if (((this.group === CB) ||
                this.group === CP || this.group === PL) &&
                this.multiplier.lessThan(0) && !even(this.power)) {
                // console.log();
                // console.log("replacing "+this.text("fractions"))
                retval = this.clone();
                let m = retval.multiplier.clone();
                m.negate();
                // console.log("  negated multiplier: "+m)
                retval.toUnitMultiplier();
            
                // console.log("  unit main part: "+this)
                for (let termkey in retval.symbols) {
                    retval.symbols[termkey] = retval.symbols[termkey].clone().negate();
                    // console.log("  negated term: "+this.symbols[termkey])
                    if (retval.group === CB) {
                        // console.log("  is CB, breaking");
                        break;
                    }
                }

                // console.log("  combined: "+retval.text("fractions"));
                if (retval.length > 0) {
                    retval.each(c => c.pushMinus());
                    // console.log("  result: "+this.text("fractions"));
                }
                
                // console.log("  negated main part: "+retval)
                retval = _.parse(retval);
                retval = _.multiply(_.parse(m), retval);
            }
            return retval;
        },
        
        /**
         * Gets nth root accounting for rounding errors
         * @param {Number} n
         * @return {Number}
         */
        getNth: function (n) {
            // First calculate the root
            var root = evaluate(_.pow(_.parse(this.multiplier), _.parse(n).invert()));
            // Round of any errors
            var rounded = _.parse(nround(root));
            // Reverse the root
            var e = evaluate(_.pow(rounded, _.parse(n)));
            // If the rounded root equals the original number then we're good 
            if(e.equals(_.parse(this.multiplier))) {
                return rounded;
            }
            // Otherwise return the unrounded version
            return root;
        },
        /**
         * Checks if symbol is to the nth power
         * @returns {Boolean}
         */
        isToNth: function (n) {
            // Start by check in the multiplier for squareness
            // First get the root but round it because currently we still depend 
            var root = this.getNth(n);
            var nthMultiplier = isInt(root);
            var nthPower;

            if(this.group === CB) {
                // Start by assuming that all will be square.
                nthPower = true;
                // All it takes is for one of the symbols to not have an even power
                // e.g. x^n1*y^n2 requires that both n1 and n2 are even
                this.each(function (x) {
                    var isNth = x.isToNth(n);

                    if(!isNth) {
                        nthPower = false;
                    }
                });
            }
            else {
                // Check if the power is divisible by n if it's not a number.
                nthPower = this.group === N ? true : isInt(_.divide(_.parse(this.power), _.parse(n)));
            }

            return nthMultiplier && nthPower;
        },
        /**
         * Checks if a symbol is square
         * @return {Boolean}
         */
        isSquare: function () {
            return this.isToNth(2);
        },
        /**
         * Checks if a symbol is cube
         * @return {Boolean}
         */
        isCube: function () {
            return this.isToNth(3);
        },
        /**
         * Checks if a symbol is a bare variable
         * @return {Boolean}
         */
        isSimple: function () {
            return this.power.equals(1) && this.multiplier.equals(1);
        },
        /**
         * Simplifies the power of the symbol
         * @returns {Symbol} a clone of the symbol
         */
        powSimp: function () {
            if(this.group === CB) {
                var powers = [],
                        sign = this.multiplier.sign();
                this.each(function (x) {
                    var p = x.power;
                    //why waste time if I can't do anything anyway
                    if(isSymbol(p) || p.equals(1))
                        return;
                    powers.push(p);
                });
                if (powers.length === 0) {
                    return this.clone();
                }
                var min = new Frac(arrayMin(powers));

                //handle the coefficient
                //handle the multiplier
                var sign = this.multiplier.sign(),
                        m = this.multiplier.clone().abs(),
                        mfactors = Math2.ifactor(m);
                //if we have a multiplier of 6750 and a min of 2 then the factors are 5^3*5^3*2
                //we can then reduce it to 2*3*5*(15)^2
                var out_ = new Frac(1);
                var in_ = new Frac(1);

                for(var x in mfactors) {
                    var n = new Frac(mfactors[x]);
                    if(!n.lessThan(min)) {
                        n = n.divide(min).subtract(new Frac(1));
                        in_ = in_.multiply(new Frac(x)); //move the factor inside the bracket
                    }

                    out_ = out_.multiply(_.parse(inBrackets(x) + '^' + inBrackets(n)).multiplier);
                }
                var t = new Symbol(in_);
                this.each(function (x) {
                    x = x.clone();
                    x.power = x.power.divide(min);
                    t = _.multiply(t, x);
                });

                var xt = _.symfunction(PARENTHESIS, [t]);
                xt.power = min;
                xt.multiplier = sign < 0 ? out_.negate() : out_;

                return xt;
            }
            return this.clone();
        },
        /**
         * Checks to see if two functions are of equal value
         * @param {Symbol} symbol
         */
        equals: function (symbol) {
            if(!isSymbol(symbol))
                symbol = new Symbol(symbol);
            return this.value === symbol.value && this.power.equals(symbol.power)
                    && this.multiplier.equals(symbol.multiplier)
                    && this.group === symbol.group;
        },
        abs: function () {
            var e = this.clone();
            e.multiplier.abs();
            return e;
        },
        // Greater than
        gt: function (symbol) {
            if(!isSymbol(symbol))
                symbol = new Symbol(symbol);
            return this.isConstant() && symbol.isConstant() && this.multiplier.greaterThan(symbol.multiplier);
        },
        // Greater than
        gte: function (symbol) {
            if(!isSymbol(symbol))
                symbol = new Symbol(symbol);
            return this.equals(symbol) ||
                    this.isConstant() && symbol.isConstant() && this.multiplier.greaterThan(symbol.multiplier);
        },
        // Less than
        lt: function (symbol) {
            if(!isSymbol(symbol))
                symbol = new Symbol(symbol);
            return this.isConstant() && symbol.isConstant() && this.multiplier.lessThan(symbol.multiplier);
        },
        // Less than
        lte: function (symbol) {
            if(!isSymbol(symbol))
                symbol = new Symbol(symbol);
            return this.equals(symbol) ||
                    this.isConstant() && symbol.isConstant() && this.multiplier.lessThan(symbol.multiplier);
        },
        /**
         * Because nerdamer doesn't group symbols by polynomials but
         * rather a custom grouping method, this has to be
         * reinserted in order to make use of most algorithms. This function
         * checks if the symbol meets the criteria of a polynomial.
         * @param {bool} multivariate
         * @returns {boolean}
         */
        isPoly: function (multivariate) {
            var g = this.group,
                    p = this.power;
            //the power must be a integer so fail if it's not
            if(!isInt(p) || p < 0)
                return false;
            //constants and first orders
            if(g === N || g === S || this.isConstant(true))
                return true;
            var vars = variables(this);
            if(g === CB && vars.length === 1) {
                //the variable is assumed the only one that was found
                var v = vars[0];
                //if no variable then guess what!?!? We're done!!! We have a polynomial.
                if(!v)
                    return true;
                for(var x in this.symbols) {
                    var sym = this.symbols[x];
                    //sqrt(x)
                    if(sym.group === FN && !sym.args[0].isConstant())
                        return false;
                    if(!sym.contains(v) && !sym.isConstant(true))
                        return false;
                }
                return true;
            }
            //PL groups. These only fail if a power is not an int
            //this should handle cases such as x^2*t
            if(this.isComposite() || g === CB && multivariate) {
                //fail if we're not checking for multivariate polynomials
                if(!multivariate && vars.length > 1)
                    return false;
                //loop though the symbols and check if they qualify
                for(var x in this.symbols) {
                    //we've already the symbols if we're not checking for multivariates at this point
                    //so we check the sub-symbols
                    if(!this.symbols[x].isPoly(multivariate))
                        return false;
                }
                return true;
            }
            else
                return false;

            /*
             //all tests must have passed so we must be dealing with a polynomial
             return true;
             */
        },
        //removes the requested variable from the symbol and returns the remainder
        stripVar: function (x, exclude_x) {
            var retval;
            if((this.group === PL || this.group === S) && this.value === x)
                retval = new Symbol(exclude_x ? 0 : this.multiplier);
            else if(this.group === CB && this.isLinear()) {
                retval = new Symbol(1);
                this.each(function (s) {
                    if(!s.contains(x, true))
                        retval = _.multiply(retval, s.clone());
                });
                retval.multiplier = retval.multiplier.multiply(this.multiplier);
            }
            else if(this.group === CP && !this.isLinear()) {
                retval = new Symbol(this.multiplier);
            }
            else if(this.group === CP && this.isLinear()) {
                retval = new Symbol(0);
                this.each(function (s) {
                    if(!s.contains(x)) {
                        var t = s.clone();
                        t.multiplier = t.multiplier.multiply(this.multiplier);
                        retval = _.add(retval, t);
                    }
                });
                //BIG TODO!!! It doesn't make much sense
                if(retval.equals(0))
                    retval = new Symbol(this.multiplier);
            }
            else if(this.group === EX && this.power.contains(x, true)) {
                retval = new Symbol(this.multiplier);
            }
            else if(this.group === FN && this.contains(x)) {
                retval = new Symbol(this.multiplier);
            }
            else
                //wth? This should technically be the multiplier.
                //Unfortunately this method wasn't very well thought out :`(.
                //should be: retval = new Symbol(this.multiplier);
                //use: ((1+x^2)*sqrt(-1+x^2))^(-1) for correction.
                //this will break a bunch of unit tests so be ready to for the long haul
                retval = this.clone();


            return retval;
        },
        //returns symbol in array form with x as base e.g. a*x^2+b*x+c = [c, b, a].
        toArray: function (v, arr) {
            arr = arr || {
                arr: [],
                add: function (x, idx) {
                    var e = this.arr[idx];
                    this.arr[idx] = e ? _.add(e, x) : x;
                }
            };
            var g = this.group;

            if(g === S && this.contains(v)) {
                arr.add(new Symbol(this.multiplier), this.power);
            }
            else if(g === CB) {
                var a = this.stripVar(v),
                        x = _.divide(this.clone(), a.clone());
                var p = x.isConstant() ? 0 : x.power;
                arr.add(a, p);
            }
            else if(g === PL && this.value === v) {
                this.each(function (x, p) {
                    arr.add(x.stripVar(v), p);
                });
            }
            else if(g === CP) {
                //the logic: they'll be broken into symbols so e.g. (x^2+x)+1 or (a*x^2+b*x+c)
                //each case is handled above
                this.each(function (x) {
                    x.toArray(v, arr);
                });
            }
            else if(this.contains(v)) {
                throw new NerdamerTypeError('Cannot convert to array! Exiting');
            }
            else {
                arr.add(this.clone(), 0); //it's just a constant wrt to v
            }
            //fill the holes
            arr = arr.arr; //keep only the array since we don't need the object anymore
            for(var i = 0; i < arr.length; i++)
                if(!arr[i])
                    arr[i] = new Symbol(0);
            return arr;
        },
        //checks to see if a symbol contans a function
        hasFunc: function (v) {
            var fn_group = this.group === FN || this.group === EX;
            if(fn_group && !v || fn_group && this.contains(v))
                return true;
            if(this.symbols) {
                for(var x in this.symbols) {
                    if(this.symbols[x].hasFunc(v))
                        return true;
                }
            }
            return false;
        },
        sub: function (a, b) {
            a = !isSymbol(a) ? _.parse(a) : a.clone();
            b = !isSymbol(b) ? _.parse(b) : b.clone();
            if(a.group === N || a.group === P)
                err('Cannot substitute a number. Must be a variable');
            var same_pow = false,
                    a_is_unit_multiplier = a.multiplier.equals(1),
                    m = this.multiplier.clone(),
                    retval;
            /*
             * In order to make the substitution the bases have to first match take
             * (x+1)^x -> (x+1)=y || x^2 -> x=y^6
             * In both cases the first condition is that the bases match so we begin there
             * Either both are PL or both are not PL but we cannot have PL and a non-PL group match
             */
            if(this.value === a.value && (this.group !== PL && a.group !== PL || this.group === PL && a.group === PL)) {
                //we cleared the first hurdle but a subsitution may not be possible just yet
                if(a_is_unit_multiplier || a.multiplier.equals(this.multiplier)) {
                    if(a.isLinear()) {
                        retval = b;
                    }
                    else if(a.power.equals(this.power)) {
                        retval = b;
                        same_pow = true;
                    }
                    if(a.multiplier.equals(this.multiplier))
                        m = new Frac(1);
                }
            }
            //the next thing is to handle CB
            else if(this.group === CB || this.previousGroup === CB) {
                retval = new Symbol(1);
                this.each(function (x) {
                    var subbed = _.parse(x.sub(a, b)); //parse it again for safety
                    retval = _.multiply(retval, subbed);

                });
            }
            else if(this.isComposite()) {
                var symbol = this.clone();

                if(a.isComposite() && symbol.isComposite() && symbol.isLinear() && a.isLinear()) {
                    var find = function (stack, needle) {
                        for(var x in stack.symbols) {
                            var sym = stack.symbols[x];
                            //if the symbol equals the needle or it's within the sub-symbols we're done
                            if(sym.isComposite() && find(sym, needle) || sym.equals(needle))
                                return true;
                        }
                        return false;
                    };
                    //go fish
                    for(var x in a.symbols) {
                        if(!find(symbol, a.symbols[x]))
                            return symbol.clone();
                    }
                    retval = _.add(_.subtract(symbol.clone(), a), b);
                }
                else {
                    retval = new Symbol(0);
                    symbol.each(function (x) {
                        retval = _.add(retval, x.sub(a, b));
                    });
                }
            }
            else if(this.group === EX) {
                // the parsed value could be a function so parse and sub
                retval = _.parse(this.value).sub(a, b);
            }
            else if(this.group === FN) {
                var nargs = [];
                for(var i = 0; i < this.args.length; i++) {
                    var arg = this.args[i];
                    if(!isSymbol(arg))
                        arg = _.parse(arg);
                    nargs.push(arg.sub(a, b));
                }
                retval = _.symfunction(this.fname, nargs);
            }
            //if we did manage a substitution
            if(retval) {
                if(!same_pow) {
                    //substitute the power
                    var p = this.group === EX ? this.power.sub(a, b) : _.parse(this.power);
                    //now raise the symbol to that power
                    retval = _.pow(retval, p);
                }

                //transfer the multiplier
                retval.multiplier = retval.multiplier.multiply(m);

                //done
                return retval;
            }
            //if all else fails
            return this.clone();
        },
        isMonomial: function () {
            if(this.group === S)
                return true;
            if(this.group === CB) {
                for(var x in this.symbols)
                    if(this.symbols[x].group !== S)
                        return false;
            }
            else
                return false;
            return true;
        },
        isPi: function () {
            return this.group === S && this.value === 'pi';
        },
        sign: function () {
            return this.multiplier.sign();
        },
        isE: function () {
            return this.value === 'e';
        },
        isSQRT: function () {
            return this.fname === SQRT;
        },
        isConstant: function (check_all, check_symbols) {
            if(check_symbols && this.group === CB) {
                for(var x in this.symbols) {
                    if(this.symbols[x].isConstant(true))
                        return true;
                }
            }

            if(check_all === 'functions' && this.isComposite()) {
                var isConstant = true;

                this.each(function (x) {
                    if(!x.isConstant(check_all, check_symbols)) {
                        isConstant = false;
                    }
                }, true);

                return isConstant;
            }

            if(check_all === 'all' && (this.isPi() || this.isE())) {
                return true;
            }

            if(check_all && this.group === FN) {
                for(var i = 0; i < this.args.length; i++) {
                    if(!this.args[i].isConstant(check_all))
                        return false;
                }
                return true;
            }

            if(check_all)
                return isNumericSymbol(this);
            return this.value === CONST_HASH;
        },
        //the symbols is imaginary if
        //1. n*i
        //2. a+b*i
        //3. a*i
        isImaginary: function () {
            if(this.imaginary)
                return true;
            else if(this.symbols) {
                for(var x in this.symbols)
                    if(this.symbols[x].isImaginary())
                        return true;
            }
            return false;
        },
        /**
         * Returns the real part of a symbol
         * @returns {Symbol}
         */
        realpart: function () {
            if(this.isConstant()) {
                return this.clone();
            }
            else if(this.imaginary)
                return new Symbol(0);
            else if(this.isComposite()) {
                var retval = new Symbol(0);
                this.each(function (x) {
                    retval = _.add(retval, x.realpart());
                });
                return retval;
            }
            else if(this.isImaginary())
                return new Symbol(0);
            return this.clone();
        },
        /*
         * Return imaginary part of a symbol
         * @returns {Symbol}
         */
        imagpart: function () {
            if(this.group === S && this.isImaginary()) {
                let x = this;
                if (this.power.isNegative()) {
                    x = this.clone();
                    x.power.negate();
                    x.multiplier.negate()
                }
                return new Symbol(x.multiplier);
            }
            if(this.isComposite()) {
                var retval = new Symbol(0);
                this.each(function (x) {
                    retval = _.add(retval, x.imagpart());
                });
                return retval;
            }
            if(this.group === CB)
                return this.stripVar(Settings.IMAGINARY);
            return new Symbol(0);
        },
        isInteger: function () {
            return this.isConstant() && this.multiplier.isInteger();
        },
        isLinear: function (wrt) {
            if(wrt) {
                if(this.isConstant())
                    return true;
                if(this.group === S) {
                    if(this.value === wrt)
                        return this.power.equals(1);
                    else
                        return true;
                }

                if(this.isComposite() && this.power.equals(1)) {
                    for(var x in this.symbols) {
                        if(!this.symbols[x].isLinear(wrt))
                            return false;
                    }
                    return true;
                }

                if(this.group === CB && this.symbols[wrt])
                    return this.symbols[wrt].isLinear(wrt);
                return false;
            }
            else
                return this.power.equals(1);
        },
        /**
         * Checks to see if a symbol has a function by a specified name or within a specified list
         * @param {String|String[]} names
         * @returns {Boolean}
         */
        containsFunction: function (names) {
            if(typeof names === 'string')
                names = [names];
            if(this.group === FN && names.indexOf(this.fname) !== -1)
                return true;
            if(this.symbols) {
                for(var x in this.symbols) {
                    if(this.symbols[x].containsFunction(names))
                        return true;
                }
            }
            return false;
        },
        multiplyPower: function (p2) {
            //leave out 1
            if(this.group === N && this.multiplier.equals(1))
                return this;

            var p1 = this.power;

            if(this.group !== EX && p2.group === N) {
                var p = p2.multiplier;
                if(this.group === N && !p.isInteger()) {
                    this.convert(P);
                }

                this.power = p1.equals(1) ? p.clone() : p1.multiply(p);

                if(this.group === P && isInt(this.power)) {
                    //bring it back to an N
                    this.value = Math.pow(this.value, this.power);
                    this.toLinear();
                    this.convert(N);
                }
            }
            else {
                if(this.group !== EX) {
                    p1 = new Symbol(p1);
                    this.convert(EX);
                }
                this.power = _.multiply(p1, p2);
            }

            return this;
        },
        setPower: function (p, retainSign) {
            //leave out 1
            if(this.group === N && this.multiplier.equals(1)) {
                return this;
            }
            if(this.group === EX && !isSymbol(p)) {
                this.group = this.previousGroup;
                delete this.previousGroup;
                if(this.group === N) {
                    this.multiplier = new Frac(this.value);
                    this.value = CONST_HASH;
                }
                else
                    this.power = p;
            }
            else {
                var isSymbolic = false;
                if(isSymbol(p)) {
                    if(p.group === N) {
                        //p should be the multiplier instead
                        p = p.multiplier;

                    }
                    else {
                        isSymbolic = true;
                    }
                }
                var group = isSymbolic ? EX : P;
                this.power = p;
                if(this.group === N && group)
                    this.convert(group, retainSign);
            }

            return this;
        },
        /**
         * Checks to see if symbol is located in the denominator
         * @returns {boolean}
         */
        isInverse: function () {
            if(this.group === EX)
                return (this.power.multiplier.lessThan(0));
            return this.power < 0;
        },
        /**
         * Make a duplicate of a symbol by copying a predefined list of items.
         * The name 'copy' would probably be a more appropriate name.
         * to a new symbol
         * @param {Symbol} c
         * @returns {Symbol}
         */
        clone: function (c) {
            var clone = c || new Symbol(0),
                    //list of properties excluding power as this may be a symbol and would also need to be a clone.
                    properties = [
                        'value', 'group', 'length', 'previousGroup', 'imaginary', 'fname', 'args', 'isInfinity', 'scientific'],
                    l = properties.length, i;
            if(this.symbols) {
                clone.symbols = {};
                for(var x in this.symbols) {
                    clone.symbols[x] = this.symbols[x].clone();
                }
            }

            for(i = 0; i < l; i++) {
                if(this[properties[i]] !== undefined) {
                    clone[properties[i]] = this[properties[i]];
                }
            }

            clone.power = this.power.clone();
            clone.multiplier = this.multiplier.clone();
            //add back the flag to track if this symbol is a conversion symbol
            if(this.isConversion)
                clone.isConversion = this.isConversion;

            if(this.isUnit)
                clone.isUnit = this.isUnit;

            return clone;
        },
        /**
         * Converts a symbol multiplier to one.
         * @param {Boolean} keepSign Keep the multiplier as negative if the multiplier is negative and keepSign is true
         * @returns {Symbol}
         */
        toUnitMultiplier: function (keepSign) {
            this.multiplier.num = new bigInt(this.multiplier.num.isNegative() && keepSign ? -1 : 1);
            this.multiplier.den = new bigInt(1);
            return this;
        },
        /**
         * Converts a Symbol's power to one.
         * @returns {Symbol}
         */
        toLinear: function () {
            // Do nothing if it's already linear
            if(this.power.equals(1)) {
                return this;
            }
            this.setPower(new Frac(1));
            return this;
        },
        /**
         * Iterates over all the sub-symbols. If no sub-symbols exist then it's called on itself
         * @param {Function} fn
         * @@param {Boolean} deep If true it will itterate over the sub-symbols their symbols as well
         */
        each: function (fn, deep) {
            if(!this.symbols) {
                fn.call(this, this, this.value);
            }
            else {
                for(var x in this.symbols) {
                    var sym = this.symbols[x];
                    if(sym.group === PL && deep) {
                        for(var y in sym.symbols) {
                            fn.call(x, sym.symbols[y], y);
                        }
                    }
                    else
                        fn.call(this, sym, x);
                }
            }
        },
        /**
         * A numeric value to be returned for Javascript. It will try to
         * return a number as far a possible but in case of a pure symbolic
         * symbol it will just return its text representation
         * @returns {String|Number}
         */
        valueOf: function () {
            if(this.group === N)
                return this.multiplier.valueOf();
            else if(this.power === 0) {
                return 1;
            }
            else if(this.multiplier === 0) {
                return 0;
            }
            else {
                return text(this, 'decimals');
            }
        },
        /**
         * Checks to see if a symbols has a particular variable within it.
         * Pass in true as second argument to include the power of exponentials
         * which aren't check by default.
         * @example var s = _.parse('x+y+z'); s.contains('y');
         * //returns true
         * @param {any} variable
         * @param {boolean} all
         * @returns {boolean}
         */
        contains: function (variable, all) {
            //contains expects a string
            variable = String(variable);
            var g = this.group;
            if(this.value === variable)
                return true;
            if(this.symbols) {
                for(var x in this.symbols) {
                    if(this.symbols[x].contains(variable, all))
                        return true;
                }
            }
            if(g === FN || this.previousGroup === FN) {
                for(var i = 0; i < this.args.length; i++) {
                    if(this.args[i].contains(variable, all))
                        return true;
                }
            }

            if(g === EX) {
                //exit only if it does
                if(all && this.power.contains(variable, all)) {
                    return true;
                }
                if(this.value === variable)
                    return true;

            }

            return this.value === variable;
        },
        /**
         * Negates a symbols
         * @returns {boolean}
         */
        negate: function () {
            this.multiplier.negate();
            if(this.group === CP || this.group === PL)
                this.distributeMultiplier();
            return this;
        },
        /**
         * Inverts a symbol
         * @param {boolean} power_only
         * @param {boolean} all
         * @returns {boolean}
         */
        invert: function (power_only, all) {
            //invert the multiplier
            if(!power_only)
                this.multiplier = this.multiplier.invert();
            //invert the rest
            if(isSymbol(this.power)) {
                this.power.negate();
            }
            else if(this.group === CB && all) {
                this.each(function (x) {
                    return x.invert();
                });
            }
            else {
                if(this.power && this.group !== N)
                    this.power.negate();
            }
            return this;
        },
        /**
         * Symbols of group CP or PL may have the multiplier being carried by
         * the top level symbol at any given time e.g. 2*(x+y+z). This is
         * convenient in many cases, however in some cases the multiplier needs
         * to be carried individually e.g. 2*x+2*y+2*z.
         * This method distributes the multiplier over the entire symbol
         * @param {boolean} all
         * @returns {Symbol}
         */
        distributeMultiplier: function (all) {
            var is_one = all ? this.power.absEquals(1) : this.power.equals(1);
            if(this.symbols && is_one && this.group !== CB && !this.multiplier.equals(1)) {
                for(var x in this.symbols) {
                    var s = this.symbols[x];
                    s.multiplier = s.multiplier.multiply(this.multiplier);
                    s.distributeMultiplier();
                }
                this.toUnitMultiplier();
            }

            return this;
        },
        /**
         * This method expands the exponent over the entire symbol just like
         * distributeMultiplier
         * @returns {Symbol}
         */
        distributeExponent: function () {
            if(!this.power.equals(1)) {
                var p = this.power;
                for(var x in this.symbols) {
                    var s = this.symbols[x];
                    if(s.group === EX) {
                        s.power = _.multiply(s.power, new Symbol(p));
                    }
                    else {
                        if (isSymbol(this.symbols[x].power)) {
                            this.symbols[x].power = _.multiply(this.symbols[x].power, new Symbol(p));
                        } else {
                            this.symbols[x].power = this.symbols[x].power.multiply(p);
                        }
                    }
                }
                this.toLinear();
            }
            return this;
        },
        /**
         * This method will attempt to up-convert or down-convert one symbol
         * from one group to another. Not all symbols are convertible from one
         * group to another however. In that case the symbol will remain
         * unchanged.
         * @param {int} group
         * @param {string} imaginary
         */
        convert: function (group, imaginary) {
            if(group > FN) {
                //make a clone of this symbol;
                var cp = this.clone();

                //attach a symbols object and upgrade the group
                this.symbols = {};

                if(group === CB) {
                    //symbol of group CB hold symbols bound together through multiplication
                    //because of commutativity this multiplier can technically be anywhere within the group
                    //to keep track of it however it's easier to always have the top level carry it
                    cp.toUnitMultiplier();
                }
                else {
                    //reset the symbol
                    this.toUnitMultiplier();
                }

                if(this.group === FN) {
                    cp.args = this.args;
                    delete this.args;
                    delete this.fname;
                }

                //the symbol may originate from the symbol i but this property no longer holds true
                //after copying
                if(this.isImgSymbol)
                    delete this.isImgSymbol;

                this.toLinear();
                //attach a clone of this symbol to the symbols object using its proper key
                this.symbols[cp.keyForGroup(group)] = cp;
                this.group = group;
                //objects by default don't have a length property. However, in order to keep track of the number
                //of sub-symbols we have to impliment our own.
                this.length = 1;
            }
            else if(group === EX) {
                //1^x is just one so check and make sure
                if(!(this.group === N && this.multiplier.equals(1))) {
                    if(this.group !== EX)
                        this.previousGroup = this.group;
                    if(this.group === N) {
                        this.value = this.multiplier.num.toString();
                        this.toUnitMultiplier();
                    }
                    //update the hash to reflect the accurate hash
                    else
                        this.value = text(this, 'hash');

                    this.group = EX;
                }
            }
            else if(group === N) {
                var m = this.multiplier.toDecimal();
                if(this.symbols)
                    this.symbols = undefined;
                new Symbol(this.group === P ? m * Math.pow(this.value, this.power) : m).clone(this);
            }
            else if(group === P && this.group === N) {
                this.value = imaginary ? this.multiplier.num.toString() : Math.abs(this.multiplier.num.toString());
                this.toUnitMultiplier(!imaginary);
                this.group = P;
            }
            return this;
        },
        /**
         * This method is one of the principal methods to make it all possible.
         * It performs cleanup and prep operations whenever a symbols is
         * inserted. If the symbols results in a 1 in a CB (multiplication)
         * group for instance it will remove the redundant symbol. Similarly
         * in a symbol of group PL or CP (symbols glued by multiplication) it
         * will remove any dangling zeroes from the symbol. It will also
         * up-convert or down-convert a symbol if it detects that it's
         * incorrectly grouped. It should be noted that this method is not
         * called directly but rather by the 'attach' method for addition groups
         * and the 'combine' method for multiplication groups.
         * @param {Symbol} symbol
         * @param {String} action
         */
        insert: function (symbol, action) {
            //this check can be removed but saves a lot of aggravation when trying to hunt down
            //a bug. If left, you will instantly know that the error can only be between 2 symbols.
            if(!isSymbol(symbol))
                err('Object ' + symbol + ' is not of type Symbol!');
            if(this.symbols) {
                var group = this.group;
                if(group > FN) {
                    var key = symbol.keyForGroup(group);
                    var existing = key in this.symbols ? this.symbols[key] : false; //check if there's already a symbol there
                    if(action === 'add') {
                        var hash = key;
                        if(existing) {
                            //add them together using the parser
                            this.symbols[hash] = _.add(existing, symbol);
                            //if the addition resulted in a zero multiplier remove it
                            if(this.symbols[hash].multiplier.equals(0)) {
                                delete this.symbols[hash];
                                this.length--;

                                if(this.length === 0) {
                                    this.convert(N);
                                    this.multiplier = new Frac(0);
                                }
                            }
                        }
                        else {
                            this.symbols[key] = symbol;
                            this.length++;
                        }
                    }
                    else {
                        //check if this is of group P and unwrap before inserting
                        if(symbol.group === P && isInt(symbol.power)) {
                            symbol.convert(N);
                        }

                        //transfer the multiplier to the upper symbol but only if the symbol numeric
                        if(symbol.group !== EX) {
                            this.multiplier = this.multiplier.multiply(symbol.multiplier);
                            symbol.toUnitMultiplier();
                        }
                        else {
                            symbol.parens = symbol.multiplier.lessThan(0);
                            this.multiplier = this.multiplier.multiply(symbol.multiplier.clone().abs());
                            symbol.toUnitMultiplier(true);
                        }

                        if(existing) {
                            //remove because the symbol may have changed
                            symbol = _.multiply(remove(this.symbols, key), symbol);
                            if(symbol.isConstant()) {
                                this.multiplier = this.multiplier.multiply(symbol.multiplier);
                                symbol = new Symbol(1); //the dirty work gets done down the line when it detects 1
                            }

                            this.length--;
                            //clean up
                        }

                        //don't insert the symbol if it's 1
                        if(!symbol.isOne(true)) {
                            this.symbols[key] = symbol;
                            this.length++;
                        }
                        else if(symbol.multiplier.lessThan(0)) {
                            this.negate(); //put back the sign
                        }
                    }

                    //clean up
                    if(this.length === 0)
                        this.convert(N);
                    //update the hash
                    if(this.group === CP || this.group === CB) {
                        this.updateHash();
                    }
                }
            }

            return this;
        },
        //the insert method for addition
        attach: function (symbol) {
            if(isArray(symbol)) {
                for(var i = 0; i < symbol.length; i++)
                    this.insert(symbol[i], 'add');
                return this;
            }
            return this.insert(symbol, 'add');
        },
        //the insert method for multiplication
        combine: function (symbol) {
            if(isArray(symbol)) {
                for(var i = 0; i < symbol.length; i++)
                    this.insert(symbol[i], 'multiply');
                return this;
            }
            return this.insert(symbol, 'multiply');
        },
        /**
         * This method should be called after any major "surgery" on a symbol.
         * It updates the hash of the symbol for example if the fname of a
         * function has changed it will update the hash of the symbol.
         */
        updateHash: function () {
            if(this.group === N)
                return;

            if(this.group === FN) {
                var contents = '',
                        args = this.args,
                        is_parens = this.fname === PARENTHESIS;
                for(var i = 0; i < args.length; i++)
                    contents += (i === 0 ? '' : ',') + text(args[i]);
                var fn_name = is_parens ? '' : this.fname;
                this.value = fn_name + (is_parens ? contents : inBrackets(contents));
            }
            else if(!(this.group === S || this.group === PL)) {
                this.value = text(this, 'hash');
            }
        },
        /**
         * this function defines how every group in stored within a group of
         * higher order think of it as the switchboard for the library. It
         * defines the hashes for symbols.
         * @param {int} group
         */
        keyForGroup: function (group) {
            var g = this.group;
            var key;

            if(g === N) {
                key = this.value;
            }
            else if(g === S || g === P) {
                if(group === PL)
                    key = this.power.toDecimal();
                else
                    key = this.value;
            }
            else if(g === FN) {
                if(group === PL)
                    key = this.power.toDecimal();
                else
                    key = text(this, 'hash');
            }
            else if(g === PL) {
                //if the order is reversed then we'll assume multiplication
                //TODO: possible future dilemma
                if(group === CB)
                    key = text(this, 'hash');
                else if(group === CP) {
                    if(this.power.equals(1))
                        key = this.value;
                    else
                        key = inBrackets(text(this, 'hash')) + Settings.POWER_OPERATOR + this.power.toDecimal();
                }
                else if(group === PL)
                    key = this.power.toString();
                else
                    key = this.value;
                return key;
            }
            else if(g === CP) {
                if(group === CP) {
                    key = text(this, 'hash');
                }
                if(group === PL)
                    key = this.power.toDecimal();
                else
                    key = this.value;
            }
            else if(g === CB) {
                if(group === PL)
                    key = this.power.toDecimal();
                else
                    key = text(this, 'hash');
            }
            else if(g === EX) {
                if(group === PL)
                    key = text(this.power);
                else
                    key = text(this, 'hash');
            }

            return key;
        },
        /**
         * Symbols are typically stored in an object which works fine for most
         * cases but presents a problem when the order of the symbols makes
         * a difference. This function simply collects all the symbols and
         * returns them as an array. If a function is supplied then that
         * function is called on every symbol contained within the object.
         * @param {Function} fn
         * @param {Object} opt
         * @param {Function} sort_fn
         * @@param {Boolean} expand_symbol
         * @returns {Array}
         */
        collectSymbols: function (fn, opt, sort_fn, expand_symbol) {
            var collected = [];
            if(!this.symbols)
                collected.push(this);
            else {
                for(var x in this.symbols) {
                    var symbol = this.symbols[x];
                    if(expand_symbol && (symbol.group === PL || symbol.group === CP)) {
                        collected = collected.concat(symbol.collectSymbols());
                    }
                    else
                        collected.push(fn ? fn(symbol, opt) : symbol);
                }
            }
            if(sort_fn === null)
                sort_fn = undefined; //WTF Firefox? Seriously?

            return collected.sort(sort_fn);//sort hopefully gives us some sort of consistency
        },

        /**
         * collectSymbols but only for summands
         * @param {Function} fn
         * @param {Object} opt
         * @param {Function} sort_fn
         * @@param {Boolean} expand_symbol
         * @returns {Array}
         */
        collectSummandSymbols: function (fn, opt, sort_fn, expand_symbol) {
            var collected = [];
            if(!this.symbols || this.group === CB)
                collected.push(this);
            else {
                for(var x in this.symbols) {
                    var symbol = this.symbols[x];
                    if(expand_symbol && (symbol.group === PL || symbol.group === CP)) {
                        collected = collected.concat(symbol.collectSymbols());
                    }
                    else
                        collected.push(fn ? fn(symbol, opt) : symbol);
                }
            }
            if(sort_fn === null)
                sort_fn = undefined; //WTF Firefox? Seriously?

            return collected.sort(sort_fn);//sort hopefully gives us some sort of consistency
        },
        /**
         * Returns the latex representation of the symbol
         * @param {String} option
         * @returns {String}
         */
        latex: function (option) {
            return LaTeX.latex(this, option);
        },
        /**
         * Returns the text representation of a symbol
         * @param {String} option
         * @returns {String}
         */
        text: function (option) {
            return text(this, option);
        },
        /**
         * Checks if the function evaluates to 1. e.g. x^0 or 1 :)
         * @@param {bool} abs Compares the absolute value
         */
        isOne: function (abs) {
            var f = abs ? 'absEquals' : 'equals';
            if(this.group === N)
                return this.multiplier[f](1);
            else
                return this.power.equals(0);
        },
        isComposite: function () {
            var g = this.group,
                    pg = this.previousGroup;
            return g === CP || g === PL || pg === PL || pg === CP;
        },
        isCombination: function () {
            var g = this.group,
                    pg = this.previousGroup;
            return g === CB || pg === CB;
        },
        lessThan: function (n) {
            return this.multiplier.lessThan(n);
        },
        greaterThan: function (n) {
            if(!isSymbol(n)) {
                n = new Symbol(n);
            }

            // We can't tell for sure if a is greater than be if they're not both numbers
            if(!this.isConstant(true) || !n.isConstant(true)) {
                return false;
            }

            return this.multiplier.greaterThan(n.multiplier);
        },
        /**
         * Get's the denominator of the symbol if the symbol is of class CB (multiplication)
         * with other classes the symbol is either the denominator or not.
         * Take x^-1+x^-2. If the symbol was to be mixed such as x+x^-2 then the symbol doesn't have have an exclusive
         * denominator and has to be found by looking at the actual symbols themselves.
         */
        getDenom: function () {
            var retval, symbol;
            symbol = this.clone();
            //e.g. 1/(x*(x+1))
            if(this.group === CB && this.power.lessThan(0))
                symbol = _.expand(symbol);

            //if the symbol already is the denominator... DONE!!!
            if(symbol.power.lessThan(0) || symbol.group === EX && symbol.power.multiplier.lessThan(0)) {
                var d = _.parse(symbol.multiplier.den);
                retval = symbol.toUnitMultiplier();
                retval.power.negate();
                retval = _.multiply(d, retval); //put back the coeff
            }
            else if(symbol.group === CB) {
                retval = _.parse(symbol.multiplier.den);
                for(var x in symbol.symbols) {
                    var s = symbol.symbols[x];
                    if(s.power < 0 || s.group === EX && s.power.multiplier.lessThan(0))
                        retval = _.multiply(retval, symbol.symbols[x].clone().invert());
                }
            }
            else {
                retval = _.parse(symbol.multiplier.den);
            }
            return retval;
        },
        getNum: function () {
            var retval, symbol;
            symbol = this.clone();
            //e.g. 1/(x*(x+1))
            if(symbol.group === CB && symbol.power.lessThan(0))
                symbol = _.expand(symbol);
            //if the symbol already is the denominator... DONE!!!
            if(symbol.power.greaterThan(0) && symbol.group !== CB || symbol.group === EX && symbol.power.multiplier.greaterThan(0)) {
                retval = _.multiply(_.parse(symbol.multiplier.num), symbol.toUnitMultiplier());
            }
            else if(symbol.group === CB) {
                retval = _.parse(symbol.multiplier.num);
                symbol.each(function (x) {
                    if(x.power > 0 || x.group === EX && x.power.multiplier > 0) {
                        retval = _.multiply(retval, x.clone());
                    }
                });
            }
//            else if(symbol.group === EX && this.previousGroup === S) {
//                retval = _.multiply(_.parse(symbol.multiplier.num), symbol.toUnitMultiplier());
//            }
            else {
                retval = _.parse(symbol.multiplier.num);
            }
            return retval;
        },
        toString: function () {
            return this.text();
        }
    };

//Parser =======================================================================
    //Uses modified Shunting-yard algorithm. http://en.wikipedia.org/wiki/Shunting-yard_algorithm
    function Parser() {
        //Point to the local parser instead of the global one
        var _ = this;
        var bin = {};
        var preprocessors = {names: [], actions: []};

//Parser.classes ===============================================================
        function Slice(upper, lower) {
            this.start = upper;
            this.end = lower;
        }
        ;
        Slice.prototype.isConstant = function () {
            return this.start.isConstant() && this.end.isConstant();
        };
        Slice.prototype.text = function () {
            return text(this.start) + ':' + text(this.end);
        };

        function Token(node, node_type, column) {
            this.type = node_type;
            this.value = node;
            if(column !== undefined)
                this.column = column + 1;
            if(node_type === Token.OPERATOR) {
                //copy everything over from the operator
                var operator = operators[node];
                for(var x in operator)
                    this[x] = operator[x];

            }
            else if(node_type === Token.FUNCTION) {
                this.precedence = Token.MAX_PRECEDENCE; //leave enough roon
                this.leftAssoc = false;
            }
        }
        Token.prototype.toString = function () {
            return this.value;
        };
        Token.prototype.toString = function () {
            if(this.is_prefix)
                return '`' + this.value;
            return this.value;
        };
        //some constants
        Token.OPERATOR = 'OPERATOR';
        Token.VARIABLE_OR_LITERAL = 'VARIABLE_OR_LITERAL';
        Token.FUNCTION = 'FUNCTION';
        Token.UNIT = 'UNIT';
        Token.KEYWORD = 'KEYWORD';
        Token.MAX_PRECEDENCE = 999;
        //create link to classes
        this.classes = {
            Collection: Collection,
            Slice: Slice,
            Token: Token
        };
//Parser.modules ===============================================================
        //object for functions which handle complex number
        var complex = {
            prec: undefined,
            cos: function (r, i) {
                var re, im;
                re = _.parse(Math.cos(r) * Math.cosh(i));
                im = _.parse(Math.sin(r) * Math.sinh(i));
                return _.subtract(re, _.multiply(im, Symbol.imaginary()));
            },
            sin: function (r, i) {
                var re, im;
                re = _.parse(Math.sin(r) * Math.cosh(i));
                im = _.parse(Math.cos(r) * Math.sinh(i));
                return _.subtract(re, _.multiply(im, Symbol.imaginary()));
            },
            tan: function (r, i) {
                var re, im;
                re = _.parse(Math.sin(2 * r) / (Math.cos(2 * r) + Math.cosh(2 * i)));
                im = _.parse(Math.sinh(2 * i) / (Math.cos(2 * r) + Math.cosh(2 * i)));
                return _.add(re, _.multiply(im, Symbol.imaginary()));
            },
            sec: function (r, i) {
                var t = this.removeDen(this.cos(r, i));
                return _.subtract(t[0], _.multiply(t[1], Symbol.imaginary()));
            },
            csc: function (r, i) {
                var t = this.removeDen(this.sin(r, i));
                return _.add(t[0], _.multiply(t[1], Symbol.imaginary()));
            },
            cot: function (r, i) {
                var t = this.removeDen(this.tan(r, i));
                return _.subtract(t[0], _.multiply(t[1], Symbol.imaginary()));
            },
            acos: function (r, i) {
                var symbol, sq, a, b, c, squared;
                symbol = this.fromArray([r, i]);
                squared = _.pow(symbol.clone(), new Symbol(2));
                sq = _.expand(squared); //z*z
                a = _.multiply(sqrt(_.subtract(new Symbol(1), sq)), Symbol.imaginary());
                b = _.expand(_.add(symbol.clone(), a));
                c = log(b);
                return _.expand(_.multiply(Symbol.imaginary().negate(), c));
            },
            asin: function (r, i) {
                return _.subtract(_.parse('pi/2'), this.acos(r, i));
            },
            atan: function (r, i) {
                // Handle i and -i
                if(r.equals(0) && (i.equals(1) || i.equals(-1))) {
                    // Just copy Wolfram Alpha for now. The parenthesis 
                    return _.parse(`${Symbol.infinity()}*${Settings.IMAGINARY}*${i}`);
                }
                var a, b, c, symbol;
                symbol = complex.fromArray([r, i]);
                a = _.expand(_.multiply(Symbol.imaginary(), symbol.clone()));
                b = log(_.expand(_.subtract(new Symbol(1), a.clone())));
                c = log(_.expand(_.add(new Symbol(1), a.clone())));
                return _.expand(_.multiply(_.divide(Symbol.imaginary(), new Symbol(2)), _.subtract(b, c)));
            },
            asec: function (r, i) {
                var d = this.removeDen([r, i]);
                d[1].negate();
                return this.acos.apply(this, d);
            },
            acsc: function (r, i) {
                var d = this.removeDen([r, i]);
                d[1].negate();
                return this.asin.apply(this, d);
            },
            acot: function (r, i) {
                var d = this.removeDen([r, i]);
                d[1].negate();
                return this.atan.apply(this, d);
            },
            //Hyperbolic trig
            cosh: function (r, i) {
                var re, im;
                re = _.parse(Math.cosh(r) * Math.cos(i));
                im = _.parse(Math.sinh(r) * Math.sin(i));
                return _.add(re, _.multiply(im, Symbol.imaginary()));
            },
            sinh: function (r, i) {
                var re, im;
                re = _.parse(Math.sinh(r) * Math.cos(i));
                im = _.parse(Math.cosh(r) * Math.sin(i));
                return _.add(re, _.multiply(im, Symbol.imaginary()));
            },
            tanh: function (r, i) {
                var re, im;
                re = _.parse(Math.sinh(2 * r) / (Math.cos(2 * i) + Math.cosh(2 * r)));
                im = _.parse(Math.sin(2 * i) / (Math.cos(2 * i) + Math.cosh(2 * r)));
                return _.subtract(re, _.multiply(im, Symbol.imaginary()));
            },
            sech: function (r, i) {
                var t = this.removeDen(this.cosh(r, i));
                return _.subtract(t[0], _.multiply(t[1], Symbol.imaginary()));
            },
            csch: function (r, i) {
                var t = this.removeDen(this.sinh(r, i));
                return _.subtract(t[0], _.multiply(t[1], Symbol.imaginary()));
            },
            coth: function (r, i) {
                var t = this.removeDen(this.tanh(r, i));
                return _.add(t[0], _.multiply(t[1], Symbol.imaginary()));
            },
            acosh: function (r, i) {
                var a, b, z;
                z = this.fromArray([r, i]);
                a = sqrt(_.add(z.clone(), new Symbol(1)));
                b = sqrt(_.subtract(z.clone(), new Symbol(1)));
                return _.expand(log(_.add(z, _.expand(_.multiply(a, b)))));
            },
            asinh: function (r, i) {
                var a, z;
                z = this.fromArray([r, i]);
                a = sqrt(_.add(new Symbol(1), _.expand(_.pow(z.clone(), new Symbol(2)))));
                return _.expand(log(_.add(z, a)));
            },
            atanh: function (r, i) {
                var a, b, z;
                z = this.fromArray([r, i]);
                a = log(_.add(z.clone(), new Symbol(1)));
                b = log(_.subtract(new Symbol(1), z));
                return _.expand(_.divide(_.subtract(a, b), new Symbol(2)));
            },
            asech: function (r, i) {
                var t = this.removeDen([r, i]);
                t[1].negate();
                return this.acosh.apply(this, t);
            },
            acsch: function (r, i) {
                var t = this.removeDen([r, i]);
                t[1].negate();
                return this.asinh.apply(this, t);
            },
            acoth: function (r, i) {
                var t = this.removeDen([r, i]);
                t[1].negate();
                return this.atanh.apply(this, t);
            },
            sqrt: function (symbol) {
                var re, im, h, a, d;
                re = symbol.realpart();
                im = symbol.imagpart();
                h = Symbol.hyp(re, im);
                a = _.add(re.clone(), h);
                d = sqrt(_.multiply(new Symbol(2), a.clone()));
                return _.add(_.divide(a.clone(), d.clone()), _.multiply(_.divide(im, d), Symbol.imaginary()));
            },
            log: function (r, i) {
                var re, im, phi;
                re = log(Symbol.hyp(r, i));
                phi = Settings.USE_BIG ? Symbol(bigDec.atan2(i.multiplier.toDecimal(), r.multiplier.toDecimal())) : Math.atan2(i, r);
                im = _.parse(phi);
                return _.add(re, _.multiply(Symbol.imaginary(), im));
            },
            erf(symbol, n) {
                //Do nothing for now. Revisit this in the future.
                return _.symfunction('erf', [symbol]);

                n = n || 30;

                var f = function (R, I) {
                    return block('PARSE2NUMBER', function () {
                        var retval = new Symbol(0);
                        for(var i = 0; i < n; i++) {
                            var a, b;
                            a = _.parse(bigDec.exp(bigDec(i).toPower(2).neg().dividedBy(bigDec(n).pow(2).plus(bigDec(R).toPower(2).times(4)))));
                            b = _.parse(format('2*({1})-e^(-(2*{0}*{1}*{2}))*(2*{1}*cosh({2}*{3})-{0}*{3}*sinh({3}*{2}))', Settings.IMAGINARY, R, I, i));
                            retval = _.add(retval, _.multiply(a, b));
                        }
                        return _.multiply(retval, new Symbol(2));
                    }, true);
                };
                var re, im, a, b, c, k;
                re = symbol.realpart();
                im = symbol.imagpart();

                k = _.parse(format('(e^(-{0}^2))/pi', re));
                a = _.parse(format('(1-e^(-(2*{0}*{1}*{2})))/(2*{1})', Settings.IMAGINARY, re, im));
                b = f(re.toString(), im.toString());

                return _.add(_.parse(Math2.erf(re.toString())), _.multiply(k, _.add(a, b)));
            },
            removeDen: function (symbol) {
                var den, r, i, re, im;
                if(isArray(symbol)) {
                    r = symbol[0];
                    i = symbol[1];
                }
                else {
                    r = symbol.realpart();
                    i = symbol.imagpart();
                }

                den = Math.pow(r, 2) + Math.pow(i, 2);
                re = _.parse(r / den);
                im = _.parse(i / den);
                return [re, im];
            },
            fromArray: function (arr) {
                return _.add(arr[0], _.multiply(Symbol.imaginary(), arr[1]));
            },
            evaluate: function (symbol, f) {
                var re, im, sign;

                sign = symbol.power.sign();
                //remove it from under the denominator
                symbol.power = symbol.power.abs();
                //expand
                if(symbol.power.greaterThan(1))
                    symbol = _.expand(symbol);
                //remove the denominator
                if(sign < 0) {
                    var d = this.removeDen(symbol);
                    re = d[0];
                    im = d[1];
                }
                else {
                    re = symbol.realpart();
                    im = symbol.imagpart();
                }

                if(re.isConstant('all') && im.isConstant('all'))
                    return this[f].call(this, re, im);

                return _.symfunction(f, [symbol]);
            }
        };
        //object for functions which handle trig
        var trig = this.trig = {
            //container for trigonometric function
            cos: function (symbol) {
                if(symbol.equals('pi') && symbol.multiplier.den.equals(2))
                    return new Symbol(0);

                if(Settings.PARSE2NUMBER) {
                    if(symbol.equals(new Symbol(Settings.PI / 2)))
                        return new Symbol(0);
                    if(symbol.isConstant()) {
                        if(Settings.USE_BIG) {
                            return new Symbol(bigDec.cos(symbol.multiplier.toDecimal()));
                        }

                        return new Symbol(Math.cos(symbol.valueOf()));
                    }
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'cos');
                    }
                }
                if(symbol.equals(0))
                    return new Symbol(1);

                var retval,
                        c = false,
                        q = getQuadrant(symbol.multiplier.toDecimal()),
                        m = symbol.multiplier.abs();
                symbol.multiplier = m;

                if(symbol.isPi() && symbol.isLinear()) {
                    //return for 1 or -1 for multiples of pi
                    if(isInt(m)) {
                        retval = new Symbol(even(m) ? 1 : -1);
                    }
                    else {
                        var n = Number(m.num), d = Number(m.den);
                        if(d === 2)
                            retval = new Symbol(0);
                        else if(d === 3) {
                            retval = _.parse('1/2');
                            c = true;
                        }
                        else if(d === 4) {
                            retval = _.parse('1/sqrt(2)');
                            c = true;
                        }
                        else if(d === 6) {
                            retval = _.parse('sqrt(3)/2');
                            c = true;
                        }
                        else
                            retval = _.symfunction('cos', [symbol]);
                    }
                }

                if(c && (q === 2 || q === 3))
                    retval.negate();

                if(!retval)
                    retval = _.symfunction('cos', [symbol]);

                return retval;
            },
            sin: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        if(symbol % Math.PI === 0) {
                            return new Symbol(0);
                        }

                        if(Settings.USE_BIG) {
                            return new Symbol(bigDec.sin(symbol.multiplier.toDecimal()));
                        }

                        return new Symbol(Math.sin(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'sin');
                }

                if(symbol.equals(0))
                    return new Symbol(0);

                var retval,
                        c = false,
                        q = getQuadrant(symbol.multiplier.toDecimal()),
                        sign = symbol.multiplier.sign(),
                        m = symbol.multiplier.abs();
                symbol.multiplier = m;
                if(symbol.equals('pi'))
                    retval = new Symbol(0);
                else if(symbol.isPi() && symbol.isLinear()) {
                    //return for 0 for multiples of pi
                    if(isInt(m)) {
                        retval = new Symbol(0);
                    }
                    else {
                        var n = m.num, d = m.den;
                        if(d == 2) {
                            retval = new Symbol(1);
                            c = true;
                        }
                        else if(d == 3) {
                            retval = _.parse('sqrt(3)/2');
                            c = true
                        }
                        else if(d == 4) {
                            retval = _.parse('1/sqrt(2)');
                            c = true;
                        }
                        else if(d == 6) {
                            retval = _.parse('1/2');
                            c = true;
                        }
                        else
                            retval = _.multiply(new Symbol(sign), _.symfunction('sin', [symbol]));
                    }
                }

                if(!retval)
                    retval = _.multiply(new Symbol(sign), _.symfunction('sin', [symbol]));

                if(c && (q === 3 || q === 4))
                    retval.negate();

                return retval;
            },
            tan: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol % Math.PI === 0 && symbol.isLinear()) {
                        return new Symbol(0);
                    }
                    if(symbol.isConstant()) {
                        if(Settings.USE_BIG) {
                            return new Symbol(bigDec.tan(symbol.multiplier.toDecimal()));
                        }

                        return new Symbol(Math.tan(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'tan');
                }
                var retval,
                        c = false,
                        q = getQuadrant(symbol.multiplier.toDecimal()),
                        m = symbol.multiplier;

                symbol.multiplier = m;

                if(symbol.isPi() && symbol.isLinear()) {
                    //return 0 for all multiples of pi
                    if(isInt(m)) {
                        retval = new Symbol(0);
                    }
                    else {
                        var n = m.num, d = m.den;
                        if(d == 2)
                            throw new UndefinedError('tan is undefined for ' + symbol.toString());
                        else if(d == 3) {
                            retval = _.parse('sqrt(3)');
                            c = true;
                        }
                        else if(d == 4) {
                            retval = new Symbol(1);
                            c = true;
                        }
                        else if(d == 6) {
                            retval = _.parse('1/sqrt(3)');
                            c = true;
                        }
                        else
                            retval = _.symfunction('tan', [symbol]);
                    }
                }

                if(!retval)
                    retval = _.symfunction('tan', [symbol]);

                if(c && (q === 2 || q === 4))
                    retval.negate();

                return retval;
            },
            sec: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        if(Settings.USE_BIG) {
                            return new Symbol(new bigDec(1).dividedBy(bigDec.cos(symbol.multiplier.toDecimal())));
                        }

                        return new Symbol(Math2.sec(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'sec');
                    return _.parse(format('1/cos({0})', symbol));
                }

                var retval,
                        c = false,
                        q = getQuadrant(symbol.multiplier.toDecimal()),
                        m = symbol.multiplier.abs();
                symbol.multiplier = m;

                if(symbol.isPi() && symbol.isLinear()) {
                    //return for 1 or -1 for multiples of pi
                    if(isInt(m)) {
                        retval = new Symbol(even(m) ? 1 : -1);
                    }
                    else {
                        var n = m.num, d = m.den;
                        if(d == 2)
                            throw new UndefinedError('sec is undefined for ' + symbol.toString());
                        else if(d == 3) {
                            retval = new Symbol(2);
                            c = true;
                        }
                        else if(d == 4) {
                            retval = _.parse('sqrt(2)');
                            c = true;
                        }
                        else if(d == 6) {
                            retval = _.parse('2/sqrt(3)');
                            c = true;
                        }
                        else
                            retval = _.symfunction('sec', [symbol]);
                    }
                }

                if(c && (q === 2 || q === 3))
                    retval.negate();

                if(!retval)
                    retval = _.symfunction('sec', [symbol]);

                return retval;
            },
            csc: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        if(Settings.USE_BIG) {
                            return new Symbol(new bigDec(1).dividedBy(bigDec.sin(symbol.multiplier.toDecimal())));
                        }

                        return new Symbol(Math2.csc(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'csc');
                    return _.parse(format('1/sin({0})', symbol));
                }

                var retval,
                        c = false,
                        q = getQuadrant(symbol.multiplier.toDecimal()),
                        sign = symbol.multiplier.sign(),
                        m = symbol.multiplier.abs();

                symbol.multiplier = m;

                if(symbol.isPi() && symbol.isLinear()) {
                    //return for 0 for multiples of pi
                    if(isInt(m)) {
                        throw new UndefinedError('csc is undefined for ' + symbol.toString());
                    }
                    else {
                        var n = m.num, d = m.den;
                        if(d == 2) {
                            retval = new Symbol(1);
                            c = true;
                        }
                        else if(d == 3) {
                            retval = _.parse('2/sqrt(3)');
                            c = true
                        }
                        else if(d == 4) {
                            retval = _.parse('sqrt(2)');
                            c = true;
                        }
                        else if(d == 6) {
                            retval = new Symbol(2);
                            c = true;
                        }
                        else
                            retval = _.multiply(new Symbol(sign), _.symfunction('csc', [symbol]));
                    }
                }

                if(!retval)
                    retval = _.multiply(new Symbol(sign), _.symfunction('csc', [symbol]));

                if(c && (q === 3 || q === 4))
                    retval.negate();

                return retval;
            },
            cot: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol % (Math.PI/2) === 0) {
                        return new Symbol(0);
                    }
                    if(symbol.isConstant()) {
                        if(Settings.USE_BIG) {
                            return new Symbol(new bigDec(1).dividedBy(bigDec.tan(symbol.multiplier.toDecimal())));
                        }

                        return new Symbol(Math2.cot(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'cot');
                    return _.parse(format('1/tan({0})', symbol));
                }
                var retval,
                        c = false,
                        q = getQuadrant(symbol.multiplier.toDecimal()),
                        m = symbol.multiplier;

                symbol.multiplier = m;

                if(symbol.isPi() && symbol.isLinear()) {
                    //return 0 for all multiples of pi
                    if(isInt(m)) {
                        throw new UndefinedError('cot is undefined for ' + symbol.toString());
                    }
                    else {
                        var n = m.num, d = m.den;
                        if(d == 2)
                            retval = new Symbol(0);
                        else if(d == 3) {
                            retval = _.parse('1/sqrt(3)');
                            c = true;
                        }
                        else if(d == 4) {
                            retval = new Symbol(1);
                            c = true;
                        }
                        else if(d == 6) {
                            retval = _.parse('sqrt(3)');
                            c = true;
                        }
                        else
                            retval = _.symfunction('cot', [symbol]);
                    }
                }

                if(!retval)
                    retval = _.symfunction('cot', [symbol]);

                if(c && (q === 2 || q === 4))
                    retval.negate();

                return retval;
            },
            acos: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        // Handle values in the complex domain
                        if(symbol.gt(1) || symbol.lt(-1)) {
                            var x = symbol.toString();
                            return expand(evaluate(`pi/2-asin(${x})`));
                        }
                        // Handle big numbers
                        if(Settings.USE_BIG) {
                            return new Symbol(bigDec.acos(symbol.multiplier.toDecimal()));
                        }

                        return new Symbol(Math.acos(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'acos');
                }
                return _.symfunction('acos', arguments);
            },
            asin: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        // Handle values in the complex domain
                        if(symbol.gt(1) || symbol.lt(-1)) {
                            var i = Settings.IMAGINARY;
                            var x = symbol.multiplier.toDecimal();
                            return expand(evaluate(`${i}*log(sqrt(1-${x}^2)-${i}*${x})`));
                        }
                        // Handle big numbers
                        if(Settings.USE_BIG) {
                            return new Symbol(bigDec.asin(symbol.multiplier.toDecimal()));
                        }

                        return new Symbol(Math.asin(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'asin');
                }
                return _.symfunction('asin', arguments);
            },
            atan: function (symbol) {
                var retval;
                if(symbol.equals(0))
                    retval = new Symbol(0);
                else if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        // Handle big numbers
                        if(Settings.USE_BIG) {
                            return new Symbol(bigDec.atan(symbol.multiplier.toDecimal()));
                        }

                        return new Symbol(Math.atan(symbol.valueOf()));
                    }
                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'atan');
                    return _.symfunction('atan', arguments);
                }
                else if(symbol.equals(-1))
                    retval = _.parse('-pi/4');
                else
                    retval = _.symfunction('atan', arguments);
                return retval;
            },
            asec: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.equals(0)) {
                        throw new OutOfFunctionDomainError('Input is out of the domain of sec!');
                    }
                    if(symbol.isConstant()) {
                        return trig.acos(symbol.invert());
                    }
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'asec');
                    }
                }
                return _.symfunction('asec', arguments);
            },
            acsc: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        return trig.asin(symbol.invert());
                    }

                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'acsc');
                }
                return _.symfunction('acsc', arguments);
            },
            acot: function (symbol) {
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        return new _.add(_.parse('pi/2'), trig.atan(symbol).negate());
                    }

                    if(symbol.isImaginary())
                        return complex.evaluate(symbol, 'acot');
                }
                return _.symfunction('acot', arguments);
            },
            atan2: function (a, b) {
                if(a.equals(0) && b.equals(0))
                    throw new UndefinedError('atan2 is undefined for 0, 0');

                if(Settings.PARSE2NUMBER && a.isConstant() && b.isConstant()) {
                    return new Symbol(Math.atan2(a, b));
                }
                return _.symfunction('atan2', arguments);
            }
        };
        //object for functions which handle hyperbolic trig
        var trigh = this.trigh = {
            //container for hyperbolic trig function
            cosh: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant())
                        return new Symbol(Math.cosh(symbol.valueOf()));
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'cosh');
                    }
                }

                return retval = _.symfunction('cosh', arguments);
            },
            sinh: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant())
                        return new Symbol(Math.sinh(symbol.valueOf()));
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'sinh');
                    }
                }

                return retval = _.symfunction('sinh', arguments);
            },
            tanh: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant())
                        return new Symbol(Math.tanh(symbol.valueOf()));
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'tanh');
                    }
                }

                return retval = _.symfunction('tanh', arguments);
            },
            sech: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant()) {
                        return new Symbol(Math.sech(symbol.valueOf()));
                    }
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'sech');
                    }
                    return _.parse(format('1/cosh({0})', symbol));
                }

                return retval = _.symfunction('sech', arguments);
            },
            csch: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant())
                        return new Symbol(Math.csch(symbol.valueOf()));
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'csch');
                    }
                    return _.parse(format('1/sinh({0})', symbol));
                }

                return retval = _.symfunction('csch', arguments);
            },
            coth: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER) {
                    if(symbol.isConstant())
                        return new Symbol(Math.coth(symbol.valueOf()));
                    if(symbol.isImaginary()) {
                        return complex.evaluate(symbol, 'coth');
                    }
                    return _.parse(format('1/tanh({0})', symbol));
                }

                return retval = _.symfunction('coth', arguments);
            },
            acosh: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER && symbol.isImaginary())
                    retval = complex.evaluate(symbol, 'acosh');
                else if(Settings.PARSE2NUMBER)
                    retval = evaluate(_.parse(format(Settings.LOG + '(({0})+sqrt(({0})^2-1))', symbol.toString())));
                else
                    retval = _.symfunction('acosh', arguments);
                return retval;
            },
            asinh: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER && symbol.isImaginary())
                    retval = complex.evaluate(symbol, 'asinh');
                else if(Settings.PARSE2NUMBER)
                    retval = evaluate(_.parse(format(Settings.LOG + '(({0})+sqrt(({0})^2+1))', symbol.toString())));
                else
                    retval = _.symfunction('asinh', arguments);
                return retval;
            },
            atanh: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER && symbol.isImaginary())
                    retval = complex.evaluate(symbol, 'atanh');
                else if(Settings.PARSE2NUMBER) {
                    retval = evaluate(_.parse(format('(1/2)*' + Settings.LOG + '((1+({0}))/(1-({0})))', symbol.toString())));
                }
                else
                    retval = _.symfunction('atanh', arguments);
                return retval;
            },
            asech: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER && symbol.isImaginary())
                    retval = complex.evaluate(symbol, 'asech');
                else if(Settings.PARSE2NUMBER)
                    retval = evaluate(log(_.add(symbol.clone().invert(), sqrt(_.subtract(_.pow(symbol, new Symbol(-2)), new Symbol(1))))));
                else
                    retval = _.symfunction('asech', arguments);
                return retval;
            },
            acsch: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER && symbol.isImaginary())
                    retval = complex.evaluate(symbol, 'acsch');
                else if(Settings.PARSE2NUMBER)
                    retval = evaluate(_.parse(format(Settings.LOG + '((1+sqrt(1+({0})^2))/({0}))', symbol.toString())));
                else
                    retval = _.symfunction('acsch', arguments);
                return retval;
            },
            acoth: function (symbol) {
                var retval;
                if(Settings.PARSE2NUMBER && symbol.isImaginary())
                    retval = complex.evaluate(symbol, 'acoth');
                else if(Settings.PARSE2NUMBER) {
                    if(symbol.equals(1))
                        retval = Symbol.infinity();
                    else
                        retval = evaluate(
                                _.divide(
                                        log(_.divide(_.add(symbol.clone(), new Symbol(1)), _.subtract(symbol.clone(), new Symbol(1)))),
                                        new Symbol(2)));
                }
                else
                    retval = _.symfunction('acoth', arguments);
                return retval;
            }
        };
        //list of supported units
        this.units = {};
        //list all the supported operators
        var operators = {
            '\\': {
                precedence: 8,
                operator: '\\',
                action: 'slash',
                prefix: true,
                postfix: false,
                leftAssoc: true,
                operation: function (e) {
                    return e; //bypass the slash
                }
            },
            '!!': {
                precedence: 7,
                operator: '!!',
                action: 'dfactorial',
                prefix: false,
                postfix: true,
                leftAssoc: true,
                operation: function (e) {
                    return _.symfunction(Settings.DOUBLEFACTORIAL, [e]); //wrap it in a factorial function
                }
            },
            '!': {
                precedence: 7,
                operator: '!',
                action: 'factorial',
                prefix: false,
                postfix: true,
                leftAssoc: true,
                operation: function (e) {
                    return factorial(e); //wrap it in a factorial function
                }
            },
            '^': {
                precedence: 6,
                operator: '^',
                action: 'pow',
                prefix: false,
                postfix: false,
                leftAssoc: true
            },
            '**': {
                precedence: 6,
                operator: '**',
                action: 'pow',
                prefix: false,
                postfix: false,
                leftAssoc: true
            },
            '%': {
                precedence: 4,
                operator: '%',
                action: 'percent',
                prefix: false,
                postfix: true,
                leftAssoc: true,
                overloaded: true,
                overloadAction: 'mod',
                overloadLeftAssoc: false,
                operation: function (x) {
                    return _.divide(x, new Symbol(100));
                }
            },
            '*': {
                precedence: 4,
                operator: '*',
                action: 'multiply',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '/': {
                precedence: 4,
                operator: '/',
                action: 'divide',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '+': {
                precedence: 3,
                operator: '+',
                action: 'add',
                prefix: true,
                postfix: false,
                leftAssoc: false,
                operation: function (x) {
                    return x;
                }
            },
            'plus': {
                precedence: 3,
                operator: 'plus',
                action: 'add',
                prefix: true,
                postfix: false,
                leftAssoc: false,
                operation: function (x) {
                    return x;
                }
            },
            '-': {
                precedence: 3,
                operator: '-',
                action: 'subtract',
                prefix: true,
                postfix: false,
                leftAssoc: false,
                operation: function (x) {
                    return x.negate();
                }
            },
            '=': {
                precedence: 2,
                operator: '=',
                action: 'equals',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '==': {
                precedence: 1,
                operator: '==',
                action: 'eq',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '<': {
                precedence: 1,
                operator: '<',
                action: 'lt',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '<=': {
                precedence: 1,
                operator: '<=',
                action: 'lte',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '>': {
                precedence: 1,
                operator: '>',
                action: 'gt',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            '=>': {
                precedence: 1,
                operator: '=>',
                action: 'gte',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            ',': {
                precedence: 0,
                operator: ',',
                action: 'comma',
                prefix: false,
                postfix: false,
                leftAssoc: false
            },
            ':': {
                precedence: 0,
                operator: ',',
                action: 'assign',
                prefix: false,
                postfix: false,
                leftAssoc: false,
                vectorFn: 'slice'
            },
            ':=': {
                precedence: 0,
                operator: ',',
                action: 'function_assign',
                prefix: false,
                postfix: false,
                leftAssoc: true
            }
        };
        //brackets
        var brackets = {
            '(': {
                type: 'round',
                id: 1,
                is_open: true,
                is_close: false
            },
            ')': {
                type: 'round',
                id: 2,
                is_open: false,
                is_close: true
            },
            '[': {
                type: 'square',
                id: 3,
                is_open: true,
                is_close: false,
                maps_to: 'vector'
            },
            ']': {
                type: 'square',
                id: 4,
                is_open: false,
                is_close: true
            },
            '{': {
                type: 'curly',
                id: 5,
                is_open: true,
                is_close: false,
                maps_to: 'Set'
            },
            '}': {
                type: 'curly',
                id: 6,
                is_open: false,
                is_close: true
            }
        };
        // Supported functions.
        // Format: function_name: [mapped_function, number_of_parameters]
        var functions = this.functions = {
            'cos': [trig.cos, 1],
            'sin': [trig.sin, 1],
            'tan': [trig.tan, 1],
            'sec': [trig.sec, 1],
            'csc': [trig.csc, 1],
            'cot': [trig.cot, 1],
            'acos': [trig.acos, 1],
            'asin': [trig.asin, 1],
            'atan': [trig.atan, 1],
            'arccos': [trig.acos, 1],
            'arcsin': [trig.asin, 1],
            'arctan': [trig.atan, 1],
            'asec': [trig.asec, 1],
            'acsc': [trig.acsc, 1],
            'acot': [trig.acot, 1],
            'atan2': [trig.atan2, 2],
            'acoth': [trigh.acoth, 1],
            'asech': [trigh.asech, 1],
            'acsch': [trigh.acsch, 1],
            'sinh': [trigh.sinh, 1],
            'cosh': [trigh.cosh, 1],
            'tanh': [trigh.tanh, 1],
            'asinh': [trigh.asinh, 1],
            'sech': [trigh.sech, 1],
            'csch': [trigh.csch, 1],
            'coth': [trigh.coth, 1],
            'acosh': [trigh.acosh, 1],
            'atanh': [trigh.atanh, 1],
            'log10': [, 1],
            'exp': [exp, 1],
            'radians': [radians, 1],
            'degrees': [degrees, 1],
            'min': [min, -1],
            'max': [max, -1],
            'erf': [, 1],
            'floor': [, 1],
            'ceil': [, 1],
            'trunc': [, 1],
            'Si': [, 1],
            'step': [, 1],
            'rect': [, 1],
            'sinc': [sinc, 1],
            'tri': [, 1],
            'sign': [sign, 1],
            'Ci': [, 1],
            'Ei': [, 1],
            'Shi': [, 1],
            'Chi': [, 1],
            'Li': [, 1],
            'fib': [, 1],
            'fact': [factorial, 1],
            'factorial': [factorial, 1],
            'continued_fraction': [continued_fraction, [1, 2]],
            'dfactorial': [, 1],
            'gamma_incomplete': [, [1, 2]],
            'round': [round, [1, 2]],
            'scientific': [scientific, [1, 2]],
            'mod': [mod, 2],
            'pfactor': [pfactor, 1],
            'vector': [vector, -1],
            'matrix': [matrix, -1],
            'Set': [set, -1],
            'imatrix': [imatrix, -1],
            'parens': [parens, -1],
            'sqrt': [sqrt, 1],
            'cbrt': [cbrt, 1],
            'nthroot': [nthroot, 2],
            'log': [log, [1, 2]],
            'expand': [expandall, 1],
            'abs': [abs, 1],
            'invert': [invert, 1],
            'determinant': [determinant, 1],
            'size': [size, 1],
            'transpose': [transpose, 1],
            'dot': [dot, 2],
            'cross': [cross, 2],
            'vecget': [vecget, 2],
            'vecset': [vecset, 3],
            'vectrim': [vectrim, [1, 2]],
            'matget': [matget, 3],
            'matset': [matset, 4],
            'matgetrow': [matgetrow, 2],
            'matsetrow': [matsetrow, 3],
            'matgetcol': [matgetcol, 2],
            'matsetcol': [matsetcol, 3],
            'rationalize': [rationalize, 1],
            'IF': [IF, 3],
            'is_in': [is_in, 2],
            //imaginary support
            'realpart': [realpart, 1],
            'imagpart': [imagpart, 1],
            'conjugate': [conjugate, 1],
            'arg': [arg, 1],
            'polarform': [polarform, 1],
            'rectform': [rectform, 1],
            'sort': [sort, [1, 2]],
            'integer_part': [, 1],
            'union': [union, 2],
            'contains': [contains, 2],
            'intersection': [intersection, 2],
            'difference': [difference, 2],
            'intersects': [intersects, 2],
            'is_subset': [is_subset, 2],
            //system support
            'print': [print, -1]
        };

        //error handler
        this.error = err;
        //this function is used to comb through the function modules and find a function given its name
        var findFunction = function (fname) {
            var fmodules = Settings.FUNCTION_MODULES,
                    l = fmodules.length;
            for(var i = 0; i < l; i++) {
                var fmodule = fmodules[i];
                if(fname in fmodule)
                    return fmodule[fname];
            }
            err('The function ' + fname + ' is undefined!');
        };

        /**
         * This method gives the ability to override operators with new methods.
         * @param {String} which
         * @param {Function} with_what
         */
        this.override = function (which, with_what) {
            if(!bin[which])
                bin[which] = [];
            bin[which].push(this[which]);
            this[which] = with_what;
        };

        /**
         * Restores a previously overridden operator
         * @param {String} what
         */
        this.restore = function (what) {
            if(this[what])
                this[what] = bin[what].pop();
        };

        /**
         * This method is supposed to behave similarly to the override method but it does not override
         * the existing function rather it only extends it
         * @param {String} what
         * @param {Function} with_what
         * @param {boolean} force_call
         */
        this.extend = function (what, with_what, force_call) {
            var _ = this,
                    extended = this[what];
            if(typeof extended === 'function' && typeof with_what === 'function') {
                var f = this[what];
                this[what] = function (a, b) {
                    if(isSymbol(a) && isSymbol(b) && !force_call)
                        return f.call(_, a, b);
                    else
                        return with_what.call(_, a, b, f);
                };
            }
        };

        /**
         * Generates library's representation of a function. It's a fancy way of saying a symbol with
         * a few extras. The most important thing is that that it gives a fname and
         * an args property to the symbols in addition to changing its group to FN
         * @param {String} fn_name
         * @param {Array} params
         * @returns {Symbol}
         */
        this.symfunction = function (fn_name, params) {
            //call the proper function and return the result;
            var f = new Symbol(fn_name);
            f.group = FN;
            if(typeof params === 'object')
                params = [].slice.call(params);//ensure an array
            f.args = params;
            f.fname = fn_name === PARENTHESIS ? '' : fn_name;
            f.updateHash();
            return f;
        };

        /**
         * An internal function call for the Parser. This will either trigger a real
         * function call if it can do so or just return a symbolic representation of the
         * function using symfunction.
         * @param {String} fn_name
         * @param {Array} args
         * @param {int} allowed_args
         * @returns {Symbol}
         */
        this.callfunction = function (fn_name, args, allowed_args) {
            var fn_settings = functions[fn_name];

            if(!fn_settings)
                err('Nerdamer currently does not support the function ' + fn_name);

            var num_allowed_args = fn_settings[1] || allowed_args, //get the number of allowed arguments
                    fn = fn_settings[0], //get the mapped function
                    retval;
            //We want to be able to call apply on the arguments or create a symfunction. Both require
            //an array so make sure to wrap the argument in an array.
            if(!(args instanceof Array))
                args = args !== undefined ? [args] : [];

            if(num_allowed_args !== -1) {
                var is_array = isArray(num_allowed_args),
                        min_args = is_array ? num_allowed_args[0] : num_allowed_args,
                        max_args = is_array ? num_allowed_args[1] : num_allowed_args,
                        num_args = args.length;

                var error_msg = fn_name + ' requires a {0} of {1} arguments. {2} provided!';

                if(num_args < min_args)
                    err(format(error_msg, 'minimum', min_args, num_args));
                if(num_args > max_args)
                    err(format(error_msg, 'maximum', max_args, num_args));
            }

            /*
             * The following are very important to the how nerdamer constructs functions!
             * Assumption 1 - if fn is undefined then handling of the function is purely numeric. This
             *     enables us to reuse Math, Math2, ..., any function from Settings.FUNCTIONS_MODULES entry
             * Assumption 2 - if fn is defined then that function takes care of EVERYTHING including symbolics
             * Assumption 3 - if the user calls symbolics on a function that returns a numeric value then
             *     they are expecting a symbolic output.
             */
            //check if arguments are all numers
            var numericArgs = allNumbers(args);
            //Big number support. Check if Big number is requested and the arguments are all numeric and, not imaginary
//            if (Settings.USE_BIG && numericArgs) {
//                retval = Big[fn_name].apply(undefined, args);
//            }
//            else {
            if(!fn) {
                // Call JS function
                //Remember assumption 1. No function defined so it MUST be numeric in nature
                fn = findFunction(fn_name);
                if(Settings.PARSE2NUMBER && numericArgs)
                    retval = bigConvert(fn.apply(fn, args));
                else
                    retval = _.symfunction(fn_name, args);
            }
            else {
                // Call nerdamer function
                //Remember assumption 2. The function is defined so it MUST handle all aspects including numeric values
                retval = fn.apply(fn_settings[2], args);
            }
//            }

            return retval;
        };
        /**
         * Build a regex based on the operators currently loaded. These operators are to be ignored when
         * substituting spaces for multiplication
         */
        this.operator_filter_regex = (function () {
            //we only want the operators which are singular since those are the ones
            //that nerdamer uses anyway
            var ostr = '^\\' + Object.keys(operators).filter(function (x) {
                if(x.length === 1)
                    return x;
            }).join('\\');
            //create a regex which captures all spaces between characters except those
            //have an operator on one end
            return new RegExp('([' + ostr + '])\\s+([' + ostr + '])');
        })();

        /**
         * Replaces nerdamer.setOperator
         * @param {object} operator
         * @param {boolean} shift
         */
        this.setOperator = function (operator, action, shift) {
            var name = operator.operator; //take the name to be the symbol
            operators[name] = operator;
            if(action)
                this[operator.action] = action;
            //make the parser aware of the operator
            _[name] = operator.operation;
            //make the action available to the parser if infix
            if(!operator.action && !(operator.prefix || operator.postif)) {
                operator.action = name;
            }
            //if this operator is exclusive then all successive operators should be shifted
            if(shift === 'over' || shift === 'under') {
                var precedence = operator.precedence;

                for(var x in operators) {
                    var o = operators[x];
                    var condition = shift === 'over' ? o.precedence >= precedence : o.precedence > precedence;
                    if(condition)
                        o.precedence++;
                }
                ;
            }
        };

        /**
         * Gets an opererator by its symbol
         * @param {String} operator
         * @returns {Object}
         */
        this.getOperator = function (operator) {
            return operators[operator];
        };

        this.aliasOperator = function (o, n) {
            var t = {};
            var operator = operators[o];
            //copy everything over to the new operator
            for(var x in operator) {
                t[x] = operator[x];
            }
            //update the symbol
            t.operator = n;

            this.setOperator(t);
        };

        /**
         * Returns the list of operators. Caution! Can break parser!
         * @returns {object}
         */
        this.getOperators = function () {
            //will replace this with some cloning action in the future
            return operators;
        };

        this.getBrackets = function () {
            return brackets;
        };
        /*
         * Preforms preprocessing on the string. Useful for making early modification before
         * sending to the parser
         * @param {String} e
         */
        var prepare_expression = function (e) {
            /*
             * Since variables cannot start with a number, the assumption is made that when this occurs the
             * user intents for this to be a coefficient. The multiplication symbol in then added. The same goes for
             * a side-by-side close and open parenthesis
             */
            e = String(e);
            //apply preprocessors
            for(var i = 0; i < preprocessors.actions.length; i++)
                e = preprocessors.actions[i].call(this, e);

            //e = e.split(' ').join('');//strip empty spaces
            //replace multiple spaces with one space
            e = e.replace(/\s+/g, ' ');

            //only even bother to check if the string contains e. This regex is painfully slow and might need a better solution. e.g. hangs on (0.06/3650))^(365)
            if(/e/gi.test(e)) {
                // negative numbers
                e = e.replace(/\-+\d+\.?\d*e\+?\-?\d+/gi, function (x) {
                    return scientificToDecimal(x);
                });
                // positive numbers that are not part of an identifier
                e = e.replace(/(?<![A-Za-z])\d+\.?\d*e\+?\-?\d+/gi, function (x) {
                    return scientificToDecimal(x);
                });
            }
            //replace scientific numbers

            //allow omission of multiplication after coefficients
            e = e.replace(Settings.IMPLIED_MULTIPLICATION_REGEX, function () {
                var str = arguments[4],
                        group1 = arguments[1],
                        group2 = arguments[2],
                        start = arguments[3],
                        first = str.charAt(start),
                        before = '',
                        d = '*';
                if(!first.match(/[\+\-\/\*]/))
                    before = str.charAt(start - 1);
                if(before.match(/[a-z]/i))
                    d = '';
                return group1 + d + group2;
            })
                    .replace(/([a-z0-9_]+)/gi, function (match, a) {
                        if(Settings.USE_MULTICHARACTER_VARS === false && !(a in functions)) {
                            if(!isNaN(a))
                                return a;
                            return a.split('').join('*');
                        }
                        return a;
                    })
                    //allow omission of multiplication sign between brackets
                    .replace(/\)\(/g, ')*(') || '0';
            //replace x(x+a) with x*(x+a)
            while(true) {
                var e_org = e; //store the original
                e = e.replace(/([a-z0-9_]+)(\()|(\))([a-z0-9]+)/gi, function (match, a, b, c, d) {
                    var g1 = a || c,
                            g2 = b || d;
                    if(g1 in functions) //create a passthrough for functions
                        return g1 + g2;
                    return g1 + '*' + g2;
                });
                //if the original equals the replace we're done
                if(e_org === e)
                    break;
            }
            return e;
        };
        //delay setting of constants until Settings is ready
        this.initConstants = function () {
            this.CONSTANTS = {
                E: new Symbol(Settings.E),
                PI: new Symbol(Settings.PI)
            };
        };
        /*
         * Debugging method used to better visualize vector and arrays
         * @param {object} o
         * @returns {String}
         */
        this.pretty_print = function (o) {
            if(Array.isArray(o)) {
                var s = o.map(x => _.pretty_print(x)).join(', ');
                if(o.type === 'vector')
                    return 'vector<' + s + '>';
                return '(' + s + ')';
            }
            return o.toString();
        };
        this.peekers = {
            pre_operator: [],
            post_operator: [],
            pre_function: [],
            post_function: []
        };

        this.callPeekers = function (name) {
            if(Settings.callPeekers) {
                var peekers = this.peekers[name];
                //remove the first items and stringify
                var args = arguments2Array(arguments).slice(1).map(stringify);
                //call each one of the peekers
                for(var i = 0; i < peekers.length; i++) {
                    peekers[i].apply(null, args);
                }
            }
        };
        /*
         * Tokenizes the string
         * @param {String} e
         * @returns {Token[]}
         */
        this.tokenize = function (e) {
            //cast to String
            e = String(e);
            //remove multiple white spaces and spaces at beginning and end of string
            e = e.trim().replace(/\s+/g, ' ');
            //remove spaces before and after brackets
            for(var x in brackets) {
                var regex = new RegExp(brackets[x].is_close ? '\\s+\\' + x : '\\' + x + '\\s+', 'g');
                e = e.replace(regex, x);
            }

            var col = 0; //the column position
            var L = e.length; //expression length
            var lpos = 0; //marks beginning of next token
            var tokens = []; //the tokens container
            var scopes = [tokens]; //initiate with the tokens as the highest scope
            var target = scopes[0]; //the target to which the tokens are added. This can swing up or down
            var depth = 0;
            var open_brackets = [];
            var has_space = false; //marks if an open space character was found
            var SPACE = ' ';
            var EMPTY_STRING = '';
            var COMMA = ',';
            var MINUS = '-';
            var MULT = '*';
            //Possible source of bug. Review
            /*
             //gets the next space
             var next_space = function(from) {
             for(var i=from; i<L; i++) {
             if(e.charAt(i) === ' ')
             return i;
             }
             
             return L; //assume the end of the string instead
             };
             */
            /**
             * Adds a scope to tokens
             * @param {String} scope_type
             * @param {int} column
             * @returns {undefined}
             */
            var addScope = function (scope_type, column) {
                var new_scope = []; //create a new scope
                if(scope_type !== undefined) {
                    new_scope.type = scope_type;
                }
                new_scope.column = column; //mark the column of the scope
                scopes.push(new_scope); //add it to the list of scopes
                target.push(new_scope); //add it to the tokens list since now it's a scope
                target = new_scope; //point to it
                depth++; //go down one in scope
            };
            /**
             * Goes up in scope by one
             * @returns {undefined}
             */
            var goUp = function () {
                scopes.pop(); //remove the scope from the scopes stack
                target = scopes[--depth]; //point the above scope
            };
            /**
             * Extracts all the operators from the expression string starting at postion start_at
             * @param {int} start_at
             * @returns {String}
             */
            var get_operator_str = function (start_at) {
                start_at = start_at !== undefined ? start_at : col;
                //mark the end of the operator as the start since we're just going
                //to be walking along the string
                var end = start_at + 1;
                //just keep moving along
                while(e.charAt(end++) in operators) {
                }
                //remember that we started at one position ahead. The beginning operator is what triggered
                //this function to be called in the first place. String.CharAt is zero based so we now
                //have to correct two places. The initial increment + the extra++ at the end of end during
                //the last iteration.
                return e.substring(start_at, end - 1);
            };
            /**
             * Breaks operator up in to several different operators as defined in operators
             * @param {String} operator_str
             * @returns {String[]}
             */
            var chunkify = function (operator_str) {
                var start = col - operator_str.length; //start of operator
                var _operators = [];
                var operator = operator_str.charAt(0);
                //grab the largest possible chunks but start at 2 since we already know
                //that the first character is an operator

                for(var i = 1, L = operator_str.length; i < L; i++) {
                    var ch = operator_str.charAt(i);
                    var o = operator + ch;
                    //since the operator now is undefined then the last operator
                    //was the largest possible combination.
                    if(!(o in operators)) {
                        _operators.push(new Token(operator, Token.OPERATOR, start + i));
                        operator = ch;
                    }
                    else
                        operator = o;//now the operator is the larger chunk
                }
                //add the last operator
                _operators.push(new Token(operator, Token.OPERATOR, start + i));
                return _operators;
            };

            /**
             * Is used to add a token to the tokens array. Makes sure that no empty token is added
             * @param {int} at
             * @param {String} token
             * @returns {undefined}
             */
            var add_token = function (at, token) {
                //grab the token if we're not supplied one
                if(token === undefined)
                    token = e.substring(lpos, at);
                //only add it if it's not an empty string
                if(token in _.units)
                    target.push(new Token(token, Token.UNIT, lpos));
                else if(token !== '')
                    target.push(new Token(token, Token.VARIABLE_OR_LITERAL, lpos));
            };
            /**
             * Adds a function to the output
             * @param {String} f
             * @returns {undefined}
             */
            var add_function = function (f) {
                target.push(new Token(f, Token.FUNCTION, lpos));
            };
            /**
             * Tokens are found between operators so this marks the location of where the last token was found
             * @param {int} position
             * @returns {undefined}
             */
            var set_last_position = function (position) {
                lpos = position + 1;
            };
            /**
             * When a operator is found and added, especially a combo operator, then the column location
             * has to be adjusted to the end of the operator
             * @returns {undefined}
             */
            var adjust_column_position = function () {
                lpos = lpos + operator_str.length - 2;
                col = lpos - 1;
            };
            for(; col < L; col++) {
                var ch = e.charAt(col);
                if(ch in operators) {
                    add_token(col);
                    //is the last token numeric?
                    var last_token_is_numeric = target[0] && isNumber(target[0]);
                    //is this character multiplication?
                    var is_multiplication = last_token_is_numeric && ch === MULT;
                    //if we're in a new scope then go up by one but if the space
                    //is right befor an operator then it makes no sense to go up in scope
                    //consider sin -x. The last position = current position at the minus sign
                    //this means that we're going for sin(x) -x which is wrong
                    //Ignore comma since comma is still part of the existing scope.
                    if(has_space && lpos < col && !(ch === COMMA || is_multiplication)) {
                        has_space = false;
                        goUp();
                    }
                    //mark the last position that a
                    set_last_position(col + 1);
                    var operator_str = get_operator_str(col);

                    adjust_column_position();
                    target.push.apply(target, chunkify(operator_str));
                }
                else if(ch in brackets) {
                    var bracket = brackets[ch];

                    if(bracket.is_open) {
                        //mark the bracket
                        open_brackets.push([bracket, lpos]);
                        var f = e.substring(lpos, col);
                        if(f in functions) {
                            add_function(f);
                        }
                        else if(f !== '') {
                            //assume multiplication
                            //TODO: Add the multiplication to stack
                            target.push(new Token(f, Token.VARIABLE_OR_LITERAL, lpos));
                        }
                        //go down one in scope
                        addScope(bracket.maps_to, col);
                    }
                    else if(bracket.is_close) {
                        //get the matching bracket
                        var pair = open_brackets.pop();
                        //throw errors accordingly
                        //missing open bracket
                        if(!pair)
                            throw new ParityError('Missing open bracket for bracket at: ' + (col + 1));
                        //incorrect pair
                        else if(pair[0].id !== bracket.id - 1)
                            throw new ParityError('Parity error');

                        add_token(col);
                        goUp();
                    }
                    set_last_position(col);
                }
                else if(ch === SPACE) {
                    var prev = e.substring(lpos, col); //look back
                    var nxt = e.charAt(col + 1); //look forward
                    if(has_space) {

                        if(prev in operators) {
                            target.push(new Token(prev, Token.OPERATOR, col));
                        }
                        else {
                            add_token(undefined, prev);
                            //we're at the closing space
                            goUp(); //go up in scope if we're at a space

                            //assume multiplication if it's not an operator except for minus
                            var is_operator = nxt in operators;

                            if((is_operator && operators[nxt].value === MINUS) || !is_operator) {
                                target.push(new Token(MULT, Token.OPERATOR, col));
                            }
                        }
                        has_space = false; //remove the space
                    }
                    else {
                        //we're at the closing space
                        //check if it's a function
                        var f = e.substring(lpos, col);

                        if(f in functions) {
                            //there's no need to go up in scope if the next character is an operator
                            has_space = true; //mark that a space was found
                            add_function(f);
                            addScope();
                        }
                        else if(f in operators) {
                            target.push(new Token(f, Token.OPERATOR, col));
                        }
                        else {
                            add_token(undefined, f);
                            //peek ahead to the next character
                            var nxt = e.charAt(col + 1);

                            //If it's a number then add the multiplication operator to the stack but make sure that the next character
                            //is not an operator

                            if(prev !== EMPTY_STRING && nxt !== EMPTY_STRING && !(prev in operators) && !(nxt in operators))
                                target.push(new Token(MULT, Token.OPERATOR, col));
                        }
                        //Possible source of bug. Review
                        /*
                         //space can mean multiplication so add the symbol if the is encountered
                         if(/\d+|\d+\.?\d*e[\+\-]*\d+/i.test(f)) {
                         var next = e.charAt(col+1);
                         var next_is_operator = next in operators;
                         var ns = next_space(col+1);
                         var next_word = e.substring(col+1, ns);
                         //the next can either be a prefix operator or no operator
                         if((next_is_operator && operators[next].prefix) || !(next_is_operator || next_word in operators))
                         target.push(new Token('*', Token.OPERATOR, col));
                         }
                         */
                    }
                    set_last_position(col); //mark this location
                }
            }
            //check that all brackets were closed
            if(open_brackets.length) {
                var b = open_brackets.pop();
                throw new ParityError('Missing closed bracket for bracket at ' + (b[1] + 1));
            }
            //add the last token
            add_token(col);

            return tokens;
        };
        /*
         * Puts token array in Reverse Polish Notation
         * @param {Token[]} tokens
         * @returns {Token[]}
         */
        this.toRPN = function (tokens) {
            var fn = tokens.type;
            var l = tokens.length, i;
            var output = [];
            var stack = [];
            var prefixes = [];
            var collapse = function (target, destination) {
                while(target.length)
                    destination.push(target.pop());
            };
            //mark all the prefixes and add them to the stack
            for(i = 0; i < l; i++) {
                var token = tokens[i];
                if(token.type !== Token.OPERATOR)
                    break;
                if(!token.prefix)
                    throw new OperatorError('Not a prefix operator');
                token.is_prefix = true;
                stack.push(token);
            }
            //begin with remaining tokens
            for(; i < l; i++) {
                var e = tokens[i];
                if(e.type === Token.OPERATOR) {
                    var operator = e;

                    //create the option for the operator being overloaded
                    if(operator.overloaded) {
                        var next = tokens[i + 1];
                        //if it's followed by a number or variable then we assume it's not a postfix operator
                        if(next && next.type === Token.VARIABLE_OR_LITERAL) {
                            operator.postfix = false;
                            //override the original function with the overload function
                            operator.action = operator.overloadAction;
                            operator.leftAssoc = operator.overloadLeftAssoc;
                        }
                    }

                    //if the stack is not empty
                    while(stack.length) {
                        var last = stack[stack.length - 1];
                        //if (there is an operator at the top of the operator stack with greater precedence)
                        //or (the operator at the top of the operator stack has equal precedence and is left associative)) ~ wikipedia
                        //the !prefixes.length makes sure that the operator on stack isn't prematurely taken fromt he stack.
                        if(!(last.precedence > operator.precedence || !operator.leftAssoc && last.precedence === operator.precedence))
                            break;
                        output.push(stack.pop());
                    }

                    //change the behavior of the operator if it's a vector and we've been asked to do so
                    if((fn === 'vector' || fn === 'set') && 'vectorFn' in operator)
                        operator.action = operator.vectorFn;


                    //if the operator is a postfix operator then we're ready to go since it belongs
                    //to the preceding token. However the output cannot be empty. It must have either
                    //an operator or a variable/literal
                    if(operator.postfix) {
                        var previous = tokens[i - 1];
                        if(!previous)
                            throw new OperatorError("Unexpected prefix operator '" + e.value + "'! at " + e.column);
                        else if(previous.type === Token.OPERATOR) {
                            //a postfix can only be followed by a postfix
                            if(!previous.postfix)
                                throw new OperatorError("Unexpected prefix operator '" + previous.value + "'! at " + previous.column);
                        }
                    }
                    else {
                        //we must be at an infix so point the operator this
                        do {
                            //the first one is an infix operator all others have to be prefix operators so jump to the end
                            var next = tokens[i + 1]; //take a look ahead
                            var next_is_operator = next ? next.type === Token.OPERATOR : false; //check if it's an operator
                            if(next_is_operator) {
                                //if it's not a prefix operator then it not in the right place
                                if(!next.prefix) {
                                    throw new OperatorError('A prefix operator was expected at ' + next.column);
                                }
                                //mark it as a confirmed prefix
                                next.is_prefix = true;
                                //add it to the prefixes
                                prefixes.push(next);
                                i++;
                            }
                        }
                        while(next_is_operator)
                    }

                    //if it's a prefix it should be on a special stack called prefixes
                    //we do this to hold on to prefixes because of left associative operators.
                    //they belong to the variable/literal but if placed on either the stack
                    //or output there's no way of knowing this. I might be wrong so I welcome
                    //any discussion about this.

                    if(operator.is_prefix) //ADD ALL EXCEPTIONS FOR ADDING TO PREFIX STACK HERE. !!!
                        prefixes.push(operator);
                    else
                        stack.push(operator);
                    //move the prefixes to the stack
                    while(prefixes.length) {
                        if(operator.leftAssoc || !operator.leftAssoc && prefixes[prefixes.length - 1].precedence >= operator.precedence) //revisit for commas
                            stack.push(prefixes.pop());
                        else
                            break;
                    }
                }
                else if(e.type === Token.VARIABLE_OR_LITERAL) {
                    //move prefixes to stack at beginning of scope
                    if(output.length === 0)
                        collapse(prefixes, stack);
                    //done with token
                    output.push(e);
                    var last_on_stack = stack[stack.length - 1];
                    //then move all the prefixes to the output
                    if(!last_on_stack || !last_on_stack.leftAssoc)
                        collapse(prefixes, output);
                }
                else if(e.type === Token.FUNCTION) {
                    stack.push(e);
                }
                else if(e.type === Token.UNIT) {
                    //if it's a unit it belongs on the stack since it's tied to the previous token
                    output.push(e);
                }
                //if it's an additonal scope then put that into RPN form
                if(Array.isArray(e)) {
                    output.push(this.toRPN(e));
                    if(e.type)
                        output.push(new Token(e.type, Token.FUNCTION, e.column)); //since it's hidden it needs no column

                }
            }
            //collapse the remainder of the stack and prefixes to output
            collapse(stack, output);
            collapse(prefixes, output);

            return output;
        };
        /*
         * Parses the tokens
         * @param {Tokens[]} rpn
         * @param {object} substitutions
         * @returns {Symbol}
         */
        this.parseRPN = function (rpn, substitutions) {
            try {
                //default substitutions
                substitutions = substitutions || {};
                //prepare the substitutions.
                //we first parse them out as-is
                for(var x in substitutions)
                    substitutions[x] = _.parse(substitutions[x], {});

                //Although technically constants,
                //pi and e are only available when evaluating the expression so add to the subs.
                //Doing this avoids rounding errors
                //link e and pi
                if(Settings.PARSE2NUMBER) {
                    //use the value provided if the individual for some strange reason prefers this.
                    //one reason could be to sub e but not pi or vice versa
                    if(!('e' in substitutions))
                        substitutions.e = new Symbol(Settings.E);
                    if((!('pi' in substitutions)))
                        substitutions.pi = new Symbol(Settings.PI);
                }

                var Q = [];
                for(var i = 0, l = rpn.length; i < l; i++) {
                    var e = rpn[i];

                    //Arrays indicate a new scope so parse that out
                    if(Array.isArray(e)) {
                        e = this.parseRPN(e, substitutions);
                    }

                    if(e) {
                        if(e.type === Token.OPERATOR) {
                            if(e.is_prefix || e.postfix)
                                //resolve the operation assocated with the prefix
                                Q.push(e.operation(Q.pop()));
                            else {
                                var b = Q.pop();
                                var a = Q.pop();
                                //Throw an error if the RH value is empty. This cannot be a postfix since we already checked
                                if(typeof a === 'undefined')
                                    throw new OperatorError(e + ' is not a valid postfix operator at ' + e.column);

                                var is_comma = e.action === 'comma';
                                //convert Sets to Vectors on all operations at this point. Sets are only recognized functions or individually
                                if(a instanceof Set && !is_comma)
                                    a = Vector.fromSet(a);

                                if(b instanceof Set && !is_comma)
                                    b = Vector.fromSet(b);

                                //call all the pre-operators
                                this.callPeekers('pre_operator', a, b, e);

                                var ans = _[e.action](a, b);

                                //call all the pre-operators
                                this.callPeekers('post_operator', ans, a, b, e);

                                Q.push(ans);
                            }
                        }
                        else if(e.type === Token.FUNCTION) {
                            var args = Q.pop();
                            var parent = args.parent; //make a note of the parent
                            if(!(args instanceof Collection))
                                args = Collection.create(args);
                            //the return value may be a vector. If it is then we check
                            //Q to see if there's another vector on the stack. If it is then
                            //we check if has elements. If it does then we know that we're dealing
                            //with an "getter" object and return the requested values

                            //call the function. This is the _.callfunction method in nerdamer
                            var fn_name = e.value;
                            var fn_args = args.getItems();

                            //call the pre-function peekers
                            this.callPeekers('pre_function', fn_name, fn_args);

                            var ret = _.callfunction(fn_name, fn_args);

                            //call the post-function peekers
                            this.callPeekers('post_function', ret, fn_name, fn_args);

                            var last = Q[Q.length - 1];
                            var next = rpn[i + 1];
                            var next_is_comma = next && next.type === Token.OPERATOR && next.value === ',';

                            // if(!next_is_comma && ret instanceof Vector && last && last.elements && !(last instanceof Collection)) {
                            //     //remove the item from the queue
                            //     var item = Q.pop();

                            //     var getter = ret.elements[0];
                            //     //check if it's symbolic. If so put it back and add the item to the stack
                            //     if(!getter.isConstant()) {
                            //         item.getter = getter;
                            //         Q.push(item);
                            //         Q.push(ret);
                            //     }
                            //     else if(getter instanceof Slice) {
                            //         //if it's a Slice return the slice
                            //         Q.push(Vector.fromArray(item.elements.slice(getter.start, getter.end)));
                            //     }
                            //     else {
                            //         var index = Number(getter);
                            //         var il = item.elements.length;
                            //         //support for negative indices
                            //         if(index < 0)
                            //             index = il + index;
                            //         //it it's still out of bounds
                            //         if(index < 0 || index >= il) //index should no longer be negative since it's been reset above
                            //             //range error
                            //             throw new OutOfRangeError('Index out of range ' + (e.column + 1));

                            //         var element = item.elements[index];
                            //         //cyclic but we need to mark this for future reference
                            //         item.getter = index;
                            //         element.parent = item;

                            //         Q.push(element);
                            //     }
                            // }
                            // else {
                                //extend the parent reference
                                if(parent)
                                    ret.parent = parent;
                                Q.push(ret);
                            // }

                        }
                        else {
                            var subbed;
                            var v = e.value;

                            if(v in Settings.ALIASES)
                                e = _.parse(Settings.ALIASES[e]);
                            //wrap it in a symbol if need be
                            else if(e.type === Token.VARIABLE_OR_LITERAL)
                                e = new Symbol(v);
                            else if(e.type === Token.UNIT) {
                                e = new Symbol(v);
                                e.isUnit = true;
                            }

                            //make substitutions
                            //Always constants first. This avoids the being overridden
                            if(v in _.CONSTANTS) {
                                subbed = e;
                                e = new Symbol(_.CONSTANTS[v]);
                            }
                            //next substitutions. This allows declared variable to be overridden
                            //check if the values match to avoid erasing the multiplier.
                            //Example:/e = 3*a. substutiting a for a will wipe out the multiplier.
                            else if(v in substitutions && v !== substitutions[v].toString()) {
                                subbed = e;
                                e = substitutions[v].clone();
                            }
                            //next declare variables
                            else if(v in VARS) {
                                subbed = e;
                                e = VARS[v].clone();
                            }
                            //make notation of what it was before
                            if(subbed)
                                e.subbed = subbed;

                            Q.push(e);
                        }
                    }
                }

                var retval = Q[0];

                if(['undefined', 'string', 'number'].indexOf(typeof retval) !== -1) {
                    throw new UnexpectedTokenError('Unexpected token!');
                }

                return retval;
            }
            catch(error) {
                if (error.message === "timeout") throw error;
                var rethrowErrors = [OutOfFunctionDomainError];
                // Rethrow certain errors in the same class to preserve them
                rethrowErrors.forEach(function (E) {
                    if(error instanceof E) {
                        throw new E(error.message + ': ' + e.column);
                    }
                });

                throw new ParseError(error.message + ': ' + e.column);
            }
        };
        /**
         * This is the method that triggers the parsing of the string. It generates a parse tree but processes
         * it right away. The operator functions are called when their respective operators are reached. For instance
         * + with cause this.add to be called with the left and right hand values. It works by walking along each
         * character of the string and placing the operators on the stack and values on the output. When an operator
         * having a lower order than the last is reached then the stack is processed from the last operator on the
         * stack.
         * @param {String} token
         */

        function Node(token) {
            this.type = token.type;
            this.value = token.value;
            //the incoming token may already be a Node type
            this.left = token.left;
            this.right = token.right;
        }

        Node.prototype.toString = function () {
            var left = this.left ? this.left.toString() + '---' : '';
            var right = this.right ? '---' + this.right.toString() : '';
            return left + '(' + this.value + ')' + right;
        };

        Node.prototype.toHTML = function (depth, indent) {
            depth = depth || 0;
            indent = typeof indent === 'undefined' ? 4 : indent;
            var tab = function (n) {
                return ' '.repeat(indent * n);
            };
            var html = '';
            var left = this.left ? tab(depth + 1) + '<li>\n' + this.left.toHTML(depth + 2, indent) + tab(depth + 1) + '</li> \n' : '';
            var right = this.right ? tab(depth + 1) + '<li>\n' + this.right.toHTML(depth + 2, indent) + tab(depth + 1) + '</li>\n' : '';
            var html = tab(depth) + '<div class="' + this.type.toLowerCase() + '"><span>' + this.value + '</span></div>' + tab(depth) + '\n';
            if(left || right) {
                html += tab(depth) + '<ul>\n' + left + right + tab(depth) + '</ul>\n';
            }
            html += '';
            return html;
        };

        this.tree = function (tokens) {
            var Q = [];
            for(var i = 0; i < tokens.length; i++) {
                var e = tokens[i];
                //Arrays indicate a new scope so parse that out
                if(Array.isArray(e)) {
                    e = this.tree(e);
                    //if it's a comma then it's just arguments
                    Q.push(e);
                    continue;
                }
                if(e.type === Token.OPERATOR) {
                    if(e.is_prefix || e.postfix) {
                        //prefixes go to the left, postfix to the right
                        var location = e.is_prefix ? 'left' : 'right';
                        var last = Q.pop();
                        e = new Node(e);
                        e[location] = last;
                        Q.push(e);
                    }
                    else {
                        e = new Node(e);
                        e.right = Q.pop();
                        e.left = Q.pop();
                        Q.push(e);
                    }
                }
                else if(e.type === Token.FUNCTION) {
                    e = new Node(e);
                    var args = Q.pop();
                    e.right = args;
                    if(e.value === 'object') {
                        //check if Q has a value
                        var last = Q[Q.length - 1];
                        if(last) {
                            while(last.right) {
                                last = last.right;
                            }
                            last.right = e;
                            continue;
                        }
                    }

                    Q.push(e);
                }
                else {
                    Q.push(new Node(e));
                }
            }

            return Q[0];
        };
        this.parse = function (e, substitutions) {
            e = prepare_expression(e);
            substitutions = substitutions || {};
            //three passes but easier to debug
            var tokens = this.tokenize(e);
            var rpn = this.toRPN(tokens);
            return this.parseRPN(rpn, substitutions);
        };
        /**
         * TODO: Switch to Parser.tokenize for this method
         * Reads a string into an array of Symbols and operators
         * @param {String} expression_string
         * @returns {Array}
         */
        this.toObject = function (expression_string) {
            var objectify = function (tokens) {
                var output = [];
                for(var i = 0, l = tokens.length; i < l; i++) {
                    var token = tokens[i];
                    var v = token.value;
                    if(token.type === Token.VARIABLE_OR_LITERAL) {
                        output.push(new Symbol(v));
                    }
                    else if(token.type === Token.FUNCTION) {
                        //jump ahead since the next object are the arguments
                        i++;
                        //create a symbolic function and stick it on output
                        var f = _.symfunction(v, objectify(tokens[i]));
                        f.isConversion = true;
                        output.push(f);
                    }
                    else if(token.type === Token.OPERATOR) {
                        output.push(v);
                    }
                    else {
                        output.push(objectify(token));
                    }
                }

                return output;
            };
            return objectify(_.tokenize(expression_string));
        };

        // A helper method for toTeX
        var chunkAtCommas = function (arr) {
            var j, k = 0, chunks = [[]];
            for(var j = 0, l = arr.length; j < l; j++) {
                if(arr[j] === ',') {
                    k++;
                    chunks[k] = [];
                }
                else {
                    chunks[k].push(arr[j]);
                }
            }
            return chunks;
        };

        // Helper method for toTeX
        var rem_brackets = function (str) {
            return str.replace(/^\\left\((.+)\\right\)$/g, function (str, a) {
                if(a)
                    return a;
                return str;
            });
        };

        var remove_redundant_powers = function (arr) {
            // The filtered array
            var narr = [];

            while(arr.length) {
                // Remove the element from the front
                var e = arr.shift();
                var next = arr[0];
                var next_is_array = isArray(next);
                var next_is_minus = next === '-';

                // Remove redundant plusses 
                if(e === '^') {
                    if(next === '+') {
                        arr.shift();
                    }
                    else if(next_is_array && next[0] === '+') {
                        next.shift();
                    }

                    // Remove redundant parentheses
                    if(next_is_array && next.length === 1) {
                        arr.unshift(arr.shift()[0]);
                    }
                }

                // Check if it's a negative power
                if(e === '^' && (next_is_array && next[0] === '-' || next_is_minus)) {
                    // If so:
                    // - Remove it from the new array, place a one and a division sign in that array and put it back
                    var last = narr.pop();
                    // Check if it's something multiplied by
                    var before = narr[narr.length - 1];
                    var before_last = '1';

                    if(before === '*') {
                        narr.pop();
                        // For simplicity we just pop it. 
                        before_last = narr.pop();
                    }
                    // Implied multiplication
                    else if(isArray(before)) {
                        before_last = narr.pop();
                    }

                    narr.push(before_last, '/', last, e);

                    // Remove the negative sign from the power 
                    if(next_is_array) {
                        next.shift();
                    }
                    else {
                        arr.shift();
                    }

                    // Remove it from the array so we don't end up with redundant parentheses if we can
                    if(next_is_array && next.length === 1) {
                        narr.push(arr.shift()[0]);
                    }
                }
                else {
                    narr.push(e);
                }
            }

            return narr;
        };
        /*
         * Convert expression or object to LaTeX
         * @param {String} expression_or_obj
         * @param {object} opt
         * @returns {String}
         */
        this.toTeX = function (expression_or_obj, opt) {
            opt = opt || {};
            // Add decimal option as per issue #579. Consider passing an object to Latex.latex as option instead of string
            var decimals = opt.decimals === true ? 'decimals' : undefined;

            var obj = typeof expression_or_obj === 'string' ? this.toObject(expression_or_obj) : expression_or_obj,
                    TeX = [],
                    cdot = typeof opt.cdot === 'undefined' ? '\\cdot' : opt.cdot; //set omit cdot to true by default

            // Remove negative powers as per issue #570
            obj = remove_redundant_powers(obj);

            if(isArray(obj)) {
                var nobj = [], a, b;
                //first handle ^
                for(var i = 0; i < obj.length; i++) {
                    a = obj[i];

                    if(obj[i + 1] === '^') {
                        b = obj[i + 2];
                        nobj.push(LaTeX.braces(this.toTeX([a])) + '^' + LaTeX.braces(this.toTeX([b])));
                        i += 2;
                    }
                    else {
                        nobj.push(a);
                    }
                }
                obj = nobj;
            }

            for(var i = 0, l = obj.length; i < l; i++) {
                var e = obj[i];

                // Convert * to cdot
                if(e === '*') {
                    e = cdot;
                }

                if(isSymbol(e)) {
                    if(e.group === FN) {
                        var fname = e.fname, f;

                        if(fname === SQRT) {
                            f = '\\sqrt' + LaTeX.braces(this.toTeX(e.args));
                        }
                        else if(fname === ABS) {
                            f = LaTeX.brackets(this.toTeX(e.args), 'abs');
                        }
                        else if(fname === PARENTHESIS) {
                            f = LaTeX.brackets(this.toTeX(e.args), 'parens');
                        }
                        else if(fname === Settings.LOG10) {
                            f = '\\' + Settings.LOG10_LATEX + '\\left( ' + this.toTeX(e.args) + '\\right)';
                        }
                        else if(fname === 'integrate') {
                            /* Retrive [Expression, x] */
                            var chunks = chunkAtCommas(e.args);
                            /* Build TeX */
                            var expr = LaTeX.braces(this.toTeX(chunks[0])),
                                    dx = this.toTeX(chunks[1]);
                            f = '\\int ' + expr + '\\, d' + dx;
                        }
                        else if(fname === 'defint') {
                            var chunks = chunkAtCommas(e.args),
                                    expr = LaTeX.braces(this.toTeX(chunks[0])),
                                    dx = this.toTeX(chunks[3]),
                                    lb = this.toTeX(chunks[1]),
                                    ub = this.toTeX(chunks[2]);
                            f = '\\int\\limits_{' + lb + '}^{' + ub + '} ' + expr + '\\, d' + dx;

                        }
                        else if(fname === 'diff') {
                            var chunks = chunkAtCommas(e.args);
                            var dx = '', expr = LaTeX.braces(this.toTeX(chunks[0]));
                            /* Handle cases: one argument provided, we need to guess the variable, and assume n = 1 */
                            if(chunks.length === 1) {
                                var vars = [];
                                for(j = 0; j < chunks[0].length; j++) {
                                    if(chunks[0][j].group === 3) {
                                        vars.push(chunks[0][j].value);
                                    }
                                }
                                vars.sort();
                                dx = vars.length > 0 ? ('\\frac{d}{d ' + vars[0] + '}') : '\\frac{d}{d x}';
                            }
                            /* If two arguments, we have expression and variable, we assume n = 1 */
                            else if(chunks.length === 2) {
                                dx = '\\frac{d}{d ' + chunks[1] + '}';
                            }
                            /* If we have more than 2 arguments, we assume we've got everything */
                            else {
                                dx = '\\frac{d^{' + chunks[2] + '}}{d ' + this.toTeX(chunks[1]) + '^{' + chunks[2] + '}}';
                            }

                            f = dx + '\\left(' + expr + '\\right)';

                        }
                        else if(fname === 'sum' || fname === 'product') {
                            // Split e.args into 4 parts based on locations of , symbols.
                            var argSplit = [[], [], [], []], j = 0, i;
                            for(i = 0; i < e.args.length; i++) {
                                if(e.args[i] === ',') {
                                    j++;
                                    continue;
                                }
                                argSplit[j].push(e.args[i]);
                            }
                            // Then build TeX string.
                            f = (fname === 'sum' ? '\\sum_' : '\\prod_') + LaTeX.braces(this.toTeX(argSplit[1]) + ' = ' + this.toTeX(argSplit[2]));
                            f += '^' + LaTeX.braces(this.toTeX(argSplit[3])) + LaTeX.braces(this.toTeX(argSplit[0]));
                        }
                        else if(fname === 'limit') {
                            var args = chunkAtCommas(e.args).map(function (x) {
                                if(Array.isArray(x))
                                    return _.toTeX(x.join(''));
                                return _.toTeX(String(x));
                            });
                            f = '\\lim_' + LaTeX.braces(args[1] + '\\to ' + args[2]) + ' ' + LaTeX.braces(args[0]);
                        }
                        else if(fname === FACTORIAL || fname === DOUBLEFACTORIAL) {
                            f = this.toTeX(e.args) + (fname === FACTORIAL ? '!' : '!!');
                        }
                        else {
                            f = LaTeX.latex(e, decimals);
                            //f = '\\mathrm'+LaTeX.braces(fname.replace(/_/g, '\\_')) + LaTeX.brackets(this.toTeX(e.args), 'parens');
                        }

                        TeX.push(f);
                    }
                    else {
                        TeX.push(LaTeX.latex(e, decimals));
                    }
                }
                else if(isArray(e)) {
                    TeX.push(LaTeX.brackets(this.toTeX(e)));
                }
                else {
                    if(e === '/')
                        TeX.push(LaTeX.frac(rem_brackets(TeX.pop()), rem_brackets(this.toTeX([obj[++i]]))));
                    else
                        TeX.push(e);
                }
            }

            return TeX.join(' ');
        };

//Parser.functions ==============================================================
        /* Although parens is not a "real" function it is important in some cases when the
         * symbol must carry parenthesis. Once set you don't have to worry about it anymore
         * as the parser will get rid of it at the first opportunity
         */
        function parens(symbol) {
            if(Settings.PARSE2NUMBER) {
                return symbol;
            }
            return _.symfunction('parens', [symbol]);
        }

        function abs(symbol) {

            //|-∞| = ∞
            if(symbol.isInfinity) {
                return Symbol.infinity();
            }
            if(symbol.multiplier.lessThan(0))
                symbol.multiplier.negate();

            if(symbol.isImaginary()) {
                var re = symbol.realpart();
                var im = symbol.imagpart();
                if(re.isConstant() && im.isConstant())
                    return sqrt(_.add(_.pow(re, new Symbol(2)), _.pow(im, new Symbol(2))));
            }
            else if(isNumericSymbol(symbol) || even(symbol.power)) {
                return symbol;
            }
            // together.math baseunits are presumed positive
            else if(isVariableSymbol(symbol) && (typeof symbol.value==="string") &&
                symbol.value.startsWith("baseunit_")) {
                return symbol;
            }

            if(symbol.isComposite()) {
                var ms = [];
                symbol.each(function (x) {
                    ms.push(x.multiplier);
                });
                var gcd = Math2.QGCD.apply(null, ms);
                if(gcd.lessThan(0)) {
                    symbol.multiplier = symbol.multiplier.multiply(new Frac(-1));
                    symbol.distributeMultiplier();
                }
            }

            //convert |n*x| to n*|x|
            var m = _.parse(symbol.multiplier);
            symbol.toUnitMultiplier();

            return _.multiply(m, _.symfunction(ABS, [symbol]));
        }
        /**
         * The factorial function
         * @param {Symbol} symbol
         * @return {Symbol}
         */
        function factorial(symbol) {
            var retval;
            if(isVector(symbol)) {
                var V = new Vector();
                symbol.each(function (x, i) {
                    //i start at one.
                    V.set(i - 1, factorial(x));
                });
                return V;
            }
            if(isMatrix(symbol)) {
                var M = new Matrix();
                symbol.each(function (x, i, j) {
                    //i start at one.
                    M.set(i, j, factorial(x));
                });
                return M;
            }
            if(Settings.PARSE2NUMBER && symbol.isConstant()) {
                if(isInt(symbol)) {
                    retval = Math2.bigfactorial(symbol);
                }
                else {
                    retval = Math2.gamma(symbol.multiplier.add(new Frac(1)).toDecimal());
                }

                retval = bigConvert(retval);
                return retval;
            }
            else if(symbol.isConstant()) {
                var den = symbol.getDenom();
                if(den.equals(2)) {
                    var num = symbol.getNum();
                    var a, b, c, n;

                    if(!symbol.multiplier.isNegative()) {
                        n = _.add(num, new Symbol(1)).multiplier.divide(new Frac(2));
                        a = Math2.bigfactorial(new Frac(2).multiply(n));
                        b = _.pow(new Symbol(4), new Symbol(n)).multiplier.multiply(Math2.bigfactorial(n));
                    }
                    else {
                        n = _.subtract(num.negate(), new Symbol(1)).multiplier.divide(new Frac(2));
                        a = _.pow(new Symbol(-4), new Symbol(n)).multiplier.multiply(Math2.bigfactorial(n));
                        b = Math2.bigfactorial(new Frac(2).multiply(n));
                    }
                    c = a.divide(b);
                    return _.multiply(_.parse('sqrt(pi)'), new Symbol(c));
                }
            }
            return _.symfunction(FACTORIAL, [symbol]);
        }
        ;
        /**
         * Returns the continued fraction of a number
         * @param {Symbol} symbol
         * @param {Symbol} n
         * @returns {Symbol}
         */
        function continued_fraction(symbol, n) {
            var _symbol = evaluate(symbol);
            if(_symbol.isConstant()) {
                var cf = Math2.continuedFraction(_symbol, n);
                //convert the fractions array to a new Vector
                var fractions = Vector.fromArray(cf.fractions.map(function (x) {
                    return new Symbol(x);
                }));
                return Vector.fromArray([new Symbol(cf.sign), new Symbol(cf.whole), fractions]);
            }
            return _.symfunction('continued_fraction', arguments);
        }
        /**
         * Returns the error function
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function erf(symbol) {
            var _symbol = evaluate(symbol);

            if(_symbol.isConstant()) {
                return Math2.erf(_symbol);
            }
            else if(_symbol.isImaginary()) {
                return complex.erf(symbol);
            }
            return _.symfunction('erf', arguments);
        }
        ;
        /**
         * The mod function
         * @param {Symbol} symbol1
         * @param {Symbol} symbol2
         * @returns {Symbol}
         */
        function mod(symbol1, symbol2) {
            if(symbol1.isConstant() && symbol2.isConstant()) {
                var retval = new Symbol(1);
                retval.multiplier = retval.multiplier.multiply(symbol1.multiplier.mod(symbol2.multiplier));
                return retval;
            }
            //try to see if division has remainder of zero
            var r = _.divide(symbol1.clone(), symbol2.clone());
            if(isInt(r))
                return new Symbol(0);
            return _.symfunction('mod', [symbol1, symbol2]);
        }
        /**
         * A branghing function
         * @param {Boolean} condition
         * @param {Symbol} a
         * @param {Symbol} b
         * @returns {Symbol}
         */
        function IF(condition, a, b) {
            if(typeof condition !== 'boolean')
                if(isNumericSymbol(condition))
                    condition = !!Number(condition);
            if(condition)
                return a;
            return b;
        }
        /**
         *
         * @param {Matrix|Vector|Set|Collection} obj
         * @param {Symbol} item
         * @returns {Boolean}
         */
        function is_in(obj, item) {
            if(isMatrix(obj)) {
                for(var i = 0, l = obj.rows(); i < l; i++) {
                    for(var j = 0, l2 = obj.cols(); j < l2; j++) {
                        var element = obj.elements[i][j];
                        if(element.equals(item))
                            return new Symbol(1);
                    }
                }
            }
            else if(obj.elements) {
                for(var i = 0, l = obj.elements.length; i < l; i++) {
                    if(obj.elements[i].equals(item))
                        return new Symbol(1);
                }
            }

            return new Symbol(0);
        }

        /**
         * A symbolic extension for sinc
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function sinc(symbol) {
            if(Settings.PARSE2NUMBER) {
                if(symbol.isConstant()) {
                    return new Symbol(Math2.sinc(symbol));
                }
                return _.parse(format('sin({0})/({0})', symbol));
            }
            return _.symfunction('sinc', [symbol]);
        }

        /**
         * A symbolic extension for exp. This will auto-convert all instances of exp(x) to e^x.
         * Thanks @ Happypig375
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function exp(symbol) {
            if(symbol.fname === Settings.LOG && symbol.isLinear()) {
                return _.pow(symbol.args[0], Symbol.create(symbol.multiplier));
            }
            return _.parse(format('e^({0})', symbol));
        }

        /**
         * Converts value degrees to radians
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function radians(symbol) {
            return _.parse(format('({0})*pi/180', symbol));
        }

        /**
         * Converts value from radians to degrees
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function degrees(symbol) {
            return _.parse(format('({0})*180/pi', symbol));
        }

        function nroots(symbol) {
            var a, b;
            if(symbol.group === FN && symbol.fname === '') {
                a = Symbol.unwrapPARENS(_.parse(symbol).toLinear());
                b = _.parse(symbol.power);
            }
            else if(symbol.group === P) {
                a = _.parse(symbol.value);
                b = _.parse(symbol.power);
            }

            if(a && b && a.group === N && b.group === N) {
                var _roots = [];
                var parts = Symbol.toPolarFormArray(symbol);
                var r = _.parse(a).abs().toString();
                //https://en.wikipedia.org/wiki/De_Moivre%27s_formula
                var x = arg(a).toString();
                var n = b.multiplier.den.toString();
                var p = b.multiplier.num.toString();

                var formula = "(({0})^({1})*(cos({3})+({2})*sin({3})))^({4})";
                for(var i = 0; i < n; i++) {
                    var t = evaluate(_.parse(format("(({0})+2*pi*({1}))/({2})", x, i, n))).multiplier.toDecimal();
                    _roots.push(evaluate(_.parse(format(formula, r, n, Settings.IMAGINARY, t, p))));
                }
                return Vector.fromArray(_roots);
            }
            else if(symbol.isConstant(true)) {
                var sign = symbol.sign();
                var x = evaluate(symbol.abs());
                var root = _.sqrt(x);

                var _roots = [root.clone(), root.negate()];

                if(sign < 0)
                    _roots = _roots.map(function (x) {
                        return _.multiply(x, Symbol.imaginary());
                    });
            }
            else {
                _roots = [_.parse(symbol)];
            }

            return Vector.fromArray(_roots);
        }

        /**
         * Rationalizes a symbol
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function rationalize(symbol) {
            if(symbol.isComposite()) {
                var retval = new Symbol(0);
                var num, den, retnum, retden, a, b, n, d;
                symbol.each(function (x) {
                    num = x.getNum();
                    den = x.getDenom();
                    retnum = retval.getNum();
                    retden = retval.getDenom();
                    a = _.multiply(den, retnum);
                    b = _.multiply(num, retden);
                    n = _.expand(_.add(a, b));
                    d = _.multiply(retden, den);
                    retval = _.divide(n, d);
                }, true);

                return retval;
            }
            return symbol;
        }

        /**
         * The square root function
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function sqrt(symbol) {
            if(!isSymbol(symbol)) {
                symbol = _.parse(symbol);
            }

            const original = _.symfunction('sqrt', [symbol]);
            
            // Exit early for EX
            if(symbol.group === EX) {
                return _.symfunction(SQRT, [symbol]);
            }

            if(symbol.fname === '' && symbol.power.equals(1))
                symbol = symbol.args[0];

            var is_negative = symbol.multiplier.sign() < 0;

            if(Settings.PARSE2NUMBER) {
                if(symbol.isConstant() && !is_negative) {
                    return new Symbol(bigDec.sqrt(symbol.multiplier.toDecimal()));
                }
                else if(symbol.isImaginary()) {
                    return complex.sqrt(symbol);
                }
                else if(symbol.group === S) {
                    return _.symfunction('sqrt', [symbol]);
                }
            }

            var img, retval,
                    isConstant = symbol.isConstant();

            if(symbol.group === CB && symbol.isLinear()) {
                var m = sqrt(Symbol(symbol.multiplier));
                for(var s in symbol.symbols) {
                    var x = symbol.symbols[s];
                    m = _.multiply(m, sqrt(x));
                }

                retval = m;
            }
            //if the symbol is already sqrt then it's that symbol^(1/4) and we can unwrap it
            else if(symbol.fname === SQRT) {
                var s = symbol.args[0];
                var ms = symbol.multiplier;
                s.setPower(symbol.power.multiply(new Frac(0.25)));
                retval = s;
                //grab the multiplier
                if(!ms.equals(1))
                    retval = _.multiply(sqrt(_.parse(ms)), retval);
            }
            //if the symbol is a fraction then we don't keep can unwrap it. For instance
            //no need to keep sqrt(x^(1/3))
            else if(!symbol.power.isInteger()) {
                symbol.setPower(symbol.power.multiply(new Frac(0.5)));
                retval = symbol;
            }
            else if(symbol.multiplier < 0 && symbol.group === S) {
                var a = _.parse(symbol.multiplier).negate();
                var b = _.parse(symbol).toUnitMultiplier().negate();
                retval = _.multiply(_.symfunction(Settings.SQRT, [b]), sqrt(a));
            }
            else {

                //Related to issue #401. Since sqrt(a)*sqrt(b^-1) relates in issues, we'll change the form
                //to sqrt(a)*sqrt(b)^1 for better simplification
                //the sign of the power
                var sign = symbol.power.sign();
                //remove the sign
                symbol.power = symbol.power.abs();

                //if the symbols is imagary then we place in the imaginary part. We'll return it
                //as a product
                if(isConstant && symbol.multiplier.lessThan(0)) {
                    img = Symbol.imaginary();
                    symbol.multiplier = symbol.multiplier.abs();
                }

                var q = symbol.multiplier.toDecimal(),
                        qa = Math.abs(q),
                        t = Math.sqrt(qa);

                var m;
                //it's a perfect square so take the square
                if(isInt(t)) {
                    m = new Symbol(t);
                }
                else if(isInt(q)) {
                    var factors = Math2.ifactor(q);
                    var tw = 1;
                    for(var x in factors) {
                        var n = factors[x],
                                nn = (n - (n % 2)); //get out the whole numbers
                        if(nn) { //if there is a whole number ...
                            var w = Math.pow(x, nn);
                            tw *= Math.pow(x, nn / 2); //add to total wholes
                            q /= w; //reduce the number by the wholes
                        }
                    }
                    m = _.multiply(_.symfunction(SQRT, [new Symbol(q)]), new Symbol(tw));
                }
                else {
                    //reduce the numerator and denominator using prime factorization
                    var c = [new Symbol(symbol.multiplier.num), new Symbol(symbol.multiplier.den)];
                    var r = [new Symbol(1), new Symbol(1)];
                    var sq = [new Symbol(1), new Symbol(1)];
                    for(var i = 0; i < 2; i++) {
                        var n = c[i];
                        //get the prime factors and loop through each.
                        pfactor(n).each(function (x) {
                            x = Symbol.unwrapPARENS(x);
                            var b = x.clone().toLinear();
                            var p = Number(x.power);
                            //We'll consider it safe to use the native Number since 2^1000 is already a pretty huge number
                            var rem = p % 2; //get the remainder. This will be 1 if 3 since sqrt(n^2) = n where n is positive
                            var w = (p - rem) / 2; //get the whole numbers of n/2
                            r[i] = _.multiply(r[i], _.pow(b, new Symbol(w)));
                            sq[i] = _.multiply(sq[i], sqrt(_.pow(b, new Symbol(rem))));
                        });
                    }
                    m = _.divide(_.multiply(r[0], sq[0]), _.multiply(r[1], sq[1]));
                }


                //strip the multiplier since we already took the sqrt
                symbol = symbol.toUnitMultiplier(true);
                //if the symbol is one just return one and not the sqrt function
                if(symbol.isOne()) {
                    retval = symbol;
                }
                else if(even(symbol.power.toString())) {
                    //just raise it to the 1/2
                    retval = _.pow(symbol.clone(), new Symbol(0.5));
                }
                else {
                    retval = _.symfunction(SQRT, [symbol]);
                }

                //put back the sign that was removed earlier
                if(sign < 0)
                    retval.power.negate();

                if(m)
                    retval = _.multiply(m, retval);

                if(img)
                    retval = _.multiply(img, retval);
            }

            if(is_negative && Settings.PARSE2NUMBER &&
                retval.text() !== original.text()) {
                return _.parse(retval);
            }

            return retval;
        }

        /**
         * The cube root function
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function cbrt(symbol) {
            if(!symbol.isConstant(true)) {
                var retval;

                var n = symbol.power / 3;
                //take the cube root of the multplier
                var m = _.pow(_.parse(symbol.multiplier), new Symbol(1 / 3));
                //strip the multiplier
                var sym = symbol.toUnitMultiplier();

                //simplify the power
                if(isInt(n)) {
                    retval = _.pow(sym.toLinear(), _.parse(n));
                }
                else {
                    if(sym.group === CB) {
                        retval = new Symbol(1);
                        sym.each(function (x) {
                            retval = _.multiply(retval, cbrt(x));
                        });
                    }
                    else {
                        retval = _.symfunction('cbrt', [sym]);
                    }
                }

                return _.multiply(m, retval);
            }
            return nthroot(symbol, new Symbol(3));
        }

        function scientific(symbol, sigfigs) {
            //Just set the flag and keep it moving. Symbol.toString will deal with how to
            //display this
            symbol.scientific = sigfigs || 10;
            return symbol;
        }

        /**
         *
         * @param {Symbol} num - the number being raised
         * @param {Symbol} p - the exponent
         * @param {type} prec - the precision wanted
         * @param {bool} asbig - true if a bigDecimal is wanted
         * @returns {Symbol}
         */
        function nthroot(num, p, prec, asbig) {
            //clone p and convert to a number if possible
            p = evaluate(_.parse(p));

            //cannot calculate if p = 0. nthroot(0, 0) => 0^(1/0) => undefined
            if(p.equals(0)) {
                throw new UndefinedError('Unable to calculate nthroots of zero');
            }

            //Stop computation if it negative and even since we have an imaginary result
            if(num < 0 && even(p))
                throw new Error('Cannot calculate nthroot of negative number for even powers');

            //return non numeric values unevaluated
            if(!num.isConstant(true)) {
                return _.symfunction('nthroot', arguments);
            }

            //evaluate numeric values
            if(num.group !== N) {
                num = evaluate(num);
            }

            //default is to return a big value
            if(typeof asbig === 'undefined')
                asbig = true;

            prec = prec || 25;

            var sign = num.sign();
            var retval;
            var ans;

            if(sign < 0) {
                num = abs(num); //remove the sign
            }

            if(isInt(num) && p.isConstant()) {

                if(num < 18446744073709551616) {
                    //2^64
                    ans = Frac.create(Math.pow(num, 1 / p));
                }
                else {
                    ans = Math2.nthroot(num, p);
                }

                var retval;
                if(asbig) {
                    retval = new Symbol(ans);
                }
                retval = new Symbol(ans.toDecimal(prec));

                return _.multiply(new Symbol(sign), retval);
            }
        }

        function pfactor(symbol) {
            //Fix issue #458 | nerdamer("sqrt(1-(3.3333333550520926e-7)^2)").evaluate().text()
            //More Big Number issues >:(
            if(symbol.greaterThan(9.999999999998891e+41) || symbol.equals(-1))
                return symbol;
            //Fix issue #298
            if(symbol.equals(Math.PI))
                return new Symbol(Math.PI);
            //evaluate the symbol to merge constants
            symbol = evaluate(symbol.clone());

            if(symbol.isConstant()) {
                var retval = new Symbol(1);
                var m = symbol.toString();
                if(isInt(m)) {
                    var factors = Math2.ifactor(m);
                    for(var factor in factors) {
                        var p = factors[factor];
                        retval = _.multiply(retval, _.symfunction('parens', [new Symbol(factor).setPower(new Frac(p))]));
                    }
                }
                else {
                    var n = pfactor(new Symbol(symbol.multiplier.num));
                    var d = pfactor(new Symbol(symbol.multiplier.den));
                    retval = _.multiply(_.symfunction('parens', [n]), _.symfunction('parens', [d]).invert());
                }
            }
            else
                retval = _.symfunction('pfactor', arguments);
            return retval;
        }

        /**
         * Get's the real part of a complex number. Return number if real
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function realpart(symbol) {
            return symbol.realpart();
        }

        /**
         * Get's the imaginary part of a complex number
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function imagpart(symbol) {
            return symbol.imagpart();
        }

        /**
         * Computes the conjugate of a complex number
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function conjugate(symbol) {
            var re = symbol.realpart();
            var im = symbol.imagpart();
            return _.add(re, _.multiply(im.negate(), Symbol.imaginary()));
        }

        /**
         * Returns the arugment of a complex number
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function arg(symbol) {
            var re = symbol.realpart();
            var im = symbol.imagpart();
            if(re.isConstant() && im.isConstant())
                return new Symbol(Math.atan2(im, re));
            return _.symfunction('atan2', [im, re]);
        }

        /**
         * Returns the arugment of a complex number
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function arg(symbol) {
            var re = symbol.realpart();
            var im = symbol.imagpart();
            if(re.isConstant() && im.isConstant()) {
                // right angles
                if(im.equals(0) && re.equals(1)) {
                    return _.parse('0');
                }
                else if(im.equals(1) && re.equals(0)) {
                    return _.parse('pi/2');
                }
                if(im.equals(0) && re.equals(-1)) {
                    return _.parse('pi');
                }
                else if(im.equals(-1) && re.equals(0)) {
                    return _.parse('-pi/2');
                }

                // 45 degrees
                else if(im.equals(1) && re.equals(1)) {
                    return _.parse('pi/4');
                }
                else if(im.equals(1) && re.equals(-1)) {
                    return _.parse('pi*3/4');
                }
                else if(im.equals(-1) && re.equals(1)) {
                    return _.parse('-pi/4');
                }
                else if(im.equals(-1) && re.equals(-1)) {
                    return _.parse('-pi*3/4');
                }
                
                // all the rest
                return new Symbol(Math.atan2(im, re));
            }
            return _.symfunction('atan2', [im, re]);
        }

        /**
         * Returns the polarform of a complex number
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function polarform(symbol) {
            var p, r, e, theta;
            p = Symbol.toPolarFormArray(symbol);
            theta = p[1];
            r = p[0];
            e = _.parse(format('e^({0}*({1}))', Settings.IMAGINARY, theta));
            return _.multiply(r, e);
        }

        /**
         * Returns the rectangular form of a complex number. Does not work for symbolic coefficients
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function rectform(symbol) {
            //TODO: e^((i*pi)/4)
            var original = symbol.clone();
            try {
                var f, p, q, s, h, d, n;
                f = decompose_fn(symbol, 'e', true);
                p = _.divide(f.x.power, Symbol.imaginary());
                q = evaluate(trig.tan(p));
                s = _.pow(f.a, new Symbol(2));
                d = q.getDenom(true);
                n = q.getNum();
                h = Symbol.hyp(n, d);
                //check
                if(h.equals(f.a)) {
                    return _.add(d, _.multiply(Symbol.imaginary(), n));
                }
                else {
                    return original;
                }
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return original;
            }
        }

        function symMinMax(f, args) {
            args.map(function (x) {
                x.numVal = evaluate(x).multiplier;
            });
            var l, a, b, a_val, b_val;
            while(true) {
                l = args.length;
                if(l < 2)
                    return args[0];
                a = args.pop();
                b = args[l - 2];
                if(f === 'min' ? a.numVal < b.numVal : a.numVal > b.numVal) {
                    args.pop();
                    args.push(a);
                }
            }
        }

        /**
         * Returns maximum of a set of numbers
         * @returns {Symbol}
         */
        function max() {
            var args = [].slice.call(arguments);
            if(allSame(args))
                return args[0];
            if(allNumbers(args))
                return new Symbol(Math.max.apply(null, args));
            if(Settings.SYMBOLIC_MIN_MAX && allConstants(args))
                return symMinMax('max', args);
            return _.symfunction('max', args);
        }

        /**
         * Returns minimum of a set of numbers
         * @returns {Symbol}
         */
        function min() {
            var args = [].slice.call(arguments);
            if(allSame(args))
                return args[0];
            if(allNumbers(args))
                return new Symbol(Math.min.apply(null, args));
            if(Settings.SYMBOLIC_MIN_MAX && allConstants(args))
                return symMinMax('min', args);
            return _.symfunction('min', args);
        }

        /**
         * Returns the sign of a number
         * @param {Symbol} x
         * @returns {Symbol}
         */
        function sign(x) {
            if(x.isConstant(true))
                return new Symbol(Math.sign(evaluate(x)));
            return _.symfunction('sign', arguments);
        }

        function sort(symbol, opt) {
            opt = opt ? opt.toString() : 'asc';
            var getval = function (e) {
                if(e.group === N)
                    return e.multiplier;
                if(e.group === FN) {
                    if(e.fname === '')
                        return getval(e.args[0]);
                    return e.fname;
                }
                if(e.group === S)
                    return e.power;

                return e.value;
            };
            var symbols = isVector(symbol) ? symbol.elements : symbol.collectSymbols();
            return new Vector(symbols.sort(function (a, b) {
                var aval = getval(a),
                        bval = getval(b);
                if(opt === 'desc')
                    return bval - aval;
                return aval - bval;
            }));
        }

        /**
         * The log function
         * @param {Symbol} symbol
         * @param {Symbol} base
         * @returns {Symbol}
         */
        function log(symbol, base) {

            if(symbol.equals(1)) {
                return new Symbol(0);
            }

            var retval;

            if(symbol.fname === SQRT && symbol.multiplier.equals(1)) {
                retval = _.divide(log(symbol.args[0]), new Symbol(2));

                if(symbol.power.sign() < 0) {
                    retval.negate();
                }

                // Exit early
                return retval;
            }

            //log(0) is undefined so complain
            if(symbol.equals(0)) {
                throw new UndefinedError(Settings.LOG + '(0) is undefined!');
            }

            //deal with imaginary values
            if(symbol.isImaginary()) {
                return complex.evaluate(symbol, Settings.LOG);
            }

            if(symbol.isConstant() && typeof base !== 'undefined' && base.isConstant()) {
                var log_sym = Math.log(symbol);
                var log_base = Math.log(base);
                retval = new Symbol(log_sym / log_base);
            }
            else if(symbol.group === EX && symbol.power.multiplier.lessThan(0) || symbol.power.toString() === '-1') {
                symbol.power.negate();
                //move the negative outside but keep the positive inside :)
                retval = log(symbol).negate();
            }
            else if(symbol.value === 'e' && symbol.multiplier.equals(1)) {
                var p = symbol.power;
                retval = isSymbol(p) ? p : new Symbol(p);
            }
            else if(symbol.group === FN && symbol.fname === 'exp') {
                var s = symbol.args[0];
                if(symbol.multiplier.equals(1))
                    retval = _.multiply(s, new Symbol(symbol.power));
                else
                    retval = _.symfunction(Settings.LOG, [symbol]);
            }
            else if(Settings.PARSE2NUMBER && isNumericSymbol(symbol)) {
                // Parse for safety.
                symbol = _.parse(symbol);

                var img_part;
                if(symbol.multiplier.lessThan(0)) {
                    symbol.negate();
                    img_part = _.multiply(new Symbol(Math.PI), new Symbol('i'));
                }

                retval = new Symbol(Math.log(symbol.multiplier.toDecimal()));

                if(img_part) {
                    retval = _.add(retval, img_part);
                }

            }
            else {
                var s;
                if(!symbol.power.equals(1) && !symbol.contains('e') && symbol.multiplier.isOne()) {
                    s = symbol.group === EX ? symbol.power : new Symbol(symbol.power);
                    symbol.toLinear();
                }
                //log(a,a) = 1 since the base is allowed to be changed.
                //This was pointed out by Happypig375 in issue #280
                if(arguments.length > 1 && allSame(arguments)) {
                    retval = new Symbol(1);
                }
                else {
                    retval = _.symfunction(Settings.LOG, arguments);
                }

                if(s) {
                    retval = _.multiply(s, retval);
                }
            }

            return retval;
        }

        /**
         * Round a number up to s decimal places
         * @param {Number} x
         * @param {int} s - the number of decimal places
         * @returns {undefined}
         */
        function round(x, s) {
            var sIsConstant = s && s.isConstant() || typeof s === 'undefined';
            if(x.isConstant() && sIsConstant) {
                var v, e, exp, retval;
                v = x;
                //round the coefficient of then number but not the actual decimal value
                //we know this because a negative number was passed
                if(s && s.lessThan(0)) {
                    s = abs(s);
                    //convert the number to exponential form
                    e = Number(x).toExponential().toString().split('e');
                    //point v to the coefficient of then number
                    v = e[0];
                    //set the expontent
                    exp = e[1];
                }
                //round the number to the requested precision
                retval = new Symbol(nround(v, Number(s || 0)));
                //if there's a exponent then put it back
                return _.multiply(retval, _.pow(new Symbol(10), new Symbol(exp || 0)))
            }


            return _.symfunction('round', arguments);
        }

        /**
         * Gets the quadrant of the trig function
         * @param {Frac} m
         * @returns {Int}
         */
        function getQuadrant(m) {
            var v = m % 2, quadrant;

            if(v < 0)
                v = 2 + v; //put it in terms of pi

            if(v >= 0 && v <= 0.5)
                quadrant = 1;
            else if(v > 0.5 && v <= 1)
                quadrant = 2;
            else if(v > 1 && v <= 1.5)
                quadrant = 3;
            else
                quadrant = 4;
            return quadrant;
        }

        /*
         * Serves as a bridge between numbers and bigNumbers
         * @param {Frac|Number} n
         * @returns {Symbol}
         */
        function bigConvert(n) {
            if(!isFinite(n)) {
                var sign = Math.sign(n);
                var r = new Symbol(String(Math.abs(n)));
                r.multiplier = r.multiplier.multiply(new Frac(sign));
                return r;
            }
            if(isSymbol(n))
                return n;
            if(typeof n === 'number') {
                try {
                    n = Frac.simple(n);
                }
                catch(e) {
                    if (e.message === "timeout") throw e;
                    n = new Frac(n);
                }
            }

            var symbol = new Symbol(0);
            symbol.multiplier = n;
            return symbol;
        }
        ;

        function clean(symbol) {
            // handle functions with numeric values
            // handle denominator within denominator
            // handle trig simplifications
            var g = symbol.group, retval;
            //Now let's get to work
            if(g === CP) {
                var num = symbol.getNum(),
                        den = symbol.getDenom() || new Symbol(1),
                        p = Number(symbol.power),
                        factor = new Symbol(1);
                if(Math.abs(p) === 1) {
                    den.each(function (x) {
                        if(x.group === CB) {
                            factor = _.multiply(factor, clean(x.getDenom()));
                        }
                        else if(x.power.lessThan(0)) {
                            factor = _.multiply(factor, clean(x.clone().toUnitMultiplier()));
                        }
                    });

                    var new_den = new Symbol(0);
                    //now divide out the factor and add to new den
                    den.each(function (x) {
                        new_den = _.add(_.divide(x, factor.clone()), new_den);
                    });

                    factor.invert(); //invert so it can be added to the top
                    var new_num;
                    if(num.isComposite()) {
                        new_num = new Symbol(0);
                        num.each(function (x) {
                            new_num = _.add(_.multiply(clean(x), factor.clone()), new_num);
                        });
                    }
                    else
                        new_num = _.multiply(factor, num);

                    retval = _.divide(new_num, new_den);
                }
            }
            else if(g === CB) {
                retval = new Symbol(1);
                symbol.each(function (x) {
                    retval = _.multiply(retval, _.clean(x));
                });
            }
            else if(g === FN) {
                if(symbol.args.length === 1 && symbol.args[0].isConstant())
                    retval = block('PARSE2NUMBER', function () {
                        return _.parse(symbol);
                    }, true);
            }

            if(!retval)
                retval = symbol;

            return retval;
        }

        /**
         * A wrapper for the expand function
         * @param {Symbol} symbol
         * @returns {Symbol}
         */
        function expandall(symbol, opt) {
            opt = opt || {
                expand_denominator: true,
                expand_functions: true
            };
            return expand(symbol, opt);
        }
        /**
         * Expands a symbol
         * @param symbol
         */
        // Old expand
        function expand(symbol, opt) {
            if(Array.isArray(symbol)) {
                return symbol.map(function (x) {
                    return expand(x, opt);
                });
            }
            if (symbol.expand) {
                return symbol.expand(opt);
            }
            opt = opt || {};
            //deal with parenthesis
            if(symbol.group === FN && symbol.fname === '') {
                var f = expand(symbol.args[0], opt);
                var x = expand(_.pow(f, _.parse(symbol.power)), opt);
                return _.multiply(_.parse(symbol.multiplier), x).distributeMultiplier();
            }
            // We cannot expand these groups so no need to waste time. Just return and be done.
            if([N, P, S].indexOf(symbol.group) !== -1) {
                return symbol; //nothing to do
            }

            var original = symbol.clone();

            // Set up a try-catch block. If anything goes wrong then we simply return the original symbol
            try {
                // Store the power and multiplier
                var m = symbol.multiplier.toString();
                var p = Number(symbol.power);
                var retval = symbol;

                // Handle (a+b)^2 | (x+x^2)^2
                if(symbol.isComposite() && isInt(symbol.power) && symbol.power > 0) {
                    var n = p - 1;
                    // Strip the expression of it's multiplier and power. We'll call it f. The power will be p and the multiplier m.
                    var f = new Symbol(0);

                    symbol.each(function (x) {
                        f = _.add(f, expand(_.parse(x), opt));
                    });

                    var expanded = _.parse(f);

                    for(var i = 0; i < n; i++) {
                        expanded = mix(expanded, f, opt);
                    }

                    retval = _.multiply(_.parse(m), expanded).distributeMultiplier();
                }
                else if(symbol.group === FN && opt.expand_functions === true) {
                    var args = [];
                    // Expand function the arguments
                    symbol.args.forEach(function (x) {
                        args.push(expand(x, opt));
                    });
                    // Put back the power and multiplier
                    retval = _.pow(_.symfunction(symbol.fname, args), _.parse(symbol.power));
                    retval = _.multiply(retval, _.parse(symbol.multiplier));
                }
                else if(symbol.isComposite() && isInt(symbol.power) && symbol.power < 0 && opt.expand_denominator === true) {
                    // Invert it. Expand it and then re-invert it.
                    symbol = symbol.invert();
                    retval = expand(symbol, opt);
                    retval.invert();
                }
                else if(symbol.group === CB) {
                    var rank = function (s) {
                        switch(s.group) {
                            case CP:
                                return 0;
                            case PL:
                                return 1;
                            case CB:
                                return 2;
                            case FN:
                                return 3;
                            default:
                                return 4;
                        }
                    };
                    // Consider (a+b)(c+d). The result will be (a*c+a*d)+(b*c+b*d).
                    // We start by moving collecting the symbols. We want others>FN>CB>PL>CP
                    var symbols = symbol.collectSymbols().sort(function (a, b) {
                        return rank(b) - rank(a);
                    })
                            // Distribute the power to each symbol and expand
                            .map(function (s) {
                                var x = _.pow(s, _.parse(p));
                                var e = expand(x, opt);
                                return e;
                            });

                    var f = symbols.pop();

                    // If the first symbols isn't a composite then we're done
                    if(f.isComposite() && f.isLinear()) {
                        symbols.forEach(function (s) {
                            f = mix(f, s, opt);
                        });

                        // If f is of group PL or CP then we can expand some more
                        if(f.isComposite()) {
                            if(f.power > 1) {
                                f = expand(_.pow(f, _.parse(f.power)), opt);
                            }
                            // Put back the multiplier
                            retval = _.multiply(_.parse(m), f).distributeMultiplier();
                            ;
                        }
                        else {
                            // Everything is expanded at this point so if it's still a CB
                            // then just return the symbol
                            retval = f;
                        }
                    }
                    else {
                        // Just multiply back in the expanded form of each
                        retval = f;
                        symbols.forEach(function (s) {
                            retval = _.multiply(retval, s);
                        });
                        // Put back the multiplier
                        retval = _.multiply(retval, _.parse(m)).distributeMultiplier();
                    }

                    // TODO: This exists solely as a quick fix for sqrt(11)*sqrt(33) not simplifying.
                    if(retval.group === CB) {
                        retval = _.parse(retval);
                    }
                }
                else {
                    // Otherwise just return the expression
                    retval = symbol;
                }
                // Final cleanup and return
                return retval;
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return original;
            }

            return original;
        }

        /**
         * Returns an identity matrix of nxn
         * @param {Number} n
         * @returns {Matrix}
         */
        function imatrix(n) {
            return Matrix.identity(n);
        }

        /**
         * Retrieves and item from a vector
         * @param {Vector} vector
         * @param {Number} index
         * @returns {Vector|Symbol}
         */
        function vecget(vector, index) {
            if(index.isConstant() && isInt(index))
                return vector.elements[index];
            return _.symfunction('vecget', arguments);
        }

        /**
         * Removes duplicates from a vector
         * @param {Vector} vector
         * @param {Number} tolerance
         * @returns {Vector}
         */
        function vectrim(vector, tolerance) {
            tolerance = typeof tolerance === 'undefined' ? 1e-14 : tolerance;

            vector = vector.clone();

            tolerance = Number(tolerance);
            //place algebraic solutions first
            vector.elements.sort(function (a, b) {
                return b.group - a.group;
            });
            //depending on the start point we may have duplicates so we need to clean those up a bit.
            //start by creating an object with the solution and the numeric value. This way we don't destroy algebraic values
            vector.elements = removeDuplicates(vector.elements, function (a, b) {
                var diff = Number(_.subtract(evaluate(a), evaluate(b)).abs());
                return diff <= tolerance;
            });

            return vector;
        }

        /**
         * Set a value for a vector at a given index
         * @param {Vector} vector
         * @param {Number} index
         * @param {Symbol} value
         * @returns {Vector}
         */
        function vecset(vector, index, value) {
            if(!index.isConstant)
                return _.symfunction('vecset', arguments);
            vector.elements[index] = value;
            return vector;
        }

        function matget(matrix, i, j) {
            if(i.isConstant() && j.isConstant())
                return matrix.elements[i][j];
            return _.symfunction('matget', arguments);
        }

        function matgetrow(matrix, i) {
            if(i.isConstant())
                return new Matrix(matrix.elements[i]);
            return _.symfunction('matgetrow', arguments);
        }

        function matsetrow(matrix, i, x) {
            //handle symbolics
            if(!i.isConstant())
                return _.symfunction('matsetrow', arguments);
            if(matrix.elements[i].length !== x.elements.length)
                throw new DimensionError('Matrix row must match row dimensions!');
            var M = matrix.clone();
            M.elements[i] = x.clone().elements;
            return M;
        }

        function matgetcol(matrix, col_index) {
            //handle symbolics
            if(!col_index.isConstant())
                return _.symfunction('matgetcol', arguments);
            col_index = Number(col_index);
            var M = Matrix.fromArray([]);
            matrix.each(function (x, i, j) {
                if(j === col_index) {
                    M.elements.push([x.clone()]);
                }
            });
            return M;
        }

        function matsetcol(matrix, j, col) {
            //handle symbolics
            if(!j.isConstant())
                return _.symfunction('matsetcol', arguments);
            j = Number(j);
            if(matrix.rows() !== col.elements.length)
                throw new DimensionError('Matrix column length must match number of rows!');
            col.each(function (x, i) {
                matrix.set(i - 1, j, x.elements[0].clone());
            });
            return matrix;
        }


        function matset(matrix, i, j, value) {
            matrix.elements[i][j] = value;
            return matrix;
        }

        //the constructor for vectors
        function vector() {
            return new Vector([].slice.call(arguments));
        }

        //the constructor for matrices
        function matrix() {
            return Matrix.fromArray(arguments);
        }

        //the constructor for sets
        function set() {
            return Set.fromArray(arguments);
        }

        function determinant(symbol) {
            if(isMatrix(symbol)) {
                return symbol.determinant();
            }
            return symbol;
        }

        function size(symbol) {
            var retval;
            if(isMatrix(symbol))
                retval = [new Symbol(symbol.cols()), new Symbol(symbol.rows())];
            else if(isVector(symbol) || isSet(symbol))
                retval = new Symbol(symbol.elements.length);
            else
                err('size expects a matrix or a vector');
            return retval;
        }

        function dot(vec1, vec2) {
            if (isMatrix(vec1)) {
                vec1 = new Vector(vec1);
            }
            if (isMatrix(vec2)) {
                vec2 = new Vector(vec2);
            }
            
            if(isVector(vec1) && isVector(vec2))
                return vec1.dot(vec2);

            return _.multiply(vec1.clone(), vec2.clone());
            // err('function dot expects 2 vectors');
        }

        function cross(vec1, vec2) {
            if (isMatrix(vec1)) {
                vec1 = new Vector(vec1);
            }
            if (isMatrix(vec2)) {
                vec2 = new Vector(vec2);
            }
            
            if(isVector(vec1) && isVector(vec2))
                return vec1.cross(vec2);

            return _.multiply(vec1.clone(), vec2.clone());
            // err('function cross expects 2 vectors');
        }

        function transpose(mat) {
            if(isMatrix(mat))
                return mat.transpose();
            err('function transpose expects a matrix');
        }

        function invert(mat) {
            if(isMatrix(mat))
                return mat.invert();
            err('invert expects a matrix');
        }

        //basic set functions
        function union(set1, set2) {
            return set1.union(set2);
        }

        function intersection(set1, set2) {
            return set1.intersection(set2);
        }

        function contains(set1, e) {
            return set1.contains(e);
        }

        function difference(set1, set2) {
            return set1.difference(set2);
        }

        function intersects(set1, set2) {
            return new Symbol(Number(set1.intersects(set2)));
        }

        function is_subset(set1, set2) {
            return new Symbol(Number(set1.is_subset(set2)));
        }

        function print() {
            arguments2Array(arguments).map(function (x) {
                console.log(x.toString());
            });
        }

        function testSQRT(symbol) {
            //wrap the symbol in sqrt. This eliminates one more check down the line.
            if(!isSymbol(symbol.power) && symbol.power.absEquals(0.5)) {
                var sign = symbol.power.sign();
                //don't devide the power directly. Notice the use of toString. This makes it possible
                //to use a bigNumber library in the future
                var retval = sqrt(symbol.group === P ? new Symbol(symbol.value) : symbol.toLinear());
                //place back the sign of the power
                if(sign < 0)
                    retval.invert();
                return retval;
            }
            return symbol;
        }

        //try to reduce a symbol by pulling its power
        function testPow(symbol) {
            if(symbol.group === P) {
                var v = symbol.value;

                var fct = primeFactors(v)[0];

                //safety
                if(!fct) {
                    warn('Unable to compute prime factors. This should not happen. Please review and report.');
                    return symbol;
                }

                var n = new Frac(Math.log(v) / Math.log(fct)),
                        p = n.multiply(symbol.power);

                //we don't want a more complex number than before
                if(p.den > symbol.power.den)
                    return symbol;

                if(isInt(p))
                    symbol = Symbol(Math.pow(fct, p));
                else
                    symbol = new Symbol(fct).setPower(p);
            }

            return symbol;
        }

        //Link the functions to the parse so they're available outside of the library.
        //This is strictly for convenience and may be deprecated.
        this.expand = expand;
        this.round = round;
        this.clean = clean;
        this.sqrt = sqrt;
        this.cbrt = cbrt;
        this.abs = abs;
        this.log = log;
        this.rationalize = rationalize;
        this.nthroot = nthroot;
        this.arg = arg;
        this.conjugate = conjugate;
        this.imagpart = imagpart;
        this.realpart = realpart;

        //TODO:
        //Utilize the function below instead of the linked function
        this.getFunction = function (name) {
            return functions[name][0];
        };

//Parser.methods ===============================================================
        this.addPreprocessor = function (name, action, order, shift_cells) {
            var names = preprocessors.names;
            var actions = preprocessors.actions;
            if((typeof action !== 'function')) //the person probably forgot to specify a name
                throw new PreprocessorError('Incorrect parameters. Function expected!');
            if(!order) {
                names.push(name);
                actions.push(action);
            }
            else {
                if(shift_cells) {
                    names.splice(order, 0, name);
                    actions.splice(order, 0, action);
                }
                else {
                    names[order] = name;
                    actions[order] = action;
                }
            }
        };

        this.getPreprocessors = function () {
            var preprocessors = {};
            for(var i = 0, l = preprocessors.names.length; i < l; i++) {
                var name = preprocessors.names[i];
                preprocessors[name] = {
                    order: i,
                    action: preprocessors.actions[i]
                };
            }
            return preprocessors;
        };

        this.removePreprocessor = function (name, shift_cells) {
            var i = preprocessors.names.indexOf(name);
            if(shift_cells) {
                remove(preprocessors.names, i);
                remove(preprocessors.actions, i);
            }
            else {
                preprocessors.names[i] = undefined;
                preprocessors.actions[i] = undefined;
            }
        };

        //The loader for functions which are not part of Math2
        this.mapped_function = function () {
            var subs = {},
                    params = this.params;

            for(var i = 0; i < params.length; i++) {
                subs[params[i]] = String(arguments[i]);
            }

            return _.parse(this.body, subs);
        };
        /**
         * Adds two symbols
         * @param {Symbol} a
         * @param {Symbol} b
         * @returns {Symbol}
         */
        this.add = function (a, b) {
            var aIsSymbol = isSymbol(a),
                    bIsSymbol = isSymbol(b);
            //we're dealing with two symbols
            if(aIsSymbol && bIsSymbol) {
                //forward the adding of symbols with units to the Unit module
                if(a.unit || b.unit) {
                    return _.Unit.add(a, b);
                }
                //handle Infinity
                //https://www.encyclopediaofmath.org/index.php/Infinity
                if(a.isInfinity || b.isInfinity) {
                    var aneg = a.multiplier.lessThan(0),
                            bneg = b.multiplier.lessThan(0);

                    if(a.isInfinity && b.isInfinity && aneg !== bneg) {
                        throw new UndefinedError('(' + a + ')+(' + b + ') is not defined!');
                    }

                    var inf = Symbol.infinity();
                    if(bneg)
                        inf.negate();
                    return inf;
                }

                if(a.isComposite() && a.isLinear() && b.isComposite() && b.isLinear()) {
                    a.distributeMultiplier();
                    b.distributeMultiplier();
                    // Fix for issue #606
                    if(b.length > a.length && a.group === b.group) {
                        [a, b] = [b, a];
                    }
                }
                
                //no need to waste time on zeroes
                if(a.multiplier.equals(0))
                    return b;
                if(b.multiplier.equals(0))
                    return a;

                if(a.isConstant() && b.isConstant() && Settings.PARSE2NUMBER) {
                    var result = new Symbol(a.multiplier.add(b.multiplier).toDecimal(Settings.PRECISION));
                    return result;
                }

                var g1 = a.group,
                        g2 = b.group,
                        ap = a.power.toString(),
                        bp = b.power.toString();

                //always keep the greater group on the left.
                if(g1 < g2 || (g1 === g2 && ap > bp && bp > 0)) {
                    return this.add(b, a);
                }

                /*note to self: Please don't forget about this dilemma ever again. In this model PL and CB goes crazy
                 * because it doesn't know which one to prioritize. */
                //correction to PL dilemma
                if(g1 === CB && g2 === PL && a.value === b.value) {
                    //swap
                    var t = a;
                    a = b;
                    b = t;
                    g1 = a.group;
                    g2 = b.group;
                    ap = a.power.toString();
                    bp = b.power.toString();
                }

                var powEQ = ap === bp,
                        v1 = a.value,
                        v2 = b.value,
                        aIsComposite = a.isComposite(),
                        bIsComposite = b.isComposite(),
                        h1, h2, result;

                if(aIsComposite)
                    h1 = text(a, 'hash');
                if(bIsComposite)
                    h2 = text(b, 'hash');

                if(g1 === CP && g2 === CP && b.isLinear() && !a.isLinear() && h1 !== h2) {
                    return this.add(b, a);
                }

                //PL & PL should compare hashes and not values e.g. compare x+x^2 with x+x^3 and not x with x
                if(g1 === PL && g2 === PL) {
                    v1 = h1;
                    v2 = h2;
                }

                var PN = g1 === P && g2 === N,
                        PNEQ = a.value === b.multiplier.toString(),
                        valEQ = (v1 === v2 || h1 === h2 && h1 !== undefined || (PN && PNEQ));

                //equal values, equal powers
                if(valEQ && powEQ && g1 === g2) {
                    //make sure to convert N to something P can work with
                    if(PN)
                        b = b.convert(P);//CL

                    //handle PL
                    if(g1 === PL && (g2 === S || g2 === P)) {
                        a.distributeMultiplier();
                        result = a.attach(b);
                    }
                    else {
                        result = a;//CL
                        if(a.multiplier.isOne() && b.multiplier.isOne() && g1 === CP && a.isLinear() && b.isLinear()) {
                            for(var s in b.symbols) {
                                var x = b.symbols[s];
                                result.attach(x);
                            }
                        }
                        else
                            result.multiplier = result.multiplier.add(b.multiplier);
                    }
                }
                //equal values uneven powers
                else if(valEQ && g1 !== PL) {
                    //break the tie for e.g. (x+1)+((x+1)^2+(x+1)^3)
                    if(g1 === CP && g2 === PL) {
                        b.insert(a, 'add');
                        result = b;
                    }
                    else {
                        result = Symbol.shell(PL).attach([a, b]);
                        //update the hash
                        result.value = g1 === PL ? h1 : v1;
                    }
                }
                else if(aIsComposite && a.isLinear()) {
                    var canIterate = g1 === g2,
                            bothPL = g1 === PL && g2 === PL;

                    //we can only iterate group PL if they values match
                    if(bothPL)
                        canIterate = a.value === b.value;
                    //distribute the multiplier over the entire symbol
                    a.distributeMultiplier();

                    if(b.isComposite() && b.isLinear() && canIterate) {
                        b.distributeMultiplier();
                        //CL
                        for(var s in b.symbols) {
                            var x = b.symbols[s];
                            a.attach(x);
                        }
                        result = a;
                    }
                    //handle cases like 2*(x+x^2)^2+2*(x+x^2)^3+4*(x+x^2)^2
                    else if(bothPL && a.value !== h2 || g1 === PL && !valEQ) {
                        result = Symbol.shell(CP).attach([a, b]);
                        result.updateHash();

                    }
                    else {
                        result = a.attach(b);
                    }
                }
                else {
                    if(g1 === FN && a.fname === SQRT && g2 !== EX && b.power.equals(0.5)) {
                        var m = b.multiplier.clone();
                        b = sqrt(b.toUnitMultiplier().toLinear());
                        b.multiplier = m;
                    }
                    //fix for issue #3 and #159
                    if(a.length === 2 && b.length === 2 && even(a.power) && even(b.power)) {
                        result = _.add(expand(a), expand(b));
                    }
                    else {
                        result = Symbol.shell(CP).attach([a, b]);
                        result.updateHash();
                    }
                }

                if(result.multiplier.equals(0))
                    result = new Symbol(0);

                //make sure to remove unnecessary wraps
                if(result.length === 1) {
                    var m = result.multiplier;
                    result = firstObject(result.symbols);
                    result.multiplier = result.multiplier.multiply(m);
                }

                return result;
            }
            else {
                //keep symbols to the right
                if(bIsSymbol && !aIsSymbol) {
                    var t = a;
                    a = b;
                    b = t; //swap
                    t = bIsSymbol;
                    bIsSymbol = aIsSymbol;
                    aIsSymbol = t;
                }

                var bIsMatrix = isMatrix(b);

                if(aIsSymbol && bIsMatrix) {
                    var M = new Matrix();
                    b.eachElement(function (e, i, j) {
                        M.set(i, j, _.add(a.clone(), e));
                    });

                    b = M
                }
                else {
                    if(isMatrix(a) && bIsMatrix) {
                        b = a.add(b);
                    }
                    else if(aIsSymbol && isVector(b)) {
                        b.each(function (x, i) {
                            i--;
                            b.elements[i] = _.add(a.clone(), b.elements[i]);
                        });
                    }
                    else {
                        if(isVector(a) && isVector(b)) {
                            b.each(function (x, i) {
                                i--;
                                b.elements[i] = _.add(a.elements[i], b.elements[i]);
                            });
                        }
                        else if(isVector(a) && isMatrix(b)) {
                            //try to convert a to a matrix
                            return _.add(b, a);
                        }
                        else if(isMatrix(a) && isVector(b)) {
                            if(b.elements.length === a.rows()) {
                                var M = new Matrix(), l = a.cols();
                                b.each(function (e, i) {
                                    var row = [];
                                    if (isVector(e)) {
                                        for(var j = 0; j < l; j++) {
                                            row.push(_.add(a.elements[i - 1][j].clone(), e.elements[j].clone()));
                                        }
                                    } else {
                                        for(var j = 0; j < l; j++) {
                                            row.push(_.add(a.elements[i - 1][j].clone(), e.clone()));
                                        }
                                    }
                                    M.elements.push(row);
                                });
                                return M;
                            }
                            else
                                err('Dimensions must match!');
                        }
                    }
                }
                return b;
            }

        };
        /**
         * Gets called when the parser finds the - operator. Not the prefix operator. See this.add
         * @param {Symbol} a
         * @param {Symbol} b
         * @returns {Symbol}
         */
        this.subtract = function (a, b) {
            var aIsSymbol = aIsSymbol = isSymbol(a),
                    bIsSymbol = isSymbol(b), t;

            if(aIsSymbol && bIsSymbol) {
                if(a.unit || b.unit) {
                    return _.Unit.subtract(a, b);
                }
                return this.add(a, b.negate());
            }
            else {
                if(bIsSymbol && isVector(a)) {
                    b = a.map(function (x) {
                        return _.subtract(x, b.clone());
                    });
                }
                else if(aIsSymbol && isVector(b)) {
                    b = b.map(function (x) {
                        return _.subtract(a.clone(), x);
                    });
                }
                else if((isVector(a) && isVector(b)) || (isCollection(a) && isCollection(b))) {
                    if(a.dimensions() === b.dimensions())
                        b = a.subtract(b);
                    else
                        _.error('Unable to subtract vectors/collections. Dimensions do not match.');
                }
                else if(isMatrix(a) && isVector(b)) {
                    if(b.elements.length === a.rows()) {
                        var M = new Matrix(), l = a.cols();
                        b.each(function (e, i) {
                            var row = [];
                            for(var j = 0; j < l; j++) {
                                row.push(_.subtract(a.elements[i - 1][j].clone(), e.clone()));
                            }
                            M.elements.push(row);
                        });
                        return M;
                    }
                    else
                        err('Dimensions must match!');
                }
                else if(isVector(a) && isMatrix(b)) {
                    var M = b.clone().negate();
                    return _.add(M, a);
                }
                else if(isMatrix(a) && isMatrix(b)) {
                    b = a.subtract(b);
                }
                else if(isMatrix(a) && bIsSymbol) {
                    var M = new Matrix();
                    a.each(function (x, i, j) {
                        M.set(i, j, _.subtract(x, b.clone()));
                    });
                    b = M;
                }
                else if(aIsSymbol && isMatrix(b)) {
                    var M = new Matrix();
                    b.each(function (x, i, j) {
                        M.set(i, j, _.subtract(a.clone(), x));
                    });
                    b = M;
                }
                return b;
            }
        };
        /**
         * Gets called when the parser finds the * operator. See this.add
         * @param {Symbol} a
         * @param {Symbol} b
         * @returns {Symbol}
         */
        this.multiply = function (a, b) {
            var aIsSymbol = isSymbol(a),
                    bIsSymbol = isSymbol(b);
            //we're dealing with function assignment here
            if(aIsSymbol && b instanceof Collection) {
                b.elements.push(a);
                return b;
            }
            if(aIsSymbol && bIsSymbol) {
                //if it has a unit then add it and return it right away.
                if(b.isUnit) {
                    var result = a.clone();
                    a.unit = b;
                    return result;
                }
                
                //if it has units then just forward that problem to the unit module
                if(a.unit || b.unit) {
                    return _.Unit.multiply(a, b);
                }

                //handle Infinty
                if(a.isInfinity || b.isInfinity) {
                    if(a.equals(0) || b.equals(0))
                        throw new UndefinedError(a + '*' + b + ' is undefined!');
                    //x/infinity
                    if(b.power.lessThan(0)) {
                        if(!a.isInfinity) {
                            return new Symbol(0);
                        }
                        else {
                            throw new UndefinedError('Infinity/Infinity is not defined!');
                        }
                    }

                    var sign = a.multiplier.multiply(b.multiplier).sign(),
                            inf = Symbol.infinity();
                    if(a.isConstant() || b.isConstant() || (a.isInfinity && b.isInfinity)) {
                        if(sign < 0)
                            inf.negate();

                        return inf;
                    }
                }

                //the quickies
                if(a.multiplier.equals(0) || b.multiplier.equals(0))
                    return new Symbol(0);

                if(a.isOne()) {
                    return b.clone();
                }
                if(b.isOne()) {
                    return a.clone();
                }

                // now we know that neither is 0
                if(a.isConstant() && b.isConstant() && Settings.PARSE2NUMBER) {
                    let retval;
                    const ad = new bigDec(a.multiplier.toDecimal());
                    const bd = new bigDec(b.multiplier.toDecimal());
                    if (ad.isZero() || bd.isZero()) {
                        // we shouldn't be here - there was a precision underflow.
                        // go the long way round to multiply these two (presumed) fractions
                        const anum = new bigDec(String(a.multiplier.num));
                        const aden = new bigDec(String(a.multiplier.den));
                        const bnum = new bigDec(String(b.multiplier.num));
                        const bden = new bigDec(String(b.multiplier.den));
                        retval = new Symbol(anum.times(bnum).dividedBy(aden).dividedBy(bden));
                    } else {
                        // the original code. still don't know why toFixed()
                        var t = ad.times(bd).toFixed();
                        retval = new Symbol(t);
                    }
                    return retval;
                }

                if(b.group > a.group && !(b.group === CP))
                    return this.multiply(b, a);
                //correction for PL/CB dilemma
                if(a.group === CB && b.group === PL && a.value === b.value) {
                    var t = a;
                    a = b;
                    b = t;//swap
                }

                var g1 = a.group,
                        g2 = b.group,
                        bnum = b.multiplier.num,
                        bden = b.multiplier.den;

                if(g1 === FN && a.fname === SQRT && !b.isConstant() && a.args[0].value === b.value && !a.args[0].multiplier.lessThan(0)) {
                    //unwrap sqrt
                    var a_pow = a.power;
                    var a_multiplier = _.parse(a.multiplier);
                    a = _.multiply(a_multiplier, a.args[0].clone());
                    a.setPower(new Frac(0.5).multiply(a_pow));
                    g1 = a.group;
                }
                //simplify n/sqrt(n). Being very specific
                else if(g1 === FN && a.fname === SQRT && a.multiplier.equals(1) && a.power.equals(-1) && b.isConstant() && a.args[0].equals(b)) {
                    a = _.symfunction(SQRT, [b.clone()]);
                    b = new Symbol(1);
                }
                ;

                var v1 = a.value,
                        v2 = b.value,
                        sign = new Frac(a.sign()),
                        //since P is just a morphed version of N we need to see if they relate
                        ONN = (g1 === P && g2 === N && b.multiplier.equals(a.value)),
                        //don't multiply the multiplier of b since that's equal to the value of a
                        m = ONN ? new Frac(1).multiply(a.multiplier).abs() : a.multiplier.multiply(b.multiplier).abs(),
                        result = a.clone().toUnitMultiplier();
                b = b.clone().toUnitMultiplier(true);

                //further simplification of sqrt
                if(g1 === FN && g2 === FN) {
                    var u = a.args[0].clone();
                    var v = b.args[0].clone();
                    if(a.fname === SQRT && b.fname === SQRT && a.isLinear() && b.isLinear()) {

                        var q = _.divide(u, v).invert();
                        if(q.gt(1) && isInt(q)) {
                            //b contains a factor a which can be moved to a
                            result = _.multiply(a.args[0].clone(), sqrt(q.clone()));
                            b = new Symbol(1);
                        }
                    }
                    //simplify factorial but only if
                    //1 - It's division so b will have a negative power
                    //2 - We're not dealing with factorials of numbers
                    else if(a.fname === FACTORIAL && b.fname === FACTORIAL && !u.isConstant() && !v.isConstant() && b.power < 0) {
                        //assume that n = positive
                        var d = _.subtract(u.clone(), v.clone());

                        //if it's not numeric then we don't know if we can simplify so just return
                        if(d.isConstant()) {

                            //there will never be a case where d == 0 since this will already have
                            //been handled at the beginning of this function
                            t = new Symbol(1);
                            if(d < 0) {
                                //If d is negative then the numerator is larger so expand that
                                for(var i = 0, n = Math.abs(d); i <= n; i++) {
                                    var s = _.add(u.clone(), new Symbol(i));
                                    t = _.multiply(t, s);
                                }

                                result = _.multiply(_.pow(u, new Symbol(a.power)), _.pow(t, new Symbol(b.power)));

                                b = new Symbol(1);
                            }
                            else {
                                //Otherwise the denominator is larger so expand that
                                for(var i = 0, n = Math.abs(d); i <= n; i++) {
                                    var s = _.add(v.clone(), new Symbol(i));
                                    t = _.multiply(t, s);
                                }

                                result = _.multiply(_.pow(t, new Symbol(a.power)), _.pow(v, new Symbol(b.power)));

                                b = new Symbol(1);
                            }
                        }
                    }
                }


                //if both are PL then their hashes have to match
                if(v1 === v2 && g1 === PL && g1 === g2) {
                    v1 = a.text('hash');
                    v2 = b.text('hash');
                }

                //same issue with (x^2+1)^x*(x^2+1)
                //EX needs an exception when multiplying because it needs to recognize
                //that (x+x^2)^x has the same hash as (x+x^2). The latter is kept as x
                if(g2 === EX && b.previousGroup === PL && g1 === PL) {
                    v1 = text(a, 'hash', EX);
                }

                if((v1 === v2 || ONN) && !(g1 === PL && (g2 === S || g2 === P || g2 === FN)) && !(g1 === PL && g2 === CB)) {
                    var p1 = a.power,
                            p2 = b.power,
                            isSymbolP1 = isSymbol(p1),
                            isSymbolP2 = isSymbol(p2),
                            toEX = (isSymbolP1 || isSymbolP2);
                    //TODO: this needs cleaning up
                    if(g1 === PL && g2 !== PL && b.previousGroup !== PL && p1.equals(1)) {
                        result = new Symbol(0);
                        a.each(function (x) {
                            result = _.add(result, _.multiply(x, b.clone()));
                        }, true);
                    }
                    else {
                        //add the powers
                        result.power = toEX ? _.add(
                                !(isSymbol(p1)) ? new Symbol(p1) : p1,
                                !(isSymbol(p2)) ? new Symbol(p2) : p2
                                ) : (g1 === N /*don't add powers for N*/ ? p1 : p1.add(p2));

                        //eliminate zero power values and convert them to numbers
                        if(result.power.equals(0))
                            result = result.convert(N);

                        //properly convert to EX
                        if(toEX)
                            result.convert(EX);

                        //take care of imaginaries
                        if(a.imaginary && b.imaginary) {
                            var isEven = even(result.power % 2);
                            if(isEven) {
                                result = new Symbol(1);
                                m.negate();
                            }
                        }

                        //cleanup: this causes the LaTeX generator to get confused as to how to render the symbol
                        if(result.group !== EX && result.previousGroup)
                            result.previousGroup = undefined;
                        //the sign for b is floating around. Remember we are assuming that the odd variable will carry
                        //the sign but this isn't true if they're equals symbols
                        result.multiplier = result.multiplier.multiply(b.multiplier);
                    }
                }
                else if(g1 === CB && a.isLinear()) {
                    if(g2 === CB)
                        b.distributeExponent();
                    if(g2 === CB && b.isLinear()) {
                        for(var s in b.symbols) {
                            var x = b.symbols[s];
                            result = result.combine(x);
                        }
                        result.multiplier = result.multiplier.multiply(b.multiplier);
                    }
                    else {
                        result.combine(b);
                    }
                }
                else {
                    //the multiplier was already handled so nothing left to do
                    if(g1 !== N) {
                        if(g1 === CB) {
                            result.distributeExponent();
                            result.combine(b);
                        }
                        else if(!b.isOne()) {
                            var bm = b.multiplier.clone();
                            b.toUnitMultiplier();
                            result = Symbol.shell(CB).combine([result, b]);
                            //transfer the multiplier to the outside
                            result.multiplier = result.multiplier.multiply(bm);
                        }
                    }
                    else {
                        result = b.clone().toUnitMultiplier(true);
                    }
                }

                if(result.group === P) {
                    var logV = Math.log(result.value),
                            n1 = Math.log(bnum) / logV,
                            n2 = Math.log(bden) / logV,
                            ndiv = m.num / bnum,
                            ddiv = m.den / bden;
                    //we don't want to divide by zero no do we? Strange things happen.
                    if(n1 !== 0 && isInt(n1) && isInt(ndiv)) {
                        result.power = result.power.add(new Frac(n1));
                        m.num /= bnum; //BigInt? Keep that in mind for the future.
                    }
                    if(n2 !== 0 && isInt(n2) && isInt(ddiv)) {
                        result.power = result.power.subtract(new Frac(n2));
                        m.den /= bden; //BigInt? Keep that in mind for the future.
                    }
                }

                //unpack CB if length is only one
                if(result.length === 1) {
                    var t = result.multiplier;
                    //transfer the multiplier
                    result = firstObject(result.symbols);
                    result.multiplier = result.multiplier.multiply(t);
                }

                //reduce square root
                var ps = result.power.toString();
                if(even(ps) && result.fname === SQRT) {
                    //grab the sign of the symbol
                    sign = sign * result.sign();
                    var p = result.power;
                    result = result.args[0];
                    result = _.multiply(new Symbol(m), _.pow(result, new Symbol(p.divide(new Frac(2)))));
                    //flip it back to the correct sign
                    if(sign < 0)
                        result.negate()
                }
                else {
                    result.multiplier = result.multiplier.multiply(m).multiply(sign);
                    if(result.group === CP && result.isImaginary())
                        result.distributeMultiplier();
                }

                //back convert group P to a simpler group N if possible
                if(result.group === P && isInt(result.power.toDecimal()))
                    result = result.convert(N);

                return result;
            }
            else {
                //****** Matrices & Vector *****//
                if(bIsSymbol && !aIsSymbol) { //keep symbols to the right
                    t = a;
                    a = b;
                    b = t; //swap
                    t = bIsSymbol;
                    bIsSymbol = aIsSymbol;
                    aIsSymbol = t;
                }

                var isMatrixB = isMatrix(b), isMatrixA = isMatrix(a);
                if(aIsSymbol && isMatrixB) {
                    var M = new Matrix();
                    b.eachElement(function (e, i, j) {
                        M.set(i, j, _.multiply(a.clone(), e));
                    });

                    b = M;
                }
                else {
                    if(isMatrixA && isMatrixB) {
                        b = a.multiply(b);
                    }
                    else if(aIsSymbol && isVector(b)) {
                        b.each(function (x, i) {
                            i--;
                            b.elements[i] = _.multiply(a.clone(), b.elements[i]);
                        });
                    }
                    else {
                        if(isVector(a) && isVector(b)) {
                            b.each(function (x, i) {
                                i--;
                                b.elements[i] = _.multiply(a.elements[i], b.elements[i]);
                            });
                        }
                        else if(isVector(a) && isMatrix(b)) {
                            //try to convert a to a matrix
                            return this.multiply(b, a);
                        }
                        else if(isMatrix(a) && isVector(b)) {
                            if(b.elements.length === a.rows()) {
                                var M = new Matrix(), l = a.cols();
                                b.each(function (e, i) {
                                    var row = [];
                                    for(var j = 0; j < l; j++) {
                                        row.push(_.multiply(a.elements[i - 1][j].clone(), e.clone()));
                                    }
                                    M.elements.push(row);
                                });
                                return M;
                            }
                            else
                                err('Dimensions must match!');
                        }
                    }
                }

                return b;
            }
        };
        /**
         * Gets called when the parser finds the / operator. See this.add
         * @param {Symbol} a
         * @param {Symbol} b
         * @returns {Symbol}
         */
        this.divide = function (a, b) {
            var aIsSymbol = isSymbol(a),
                    bIsSymbol = isSymbol(b);

            if(aIsSymbol && bIsSymbol) {
                //forward to Unit division
                if(a.unit || b.unit) {
                    return _.Unit.divide(a, b);
                }
                var result;
                if(b.equals(0))
                    throw new DivisionByZero('Division by zero not allowed!');

                if(a.isConstant() && b.isConstant()) {
                    result = a.clone();
                    result.multiplier = result.multiplier.divide(b.multiplier);
                }
                else {
                    b.invert();
                    result = _.multiply(a, b);
                }
                return result;
            }
            else {
                //******* Vectors & Matrices *********//
                var isVectorA = isVector(a), isVectorB = isVector(b);
                if(aIsSymbol && isVectorB) {
                    b = b.map(function (x) {
                        return _.divide(a.clone(), x);
                    });
                }
                else if(isVectorA && bIsSymbol) {
                    b = a.map(function (x) {
                        return _.divide(x, b.clone());
                    });
                }
                else if(isVectorA && isVectorB) {
                    if(a.dimensions() === b.dimensions()) {
                        b = b.map(function (x, i) {
                            return _.divide(a.elements[--i], x);
                        });
                    }
                    else
                        _.error('Cannot divide vectors. Dimensions do not match!');
                }
                else {
                    var isMatrixA = isMatrix(a), isMatrixB = isMatrix(b);
                    if(isMatrixA && bIsSymbol) {
                        var M = new Matrix();
                        a.eachElement(function (x, i, j) {
                            M.set(i, j, _.divide(x, b.clone()));
                        });
                        b = M;
                    }
                    else if(aIsSymbol && isMatrixB) {
                        var M = new Matrix();
                        b.eachElement(function (x, i, j) {
                            M.set(i, j, _.divide(a.clone(), x));
                        });
                        b = M;
                    }
                    else if(isMatrixA && isMatrixB) {
                        var M = new Matrix();
                        if(a.rows() === b.rows() && a.cols() === b.cols()) {
                            a.eachElement(function (x, i, j) {
                                M.set(i, j, _.divide(x, b.elements[i][j]));
                            });
                            b = M;
                        }
                        else {
                            _.error('Dimensions do not match!');
                        }
                    }
                    else if(isMatrixA && isVectorB) {
                        if(a.cols() === b.dimensions()) {
                            var M = new Matrix();
                            a.eachElement(function (x, i, j) {
                                M.set(i, j, _.divide(x, b.elements[i].clone()));
                            });
                            b = M;
                        }
                        else {
                            _.error('Unable to divide matrix by vector.');
                        }
                    }
                }
                return b;
            }
        };
        /**
         * Gets called when the parser finds the ^ operator. See this.add
         * @param {Symbol} a
         * @param {Symbol} b
         * @returns {Symbol}
         */
        this.pow = function (a, b) {
            var aIsSymbol = isSymbol(a),
                    bIsSymbol = isSymbol(b);
            if(aIsSymbol && bIsSymbol) {
                //it has units then it's the Unit module's problem
                if(a.unit || b.unit) {
                    return _.Unit.pow(a, b);
                }
                
                // Handle abs
                if(a.group === FN && a.fname === ABS && even(b)) {
                    var m = a.multiplier.clone();
                    var raised = _.pow(a.args[0], b);
                    raised.multiplier = m;
                    return raised;
                }
                
                // Handle infinity
                if(a.isInfinity || b.isInfinity) {
                    if(a.isInfinity && b.isInfinity)
                        throw new UndefinedError('(' + a + ')^(' + b + ') is undefined!');

                    if(a.isConstant() && b.isInfinity) {
                        if(a.equals(0)) {
                            if(b.lessThan(0))
                                throw new UndefinedError('0^Infinity is undefined!');
                            return new Symbol(0);
                        }
                        if(a.equals(1))
                            throw new UndefinedError('1^' + b.toString() + ' is undefined!');
                        //a^-oo
                        if(b.lessThan(0))
                            return new Symbol(0);
                        //a^oo
                        if(!a.lessThan(0))
                            return Symbol.infinity();
                    }

                    if(a.isInfinity && b.isConstant()) {
                        if(b.equals(0))
                            throw new UndefinedError(a + '^0 is undefined!');
                        if(b.lessThan(0))
                            return new Symbol(0);
                        return _.multiply(Symbol.infinity(), _.pow(new Symbol(a.sign()), b.clone()));
                    }
                }

                var aIsZero = a.equals(0);
                var bIsZero = b.equals(0);
                if(aIsZero && bIsZero)
                    throw new UndefinedError('0^0 is undefined!');

                // Return 0 right away if possible
                if(aIsZero && b.isConstant() && b.multiplier.greaterThan(0))
                    return new Symbol(0);

                if(bIsZero)
                    return new Symbol(1);

                var bIsConstant = b.isConstant(),
                        aIsConstant = a.isConstant(),
                        bIsInt = b.isInteger(),
                        m = a.multiplier,
                        result = a.clone();

                // 0^0, 1/0, etc. Complain.
                if(aIsConstant && bIsConstant && a.equals(0) && b.lessThan(0))
                    throw new UndefinedError('Division by zero is not allowed!');

                // Compute imaginary numbers right away
                if(Settings.PARSE2NUMBER && aIsConstant && bIsConstant && a.sign() < 0 && evenFraction(b)) {
                    var k, re, im;
                    k = Math.PI * b;
                    re = new Symbol(Math.cos(k));
                    im = _.multiply(Symbol.imaginary(), new Symbol(Math.sin(k)));
                    return _.add(re, im);
                }

                // Imaginary number under negative nthroot or to the n
                if(Settings.PARSE2NUMBER && a.isImaginary() && bIsConstant && isInt(b) && !b.lessThan(0)) {
                    var re, im, r, theta, nre, nim, phi;
                    re = a.realpart();
                    im = a.imagpart();
                    if(re.isConstant('all') && im.isConstant('all')) {
                        phi = Settings.USE_BIG ? Symbol(bigDec.atan2(i.multiplier.toDecimal(), r.multiplier.toDecimal()).times(b.toString())) : Math.atan2(im, re) * b;
                        theta = new Symbol(phi);
                        r = _.pow(Symbol.hyp(re, im), b);
                        nre = _.multiply(r.clone(), _.trig.cos(theta.clone()));
                        nim = _.multiply(r, _.trig.sin(theta));
                        return _.add(nre, _.multiply(Symbol.imaginary(), nim));
                    }
                }

                // Take care of the symbolic part
                result.toUnitMultiplier();
                //simpifly sqrt
                if(result.group === FN && result.fname === SQRT && !bIsConstant) {
                    var s = result.args[0];
                    s.multiplyPower(new Symbol(0.5));
                    s.multiplier.multiply(result.multiplier);
                    s.multiplyPower(b);
                    result = s;
                }
                else {
                    var sign = m.sign();
                    //handle cases such as (-a^3)^(1/4)
                    if(evenFraction(b) && sign < 0) {
                        // Swaperoo
                        // First put the sign back on the symbol
                        result.negate();
                        // Wrap it in brackets
                        result = _.symfunction(PARENTHESIS, [result]);
                        // Move the sign back the exterior and let nerdamer handle the rest
                        result.negate();
                    }

                    result.multiplyPower(b);
                }

                if(aIsConstant && bIsConstant && Settings.PARSE2NUMBER) {
                    var c;
                    //remove the sign
                    if(sign < 0) {
                        a.negate();
                        if(b.multiplier.den.equals(2))
                            //we know that the numerator has to be odd and therefore it's i
                            c = new Symbol(Settings.IMAGINARY);
                        else if(isInt(b.multiplier)) {
                            if(even(b.multiplier))
                                c = new Symbol(1);
                            else
                                c = new Symbol(-1);
                        }
                        else if(!even(b.multiplier.den)) {
                            c = new Symbol(Math.pow(sign, b.multiplier.num));
                        }
                        else {
                            c = _.pow(_.symfunction(PARENTHESIS, [new Symbol(sign)]), b.clone());
                        }
                    }

                    const _pow = Math.pow(a.multiplier.toDecimal(), b.multiplier.toDecimal());
                    if (_pow !== 0 || a.multiplier.equals(0)) {
                        result = new Symbol(_pow);
                    } else {
                        // should not be here, must have underflowed precision
                        const ad = new bigDec(a.multiplier.toDecimal());
                        const bd = new bigDec(b.multiplier.toDecimal());
                        result = new Symbol(ad.pow(bd).toFixed());
                    }
                    //put the back sign
                    if(c)
                        result = _.multiply(result, c);
                }
                else if(bIsInt && !m.equals(1)) {
                    var abs_b = b.abs();
                    // Provide fall back to JS until big number implementation is improved
                    if(abs_b.gt(Settings.MAX_EXP)) {
                        if(b.sign() < 0)
                            return new Symbol(0);
                        return Symbol.infinity();
                    }
                    else {
                        var p = b.multiplier.toDecimal();
                        var sgn = Math.sign(p);
                        p = Math.abs(p);
                        var multiplier = new Frac(1);
                        multiplier.num = m.num.pow(p);
                        multiplier.den = m.den.pow(p);
                        if(sgn < 0)
                            multiplier.invert();
                        //multiplying is justified since after mulltiplyPower if it was of group P it will now be of group N
                        result.multiplier = result.multiplier.multiply(multiplier);
                    }
                }
                else {
                    var sign = a.sign();
                    if(b.isConstant() && a.isConstant() && !b.multiplier.den.equals(1) && sign < 0) {
                        //we know the sign is negative so if the denominator for b == 2 then it's i
                        if(b.multiplier.den.equals(2)) {
                            var i = new Symbol(Settings.IMAGINARY);
                            a.negate();//remove the sign
                            //if the power is negative then i is negative
                            if(b.lessThan(0)) {
                                i.negate();
                                b.negate();//remove the sign from the power
                            }
                            //pull the power normally and put back the imaginary
                            result = _.multiply(_.pow(a, b), i);
                        }
                        else {
                            var aa = a.clone();
                            aa.multiplier.negate();
                            result = _.pow(_.symfunction(PARENTHESIS, [new Symbol(sign)]), b.clone());
                            var _a = _.pow(new Symbol(aa.multiplier.num), b.clone());
                            var _b = _.pow(new Symbol(aa.multiplier.den), b.clone());
                            var r = _.divide(_a, _b);
                            result = _.multiply(result, r);
                        }
                    }
                    else if(Settings.PARSE2NUMBER && b.isImaginary()) {
                        //4^(i + 2) = e^(- (2 - 4 i) π n + (2 + i) log(4))

                        var re = b.realpart();
                        var im = b.imagpart();
                        /*
                         if(b.group === CP && false) {
                         var ex = _.pow(a.clone(), re);
                         var xi = _.multiply(_.multiply(ex.clone(), trig.sin(im.clone())), Symbol.imaginary());
                         var xa = _.multiply(trig.cos(im), ex);
                         result = _.add(xi, xa);
                         }
                         else {
                         */
                        var aa = a.clone().toLinear();
                        var a1 = _.pow(aa.clone(), re);
                        var log_a = log(aa.clone());
                        var b1 = trig.cos(_.multiply(im.clone(), log_a));
                        var c1 = _.multiply(trig.sin(_.multiply(im, log(aa))), Symbol.imaginary());
                        result = _.multiply(a1, _.add(b1, c1));
                        result = _.expand(_.parse(result));
                        /*
                         }   
                         */
                    }
                    else {
                        //b is a symbol
                        var neg_num = a.group === N && sign < 0,
                            num = testSQRT(new Symbol(neg_num ? m.num : Math.abs(m.num)).setPower(b.clone())),
                            den = testSQRT(new Symbol(m.den).setPower(b.clone()).invert());

                        //eliminate imaginary if possible
                        if(a.imaginary) {
                            if(bIsInt) {
                                var s, p, n;
                                s = Math.sign(b);
                                p = abs(b);
                                n = p % 4;
                                result = new Symbol(even(n) ? -1 : Settings.IMAGINARY);
                                if(n === 0 || s < 0 && (n === 1) || s > 0 && (n === 3)) {
                                    result.negate();
                                }
                            }
                            else {
                                //assume i = sqrt(-1) -> (-1)^(1/2)
                                var nr = b.multiplier.multiply(Frac.quick(1, 2)),
                                        //the denominator denotes the power so raise to it. It will turn positive it round
                                        tn = Math.pow(-1, nr.num);
                                result = even(nr.den) ? new Symbol(-1).setPower(nr, true) : new Symbol(tn);
                            }
                        }
                        //ensure that the sign is carried by the symbol and not the multiplier
                        //this enables us to check down the line if the multiplier can indeed be transferred
                        if(sign < 0 && !neg_num)
                            result.negate();

                        //retain the absolute value
                        if(bIsConstant && a.group !== EX) {
                            var evenr = even(b.multiplier.den),
                                    evenp = even(a.power),
                                    n = result.power.toDecimal(),
                                    evennp = even(n);
                            if(evenr && evenp && !evennp) {
                                if(n === "1" || n === 1){
                                    // check for together.math baseunits
                                    // don't have to wrap them in abs()
                                    if (typeof result.value !== "string" ||
                                        !result.value.startsWith("baseunit_")) {
                                        result = _.symfunction(ABS, [result]);
                                    }
                                }
                                else if(!isInt(n)) {
                                    var p = result.power;
                                    result = _.symfunction(ABS, [result.toLinear()]).setPower(p);
                                }
                                else {
                                    result = _.multiply(_.symfunction(ABS, [result.clone().toLinear()]),
                                            result.clone().setPower(new Frac(n - 1)));
                                }
                                //quick workaround. Revisit
                                if(Settings.POSITIVE_MULTIPLIERS && result.fname === ABS)
                                    result = result.args[0];
                            }
                        }
                        //multiply out sqrt
                        if(b.equals(2) && result.group === CB) {
                            var _result = new Symbol(1);
                            result.each(function (sym) {
                                _result = _.multiply(_result, _.pow(sym, b));
                            });
                            result = _result;
                        }
                    }
                }

                result = testSQRT(result);

                // Don't multiply until we've tested the remaining symbol
                if(num && den) {
                    result = _.multiply(result, testPow(_.multiply(num, den)));
                }

                // Reduce square root
                if(result.fname === SQRT) {
                    var isEX = result.group === EX;
                    var t = isEX ? result.power.multiplier.toString() : result.power.toString();
                    if(even(t)) {
                        var pt = isEX ? _.divide(result.power, new Symbol(2)) : new Symbol(result.power.divide(new Frac(2))),
                                m = result.multiplier;
                        result = _.pow(result.args[0], pt);
                        result.multiplier = result.multiplier.multiply(m);
                    }
                }
                // Detect Euler's identity
                else if(!Settings.IGNORE_E && result.isE() && result.group === EX && result.power.contains('pi')
                        && result.power.contains(Settings.IMAGINARY) && b.group === CB) {
                    var theta = b.stripVar(Settings.IMAGINARY);
                    result = _.add(trig.cos(theta), _.multiply(Symbol.imaginary(), trig.sin(theta)));
                }

                return result;
            }
            else {
                if(isVector(a) && bIsSymbol) {
                    a = a.map(function (x) {
                        return _.pow(x, b.clone());
                    });
                }
                else if(isMatrix(a) && bIsSymbol) {
                    var M = new Matrix();
                    a.eachElement(function (x, i, j) {
                        M.set(i, j, _.pow(x, b.clone()));
                    });
                    a = M;
                }
                else if(aIsSymbol && isMatrix(b)) {
                    var M = new Matrix();
                    b.eachElement(function (x, i, j) {
                        M.set(i, j, _.pow(a.clone(), x));
                    });
                    a = M;
                }
                return a;
            }
        };
        // Gets called when the parser finds the , operator.
        // Commas return a Collector object which is roughly an array
        this.comma = function (a, b) {
            if(!(a instanceof Collection))
                a = Collection.create(a);
            a.append(b);
            return a;
        };
        // Link to modulus
        this.mod = function (a, b) {
            return mod(a, b);
        };
        // Used to slice elements from arrays
        this.slice = function (a, b) {
            return new Slice(a, b);
        };
        // The equality setter
        this.equals = function (a, b) {
            // Equality can only be set for group S so complain it's not
            if(a.group !== S && !a.isLinear())
                err('Cannot set equality for ' + a.toString());
            VARS[a.value] = b.clone();
            return b;
        };
        // Percent
        this.percent = function (a) {
            return _.divide(a, new Symbol(100));
        };
        // Set variable
        this.assign = function (a, b) {
            if(a instanceof Collection && b instanceof Collection) {
                a.elements.map(function (x, i) {
                    return _.assign(x, b.elements[i]);
                });
                return Vector.fromArray(b.elements);
            }
            if(a.parent) {
                // It's referring to the parent instead. The current item can be discarded
                var e = a.parent;
                e.elements[e.getter] = b;
                delete e.getter;
                return e;
            }

            if(a.group !== S)
                throw new NerdamerValueError('Cannot complete operation. Incorrect LH value for ' + a);
            VARS[a.value] = b;
            return b;
        };
        this.function_assign = function (a, b) {
            var f = a.elements.pop();
            return setFunction(f, a.elements, b);
        };
        // Function to quickly convert bools to Symbols
        var bool2Symbol = function (x) {
            return new Symbol(x === true ? 1 : 0);
        };
        //check for equality
        this.eq = function (a, b) {
            return bool2Symbol(a.equals(b));
        };
        //checks for greater than
        this.gt = function (a, b) {
            return bool2Symbol(a.gt(b));
        };
        //checks for greater than equal
        this.gte = function (a, b) {
            return bool2Symbol(a.gte(b));
        };
        //checks for less than
        this.lt = function (a, b) {
            return bool2Symbol(a.lt(b));
        };
        //checks for less than equal
        this.lte = function (a, b) {
            return bool2Symbol(a.lte(b));
        };
        // wraps the factorial
        this.factorial = function (a) {
            return this.symfunction(FACTORIAL, [a]);
        };
        // wraps the double factorial
        this.dfactorial = function (a) {
            return this.symfunction(DOUBLEFACTORIAL, [a]);
        };
    }
    ;

    /* "STATIC" */
    // converts a number to a fraction.
    var Fraction = {
        /**
         * Converts a decimal to a fraction
         * @param {number} value
         * @param {object} opts
         * @returns {Array} - an array containing the denominator and the numerator
         */
        convert: function (value, opts) {
            var frac;
            if(value === 0) {
                frac = [0, 1];
            }
            else {
                if(value < 1e-6 || value > 1e20) {
                    var qc = this.quickConversion(Number(value));
                    if(qc[1] <= 1e20) {
                        var abs = Math.abs(value);
                        var sign = value / abs;
                        frac = this.fullConversion(abs.toFixed((qc[1] + '').length - 1));
                        frac[0] = frac[0] * sign;
                    }
                    else {
                        frac = qc;
                    }
                }
                else {
                    frac = this.fullConversion(value);
                }
            }
            return frac;
        },
        /**
         * If the fraction is too small or too large this gets called instead of fullConversion method
         * @param {number} dec
         * @returns {Array} - an array containing the denominator and the numerator
         */
        quickConversion: function (value) {
            var stripSign = function (s) {
                // Explicitely convert to a string
                if(typeof s !== 'string') {
                    s = s.toString();
                }

                var sign = '';

                // Remove and store the sign
                var start = s.charAt(0);
                if(start === '-') {
                    s = s.substr(1, s.length);
                    sign = '-';
                }
                else if(start === '+') {
                    // Just remove the plus sign
                    s = s.substr(1, s.length);
                }

                return {
                    sign: sign,
                    value: s
                };
            };


            function convert(value) {
                // Explicitely convert to a decimal
                if(Scientific.isScientific(value)) {
                    value = scientificToDecimal(value);
                }

                // Split the value into the sign and the value
                var nparts = stripSign(value);

                // Split it at the decimal. We'll refer to it as the coeffient parts
                var cparts = nparts.value.split('.');

                // Combine the entire number by removing leading zero and adding the decimal part
                // This would be teh same as moving the decimal point to the end
                var num;
                // We're dealing with integers
                if(cparts.length === 1) {
                    num = cparts[0];
                }
                else {
                    num = cparts[0] + cparts[1];
                }
                var n = cparts[1] ? cparts[1].length : 0;
                // Generate the padding for the zeros
                var den = `1${'0'.repeat(n)}`;

                if(num !== '0') {
                    num = num.replace(/^0+/, '');
                }
                return [nparts.sign + num, den];
            }

            return convert(value);
        },
        /**
         * Returns a good approximation of a fraction. This method gets called by convert
         * http://mathforum.org/library/drmath/view/61772.html
         * Decimal To Fraction Conversion - A Simpler Version
         * Dr Peterson
         * @param {number} dec
         * @returns {Array} - an array containing the denominator and the numerator
         */
        fullConversion: function (dec) {
            var done = false;
            // you can adjust the epsilon to a larger number if you don't need very high precision
            var n1 = 0, d1 = 1, n2 = 1, d2 = 0, n = 0, q = dec, epsilon = 1e-16;
            while(!done) {
                n++;
                if(n > 10000) {
                    done = true;
                }
                var a = Math.floor(q);
                var num = n1 + a * n2;
                var den = d1 + a * d2;
                var e = (q - a);
                if(e < epsilon) {
                    done = true;
                }
                q = 1 / e;
                n1 = n2;
                d1 = d2;
                n2 = num;
                d2 = den;
                if(Math.abs(num / den - dec) < epsilon || n > 30) {
                    done = true;
                }
            }
            return [num, den];
        }
    };
    //Depends on Fraction

    //The latex generator
    var LaTeX = {
        parser: (function () {
            // create a parser and strip it from everything except the items that you need
            var keep = ['classes', 'setOperator', 'getOperators', 'getBrackets', 'tokenize', 'toRPN', 'tree', 'units'];
            var parser = new Parser();
            for(var x in parser) {
                if(keep.indexOf(x) === -1)
                    delete parser[x];
            }
            // declare the operators
            parser.setOperator({
                precedence: 8,
                operator: '\\',
                action: 'slash',
                prefix: true,
                postfix: false,
                leftAssoc: true,
                operation: function (e) {
                    return e; // bypass the slash
                }
            });
            parser.setOperator({
                precedence: 8,
                operator: '\\,',
                action: 'slash_comma',
                prefix: true,
                postfix: false,
                leftAssoc: true,
                operation: function (e) {
                    return e; // bypass the slash
                }
            });
            // have braces not map to anything. We want them to be return as-is
            var brackets = parser.getBrackets();
            brackets['{'].maps_to = undefined;
            return parser;
        })(),
        space: '~',
        dot: ' \\cdot ',
        // grab a list of supported functions but remove the excluded ones found in exclFN

        latex: function (symbol, option) {
            // it might be an array
            if(symbol.clone) {
                symbol = symbol.clone(); // leave original as-is
            }
            if(symbol instanceof _.classes.Collection)
                symbol = symbol.elements;

            if(isArray(symbol)) {
                var LaTeXArray = [];
                for(var i = 0; i < symbol.length; i++) {
                    var sym = symbol[i];
                    //This way I can generate LaTeX on an array of strings.
                    if(!isSymbol(sym))
                        sym = _.parse(sym);
                    LaTeXArray.push(this.latex(sym, option));
                }
                return this.brackets(LaTeXArray.join(', '), 'square');
            }

            else if(isMatrix(symbol)) {
                var TeX = '\\begin{pmatrix}\n';
                for(var i = 0; i < symbol.elements.length; i++) {
                    var rowTeX = [],
                            e = symbol.elements[i];
                    for(var j = 0; j < e.length; j++) {
                        rowTeX.push(this.latex(e[j], option));
                    }
                    TeX += rowTeX.join(' & ');
                    if(i < symbol.elements.length - 1) {
                        TeX += '\\\\\n';
                    }
                }
                TeX += '\\end{pmatrix}';
                return TeX;
            }

            else if(isVector(symbol)) {
                var TeX = '\\left[';
                for(var i = 0; i < symbol.elements.length; i++) {
                    TeX += this.latex(symbol.elements[i], option) + ' ' + (i !== symbol.elements.length - 1 ? ',\\,' : '');
                }
                TeX += '\\right]';
                return TeX;
            }

            else if(isSet(symbol)) {
                var TeX = '\\{';
                for(var i = 0; i < symbol.elements.length; i++) {
                    TeX += this.latex(symbol.elements[i], option) + ' ' + (i !== symbol.elements.length - 1 ? ',\\,' : '');
                }
                TeX += '\\}';
                return TeX;
            }

            symbol = symbol.clone();

            var decimal = (option === 'decimal' || option === 'decimals'),
                    power = symbol.power,
                    invert = isNegative(power),
                    negative = symbol.multiplier.lessThan(0);

            if(symbol.group === P && decimal) {
                return String(symbol.multiplier.toDecimal() * Math.pow(symbol.value, symbol.power.toDecimal()));
            }
            else {
                symbol.multiplier = symbol.multiplier.abs();

                // if the user wants the result in decimal format then return it as such by placing it at the top part
                var m_array;

                if(decimal) {
                    var m = String(symbol.multiplier.toDecimal());
                    // if(String(m) === '1' && !decimal) m = '';
                    m_array = [m, ''];
                }
                else {
                    m_array = [symbol.multiplier.num, symbol.multiplier.den];
                }
                // get the value as a two part array
                var v_array = this.value(symbol, invert, option, negative),
                        p;
                // make it all positive since we know whether to push the power to the numerator or denominator already.
                if(invert)
                    power.negate();
                // the power is simple since it requires no additional formatting. We can get it to a
                // string right away. pass in true to neglect unit powers
                if(decimal) {
                    p = isSymbol(power) ? LaTeX.latex(power, option) : String(power.toDecimal());
                    if(String(p) === '1')
                        p = '';
                }
                // get the latex representation
                else if(isSymbol(power))
                    p = this.latex(power, option);
                // get it as a fraction
                else
                    p = this.formatFrac(power, true);
                // use this array to specify if the power is getting attached to the top or the bottom
                var p_array = ['', ''],
                        // stick it to the top or the bottom. If it's negative then the power gets placed on the bottom
                        index = invert ? 1 : 0;
                p_array[index] = p;

                // special case group P and decimal
                var retval = (negative ? '-' : '') + this.set(m_array, v_array, p_array, symbol.group === CB);

                return retval.replace(/\+\-/gi, '-');
            }

        },
        // greek mapping
        greek: {
            alpha: '\\alpha',
            beta: '\\beta',
            gamma: '\\gamma',
            delta: '\\delta',
            epsilon: '\\epsilon',
            zeta: '\\zeta',
            eta: '\\eta',
            theta: '\\theta',
            iota: '\\iota',
            kappa: '\\kappa',
            lambda: '\\lambda',
            mu: '\\mu',
            nu: '\\nu',
            xi: '\\xi',
            omnikron: '\\omnikron',
            pi: '\\pi',
            rho: '\\rho',
            sigma: '\\sigma',
            tau: '\\tau',
            upsilon: '\\upsilon',
            phi: '\\phi',
            chi: '\\chi',
            psi: '\\psi',
            omega: '\\omega',
            Gamma: '\\Gamma',
            Delta: '\\Delta',
            Epsilon: '\\Epsilon',
            Theta: '\\Theta',
            Lambda: '\\Lambda',
            Xi: '\\Xi',
            Pi: '\\Pi',
            Sigma: '\\Sigma',
            Phi: '\\Phi',
            Psi: '\\Psi',
            Omega: '\\Omega'
        },
        symbols: {
            arccos: '\\arccos',
            cos: '\\cos',
            csc: '\\csc',
            exp: '\\exp',
            ker: '\\ker',
            limsup: '\\limsup',
            min: '\\min',
            sinh: '\\sinh',
            arcsin: '\\arcsin',
            cosh: '\\cosh',
            deg: '\\deg',
            gcd: '\\gcd',
            lg: '\\lg',
            ln: '\\ln',
            Pr: '\\Pr',
            sqrt: '\\sqrt',
            sup: '\\sup',
            arctan: '\\arctan',
            cot: '\\cot',
            det: '\\det',
            hom: '\\hom',
            lim: '\\lim',
            log: '\\log',
            LN: '\\LN',
            sec: '\\sec',
            tan: '\\tan',
            arg: '\\arg',
            coth: '\\coth',
            dim: '\\dim',
            inf: '\\inf',
            liminf: '\\liminf',
            max: '\\max',
            sin: '\\sin',
            tanh: '\\tanh'
        },
        // get the raw value of the symbol as an array
        value: function (symbol, inverted, option, negative) {
            var group = symbol.group,
                    previousGroup = symbol.previousGroup,
                    v = ['', ''],
                    index = inverted ? 1 : 0;
            /*if(group === N) // do nothing since we want to return top & bottom blank; */
            if(symbol.isInfinity) {
                v[index] = '\\infty';
            }
            else if(group === S || group === P || previousGroup === S || previousGroup === P || previousGroup === N) {
                var value = this.formatSubscripts(symbol.value);
                if(value.replace)
                    value = value.replace(/(.+)_$/, '$1\\_');
                // split it so we can check for instances of alpha as well as alpha_b
                var t_varray = String(value).split('_');
                var greek = this.greek[t_varray[0]];
                if(greek) {
                    t_varray[0] = greek;
                    value = t_varray.join('_');
                }
                var symbol = this.symbols[t_varray[0]];
                if(symbol) {
                    t_varray[0] = symbol;
                    value = t_varray.join('_');
                }
                v[index] = value;
            }
            else if(group === FN || previousGroup === FN) {
                var name,
                        input = [],
                        fname = symbol.fname;
                // collect the arguments
                for(var i = 0; i < symbol.args.length; i++) {
                    var arg = symbol.args[i], item;
                    if(typeof arg === 'string')
                        item = arg;
                    else {
                        item = this.latex(arg, option);
                    }
                    input.push(item);
                }

                if(fname === SQRT) {
                    v[index] = '\\sqrt' + this.braces(input.join(','));
                }
                else if(fname === ABS) {
                    v[index] = this.brackets(input.join(','), 'abs');
                }
                else if(fname === PARENTHESIS) {
                    v[index] = this.brackets(input.join(','), 'parens');
                }
                else if(fname === 'limit') {
                    v[index] = ' \\lim\\limits_{' + input[1] + ' \\to ' + input[2] + '} ' + input[0];
                }
                else if(fname === 'integrate') {
                    v[index] = '\\int' + this.braces(input[0]) + this.braces('d' + input[1]);
                }
                else if(fname === 'defint') {
                    v[index] = '\\int\\limits_' + this.braces(input[1]) + '^' + this.braces(input[2]) + ' ' + input[0] + ' d' + input[3];
                }
                else if(fname === FACTORIAL || fname === DOUBLEFACTORIAL) {
                    var arg = symbol.args[0];
                    if(arg.power.equals(1) && (arg.isComposite() || arg.isCombination())) {
                        input[0] = this.brackets(input[0]);
                    }
                    v[index] = input[0] + (fname === FACTORIAL ? '!' : '!!');
                }
                else if(fname === 'floor') {
                    v[index] = '\\left \\lfloor' + this.braces(input[0]) + '\\right \\rfloor';
                }
                else if(fname === 'ceil') {
                    v[index] = '\\left \\lceil' + this.braces(input[0]) + '\\right \\rceil';
                }
                // capture log(a, b)
                else if(fname === Settings.LOG && input.length > 1) {
                    v[index] = '\\mathrm' + this.braces(Settings.LOG) + '_' + this.braces(input[1]) + this.brackets(input[0]);
                }
                // capture log(a, b)
                else if(fname === Settings.LOG10) {
                    v[index] = '\\mathrm' + this.braces(Settings.LOG) + '_' + this.braces(10) + this.brackets(input[0]);
                }
                else if(fname === 'sum') {
                    var a = input[0],
                            b = input[1],
                            c = input[2],
                            d = input[3];
                    v[index] = '\\sum\\limits_{' + this.braces(b) + '=' + this.braces(c) + '}^' + this.braces(d) + ' ' + this.braces(a) + '';
                }
                else if(fname === 'product') {
                    var a = input[0],
                            b = input[1],
                            c = input[2],
                            d = input[3];
                    v[index] = '\\prod\\limits_{' + this.braces(b) + '=' + this.braces(c) + '}^' + this.braces(d) + ' ' + this.braces(a) + '';
                }
                else if(fname === 'nthroot') {
                    v[index] = '\\sqrt[' + input[1] + ']' + this.braces(input[0]);
                }
                else if(fname === 'mod') {
                    v[index] = input[0] + ' \\bmod ' + input[1];
                }
                else if(fname === 'realpart') {
                    v[index] = '\\operatorname{Re}' + this.brackets(input[0]);
                }
                else if(fname === 'imagpart') {
                    v[index] = '\\operatorname{Im}' + this.brackets(input[0]);
                }
                else {
                    var name = fname !== '' ? '\\mathrm' + this.braces(fname.replace(/_/g, '\\_')) : '';
                    if(symbol.isConversion)
                        v[index] = name + this.brackets(input.join(''), 'parens');
                    else
                        v[index] = name + this.brackets(input.join(','), 'parens');
                }
            }
            else if(symbol.isComposite()) {
                var collected = symbol.collectSymbols().sort(
                        group === CP || previousGroup === CP ?
                        function (a, b) {
                            return b.group - a.group;
                        } :
                        function (a, b) {
                            var x = isSymbol(a.power) ? -1 : a.power;
                            var y = isSymbol(b.power) ? -1 : b.power;
                            return y - x;
                        }
                ),
                        symbols = [],
                        l = collected.length;
                for(var i = 0; i < l; i++) {
                    symbols.push(LaTeX.latex(collected[i], option));
                }
                var value = symbols.join('+');

                v[index] = !(symbol.isLinear() && symbol.multiplier.equals(1)) || negative ? this.brackets(value, 'parens') : value;
            }
            else if(group === CB || previousGroup === EX || previousGroup === CB) {
                if(group === CB)
                    symbol.distributeExponent();
                // This almost feels a little like cheating but I need to know if I should be wrapping the symbol
                // in brackets or not. We'll do this by checking the value of the numerator and then comparing it
                // to whether the symbol value is "simple" or not.
                var denominator = [],
                        numerator = [];
                // Generate a profile
                var den_map = [], num_map = [], num_c = 0, den_c = 0;
                var setBrackets = function (container, map, counter) {
                    if(counter > 1 && map.length > 0) {
                        var l = map.length;
                        for(var i = 0; i < l; i++) {
                            var idx = map[i], item = container[idx];
                            if(!(/^\\left\(.+\\right\)\^\{.+\}$/g.test(item) || /^\\left\(.+\\right\)$/g.test(item))) {
                                container[idx] = LaTeX.brackets(item, 'parens');
                            }
                        }
                    }
                    return container;
                };

                // Generate latex for each of them
                symbol.each(function (x) {
                    var isDenom = isNegative(x.power),
                            laTex;

                    if(isDenom) {
                        laTex = LaTeX.latex(x.invert(), option);
                        den_c++;
                        if(x.isComposite()) {
                            if(symbol.multiplier.den != 1 && Math.abs(x.power) == 1)
                                laTex = LaTeX.brackets(laTex, 'parens');
                            den_map.push(denominator.length); // make a note of where the composite was found
                        }

                        denominator.push(laTex);
                    }
                    else {
                        laTex = LaTeX.latex(x, option);
                        num_c++;
                        if(x.isComposite()) {
                            if(symbol.multiplier.num != 1 && Math.abs(x.power) == 1)
                                laTex = LaTeX.brackets(laTex, 'parens');
                            num_map.push(numerator.length);   // make a note of where the composite was found
                        }
                        numerator.push(laTex);
                    }
                });

                // Apply brackets
                setBrackets(numerator, num_map, num_c);
                v[0] = numerator.join(this.dot); // collapse the numerator into one string

                setBrackets(denominator, den_map, den_c);
                v[1] = denominator.join(this.dot);
            }

            return v;
        },
        set: function (m, v, p, combine_power) {
            var isBracketed = function (v) {
                return /^\\left\(.+\\right\)$/.test(v);
            };
            // format the power if it exists
            if(p)
                p = this.formatP(p);
            // group CB will have to be wrapped since the power applies to both it's numerator and denominator
            if(combine_power) {
                // POSSIBLE BUG: If powers for group CB format wrong, investigate this since I might have overlooked something
                // the assumption is that in every case the denonimator should be empty when dealing with CB. I can't think
                // of a case where this isn't true
                var tp = p[0];
                p[0] = ''; // temporarily make p blank
            }

            // merge v and p. Not that v MUST be first since the order matters
            v = this.merge(v, p);
            var mn = m[0], md = m[1], vn = v[0], vd = v[1];
            // filters
            // if the top has a variable but the numerator is one drop it
            if(vn && Number(mn) === 1)
                mn = '';
            // if denominator is 1 drop it always
            if(Number(md) === 1)
                md = '';
            // prepare the top portion but check that it's not already bracketed. If it is then leave out the cdot
            var top = this.join(mn, vn, !isBracketed(vn) ? this.dot : '');

            // prepare the bottom portion but check that it's not already bracketed. If it is then leave out the cdot
            var bottom = this.join(md, vd, !isBracketed(vd) ? this.dot : '');
            // format the power if it exists
            // make it a fraction if both top and bottom exists
            if(top && bottom) {
                var frac = this.frac(top, bottom);
                if(combine_power && tp)
                    frac = this.brackets(frac) + tp;
                return frac;
            }
            // otherwise only the top exists so return that
            else
                return top;
        },
        merge: function (a, b) {
            var r = [];
            for(var i = 0; i < 2; i++)
                r[i] = a[i] + b[i];
            return r;
        },
        // joins together two strings if both exist
        join: function (n, d, glue) {
            if(!n && !d)
                return '';
            if(n && !d)
                return n;
            if(d && !n)
                return d;
            return n + glue + d;
        },
        /**
         * Places subscripts in braces for proper formatting
         * @param {String} v
         * @returns {String}
         */
        formatSubscripts: function (v) {
            // Split it at the underscore
            var arr = v.toString().split('_');

            var name = '';

            // Loop over all entries except the first one
            while(arr.length > 1) {
                // Wrap all in braces except for the last one
                if(arr.length > 0) {
                    name = '_' + this.braces(arr.pop() + name);
                }
            }

            return arr[0] + name;
        },
        formatP: function (p_array) {
            for(var i = 0; i < 2; i++) {
                var p = p_array[i];
                if(p)
                    p_array[i] = '^' + this.braces(p);
            }
            return p_array;
        },
        /**
         * formats the fractions accordingly.
         * @param {Frac} f
         * @param {bool} is_pow
         */
        formatFrac: function (f, is_pow) {
            var n = f.num.toString(),
                    d = f.den.toString();
            // no need to have x^1
            if(is_pow && n === '1' && d === '1')
                return '';
            // no need to have x/1
            if(d === '1')
                return n;
            return this.frac(n, d);
        },
        frac: function (n, d) {
            return '\\frac' + this.braces(n) + this.braces(d);
        },
        braces: function (e) {
            return '{' + e + '}';
        },
        brackets: function (e, typ) {
            typ = typ || 'parens';
            var bracketTypes = {
                parens: ['(', ')'],
                square: ['[', ']'],
                brace: ['{', '}'],
                abs: ['|', '|'],
                angle: ['\\langle', '\\rangle']
            };
            var bracket = bracketTypes[typ];
            return '\\left' + bracket[0] + e + '\\right' + bracket[1];
        },
        /**
         * Removes extreneous tokens
         * @param {Tokens[]} tokens
         * @returns {Tokens[]}
         */
        filterTokens: function (tokens) {
            var filtered = [];

            // Copy over the type of the scope
            if(isArray(tokens)) {
                filtered.type = tokens.type;
            }

            // the items that need to be disposed
            var d = ['\\', 'left', 'right', 'big', 'Big', 'large', 'Large'];
            for(var i = 0, l = tokens.length; i < l; i++) {
                var token = tokens[i];
                var next_token = tokens[i + 1];
                if(token.value === '\\' && next_token.value === '\\') {
                    filtered.push(token);
                }
                else if(isArray(token)) {
                    filtered.push(LaTeX.filterTokens(token));
                }
                else if(d.indexOf(token.value) === -1) {
                    filtered.push(token);
                }
            }
            return filtered;
        },
        /*
         * Parses tokens from LaTeX string. Does not do any error checking
         * @param {Tokens[]} rpn
         * @returns {String}
         */
        parse: function (raw_tokens) {
            var i, l;
            var retval = '';
            var tokens = this.filterTokens(raw_tokens);
            var replace = {
                'cdot': '',
                'times': '',
                'infty': 'Infinity'
            };
            // get the next token
            var next = function (n) {
                return tokens[(typeof n === 'undefined' ? ++i : i += n)];
            };
            var parse_next = function () {
                return LaTeX.parse(next());
            };
            var get = function (token) {
                if(token in replace) {
                    return replace[token];
                }
                // A quirk with implicit multiplication forces us to check for *
                if(token === '*' && tokens[i + 1].value === '&') {
                    next(2); // skip this and the &
                    return ',';
                }

                if(token === '&') {
                    next();
                    return ','; // Skip the *
                }
                // If it's the end of a row, return the row separator
                if(token === '\\') {
                    return '],[';
                }
                return token;
            };

            // start parsing the tokens
            for(i = 0, l = tokens.length; i < l; i++) {
                var token = tokens[i];
                // fractions
                if(token.value === 'frac') {
                    // parse and wrap it in brackets
                    var n = parse_next();
                    var d = parse_next();
                    retval += n + '/' + d;
                }
                else if(token.value in LaTeX.symbols) {
                    if(token.value === SQRT && tokens[i + 1].type === 'vector' && tokens[i + 2].type === 'Set') {
                        var base = parse_next();
                        var expr = parse_next();
                        retval += (expr + '^' + inBrackets('1/' + base));
                    }
                    else {
                        retval += token.value + parse_next();
                    }
                }
                else if(token.value === 'int') {
                    var f = parse_next();
                    // skip the comma
                    i++;
                    // get the variable of integration
                    var dx = next().value;
                    dx = get(dx.substring(1, dx.length));
                    retval += 'integrate' + inBrackets(f + ',' + dx);
                }
                else if(token.value === 'int_') {
                    var l = parse_next(); // lower
                    i++; // skip the ^
                    var u = next().value; // upper
                    // if it is in brackets
                    if (u === undefined) {
                        i--;
                        var u = parse_next();
                    }
                    var f = parse_next(); // function
                    
                    // get the variable of integration
                    var dx = next().value;
                    // skip the comma
                    if (dx === ',') {
                        var dx = next().value;
                    }
                    // if 'd', skip
                    if (dx === 'differentialD') {
                        // skip the *
                        i++;
                        var dx = next().value;
                    }
                    if (dx === 'mathrm') {
                        // skip the mathrm{d}
                        i++;
                        var dx = next().value;
                    }
                    retval += 'defint' + inBrackets(f + ',' + l + ',' + u + ',' + dx);
                }
                else if(token.value && token.value.startsWith('int_')) {
                    // var l = parse_next(); // lower
                    var l = token.value.replace('int_', '')
                    console.log('uppernow')
                    i++; // skip the ^
                    var u = next().value; // upper
                    // if it is in brackets
                    if (u === undefined) {
                        i--;
                        var u = parse_next();
                    }
                    var f = parse_next(); // function
                    
                    // get the variable of integration
                    var dx = next().value;
                    // skip the comma
                    if (dx === ',') {
                        var dx = next().value;
                    }
                    // if 'd', skip
                    if (dx === 'differentialD') {
                        // skip the *
                        i++;
                        var dx = next().value;
                    }
                    if (dx === 'mathrm') {
                        // skip the mathrm{d}
                        i++;
                        var dx = next().value;
                    }
                    retval += 'defint' + inBrackets(f + ',' + l + ',' + u + ',' + dx);
                }
                else if(token.value === 'mathrm') {
                    var f = tokens[++i][0].value;
                    retval += f + parse_next();
                }
                // sum and product
                else if(token.value === 'sum_' || token.value === 'prod_') {
                    var fn = token.value === 'sum_' ? 'sum' : 'product';
                    var nxt = next();
                    i++; // skip the caret
                    var end = parse_next();
                    var f = parse_next();
                    retval += fn + inBrackets([f, get(nxt[0]), get(nxt[2]), get(end)].join(','));
                }
                else if(token.value === 'lim_') {
                    var nxt = next();
                    retval += 'limit' + inBrackets([parse_next(), get(nxt[0]), get(nxt[2])].join(','));
                }
                else if(token.value === 'begin') {
                    var nxt = next();
                    if(Array.isArray(nxt)) {
                        var v = nxt[0].value;
                        if(v === 'matrix') {
                            // Start a matrix
                            retval += 'matrix([';
                        }
                    }
                }
                else if(token.value === 'end') {
                    var nxt = next();
                    if(Array.isArray(nxt)) {
                        var v = nxt[0].value;
                        if(v === 'matrix') {
                            // End a matrix
                            retval += '])';
                        }
                    }
                }
                else {
                    if(Array.isArray(token)) {
                        retval += get(LaTeX.parse(token));
                    }
                    else {
                        retval += get(token.value.toString());
                    }
                }
            }

            return inBrackets(retval);
        }
    };
//Vector =======================================================================
    function Vector(v) {
        this.multiplier = new Frac(1);
        if(isVector(v))
            this.elements = v.items.slice(0);
        else if(isArray(v))
            this.elements = v.slice(0);
        else if(isMatrix(v)) {
            if (v.elements.length === 1) {
                this.elements = [...v.elements[0]];
                this.rowVector = true;
            } else if (v.elements.length > 1 && Array.isArray(v.elements[0]) && v.elements[0].length === 1) {
                this.elements = v.elements.map((row)=>row[0]);
                this.rowVector = false;
            }
        }
        else
            this.elements = [].slice.call(arguments);
    }
    /*
     * Generates a pre-filled array
     * @param {type} n
     * @param {type} val
     * @returns {unresolved}
     */
    Vector.arrayPrefill = function (n, val) {
        var a = [];
        val = val || 0;
        for(var i = 0; i < n; i++)
            a[i] = val;
        return a;
    };
    /**
     * Generate a vector from and array
     * @param {type} a
     * @returns {unresolved}
     */
    Vector.fromArray = function (a) {
        var v = new Vector();
        v.elements = a;
        return v;
    };

    /**
     * Convert a Set to a Vector
     * @param {Set} set
     * @returns {Vector}
     */
    Vector.fromSet = function (set) {
        return Vector.fromArray(set.elements);
    };

    //Ported from Sylvester.js
    Vector.prototype = {
        custom: true,
        // Returns element i of the vector
        e: function (i) {
            return (i < 1 || i > this.elements.length) ? null : this.elements[i - 1];
        },

        set: function (i, val) {
            if(!isSymbol(val))
                val = new Symbol(val);
            this.elements[i] = val;
        },

        // Returns the number of elements the vector has
        dimensions: function () {
            return this.elements.length;
        },

        // Returns the modulus ('length') of the vector
        modulus: function () {
            return block('SAFE', function () {
                return _.pow((this.dot(this.clone())), new Symbol(0.5));
            }, undefined, this);
        },

        // Returns true iff the vector is equal to the argument
        eql: function (vector) {
            var n = this.elements.length;
            var V = vector.elements || vector;
            if(n !== V.length) {
                return false;
            }
            do {
                if(Math.abs(_.subtract(this.elements[n - 1], V[n - 1]).valueOf()) > PRECISION) {
                    return false;
                }
            }
            while(--n);
            return true;
        },

        // Returns a clone of the vector
        clone: function () {
            var V = new Vector(),
                    l = this.elements.length;
            for(var i = 0; i < l; i++) {
                //Rule: all items within the vector must have a clone method.
                V.elements.push(this.elements[i].clone());
            }
            V.rowVector = this.rowVector;
            return V;
        },

        expand: function (options) {
            this.elements = this.elements.map((e)=>_.expand(e, options));
            return this;
        },

        // Maps the vector to another vector according to the given function
        map: function (fn) {
            var elements = [];
            this.each(function (x, i) {
                elements.push(fn(x, i));
            });

            return new Vector(elements);
        },

        // Calls the iterator for each element of the vector in turn
        each: function (fn) {
            var n = this.elements.length, k = n, i;
            do {
                i = k - n;
                fn(this.elements[i], i + 1);
            }
            while(--n);
        },

        // Returns a new vector created by normalizing the receiver
        toUnitVector: function () {
            return block('SAFE', function () {
                var r = this.modulus();
                if(r.valueOf() === 0) {
                    return this.clone();
                }
                return this.map(function (x) {
                    return _.divide(x, r);
                });
            }, undefined, this);
        },

        // Returns the angle between the vector and the argument (also a vector)
        angleFrom: function (vector) {
            return block('SAFE', function () {
                var V = vector.elements || vector;
                var n = this.elements.length;
                if(n !== V.length) {
                    return null;
                }
                var dot = new Symbol(0), mod1 = new Symbol(0), mod2 = new Symbol(0);
                // Work things out in parallel to save time
                this.each(function (x, i) {
                    dot = _.add(dot, _.multiply(x, V[i - 1]));
                    mod1 = _.add(mod1, _.multiply(x, x));// will not conflict in safe block
                    mod2 = _.add(mod2, _.multiply(V[i - 1], V[i - 1]));// will not conflict in safe block
                });
                mod1 = _.pow(mod1, new Symbol(0.5));
                mod2 = _.pow(mod2, new Symbol(0.5));
                var product = _.multiply(mod1, mod2);
                if(product.valueOf() === 0) {
                    return null;
                }
                var theta = _.divide(dot, product);
                var theta_val = theta.valueOf();
                if(theta_val < -1) {
                    theta = -1;
                }
                if(theta_val > 1) {
                    theta = 1;
                }
                return new Symbol(Math.acos(theta));
            }, undefined, this);
        },

        // Returns true iff the vector is parallel to the argument
        isParallelTo: function (vector) {
            var angle = this.angleFrom(vector).valueOf();
            return (angle === null) ? null : (angle <= PRECISION);
        },

        // Returns true iff the vector is antiparallel to the argument
        isAntiparallelTo: function (vector) {
            var angle = this.angleFrom(vector).valueOf();
            return (angle === null) ? null : (Math.abs(angle - Math.PI) <= PRECISION);
        },

        // Returns true iff the vector is perpendicular to the argument
        isPerpendicularTo: function (vector) {
            var dot = this.dot(vector);
            return (dot === null) ? null : (Math.abs(dot) <= PRECISION);
        },

        // Returns the result of adding the argument to the vector
        add: function (vector) {
            return block('SAFE', function () {
                var V = vector.elements || vector;
                if(this.elements.length !== V.length) {
                    return null;
                }
                return this.map(function (x, i) {
                    return _.add(x, V[i - 1]);
                });
            }, undefined, this);
        },

        // Returns the result of subtracting the argument from the vector
        subtract: function (vector) {
            return block('SAFE', function () {
                var V = vector.elements || vector;
                if(this.elements.length !== V.length) {
                    return null;
                }
                return this.map(function (x, i) {
                    return _.subtract(x, V[i - 1]);
                });
            }, undefined, this);
        },

        // Returns the result of multiplying the elements of the vector by the argument
        multiply: function (k) {
            return this.map(function (x) {
                return x.clone() * k.clone();
            });
        },

        x: function (k) {
            return this.multiply(k);
        },

        // Returns the scalar product of the vector with the argument
        // Both vectors must have equal dimensionality
        dot: function (vector) {
            return block('SAFE', function () {
                var V = vector.elements || vector;
                var product = new Symbol(0), n = this.elements.length;
                if(n !== V.length) {
                    return null;
                }
                do {
                    product = _.add(product, _.multiply(this.elements[n - 1], V[n - 1]));
                }
                while(--n);
                return product;
            }, undefined, this);
        },

        // Returns the vector product of the vector with the argument
        // Both vectors must have dimensionality 3
        cross: function (vector) {
            var B = vector.elements || vector;
            if(this.elements.length !== 3 || B.length !== 3) {
                return null;
            }
            const rowVector = this.rowVector && vector.rowVector;
            var A = this.elements;
            return block('SAFE', function () {
                const result = new Vector([
                    _.subtract(_.multiply(A[1], B[2]), _.multiply(A[2], B[1])),
                    _.subtract(_.multiply(A[2], B[0]), _.multiply(A[0], B[2])),
                    _.subtract(_.multiply(A[0], B[1]), _.multiply(A[1], B[0]))
                ]);
                result.rowVector = rowVector;
                return result;
            }, undefined, this);
        },

        toUnitMultiplier: function() {
            return this;
        },

        // Returns the (absolute) largest element of the vector
        max: function () {
            var m = 0, n = this.elements.length, k = n, i;
            do {
                i = k - n;
                if(Math.abs(this.elements[i].valueOf()) > Math.abs(m.valueOf())) {
                    m = this.elements[i];
                }
            }
            while(--n);
            return m;
        },
        magnitude: function () {
            var magnitude = new Symbol(0);
            this.each(function (e) {
                magnitude = _.add(magnitude, _.pow(e, new Symbol(2)));
            });
            return _.sqrt(magnitude);
        },
        // Returns the index of the first match found
        indexOf: function (x) {
            var index = null, n = this.elements.length, k = n, i;
            do {
                i = k - n;
                if(index === null && this.elements[i].valueOf() === x.valueOf()) {
                    index = i + 1;
                }
            }
            while(--n);
            return index;
        },
        text_: function (x, options) {
            let result = text(this, options);
            return (this.rowVector?"[":"")+result+(this.rowVector?"]":"");
        },
        text: function (x, options) {
            let result = text(this, options);
            return (this.rowVector?"[":"")+result+(this.rowVector?"]":"");
        },
        toString: function () {
            return this.text();
        },
        latex: function (option) {
            var tex = [];
            for(var i = 0; i < this.elements.length; i++) {
                tex.push(LaTeX.latex.call(LaTeX, this.elements[i], option));
            }
            return '[' + tex.join(', ') + ']';
        }
    };

//Matrix =======================================================================
    function Matrix() {
        this.multiplier = new Frac(1);
        var m = arguments,
                l = m.length, i, el = [];
        if(isMatrix(m)) { // if it's a matrix then make a clone
            for(i = 0; i < l; i++) {
                el.push(m[i].slice(0));
            }
        }
        else {
            var row, lw, rl;
            for(i = 0; i < l; i++) {
                row = m[i];
                if(isVector(row))
                    row = row.elements;
                if(!isArray(row))
                    row = [row];
                rl = row.length;
                if(lw && lw !== rl)
                    err('Unable to create Matrix. Row dimensions do not match!');
                el.push(row);
                lw = rl;
            }
        }
        this.elements = el;
    }
    Matrix.identity = function (n) {
        var m = new Matrix();
        for(var i = 0; i < n; i++) {
            m.elements.push([]);
            for(var j = 0; j < n; j++) {
                m.set(i, j, i === j ? new Symbol(1) : new Symbol(0));
            }
        }
        return m;
    };
    Matrix.fromArray = function (arr) {
        function F(args) {
            return Matrix.apply(this, args);
        }
        F.prototype = Matrix.prototype;

        return new F(arr);
    };
    Matrix.zeroMatrix = function (rows, cols) {
        var m = new Matrix();
        for(var i = 0; i < rows; i++) {
            m.elements.push(Vector.arrayPrefill(cols, new Symbol(0)));
        }
        return m;
    };
    Matrix.prototype = {
        // needs be true to let the parser know not to try to cast it to a symbol
        custom: true,
        get: function (row, column) {
            if(!this.elements[row])
                return undefined;
            return this.elements[row][column];
        },
        map: function (f, raw_values) {
            var M = new Matrix();
            this.each(function (e, i, j) {
                M.set(i, j, f.call(M, e), raw_values);
            });
            return M;
        },
        set: function (row, column, value, raw) {
            if(!this.elements[row])
                this.elements[row] = [];
            this.elements[row][column] = raw ? value : (isSymbol(value) ? value : new Symbol(value));
        },
        cols: function () {
            return this.elements[0].length;
        },
        rows: function () {
            return this.elements.length;
        },
        row: function (n) {
            if(!n || n > this.cols())
                return [];
            return this.elements[n - 1];
        },
        col: function (n) {
            var nr = this.rows(),
                    col = [];
            if(n > this.cols() || !n)
                return col;
            for(var i = 0; i < nr; i++) {
                col.push(this.elements[i][n - 1]);
            }
            return col;
        },
        eachElement: function (fn) {
            var nr = this.rows(),
                    nc = this.cols(), i, j;
            for(i = 0; i < nr; i++) {
                for(j = 0; j < nc; j++) {
                    fn.call(this, this.elements[i][j], i, j);
                }
            }
        },
        // ported from Sylvester.js
        determinant: function () {
            if(!this.isSquare()) {
                return null;
            }
            var M = this.toRightTriangular();
            var det = M.elements[0][0], n = M.elements.length - 1, k = n, i;
            do {
                i = k - n + 1;
                det = _.multiply(det, M.elements[i][i]);
            }
            while(--n);
            return det;
        },
        isSquare: function () {
            return this.elements.length === this.elements[0].length;
        },
        isSingular: function () {
            return this.isSquare() && this.determinant() === 0;
        },
        augment: function (m) {
            var r = this.rows(), rr = m.rows();
            if(r !== rr)
                err("Cannot augment matrix. Rows don't match.");
            for(var i = 0; i < r; i++) {
                this.elements[i] = this.elements[i].concat(m.elements[i]);
            }

            return this;
        },
        clone: function () {
            var r = this.rows(), c = this.cols(),
                    m = new Matrix();
            for(var i = 0; i < r; i++) {
                m.elements[i] = [];
                for(var j = 0; j < c; j++) {
                    var symbol = this.elements[i][j];
                    m.elements[i][j] = isSymbol(symbol) ? symbol.clone() : symbol;
                }
            }
            return m;
        },
        toUnitMultiplier: function() {
            return this;
        },
        expand: function(options) {
            this.eachElement((e)=>_.expand(e, options));
            return this;
        },
        evaluate: function(options) {
            this.eachElement((e)=>_.evaluate(e, options));
            return this;
        },

        // ported from Sylvester.js
        invert: function () {
            if(!this.isSquare())
                err('Matrix is not square!');
            return block('SAFE', function () {
                var ni = this.elements.length, ki = ni, i, j;
                var imatrix = Matrix.identity(ni);
                var M = this.augment(imatrix).toRightTriangular();
                var np, kp = M.elements[0].length, p, els, divisor;
                var inverse_elements = [], new_element;
                // Matrix is non-singular so there will be no zeros on the diagonal
                // Cycle through rows from last to first
                do {
                    i = ni - 1;
                    // First, normalise diagonal elements to 1
                    els = [];
                    np = kp;
                    inverse_elements[i] = [];
                    divisor = M.elements[i][i];
                    do {
                        p = kp - np;
                        new_element = _.divide(M.elements[i][p], divisor.clone());
                        els.push(new_element);
                        // Shuffle of the current row of the right hand side into the results
                        // array as it will not be modified by later runs through this loop
                        if(p >= ki) {
                            inverse_elements[i].push(new_element);
                        }
                    }
                    while(--np);
                    M.elements[i] = els;
                    // Then, subtract this row from those above it to
                    // give the identity matrix on the left hand side
                    for(j = 0; j < i; j++) {
                        els = [];
                        np = kp;
                        do {
                            p = kp - np;
                            els.push(_.subtract(M.elements[j][p].clone(), _.multiply(M.elements[i][p].clone(), M.elements[j][i].clone())));
                        }
                        while(--np);
                        M.elements[j] = els;
                    }
                }
                while(--ni);
                return Matrix.fromArray(inverse_elements);
            }, undefined, this);
        },
        // ported from Sylvester.js
        toRightTriangular: function () {
            return block('SAFE', function () {
                var M = this.clone(), els, fel, nel,
                        n = this.elements.length, k = n, i, np, kp = this.elements[0].length, p;
                do {
                    i = k - n;
                    fel = M.elements[i][i];
                    if(fel.valueOf() === 0) {
                        for(var j = i + 1; j < k; j++) {
                            nel = M.elements[j][i];
                            if(nel && nel.valueOf() !== 0) {
                                els = [];
                                np = kp;
                                do {
                                    p = kp - np;
                                    els.push(_.add(M.elements[i][p].clone(), M.elements[j][p].clone()));
                                }
                                while(--np);
                                M.elements[i] = els;
                                break;
                            }
                        }
                    }
                    var fel = M.elements[i][i];
                    if(fel.valueOf() !== 0) {
                        for(j = i + 1; j < k; j++) {
                            var multiplier = _.divide(M.elements[j][i].clone(), M.elements[i][i].clone());
                            els = [];
                            np = kp;
                            do {
                                p = kp - np;
                                // Elements with column numbers up to an including the number
                                // of the row that we're subtracting can safely be set straight to
                                // zero, since that's the point of this routine and it avoids having
                                // to loop over and correct rounding errors later
                                els.push(p <= i ? new Symbol(0) :
                                        _.subtract(M.elements[j][p].clone(), _.multiply(M.elements[i][p].clone(), multiplier.clone())));
                            }
                            while(--np);
                            M.elements[j] = els;
                        }
                    }
                }
                while(--n);

                return M;
            }, undefined, this);
        },
        transpose: function () {
            var rows = this.elements.length, cols = this.elements[0].length;
            var M = new Matrix(), ni = cols, i, nj, j;

            do {
                i = cols - ni;
                M.elements[i] = [];
                nj = rows;
                do {
                    j = rows - nj;
                    M.elements[i][j] = this.elements[j][i].clone();
                }
                while(--nj);
            }
            while(--ni);
            return M;
        },
        // Returns true if the matrix can multiply the argument from the left
        canMultiplyFromLeft: function (matrix) {
            var l = isMatrix(matrix) ? matrix.elements.length : matrix.length;
            // this.columns should equal matrix.rows
            return (this.elements[0].length === l);
        },
        sameSize: function (matrix) {
            return this.rows() === matrix.rows() && this.cols() === matrix.cols();
        },
        multiply: function (matrix) {
            return block('SAFE', function () {
                var M = matrix.elements || matrix;
                if(!this.canMultiplyFromLeft(M)) {
                    if(this.sameSize(matrix)) {
                        var MM = new Matrix();
                        var rows = this.rows();
                        for(var i = 0; i < rows; i++) {
                            var e = _.multiply(new Vector(this.elements[i]), new Vector(matrix.elements[i]));
                            MM.elements[i] = e.elements;
                        }
                        return MM;
                    }
                    return null;
                }
                var ni = this.elements.length, ki = ni, i, nj, kj = M[0].length, j;
                var cols = this.elements[0].length, elements = [], sum, nc, c;
                do {
                    i = ki - ni;
                    elements[i] = [];
                    nj = kj;
                    do {
                        j = kj - nj;
                        sum = new Symbol(0);
                        nc = cols;
                        do {
                            c = cols - nc;
                            sum = _.add(sum, _.multiply(this.elements[i][c], M[c][j]));
                        }
                        while(--nc);
                        elements[i][j] = sum;
                    }
                    while(--nj);
                }
                while(--ni);
                return Matrix.fromArray(elements);
            }, undefined, this);
        },
        add: function (matrix, callback) {
            var M = new Matrix();
            if(this.sameSize(matrix)) {
                this.eachElement(function (e, i, j) {
                    var result = _.add(e.clone(), matrix.elements[i][j].clone());
                    if(callback) {
                        result = callback.call(M, result, e, matrix.elements[i][j]);
                    }
                    M.set(i, j, result);
                });
            }
            return M;
        },
        subtract: function (matrix, callback) {
            var M = new Matrix();
            if(this.sameSize(matrix)) {
                this.eachElement(function (e, i, j) {
                    var result = _.subtract(e.clone(), matrix.elements[i][j].clone());
                    if(callback) {
                        result = callback.call(M, result, e, matrix.elements[i][j]);
                    }
                    M.set(i, j, result);
                });
            }
            return M;
        },
        negate: function () {
            this.each(function (e) {
                return e.negate();
            });
            return this;
        },
        toVector: function () {
            if(this.rows() === 1 || this.cols() === 1) {
                var v = new Vector();
                v.elements = this.elements;
                return v;
            }
            return this;
        },
        toString: function (newline, to_decimal) {
            var l = this.rows(),
                    s = [];
            newline = newline === undefined ? '\n' : newline;
            for(var i = 0; i < l; i++) {
                s.push('[' + this.elements[i].map(function (x) {
                    var v = to_decimal ? x.multiplier.toDecimal() : x.toString();
                    return x !== undefined ? v : '';
                }).join(',') + ']');
            }
            return 'matrix' + inBrackets(s.join(','));
        },
        text: function () {
            return 'matrix(' + this.elements.map(row=>"["+row.toString('')+"]") + ')';
        },
        latex: function (option) {
            var cols = this.cols(), elements = this.elements;
            return format('\\begin{vmatrix}{0}\\end{vmatrix}', function () {
                var tex = [];
                for(var row in elements) {
                    var row_tex = [];
                    for(var i = 0; i < cols; i++) {
                        row_tex.push(LaTeX.latex.call(LaTeX, elements[row][i], option));
                    }
                    tex.push(row_tex.join(' & '));
                }
                return tex.join(' \\cr ');
            });
        }
    };
    // aliases
    Matrix.prototype.each = Matrix.prototype.eachElement;


    function Set(set) {
        this.elements = [];
        // if the first object isn't an array, convert it to one.
        if(!isVector(set))
            set = Vector.fromArray(arguments);

        if(set) {
            var elements = set.elements;
            for(var i = 0, l = elements.length; i < l; i++) {
                this.add(elements[i]);
            }
        }
    }

    Set.fromArray = function (arr) {
        function F(args) {
            return Set.apply(this, args);
        }
        F.prototype = Set.prototype;

        return new F(arr);
    };

    Set.prototype = {
        add: function (x) {
            if(!this.contains(x))
                this.elements.push(x.clone());
        },
        contains: function (x) {
            for(var i = 0; i < this.elements.length; i++) {
                var e = this.elements[i];
                if(x.equals(e))
                    return true;
            }
            return false;
        },
        each: function (f) {
            var elements = this.elements;
            var set = new Set();
            for(var i = 0, l = elements.length; i < l; i++) {
                var e = elements[i];
                f.call(this, e, set, i);
            }
            return set;
        },
        clone: function () {
            var set = new Set();
            this.each(function (e) {
                set.add(e.clone());
            });
            return set;
        },
        union: function (set) {
            var _union = this.clone();
            set.each(function (e) {
                _union.add(e);
            });

            return _union;
        },
        difference: function (set) {
            var diff = this.clone();
            set.each(function (e) {
                diff.remove(e);
            });
            return diff;
        },
        remove: function (element) {
            for(var i = 0, l = this.elements.length; i < l; i++) {
                var e = this.elements[i];
                if(e.equals(element)) {
                    remove(this.elements, i);
                    return true;
                }
            }
            return false;
        },
        intersection: function (set) {
            var _intersection = new Set();
            var A = this;
            set.each(function (e) {
                if(A.contains(e)) {
                    _intersection.add(e);
                }
                ;
            });

            return _intersection;
        },
        intersects: function (set) {
            return this.intersection(set).elements.length > 0;
        },
        is_subset: function (set) {
            var elements = set.elements;
            for(var i = 0, l = elements.length; i < l; i++) {
                if(!this.contains(elements[i])) {
                    return false;
                }
            }
            return true;
        },
        toString: function () {
            return '{' + this.elements.join(',') + '}';
        }
    };

//build ========================================================================
    var Build = {
        dependencies: {
            _rename: {
                'Math2.factorial': 'factorial'
            },
            factorial: {
                'Math2.gamma': Math2.gamma
            },
            gamma_incomplete: {
                'Math2.factorial': Math2.factorial
            },
            Li: {
                'Math2.Ei': Math2.Ei,
                'Math2.bigLog': Math2.bigLog,
                'Frac': Frac
            },
            Ci: {
                'Math2.factorial': Math2.factorial
            },
            Ei: {
                'Math2.factorial': Math2.factorial
            },
            Si: {
                'Math2.factorial': Math2.factorial
            },
            Shi: {
                'Math2.factorial': Math2.factorial
            },
            Chi: {
                'isInt': isInt,
                'nround': nround,
                'Math2.num_integrate': Math2.num_integrate
            },
            factor: {
                'Math2.ifactor': Math2.ifactor,
                'Symbol': Symbol
            },
            num_integrate: {
                'Math2.simpson': Math2.simpson,
                'nround': nround
            },
            fib: {
                'even': even
            }
        },
        /* Some functions need to be made numeric safe. Build checks if there's a
         * reformat option and calls that instead when compiling the function string.
         */
        reformat: {
            // this simply extends the build function
            diff: function (symbol, deps) {
                var v = symbol.args[1].toString();
                var f = 'var f = ' + Build.build(symbol.args[0].toString(), [v]) + ';';
                deps[1] += 'var diff = ' + Math2.diff.toString() + ';';
                deps[1] += f;

                return ['diff(f)(' + v + ')', deps];
            }
        },
        getProperName: function (f) {
            var map = {
                continued_fraction: 'continuedFraction'
            };
            return map[f] || f;
        },
        // assumes that dependences are at max 2 levels
        compileDependencies: function (f, deps) {
            // grab the predefined dependiences
            var dependencies = Build.dependencies[f];

            // the dependency string
            var dep_string = deps && deps[1] ? deps[1] : '';

            // the functions to be replaced
            var replacements = deps && deps[0] ? deps[0] : {};

            // loop through them and add them to the list
            for(var x in dependencies) {
                if(typeof dependencies[x] === 'object')
                    continue; // skip object
                var components = x.split('.'); //Math.f becomes f
                // if the function isn't part of an object then reference the function itself
                dep_string += 'var ' + (components.length > 1 ? components[1] : components[0]) + '=' + dependencies[x] + ';';
                replacements[x] = components.pop();
            }

            return [replacements, dep_string];
        },
        getArgsDeps: function (symbol, dependencies) {
            var args = symbol.args;
            for(var i = 0; i < args.length; i++) {
                symbol.args[i].each(function (x) {
                    if(x.group === FN)
                        dependencies = Build.compileDependencies(x.fname, dependencies);
                });
            }
            return dependencies;
        },
        build: function (symbol, arg_array) {
            symbol = block('PARSE2NUMBER', function () {
                return _.parse(symbol);
            }, true);
            var args = variables(symbol);
            var supplements = [];
            var dependencies = [];
            var ftext = function (symbol, xports) {
                //Fix for #545 - Parentheses confuse build.
                if(symbol.fname === '') {
                    symbol = Symbol.unwrapPARENS(symbol);
                }
                xports = xports || [];
                var c = [],
                        group = symbol.group,
                        prefix = '';

                var ftext_complex = function (group) {
                    var d = group === CB ? '*' : '+',
                            cc = [];

                    for(var x in symbol.symbols) {
                        var sym = symbol.symbols[x],
                                ft = ftext(sym, xports)[0];
                        // wrap it in brackets if it's group PL or CP
                        if(sym.isComposite())
                            ft = inBrackets(ft);
                        cc.push(ft);
                    }
                    var retval = cc.join(d);
                    retval = retval && !symbol.multiplier.equals(1) ? inBrackets(retval) : retval;
                    return retval;
                },
                        ftext_function = function (bn) {
                            var retval;
                            if(bn in Math)
                                retval = 'Math.' + bn;
                            else {
                                bn = Build.getProperName(bn);
                                if(supplements.indexOf(bn) === -1) { // make sure you're not adding the function twice
                                    //Math2 functions aren't part of the standard javascript
                                    //Math library and must be exported.
                                    xports.push('var ' + bn + ' = ' + Math2[bn].toString() + '; ');
                                    supplements.push(bn);
                                }
                                retval = bn;
                            }
                            retval = retval + inBrackets(symbol.args.map(function (x) {
                                return ftext(x, xports)[0];
                            }).join(','));

                            return retval;
                        };

                // the multiplier
                if(group === N)
                    c.push(symbol.multiplier.toDecimal());
                else if(symbol.multiplier.equals(-1))
                    prefix = '-';
                else if(!symbol.multiplier.equals(1))
                    c.push(symbol.multiplier.toDecimal());
                // the value
                var value;

                if(group === S || group === P)
                    value = symbol.value;
                else if(group === FN) {
                    dependencies = Build.compileDependencies(symbol.fname, dependencies);
                    dependencies = Build.getArgsDeps(symbol, dependencies);
                    if(Build.reformat[symbol.fname]) {
                        var components = Build.reformat[symbol.fname](symbol, dependencies);
                        dependencies = components[1];
                        value = components[0];
                    }
                    else {
                        value = ftext_function(symbol.fname);
                    }

                }
                else if(group === EX) {
                    var pg = symbol.previousGroup;
                    if(pg === N || pg === S)
                        value = symbol.value;
                    else if(pg === FN) {
                        value = ftext_function(symbol.fname);
                        dependencies = Build.compileDependencies(symbol.fname, dependencies);
                        dependencies = Build.getArgsDeps(symbol, dependencies);
                    }
                    else
                        value = ftext_complex(symbol.previousGroup);
                }
                else {
                    value = ftext_complex(symbol.group);
                }

                if(symbol.group !== N && !symbol.power.equals(1)) {
                    var pow = ftext(_.parse(symbol.power));
                    xports.push(pow[1]);
                    value = 'Math.pow' + inBrackets(value + ',' + pow[0]);
                }

                if(value)
                    c.push(prefix + value);

                return [c.join('*'), xports.join('').replace(/\n+\s+/g, ' ')];
            };
            if(arg_array) {
                // Fix for issue #546
                // Disable argument checking since it's a bit presumptuous.
                // Consider f(x) = 5; If I explicitely pass in an argument array contain x 
                // this check will fail and complain since the function doesn't contain x.
                /*
                 for (var i = 0; i < args.length; i++) {
                 var arg = args[i];
                 if (arg_array.indexOf(arg) === -1)
                 err(arg + ' not found in argument array');
                 }
                 */
                args = arg_array;
            }

            var f_array = ftext(symbol);

            // make all the substitutions;
            for(var x in dependencies[0]) {
                var alias = dependencies[0][x];
                f_array[1] = f_array[1].replace(x, alias);
                dependencies[1] = dependencies[1].replace(x, alias);
            }

            var f = new Function(args, (dependencies[1] || '') + f_array[1] + ' return ' + f_array[0] + ';');

            return f;
        }
    };


//finalize =====================================================================
    /* FINALIZE */
    (function () {
        reserveNames(_.CONSTANTS);
        reserveNames(_.functions);
        _.initConstants();
        //bug fix for error but needs to be revisited
        if(!_.error)
            _.error = err;

        //Store the log and log10 functions
        Settings.LOG_FNS = {
            log: _.functions['log'],
            log10: _.functions['log10']
        };

    })();

    /* END FINALIZE */

//Core =========================================================================
    var Utils = {
        allSame: allSame,
        allNumeric: allNumeric,
        arguments2Array: arguments2Array,
        armTimeout: armTimeout,
        arrayAddSlices: arrayAddSlices,
        arrayClone: arrayClone,
        arrayMax: arrayMax,
        arrayMin: arrayMin,
        arrayEqual: arrayEqual,
        arrayUnique: arrayUnique,
        arrayGetVariables: arrayGetVariables,
        arraySum: arraySum,
        block: block,
        build: Build.build,
        checkTimeout: checkTimeout,
        clearU: clearU,
        comboSort: comboSort,
        compare: compare,
        convertToVector: convertToVector,
        customError: customError,
        customType: customType,
        decompose_fn: decompose_fn,
        disarmTimeout: disarmTimeout,
        each: each,
        evaluate: evaluate,
        even: even,
        evenFraction: evenFraction,
        fillHoles: fillHoles,
        firstObject: firstObject,
        format: format,
        generatePrimes: generatePrimes,
        getCoeffs: getCoeffs,
        getU: getU,
        importFunctions: importFunctions,
        inBrackets: inBrackets,
        isArray: isArray,
        isExpression: isExpression,
        isFraction: isFraction,
        isInt: isInt,
        isMatrix: isMatrix,
        isNegative: isNegative,
        isNumericSymbol: isNumericSymbol,
        isPrime: isPrime,
        isReserved: isReserved,
        isSymbol: isSymbol,
        isVariableSymbol: isVariableSymbol,
        isVector: isVector,
        isCollection: isCollection,
        keys: keys,
        knownVariable: knownVariable,
        nroots: nroots,
        remove: remove,
        reserveNames: reserveNames,
        range: range,
        round: nround,
        sameSign: sameSign,
        scientificToDecimal: scientificToDecimal,
        separate: separate,
        stringReplace: stringReplace,
        text: text,
        validateName: validateName,
        variables: variables,
        warn: warn
    };

    //This contains all the parts of nerdamer and enables nerdamer's internal functions
    //to be used.
    var C = {
        groups: Groups,
        Symbol: Symbol,
        Expression: Expression,
        Collection: Collection,
        Frac: Frac,
        Vector: Vector,
        Matrix: Matrix,
        Parser: Parser,
        Scientific: Scientific,
        Fraction: Fraction,
        Math2: Math2,
        LaTeX: LaTeX,
        Utils: Utils,
        PARSER: _,
        PARENTHESIS: PARENTHESIS,
        Settings: Settings,
        err: err,
        bigInt: bigInt,
        bigDec: bigDec,
        exceptions: exceptions
    };

//libExports ===================================================================
    /**
     *
     * @param {String} expression the expression to be evaluated
     * @param {Object} subs the object containing the variable values
     * @param {Integer} location a specific location in the equation list to
     * insert the evaluated expression
     * @param {String} option additional options
     * @returns {Expression}
     */
    var libExports = function (expression, subs, option, location) {
        armTimeout();
        try {
            // Initiate the numer flag
            var numer = false;

            // Is the user declaring a function? Try to add user function
            if (setFunction(expression)) {
                return nerdamer;
            }

            // var variable, fn, args;
            // Convert any expression passed in to a string
            if (expression instanceof Expression) {
                expression = expression.toString();
            }

            // Convert it to an array for simplicity
            if(!isArray(option)) {
                option = typeof option === 'undefined' ? [] : [option];
            }

            option.forEach(function (o) {
                // Turn on the numer flag if requested
                if(o === 'numer') {
                    numer = true;
                    return;
                }
                // Wrap it in a function if requested. This only holds true for
                // functions that take a single argument which is the expression
                var f = _.functions[option];
                // If there's a function and it takes a single argument, then wrap
                // the expression in it
                if(f && f[1] === 1) {
                    expression = `${o}(${expression})`;
                }
            });

            var e = block('PARSE2NUMBER', function () {
                return _.parse(expression, subs);
            }, numer || Settings.PARSE2NUMBER);

            if(location) {
                EXPRESSIONS[location - 1] = e;
            }
            else {
                EXPRESSIONS.push(e);
            }

            return new Expression(e);
        } finally {
            disarmTimeout();
        }
    };
    /**
     * Converts expression into rpn form
     * @param {String} expression
     * @returns {Token[]}
     */
    libExports.rpn = function (expression) {
        return _.tokenize(_.toRPN(expression));
    };

    /**
     * Generates LaTeX from expression string
     * @param {String} e
     * @param {object} opt
     * @returns {String}
     */
    libExports.convertToLaTeX = function (e, opt) {
        return _.toTeX(e, opt);
    };

    /**
     * Converts latex to text - Very very very basic at the moment
     * @param {String} e
     * @returns {String}
     */
    libExports.convertFromLaTeX = function (e) {
        // convert x_2a => x_2 a
        e = e.replace(/_([A-Za-z0-9])/g, (...g)=>{
            return g[0]+" "
        });
        // convert x^2 => x^{2}
        e = e.replace(/\^([A-Za-z0-9])/g, (...g)=>{
            return "^{"+g[1]+"}"
        });
        // convert \frac12 => \frac{1}2
        e = e.replace(/(\\[A-Za-z]+)(\d)/g, (...g)=>{
            return g[1]+"{"+g[2]+"}"
        });
        // convert \frac{1}2 => \frac{1}{2}
        e = e.replace(/(\\[A-Za-z]+{.*?})(\d)/g, (...g)=>{
            return g[1]+"{"+g[2]+"}"
        });
        var txt = LaTeX.parse(_.tokenize(e));
        return new Expression(_.parse(txt));
    };

    /**
     * Get the version of nerdamer or a loaded add-on
     * @param {String} add_on - The add-on being checked
     * @returns {String} returns the version of nerdamer
     */
    libExports.version = function (add_on) {
        if(add_on) {
            try {
                return C[add_on].version;
            }
            catch(e) {
                if (e.message === "timeout") throw e;
                return "No module named " + add_on + " found!";
            }
        }
        return version;
    };

    /**
     * Get nerdamer generated warnings
     * @returns {String[]}
     */
    libExports.getWarnings = function () {
        return WARNINGS;
    };

    /**
     *
     * @param {String} constant The name of the constant to be set
     * @param {mixed} value The value of the constant
     * @returns {Object} Returns the nerdamer object
     */
    libExports.setConstant = function (constant, value) {
        validateName(constant);
        if(!isReserved(constant)) {
            //fix for issue #127
            if(value === 'delete' || value === '') {
                delete _.CONSTANTS[constant];
            }
            else {
                if(isNaN(value))
                    throw new NerdamerTypeError('Constant must be a number!');
                _.CONSTANTS[constant] = value;
            }
        }
        return this;
    };

    /**
     * Returns the value of a previously set constant
     * @param {type} constant
     * @returns {String}
     */
    libExports.getConstant = function (constant) {
        return String(_.CONSTANTS[constant]);
    };

    /**
     * Clear added constants from the CONSTANTS object
     * @returns {Object} Returns the nerdamer object
     */
    libExports.clearConstants = function () {
        _.initConstants.bind(_);
        return this;
    }

    /**
     *
     * @param {string | Function} fnName The name of the function
     * @param {string[] | undefined} fnParams A list containing the parameter name of the functions
     * @param {string | undefined} body The body of the function
     * @returns {nerdamer} returns nerdamer if succeeded and falls on fail
     * @example nerdamer.setFunction('f',['x'], 'x^2+2');
     *          OR nerdamer.setFunction('f(x)=x^2+2');
     *          OR function custom(x , y) {
     *              return x + y;
     *          }
     *          nerdamer.setFunction(custom);
     */
    libExports.setFunction = function (fnName, fnParams, fnBody) {
        if(!setFunction(fnName, fnParams, fnBody)) {
            throw new Error('Failed to set function!');
        }
        return this;
    }

    /**
     * Clears all added functions
     * @returns {libExports}
     */
    libExports.clearFunctions = function () {
        clearFunctions();
        return this;
    }

    /**
     *
     * @returns {C} Exports the nerdamer core functions and objects
     */
    libExports.getCore = function () {
        return C;
    };

    libExports.getExpression = libExports.getEquation = Expression.getExpression;

    /**
     *
     * @param {Boolean} asArray The returned names are returned as an array if this is set to true;
     * @returns {String|Array}
     */
    libExports.reserved = function (asArray) {
        if(asArray) {
            return RESERVED;
        }
        return RESERVED.join(', ');
    };

    /**
     *
     * @param {Integer} equation_number the number of the equation to clear.
     * If 'all' is supplied then all equations are cleared
     * @param {Boolean} keep_EXPRESSIONS_fixed use true if you don't want to keep EXPRESSIONS length fixed
     * @returns {Object} Returns the nerdamer object
     */
    libExports.clear = function (equation_number, keep_EXPRESSIONS_fixed) {
        if(equation_number === 'all') {
            EXPRESSIONS = [];
        }
        else if(equation_number === 'last') {
            EXPRESSIONS.pop();
        }
        else if(equation_number === 'first') {
            EXPRESSIONS.shift();
        }
        else {
            var index = !equation_number ? EXPRESSIONS.length : equation_number - 1;
            keep_EXPRESSIONS_fixed === true ? EXPRESSIONS[index] = undefined : remove(EXPRESSIONS, index);
        }
        return this;
    };

    /**
     * Alias for nerdamer.clear('all')
     */
    libExports.flush = function () {
        this.clear('all');
        return this;
    };

    /**
     *
     * @param {Boolean} asObject
     * @param {Boolean} asLaTeX
     * @param {String|String[]} option
     * @returns {Array}
     */
    libExports.expressions = function (asObject, asLaTeX, option) {
        var result = asObject ? {} : [];
        for(var i = 0; i < EXPRESSIONS.length; i++) {
            var eq = asLaTeX ? LaTeX.latex(EXPRESSIONS[i], option) : text(EXPRESSIONS[i], option);
            asObject ? result[i + 1] = eq : result.push(eq);
        }
        return result;
    };

    /**
     *
     * @param {Boolean} asObject
     * @param {String|String[]} option
     * @returns {Array}
     */
    libExports.functions = function (asObject, option) {
        var result = asObject ? {} : [];
        for (var i = 0; i < USER_FUNCTIONS.length; i++) {
            var params, body;
            var fnName = USER_FUNCTIONS[i];
            var fnDef = _.functions[fnName][2];
            if(fnDef) {
                ({params, body} = fnDef);
            } else {
                var fnString = C.Math2[fnName].toString();
                ([,params] = /\((.*?)\)/.exec(fnString));
                params = params.split(',').map(x => x.trim());
                body = '{JavaScript}';
            }
            var fn = fnName + '(' + params.join(', ') + ')=' + body;
            var eq = text(fn, option);
            asObject ? result[i + 1] = eq : result.push(eq);
        }
        return result;
    }

    //the method for registering modules
    libExports.register = function (obj) {
        var core = this.getCore();

        if(isArray(obj)) {
            for(var i = 0; i < obj.length; i++) {
                if(obj)
                    this.register(obj[i]);
            }
        }
        else if(obj && Settings.exclude.indexOf(obj.name) === -1) {
            //make sure all the dependencies are available
            if(obj.dependencies) {
                for(var i = 0; i < obj.dependencies.length; i++)
                    if(!core[obj.dependencies[i]])
                        throw new Error(format('{0} requires {1} to be loaded!', obj.name, obj.dependencies[i]));
            }
            //if no parent object is provided then the function does not have an address and cannot be called directly
            var parent_obj = obj.parent,
                    fn = obj.build.call(core); //call constructor to get function
            if(parent_obj) {
                if(!core[parent_obj])
                    core[obj.parent] = {};

                var ref_obj = parent_obj === 'nerdamer' ? this : core[parent_obj];
                //attach the function to the core
                ref_obj[obj.name] = fn;
            }
            if(obj.visible)
                _.functions[obj.name] = [fn, obj.numargs]; //make the function available

        }
    };

    /**
     * @param {String} name variable name
     * @returns {boolean} validates if the profided string is a valid variable name
     */
    libExports.validateName = validateName;

    /**
     * @param {String} varname variable name
     * @returns {boolean} validates if the profided string is a valid variable name
     */
    libExports.validVarName = function (varname) {
        try {
            validateName(varname);
            return RESERVED.indexOf(varname) === -1;
        }
        catch(e) {
            if (e.message === "timeout") throw e;
            return false;
        }
    };

    /**
     *
     * @returns {Array} Array of functions currently supported by nerdamer
     */
    libExports.supported = function () {
        return keys(_.functions);
    };

    /**
     *
     * @returns {Number} The number equations/expressions currently loaded
     */
    libExports.numEquations = libExports.numExpressions = function () {
        return EXPRESSIONS.length;
    };
    /* END EXPORTS */

    /**
     *
     * @param {String} v variable to be set
     * @param {String} val value of variable. This can be a variable expression or number
     * @returns {Object} Returns the nerdamer object
     */
    libExports.setVar = function (v, val) {
        validateName(v);
        //check if it's not already a constant
        if(v in _.CONSTANTS)
            err('Cannot set value for constant ' + v);
        if(val === 'delete' || val === '')
            delete VARS[v];
        else {
            VARS[v] = isSymbol(val) ? val : _.parse(val);
        }
        return this;
    };

    /**
     * Returns the value of a set variable
     * @param {type} v
     * @returns {varies}
     */
    libExports.getVar = function (v) {
        return VARS[v];
    };
    /**
     * Clear the variables from the VARS object
     * @returns {Object} Returns the nerdamer object
     */
    libExports.clearVars = function () {
        VARS = {};
        return this;
    };

    /**
     *
     * @param {Function} loader
     * @returns {nerdamer}
     */
    libExports.load = function (loader) {
        loader.call(this);
        return this;
    };

    /**
     * @param {String} output - output format. Can be 'object' (just returns the VARS object), 'text' or 'latex'. Default: 'text'
     * @param {String|String[]} option
     * @returns {Object} Returns an object with the variables
     */
    libExports.getVars = function (output, option) {
        output = output || 'text';
        var variables = {};
        if(output === 'object')
            variables = VARS;
        else {
            for(var v in VARS) {
                if(output === 'latex') {
                    variables[v] = VARS[v].latex(option);
                }
                else if(output === 'text') {
                    variables[v] = VARS[v].text(option);
                }
            }
        }
        return variables;
    };

    /**
     * Set the value of a setting
     * @param {String} setting The setting to be changed
     * @param {boolean} value
     */
    libExports.set = function (setting, value) {
        //current options:
        //PARSE2NUMBER, suppress_errors
        if(typeof setting === 'object')
            for(var x in setting) {
                libExports.set(x, setting[x]);
            }

        var disallowed = ['SAFE'];
        if(disallowed.indexOf(setting) !== -1)
            err('Cannot modify setting: ' + setting);

        if(setting === 'PRECISION') {
            bigDec.set({precision: value});
            Settings.PRECISION = value;

            // Avoid that nerdamer puts out garbage after 21 decimal place
            if(value > 21) {
                this.set('USE_BIG', true);
            }
        }
        else if(setting === 'USE_LN' && value === true) {
            //set log as LN
            Settings.LOG = 'LN';
            //set log10 as log
            Settings.LOG10 = 'log';
            //point the functions in the right direction
            _.functions['log'] = Settings.LOG_FNS.log10; //log is now log10
            //the log10 function must be explicitly set
            _.functions['log'][0] = function (x) {
                if(x.isConstant())
                    return new Symbol(Math.log10(x));
                return _.symfunction(Settings.LOG10, [x]);
            };
            _.functions['LN'] = Settings.LOG_FNS.log; //LN is now log

            //remove log10
            delete _.functions['log10'];
        }
        else
            Settings[setting] = value;
    };

    /**
     * Get the value of a setting
     * @param {type} setting
     * @returns {undefined}
     */
    libExports.get = function (setting) {
        return Settings[setting];
    };

    /**
     * This functions makes internal functions available externally
     * @param {bool} override Override the functions when calling updateAPI if it exists
     */
    libExports.updateAPI = function (override) {
        //Map internal functions to external ones
        var linker = function (fname) {
            return function () {
                var args = [].slice.call(arguments);
                for(var i = 0; i < args.length; i++)
                    args[i] = _.parse(args[i]);
                return new Expression(block('PARSE2NUMBER', function () {
                    return _.callfunction(fname, args);
                }));
            };
        };
        //perform the mapping
        for(var x in _.functions)
            if(!(x in libExports) || override)
                libExports[x] = linker(x);
    };

    libExports.replaceFunction = function (name, fn, num_args) {
        var existing = _.functions[name];
        var new_num_args = typeof num_args === 'undefined' ? existing[1] : num_args;
        _.functions[name] = [fn.call(undefined, existing[0], C), new_num_args];
    };

    libExports.setOperator = function (operator, shift) {
        _.setOperator(operator, shift);
    };

    libExports.getOperator = function (operator) {
        return _.getOperator(operator);
    };

    libExports.aliasOperator = function (operator, withOperator) {
        _.aliasOperator(operator, withOperator);
    };

    libExports.tree = function (expression) {
        return _.tree(_.toRPN(_.tokenize(expression)));
    };

    libExports.htmlTree = function (expression, indent) {
        var tree = this.tree(expression);

        return '<div class="tree">\n' +
                '    <ul>\n' +
                '        <li>\n' +
                tree.toHTML(3, indent) + '\n' +
                '        </li>\n' +
                '    </ul>\n' +
                '</div>';
    };

    libExports.addPeeker = function (name, f) {
        if(_.peekers[name])
            _.peekers[name].push(f);
    };

    libExports.removePeeker = function (name, f) {
        remove(_.peekers[name], f);
    };

    libExports.parse = function (e) {
        return String(e).split(';').map(function (x) {
            return _.parse(x);
        });
    };

    libExports.updateAPI();

    return libExports; //Done
//imports ======================================================================
})({
    //https://github.com/peterolson/BigInteger.js
    bigInt: (function(){
        var bigInt=function(undefined){"use strict";var BASE=1e7,LOG_BASE=7,MAX_INT=9007199254740992,MAX_INT_ARR=smallToArray(MAX_INT),LOG_MAX_INT=Math.log(MAX_INT);function Integer(v,radix){if(typeof v==="undefined")return Integer[0];if(typeof radix!=="undefined")return+radix===10?parseValue(v):parseBase(v,radix);return parseValue(v)}function BigInteger(value,sign){this.value=value;this.sign=sign;this.isSmall=false}BigInteger.prototype=Object.create(Integer.prototype);function SmallInteger(value){this.value=value;this.sign=value<0;this.isSmall=true}SmallInteger.prototype=Object.create(Integer.prototype);function isPrecise(n){return-MAX_INT<n&&n<MAX_INT}function smallToArray(n){if(n<1e7)return[n];if(n<1e14)return[n%1e7,Math.floor(n/1e7)];return[n%1e7,Math.floor(n/1e7)%1e7,Math.floor(n/1e14)]}function arrayToSmall(arr){trim(arr);var length=arr.length;if(length<4&&compareAbs(arr,MAX_INT_ARR)<0){switch(length){case 0:return 0;case 1:return arr[0];case 2:return arr[0]+arr[1]*BASE;default:return arr[0]+(arr[1]+arr[2]*BASE)*BASE}}return arr}function trim(v){var i=v.length;while(v[--i]===0);v.length=i+1}function createArray(length){var x=new Array(length);var i=-1;while(++i<length){x[i]=0}return x}function truncate(n){if(n>0)return Math.floor(n);return Math.ceil(n)}function add(a,b){var l_a=a.length,l_b=b.length,r=new Array(l_a),carry=0,base=BASE,sum,i;for(i=0;i<l_b;i++){sum=a[i]+b[i]+carry;carry=sum>=base?1:0;r[i]=sum-carry*base}while(i<l_a){sum=a[i]+carry;carry=sum===base?1:0;r[i++]=sum-carry*base}if(carry>0)r.push(carry);return r}function addAny(a,b){if(a.length>=b.length)return add(a,b);return add(b,a)}function addSmall(a,carry){var l=a.length,r=new Array(l),base=BASE,sum,i;for(i=0;i<l;i++){sum=a[i]-base+carry;carry=Math.floor(sum/base);r[i]=sum-carry*base;carry+=1}while(carry>0){r[i++]=carry%base;carry=Math.floor(carry/base)}return r}BigInteger.prototype.add=function(v){var n=parseValue(v);if(this.sign!==n.sign){return this.subtract(n.negate())}var a=this.value,b=n.value;if(n.isSmall){return new BigInteger(addSmall(a,Math.abs(b)),this.sign)}return new BigInteger(addAny(a,b),this.sign)};BigInteger.prototype.plus=BigInteger.prototype.add;SmallInteger.prototype.add=function(v){var n=parseValue(v);var a=this.value;if(a<0!==n.sign){return this.subtract(n.negate())}var b=n.value;if(n.isSmall){if(isPrecise(a+b))return new SmallInteger(a+b);b=smallToArray(Math.abs(b))}return new BigInteger(addSmall(b,Math.abs(a)),a<0)};SmallInteger.prototype.plus=SmallInteger.prototype.add;function subtract(a,b){var a_l=a.length,b_l=b.length,r=new Array(a_l),borrow=0,base=BASE,i,difference;for(i=0;i<b_l;i++){difference=a[i]-borrow-b[i];if(difference<0){difference+=base;borrow=1}else borrow=0;r[i]=difference}for(i=b_l;i<a_l;i++){difference=a[i]-borrow;if(difference<0)difference+=base;else{r[i++]=difference;break}r[i]=difference}for(;i<a_l;i++){r[i]=a[i]}trim(r);return r}function subtractAny(a,b,sign){var value;if(compareAbs(a,b)>=0){value=subtract(a,b)}else{value=subtract(b,a);sign=!sign}value=arrayToSmall(value);if(typeof value==="number"){if(sign)value=-value;return new SmallInteger(value)}return new BigInteger(value,sign)}function subtractSmall(a,b,sign){var l=a.length,r=new Array(l),carry=-b,base=BASE,i,difference;for(i=0;i<l;i++){difference=a[i]+carry;carry=Math.floor(difference/base);difference%=base;r[i]=difference<0?difference+base:difference}r=arrayToSmall(r);if(typeof r==="number"){if(sign)r=-r;return new SmallInteger(r)}return new BigInteger(r,sign)}BigInteger.prototype.subtract=function(v){var n=parseValue(v);if(this.sign!==n.sign){return this.add(n.negate())}var a=this.value,b=n.value;if(n.isSmall)return subtractSmall(a,Math.abs(b),this.sign);return subtractAny(a,b,this.sign)};BigInteger.prototype.minus=BigInteger.prototype.subtract;SmallInteger.prototype.subtract=function(v){var n=parseValue(v);var a=this.value;if(a<0!==n.sign){return this.add(n.negate())}var b=n.value;if(n.isSmall){return new SmallInteger(a-b)}return subtractSmall(b,Math.abs(a),a>=0)};SmallInteger.prototype.minus=SmallInteger.prototype.subtract;BigInteger.prototype.negate=function(){return new BigInteger(this.value,!this.sign)};SmallInteger.prototype.negate=function(){var sign=this.sign;var small=new SmallInteger(-this.value);small.sign=!sign;return small};BigInteger.prototype.abs=function(){return new BigInteger(this.value,false)};SmallInteger.prototype.abs=function(){return new SmallInteger(Math.abs(this.value))};function multiplyLong(a,b){var a_l=a.length,b_l=b.length,l=a_l+b_l,r=createArray(l),base=BASE,product,carry,i,a_i,b_j;for(i=0;i<a_l;++i){a_i=a[i];for(var j=0;j<b_l;++j){b_j=b[j];product=a_i*b_j+r[i+j];carry=Math.floor(product/base);r[i+j]=product-carry*base;r[i+j+1]+=carry}}trim(r);return r}function multiplySmall(a,b){var l=a.length,r=new Array(l),base=BASE,carry=0,product,i;for(i=0;i<l;i++){product=a[i]*b+carry;carry=Math.floor(product/base);r[i]=product-carry*base}while(carry>0){r[i++]=carry%base;carry=Math.floor(carry/base)}return r}function shiftLeft(x,n){var r=[];while(n-- >0)r.push(0);return r.concat(x)}function multiplyKaratsuba(x,y){var n=Math.max(x.length,y.length);if(n<=30)return multiplyLong(x,y);n=Math.ceil(n/2);var b=x.slice(n),a=x.slice(0,n),d=y.slice(n),c=y.slice(0,n);var ac=multiplyKaratsuba(a,c),bd=multiplyKaratsuba(b,d),abcd=multiplyKaratsuba(addAny(a,b),addAny(c,d));var product=addAny(addAny(ac,shiftLeft(subtract(subtract(abcd,ac),bd),n)),shiftLeft(bd,2*n));trim(product);return product}function useKaratsuba(l1,l2){return-.012*l1-.012*l2+15e-6*l1*l2>0}BigInteger.prototype.multiply=function(v){var n=parseValue(v),a=this.value,b=n.value,sign=this.sign!==n.sign,abs;if(n.isSmall){if(b===0)return Integer[0];if(b===1)return this;if(b===-1)return this.negate();abs=Math.abs(b);if(abs<BASE){return new BigInteger(multiplySmall(a,abs),sign)}b=smallToArray(abs)}if(useKaratsuba(a.length,b.length))return new BigInteger(multiplyKaratsuba(a,b),sign);return new BigInteger(multiplyLong(a,b),sign)};BigInteger.prototype.times=BigInteger.prototype.multiply;function multiplySmallAndArray(a,b,sign){if(a<BASE){return new BigInteger(multiplySmall(b,a),sign)}return new BigInteger(multiplyLong(b,smallToArray(a)),sign)}SmallInteger.prototype._multiplyBySmall=function(a){if(isPrecise(a.value*this.value)){return new SmallInteger(a.value*this.value)}return multiplySmallAndArray(Math.abs(a.value),smallToArray(Math.abs(this.value)),this.sign!==a.sign)};BigInteger.prototype._multiplyBySmall=function(a){if(a.value===0)return Integer[0];if(a.value===1)return this;if(a.value===-1)return this.negate();return multiplySmallAndArray(Math.abs(a.value),this.value,this.sign!==a.sign)};SmallInteger.prototype.multiply=function(v){return parseValue(v)._multiplyBySmall(this)};SmallInteger.prototype.times=SmallInteger.prototype.multiply;function square(a){var l=a.length,r=createArray(l+l),base=BASE,product,carry,i,a_i,a_j;for(i=0;i<l;i++){a_i=a[i];carry=0-a_i*a_i;for(var j=i;j<l;j++){a_j=a[j];product=2*(a_i*a_j)+r[i+j]+carry;carry=Math.floor(product/base);r[i+j]=product-carry*base}r[i+l]=carry}trim(r);return r}BigInteger.prototype.square=function(){return new BigInteger(square(this.value),false)};SmallInteger.prototype.square=function(){var value=this.value*this.value;if(isPrecise(value))return new SmallInteger(value);return new BigInteger(square(smallToArray(Math.abs(this.value))),false)};function divMod1(a,b){var a_l=a.length,b_l=b.length,base=BASE,result=createArray(b.length),divisorMostSignificantDigit=b[b_l-1],lambda=Math.ceil(base/(2*divisorMostSignificantDigit)),remainder=multiplySmall(a,lambda),divisor=multiplySmall(b,lambda),quotientDigit,shift,carry,borrow,i,l,q;if(remainder.length<=a_l)remainder.push(0);divisor.push(0);divisorMostSignificantDigit=divisor[b_l-1];for(shift=a_l-b_l;shift>=0;shift--){quotientDigit=base-1;if(remainder[shift+b_l]!==divisorMostSignificantDigit){quotientDigit=Math.floor((remainder[shift+b_l]*base+remainder[shift+b_l-1])/divisorMostSignificantDigit)}carry=0;borrow=0;l=divisor.length;for(i=0;i<l;i++){carry+=quotientDigit*divisor[i];q=Math.floor(carry/base);borrow+=remainder[shift+i]-(carry-q*base);carry=q;if(borrow<0){remainder[shift+i]=borrow+base;borrow=-1}else{remainder[shift+i]=borrow;borrow=0}}while(borrow!==0){quotientDigit-=1;carry=0;for(i=0;i<l;i++){carry+=remainder[shift+i]-base+divisor[i];if(carry<0){remainder[shift+i]=carry+base;carry=0}else{remainder[shift+i]=carry;carry=1}}borrow+=carry}result[shift]=quotientDigit}remainder=divModSmall(remainder,lambda)[0];return[arrayToSmall(result),arrayToSmall(remainder)]}function divMod2(a,b){var a_l=a.length,b_l=b.length,result=[],part=[],base=BASE,guess,xlen,highx,highy,check;while(a_l){part.unshift(a[--a_l]);trim(part);if(compareAbs(part,b)<0){result.push(0);continue}xlen=part.length;highx=part[xlen-1]*base+part[xlen-2];highy=b[b_l-1]*base+b[b_l-2];if(xlen>b_l){highx=(highx+1)*base}guess=Math.ceil(highx/highy);do{check=multiplySmall(b,guess);if(compareAbs(check,part)<=0)break;guess--}while(guess);result.push(guess);part=subtract(part,check)}result.reverse();return[arrayToSmall(result),arrayToSmall(part)]}function divModSmall(value,lambda){var length=value.length,quotient=createArray(length),base=BASE,i,q,remainder,divisor;remainder=0;for(i=length-1;i>=0;--i){divisor=remainder*base+value[i];q=truncate(divisor/lambda);remainder=divisor-q*lambda;quotient[i]=q|0}return[quotient,remainder|0]}function divModAny(self,v){var value,n=parseValue(v);var a=self.value,b=n.value;var quotient;if(b===0)throw new Error("Cannot divide by zero");if(self.isSmall){if(n.isSmall){return[new SmallInteger(truncate(a/b)),new SmallInteger(a%b)]}return[Integer[0],self]}if(n.isSmall){if(b===1)return[self,Integer[0]];if(b==-1)return[self.negate(),Integer[0]];var abs=Math.abs(b);if(abs<BASE){value=divModSmall(a,abs);quotient=arrayToSmall(value[0]);var remainder=value[1];if(self.sign)remainder=-remainder;if(typeof quotient==="number"){if(self.sign!==n.sign)quotient=-quotient;return[new SmallInteger(quotient),new SmallInteger(remainder)]}return[new BigInteger(quotient,self.sign!==n.sign),new SmallInteger(remainder)]}b=smallToArray(abs)}var comparison=compareAbs(a,b);if(comparison===-1)return[Integer[0],self];if(comparison===0)return[Integer[self.sign===n.sign?1:-1],Integer[0]];if(a.length+b.length<=200)value=divMod1(a,b);else value=divMod2(a,b);quotient=value[0];var qSign=self.sign!==n.sign,mod=value[1],mSign=self.sign;if(typeof quotient==="number"){if(qSign)quotient=-quotient;quotient=new SmallInteger(quotient)}else quotient=new BigInteger(quotient,qSign);if(typeof mod==="number"){if(mSign)mod=-mod;mod=new SmallInteger(mod)}else mod=new BigInteger(mod,mSign);return[quotient,mod]}BigInteger.prototype.divmod=function(v){var result=divModAny(this,v);return{quotient:result[0],remainder:result[1]}};SmallInteger.prototype.divmod=BigInteger.prototype.divmod;BigInteger.prototype.divide=function(v){return divModAny(this,v)[0]};SmallInteger.prototype.over=SmallInteger.prototype.divide=BigInteger.prototype.over=BigInteger.prototype.divide;BigInteger.prototype.mod=function(v){return divModAny(this,v)[1]};SmallInteger.prototype.remainder=SmallInteger.prototype.mod=BigInteger.prototype.remainder=BigInteger.prototype.mod;BigInteger.prototype.pow=function(v){var n=parseValue(v),a=this.value,b=n.value,value,x,y;if(b===0)return Integer[1];if(a===0)return Integer[0];if(a===1)return Integer[1];if(a===-1)return n.isEven()?Integer[1]:Integer[-1];if(n.sign){return Integer[0]}if(!n.isSmall)throw new Error("The exponent "+n.toString()+" is too large.");if(this.isSmall){if(isPrecise(value=Math.pow(a,b)))return new SmallInteger(truncate(value))}x=this;y=Integer[1];while(true){if(b&1===1){y=y.times(x);--b}if(b===0)break;b/=2;x=x.square()}return y};SmallInteger.prototype.pow=BigInteger.prototype.pow;BigInteger.prototype.modPow=function(exp,mod){exp=parseValue(exp);mod=parseValue(mod);if(mod.isZero())throw new Error("Cannot take modPow with modulus 0");var r=Integer[1],base=this.mod(mod);while(exp.isPositive()){if(base.isZero())return Integer[0];if(exp.isOdd())r=r.multiply(base).mod(mod);exp=exp.divide(2);base=base.square().mod(mod)}return r};SmallInteger.prototype.modPow=BigInteger.prototype.modPow;function compareAbs(a,b){if(a.length!==b.length){return a.length>b.length?1:-1}for(var i=a.length-1;i>=0;i--){if(a[i]!==b[i])return a[i]>b[i]?1:-1}return 0}BigInteger.prototype.compareAbs=function(v){var n=parseValue(v),a=this.value,b=n.value;if(n.isSmall)return 1;return compareAbs(a,b)};SmallInteger.prototype.compareAbs=function(v){var n=parseValue(v),a=Math.abs(this.value),b=n.value;if(n.isSmall){b=Math.abs(b);return a===b?0:a>b?1:-1}return-1};BigInteger.prototype.compare=function(v){if(v===Infinity){return-1}if(v===-Infinity){return 1}var n=parseValue(v),a=this.value,b=n.value;if(this.sign!==n.sign){return n.sign?1:-1}if(n.isSmall){return this.sign?-1:1}return compareAbs(a,b)*(this.sign?-1:1)};BigInteger.prototype.compareTo=BigInteger.prototype.compare;SmallInteger.prototype.compare=function(v){if(v===Infinity){return-1}if(v===-Infinity){return 1}var n=parseValue(v),a=this.value,b=n.value;if(n.isSmall){return a==b?0:a>b?1:-1}if(a<0!==n.sign){return a<0?-1:1}return a<0?1:-1};SmallInteger.prototype.compareTo=SmallInteger.prototype.compare;BigInteger.prototype.equals=function(v){return this.compare(v)===0};SmallInteger.prototype.eq=SmallInteger.prototype.equals=BigInteger.prototype.eq=BigInteger.prototype.equals;BigInteger.prototype.notEquals=function(v){return this.compare(v)!==0};SmallInteger.prototype.neq=SmallInteger.prototype.notEquals=BigInteger.prototype.neq=BigInteger.prototype.notEquals;BigInteger.prototype.greater=function(v){return this.compare(v)>0};SmallInteger.prototype.gt=SmallInteger.prototype.greater=BigInteger.prototype.gt=BigInteger.prototype.greater;BigInteger.prototype.lesser=function(v){return this.compare(v)<0};SmallInteger.prototype.lt=SmallInteger.prototype.lesser=BigInteger.prototype.lt=BigInteger.prototype.lesser;BigInteger.prototype.greaterOrEquals=function(v){return this.compare(v)>=0};SmallInteger.prototype.geq=SmallInteger.prototype.greaterOrEquals=BigInteger.prototype.geq=BigInteger.prototype.greaterOrEquals;BigInteger.prototype.lesserOrEquals=function(v){return this.compare(v)<=0};SmallInteger.prototype.leq=SmallInteger.prototype.lesserOrEquals=BigInteger.prototype.leq=BigInteger.prototype.lesserOrEquals;BigInteger.prototype.isEven=function(){return(this.value[0]&1)===0};SmallInteger.prototype.isEven=function(){return(this.value&1)===0};BigInteger.prototype.isOdd=function(){return(this.value[0]&1)===1};SmallInteger.prototype.isOdd=function(){return(this.value&1)===1};BigInteger.prototype.isPositive=function(){return!this.sign};SmallInteger.prototype.isPositive=function(){return this.value>0};BigInteger.prototype.isNegative=function(){return this.sign};SmallInteger.prototype.isNegative=function(){return this.value<0};BigInteger.prototype.isUnit=function(){return false};SmallInteger.prototype.isUnit=function(){return Math.abs(this.value)===1};BigInteger.prototype.isZero=function(){return false};SmallInteger.prototype.isZero=function(){return this.value===0};BigInteger.prototype.isDivisibleBy=function(v){var n=parseValue(v);var value=n.value;if(value===0)return false;if(value===1)return true;if(value===2)return this.isEven();return this.mod(n).equals(Integer[0])};SmallInteger.prototype.isDivisibleBy=BigInteger.prototype.isDivisibleBy;function isBasicPrime(v){var n=v.abs();if(n.isUnit())return false;if(n.equals(2)||n.equals(3)||n.equals(5))return true;if(n.isEven()||n.isDivisibleBy(3)||n.isDivisibleBy(5))return false;if(n.lesser(49))return true}function millerRabinTest(n,a){var nPrev=n.prev(),b=nPrev,r=0,d,t,i,x;while(b.isEven())b=b.divide(2),r++;next:for(i=0;i<a.length;i++){if(n.lesser(a[i]))continue;x=bigInt(a[i]).modPow(b,n);if(x.equals(Integer[1])||x.equals(nPrev))continue;for(d=r-1;d!=0;d--){x=x.square().mod(n);if(x.isUnit())return false;if(x.equals(nPrev))continue next}return false}return true}BigInteger.prototype.isPrime=function(strict){var isPrime=isBasicPrime(this);if(isPrime!==undefined)return isPrime;var n=this.abs();var bits=n.bitLength();if(bits<=64)return millerRabinTest(n,[2,325,9375,28178,450775,9780504,1795265022]);var logN=Math.log(2)*bits;var t=Math.ceil(strict===true?2*Math.pow(logN,2):logN);for(var a=[],i=0;i<t;i++){a.push(bigInt(i+2))}return millerRabinTest(n,a)};SmallInteger.prototype.isPrime=BigInteger.prototype.isPrime;BigInteger.prototype.isProbablePrime=function(iterations){var isPrime=isBasicPrime(this);if(isPrime!==undefined)return isPrime;var n=this.abs();var t=iterations===undefined?5:iterations;for(var a=[],i=0;i<t;i++){a.push(bigInt.randBetween(2,n.minus(2)))}return millerRabinTest(n,a)};SmallInteger.prototype.isProbablePrime=BigInteger.prototype.isProbablePrime;BigInteger.prototype.modInv=function(n){var t=bigInt.zero,newT=bigInt.one,r=parseValue(n),newR=this.abs(),q,lastT,lastR;while(!newR.equals(bigInt.zero)){q=r.divide(newR);lastT=t;lastR=r;t=newT;r=newR;newT=lastT.subtract(q.multiply(newT));newR=lastR.subtract(q.multiply(newR))}if(!r.equals(1))throw new Error(this.toString()+" and "+n.toString()+" are not co-prime");if(t.compare(0)===-1){t=t.add(n)}if(this.isNegative()){return t.negate()}return t};SmallInteger.prototype.modInv=BigInteger.prototype.modInv;BigInteger.prototype.next=function(){var value=this.value;if(this.sign){return subtractSmall(value,1,this.sign)}return new BigInteger(addSmall(value,1),this.sign)};SmallInteger.prototype.next=function(){var value=this.value;if(value+1<MAX_INT)return new SmallInteger(value+1);return new BigInteger(MAX_INT_ARR,false)};BigInteger.prototype.prev=function(){var value=this.value;if(this.sign){return new BigInteger(addSmall(value,1),true)}return subtractSmall(value,1,this.sign)};SmallInteger.prototype.prev=function(){var value=this.value;if(value-1>-MAX_INT)return new SmallInteger(value-1);return new BigInteger(MAX_INT_ARR,true)};var powersOfTwo=[1];while(2*powersOfTwo[powersOfTwo.length-1]<=BASE)powersOfTwo.push(2*powersOfTwo[powersOfTwo.length-1]);var powers2Length=powersOfTwo.length,highestPower2=powersOfTwo[powers2Length-1];function shift_isSmall(n){return(typeof n==="number"||typeof n==="string")&&+Math.abs(n)<=BASE||n instanceof BigInteger&&n.value.length<=1}BigInteger.prototype.shiftLeft=function(n){if(!shift_isSmall(n)){throw new Error(String(n)+" is too large for shifting.")}n=+n;if(n<0)return this.shiftRight(-n);var result=this;if(result.isZero())return result;while(n>=powers2Length){result=result.multiply(highestPower2);n-=powers2Length-1}return result.multiply(powersOfTwo[n])};SmallInteger.prototype.shiftLeft=BigInteger.prototype.shiftLeft;BigInteger.prototype.shiftRight=function(n){var remQuo;if(!shift_isSmall(n)){throw new Error(String(n)+" is too large for shifting.")}n=+n;if(n<0)return this.shiftLeft(-n);var result=this;while(n>=powers2Length){if(result.isZero()||result.isNegative()&&result.isUnit())return result;remQuo=divModAny(result,highestPower2);result=remQuo[1].isNegative()?remQuo[0].prev():remQuo[0];n-=powers2Length-1}remQuo=divModAny(result,powersOfTwo[n]);return remQuo[1].isNegative()?remQuo[0].prev():remQuo[0]};SmallInteger.prototype.shiftRight=BigInteger.prototype.shiftRight;function bitwise(x,y,fn){y=parseValue(y);var xSign=x.isNegative(),ySign=y.isNegative();var xRem=xSign?x.not():x,yRem=ySign?y.not():y;var xDigit=0,yDigit=0;var xDivMod=null,yDivMod=null;var result=[];while(!xRem.isZero()||!yRem.isZero()){xDivMod=divModAny(xRem,highestPower2);xDigit=xDivMod[1].toJSNumber();if(xSign){xDigit=highestPower2-1-xDigit}yDivMod=divModAny(yRem,highestPower2);yDigit=yDivMod[1].toJSNumber();if(ySign){yDigit=highestPower2-1-yDigit}xRem=xDivMod[0];yRem=yDivMod[0];result.push(fn(xDigit,yDigit))}var sum=fn(xSign?1:0,ySign?1:0)!==0?bigInt(-1):bigInt(0);for(var i=result.length-1;i>=0;i-=1){sum=sum.multiply(highestPower2).add(bigInt(result[i]))}return sum}BigInteger.prototype.not=function(){return this.negate().prev()};SmallInteger.prototype.not=BigInteger.prototype.not;BigInteger.prototype.and=function(n){return bitwise(this,n,function(a,b){return a&b})};SmallInteger.prototype.and=BigInteger.prototype.and;BigInteger.prototype.or=function(n){return bitwise(this,n,function(a,b){return a|b})};SmallInteger.prototype.or=BigInteger.prototype.or;BigInteger.prototype.xor=function(n){return bitwise(this,n,function(a,b){return a^b})};SmallInteger.prototype.xor=BigInteger.prototype.xor;var LOBMASK_I=1<<30,LOBMASK_BI=(BASE&-BASE)*(BASE&-BASE)|LOBMASK_I;function roughLOB(n){var v=n.value,x=typeof v==="number"?v|LOBMASK_I:v[0]+v[1]*BASE|LOBMASK_BI;return x&-x}function integerLogarithm(value,base){if(base.compareTo(value)<=0){var tmp=integerLogarithm(value,base.square(base));var p=tmp.p;var e=tmp.e;var t=p.multiply(base);return t.compareTo(value)<=0?{p:t,e:e*2+1}:{p:p,e:e*2}}return{p:bigInt(1),e:0}}BigInteger.prototype.bitLength=function(){var n=this;if(n.compareTo(bigInt(0))<0){n=n.negate().subtract(bigInt(1))}if(n.compareTo(bigInt(0))===0){return bigInt(0)}return bigInt(integerLogarithm(n,bigInt(2)).e).add(bigInt(1))};SmallInteger.prototype.bitLength=BigInteger.prototype.bitLength;function max(a,b){a=parseValue(a);b=parseValue(b);return a.greater(b)?a:b}function min(a,b){a=parseValue(a);b=parseValue(b);return a.lesser(b)?a:b}function gcd(a,b){a=parseValue(a).abs();b=parseValue(b).abs();if(a.equals(b))return a;if(a.isZero())return b;if(b.isZero())return a;var c=Integer[1],d,t;while(a.isEven()&&b.isEven()){d=Math.min(roughLOB(a),roughLOB(b));a=a.divide(d);b=b.divide(d);c=c.multiply(d)}while(a.isEven()){a=a.divide(roughLOB(a))}do{while(b.isEven()){b=b.divide(roughLOB(b))}if(a.greater(b)){t=b;b=a;a=t}b=b.subtract(a)}while(!b.isZero());return c.isUnit()?a:a.multiply(c)}function lcm(a,b){a=parseValue(a).abs();b=parseValue(b).abs();return a.divide(gcd(a,b)).multiply(b)}function randBetween(a,b){a=parseValue(a);b=parseValue(b);var low=min(a,b),high=max(a,b);var range=high.subtract(low).add(1);if(range.isSmall)return low.add(Math.floor(Math.random()*range));var length=range.value.length-1;var result=[],restricted=true;for(var i=length;i>=0;i--){var top=restricted?range.value[i]:BASE;var digit=truncate(Math.random()*top);result.unshift(digit);if(digit<top)restricted=false}result=arrayToSmall(result);return low.add(typeof result==="number"?new SmallInteger(result):new BigInteger(result,false))}var parseBase=function(text,base){var length=text.length;var i;var absBase=Math.abs(base);for(var i=0;i<length;i++){var c=text[i].toLowerCase();if(c==="-")continue;if(/[a-z0-9]/.test(c)){if(/[0-9]/.test(c)&&+c>=absBase){if(c==="1"&&absBase===1)continue;throw new Error(c+" is not a valid digit in base "+base+".")}else if(c.charCodeAt(0)-87>=absBase){throw new Error(c+" is not a valid digit in base "+base+".")}}}if(2<=base&&base<=36){if(length<=LOG_MAX_INT/Math.log(base)){var result=parseInt(text,base);if(isNaN(result)){throw new Error(c+" is not a valid digit in base "+base+".")}return new SmallInteger(parseInt(text,base))}}base=parseValue(base);var digits=[];var isNegative=text[0]==="-";for(i=isNegative?1:0;i<text.length;i++){var c=text[i].toLowerCase(),charCode=c.charCodeAt(0);if(48<=charCode&&charCode<=57)digits.push(parseValue(c));else if(97<=charCode&&charCode<=122)digits.push(parseValue(c.charCodeAt(0)-87));else if(c==="<"){var start=i;do{i++}while(text[i]!==">");digits.push(parseValue(text.slice(start+1,i)))}else throw new Error(c+" is not a valid character")}return parseBaseFromArray(digits,base,isNegative)};function parseBaseFromArray(digits,base,isNegative){var val=Integer[0],pow=Integer[1],i;for(i=digits.length-1;i>=0;i--){val=val.add(digits[i].times(pow));pow=pow.times(base)}return isNegative?val.negate():val}function stringify(digit){if(digit<=35){return"0123456789abcdefghijklmnopqrstuvwxyz".charAt(digit)}return"<"+digit+">"}function toBase(n,base){base=bigInt(base);if(base.isZero()){if(n.isZero())return{value:[0],isNegative:false};throw new Error("Cannot convert nonzero numbers to base 0.")}if(base.equals(-1)){if(n.isZero())return{value:[0],isNegative:false};if(n.isNegative())return{value:[].concat.apply([],Array.apply(null,Array(-n)).map(Array.prototype.valueOf,[1,0])),isNegative:false};var arr=Array.apply(null,Array(+n-1)).map(Array.prototype.valueOf,[0,1]);arr.unshift([1]);return{value:[].concat.apply([],arr),isNegative:false}}var neg=false;if(n.isNegative()&&base.isPositive()){neg=true;n=n.abs()}if(base.equals(1)){if(n.isZero())return{value:[0],isNegative:false};return{value:Array.apply(null,Array(+n)).map(Number.prototype.valueOf,1),isNegative:neg}}var out=[];var left=n,divmod;while(left.isNegative()||left.compareAbs(base)>=0){divmod=left.divmod(base);left=divmod.quotient;var digit=divmod.remainder;if(digit.isNegative()){digit=base.minus(digit).abs();left=left.next()}out.push(digit.toJSNumber())}out.push(left.toJSNumber());return{value:out.reverse(),isNegative:neg}}function toBaseString(n,base){var arr=toBase(n,base);return(arr.isNegative?"-":"")+arr.value.map(stringify).join("")}BigInteger.prototype.toArray=function(radix){return toBase(this,radix)};SmallInteger.prototype.toArray=function(radix){return toBase(this,radix)};BigInteger.prototype.toString=function(radix){if(radix===undefined)radix=10;if(radix!==10)return toBaseString(this,radix);var v=this.value,l=v.length,str=String(v[--l]),zeros="0000000",digit;while(--l>=0){digit=String(v[l]);str+=zeros.slice(digit.length)+digit}var sign=this.sign?"-":"";return sign+str};SmallInteger.prototype.toString=function(radix){if(radix===undefined)radix=10;if(radix!=10)return toBaseString(this,radix);return String(this.value)};BigInteger.prototype.toJSON=SmallInteger.prototype.toJSON=function(){return this.toString()};BigInteger.prototype.valueOf=function(){return parseInt(this.toString(),10)};BigInteger.prototype.toJSNumber=BigInteger.prototype.valueOf;SmallInteger.prototype.valueOf=function(){return this.value};SmallInteger.prototype.toJSNumber=SmallInteger.prototype.valueOf;function parseStringValue(v){if(isPrecise(+v)){var x=+v;if(x===truncate(x))return new SmallInteger(x);throw new Error("Invalid integer: "+v)}var sign=v[0]==="-";if(sign)v=v.slice(1);var split=v.split(/e/i);if(split.length>2)throw new Error("Invalid integer: "+split.join("e"));if(split.length===2){var exp=split[1];if(exp[0]==="+")exp=exp.slice(1);exp=+exp;if(exp!==truncate(exp)||!isPrecise(exp))throw new Error("Invalid integer: "+exp+" is not a valid exponent.");var text=split[0];var decimalPlace=text.indexOf(".");if(decimalPlace>=0){exp-=text.length-decimalPlace-1;text=text.slice(0,decimalPlace)+text.slice(decimalPlace+1)}if(exp<0)throw new Error("Cannot include negative exponent part for integers");text+=new Array(exp+1).join("0");v=text}var isValid=/^([0-9][0-9]*)$/.test(v);if(!isValid)throw new Error("Invalid integer: "+v);var r=[],max=v.length,l=LOG_BASE,min=max-l;while(max>0){r.push(+v.slice(min,max));min-=l;if(min<0)min=0;max-=l}trim(r);return new BigInteger(r,sign)}function parseNumberValue(v){if(isPrecise(v)){if(v!==truncate(v))throw new Error(v+" is not an integer.");return new SmallInteger(v)}return parseStringValue(v.toString())}function parseValue(v){if(typeof v==="number"){return parseNumberValue(v)}if(typeof v==="string"){return parseStringValue(v)}return v}for(var i=0;i<1e3;i++){Integer[i]=new SmallInteger(i);if(i>0)Integer[-i]=new SmallInteger(-i)}Integer.one=Integer[1];Integer.zero=Integer[0];Integer.minusOne=Integer[-1];Integer.max=max;Integer.min=min;Integer.gcd=gcd;Integer.lcm=lcm;Integer.isInstance=function(x){return x instanceof BigInteger||x instanceof SmallInteger};Integer.randBetween=randBetween;Integer.fromArray=function(digits,base,isNegative){return parseBaseFromArray(digits.map(parseValue),parseValue(base||10),isNegative)};return Integer}();if(typeof module!=="undefined"&&module.hasOwnProperty("exports")){module.exports=bigInt}if(typeof define==="function"&&define.amd){define("big-integer",[],function(){return bigInt})}
        return bigInt;
    })(),
    /*
     *  decimal.js v10.2.1
     *  An arbitrary-precision Decimal type for JavaScript.
     *  https://github.com/MikeMcl/decimal.js
     *  Copyright (c) 2020 Michael Mclaughlin <M8ch88l@gmail.com>
     *  MIT Licence
     */
    bigDec: function(n){"use strict";var e,i,t,r,s=9e15,o=1e9,u="0123456789abcdef",c="2.3025850929940456840179914546843642076011014886287729760333279009675726096773524802359972050895982983419677840422862486334095254650828067566662873690987816894829072083255546808437998948262331985283935053089653777326288461633662222876982198867465436674744042432743651550489343149393914796194044002221051017141748003688084012647080685567743216228355220114804663715659121373450747856947683463616792101806445070648000277502684916746550586856935673420670581136429224554405758925724208241314695689016758940256776311356919292033376587141660230105703089634572075440370847469940168269282808481184289314848524948644871927809676271275775397027668605952496716674183485704422507197965004714951050492214776567636938662976979522110718264549734772662425709429322582798502585509785265383207606726317164309505995087807523710333101197857547331541421808427543863591778117054309827482385045648019095610299291824318237525357709750539565187697510374970888692180205189339507238539205144634197265287286965110862571492198849978748873771345686209167058",f="3.1415926535897932384626433832795028841971693993751058209749445923078164062862089986280348253421170679821480865132823066470938446095505822317253594081284811174502841027019385211055596446229489549303819644288109756659334461284756482337867831652712019091456485669234603486104543266482133936072602491412737245870066063155881748815209209628292540917153643678925903600113305305488204665213841469519415116094330572703657595919530921861173819326117931051185480744623799627495673518857527248912279381830119491298336733624406566430860213949463952247371907021798609437027705392171762931767523846748184676694051320005681271452635608277857713427577896091736371787214684409012249534301465495853710507922796892589235420199561121290219608640344181598136297747713099605187072113499999983729780499510597317328160963185950244594553469083026425223082533446850352619311881710100031378387528865875332083814206171776691473035982534904287554687311595628638823537875937519577818577805321712268066130019278766111959092164201989380952572010654858632789",a={precision:20,rounding:4,modulo:1,toExpNeg:-7,toExpPos:21,minE:-s,maxE:s,crypto:!1},h=!0,d="[DecimalError] ",l=d+"Invalid argument: ",p=d+"Precision limit exceeded",g=d+"crypto unavailable",m=Math.floor,w=Math.pow,v=/^0b([01]+(\.[01]*)?|\.[01]+)(p[+-]?\d+)?$/i,N=/^0x([0-9a-f]+(\.[0-9a-f]*)?|\.[0-9a-f]+)(p[+-]?\d+)?$/i,b=/^0o([0-7]+(\.[0-7]*)?|\.[0-7]+)(p[+-]?\d+)?$/i,E=/^(\d+(\.\d*)?|\.\d+)(e[+-]?\d+)?$/i,x=1e7,y=7,M=c.length-1,q=f.length-1,O={name:"[object Decimal]"};function D(n){var e,i,t,r=n.length-1,s="",o=n[0];if(r>0){for(s+=o,e=1;e<r;e++)t=n[e]+"",(i=y-t.length)&&(s+=k(i)),s+=t;o=n[e],(i=y-(t=o+"").length)&&(s+=k(i))}else if(0===o)return"0";for(;o%10==0;)o/=10;return s+o}function F(n,e,i){if(n!==~~n||n<e||n>i)throw Error(l+n)}function A(n,e,i,t){var r,s,o,u;for(s=n[0];s>=10;s/=10)--e;return--e<0?(e+=y,r=0):(r=Math.ceil((e+1)/y),e%=y),s=w(10,y-e),u=n[r]%s|0,null==t?e<3?(0==e?u=u/100|0:1==e&&(u=u/10|0),o=i<4&&99999==u||i>3&&49999==u||5e4==u||0==u):o=(i<4&&u+1==s||i>3&&u+1==s/2)&&(n[r+1]/s/100|0)==w(10,e-2)-1||(u==s/2||0==u)&&0==(n[r+1]/s/100|0):e<4?(0==e?u=u/1e3|0:1==e?u=u/100|0:2==e&&(u=u/10|0),o=(t||i<4)&&9999==u||!t&&i>3&&4999==u):o=((t||i<4)&&u+1==s||!t&&i>3&&u+1==s/2)&&(n[r+1]/s/1e3|0)==w(10,e-3)-1,o}function S(n,e,i){for(var t,r,s=[0],o=0,c=n.length;o<c;){for(r=s.length;r--;)s[r]*=e;for(s[0]+=u.indexOf(n.charAt(o++)),t=0;t<s.length;t++)s[t]>i-1&&(void 0===s[t+1]&&(s[t+1]=0),s[t+1]+=s[t]/i|0,s[t]%=i)}return s.reverse()}O.absoluteValue=O.abs=function(){var n=new this.constructor(this);return n.s<0&&(n.s=1),P(n)},O.ceil=function(){return P(new this.constructor(this),this.e+1,2)},O.comparedTo=O.cmp=function(n){var e,i,t,r,s=this,o=s.d,u=(n=new s.constructor(n)).d,c=s.s,f=n.s;if(!o||!u)return c&&f?c!==f?c:o===u?0:!o^c<0?1:-1:NaN;if(!o[0]||!u[0])return o[0]?c:u[0]?-f:0;if(c!==f)return c;if(s.e!==n.e)return s.e>n.e^c<0?1:-1;for(e=0,i=(t=o.length)<(r=u.length)?t:r;e<i;++e)if(o[e]!==u[e])return o[e]>u[e]^c<0?1:-1;return t===r?0:t>r^c<0?1:-1},O.cosine=O.cos=function(){var n,e,i=this,t=i.constructor;return i.d?i.d[0]?(n=t.precision,e=t.rounding,t.precision=n+Math.max(i.e,i.sd())+y,t.rounding=1,i=function(n,e){var i,t,r=e.d.length;r<32?(i=Math.ceil(r/3),t=(1/z(4,i)).toString()):(i=16,t="2.3283064365386962890625e-10");n.precision+=i,e=J(n,1,e.times(t),new n(1));for(var s=i;s--;){var o=e.times(e);e=o.times(o).minus(o).times(8).plus(1)}return n.precision-=i,e}(t,G(t,i)),t.precision=n,t.rounding=e,P(2==r||3==r?i.neg():i,n,e,!0)):new t(1):new t(NaN)},O.cubeRoot=O.cbrt=function(){var n,e,i,t,r,s,o,u,c,f,a=this,d=a.constructor;if(!a.isFinite()||a.isZero())return new d(a);for(h=!1,(s=a.s*w(a.s*a,1/3))&&Math.abs(s)!=1/0?t=new d(s.toString()):(i=D(a.d),(s=((n=a.e)-i.length+1)%3)&&(i+=1==s||-2==s?"0":"00"),s=w(i,1/3),n=m((n+1)/3)-(n%3==(n<0?-1:2)),(t=new d(i=s==1/0?"5e"+n:(i=s.toExponential()).slice(0,i.indexOf("e")+1)+n)).s=a.s),o=(n=d.precision)+3;;)if(f=(c=(u=t).times(u).times(u)).plus(a),t=Z(f.plus(a).times(u),f.plus(c),o+2,1),D(u.d).slice(0,o)===(i=D(t.d)).slice(0,o)){if("9999"!=(i=i.slice(o-3,o+1))&&(r||"4999"!=i)){+i&&(+i.slice(1)||"5"!=i.charAt(0))||(P(t,n+1,1),e=!t.times(t).times(t).eq(a));break}if(!r&&(P(u,n+1,0),u.times(u).times(u).eq(a))){t=u;break}o+=4,r=1}return h=!0,P(t,n,d.rounding,e)},O.decimalPlaces=O.dp=function(){var n,e=this.d,i=NaN;if(e){if(i=((n=e.length-1)-m(this.e/y))*y,n=e[n])for(;n%10==0;n/=10)i--;i<0&&(i=0)}return i},O.dividedBy=O.div=function(n){return Z(this,new this.constructor(n))},O.dividedToIntegerBy=O.divToInt=function(n){var e=this.constructor;return P(Z(this,new e(n),0,1,1),e.precision,e.rounding)},O.equals=O.eq=function(n){return 0===this.cmp(n)},O.floor=function(){return P(new this.constructor(this),this.e+1,3)},O.greaterThan=O.gt=function(n){return this.cmp(n)>0},O.greaterThanOrEqualTo=O.gte=function(n){var e=this.cmp(n);return 1==e||0===e},O.hyperbolicCosine=O.cosh=function(){var n,e,i,t,r,s=this,o=s.constructor,u=new o(1);if(!s.isFinite())return new o(s.s?1/0:NaN);if(s.isZero())return u;i=o.precision,t=o.rounding,o.precision=i+Math.max(s.e,s.sd())+4,o.rounding=1,(r=s.d.length)<32?e=(1/z(4,n=Math.ceil(r/3))).toString():(n=16,e="2.3283064365386962890625e-10"),s=J(o,1,s.times(e),new o(1),!0);for(var c,f=n,a=new o(8);f--;)c=s.times(s),s=u.minus(c.times(a.minus(c.times(a))));return P(s,o.precision=i,o.rounding=t,!0)},O.hyperbolicSine=O.sinh=function(){var n,e,i,t,r=this,s=r.constructor;if(!r.isFinite()||r.isZero())return new s(r);if(e=s.precision,i=s.rounding,s.precision=e+Math.max(r.e,r.sd())+4,s.rounding=1,(t=r.d.length)<3)r=J(s,2,r,r,!0);else{n=(n=1.4*Math.sqrt(t))>16?16:0|n,r=J(s,2,r=r.times(1/z(5,n)),r,!0);for(var o,u=new s(5),c=new s(16),f=new s(20);n--;)o=r.times(r),r=r.times(u.plus(o.times(c.times(o).plus(f))))}return s.precision=e,s.rounding=i,P(r,e,i,!0)},O.hyperbolicTangent=O.tanh=function(){var n,e,i=this,t=i.constructor;return i.isFinite()?i.isZero()?new t(i):(n=t.precision,e=t.rounding,t.precision=n+7,t.rounding=1,Z(i.sinh(),i.cosh(),t.precision=n,t.rounding=e)):new t(i.s)},O.inverseCosine=O.acos=function(){var n,e=this,i=e.constructor,t=e.abs().cmp(1),r=i.precision,s=i.rounding;return-1!==t?0===t?e.isNeg()?U(i,r,s):new i(0):new i(NaN):e.isZero()?U(i,r+4,s).times(.5):(i.precision=r+6,i.rounding=1,e=e.asin(),n=U(i,r+4,s).times(.5),i.precision=r,i.rounding=s,n.minus(e))},O.inverseHyperbolicCosine=O.acosh=function(){var n,e,i=this,t=i.constructor;return i.lte(1)?new t(i.eq(1)?0:NaN):i.isFinite()?(n=t.precision,e=t.rounding,t.precision=n+Math.max(Math.abs(i.e),i.sd())+4,t.rounding=1,h=!1,i=i.times(i).minus(1).sqrt().plus(i),h=!0,t.precision=n,t.rounding=e,i.ln()):new t(i)},O.inverseHyperbolicSine=O.asinh=function(){var n,e,i=this,t=i.constructor;return!i.isFinite()||i.isZero()?new t(i):(n=t.precision,e=t.rounding,t.precision=n+2*Math.max(Math.abs(i.e),i.sd())+6,t.rounding=1,h=!1,i=i.times(i).plus(1).sqrt().plus(i),h=!0,t.precision=n,t.rounding=e,i.ln())},O.inverseHyperbolicTangent=O.atanh=function(){var n,e,i,t,r=this,s=r.constructor;return r.isFinite()?r.e>=0?new s(r.abs().eq(1)?r.s/0:r.isZero()?r:NaN):(n=s.precision,e=s.rounding,t=r.sd(),Math.max(t,n)<2*-r.e-1?P(new s(r),n,e,!0):(s.precision=i=t-r.e,r=Z(r.plus(1),new s(1).minus(r),i+n,1),s.precision=n+4,s.rounding=1,r=r.ln(),s.precision=n,s.rounding=e,r.times(.5))):new s(NaN)},O.inverseSine=O.asin=function(){var n,e,i,t,r=this,s=r.constructor;return r.isZero()?new s(r):(e=r.abs().cmp(1),i=s.precision,t=s.rounding,-1!==e?0===e?((n=U(s,i+4,t).times(.5)).s=r.s,n):new s(NaN):(s.precision=i+6,s.rounding=1,r=r.div(new s(1).minus(r.times(r)).sqrt().plus(1)).atan(),s.precision=i,s.rounding=t,r.times(2)))},O.inverseTangent=O.atan=function(){var n,e,i,t,r,s,o,u,c,f=this,a=f.constructor,d=a.precision,l=a.rounding;if(f.isFinite()){if(f.isZero())return new a(f);if(f.abs().eq(1)&&d+4<=q)return(o=U(a,d+4,l).times(.25)).s=f.s,o}else{if(!f.s)return new a(NaN);if(d+4<=q)return(o=U(a,d+4,l).times(.5)).s=f.s,o}for(a.precision=u=d+10,a.rounding=1,n=i=Math.min(28,u/y+2|0);n;--n)f=f.div(f.times(f).plus(1).sqrt().plus(1));for(h=!1,e=Math.ceil(u/y),t=1,c=f.times(f),o=new a(f),r=f;-1!==n;)if(r=r.times(c),s=o.minus(r.div(t+=2)),r=r.times(c),void 0!==(o=s.plus(r.div(t+=2))).d[e])for(n=e;o.d[n]===s.d[n]&&n--;);return i&&(o=o.times(2<<i-1)),h=!0,P(o,a.precision=d,a.rounding=l,!0)},O.isFinite=function(){return!!this.d},O.isInteger=O.isInt=function(){return!!this.d&&m(this.e/y)>this.d.length-2},O.isNaN=function(){return!this.s},O.isNegative=O.isNeg=function(){return this.s<0},O.isPositive=O.isPos=function(){return this.s>0},O.isZero=function(){return!!this.d&&0===this.d[0]},O.lessThan=O.lt=function(n){return this.cmp(n)<0},O.lessThanOrEqualTo=O.lte=function(n){return this.cmp(n)<1},O.logarithm=O.log=function(n){var e,i,t,r,s,o,u,c,f=this.constructor,a=f.precision,d=f.rounding;if(null==n)n=new f(10),e=!0;else{if(i=(n=new f(n)).d,n.s<0||!i||!i[0]||n.eq(1))return new f(NaN);e=n.eq(10)}if(i=this.d,this.s<0||!i||!i[0]||this.eq(1))return new f(i&&!i[0]?-1/0:1!=this.s?NaN:i?0:1/0);if(e)if(i.length>1)s=!0;else{for(r=i[0];r%10==0;)r/=10;s=1!==r}if(h=!1,o=V(this,u=a+5),t=e?T(f,u+10):V(n,u),A((c=Z(o,t,u,1)).d,r=a,d))do{if(o=V(this,u+=10),t=e?T(f,u+10):V(n,u),c=Z(o,t,u,1),!s){+D(c.d).slice(r+1,r+15)+1==1e14&&(c=P(c,a+1,0));break}}while(A(c.d,r+=10,d));return h=!0,P(c,a,d)},O.minus=O.sub=function(n){var e,i,t,r,s,o,u,c,f,a,d,l,p=this,g=p.constructor;if(n=new g(n),!p.d||!n.d)return p.s&&n.s?p.d?n.s=-n.s:n=new g(n.d||p.s!==n.s?p:NaN):n=new g(NaN),n;if(p.s!=n.s)return n.s=-n.s,p.plus(n);if(f=p.d,l=n.d,u=g.precision,c=g.rounding,!f[0]||!l[0]){if(l[0])n.s=-n.s;else{if(!f[0])return new g(3===c?-0:0);n=new g(p)}return h?P(n,u,c):n}if(i=m(n.e/y),a=m(p.e/y),f=f.slice(),s=a-i){for((d=s<0)?(e=f,s=-s,o=l.length):(e=l,i=a,o=f.length),s>(t=Math.max(Math.ceil(u/y),o)+2)&&(s=t,e.length=1),e.reverse(),t=s;t--;)e.push(0);e.reverse()}else{for((d=(t=f.length)<(o=l.length))&&(o=t),t=0;t<o;t++)if(f[t]!=l[t]){d=f[t]<l[t];break}s=0}for(d&&(e=f,f=l,l=e,n.s=-n.s),o=f.length,t=l.length-o;t>0;--t)f[o++]=0;for(t=l.length;t>s;){if(f[--t]<l[t]){for(r=t;r&&0===f[--r];)f[r]=x-1;--f[r],f[t]+=x}f[t]-=l[t]}for(;0===f[--o];)f.pop();for(;0===f[0];f.shift())--i;return f[0]?(n.d=f,n.e=L(f,i),h?P(n,u,c):n):new g(3===c?-0:0)},O.modulo=O.mod=function(n){var e,i=this,t=i.constructor;return n=new t(n),!i.d||!n.s||n.d&&!n.d[0]?new t(NaN):!n.d||i.d&&!i.d[0]?P(new t(i),t.precision,t.rounding):(h=!1,9==t.modulo?(e=Z(i,n.abs(),0,3,1)).s*=n.s:e=Z(i,n,0,t.modulo,1),e=e.times(n),h=!0,i.minus(e))},O.naturalExponential=O.exp=function(){return B(this)},O.naturalLogarithm=O.ln=function(){return V(this)},O.negated=O.neg=function(){var n=new this.constructor(this);return n.s=-n.s,P(n)},O.plus=O.add=function(n){var e,i,t,r,s,o,u,c,f,a,d=this,l=d.constructor;if(n=new l(n),!d.d||!n.d)return d.s&&n.s?d.d||(n=new l(n.d||d.s===n.s?d:NaN)):n=new l(NaN),n;if(d.s!=n.s)return n.s=-n.s,d.minus(n);if(f=d.d,a=n.d,u=l.precision,c=l.rounding,!f[0]||!a[0])return a[0]||(n=new l(d)),h?P(n,u,c):n;if(s=m(d.e/y),t=m(n.e/y),f=f.slice(),r=s-t){for(r<0?(i=f,r=-r,o=a.length):(i=a,t=s,o=f.length),r>(o=(s=Math.ceil(u/y))>o?s+1:o+1)&&(r=o,i.length=1),i.reverse();r--;)i.push(0);i.reverse()}for((o=f.length)-(r=a.length)<0&&(r=o,i=a,a=f,f=i),e=0;r;)e=(f[--r]=f[r]+a[r]+e)/x|0,f[r]%=x;for(e&&(f.unshift(e),++t),o=f.length;0==f[--o];)f.pop();return n.d=f,n.e=L(f,t),h?P(n,u,c):n},O.precision=O.sd=function(n){var e,i=this;if(void 0!==n&&n!==!!n&&1!==n&&0!==n)throw Error(l+n);return i.d?(e=_(i.d),n&&i.e+1>e&&(e=i.e+1)):e=NaN,e},O.round=function(){var n=this,e=n.constructor;return P(new e(n),n.e+1,e.rounding)},O.sine=O.sin=function(){var n,e,i=this,t=i.constructor;return i.isFinite()?i.isZero()?new t(i):(n=t.precision,e=t.rounding,t.precision=n+Math.max(i.e,i.sd())+y,t.rounding=1,i=function(n,e){var i,t=e.d.length;if(t<3)return J(n,2,e,e);i=(i=1.4*Math.sqrt(t))>16?16:0|i,e=e.times(1/z(5,i)),e=J(n,2,e,e);for(var r,s=new n(5),o=new n(16),u=new n(20);i--;)r=e.times(e),e=e.times(s.plus(r.times(o.times(r).minus(u))));return e}(t,G(t,i)),t.precision=n,t.rounding=e,P(r>2?i.neg():i,n,e,!0)):new t(NaN)},O.squareRoot=O.sqrt=function(){var n,e,i,t,r,s,o=this,u=o.d,c=o.e,f=o.s,a=o.constructor;if(1!==f||!u||!u[0])return new a(!f||f<0&&(!u||u[0])?NaN:u?o:1/0);for(h=!1,0==(f=Math.sqrt(+o))||f==1/0?(((e=D(u)).length+c)%2==0&&(e+="0"),f=Math.sqrt(e),c=m((c+1)/2)-(c<0||c%2),t=new a(e=f==1/0?"5e"+c:(e=f.toExponential()).slice(0,e.indexOf("e")+1)+c)):t=new a(f.toString()),i=(c=a.precision)+3;;)if(t=(s=t).plus(Z(o,s,i+2,1)).times(.5),D(s.d).slice(0,i)===(e=D(t.d)).slice(0,i)){if("9999"!=(e=e.slice(i-3,i+1))&&(r||"4999"!=e)){+e&&(+e.slice(1)||"5"!=e.charAt(0))||(P(t,c+1,1),n=!t.times(t).eq(o));break}if(!r&&(P(s,c+1,0),s.times(s).eq(o))){t=s;break}i+=4,r=1}return h=!0,P(t,c,a.rounding,n)},O.tangent=O.tan=function(){var n,e,i=this,t=i.constructor;return i.isFinite()?i.isZero()?new t(i):(n=t.precision,e=t.rounding,t.precision=n+10,t.rounding=1,(i=i.sin()).s=1,i=Z(i,new t(1).minus(i.times(i)).sqrt(),n+10,0),t.precision=n,t.rounding=e,P(2==r||4==r?i.neg():i,n,e,!0)):new t(NaN)},O.times=O.mul=function(n){var e,i,t,r,s,o,u,c,f,a=this,d=a.constructor,l=a.d,p=(n=new d(n)).d;if(n.s*=a.s,!(l&&l[0]&&p&&p[0]))return new d(!n.s||l&&!l[0]&&!p||p&&!p[0]&&!l?NaN:l&&p?0*n.s:n.s/0);for(i=m(a.e/y)+m(n.e/y),(c=l.length)<(f=p.length)&&(s=l,l=p,p=s,o=c,c=f,f=o),s=[],t=o=c+f;t--;)s.push(0);for(t=f;--t>=0;){for(e=0,r=c+t;r>t;)u=s[r]+p[t]*l[r-t-1]+e,s[r--]=u%x|0,e=u/x|0;s[r]=(s[r]+e)%x|0}for(;!s[--o];)s.pop();return e?++i:s.shift(),n.d=s,n.e=L(s,i),h?P(n,d.precision,d.rounding):n},O.toBinary=function(n,e){return K(this,2,n,e)},O.toDecimalPlaces=O.toDP=function(n,e){var i=this,t=i.constructor;return i=new t(i),void 0===n?i:(F(n,0,o),void 0===e?e=t.rounding:F(e,0,8),P(i,n+i.e+1,e))},O.toExponential=function(n,e){var i,t=this,r=t.constructor;return void 0===n?i=R(t,!0):(F(n,0,o),void 0===e?e=r.rounding:F(e,0,8),i=R(t=P(new r(t),n+1,e),!0,n+1)),t.isNeg()&&!t.isZero()?"-"+i:i},O.toFixed=function(n,e){var i,t,r=this,s=r.constructor;return void 0===n?i=R(r):(F(n,0,o),void 0===e?e=s.rounding:F(e,0,8),i=R(t=P(new s(r),n+r.e+1,e),!1,n+t.e+1)),r.isNeg()&&!r.isZero()?"-"+i:i},O.toFraction=function(n){var e,i,t,r,s,o,u,c,f,a,d,p,g=this,m=g.d,v=g.constructor;if(!m)return new v(g);if(f=i=new v(1),t=c=new v(0),o=(s=(e=new v(t)).e=_(m)-g.e-1)%y,e.d[0]=w(10,o<0?y+o:o),null==n)n=s>0?e:f;else{if(!(u=new v(n)).isInt()||u.lt(f))throw Error(l+u);n=u.gt(e)?s>0?e:f:u}for(h=!1,u=new v(D(m)),a=v.precision,v.precision=s=m.length*y*2;d=Z(u,e,0,1,1),1!=(r=i.plus(d.times(t))).cmp(n);)i=t,t=r,r=f,f=c.plus(d.times(r)),c=r,r=e,e=u.minus(d.times(r)),u=r;return r=Z(n.minus(i),t,0,1,1),c=c.plus(r.times(f)),i=i.plus(r.times(t)),c.s=f.s=g.s,p=Z(f,t,s,1).minus(g).abs().cmp(Z(c,i,s,1).minus(g).abs())<1?[f,t]:[c,i],v.precision=a,h=!0,p},O.toHexadecimal=O.toHex=function(n,e){return K(this,16,n,e)},O.toNearest=function(n,e){var i=this,t=i.constructor;if(i=new t(i),null==n){if(!i.d)return i;n=new t(1),e=t.rounding}else{if(n=new t(n),void 0===e?e=t.rounding:F(e,0,8),!i.d)return n.s?i:n;if(!n.d)return n.s&&(n.s=i.s),n}return n.d[0]?(h=!1,i=Z(i,n,0,e,1).times(n),h=!0,P(i)):(n.s=i.s,i=n),i},O.toNumber=function(){return+this},O.toOctal=function(n,e){return K(this,8,n,e)},O.toPower=O.pow=function(n){var e,i,t,r,s,o,u=this,c=u.constructor,f=+(n=new c(n));if(!(u.d&&n.d&&u.d[0]&&n.d[0]))return new c(w(+u,f));if((u=new c(u)).eq(1))return u;if(t=c.precision,s=c.rounding,n.eq(1))return P(u,t,s);if((e=m(n.e/y))>=n.d.length-1&&(i=f<0?-f:f)<=9007199254740991)return r=C(c,u,i,t),n.s<0?new c(1).div(r):P(r,t,s);if((o=u.s)<0){if(e<n.d.length-1)return new c(NaN);if(0==(1&n.d[e])&&(o=1),0==u.e&&1==u.d[0]&&1==u.d.length)return u.s=o,u}return(e=0!=(i=w(+u,f))&&isFinite(i)?new c(i+"").e:m(f*(Math.log("0."+D(u.d))/Math.LN10+u.e+1)))>c.maxE+1||e<c.minE-1?new c(e>0?o/0:0):(h=!1,c.rounding=u.s=1,i=Math.min(12,(e+"").length),(r=B(n.times(V(u,t+i)),t)).d&&A((r=P(r,t+5,1)).d,t,s)&&(e=t+10,+D((r=P(B(n.times(V(u,e+i)),e),e+5,1)).d).slice(t+1,t+15)+1==1e14&&(r=P(r,t+1,0))),r.s=o,h=!0,c.rounding=s,P(r,t,s))},O.toPrecision=function(n,e){var i,t=this,r=t.constructor;return void 0===n?i=R(t,t.e<=r.toExpNeg||t.e>=r.toExpPos):(F(n,1,o),void 0===e?e=r.rounding:F(e,0,8),i=R(t=P(new r(t),n,e),n<=t.e||t.e<=r.toExpNeg,n)),t.isNeg()&&!t.isZero()?"-"+i:i},O.toSignificantDigits=O.toSD=function(n,e){var i=this.constructor;return void 0===n?(n=i.precision,e=i.rounding):(F(n,1,o),void 0===e?e=i.rounding:F(e,0,8)),P(new i(this),n,e)},O.toString=function(){var n=this,e=n.constructor,i=R(n,n.e<=e.toExpNeg||n.e>=e.toExpPos);return n.isNeg()&&!n.isZero()?"-"+i:i},O.truncated=O.trunc=function(){return P(new this.constructor(this),this.e+1,1)},O.valueOf=O.toJSON=function(){var n=this,e=n.constructor,i=R(n,n.e<=e.toExpNeg||n.e>=e.toExpPos);return n.isNeg()?"-"+i:i};var Z=function(){function n(n,e,i){var t,r=0,s=n.length;for(n=n.slice();s--;)t=n[s]*e+r,n[s]=t%i|0,r=t/i|0;return r&&n.unshift(r),n}function e(n,e,i,t){var r,s;if(i!=t)s=i>t?1:-1;else for(r=s=0;r<i;r++)if(n[r]!=e[r]){s=n[r]>e[r]?1:-1;break}return s}function t(n,e,i,t){for(var r=0;i--;)n[i]-=r,r=n[i]<e[i]?1:0,n[i]=r*t+n[i]-e[i];for(;!n[0]&&n.length>1;)n.shift()}return function(r,s,o,u,c,f){var a,h,d,l,p,g,w,v,N,b,E,M,q,O,D,F,A,S,Z,R,L=r.constructor,T=r.s==s.s?1:-1,U=r.d,_=s.d;if(!(U&&U[0]&&_&&_[0]))return new L(r.s&&s.s&&(U?!_||U[0]!=_[0]:_)?U&&0==U[0]||!_?0*T:T/0:NaN);for(f?(p=1,h=r.e-s.e):(f=x,p=y,h=m(r.e/p)-m(s.e/p)),Z=_.length,A=U.length,b=(N=new L(T)).d=[],d=0;_[d]==(U[d]||0);d++);if(_[d]>(U[d]||0)&&h--,null==o?(O=o=L.precision,u=L.rounding):O=c?o+(r.e-s.e)+1:o,O<0)b.push(1),g=!0;else{if(O=O/p+2|0,d=0,1==Z){for(l=0,_=_[0],O++;(d<A||l)&&O--;d++)D=l*f+(U[d]||0),b[d]=D/_|0,l=D%_|0;g=l||d<A}else{for((l=f/(_[0]+1)|0)>1&&(_=n(_,l,f),U=n(U,l,f),Z=_.length,A=U.length),F=Z,M=(E=U.slice(0,Z)).length;M<Z;)E[M++]=0;(R=_.slice()).unshift(0),S=_[0],_[1]>=f/2&&++S;do{l=0,(a=e(_,E,Z,M))<0?(q=E[0],Z!=M&&(q=q*f+(E[1]||0)),(l=q/S|0)>1?(l>=f&&(l=f-1),1==(a=e(w=n(_,l,f),E,v=w.length,M=E.length))&&(l--,t(w,Z<v?R:_,v,f))):(0==l&&(a=l=1),w=_.slice()),(v=w.length)<M&&w.unshift(0),t(E,w,M,f),-1==a&&(a=e(_,E,Z,M=E.length))<1&&(l++,t(E,Z<M?R:_,M,f)),M=E.length):0===a&&(l++,E=[0]),b[d++]=l,a&&E[0]?E[M++]=U[F]||0:(E=[U[F]],M=1)}while((F++<A||void 0!==E[0])&&O--);g=void 0!==E[0]}b[0]||b.shift()}if(1==p)N.e=h,i=g;else{for(d=1,l=b[0];l>=10;l/=10)d++;N.e=d+h*p-1,P(N,c?o+N.e+1:o,u,g)}return N}}();function P(n,e,i,t){var r,s,o,u,c,f,a,d,l,p=n.constructor;n:if(null!=e){if(!(d=n.d))return n;for(r=1,u=d[0];u>=10;u/=10)r++;if((s=e-r)<0)s+=y,o=e,c=(a=d[l=0])/w(10,r-o-1)%10|0;else if((l=Math.ceil((s+1)/y))>=(u=d.length)){if(!t)break n;for(;u++<=l;)d.push(0);a=c=0,r=1,o=(s%=y)-y+1}else{for(a=u=d[l],r=1;u>=10;u/=10)r++;c=(o=(s%=y)-y+r)<0?0:a/w(10,r-o-1)%10|0}if(t=t||e<0||void 0!==d[l+1]||(o<0?a:a%w(10,r-o-1)),f=i<4?(c||t)&&(0==i||i==(n.s<0?3:2)):c>5||5==c&&(4==i||t||6==i&&(s>0?o>0?a/w(10,r-o):0:d[l-1])%10&1||i==(n.s<0?8:7)),e<1||!d[0])return d.length=0,f?(e-=n.e+1,d[0]=w(10,(y-e%y)%y),n.e=-e||0):d[0]=n.e=0,n;if(0==s?(d.length=l,u=1,l--):(d.length=l+1,u=w(10,y-s),d[l]=o>0?(a/w(10,r-o)%w(10,o)|0)*u:0),f)for(;;){if(0==l){for(s=1,o=d[0];o>=10;o/=10)s++;for(o=d[0]+=u,u=1;o>=10;o/=10)u++;s!=u&&(n.e++,d[0]==x&&(d[0]=1));break}if(d[l]+=u,d[l]!=x)break;d[l--]=0,u=1}for(s=d.length;0===d[--s];)d.pop()}return h&&(n.e>p.maxE?(n.d=null,n.e=NaN):n.e<p.minE&&(n.e=0,n.d=[0])),n}function R(n,e,i){if(!n.isFinite())return j(n);var t,r=n.e,s=D(n.d),o=s.length;return e?(i&&(t=i-o)>0?s=s.charAt(0)+"."+s.slice(1)+k(t):o>1&&(s=s.charAt(0)+"."+s.slice(1)),s=s+(n.e<0?"e":"e+")+n.e):r<0?(s="0."+k(-r-1)+s,i&&(t=i-o)>0&&(s+=k(t))):r>=o?(s+=k(r+1-o),i&&(t=i-r-1)>0&&(s=s+"."+k(t))):((t=r+1)<o&&(s=s.slice(0,t)+"."+s.slice(t)),i&&(t=i-o)>0&&(r+1===o&&(s+="."),s+=k(t))),s}function L(n,e){var i=n[0];for(e*=y;i>=10;i/=10)e++;return e}function T(n,e,i){if(e>M)throw h=!0,i&&(n.precision=i),Error(p);return P(new n(c),e,1,!0)}function U(n,e,i){if(e>q)throw Error(p);return P(new n(f),e,i,!0)}function _(n){var e=n.length-1,i=e*y+1;if(e=n[e]){for(;e%10==0;e/=10)i--;for(e=n[0];e>=10;e/=10)i++}return i}function k(n){for(var e="";n--;)e+="0";return e}function C(n,e,i,t){var r,s=new n(1),o=Math.ceil(t/y+4);for(h=!1;;){if(i%2&&Q((s=s.times(e)).d,o)&&(r=!0),0===(i=m(i/2))){i=s.d.length-1,r&&0===s.d[i]&&++s.d[i];break}Q((e=e.times(e)).d,o)}return h=!0,s}function I(n){return 1&n.d[n.d.length-1]}function H(n,e,i){for(var t,r=new n(e[0]),s=0;++s<e.length;){if(!(t=new n(e[s])).s){r=t;break}r[i](t)&&(r=t)}return r}function B(n,e){var i,t,r,s,o,u,c,f=0,a=0,d=0,l=n.constructor,p=l.rounding,g=l.precision;if(!n.d||!n.d[0]||n.e>17)return new l(n.d?n.d[0]?n.s<0?0:1/0:1:n.s?n.s<0?0:n:NaN);for(null==e?(h=!1,c=g):c=e,u=new l(.03125);n.e>-2;)n=n.times(u),d+=5;for(c+=t=Math.log(w(2,d))/Math.LN10*2+5|0,i=s=o=new l(1),l.precision=c;;){if(s=P(s.times(n),c,1),i=i.times(++a),D((u=o.plus(Z(s,i,c,1))).d).slice(0,c)===D(o.d).slice(0,c)){for(r=d;r--;)o=P(o.times(o),c,1);if(null!=e)return l.precision=g,o;if(!(f<3&&A(o.d,c-t,p,f)))return P(o,l.precision=g,p,h=!0);l.precision=c+=10,i=s=u=new l(1),a=0,f++}o=u}}function V(n,e){var i,t,r,s,o,u,c,f,a,d,l,p=1,g=n,m=g.d,w=g.constructor,v=w.rounding,N=w.precision;if(g.s<0||!m||!m[0]||!g.e&&1==m[0]&&1==m.length)return new w(m&&!m[0]?-1/0:1!=g.s?NaN:m?0:g);if(null==e?(h=!1,a=N):a=e,w.precision=a+=10,t=(i=D(m)).charAt(0),!(Math.abs(s=g.e)<15e14))return f=T(w,a+2,N).times(s+""),g=V(new w(t+"."+i.slice(1)),a-10).plus(f),w.precision=N,null==e?P(g,N,v,h=!0):g;for(;t<7&&1!=t||1==t&&i.charAt(1)>3;)t=(i=D((g=g.times(n)).d)).charAt(0),p++;for(s=g.e,t>1?(g=new w("0."+i),s++):g=new w(t+"."+i.slice(1)),d=g,c=o=g=Z(g.minus(1),g.plus(1),a,1),l=P(g.times(g),a,1),r=3;;){if(o=P(o.times(l),a,1),D((f=c.plus(Z(o,new w(r),a,1))).d).slice(0,a)===D(c.d).slice(0,a)){if(c=c.times(2),0!==s&&(c=c.plus(T(w,a+2,N).times(s+""))),c=Z(c,new w(p),a,1),null!=e)return w.precision=N,c;if(!A(c.d,a-10,v,u))return P(c,w.precision=N,v,h=!0);w.precision=a+=10,f=o=g=Z(d.minus(1),d.plus(1),a,1),l=P(g.times(g),a,1),r=u=1}c=f,r+=2}}function j(n){return String(n.s*n.s/0)}function $(n,e){var i,t,r;for((i=e.indexOf("."))>-1&&(e=e.replace(".","")),(t=e.search(/e/i))>0?(i<0&&(i=t),i+=+e.slice(t+1),e=e.substring(0,t)):i<0&&(i=e.length),t=0;48===e.charCodeAt(t);t++);for(r=e.length;48===e.charCodeAt(r-1);--r);if(e=e.slice(t,r)){if(r-=t,n.e=i=i-t-1,n.d=[],t=(i+1)%y,i<0&&(t+=y),t<r){for(t&&n.d.push(+e.slice(0,t)),r-=y;t<r;)n.d.push(+e.slice(t,t+=y));e=e.slice(t),t=y-e.length}else t-=r;for(;t--;)e+="0";n.d.push(+e),h&&(n.e>n.constructor.maxE?(n.d=null,n.e=NaN):n.e<n.constructor.minE&&(n.e=0,n.d=[0]))}else n.e=0,n.d=[0];return n}function W(n,i){var t,r,s,o,u,c,f,a,d;if("Infinity"===i||"NaN"===i)return+i||(n.s=NaN),n.e=NaN,n.d=null,n;if(N.test(i))t=16,i=i.toLowerCase();else if(v.test(i))t=2;else{if(!b.test(i))throw Error(l+i);t=8}for((o=i.search(/p/i))>0?(f=+i.slice(o+1),i=i.substring(2,o)):i=i.slice(2),u=(o=i.indexOf("."))>=0,r=n.constructor,u&&(o=(c=(i=i.replace(".","")).length)-o,s=C(r,new r(t),o,2*o)),o=d=(a=S(i,t,x)).length-1;0===a[o];--o)a.pop();return o<0?new r(0*n.s):(n.e=L(a,d),n.d=a,h=!1,u&&(n=Z(n,s,4*c)),f&&(n=n.times(Math.abs(f)<54?w(2,f):e.pow(2,f))),h=!0,n)}function J(n,e,i,t,r){var s,o,u,c,f=n.precision,a=Math.ceil(f/y);for(h=!1,c=i.times(i),u=new n(t);;){if(o=Z(u.times(c),new n(e++*e++),f,1),u=r?t.plus(o):t.minus(o),t=Z(o.times(c),new n(e++*e++),f,1),void 0!==(o=u.plus(t)).d[a]){for(s=a;o.d[s]===u.d[s]&&s--;);if(-1==s)break}s=u,u=t,t=o,o=s,0}return h=!0,o.d.length=a+1,o}function z(n,e){for(var i=n;--e;)i*=n;return i}function G(n,e){var i,t=e.s<0,s=U(n,n.precision,1),o=s.times(.5);if((e=e.abs()).lte(o))return r=t?4:1,e;if((i=e.divToInt(s)).isZero())r=t?3:2;else{if((e=e.minus(i.times(s))).lte(o))return r=I(i)?t?2:3:t?4:1,e;r=I(i)?t?1:4:t?3:2}return e.minus(s).abs()}function K(n,e,t,r){var s,c,f,a,h,d,l,p,g,m=n.constructor,w=void 0!==t;if(w?(F(t,1,o),void 0===r?r=m.rounding:F(r,0,8)):(t=m.precision,r=m.rounding),n.isFinite()){for(w?(s=2,16==e?t=4*t-3:8==e&&(t=3*t-2)):s=e,(f=(l=R(n)).indexOf("."))>=0&&(l=l.replace(".",""),(g=new m(1)).e=l.length-f,g.d=S(R(g),10,s),g.e=g.d.length),c=h=(p=S(l,10,s)).length;0==p[--h];)p.pop();if(p[0]){if(f<0?c--:((n=new m(n)).d=p,n.e=c,p=(n=Z(n,g,t,r,0,s)).d,c=n.e,d=i),f=p[t],a=s/2,d=d||void 0!==p[t+1],d=r<4?(void 0!==f||d)&&(0===r||r===(n.s<0?3:2)):f>a||f===a&&(4===r||d||6===r&&1&p[t-1]||r===(n.s<0?8:7)),p.length=t,d)for(;++p[--t]>s-1;)p[t]=0,t||(++c,p.unshift(1));for(h=p.length;!p[h-1];--h);for(f=0,l="";f<h;f++)l+=u.charAt(p[f]);if(w){if(h>1)if(16==e||8==e){for(f=16==e?4:3,--h;h%f;h++)l+="0";for(h=(p=S(l,s,e)).length;!p[h-1];--h);for(f=1,l="1.";f<h;f++)l+=u.charAt(p[f])}else l=l.charAt(0)+"."+l.slice(1);l=l+(c<0?"p":"p+")+c}else if(c<0){for(;++c;)l="0"+l;l="0."+l}else if(++c>h)for(c-=h;c--;)l+="0";else c<h&&(l=l.slice(0,c)+"."+l.slice(c))}else l=w?"0p+0":"0";l=(16==e?"0x":2==e?"0b":8==e?"0o":"")+l}else l=j(n);return n.s<0?"-"+l:l}function Q(n,e){if(n.length>e)return n.length=e,!0}function X(n){return new this(n).abs()}function Y(n){return new this(n).acos()}function nn(n){return new this(n).acosh()}function en(n,e){return new this(n).plus(e)}function tn(n){return new this(n).asin()}function rn(n){return new this(n).asinh()}function sn(n){return new this(n).atan()}function on(n){return new this(n).atanh()}function un(n,e){n=new this(n),e=new this(e);var i,t=this.precision,r=this.rounding,s=t+4;return n.s&&e.s?n.d||e.d?!e.d||n.isZero()?(i=e.s<0?U(this,t,r):new this(0)).s=n.s:!n.d||e.isZero()?(i=U(this,s,1).times(.5)).s=n.s:e.s<0?(this.precision=s,this.rounding=1,i=this.atan(Z(n,e,s,1)),e=U(this,s,1),this.precision=t,this.rounding=r,i=n.s<0?i.minus(e):i.plus(e)):i=this.atan(Z(n,e,s,1)):(i=U(this,s,1).times(e.s>0?.25:.75)).s=n.s:i=new this(NaN),i}function cn(n){return new this(n).cbrt()}function fn(n){return P(n=new this(n),n.e+1,2)}function an(n){if(!n||"object"!=typeof n)throw Error(d+"Object expected");var e,i,t,r=!0===n.defaults,u=["precision",1,o,"rounding",0,8,"toExpNeg",-s,0,"toExpPos",0,s,"maxE",0,s,"minE",-s,0,"modulo",0,9];for(e=0;e<u.length;e+=3)if(i=u[e],r&&(this[i]=a[i]),void 0!==(t=n[i])){if(!(m(t)===t&&t>=u[e+1]&&t<=u[e+2]))throw Error(l+i+": "+t);this[i]=t}if(i="crypto",r&&(this[i]=a[i]),void 0!==(t=n[i])){if(!0!==t&&!1!==t&&0!==t&&1!==t)throw Error(l+i+": "+t);if(t){if("undefined"==typeof crypto||!crypto||!crypto.getRandomValues&&!crypto.randomBytes)throw Error(g);this[i]=!0}else this[i]=!1}return this}function hn(n){return new this(n).cos()}function dn(n){return new this(n).cosh()}function ln(n,e){return new this(n).div(e)}function pn(n){return new this(n).exp()}function gn(n){return P(n=new this(n),n.e+1,3)}function mn(){var n,e,i=new this(0);for(h=!1,n=0;n<arguments.length;)if((e=new this(arguments[n++])).d)i.d&&(i=i.plus(e.times(e)));else{if(e.s)return h=!0,new this(1/0);i=e}return h=!0,i.sqrt()}function wn(n){return n instanceof e||n&&"[object Decimal]"===n.name||!1}function vn(n){return new this(n).ln()}function Nn(n,e){return new this(n).log(e)}function bn(n){return new this(n).log(2)}function En(n){return new this(n).log(10)}function xn(){return H(this,arguments,"lt")}function yn(){return H(this,arguments,"gt")}function Mn(n,e){return new this(n).mod(e)}function qn(n,e){return new this(n).mul(e)}function On(n,e){return new this(n).pow(e)}function Dn(n){var e,i,t,r,s=0,u=new this(1),c=[];if(void 0===n?n=this.precision:F(n,1,o),t=Math.ceil(n/y),this.crypto)if(crypto.getRandomValues)for(e=crypto.getRandomValues(new Uint32Array(t));s<t;)(r=e[s])>=429e7?e[s]=crypto.getRandomValues(new Uint32Array(1))[0]:c[s++]=r%1e7;else{if(!crypto.randomBytes)throw Error(g);for(e=crypto.randomBytes(t*=4);s<t;)(r=e[s]+(e[s+1]<<8)+(e[s+2]<<16)+((127&e[s+3])<<24))>=214e7?crypto.randomBytes(4).copy(e,s):(c.push(r%1e7),s+=4);s=t/4}else for(;s<t;)c[s++]=1e7*Math.random()|0;for(t=c[--s],n%=y,t&&n&&(r=w(10,y-n),c[s]=(t/r|0)*r);0===c[s];s--)c.pop();if(s<0)i=0,c=[0];else{for(i=-1;0===c[0];i-=y)c.shift();for(t=1,r=c[0];r>=10;r/=10)t++;t<y&&(i-=y-t)}return u.e=i,u.d=c,u}function Fn(n){return P(n=new this(n),n.e+1,this.rounding)}function An(n){return(n=new this(n)).d?n.d[0]?n.s:0*n.s:n.s||NaN}function Sn(n){return new this(n).sin()}function Zn(n){return new this(n).sinh()}function Pn(n){return new this(n).sqrt()}function Rn(n,e){return new this(n).sub(e)}function Ln(n){return new this(n).tan()}function Tn(n){return new this(n).tanh()}function Un(n){return P(n=new this(n),n.e+1,1)}return(e=function n(e){var i,t,r;function s(n){var e,i,t,r=this;if(!(r instanceof s))return new s(n);if(r.constructor=s,n instanceof s)return r.s=n.s,void(h?!n.d||n.e>s.maxE?(r.e=NaN,r.d=null):n.e<s.minE?(r.e=0,r.d=[0]):(r.e=n.e,r.d=n.d.slice()):(r.e=n.e,r.d=n.d?n.d.slice():n.d));if("number"==(t=typeof n)){if(0===n)return r.s=1/n<0?-1:1,r.e=0,void(r.d=[0]);if(n<0?(n=-n,r.s=-1):r.s=1,n===~~n&&n<1e7){for(e=0,i=n;i>=10;i/=10)e++;return void(h?e>s.maxE?(r.e=NaN,r.d=null):e<s.minE?(r.e=0,r.d=[0]):(r.e=e,r.d=[n]):(r.e=e,r.d=[n]))}return 0*n!=0?(n||(r.s=NaN),r.e=NaN,void(r.d=null)):$(r,n.toString())}if("string"!==t)throw Error(l+n);return 45===(i=n.charCodeAt(0))?(n=n.slice(1),r.s=-1):(43===i&&(n=n.slice(1)),r.s=1),E.test(n)?$(r,n):W(r,n)}if(s.prototype=O,s.ROUND_UP=0,s.ROUND_DOWN=1,s.ROUND_CEIL=2,s.ROUND_FLOOR=3,s.ROUND_HALF_UP=4,s.ROUND_HALF_DOWN=5,s.ROUND_HALF_EVEN=6,s.ROUND_HALF_CEIL=7,s.ROUND_HALF_FLOOR=8,s.EUCLID=9,s.config=s.set=an,s.clone=n,s.isDecimal=wn,s.abs=X,s.acos=Y,s.acosh=nn,s.add=en,s.asin=tn,s.asinh=rn,s.atan=sn,s.atanh=on,s.atan2=un,s.cbrt=cn,s.ceil=fn,s.cos=hn,s.cosh=dn,s.div=ln,s.exp=pn,s.floor=gn,s.hypot=mn,s.ln=vn,s.log=Nn,s.log10=En,s.log2=bn,s.max=xn,s.min=yn,s.mod=Mn,s.mul=qn,s.pow=On,s.random=Dn,s.round=Fn,s.sign=An,s.sin=Sn,s.sinh=Zn,s.sqrt=Pn,s.sub=Rn,s.tan=Ln,s.tanh=Tn,s.trunc=Un,void 0===e&&(e={}),e&&!0!==e.defaults)for(r=["precision","rounding","toExpNeg","toExpPos","maxE","minE","modulo","crypto"],i=0;i<r.length;)e.hasOwnProperty(t=r[i++])||(e[t]=this[t]);return s.config(e),s}(a)).default=e.Decimal=e,c=new e(c),f=new e(f),"function"==typeof define&&define.amd?define(function(){return e}):"undefined"!=typeof module&&module.exports?("function"==typeof Symbol&&"symbol"==typeof Symbol.iterator&&(O[Symbol.for("nodejs.util.inspect.custom")]=O.toString,O[Symbol.toStringTag]="Decimal"),module.exports=e):(n||(n="undefined"!=typeof self&&self&&self.self==self?self:window),t=n.Decimal,e.noConflict=function(){return n.Decimal=t,e},n.Decimal=e),e}(this)
//    bigDec: require('decimal.js')
});

if((typeof module) !== 'undefined') {
    module.exports = nerdamer;
};